def sequence_tunable( mol, OP_REMOVE_ISOTOPE=True, OP_NEUTRALISE_CHARGE=True, OP_REMOVE_STEREO=False, OP_COMMUTE_INCHI=False, OP_KEEP_BIGGEST=True, OP_ADD_HYDROGEN=True, OP_KEKULIZE=True, OP_NEUTRALISE_CHARGE_LATE=True ): """Tunable sequence of filters for standardization. Operations will made in the following order: 1 RDKit Cleanup -- always 2 RDKIT SanitizeMol -- always 3 Remove isotope -- optional (default: True) 4 Neutralise charges -- optional (default: True) 5 RDKit SanitizeMol -- if 4 or 5 6 Remove stereo -- optional (default: False) 7 Commute Inchi -- if 6 or optional (default: False) 8 Keep biggest -- optional (default: True) 9 RDKit SanitizeMol -- if any (6, 7, 8) 10 Add hydrogens -- optional (default: True) 11 Kekulize -- optional (default: True) """ F = Filters() # Always perform the basics.. Cleanup(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) AssignStereochemistry(mol, cleanIt=True, force=True, flagPossibleStereoCenters=True) # Fix bug TD201904.01 # if OP_REMOVE_ISOTOPE: mol = F.remove_isotope(mol) if OP_NEUTRALISE_CHARGE: mol = F.neutralise_charge(mol) if any([OP_REMOVE_ISOTOPE, OP_REMOVE_ISOTOPE]): SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) # if OP_REMOVE_STEREO: mol = F.remove_stereo(mol) OP_COMMUTE_INCHI = True if OP_COMMUTE_INCHI: mol = F.commute_inchi(mol) if OP_KEEP_BIGGEST: mol = F.keep_biggest(mol) if any([OP_REMOVE_STEREO, OP_COMMUTE_INCHI, OP_KEEP_BIGGEST]): SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) # if OP_NEUTRALISE_CHARGE_LATE: mol = F.neutralise_charge(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) # if OP_ADD_HYDROGEN: mol = F.add_hydrogen(mol, addCoords=True) if OP_KEKULIZE: mol = F.kekulize(mol) # return mol
def sequence_rr_legacy(mol): """Sequence of filters applied for the first version of RetroRules """ F = Filters() Cleanup(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) AssignStereochemistry(mol, cleanIt=True, force=True, flagPossibleStereoCenters=True) # Fix bug TD201904.01 mol = F.remove_isotope(mol) mol = F.neutralise_charge(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) mol = F.keep_biggest(mol) mol = F.add_hydrogen(mol, addCoords=True) mol = F.kekulize(mol) return mol
def test_add_hydrogen(): mol = Filters.add_hydrogen(MolFromSmiles('CC(O)C(=O)O')) assert MolToSmiles(mol) == '[H]OC(=O)C([H])(O[H])C([H])([H])[H]' mol = Filters.add_hydrogen(MolFromSmiles('CC(C(=O)[O-])O')) assert MolToSmiles(mol) == '[H]OC([H])(C(=O)[O-])C([H])([H])[H]'