Ejemplo n.º 1
0
    def __init__(self, patient_name=None, speed=0, oracle=-1, reward_fun=neg_risk):
        '''
        patient_name must be 'adolescent#001' to 'adolescent#010',
        or 'adult#001' to 'adult#010', or 'child#001' to 'child#010'
        '''

        self._gym_disable_underscore_compat = True

        seeds = [0, 0, 0, 0, 0] #self._seed()
        # have to hard code the patient_name, gym has some interesting
        # error when choosing the patient
        if patient_name is None:
            patient_name = 'adolescent#002'
        patient = T1DPatient.withName(patient_name)
        # sensor = CGMSensor.withName('Navigator', seed=seeds[1])    # Sample frequency = 1 min
        # sensor = CGMSensor.withName('Dexcom', seed=seeds[1])    # Sample frequency = 3 min
        sensor = CGMSensor.withName('GuardianRT', seed=seeds[1])  # Sample frequency = 5 min
        hour = 0  #self.np_random.randint(low=0.0, high=24.0)
        start_time = datetime(2018, 1, 1, hour, 0, 0)
        scenario = RandomScenario(start_time=start_time, seed=seeds[2])
        # scenario = WeightScenario(weight=patient._params.BW, start_time=start_time, seed=seeds[2])
        pump = InsulinPump.withName('Insulet')
        self.env = _NS_T1DSimEnv_old(patient, sensor, pump, scenario, speed, oracle)
        self.reward_fun = reward_fun
        self.target = 140
        self.max_horizon = 1            # Sampling in policy parameter space, not in action space of env.
        self.oracle = oracle
 def local_build_env(pname, controller_name=''):
     patient = T1DPatient.withName(pname)
     cgm_sensor = CGMSensor.withName(cgm_sensor_name, seed=cgm_seed)
     insulin_pump = InsulinPump.withName(insulin_pump_name)
     scen = copy.deepcopy(scenario)
     env = T1DSimEnv(patient, cgm_sensor, insulin_pump, scen, controller_name=controller_name, results_path=results_path)
     return env
Ejemplo n.º 3
0
def run_sim_PID(no_runs, patients, runtime, meals, controller_params):
    '''
    Run the simulation a single time on a list of patients with the PID controller.

    Parameters
    ----------
    no_runs: int
        the number of separate simulation runs.
    patients: list of str
        a list of patient name strings. Patient name strings can be found in the params/Quest.csv file inside simGlucose.
    runtime: int
        simulation time, in hours.
    meals: (timedelta, int)
        a tuple containing the time of meal (as referenced from simulation start) and the meal size, in grams.
    targetBG: int
        the target blood glucose for the controller, in mg/dl
    lowBG: int
        the pump suspension glucose for the controller, in mg/dl

    Returns
    -------
    A pandas dataframe containing the simulation results.
        axis=0: time, type datetime.datetime
        axis=1: MultiIndex
            level 0: data category, type str
            level 1: patient id, type str
            level 2: run number, type int (starts at 1)
    '''
    sensor = CGMSensor.withName('Dexcom')
    pump = InsulinPump.withName('Insulet')
    scenario = CustomScenario(start_time = datetime(2020, 1, 1, 0,0,0), scenario=meals)
    sim_objs = []
    keys = []
    for run in range(0, no_runs):
        for pname in patients:
            sim_objs.append(SimObj(T1DSimEnv(T1DPatient.withName(pname), 
                                sensor, 
                                pump, 
                                copy.deepcopy(scenario)), # because random numbers.
                                controller.PIDController(controller_params, pname),
                                timedelta(hours=runtime),
                                animate=False,
                                path=None))
            keys.append((run + 1, pname))
    p_start = time.time()
    print('Running batch simulation of {} items...'.format(len(patients * no_runs)))
    p = pathos.pools.ProcessPool()
    results = p.map(sim, sim_objs)
    print('Simulation took {} seconds.'.format(time.time() - p_start))
    return pd.concat(results, axis=1, keys=keys)
Ejemplo n.º 4
0
def pidsim():
    for idx,patient in enumerate(patients):
        patient = T1DPatient.withName(patient)
        sensor = CGMSensor.withName('Dexcom', seed=1)
        pump = InsulinPump.withName('Insulet')
        p,i,d = pidparams[idx]
        for seed in range (10,20):
            scenario = RandomScenario(start_time=start_time, seed=randint(10, 99999))
            env = T1DSimEnv(patient, sensor, pump, scenario)
            # Create a controller
            controller = FoxPIDController(112.517,kp=p, ki=i, kd=d)
            # Put them together to create a simulation object
            s1 = SimObj(env, controller, timedelta(days=10), animate=False, path=path+str(seed))
            results1 = sim(s1)
            print('Complete:',patient.name,'-',seed)
    print('All done!')
Ejemplo n.º 5
0
    def _create_env_from_random_state(self):
        # Derive a random seed. This gets passed as a uint, but gets
        # checked as an int elsewhere, so we need to keep it below
        # 2**31.
        seed2 = seeding.hash_seed(self.np_random.randint(0, 1000)) % 2**31
        seed3 = seeding.hash_seed(seed2 + 1) % 2**31
        seed4 = seeding.hash_seed(seed3 + 1) % 2**31

        hour = self.np_random.randint(low=0.0, high=24.0)
        start_time = datetime(2018, 1, 1, hour, 0, 0)
        patient = T1DPatient.withName(self.patient_name, random_init_bg=True, seed=seed4)
        sensor = CGMSensor.withName(self.SENSOR_HARDWARE, seed=seed2)
        scenario = RandomScenario(start_time=start_time, seed=seed3)
        pump = InsulinPump.withName(self.INSULIN_PUMP_HARDWARE)
        env = _T1DSimEnv(patient, sensor, pump, scenario)
        return env, seed2, seed3, seed4
Ejemplo n.º 6
0
    def seed(self, seed=None):
        print('_seed called')
        self.np_random, seed1 = seeding.np_random(seed=seed)
        # Derive a random seed. This gets passed as a uint, but gets
        # checked as an int elsewhere, so we need to keep it below
        # 2**31.
        seed2 = seeding.hash_seed(seed1 + 1) % 2**31
        seed3 = seeding.hash_seed(seed2 + 1) % 2**31

        hour = self.np_random.randint(low=0.0, high=24.0)
        start_time = datetime(2021, 1, 1, hour, 0, 0)
        patient = T1DPatient.withName(self.patient_name)
        sensor = CGMSensor.withName(self.SENSOR_HARDWARE, seed=seed2)
        scenario = RandomScenario(start_time=start_time, seed=seed3)
        pump = InsulinPump.withName(self.INSULIN_PUMP_HARDWARE)
        self.env = _T1DSimEnv(patient, sensor, pump, scenario)
        return [seed1, seed2, seed3]
Ejemplo n.º 7
0
 def __init__(self, patient_name=None, reward_fun=None):
     '''
     patient_name must be 'adolescent#001' to 'adolescent#010',
     or 'adult#001' to 'adult#010', or 'child#001' to 'child#010'
     '''
     seeds = self._seed()
     # have to hard code the patient_name, gym has some interesting
     # error when choosing the patient
     if patient_name is None:
         patient_name = 'adolescent#001'
     patient = T1DPatient.withName(patient_name)
     sensor = CGMSensor.withName('Dexcom', seed=seeds[1])
     hour = self.np_random.randint(low=0.0, high=24.0)
     start_time = datetime(2018, 1, 1, hour, 0, 0)
     scenario = RandomScenario(start_time=start_time, seed=seeds[2])
     pump = InsulinPump.withName('Insulet')
     self.env = _T1DSimEnv(patient, sensor, pump, scenario)
     self.reward_fun = reward_fun
Ejemplo n.º 8
0
def bbsim():
    for patient in patients:
        patient = T1DPatient.withName(patient)
        sensor = CGMSensor.withName('Dexcom', seed=1)
        pump = InsulinPump.withName('Insulet')
        for seed in range(10, 20):
            scenario = RandomScenario(start_time=start_time,
                                      seed=randint(10, 99999))
            env = T1DSimEnv(patient, sensor, pump, scenario)
            # Create a controller
            controller = BBController()

            # Put them together to create a simulation object
            s1 = SimObj(env,
                        controller,
                        timedelta(days=10),
                        animate=False,
                        path=path + str(seed))
            results1 = sim(s1)
            print('Complete:', patient.name, '-', seed)
    print('All done!')
    def __init__(self, patient_name=None, reward_fun=None, Initial_Bg=0):
        '''
        patient_name must be 'adolescent#001' to 'adolescent#010',
        or 'adult#001' to 'adult#010', or 'child#001' to 'child#010'
        '''
        seeds = self._seed()
        # have to hard code the patient_name, gym has some interesting
        # error when choosing the patient
        if patient_name is None:
            patient_name = 'adolescent#001'
        patient = T1DPatient.withName(patient_name, Initial_Bg)
        sensor = CGMSensor.withName('GuardianRT', seed=seeds[1])  #Dexcom
        hour = 20  #self.np_random.randint(low=0.0, high=24.0)
        start_time = datetime(2018, 1, 1, hour, 0, 0)
        # scenario = RandomScenario(start_time=start_time, seed=seeds[2])
        # custom scenario is a list of tuples (time, meal_size)
        # scen = [(0,float(Initial_Bg)),(13, 45), (16, 10), (18, 35), (22, 10)]#, (23, 10)]
        scen = [(13, 45), (16, 10), (18, 35), (22, 10)]  #, (23, 10)]
        scenario = CustomScenario(start_time=start_time, scenario=scen)

        pump = InsulinPump.withName('Insulet')
        self.env = _T1DSimEnv(patient, sensor, pump, scenario)
        self.reward_fun = reward_fun
Ejemplo n.º 10
0
 def _create_env_from_random_state(self):
     #print('_create_env_from_random_state simglucose extended observation')
     # Derive a random seed. This gets passed as a uint, but gets
     # checked as an int elsewhere, so we need to keep it below
     # 2**31.
     seed2 = seeding.hash_seed(self.np_random.randint(0, 1000)) % 2**31
     seed3 = seeding.hash_seed(seed2 + 1) % 2**31
     seed4 = seeding.hash_seed(seed3 + 1) % 2**31
     hour = self.np_random.randint(low=0.0, high=24.0)
     if self.saved_state is not None:
        seed2=self.saved_state[0]
        seed3=self.saved_state[1]
        seed4=self.saved_state[2]
        hour=self.saved_state[3]
        print('Using state', seed2, seed3, seed4, hour)
     start_time = datetime(2021, 1, 1, hour, 0, 0)
     patient = T1DPatient.withName(self.patient_name, random_init_bg=True, seed=seed4)
     sensor = CGMSensor.withName(self.SENSOR_HARDWARE, seed=seed2)
     scenario = RandomScenario(start_time=start_time, seed=seed3)
     pump = InsulinPump.withName(self.INSULIN_PUMP_HARDWARE)
     env = _T1DSimEnvExtendedObs(patient, sensor, pump, scenario,n_samples=self._n_samples, append_action=self.append_action )
     self.time_per_step=int(sensor.sample_time)
     self.time_in_env=0
     return env, seed2, seed3, seed4, hour
    def test_results_consistency(self):
        # Test data
        results_exp = pd.read_csv(TESTDATA_FILENAME, index_col=0)
        results_exp.index = pd.to_datetime(results_exp.index)

        # specify start_time as the beginning of today
        start_time = datetime(2018, 1, 1, 0, 0, 0)

        # --------- Create Random Scenario --------------
        # Create a simulation environment
        patient = T1DPatient.withName('adolescent#001')
        sensor = CGMSensor.withName('Dexcom', seed=1)
        pump = InsulinPump.withName('Insulet')
        scenario = RandomScenario(start_time=start_time, seed=1)
        env = T1DSimEnv(patient, sensor, pump, scenario)

        # Create a controller
        controller = BBController()

        # Put them together to create a simulation object
        s = SimObj(env, controller, timedelta(
            days=2), animate=False, path=save_folder)
        results = sim(s)
        assert_frame_equal(results, results_exp)
Ejemplo n.º 12
0
        dfs = run_sim_PID(n, adults, t, meals, PIDparams)

        filename = 'dfs/' + 'p_' + str(PIDparams[0]) + ' i_' + str(PIDparams[1]) + ' d_' + str(PIDparams[2]) + ' target_' + str(PIDparams[3]) + '.bz2'
        dfs.to_pickle(filename)
=======
    pname = "adult#001"
    t = 9
    meals = [(timedelta(hours=2), 50)]
    sensor = CGMSensor.withName('Dexcom')
    pump = InsulinPump.withName('Insulet')
    scenario = CustomScenario(start_time = datetime(2020, 1, 1, 0,0,0), scenario=meals)
    keys = []
    # forward horizon
    horizon = 50
    controller_params = (140, 80, horizon)
    obj= SimObj(T1DSimEnv(T1DPatient.withName(pname), 
                        sensor, 
                        pump, 
                        copy.deepcopy(scenario)), # because random numbers.
                        controller.MPCNaive(controller_params, pname),
                        timedelta(hours=t),
                        animate=False,
                        path=None)
    keys.append((1, pname))
    p_start = time.time()
    results = sim(obj)
    print('Simulation took {} seconds.'.format(time.time() - p_start))
    dfs = results
    filename = 'mpc_test.bz2'
    dfs.to_pickle(filename)
>>>>>>> MPC-exploration
Ejemplo n.º 13
0
    fBG = 3.5506*(np.log(bg)**.8353-3.7932)
    risk = 10 * (fBG)**2
    return -1*risk

def cameron_reward(bg_hist, **kwargs):
    bg = bg_hist[-1]
    a = .2370  # 1/(mg/dL)
    b = -36.21
    c = 6.0e-5  # (1/(mg/dL)**3)
    d = 177  # mg/dL
    if bg < d:
        risk = a*bg+b+(c*(d-bg)**3)
    else:
        risk = a*bg+b
    return -1*risk

person_options = (['child#0{}'.format(str(i).zfill(2)) for i in range(1, 11)]+['adolescent#0{}'.format(str(i).zfill(2)) for i in range(1, 11)]+['adult#0{}'.format(str(i).zfill(2)) for i in range(1, 11)])
for i,p in enumerate(person_options):

    patient_id = p.split('#')[0] + str(i + 1)
    # Create a simulation environment
    print(p)
    patient = T1DPatient.withName(p)
    register(id='simglucose-'+p+'-v0',entry_point='simglucose.envs:T1DSimEnv',kwargs={'patient_name': p},'reward_fun': reward_target)
    env = gym.make('simglucose-'+p+'-v0')

    model = ACKTR(MlpLstmPolicy, env, verbose=1)
    model.learn(total_timesteps=250000)
    model.save('mlplstm_trained-'+p+'-reward_target')
    print('Model Trained and Saved for : '+ p)
from simglucose.simulation.scenario_gen import RandomScenario
from simglucose.simulation.scenario import CustomScenario
from simglucose.simulation.sim_engine import SimObj, sim, batch_sim
from datetime import timedelta
from datetime import datetime

# specify start_time as the beginning of today
now = datetime.now()
start_time = datetime.combine(now.date(), datetime.min.time())

# --------- Create Random Scenario --------------
# Specify results saving path
path = './results'

# Create a simulation environment
patient = T1DPatient.withName('adolescent#001')
sensor = CGMSensor.withName('Dexcom', seed=1)
pump = InsulinPump.withName('Insulet')
scenario = RandomScenario(start_time=start_time, seed=1)
env = T1DSimEnv(patient, sensor, pump, scenario)

# Create a controller
controller = BBController()

# Put them together to create a simulation object
s1 = SimObj(env, controller, timedelta(days=1), animate=False, path=path)
results1 = sim(s1)
print(results1)

# --------- Create Custom Scenario --------------
# Create a simulation environment
Ejemplo n.º 15
0
    def test_batch_sim(self):
        # specify start_time as the beginning of today
        now = datetime.now()
        start_time = datetime.combine(now.date(), datetime.min.time())

        # --------- Create Random Scenario --------------
        # Create a simulation environment
        patient = T1DPatient.withName('adolescent#001')
        sensor = CGMSensor.withName('Dexcom', seed=1)
        pump = InsulinPump.withName('Insulet')
        scenario = RandomScenario(start_time=start_time, seed=1)
        env = T1DSimEnv(patient, sensor, pump, scenario)

        # Create a controller
        controller = BBController()

        # Put them together to create a simulation object
        s1 = SimObj(env,
                    controller,
                    timedelta(days=2),
                    animate=True,
                    path=save_folder)
        results1 = sim(s1)

        # --------- Create Custom Scenario --------------
        # Create a simulation environment
        patient = T1DPatient.withName('adolescent#001')
        sensor = CGMSensor.withName('Dexcom', seed=1)
        pump = InsulinPump.withName('Insulet')
        # custom scenario is a list of tuples (time, meal_size)
        scen = [(7, 45), (12, 70), (16, 15), (18, 80), (23, 10)]
        scenario = CustomScenario(start_time=start_time, scenario=scen)
        env = T1DSimEnv(patient, sensor, pump, scenario)

        # Create a controller
        controller = BBController()

        # Put them together to create a simulation object
        s2 = SimObj(env,
                    controller,
                    timedelta(days=2),
                    animate=False,
                    path=save_folder)
        results2 = sim(s2)

        # --------- batch simulation --------------
        s1.reset()
        s2.reset()
        s1.animate = False
        s = [s1, s2]
        results_para = batch_sim(s, parallel=True)

        s1.reset()
        s2.reset()
        s = [s1, s2]
        results_serial = batch_sim(s, parallel=False)

        assert_frame_equal(results_para[0], results1)
        assert_frame_equal(results_para[1], results2)
        for r1, r2 in zip(results_para, results_serial):
            assert_frame_equal(r1, r2)