示例#1
0
    def __init__(
            self,
            pubchem_templates_path: str = '',
            general_templates_path: str = config.general_templates) -> None:
        """
        Initialize component which does the ligand depiction.
        If Nones is provided as parameters just the defalt RDKit
        functionality is going to be used.

        Args:
            pubchem_templates_path (str, optional): Defaults to ''.
                Path to the library with 2D structures downloaded from
                PubChem. Use `setup_pubchem_library` for this task.
            general_templates_path (str, optional): Defaults to
                config.general_templates (supplied with the pdbeccdutils).
                Path to the library with general templates to be used
                for depicting ligand e.g. porphyrin rings.

        """
        self.coordgen_params = rdCoordGen.CoordGenParams()
        self.coordgen_params.coordgenScaling = 50 / 1.5
        self.coordgen_params.templateFileDir = config.coordgen_templates

        self.pubchem_templates = pubchem_templates_path if os.path.isdir(
            pubchem_templates_path) else ''
        self.templates: Dict[str, rdkit.Chem.rdchem.Mol] = OrderedDict()

        if os.path.isdir(general_templates_path):
            for k in sorted(os.listdir(general_templates_path)):
                template = self._load_template(
                    os.path.join(general_templates_path, k))
                template_name = k.split('.')[0]
                self.templates[template_name] = template
示例#2
0
 def test_template3(self):
     # the easier way, test lifetime...
     template = Chem.MolFromSmiles('C1OCOCOCOCCCNCCC1')
     mol = Chem.MolFromSmiles('C1OCOCOCOCCCNC(OC(=O)C2CC2)CC1')
     rdCoordGen.AddCoords(template)
     template2 = Chem.Mol(template)
     ps = rdCoordGen.CoordGenParams()
     ps.SetTemplateMol(template2)
     template2 = None
     ps.dbg_useFixed = True
     rdCoordGen.AddCoords(mol,ps)
     self.assertTrue(compareConfs(mol.GetConformer(),template.GetConformer(),mol.GetSubstructMatch(template)))
示例#3
0
 def test_template2(self):
     # the easier way...
     template = Chem.MolFromSmiles('C1OCOCOCOCCCNCCC1')
     template.SetProp("_Name",'template')
     mol = Chem.MolFromSmiles('C1OCOCOCOCCCNC(OC(=O)C2CC2)CC1')
     mol.SetProp("_Name","mol")
     rdCoordGen.AddCoords(template)
     ps = rdCoordGen.CoordGenParams()
     ps.SetTemplateMol(template)
     ps.dbg_useFixed = True
     rdCoordGen.AddCoords(mol,ps)
     self.assertTrue(compareConfs(mol.GetConformer(),template.GetConformer(),mol.GetSubstructMatch(template)))
示例#4
0
 def test_template1(self):
     template = Chem.MolFromSmiles('C1OCOCOCOCCCNCCC1')
     template.SetProp("_Name",'template')
     mol = Chem.MolFromSmiles('C1OCOCOCOCCCNC(OC(=O)C2CC2)CC1')
     mol.SetProp("_Name","mol")
     rdCoordGen.AddCoords(template)
     rdCoordGen.AddCoords(mol)
     self.assertFalse(compareConfs(mol.GetConformer(),template.GetConformer(),mol.GetSubstructMatch(template)))
     match = mol.GetSubstructMatch(template)
     mapd = dict()
     for i,aid in enumerate(match):
         p = template.GetConformer().GetAtomPosition(i)
         mapd[aid] = Geometry.Point2D(p.x,p.y)
     ps = rdCoordGen.CoordGenParams()
     ps.SetCoordMap(mapd)
     ps.dbg_useFixed = True
     rdCoordGen.AddCoords(mol,ps)
     self.assertTrue(compareConfs(mol.GetConformer(),template.GetConformer(),mol.GetSubstructMatch(template)))
示例#5
0
    def testMinimizeOnly(self):
        m = Chem.MolFromMolBlock('''
  Mrv2014 08052005392D          

  0  0  0     0  0            999 V3000
M  V30 BEGIN CTAB
M  V30 COUNTS 14 15 0 0 0
M  V30 BEGIN ATOM
M  V30 1 C -1.4287 -1.4523 0 0
M  V30 2 C -2.9638 -1.5752 0 0
M  V30 3 C -3.8377 -0.3072 0 0
M  V30 4 C -3.1766 1.0837 0 0
M  V30 5 C -1.6416 1.2066 0 0
M  V30 6 C -0.7675 -0.0614 0 0
M  V30 7 C 0.7675 0.0614 0 0
M  V30 8 C 1.6416 -1.2066 0 0
M  V30 9 C 0.9804 -2.5975 0 0
M  V30 10 N 3.1766 -1.0837 0 0
M  V30 11 C 3.8377 0.3072 0 0
M  V30 12 C 2.9638 1.5752 0 0
M  V30 13 C 1.4287 1.4523 0 0
M  V30 14 F -0.5548 -2.7203 0 0
M  V30 END ATOM
M  V30 BEGIN BOND
M  V30 1 2 1 2
M  V30 2 1 2 3
M  V30 3 2 3 4
M  V30 4 1 4 5
M  V30 5 2 5 6
M  V30 6 1 6 7
M  V30 7 2 7 8
M  V30 8 1 8 9
M  V30 9 1 8 10
M  V30 10 2 10 11
M  V30 11 1 11 12
M  V30 12 2 12 13
M  V30 13 1 6 1
M  V30 14 1 13 7
M  V30 15 1 1 14
M  V30 END BOND
M  V30 END CTAB
M  END
''')
        ref = Chem.MolFromMolBlock('''
     RDKit          2D

 14 15  0  0  0  0  0  0  0  0999 V2000
   -1.5379   -1.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1218   -1.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9595   -0.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2641    1.1663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6778    1.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7941   -0.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7983    0.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7524   -1.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1246   -2.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3306   -1.0787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9439    0.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0337    1.6656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4617    1.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6924   -2.7917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
  6  1  1  0
 13  7  1  0
  1 14  1  0
M  END''')
        ps = rdCoordGen.CoordGenParams()
        ps.minimizeOnly = True
        m2 = Chem.Mol(m)
        rdCoordGen.AddCoords(m2, ps)
        self.assertGreater(rdMolAlign.AlignMol(m, ref), 0.1)
        self.assertLess(rdMolAlign.AlignMol(m2, ref), 0.1)
示例#6
0
    def testMinimizeOnly(self):
        m = Chem.MolFromMolBlock('''
  Mrv2014 03252113022D          

 14 15  0  0  0  0            999 V2000
   -0.7654   -0.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5877   -0.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0559   -0.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7017    0.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8794    0.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4112   -0.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4112    0.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8794   -0.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7771   -1.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7017   -0.5805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0559    0.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5877    0.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7654    0.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7654   -1.6519    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  8 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
  6  1  1  0  0  0  0
 13  7  1  0  0  0  0
  1 14  1  0  0  0  0
M  END
''')
        ref = Chem.MolFromMolBlock('''
     RDKit          2D

 14 15  0  0  0  0  0  0  0  0999 V2000
   -0.5957   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4185   -0.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8520   -0.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4595    0.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6368    0.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2063   -0.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2087   -0.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7102   -0.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4040   -1.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5259   -0.6099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8401    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3405    0.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5252    0.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1735   -1.5240    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
  6  1  1  0
 13  7  1  0
  1 14  1  0
M  END
''')
        ps = rdCoordGen.CoordGenParams()
        ps.minimizeOnly = True
        m2 = Chem.Mol(m)
        rdCoordGen.AddCoords(m2, ps)
        self.assertGreater(rdMolAlign.AlignMol(m, ref), 0.1)
        self.assertLess(rdMolAlign.AlignMol(m2, ref), 0.1)