def is_cell_separator(self, cursor=None, block=None):
"""Return True if cursor (or text block) is on a block separator"""
assert cursor is not None or block is not None
if cursor is not None:
cursor0 = QTextCursor(cursor)
cursor0.select(QTextCursor.BlockUnderCursor)
text = to_text_string(cursor0.selectedText())
else:
text = to_text_string(block.text())
return text.lstrip().startswith(self.CELL_SEPARATORS)
def is_cell_separator(self, cursor=None, block=None):
"""Return True if cursor (or text block) is on a block separator"""
assert cursor is not None or block is not None
if cursor is not None:
cursor0 = QTextCursor(cursor)
cursor0.select(QTextCursor.BlockUnderCursor)
text = to_text_string(cursor0.selectedText())
else:
text = to_text_string(block.text())
return text.lstrip().startswith(self.CELL_SEPARATORS)
def slotCursorPositionChanged(self):
"""Called whenever the cursor position changes.
Highlights matching characters if the cursor is at one of them.
"""
cursor = self.edit().textCursor()
block = cursor.block()
text = block.text()
# try both characters at the cursor
col = cursor.position() - block.position()
end = col + 1
col = max(0, col - 1)
for c in text[col:end]:
if c in self.matchPairs:
break
col += 1
else:
self.clear()
return
# the cursor is at a character from matchPairs
i = self.matchPairs.index(c)
cursor.setPosition(block.position() + col)
# find the matching character
new = QTextCursor(cursor)
if i & 1:
# look backward
match = self.matchPairs[i - 1]
flags = QTextDocument.FindBackward
else:
# look forward
match = self.matchPairs[i + 1]
flags = QTextDocument.FindFlags()
new.movePosition(QTextCursor.Right)
# search, also nesting
rx = QRegExp(QRegExp.escape(c) + "|" + QRegExp.escape(match))
nest = 0
while nest >= 0:
new = cursor.document().find(rx, new, flags)
if new.isNull():
self.clear()
return
nest += 1 if new.selectedText() == c else -1
cursor.movePosition(QTextCursor.Right, QTextCursor.KeepAnchor)
self.highlight([cursor, new])
def slotCursorPositionChanged(self):
"""Called whenever the cursor position changes.
Highlights matching characters if the cursor is at one of them.
"""
cursor = self.edit().textCursor()
block = cursor.block()
text = block.text()
# try both characters at the cursor
col = cursor.position() - block.position()
end = col + 1
col = max(0, col - 1)
for c in text[col:end]:
if c in self.matchPairs:
break
col += 1
else:
self.clear()
return
# the cursor is at a character from matchPairs
i = self.matchPairs.index(c)
cursor.setPosition(block.position() + col)
# find the matching character
new = QTextCursor(cursor)
if i & 1:
# look backward
match = self.matchPairs[i-1]
flags = QTextDocument.FindBackward
else:
# look forward
match = self.matchPairs[i+1]
flags = QTextDocument.FindFlags()
new.movePosition(QTextCursor.Right)
# search, also nesting
rx = QRegExp(QRegExp.escape(c) + '|' + QRegExp.escape(match))
nest = 0
while nest >= 0:
new = cursor.document().find(rx, new, flags)
if new.isNull():
self.clear()
return
nest += 1 if new.selectedText() == c else -1
cursor.movePosition(QTextCursor.Right, QTextCursor.KeepAnchor)
self.highlight([cursor, new])
def __searchDocument(self, document, pattern, settings): """ Searches for given pattern occurrences in given document using given settings. :param document: Document. :type document: QTextDocument :param pattern: Pattern. :type pattern: unicode :param settings: Search settings. :type settings: Structure :return: Matched occurrences. :rtype: list """ pattern = settings.regularExpressions and QRegExp(pattern) or pattern flags = QTextDocument.FindFlags() if settings.caseSensitive: flags = flags | QTextDocument.FindCaseSensitively if settings.wholeWord: flags = flags | QTextDocument.FindWholeWords occurrences = [] block = document.findBlock(0) cursor = document.find(pattern, block.position(), flags) while block.isValid() and cursor.position() != -1: if self.__interrupt: return blockCursor = QTextCursor(cursor) blockCursor.movePosition(QTextCursor.StartOfLine, QTextCursor.MoveAnchor) blockCursor.movePosition(QTextCursor.EndOfLine, QTextCursor.KeepAnchor) length = cursor.selectionEnd() - cursor.selectionStart() occurrences.append(Occurence(line=cursor.blockNumber(), column=cursor.columnNumber() - length, length=length, position=cursor.position() - length, text=blockCursor.selectedText())) cursor = document.find(pattern, cursor.position(), flags) block = block.next() return occurrences
def toLowerCase(self):
global reWord # the regex \b\w+\b
tc = QTextCursor(self.textCursor())
if not tc.hasSelection() :
return # no selection, nothing to do
startpos = tc.selectionStart()
endpos = tc.selectionEnd()
qs = QString(tc.selectedText()) # copy of selected text
i = reWord.indexIn(qs,0) # index of first word if any
if i < 0 : return # no words in selection, exit
while i >= 0:
w = reWord.cap(0) # found word as QString
n = w.size() # its length
qs.replace(i,n,w.toLower()) # replace it with UC version
i = reWord.indexIn(qs,i+n) # find next word if any
# we have changed at least one word, replace selection with altered text
tc.insertText(qs)
# that wiped the selection, so restore it by "dragging" left to right
tc.setPosition(startpos,QTextCursor.MoveAnchor) # click
tc.setPosition(endpos,QTextCursor.KeepAnchor) # drag
self.setTextCursor(tc)
def toLowerCase(self):
global reWord # the regex \b\w+\b
tc = QTextCursor(self.textCursor())
if not tc.hasSelection():
return # no selection, nothing to do
startpos = tc.selectionStart()
endpos = tc.selectionEnd()
qs = QString(tc.selectedText()) # copy of selected text
i = reWord.indexIn(qs, 0) # index of first word if any
if i < 0: return # no words in selection, exit
while i >= 0:
w = reWord.cap(0) # found word as QString
n = w.size() # its length
qs.replace(i, n, w.toLower()) # replace it with UC version
i = reWord.indexIn(qs, i + n) # find next word if any
# we have changed at least one word, replace selection with altered text
tc.insertText(qs)
# that wiped the selection, so restore it by "dragging" left to right
tc.setPosition(startpos, QTextCursor.MoveAnchor) # click
tc.setPosition(endpos, QTextCursor.KeepAnchor) # drag
self.setTextCursor(tc)
def selectFoundText(self, cursor: QTextCursor):
print(cursor.selectedText())
cursor.select(QTextCursor.WordUnderCursor)
