def train(num_timesteps, seed, model_path=None): env_id = 'Humanoid-v2' from baselines.ppo1 import mlp_policy, pposgd_simple U.make_session(num_cpu=1).__enter__() def policy_fn(name, ob_space, ac_space): return mlp_policy.MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space, hid_size=64, num_hid_layers=2) env = make_mujoco_env(env_id, seed) # parameters below were the best found in a simple random search # these are good enough to make humanoid walk, but whether those are # an absolute best or not is not certain env = RewScale(env, 0.1) logger.log("NOTE: reward will be scaled by a factor of 10 in logged stats. Check the monitor for unscaled reward.") pi = pposgd_simple.learn(env, policy_fn, max_timesteps=num_timesteps, timesteps_per_actorbatch=2048, clip_param=0.1, entcoeff=0.0, optim_epochs=10, optim_stepsize=1e-4, optim_batchsize=64, gamma=0.99, lam=0.95, schedule='constant', ) env.close() if model_path: U.save_state(model_path) return pi
def __init__(self, env_fns, spaces=None, context='spawn'): """ If you don't specify observation_space, we'll have to create a dummy environment to get it. """ ctx = mp.get_context(context) if spaces: observation_space, action_space = spaces else: logger.log('Creating dummy env object to get spaces') with logger.scoped_configure(format_strs=[]): dummy = env_fns[0]() observation_space, action_space = dummy.observation_space, dummy.action_space dummy.close() del dummy VecEnv.__init__(self, len(env_fns), observation_space, action_space) self.obs_keys, self.obs_shapes, self.obs_dtypes = obs_space_info(observation_space) self.obs_bufs = [ {k: ctx.Array(_NP_TO_CT[self.obs_dtypes[k].type], int(np.prod(self.obs_shapes[k]))) for k in self.obs_keys} for _ in env_fns] self.parent_pipes = [] self.procs = [] with clear_mpi_env_vars(): for env_fn, obs_buf in zip(env_fns, self.obs_bufs): wrapped_fn = CloudpickleWrapper(env_fn) parent_pipe, child_pipe = ctx.Pipe() proc = ctx.Process(target=_subproc_worker, args=(child_pipe, parent_pipe, wrapped_fn, obs_buf, self.obs_shapes, self.obs_dtypes, self.obs_keys)) proc.daemon = True self.procs.append(proc) self.parent_pipes.append(parent_pipe) proc.start() child_pipe.close() self.waiting_step = False self.viewer = None
def main(): args = mujoco_arg_parser().parse_args() logger.configure() model, env = train(args.env, num_timesteps=args.num_timesteps, seed=args.seed) if args.play: logger.log("Running trained model") obs = np.zeros((env.num_envs,) + env.observation_space.shape) obs[:] = env.reset() while True: actions = model.step(obs)[0] obs[:] = env.step(actions)[0] env.render()
def maybe_save_model(savedir, container, state): """This function checkpoints the model and state of the training algorithm.""" if savedir is None: return start_time = time.time() model_dir = "model-{}".format(state["num_iters"]) U.save_state(os.path.join(savedir, model_dir, "saved")) if container is not None: container.put(os.path.join(savedir, model_dir), model_dir) relatively_safe_pickle_dump(state, os.path.join(savedir, 'training_state.pkl.zip'), compression=True) if container is not None: container.put(os.path.join(savedir, 'training_state.pkl.zip'), 'training_state.pkl.zip') relatively_safe_pickle_dump(state["monitor_state"], os.path.join(savedir, 'monitor_state.pkl')) if container is not None: container.put(os.path.join(savedir, 'monitor_state.pkl'), 'monitor_state.pkl') logger.log("Saved model in {} seconds\n".format(time.time() - start_time))
def main(args): # configure logger, disable logging in child MPI processes (with rank > 0) arg_parser = common_arg_parser() args, unknown_args = arg_parser.parse_known_args(args) extra_args = parse_cmdline_kwargs(unknown_args) if MPI is None or MPI.COMM_WORLD.Get_rank() == 0: rank = 0 logger.configure() else: logger.configure(format_strs=[]) rank = MPI.COMM_WORLD.Get_rank() model, env = train(args, extra_args) if args.save_path is not None and rank == 0: save_path = osp.expanduser(args.save_path) model.save(save_path) if args.play: logger.log("Running trained model") obs = env.reset() state = model.initial_state if hasattr(model, 'initial_state') else None dones = np.zeros((1,)) episode_rew = 0 while True: if state is not None: actions, _, state, _ = model.step(obs,S=state, M=dones) else: actions, _, _, _ = model.step(obs) obs, rew, done, _ = env.step(actions) episode_rew += rew[0] if isinstance(env, VecEnv) else rew env.render() done = done.any() if isinstance(done, np.ndarray) else done if done: print('episode_rew={}'.format(episode_rew)) episode_rew = 0 obs = env.reset() env.close() return model
def maybe_load_model(savedir, container): """Load model if present at the specified path.""" if savedir is None: return state_path = os.path.join(os.path.join(savedir, 'training_state.pkl.zip')) if container is not None: logger.log("Attempting to download model from Azure") found_model = container.get(savedir, 'training_state.pkl.zip') else: found_model = os.path.exists(state_path) if found_model: state = pickle_load(state_path, compression=True) model_dir = "model-{}".format(state["num_iters"]) if container is not None: container.get(savedir, model_dir) U.load_state(os.path.join(savedir, model_dir, "saved")) logger.log("Loaded models checkpoint at {} iterations".format(state["num_iters"])) return state
def learn(env, policy_func, dataset, optim_batch_size=128, max_iters=1e4, adam_epsilon=1e-5, optim_stepsize=3e-4, ckpt_dir=None, log_dir=None, task_name=None, verbose=False): val_per_iter = int(max_iters/10) ob_space = env.observation_space ac_space = env.action_space pi = policy_func("pi", ob_space, ac_space) # Construct network for new policy # placeholder ob = U.get_placeholder_cached(name="ob") ac = pi.pdtype.sample_placeholder([None]) stochastic = U.get_placeholder_cached(name="stochastic") loss = tf.reduce_mean(tf.square(ac-pi.ac)) var_list = pi.get_trainable_variables() adam = MpiAdam(var_list, epsilon=adam_epsilon) lossandgrad = U.function([ob, ac, stochastic], [loss]+[U.flatgrad(loss, var_list)]) U.initialize() adam.sync() logger.log("Pretraining with Behavior Cloning...") for iter_so_far in tqdm(range(int(max_iters))): ob_expert, ac_expert = dataset.get_next_batch(optim_batch_size, 'train') train_loss, g = lossandgrad(ob_expert, ac_expert, True) adam.update(g, optim_stepsize) if verbose and iter_so_far % val_per_iter == 0: ob_expert, ac_expert = dataset.get_next_batch(-1, 'val') val_loss, _ = lossandgrad(ob_expert, ac_expert, True) logger.log("Training loss: {}, Validation loss: {}".format(train_loss, val_loss)) if ckpt_dir is None: savedir_fname = tempfile.TemporaryDirectory().name else: savedir_fname = osp.join(ckpt_dir, task_name) U.save_state(savedir_fname, var_list=pi.get_variables()) return savedir_fname
def learn(*, network, env, total_timesteps, timesteps_per_batch=1024, # what to train on max_kl=0.001, cg_iters=10, gamma=0.99, lam=1.0, # advantage estimation seed=None, ent_coef=0.0, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters =3, max_episodes=0, max_iters=0, # time constraint callback=None, load_path=None, **network_kwargs ): ''' learn a policy function with TRPO algorithm Parameters: ---------- network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types) or function that takes input placeholder and returns tuple (output, None) for feedforward nets or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class timesteps_per_batch timesteps per gradient estimation batch max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) ) ent_coef coefficient of policy entropy term in the optimization objective cg_iters number of iterations of conjugate gradient algorithm cg_damping conjugate gradient damping vf_stepsize learning rate for adam optimizer used to optimie value function loss vf_iters number of iterations of value function optimization iterations per each policy optimization step total_timesteps max number of timesteps max_episodes max number of episodes max_iters maximum number of policy optimization iterations callback function to be called with (locals(), globals()) each policy optimization step load_path str, path to load the model from (default: None, i.e. no model is loaded) **network_kwargs keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network Returns: ------- learnt model ''' if MPI is not None: nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() else: nworkers = 1 rank = 0 cpus_per_worker = 1 U.get_session(config=tf.ConfigProto( allow_soft_placement=True, inter_op_parallelism_threads=cpus_per_worker, intra_op_parallelism_threads=cpus_per_worker )) policy = build_policy(env, network, value_network='copy', **network_kwargs) set_global_seeds(seed) np.set_printoptions(precision=3) # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space ob = observation_placeholder(ob_space) with tf.variable_scope("pi"): pi = policy(observ_placeholder=ob) with tf.variable_scope("oldpi"): oldpi = policy(observ_placeholder=ob) atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) entbonus = ent_coef * meanent vferr = tf.reduce_mean(tf.square(pi.vf - ret)) ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold surrgain = tf.reduce_mean(ratio * atarg) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = get_trainable_variables("pi") # var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")] # vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")] var_list = get_pi_trainable_variables("pi") vf_var_list = get_vf_trainable_variables("pi") vfadam = MpiAdam(vf_var_list) get_flat = U.GetFlat(var_list) set_from_flat = U.SetFromFlat(var_list) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: sz = U.intprod(shape) tangents.append(tf.reshape(flat_tangent[start:start+sz], shape)) start += sz gvp = tf.add_n([tf.reduce_sum(g*tangent) for (g, tangent) in zipsame(klgrads, tangents)]) #pylint: disable=E1111 fvp = U.flatgrad(gvp, var_list) assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi"))]) compute_losses = U.function([ob, ac, atarg], losses) compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)]) compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp) compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if rank == 0: print(colorize(msg, color='magenta')) tstart = time.time() yield print(colorize("done in %.3f seconds"%(time.time() - tstart), color='magenta')) else: yield def allmean(x): assert isinstance(x, np.ndarray) if MPI is not None: out = np.empty_like(x) MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM) out /= nworkers else: out = np.copy(x) return out U.initialize() if load_path is not None: pi.load(load_path) th_init = get_flat() if MPI is not None: MPI.COMM_WORLD.Bcast(th_init, root=0) set_from_flat(th_init) vfadam.sync() print("Init param sum", th_init.sum(), flush=True) # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards if sum([max_iters>0, total_timesteps>0, max_episodes>0])==0: # noththing to be done return pi assert sum([max_iters>0, total_timesteps>0, max_episodes>0]) < 2, \ 'out of max_iters, total_timesteps, and max_episodes only one should be specified' while True: if callback: callback(locals(), globals()) if total_timesteps and timesteps_so_far >= total_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break logger.log("********** Iteration %i ************"%iters_so_far) with timed("sampling"): seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean()) / atarg.std() # standardized advantage function estimate if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret) if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy args = seg["ob"], seg["ac"], atarg fvpargs = [arr[::5] for arr in args] def fisher_vector_product(p): return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p assign_old_eq_new() # set old parameter values to new parameter values with timed("computegrad"): *lossbefore, g = compute_lossandgrad(*args) lossbefore = allmean(np.array(lossbefore)) g = allmean(g) if np.allclose(g, 0): logger.log("Got zero gradient. not updating") else: with timed("cg"): stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank==0) assert np.isfinite(stepdir).all() shs = .5*stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm expectedimprove = g.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize set_from_flat(thnew) meanlosses = surr, kl, *_ = allmean(np.array(compute_losses(*args))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f"%(expectedimprove, improve)) if not np.isfinite(meanlosses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl > max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") set_from_flat(thbefore) if nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), vfadam.getflat().sum())) # list of tuples assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) with timed("vf"): for _ in range(vf_iters): for (mbob, mbret) in dataset.iterbatches((seg["ob"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=64): g = allmean(compute_vflossandgrad(mbob, mbret)) vfadam.update(g, vf_stepsize) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values if MPI is not None: listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples else: listoflrpairs = [lrlocal] lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if rank==0: logger.dump_tabular() return pi
def main(): args = gym_ctrl_arg_parser().parse_args() logger.configure(format_strs=['stdout', 'log', 'csv'], log_suffix="RAC-" + args.env) logger.log("Algorithm: RAC-" + args.env) train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
def learn(env, q_func, lr=5e-4, max_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=1, checkpoint_freq=10000, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, num_cpu=16, callback=None): """Train a deepq model. Parameters ------- env: gym.Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer max_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. num_cpu: int number of cpus to use for training callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = U.make_session(num_cpu=num_cpu) sess.__enter__() def make_obs_ph(name): return U.BatchInput(env.observation_space.shape, name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, double_q=True, grad_norm_clipping=10 ) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = max_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * max_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() with tempfile.TemporaryDirectory() as td: model_saved = False model_file = os.path.join(td, "model") for t in range(max_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value action = act(np.array(obs)[None], update_eps=exploration.value(t))[0] new_obs, rew, done, _ = env.step(action) # Store transition in the replay buffer. replay_buffer.add(obs, action, rew, new_obs, float(done)) obs = new_obs episode_rewards[-1] += rew if done: obs = env.reset() episode_rewards.append(0.0) if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample(batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample(batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len(episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log("Saving model due to mean reward increase: {} -> {}".format( saved_mean_reward, mean_100ep_reward)) U.save_state(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format(saved_mean_reward)) U.load_state(model_file) return ActWrapper(act, act_params)
def learn(env, policy_fn, *, timesteps_per_batch, # what to train on max_kl, cg_iters, gamma, lam, # advantage estimation entcoeff=0.0, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters =3, max_timesteps=0, max_episodes=0, max_iters=0,is_Original = 0, # time constraint callback=None ): nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() np.set_printoptions(precision=3) # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space pi = policy_fn("pi", ob_space, ac_space) oldpi = policy_fn("oldpi", ob_space, ac_space) atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return ob = U.get_placeholder_cached(name="ob") ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) entbonus = entcoeff * meanent vferr = tf.reduce_mean(tf.square(pi.vpred - ret)) ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold if is_Original == 0: surrgain = tf.reduce_mean(ratio * atarg) if is_Original == 1: surrgain = tf.reduce_mean(tf.log(tf.clip_by_value(ratio, 1e-10, 1e100)) * (atarg )) if is_Original == 2: surrgain = tf.reduce_mean(tf.log(tf.clip_by_value(ratio, 1e-10, 1e100)) * tf.nn.relu(atarg) - (tf.nn.relu(-1.0 * atarg) * (2 *ratio - tf.log(tf.clip_by_value(ratio, 1e-10, 1e100))))) if is_Original == 3: surrgain = tf.reduce_mean(tf.log(tf.clip_by_value(ratio, 1e-10, 1e100)) * tf.nn.relu(atarg) + tf.nn.relu(-1.0 * atarg) * tf.log(tf.clip_by_value(2 - ratio, 1e-10, 1e100))) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")] vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")] vfadam = MpiAdam(vf_var_list) get_flat = U.GetFlat(var_list) set_from_flat = U.SetFromFlat(var_list) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: sz = U.intprod(shape) tangents.append(tf.reshape(flat_tangent[start:start+sz], shape)) start += sz gvp = tf.add_n([tf.reduce_sum(g*tangent) for (g, tangent) in zipsame(klgrads, tangents)]) #pylint: disable=E1111 fvp = U.flatgrad(gvp, var_list) assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())]) compute_losses = U.function([ob, ac, atarg], losses) compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)]) compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp) compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if rank == 0: print(colorize(msg, color='magenta')) tstart = time.time() yield print(colorize("done in %.3f seconds"%(time.time() - tstart), color='magenta')) else: yield def allmean(x): assert isinstance(x, np.ndarray) out = np.empty_like(x) MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM) out /= nworkers return out U.initialize() th_init = get_flat() MPI.COMM_WORLD.Bcast(th_init, root=0) set_from_flat(th_init) vfadam.sync() print("Init param sum", th_init.sum(), flush=True) # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards assert sum([max_iters>0, max_timesteps>0, max_episodes>0])==1 while True: if callback: callback(locals(), globals()) if max_timesteps and timesteps_so_far >= max_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break logger.log("********** Iteration %i ************"%iters_so_far) with timed("sampling"): seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate # atarg = (atarg - atarg.mean()) / atarg.std() # standardized advantage function estimate # atarg = (atarg - atarg.mean()) / atarg.std() if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret) if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy args = seg["ob"], seg["ac"], atarg fvpargs = [arr[::5] for arr in args] def fisher_vector_product(p): return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p assign_old_eq_new() # set old parameter values to new parameter values with timed("computegrad"): *lossbefore, g = compute_lossandgrad(*args) lossbefore = allmean(np.array(lossbefore)) g = allmean(g) if np.allclose(g, 0): logger.log("Got zero gradient. not updating") else: with timed("cg"): stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank==0) assert np.isfinite(stepdir).all() shs = .5*stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm expectedimprove = g.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize set_from_flat(thnew) meanlosses = surr, kl, *_ = allmean(np.array(compute_losses(*args))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f"%(expectedimprove, improve)) if not np.isfinite(meanlosses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl > max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") set_from_flat(thbefore) if nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), vfadam.getflat().sum())) # list of tuples assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) with timed("vf"): for _ in range(vf_iters): for (mbob, mbret) in dataset.iterbatches((seg["ob"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=64): g = allmean(compute_vflossandgrad(mbob, mbret)) vfadam.update(g, vf_stepsize) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if rank==0: logger.dump_tabular()
def log_info(self): logger.log("Total trajectorues: %d" % self.num_traj) logger.log("Total transitions: %d" % self.num_transition) logger.log("Average returns: %f" % self.avg_ret) logger.log("Std for returns: %f" % self.std_ret)
def learn( *, network, env, total_timesteps, timesteps_per_batch=1024, # what to train on max_kl=0.002, cg_iters=10, gamma=0.99, lam=1.0, # advantage estimation seed=None, ent_coef=0.00, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters=3, max_episodes=0, max_iters=0, # time constraint callback=None, load_path=None, num_reward=1, **network_kwargs): ''' learn a policy function with TRPO algorithm Parameters: ---------- network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types) or function that takes input placeholder and returns tuple (output, None) for feedforward nets or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class timesteps_per_batch timesteps per gradient estimation batch max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) ) ent_coef coefficient of policy entropy term in the optimization objective cg_iters number of iterations of conjugate gradient algorithm cg_damping conjugate gradient damping vf_stepsize learning rate for adam optimizer used to optimie value function loss vf_iters number of iterations of value function optimization iterations per each policy optimization step total_timesteps max number of timesteps max_episodes max number of episodes max_iters maximum number of policy optimization iterations callback function to be called with (locals(), globals()) each policy optimization step load_path str, path to load the model from (default: None, i.e. no model is loaded) **network_kwargs keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network Returns: ------- learnt model ''' if MPI is not None: nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() else: nworkers = 1 rank = 0 cpus_per_worker = 1 U.get_session( config=tf.ConfigProto(allow_soft_placement=True, inter_op_parallelism_threads=cpus_per_worker, intra_op_parallelism_threads=cpus_per_worker)) set_global_seeds(seed) # 创建policy policy = build_policy(env, network, value_network='copy', num_reward=num_reward, **network_kwargs) process_dir = logger.get_dir() save_dir = process_dir.split( 'Data')[-2] + 'log/mu/seed' + process_dir[-1] + '/' os.makedirs(save_dir, exist_ok=True) coe_save = [] impro_save = [] grad_save = [] adj_save = [] coe = np.ones((num_reward)) / num_reward np.set_printoptions(precision=3) # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space ################################################################# # ob ac ret atarg 都是 placeholder # ret atarg 此处应该是向量形式 ob = observation_placeholder(ob_space) # 创建pi和oldpi with tf.variable_scope("pi"): pi = policy(observ_placeholder=ob) with tf.variable_scope("oldpi"): oldpi = policy(observ_placeholder=ob) # 每个reward都可以算一个atarg atarg = tf.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None, num_reward]) # Empirical return ac = pi.pdtype.sample_placeholder([None]) #此处的KL div和entropy与reward无关 ################################## kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) # entbonus 是entropy loss entbonus = ent_coef * meanent ################################# ########################################################### # vferr 用来更新 v 网络 vferr = tf.reduce_mean(tf.square(pi.vf - ret)) ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold surrgain = tf.reduce_mean(ratio * atarg) # optimgain 用来更新 policy 网络, 应该每个reward有一个 optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] ########################################################### dist = meankl # 定义要优化的变量和 V 网络 adam 优化器 all_var_list = get_trainable_variables("pi") # var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")] # vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")] var_list = get_pi_trainable_variables("pi") vf_var_list = get_vf_trainable_variables("pi") vfadam = MpiAdam(vf_var_list) # 把变量展开成一个向量的类 get_flat = U.GetFlat(var_list) # 这个类可以把一个向量分片赋值给var_list里的变量 set_from_flat = U.SetFromFlat(var_list) # kl散度的梯度 klgrads = tf.gradients(dist, var_list) #################################################################### # 拉直的向量 flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") # 把拉直的向量重新分成很多向量 shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: sz = U.intprod(shape) tangents.append(tf.reshape(flat_tangent[start:start + sz], shape)) start += sz #################################################################### #################################################################### # 把kl散度梯度与变量乘积相加 gvp = tf.add_n([ tf.reduce_sum(g * tangent) for (g, tangent) in zipsame(klgrads, tangents) ]) #pylint: disable=E1111 # 把gvp的梯度展成向量 fvp = U.flatgrad(gvp, var_list) #################################################################### # 用学习后的策略更新old策略 assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi")) ]) # 计算loss compute_losses = U.function([ob, ac, atarg], losses) # 计算loss和梯度 compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)]) # 计算fvp compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp) # 计算值网络的梯度 compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if rank == 0: print(colorize(msg, color='magenta')) tstart = time.time() yield print( colorize("done in %.3f seconds" % (time.time() - tstart), color='magenta')) else: yield def allmean(x): assert isinstance(x, np.ndarray) if MPI is not None: out = np.empty_like(x) MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM) out /= nworkers else: out = np.copy(x) return out # 初始化variable U.initialize() if load_path is not None: pi.load(load_path) # 得到初始化的参数向量 th_init = get_flat() if MPI is not None: MPI.COMM_WORLD.Bcast(th_init, root=0) # 把向量the_init的值分片赋值给var_list set_from_flat(th_init) #同步 vfadam.sync() print("Init param sum", th_init.sum(), flush=True) # Prepare for rollouts # ---------------------------------------- # 这是一个生成数据的迭代器 seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True, num_reward=num_reward) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() # 双端队列 lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards if sum([max_iters > 0, total_timesteps > 0, max_episodes > 0]) == 0: # noththing to be done return pi assert sum([max_iters>0, total_timesteps>0, max_episodes>0]) < 2, \ 'out of max_iters, total_timesteps, and max_episodes only one should be specified' while True: if callback: callback(locals(), globals()) if total_timesteps and timesteps_so_far >= total_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break logger.log("********** Iteration %i ************" % iters_so_far) with timed("sampling"): seg = seg_gen.__next__() # 计算累积回报 add_vtarg_and_adv(seg, gamma, lam, num_reward=num_reward) ###########$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$$ToDo # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) # ob, ac, atarg, tdlamret 的类型都是ndarray #ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"] _, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg[ "tdlamret"] #print(seg['ob'].shape,type(seg['ob'])) #print(seg['ac'],type(seg['ac'])) #print(seg['adv'],type(seg['adv'])) #print(seg["tdlamret"].shape,type(seg['tdlamret'])) vpredbefore = seg["vpred"] # predicted value function before udpate # 标准化 #print("============================== atarg =========================================================") #print(atarg) atarg = (atarg - np.mean(atarg, axis=0)) / np.std( atarg, axis=0) # standardized advantage function estimate #atarg = (atarg) / np.max(np.abs(atarg),axis=0) #print('======================================= standardized atarg ====================================') #print(atarg) if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret) if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy ## set old parameter values to new parameter values assign_old_eq_new() G = None S = None mr_lossbefore = np.zeros((num_reward, len(loss_names))) grad_norm = np.zeros((num_reward + 1)) for i in range(num_reward): args = seg["ob"], seg["ac"], atarg[:, i] #print(atarg[:,i]) # 算是args的一个sample,每隔5个取出一个 fvpargs = [arr[::5] for arr in args] # 这个函数计算fisher matrix 与向量 p 的 乘积 def fisher_vector_product(p): return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p with timed("computegrad of " + str(i + 1) + ".th reward"): *lossbefore, g = compute_lossandgrad(*args) lossbefore = allmean(np.array(lossbefore)) mr_lossbefore[i] = lossbefore g = allmean(g) #print("***************************************************************") #print(g) if isinstance(G, np.ndarray): G = np.vstack((G, g)) else: G = g # g是目标函数的梯度 # 利用共轭梯度获得更新方向 if np.allclose(g, 0): logger.log("Got zero gradient. not updating") else: with timed("cg of " + str(i + 1) + ".th reward"): # stepdir 是更新方向 stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank == 0) shs = .5 * stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm grad_norm[i] = np.linalg.norm(fullstep) assert np.isfinite(stepdir).all() if isinstance(S, np.ndarray): S = np.vstack((S, stepdir)) else: S = stepdir #print('======================================= G ====================================') #print(G) #print('======================================= S ====================================') #print(S) try: new_coe = get_coefficient(G, S) #coe = 0.99 * coe + 0.01 * new_coe coe = new_coe coe_save.append(coe) #根据梯度的夹角调整参数 # GG = np.dot(S, S.T) # D = np.sqrt(np.diag(1/np.diag(GG))) # GG = np.dot(np.dot(D,GG),D) # #print('======================================= inner product ====================================') # #print(GG) # adj = np.sum(GG) / (num_reward ** 2) adj = 1 #print('======================================= adj ====================================') #print(adj) adj_save.append(adj) adj_max_kl = adj * max_kl ################################################################# grad_norm = grad_norm * np.sqrt(adj) stepdir = np.dot(coe, S) g = np.dot(coe, G) lossbefore = np.dot(coe, mr_lossbefore) ################################################################# shs = .5 * stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / adj_max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm grad_norm[num_reward] = np.linalg.norm(fullstep) grad_save.append(grad_norm) expectedimprove = g.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = get_flat() def compute_mr_losses(): mr_losses = np.zeros((num_reward, len(loss_names))) for i in range(num_reward): args = seg["ob"], seg["ac"], atarg[:, i] one_reward_loss = allmean(np.array(compute_losses(*args))) mr_losses[i] = one_reward_loss mr_loss = np.dot(coe, mr_losses) return mr_loss, mr_losses # 做10次搜索 for _ in range(10): thnew = thbefore + fullstep * stepsize set_from_flat(thnew) mr_loss_new, mr_losses_new = compute_mr_losses() mr_impro = mr_losses_new - mr_lossbefore meanlosses = surr, kl, *_ = allmean(np.array(mr_loss_new)) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f" % (expectedimprove, improve)) if not np.isfinite(meanlosses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl > adj_max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") impro_save.append(np.hstack((mr_impro[:, 0], improve))) break stepsize *= .5 else: logger.log("couldn't compute a good step") set_from_flat(thbefore) if nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather( (thnew.sum(), vfadam.getflat().sum())) # list of tuples assert all( np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) with timed("vf"): #print('======================================= tdlamret ====================================') #print(seg["tdlamret"]) for _ in range(vf_iters): for (mbob, mbret) in dataset.iterbatches( (seg["ob"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=64): #with tf.Session() as sess: # sess.run(tf.global_variables_initializer()) # aaa = sess.run(pi.vf,feed_dict={ob:mbob,ret:mbret}) # print("aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa") # print(aaa.shape) # print(mbret.shape) g = allmean(compute_vflossandgrad(mbob, mbret)) vfadam.update(g, vf_stepsize) except: print('error') #print(mbob,mbret) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values if MPI is not None: listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples else: listoflrpairs = [lrlocal] lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if rank == 0: logger.dump_tabular() #pdb.set_trace() np.save(save_dir + 'coe.npy', coe_save) np.save(save_dir + 'grad.npy', grad_save) np.save(save_dir + 'improve.npy', impro_save) np.save(save_dir + 'adj.npy', adj_save) return pi
def learn(env, q_func, lr=5e-4, max_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=100, checkpoint_freq=10000, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, param_noise=False, callback=None): """Train a deepq model. Parameters ------- env: gym.Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer max_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = tf.Session() sess.__enter__() # capture the shape outside the closure so that the env object is not serialized # by cloudpickle when serializing make_obs_ph observation_space_shape = env.observation_space.shape def make_obs_ph(name): return BatchInput(observation_space_shape, name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, param_noise=param_noise ) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } act = ActWrapper(act, act_params) # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = max_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * max_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() reset = True with tempfile.TemporaryDirectory() as td: model_saved = False model_file = os.path.join(td, "model") for t in range(max_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log(1. - exploration.value(t) + exploration.value(t) / float(env.action_space.n)) kwargs['reset'] = reset kwargs['update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act(np.array(obs)[None], update_eps=update_eps, **kwargs)[0] env_action = action reset = False new_obs, rew, done, _ = env.step(env_action) # Store transition in the replay buffer. replay_buffer.add(obs, action, rew, new_obs, float(done)) obs = new_obs episode_rewards[-1] += rew if done: obs = env.reset() episode_rewards.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample(batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample(batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len(episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log("Saving model due to mean reward increase: {} -> {}".format( saved_mean_reward, mean_100ep_reward)) save_state(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format(saved_mean_reward)) load_state(model_file) return act
def learn(env, q_func, num_actions=3, lr=5e-4, max_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=100, print_freq=15, checkpoint_freq=10000, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, num_cpu=16, param_noise=False, param_noise_threshold=0.05, callback=None, demo_replay=[]): """Train a deepq model. Parameters ------- q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. num_cpu: int number of cpus to use for training callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = TU.make_session(num_cpu=num_cpu) sess.__enter__() def make_obs_ph(name): return U.BatchInput((64, 64), name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=num_actions, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': num_actions, } # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = max_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * max_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. TU.initialize() update_target() group_id = 0 old_num = 0 reset = True Action_Choose = False player = [] episode_rewards = [0.0] saved_mean_reward = None marine_record = {} obs = env.reset() screen = obs[0].observation["screen"][_UNIT_TYPE] obs, xy_per_marine = common.init(env, obs) with tempfile.TemporaryDirectory() as td: model_saved = False model_file = os.path.join(td, "model") for t in range(max_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. if param_noise_threshold >= 0.: update_param_noise_threshold = param_noise_threshold else: # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log( 1. - exploration.value(t) + exploration.value(t) / float(num_actions)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True # custom process for DefeatZerglingsAndBanelings reset = False Action_Choose = not (Action_Choose) if Action_Choose == True: #the first action obs, screen, group_id, player = common.select_marine(env, obs) marine_record = common.run_record(marine_record, obs) else: # the second action action = act(np.array(screen)[None], update_eps=update_eps, **kwargs)[0] action = common.check_action(obs, action) new_action = None obs, new_action, marine_record = common.marine_action( env, obs, group_id, player, action, marine_record) army_count = env._obs[0].observation.player_common.army_count try: if army_count > 0 and ( _MOVE_SCREEN in obs[0].observation["available_actions"]): obs = env.step(actions=new_action) else: new_action = [sc2_actions.FunctionCall(_NO_OP, [])] obs = env.step(actions=new_action) except Exception as e: print(new_action) print(e) new_action = [sc2_actions.FunctionCall(_NO_OP, [])] obs = env.step(actions=new_action) # get the new screen in action 2 player_y, player_x = np.nonzero( obs[0].observation["screen"][_SELECTED] == 1) new_screen = obs[0].observation["screen"][_UNIT_TYPE] for i in range(len(player_y)): new_screen[player_y[i]][player_x[i]] = 49 #update every step rew = obs[0].reward done = obs[0].step_type == environment.StepType.LAST episode_rewards[-1] += rew reward = episode_rewards[-1] if Action_Choose == False: # only store the screen after the action is done replay_buffer.add(screen, action, rew, new_screen, float(done)) mirror_new_screen = common._map_mirror(new_screen) mirror_screen = common._map_mirror(screen) replay_buffer.add(mirror_screen, action, rew, mirror_new_screen, float(done)) if done: obs = env.reset() Action_Choose = False group_list = common.init(env, obs) episode_rewards.append(0.0) if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() num_episodes = len(episode_rewards) #test for me if num_episodes > old_num: old_num = num_episodes print("now the episode is {}".format(num_episodes)) #test for me if (num_episodes > 102): mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) else: mean_100ep_reward = round(np.mean(episode_rewards), 1) if done and print_freq is not None and len( episode_rewards) % print_freq == 0: print("get the log") logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("reward", reward) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}" .format(saved_mean_reward, mean_100ep_reward)) U.save_state(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) U.load_state(model_file) return ActWrapper(act)
def learn(env, q_func, num_actions=3, lr=5e-4, max_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=1, checkpoint_freq=10000, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, num_cpu=16, param_noise=False, param_noise_threshold=0.05, callback=None, demo_replay=[]): """Train a deepq model. Parameters ------- env: pysc2.env.SC2Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer max_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. num_cpu: int number of cpus to use for training callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = U.make_session(num_cpu=num_cpu) sess.__enter__() def make_obs_ph(name): return U.BatchInput((64, 64), name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=num_actions, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': num_actions, } # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = max_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * max_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() # Select all marines first player_relative = obs[0].observation["screen"][_PLAYER_RELATIVE] screen = player_relative obs, xy_per_marine = common.init(env, obs) group_id = 0 reset = True with tempfile.TemporaryDirectory() as td: model_saved = False model_file = os.path.join(td, "model") for t in range(max_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. if param_noise_threshold >= 0.: update_param_noise_threshold = param_noise_threshold else: # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log( 1. - exploration.value(t) + exploration.value(t) / float(num_actions)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True # custom process for DefeatZerglingsAndBanelings obs, screen, player = common.select_marine(env, obs) action = act(np.array(screen)[None], update_eps=update_eps, **kwargs)[0] reset = False rew = 0 new_action = None obs, new_action = common.marine_action(env, obs, player, action) army_count = env._obs.observation.player_common.army_count try: if army_count > 0 and _ATTACK_SCREEN in obs[0].observation[ "available_actions"]: obs = env.step(actions=new_action) else: new_action = [sc2_actions.FunctionCall(_NO_OP, [])] obs = env.step(actions=new_action) except Exception as e: #print(e) 1 # Do nothing player_relative = obs[0].observation["screen"][_PLAYER_RELATIVE] new_screen = player_relative rew += obs[0].reward done = obs[0].step_type == environment.StepType.LAST selected = obs[0].observation["screen"][_SELECTED] player_y, player_x = (selected == _PLAYER_FRIENDLY).nonzero() if (len(player_y) > 0): player = [int(player_x.mean()), int(player_y.mean())] if (len(player) == 2): if (player[0] > 32): new_screen = common.shift(LEFT, player[0] - 32, new_screen) elif (player[0] < 32): new_screen = common.shift(RIGHT, 32 - player[0], new_screen) if (player[1] > 32): new_screen = common.shift(UP, player[1] - 32, new_screen) elif (player[1] < 32): new_screen = common.shift(DOWN, 32 - player[1], new_screen) # Store transition in the replay buffer. replay_buffer.add(screen, action, rew, new_screen, float(done)) screen = new_screen episode_rewards[-1] += rew reward = episode_rewards[-1] if done: print("Episode Reward : %s" % episode_rewards[-1]) obs = env.reset() player_relative = obs[0].observation["screen"][ _PLAYER_RELATIVE] screen = player_relative group_list = common.init(env, obs) # Select all marines first #env.step(actions=[sc2_actions.FunctionCall(_SELECT_UNIT, [_SELECT_ALL])]) episode_rewards.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len( episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("reward", reward) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}" .format(saved_mean_reward, mean_100ep_reward)) U.save_state(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) U.load_state(model_file) return ActWrapper(act)
def train(self, samples_data: Dict, normalize_rewards: bool = False): """ :param samples_data: contains: rewards reward_list actions timesteps actions_one_hot wins paths :param normalize_rewards: boolean, whether to normalize rewards :return: The new value of omega """ # Init vars rewards = samples_data["rewards"] reward_list = samples_data["reward_list"] timesteps = samples_data["timesteps"] actions_one_hot = samples_data["actions_one_hot"] feat_diff = [] next_states = [] states = [] for (i, path) in enumerate(samples_data["paths"]): feats = self._features(path) obs = np.array(path) # all but the first if not self.exact: # centered next_states.append(obs[1:, :] - obs[:-1, :]) else: next_states.append(obs[1:, :]) # all but the last states.append(obs[:-1, :]) feat_diff.append(feats[1:] - feats[:-1]) feat_diff = np.vstack(feat_diff) states = np.vstack(states) next_states = np.vstack(next_states) if self.projection_type == "joint": actions = np.zeros((states.shape[0], 1)) if self.env.n_actions == 2: actions = np.hstack((actions - 1, actions + 1)) else: actions = np.hstack( (actions + 1, actions + 1, actions + 1, actions + 1)) else: actions = actions_one_hot * [-1, 1] if normalize_rewards: rewards = (rewards - np.mean(rewards)) / (np.maximum( np.std(rewards), 1e-5)) assert next_states.shape == states.shape inputs_dict = { self.rewards_ph: rewards, self.actions_one_hot_ph: actions_one_hot, self.observations_ph: states, self.next_states_ph: next_states, self.feat_diff_ph: feat_diff, self.actions_ph: actions, self.returns_ph: reward_list, self.timesteps_ph: timesteps, self.kappa_ph: self.kappa, } inputs_dict.update(self.model.get_feed_dict()) ################# # Optimize dual # ################# self.optimize_dual(inputs_dict) logger.log(f"Parameters found: {self.param_eta}", logger.INFO) # save variables before projection omega_before = np.array(self.sess.run(self.model.get_omega())) th_before = np.array(self.sess.run(self.policy.get_theta())) ################### # Optimize policy and model # ################### self.project(inputs_dict) # save variable after projection omega_after = np.array( self.sess.run(self.model.get_omega(), feed_dict=inputs_dict)) th_after = np.array(self.sess.run(self.policy.get_theta())) # log variable if self.iteration % self.write_every == 0: self.log( inputs_dict, omega_before, th_before, omega_after, th_after, samples_data, ) self.iteration += 1 self.global_step += 1 # add samples for refit # add to the new training set after subsampling # to_add = 1000 # ind = np.arange(0, np.shape(states)[0]) # selected_ind = np.random.choice(ind, size=to_add, replace=False) # inputs = states[selected_ind, :] # ac = np.sum(actions_one_hot[selected_ind,:] * samples_data['omega'], axis=1, keepdims=True) # X = np.hstack((inputs, ac)) # targets = next_states[selected_ind, :] # if self.iteration >= 2: # X_old = np.load(self.model.folder+"on_policyX.npy") # targets_old = np.load(self.model.folder+"on_policyY.npy") # X = np.vstack((X_old, X)) # targets = np.vstack((targets_old, targets)) # np.save(self.model.folder + "on_policyX.npy", X) # np.save(self.model.folder+"on_policyY.npy", targets) if self.iteration % self.refit_every_iterations == 0 and self.refit: self.model.fit( action_ph=self.actions_ph, states_ph=self.observations_ph, next_states_ph=self.next_states_ph, load_weights=False, add_onpolicy=True, training_step=1000, ) return omega_after
def learn(env, network, seed=None, lr=5e-4, total_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=100, checkpoint_freq=10000, checkpoint_path=None, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, param_noise=False, callback=None, load_path=None, **network_kwargs ): """Train a deepq model. Parameters ------- env: gym.Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer total_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to total_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. load_path: str path to load the model from. (default: None) **network_kwargs additional keyword arguments to pass to the network builder. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = get_session() set_global_seeds(seed) q_func = build_q_func(network, **network_kwargs) # capture the shape outside the closure so that the env object is not serialized # by cloudpickle when serializing make_obs_ph observation_space = env.observation_space def make_obs_ph(name): return ObservationInput(observation_space, name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, param_noise=param_noise ) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } act = ActWrapper(act, act_params) # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = total_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * total_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() reset = True with tempfile.TemporaryDirectory() as td: td = checkpoint_path or td model_file = os.path.join(td, "model") model_saved = False if tf.train.latest_checkpoint(td) is not None: load_variables(model_file) logger.log('Loaded model from {}'.format(model_file)) model_saved = True elif load_path is not None: load_variables(load_path) logger.log('Loaded model from {}'.format(load_path)) for t in range(total_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log(1. - exploration.value(t) + exploration.value(t) / float(env.action_space.n)) kwargs['reset'] = reset kwargs['update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act(np.array(obs)[None], update_eps=update_eps, **kwargs)[0] env_action = action reset = False new_obs, rew, done, _ = env.step(env_action) # Store transition in the replay buffer. replay_buffer.add(obs, action, rew, new_obs, float(done)) obs = new_obs episode_rewards[-1] += rew if done: obs = env.reset() episode_rewards.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample(batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample(batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len(episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log("Saving model due to mean reward increase: {} -> {}".format( saved_mean_reward, mean_100ep_reward)) save_variables(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format(saved_mean_reward)) load_variables(model_file) return act
def learn(make_env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=False, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() # Building the environment env = make_env() ob_space = env.observation_space ac_space = env.action_space # Building the policy pi = make_policy('pi', ob_space, ac_space) oldpi = make_policy('oldpi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split('/')[1].startswith('pol')] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([max_samples], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='mask') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='disc_rew') gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') # Policy densities target_log_pdf = pi.pd.logp(ac_) behavioral_log_pdf = oldpi.pd.logp(ac_) log_ratio = target_log_pdf - behavioral_log_pdf # Split operations disc_rew_split = tf.stack(tf.split(disc_rew_ * mask_, n_episodes)) log_ratio_split = tf.stack(tf.split(log_ratio * mask_, n_episodes)) target_log_pdf_split = tf.stack(tf.split(target_log_pdf * mask_, n_episodes)) mask_split = tf.stack(tf.split(mask_, n_episodes)) # Renyi divergence emp_d2_split = tf.stack(tf.split(pi.pd.renyi(oldpi.pd, 2) * mask_, n_episodes)) emp_d2_cum_split = tf.reduce_sum(emp_d2_split, axis=1) empirical_d2 = tf.reduce_mean(tf.exp(emp_d2_cum_split)) # Return ep_return = tf.reduce_sum(mask_split * disc_rew_split, axis=1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) if iw_method == 'pdis': raise NotImplementedError() elif iw_method == 'is': iw = tf.exp(tf.reduce_sum(log_ratio_split, axis=1)) if iw_norm == 'none': iwn = iw / n_episodes w_return_mean = tf.reduce_sum(iwn * ep_return) elif iw_norm == 'sn': iwn = iw / tf.reduce_sum(iw) w_return_mean = tf.reduce_sum(iwn * ep_return) elif iw_norm == 'regression': iwn = iw / n_episodes mean_iw = tf.reduce_mean(iw) beta = tf.reduce_sum((iw - mean_iw) * ep_return * iw) / (tf.reduce_sum((iw - mean_iw) ** 2) + 1e-24) w_return_mean = tf.reduce_mean(iw * ep_return - beta * (iw - 1)) else: raise NotImplementedError() ess_classic = tf.linalg.norm(iw, 1) ** 2 / tf.linalg.norm(iw, 2) ** 2 sqrt_ess_classic = tf.linalg.norm(iw, 1) / tf.linalg.norm(iw, 2) ess_renyi = n_episodes / empirical_d2 else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'std-d2': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_std elif bound == 'max-d2': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_abs_max elif bound == 'max-ess': bound_ = w_return_mean - tf.sqrt((1 - delta) / delta) / sqrt_ess_classic * return_abs_max elif bound == 'std-ess': bound_ = w_return_mean - tf.sqrt((1 - delta) / delta) / sqrt_ess_classic * return_std else: raise NotImplementedError() losses = [bound_, return_mean, return_max, return_min, return_std, empirical_d2, w_return_mean, tf.reduce_max(iwn), tf.reduce_min(iwn), tf.reduce_mean(iwn), U.reduce_std(iwn), tf.reduce_max(iw), tf.reduce_min(iw), tf.reduce_mean(iw), U.reduce_std(iw), ess_classic, ess_renyi] loss_names = ['Bound', 'InitialReturnMean', 'InitialReturnMax', 'InitialReturnMin', 'InitialReturnStd', 'EmpiricalD2', 'ReturnMeanIW', 'MaxIWNorm', 'MinIWNorm', 'MeanIWNorm', 'StdIWNorm', 'MaxIW', 'MinIW', 'MeanIW', 'StdIW', 'ESSClassic', 'ESSRenyi'] if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad(tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) assign_old_eq_new = U.function([], [], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())]) compute_lossandgrad = U.function([ob_, ac_, disc_rew_, mask_], losses + [U.flatgrad(bound_, var_list)]) compute_grad = U.function([ob_, ac_, disc_rew_, mask_], [U.flatgrad(bound_, var_list)]) compute_bound = U.function([ob_, ac_, disc_rew_, mask_], [bound_]) compute_losses = U.function([ob_, ac_, disc_rew_, mask_], losses) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finised...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() print(theta) with timed('sampling'): seg = sampler.collect(theta) add_disc_rew(seg, gamma) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) args = ob, ac, disc_rew, mask = seg['ob'], seg['ac'], seg['disc_rew'], seg['mask'] assign_old_eq_new() def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Itaration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights: logger.record_tabular('Weights', str(get_parameter())) with timed("offline optimization"): theta, improvement = optimize_offline(theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) logger.dump_tabular() env.close()
def learn(env, pol_maker, gamma, initial_batch_size, task_horizon, max_iterations, feature_fun=None, rmax=None, normalize=True, use_rmax=True, use_renyi=True, max_offline_ite=100, max_search_ite=30, verbose=True, save_to=None, delta=0.2, shift=False, reuse=False, use_parabola=False): #Logging format_strs = [] if verbose: format_strs.append('stdout') if save_to: format_strs.append('csv') logger.configure(dir=save_to, format_strs=format_strs) pol = pol_maker('pol') newpol = pol_maker('oldpol') newpol.set_params(pol.eval_params()) batch_size = initial_batch_size #Learning iteration actor_params, rets, disc_rets, lens = [], [], [], [] old_perf = -np.inf for it in range(max_iterations): logger.log('\n********** Iteration %i ************' % it) rho = pol.eval_params() #Higher-order-policy parameters if verbose > 1: logger.log('Higher-order parameters: ', rho) if save_to: np.save(save_to + '/weights_' + str(it), rho) #Batch of episodes #TODO: try symmetric sampling with timed('Sampling'): for ep in range(initial_batch_size): frozen_pol = pol.freeze() theta = frozen_pol.resample() actor_params.append(theta) ret, disc_ret, ep_len = eval_trajectory( env, frozen_pol, gamma, task_horizon, feature_fun) rets.append(ret) disc_rets.append(disc_ret) lens.append(ep_len) complete = len(rets) >= batch_size norm_disc_rets = np.array(disc_rets) if shift: norm_disc_rets = norm_disc_rets - np.mean(norm_disc_rets) rmax = np.max(abs(norm_disc_rets)) perf = np.mean(norm_disc_rets) logger.log('Performance: ', np.mean(perf)) #if save_to: np.save(save_to + '/rets_' + str(it), rets) if complete and perf < old_perf and batch_size < 5 * initial_batch_size: #Try with more trajectories iter_type = 0 if verbose: logger.log('Performance loss! Adding more trajectories') batch_size += initial_batch_size old_perf = -np.inf #After adding 100, go on anyway newpol.set_params(rho) complete = False #Policy does not change, so keep the trajectories elif complete: #When you have enough data, optimize iter_type = 1 if verbose: logger.log('Optimizing') with timed('Optimizing offline'): rho, improvement = optimize_offline( pol, newpol, actor_params, norm_disc_rets, normalize=normalize, use_rmax=use_rmax, use_renyi=use_renyi, max_offline_ite=max_offline_ite, max_search_ite=max_search_ite, rmax=rmax, delta=delta, use_parabola=use_parabola) newpol.set_params(rho) assert (improvement >= 0.) old_perf = perf else: iter_type = 2 if verbose: logger.log('Collecting more data (%d/%d)' % (len(rets), batch_size)) newpol.set_params(rho) logger.log('Recap of iteration %i' % it) unn_iws = newpol.eval_iws(actor_params, behavioral=pol, normalize=False) iws = unn_iws / np.sum(unn_iws) ess = np.linalg.norm(unn_iws, 1)**2 / np.linalg.norm(unn_iws, 2)**2 J, varJ = newpol.eval_performance(actor_params, norm_disc_rets, behavioral=pol) eRenyi = np.exp(newpol.eval_renyi(pol)) logger.record_tabular('IterType', iter_type) logger.record_tabular( 'Bound', newpol.eval_bound(actor_params, norm_disc_rets, pol, rmax, normalize, use_rmax, use_renyi, delta)) logger.record_tabular('ESSClassic', ess) logger.record_tabular('ESSRenyi', batch_size / eRenyi) logger.record_tabular('MaxVanillaIw', np.max(unn_iws)) logger.record_tabular('MinVanillaIw', np.min(unn_iws)) logger.record_tabular('AvgVanillaIw', np.mean(unn_iws)) logger.record_tabular('VarVanillaIw', np.var(unn_iws, ddof=1)) logger.record_tabular('MaxNormIw', np.max(iws)) logger.record_tabular('MinNormIw', np.min(iws)) logger.record_tabular('AvgNormIw', np.mean(iws)) logger.record_tabular('VarNormIw', np.var(iws, ddof=1)) logger.record_tabular('eRenyi2', eRenyi) logger.record_tabular('AvgRet', np.mean(rets)) logger.record_tabular('VanillaAvgRet', np.mean(rets)) logger.record_tabular('VarRet', np.var(rets, ddof=1)) logger.record_tabular('VarDiscRet', np.var(norm_disc_rets, ddof=1)) logger.record_tabular('AvgDiscRet', np.mean(norm_disc_rets)) logger.record_tabular('J', J) logger.record_tabular('VarJ', varJ) logger.record_tabular('BatchSize', batch_size) logger.record_tabular('EpsThisIter', initial_batch_size) logger.record_tabular('AvgEpLen', np.mean(lens)) logger.dump_tabular() #Update pol.set_params(newpol.eval_params()) if complete: actor_params, rets, disc_rets, lens = [], [], [], []
def learn(env, policy_fn, *, timesteps_per_actorbatch, # timesteps per actor per update clip_param, entcoeff, # clipping parameter epsilon, entropy coeff optim_epochs, optim_stepsize, optim_batchsize,# optimization hypers gamma, lam, # advantage estimation max_timesteps=0, max_episodes=0, max_iters=0, max_seconds=0, # time constraint callback=None, # you can do anything in the callback, since it takes locals(), globals() adam_epsilon=1e-5, schedule='constant' # annealing for stepsize parameters (epsilon and adam) ): # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space pi = policy_fn("pi", ob_space, ac_space) # Construct network for new policy oldpi = policy_fn("oldpi", ob_space, ac_space) # Network for old policy atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return lrmult = tf.placeholder(name='lrmult', dtype=tf.float32, shape=[]) # learning rate multiplier, updated with schedule clip_param = clip_param * lrmult # Annealed cliping parameter epislon ob = U.get_placeholder_cached(name="ob") ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) pol_entpen = (-entcoeff) * meanent ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # pnew / pold surr1 = ratio * atarg # surrogate from conservative policy iteration surr2 = tf.clip_by_value(ratio, 1.0 - clip_param, 1.0 + clip_param) * atarg # pol_surr = - tf.reduce_mean(tf.minimum(surr1, surr2)) # PPO's pessimistic surrogate (L^CLIP) vf_loss = tf.reduce_mean(tf.square(pi.vpred - ret)) total_loss = pol_surr + pol_entpen + vf_loss losses = [pol_surr, pol_entpen, vf_loss, meankl, meanent] loss_names = ["pol_surr", "pol_entpen", "vf_loss", "kl", "ent"] var_list = pi.get_trainable_variables() lossandgrad = U.function([ob, ac, atarg, ret, lrmult], losses + [U.flatgrad(total_loss, var_list)]) adam = MpiAdam(var_list, epsilon=adam_epsilon) assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())]) compute_losses = U.function([ob, ac, atarg, ret, lrmult], losses) U.initialize() adam.sync() # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_actorbatch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer = deque(maxlen=100) # rolling buffer for episode rewards assert sum([max_iters>0, max_timesteps>0, max_episodes>0, max_seconds>0])==1, "Only one time constraint permitted" while True: if callback: callback(locals(), globals()) if max_timesteps and timesteps_so_far >= max_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break elif max_seconds and time.time() - tstart >= max_seconds: break if schedule == 'constant': cur_lrmult = 1.0 elif schedule == 'linear': cur_lrmult = max(1.0 - float(timesteps_so_far) / max_timesteps, 0) else: raise NotImplementedError logger.log("********** Iteration %i ************"%iters_so_far) seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean()) / atarg.std() # standardized advantage function estimate d = Dataset(dict(ob=ob, ac=ac, atarg=atarg, vtarg=tdlamret), shuffle=not pi.recurrent) optim_batchsize = optim_batchsize or ob.shape[0] if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy assign_old_eq_new() # set old parameter values to new parameter values logger.log("Optimizing...") logger.log(fmt_row(13, loss_names)) # Here we do a bunch of optimization epochs over the data for _ in range(optim_epochs): losses = [] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adam.update(g, optim_stepsize * cur_lrmult) losses.append(newlosses) logger.log(fmt_row(13, np.mean(losses, axis=0))) logger.log("Evaluating losses...") losses = [] for batch in d.iterate_once(optim_batchsize): newlosses = compute_losses(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) losses.append(newlosses) meanlosses,_,_ = mpi_moments(losses, axis=0) logger.log(fmt_row(13, meanlosses)) for (lossval, name) in zipsame(meanlosses, loss_names): logger.record_tabular("loss_"+name, lossval) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if MPI.COMM_WORLD.Get_rank()==0: logger.dump_tabular()
def learn(env, q_func, num_actions=4, lr=5e-4, max_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=1, checkpoint_freq=10000, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, num_cpu=16, param_noise=False, param_noise_threshold=0.05, callback=None): """Train a deepq model. Parameters ------- env: pysc2.env.SC2Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer max_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. num_cpu: int number of cpus to use for training callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = U.make_session(num_cpu=num_cpu) sess.__enter__() def make_obs_ph(name): return U.BatchInput((32, 32), name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=num_actions, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, scope="deepq") # # act_y, train_y, update_target_y, debug_y = deepq.build_train( # make_obs_ph=make_obs_ph, # q_func=q_func, # num_actions=num_actions, # optimizer=tf.train.AdamOptimizer(learning_rate=lr), # gamma=gamma, # grad_norm_clipping=10, # scope="deepq_y" # ) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': num_actions, } # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer( buffer_size, alpha=prioritized_replay_alpha) # replay_buffer_y = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = max_timesteps beta_schedule = LinearSchedule( prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) # beta_schedule_y = LinearSchedule(prioritized_replay_beta_iters, # initial_p=prioritized_replay_beta0, # final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) # replay_buffer_y = ReplayBuffer(buffer_size) beta_schedule = None # beta_schedule_y = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule( schedule_timesteps=int(exploration_fraction * max_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() # update_target_y() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() # Select all marines first obs = env.step( actions=[sc2_actions.FunctionCall(_SELECT_ARMY, [_SELECT_ALL])]) player_relative = obs[0].observation["screen"][_PLAYER_RELATIVE] screen = (player_relative == _PLAYER_NEUTRAL).astype(int) #+ path_memory player_y, player_x = (player_relative == _PLAYER_FRIENDLY).nonzero() player = [int(player_x.mean()), int(player_y.mean())] if (player[0] > 16): screen = shift(LEFT, player[0] - 16, screen) elif (player[0] < 16): screen = shift(RIGHT, 16 - player[0], screen) if (player[1] > 16): screen = shift(UP, player[1] - 16, screen) elif (player[1] < 16): screen = shift(DOWN, 16 - player[1], screen) reset = True with tempfile.TemporaryDirectory() as td: model_saved = False model_file = os.path.join("model/", "mineral_shards") print(model_file) for t in range(max_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. if param_noise_threshold >= 0.: update_param_noise_threshold = param_noise_threshold else: # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log( 1. - exploration.value(t) + exploration.value(t) / float(num_actions)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act( np.array(screen)[None], update_eps=update_eps, **kwargs)[0] # action_y = act_y(np.array(screen)[None], update_eps=update_eps, **kwargs)[0] reset = False coord = [player[0], player[1]] rew = 0 if (action == 0): #UP if (player[1] >= 8): coord = [player[0], player[1] - 8] #path_memory_[player[1] - 16 : player[1], player[0]] = -1 elif (player[1] > 0): coord = [player[0], 0] #path_memory_[0 : player[1], player[0]] = -1 #else: # rew -= 1 elif (action == 1): #DOWN if (player[1] <= 23): coord = [player[0], player[1] + 8] #path_memory_[player[1] : player[1] + 16, player[0]] = -1 elif (player[1] > 23): coord = [player[0], 31] #path_memory_[player[1] : 63, player[0]] = -1 #else: # rew -= 1 elif (action == 2): #LEFT if (player[0] >= 8): coord = [player[0] - 8, player[1]] #path_memory_[player[1], player[0] - 16 : player[0]] = -1 elif (player[0] < 8): coord = [0, player[1]] #path_memory_[player[1], 0 : player[0]] = -1 #else: # rew -= 1 elif (action == 3): #RIGHT if (player[0] <= 23): coord = [player[0] + 8, player[1]] #path_memory_[player[1], player[0] : player[0] + 16] = -1 elif (player[0] > 23): coord = [31, player[1]] #path_memory_[player[1], player[0] : 63] = -1 if _MOVE_SCREEN not in obs[0].observation["available_actions"]: obs = env.step(actions=[ sc2_actions.FunctionCall(_SELECT_ARMY, [_SELECT_ALL]) ]) new_action = [ sc2_actions.FunctionCall(_MOVE_SCREEN, [_NOT_QUEUED, coord]) ] # else: # new_action = [sc2_actions.FunctionCall(_NO_OP, [])] obs = env.step(actions=new_action) player_relative = obs[0].observation["screen"][_PLAYER_RELATIVE] new_screen = (player_relative == _PLAYER_NEUTRAL).astype( int) #+ path_memory player_y, player_x = ( player_relative == _PLAYER_FRIENDLY).nonzero() player = [int(player_x.mean()), int(player_y.mean())] if (player[0] > 16): new_screen = shift(LEFT, player[0] - 16, new_screen) elif (player[0] < 16): new_screen = shift(RIGHT, 16 - player[0], new_screen) if (player[1] > 16): new_screen = shift(UP, player[1] - 16, new_screen) elif (player[1] < 16): new_screen = shift(DOWN, 16 - player[1], new_screen) rew = obs[0].reward done = obs[0].step_type == environment.StepType.LAST # Store transition in the replay buffer. replay_buffer.add(screen, action, rew, new_screen, float(done)) # replay_buffer_y.add(screen, action_y, rew, new_screen, float(done)) screen = new_screen episode_rewards[-1] += rew reward = episode_rewards[-1] if done: obs = env.reset() player_relative = obs[0].observation["screen"][ _PLAYER_RELATIVE] screen = (player_relative == _PLAYER_NEUTRAL).astype( int) #+ path_memory player_y, player_x = ( player_relative == _PLAYER_FRIENDLY).nonzero() player = [int(player_x.mean()), int(player_y.mean())] # Select all marines first env.step(actions=[ sc2_actions.FunctionCall(_SELECT_ARMY, [_SELECT_ALL]) ]) episode_rewards.append(0.0) #episode_minerals.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience # experience_y = replay_buffer.sample(batch_size, beta=beta_schedule.value(t)) # (obses_t_y, actions_y, rewards_y, obses_tp1_y, dones_y, weights_y, batch_idxes_y) = experience_y else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None # obses_t_y, actions_y, rewards_y, obses_tp1_y, dones_y = replay_buffer_y.sample(batch_size) # weights_y, batch_idxes_y = np.ones_like(rewards_y), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) # td_errors_y = train_x(obses_t_y, actions_y, rewards_y, obses_tp1_y, dones_y, weights_y) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps # new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) # replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() # update_target_y() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len( episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("reward", reward) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}". format(saved_mean_reward, mean_100ep_reward)) U.save_state(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) U.load_state(model_file) return ActWrapper(act)
def train(num_timesteps, iters): from baselines.ppo1 import mlp_policy U.make_session(num_cpu=1).__enter__() def policy_fn(name, ob_space, ac_space): return mlp_policy.MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space, hid_size=64, num_hid_layers=2) env0 = TestEnv() # env0 = ImageEnv() model_0 = learn( env0, policy_fn, "pi0", max_timesteps=num_timesteps, timesteps_per_batch=1000, clip_param=0.2, entcoeff=0.0, optim_epochs=10, optim_stepsize=3e-4, optim_batchsize=64, gamma=0.99, lam=0.95, schedule='linear', ) env0.close() env1 = TestEnv1() # env1 = ImageEnv1() model_1 = learn( env1, policy_fn, "pi1", max_timesteps=num_timesteps, timesteps_per_batch=1000, clip_param=0.2, entcoeff=0.0, optim_epochs=10, optim_stepsize=3e-4, optim_batchsize=64, gamma=0.99, lam=0.95, schedule='linear', ) env1.close() env2 = TestEnv2() # env2 = ImageEnv2() model_2 = learn( env2, policy_fn, "pi2", max_timesteps=num_timesteps, timesteps_per_batch=1000, clip_param=0.2, entcoeff=0.0, optim_epochs=10, optim_stepsize=3e-4, optim_batchsize=64, gamma=0.99, lam=0.95, schedule='linear', ) env2.close() ob_space = env0.observation_space ac_space = env0.action_space pi = policy_fn("model_d", ob_space, ac_space) # Construct network for new policy atarg = tf.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) lrmult = tf.placeholder(name='lrmult', dtype=tf.float32, shape=[]) ob = U.get_placeholder_cached(name="ob") ac = pi.pdtype.sample_placeholder([None]) kl = pi.pd.kl(model_0.pd) + pi.pd.kl(model_1.pd) + pi.pd.kl(model_2.pd) ent = model_0.pd.entropy() + model_1.pd.entropy() + model_2.pd.entropy() meankl = U.mean(kl) meanent = U.mean(ent) loss = -meankl # - U.mean(tf.exp(model_0.pd.logp(ac)) * atarg) - U.mean(tf.exp(model_1.pd.logp(ac)) * atarg) - U.mean(tf.exp(model_2.pd.logp(ac)) * atarg) var_list = pi.get_trainable_variables() lossandgrad = U.function([ob, ac, atarg, ret, lrmult], loss + [U.flatgrad(loss, var_list)]) adam = MpiAdam(var_list, epsilon=1e-5) compute_losses = U.function([ob, ac, atarg, ret, lrmult], loss) U.initialize() adam.sync() seg_gen0 = traj_segment_generator(model_0, env0, 1000, stochastic=True) seg_gen1 = traj_segment_generator(model_1, env1, 1000, stochastic=True) seg_gen2 = traj_segment_generator(model_2, env2, 1000, stochastic=True) seg_gend0 = traj_segment_generator(pi, env0, 1000, stochastic=True) seg_gend1 = traj_segment_generator(pi, env1, 1000, stochastic=True) seg_gend2 = traj_segment_generator(pi, env2, 1000, stochastic=True) lenbuffer0 = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer0 = deque(maxlen=100) lenbuffer1 = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer1 = deque(maxlen=100) lenbuffer2 = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer2 = deque(maxlen=100) rew0 = [] rew1 = [] rew2 = [] # env2.close() # return model_0, model_1, model_2 for i in range(iters): logger.log("********** Iteration %i ************" % i) cur_lrmult = 1.0 seg0 = seg_gen0.__next__() add_vtarg_and_adv(seg0, 0.99, 0.95) ob, ac, atarg, tdlamret = seg0["ob"], seg0["ac"], seg0["adv"], seg0[ "tdlamret"] vpredbefore = seg0["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean() ) / atarg.std() # standardized advantage function estimate d = Dataset(dict(ob=ob, ac=ac, atarg=atarg, vtarg=tdlamret)) optim_batchsize = ob.shape[0] for _ in range(10): # losses = [] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adam.update(g, 3e-4 * cur_lrmult) seg1 = seg_gen1.__next__() add_vtarg_and_adv(seg1, 0.99, 0.95) ob, ac, atarg, tdlamret = seg1["ob"], seg1["ac"], seg1["adv"], seg1[ "tdlamret"] vpredbefore = seg1["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean() ) / atarg.std() # standardized advantage function estimate d = Dataset(dict(ob=ob, ac=ac, atarg=atarg, vtarg=tdlamret)) optim_batchsize = ob.shape[0] for _ in range(10): # losses = [] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adam.update(g, 3e-4 * cur_lrmult) seg2 = seg_gen2.__next__() add_vtarg_and_adv(seg2, 0.99, 0.95) ob, ac, atarg, tdlamret = seg2["ob"], seg2["ac"], seg2["adv"], seg2[ "tdlamret"] vpredbefore = seg2["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean() ) / atarg.std() # standardized advantage function estimate d = Dataset(dict(ob=ob, ac=ac, atarg=atarg, vtarg=tdlamret)) optim_batchsize = ob.shape[0] for _ in range(10): # losses = [] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adam.update(g, 3e-4 * cur_lrmult) segd0 = seg_gend0.__next__() segd1 = seg_gend1.__next__() segd2 = seg_gend2.__next__() lrlocal0 = (segd0["ep_lens"], segd0["ep_rets"]) # local values listoflrpairs0 = MPI.COMM_WORLD.allgather(lrlocal0) # list of tuples lens0, rews0 = map(flatten_lists, zip(*listoflrpairs0)) lenbuffer0.extend(lens0) rewbuffer0.extend(rews0) mean_rew0 = np.mean(rewbuffer0) logger.record_tabular("Env0EpLenMean", np.mean(lenbuffer0)) logger.record_tabular("Env0EpRewMean", mean_rew0) rew0.append(mean_rew0) lrlocal1 = (segd1["ep_lens"], segd1["ep_rets"]) # local values listoflrpairs1 = MPI.COMM_WORLD.allgather(lrlocal1) # list of tuples lens1, rews1 = map(flatten_lists, zip(*listoflrpairs1)) lenbuffer1.extend(lens1) rewbuffer1.extend(rews1) mean_rew1 = np.mean(rewbuffer1) logger.record_tabular("Env1EpLenMean", np.mean(lenbuffer1)) logger.record_tabular("Env1EpRewMean", mean_rew1) rew1.append(mean_rew1) lrlocal2 = (segd2["ep_lens"], segd2["ep_rets"]) # local values listoflrpairs2 = MPI.COMM_WORLD.allgather(lrlocal2) # list of tuples lens2, rews2 = map(flatten_lists, zip(*listoflrpairs2)) lenbuffer2.extend(lens2) rewbuffer2.extend(rews2) mean_rew2 = np.mean(rewbuffer2) logger.record_tabular("Env2EpLenMean", np.mean(lenbuffer2)) logger.record_tabular("Env2EpRewMean", mean_rew2) rew2.append(mean_rew2) if MPI.COMM_WORLD.Get_rank() == 0: logger.dump_tabular() return model_0, model_1, model_2, pi, np.array(rew0), np.array( rew1), np.array(rew2)
def learn( env, policy_func, *, timesteps_per_batch, # timesteps per actor per update clip_param, entcoeff, # clipping parameter epsilon, entropy coeff optim_epochs, optim_stepsize, optim_batchsize, # optimization hypers gamma, lam, # advantage estimation max_timesteps=0, max_episodes=0, max_iters=0, max_seconds=0, # time constraint callback=None, # you can do anything in the callback, since it takes locals(), globals() adam_epsilon=1e-5, schedule='constant', # annealing for stepsize parameters (epsilon and adam) num_options=1, app='', saves=False, wsaves=False, epoch=-1, seed=1, dc=0): optim_batchsize_ideal = optim_batchsize np.random.seed(seed) tf.set_random_seed(seed) env._seed(seed) ### Book-keeping gamename = env.spec.id[:-3].lower() gamename += 'seed' + str(seed) gamename += app dirname = '{}_{}opts_saves/'.format(gamename, num_options) if wsaves: first = True if not os.path.exists(dirname): os.makedirs(dirname) first = False # while os.path.exists(dirname) and first: # dirname += '0' files = ['pposgd_simple.py', 'mlp_policy.py', 'run_mujoco.py'] for i in range(len(files)): src = os.path.expanduser('~/baselines/baselines/ppo1/') + files[i] dest = os.path.expanduser('~/baselines/baselines/ppo1/') + dirname shutil.copy2(src, dest) ### # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space pi = policy_func("pi", ob_space, ac_space) # Construct network for new policy oldpi = policy_func("oldpi", ob_space, ac_space) # Network for old policy atarg = tf.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return # option = tf.placeholder(dtype=tf.int32, shape=[None]) lrmult = tf.placeholder( name='lrmult', dtype=tf.float32, shape=[]) # learning rate multiplier, updated with schedule clip_param = clip_param * lrmult # Annealed cliping parameter epislon # pdb.set_trace() ob = U.get_placeholder_cached(name="ob") option = U.get_placeholder_cached(name="option") term_adv = U.get_placeholder(name='term_adv', dtype=tf.float32, shape=[None]) ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = U.mean(kloldnew) meanent = U.mean(ent) pol_entpen = (-entcoeff) * meanent ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # pnew / pold surr1 = ratio * atarg # surrogate from conservative policy iteration surr2 = U.clip(ratio, 1.0 - clip_param, 1.0 + clip_param) * atarg # pol_surr = -U.mean(tf.minimum( surr1, surr2)) # PPO's pessimistic surrogate (L^CLIP) vf_loss = U.mean(tf.square(pi.vpred - ret)) total_loss = pol_surr + pol_entpen + vf_loss losses = [pol_surr, pol_entpen, vf_loss, meankl, meanent] loss_names = ["pol_surr", "pol_entpen", "vf_loss", "kl", "ent"] term_loss = pi.tpred * term_adv log_pi = tf.log(tf.clip_by_value(pi.op_pi, 1e-20, 1.0)) entropy = -tf.reduce_sum(pi.op_pi * log_pi, reduction_indices=1) op_loss = -tf.reduce_sum(log_pi[0][option[0]] * atarg + entropy * 0.1) total_loss += op_loss var_list = pi.get_trainable_variables() term_list = var_list[6:8] lossandgrad = U.function([ob, ac, atarg, ret, lrmult, option, term_adv], losses + [U.flatgrad(total_loss, var_list)]) termloss = U.function([ob, option, term_adv], [U.flatgrad(term_loss, var_list) ]) # Since we will use a different step size. adam = MpiAdam(var_list, epsilon=adam_epsilon) assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables()) ]) compute_losses = U.function([ob, ac, atarg, ret, lrmult, option], losses) U.initialize() adam.sync() saver = tf.train.Saver(max_to_keep=10000) ### More book-kepping results = [] if saves: results = open( gamename + '_' + str(num_options) + 'opts_' + '_results.csv', 'w') out = 'epoch,avg_reward' for opt in range(num_options): out += ',option {} dur'.format(opt) for opt in range(num_options): out += ',option {} std'.format(opt) for opt in range(num_options): out += ',option {} term'.format(opt) for opt in range(num_options): out += ',option {} adv'.format(opt) out += '\n' results.write(out) # results.write('epoch,avg_reward,option 1 dur, option 2 dur, option 1 term, option 2 term\n') results.flush() if epoch >= 0: dirname = '{}_{}opts_saves/'.format(gamename, num_options) print("Loading weights from iteration: " + str(epoch)) filename = dirname + '{}_epoch_{}.ckpt'.format(gamename, epoch) saver.restore(U.get_session(), filename) ### episodes_so_far = 0 timesteps_so_far = 0 global iters_so_far iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer = deque(maxlen=100) # rolling buffer for episode rewards assert sum( [max_iters > 0, max_timesteps > 0, max_episodes > 0, max_seconds > 0]) == 1, "Only one time constraint permitted" # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True, num_options=num_options, saves=saves, results=results, rewbuffer=rewbuffer, dc=dc) datas = [0 for _ in range(num_options)] while True: if callback: callback(locals(), globals()) if max_timesteps and timesteps_so_far >= max_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break elif max_seconds and time.time() - tstart >= max_seconds: break if schedule == 'constant': cur_lrmult = 1.0 elif schedule == 'linear': cur_lrmult = max(1.0 - float(timesteps_so_far) / max_timesteps, 0) else: raise NotImplementedError logger.log("********** Iteration %i ************" % iters_so_far) seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) opt_d = [] for i in range(num_options): dur = np.mean( seg['opt_dur'][i]) if len(seg['opt_dur'][i]) > 0 else 0. opt_d.append(dur) std = [] for i in range(num_options): logstd = np.mean( seg['logstds'][i]) if len(seg['logstds'][i]) > 0 else 0. std.append(np.exp(logstd)) print("mean opt dur:", opt_d) print("mean op pol:", np.mean(np.array(seg['optpol_p']), axis=0)) print("mean term p:", np.mean(np.array(seg['term_p']), axis=0)) print("mean value val:", np.mean(np.array(seg['value_val']), axis=0)) ob, ac, opts, atarg, tdlamret = seg["ob"], seg["ac"], seg["opts"], seg[ "adv"], seg["tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean() ) / atarg.std() # standardized advantage function estimate if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy assign_old_eq_new() # set old parameter values to new parameter values if iters_so_far % 5 == 0 and wsaves: print("weights are saved...") filename = dirname + '{}_epoch_{}.ckpt'.format( gamename, iters_so_far) save_path = saver.save(U.get_session(), filename) min_batch = 160 # Arbitrary t_advs = [[] for _ in range(num_options)] for opt in range(num_options): indices = np.where(opts == opt)[0] print("batch size:", indices.size) opt_d[opt] = indices.size if not indices.size: t_advs[opt].append(0.) continue ### This part is only necessasry when we use options. We proceed to these verifications in order not to discard any collected trajectories. if datas[opt] != 0: if (indices.size < min_batch and datas[opt].n > min_batch): datas[opt] = Dataset(dict(ob=ob[indices], ac=ac[indices], atarg=atarg[indices], vtarg=tdlamret[indices]), shuffle=not pi.recurrent) t_advs[opt].append(0.) continue elif indices.size + datas[opt].n < min_batch: # pdb.set_trace() oldmap = datas[opt].data_map cat_ob = np.concatenate((oldmap['ob'], ob[indices])) cat_ac = np.concatenate((oldmap['ac'], ac[indices])) cat_atarg = np.concatenate( (oldmap['atarg'], atarg[indices])) cat_vtarg = np.concatenate( (oldmap['vtarg'], tdlamret[indices])) datas[opt] = Dataset(dict(ob=cat_ob, ac=cat_ac, atarg=cat_atarg, vtarg=cat_vtarg), shuffle=not pi.recurrent) t_advs[opt].append(0.) continue elif (indices.size + datas[opt].n > min_batch and datas[opt].n < min_batch) or (indices.size > min_batch and datas[opt].n < min_batch): oldmap = datas[opt].data_map cat_ob = np.concatenate((oldmap['ob'], ob[indices])) cat_ac = np.concatenate((oldmap['ac'], ac[indices])) cat_atarg = np.concatenate( (oldmap['atarg'], atarg[indices])) cat_vtarg = np.concatenate( (oldmap['vtarg'], tdlamret[indices])) datas[opt] = d = Dataset(dict(ob=cat_ob, ac=cat_ac, atarg=cat_atarg, vtarg=cat_vtarg), shuffle=not pi.recurrent) if (indices.size > min_batch and datas[opt].n > min_batch): datas[opt] = d = Dataset(dict(ob=ob[indices], ac=ac[indices], atarg=atarg[indices], vtarg=tdlamret[indices]), shuffle=not pi.recurrent) elif datas[opt] == 0: datas[opt] = d = Dataset(dict(ob=ob[indices], ac=ac[indices], atarg=atarg[indices], vtarg=tdlamret[indices]), shuffle=not pi.recurrent) ### optim_batchsize = optim_batchsize or ob.shape[0] optim_epochs = np.clip( np.int(10 * (indices.size / (timesteps_per_batch / num_options))), 10, 10) if num_options > 1 else optim_epochs print("optim epochs:", optim_epochs) logger.log("Optimizing...") # Here we do a bunch of optimization epochs over the data for _ in range(optim_epochs): losses = [ ] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): tadv, nodc_adv = pi.get_term_adv(batch["ob"], [opt]) tadv = tadv if num_options > 1 else np.zeros_like(tadv) t_advs[opt].append(nodc_adv) *newlosses, grads = lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult, [opt], tadv) termg = termloss(batch["ob"], [opt], tadv) adam.update(termg[0], 5e-7 * cur_lrmult) adam.update(grads, optim_stepsize * cur_lrmult) losses.append(newlosses) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if MPI.COMM_WORLD.Get_rank() == 0: logger.dump_tabular() ### Book keeping if saves: out = "{},{}" for _ in range(num_options): out += ",{},{},{},{}" out += "\n" info = [iters_so_far, np.mean(rewbuffer)] for i in range(num_options): info.append(opt_d[i]) for i in range(num_options): info.append(std[i]) for i in range(num_options): info.append(np.mean(np.array(seg['term_p']), axis=0)[i]) for i in range(num_options): info.append(np.mean(t_advs[i])) results.write(out.format(*info)) results.flush()
def logger_parameter(self): #logger.log("\npendulum_pm (Bayesian Linear Regression)") logger.log("\npendulum_pm_another (Bayesian Linear Regression using Laplace Approximation)") # add logger.log("thdot_clip_value =",self.thdot_clip_value) logger.log("alpha3 =",alpha3) logger.log("dataX.shape =",self.datasize) logger.log("precision of weight =",self.prec_weight) logger.log("post_mean =",self.post_mean) logger.log("post_var =",self.post_var) logger.log("noise_var1 =",self.noise_var1) logger.log("noise_var2 =",self.noise_var2) logger.log("log_evidence =",self.log_evidence()) logger.log("init_state_mean =",self.init_state_mean) logger.log("parameter_sampling_flag =",parameter_sampling_flag)
def learn( env, policy_func, *, timesteps_per_actorbatch, # timesteps per actor per update clip_param, entcoeff, # clipping parameter epsilon, entropy coeff optim_epochs, optim_stepsize, optim_batchsize, # optimization hypers gamma, lam, # advantage estimation max_timesteps=0, max_episodes=0, max_iters=0, max_seconds=0, # time constraint callback=None, # you can do anything in the callback, since it takes locals(), globals() adam_epsilon=1e-5, schedule='constant' # annealing for stepsize parameters (epsilon and adam) ): # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space pi = policy_func("pi", ob_space, ac_space) # Construct network for new policy oldpi = policy_func("oldpi", ob_space, ac_space) # Network for old policy atarg = tf.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return lrmult = tf.placeholder( name='lrmult', dtype=tf.float32, shape=[]) # learning rate multiplier, updated with schedule clip_param = clip_param * lrmult # Annealed cliping parameter epislon ob = U.get_placeholder_cached(name="ob") ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = U.mean(kloldnew) meanent = U.mean(ent) pol_entpen = (-entcoeff) * meanent #ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # pnew / pold #surr1 = ratio * atarg # surrogate from conservative policy iteration #surr2 = U.clip(ratio, 1.0 - clip_param, 1.0 + clip_param) * atarg # #pol_surr = - U.mean(tf.minimum(surr1, surr2)) # PPO's pessimistic surrogate (L^CLIP) (Removed) pol_surr = -U.mean(tf.exp(pi.pd.logp(ac)) * atarg) vf_loss = U.mean(tf.square(pi.vpred - ret)) total_loss = pol_surr + pol_entpen + vf_loss losses = [pol_surr, pol_entpen, vf_loss, meankl, meanent] loss_names = ["pol_surr", "pol_entpen", "vf_loss", "kl", "ent"] var_list = pi.get_trainable_variables() lossandgrad = U.function([ob, ac, atarg, ret, lrmult], losses + [U.flatgrad(total_loss, var_list)]) adam = MpiAdam(var_list, epsilon=adam_epsilon) assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables()) ]) compute_losses = U.function([ob, ac, atarg, ret, lrmult], losses) U.initialize() adam.sync() # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_actorbatch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer = deque(maxlen=100) # rolling buffer for episode rewards assert sum( [max_iters > 0, max_timesteps > 0, max_episodes > 0, max_seconds > 0]) == 1, "Only one time constraint permitted" while True: if callback: callback(locals(), globals()) if max_timesteps and timesteps_so_far >= max_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break elif max_seconds and time.time() - tstart >= max_seconds: break if schedule == 'constant': cur_lrmult = 1.0 elif schedule == 'linear': cur_lrmult = max(1.0 - float(timesteps_so_far) / max_timesteps, 0) else: raise NotImplementedError logger.log("********** Iteration %i ************" % iters_so_far) seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg[ "tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean() ) / atarg.std() # standardized advantage function estimate d = Dataset(dict(ob=ob, ac=ac, atarg=atarg, vtarg=tdlamret), shuffle=not pi.recurrent) optim_batchsize = optim_batchsize or ob.shape[0] if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy assign_old_eq_new() # set old parameter values to new parameter values logger.log("Optimizing...") logger.log(fmt_row(13, loss_names)) # Here we do a bunch of optimization epochs over the data for _ in range(optim_epochs): losses = [ ] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adam.update(g, optim_stepsize * cur_lrmult) losses.append(newlosses) logger.log(fmt_row(13, np.mean(losses, axis=0))) logger.log("Evaluating losses...") losses = [] for batch in d.iterate_once(optim_batchsize): newlosses = compute_losses(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) losses.append(newlosses) meanlosses, _, _ = mpi_moments(losses, axis=0) logger.log(fmt_row(13, meanlosses)) for (lossval, name) in zipsame(meanlosses, loss_names): logger.record_tabular("loss_" + name, lossval) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if MPI.COMM_WORLD.Get_rank() == 0: logger.dump_tabular()
def learn( base_env, policy_fn, *, max_fitness, # has to be negative, as cmaes consider minization popsize, gensize, bounds, sigma, eval_iters, timesteps_per_actorbatch, max_timesteps=0, max_episodes=0, max_iters=0, max_seconds=0, seed=0): # Setup losses and stuff # ---------------------------------------- ob_space = base_env.observation_space ac_space = base_env.action_space pi = policy_fn("pi", ob_space, ac_space) # Construct network for new policy backup_pi = policy_fn( "backup_pi", ob_space, ac_space ) # Construct a network for every individual to adapt during the es evolution var_list = pi.get_trainable_variables() layer_var_list = [] for i in range(pi.num_hid_layers): layer_var_list.append([ v for v in var_list if v.name.split("/")[2].startswith('fc%i' % (i + 1)) ]) logstd_var_list = [ v for v in var_list if v.name.split("/")[2].startswith("logstd") ] if len(logstd_var_list) != 0: layer_var_list.append( [v for v in var_list if v.name.split("/")[2].startswith("final")] + logstd_var_list) U.initialize() layer_set_operate_list = [] layer_get_operate_list = [] for var in layer_var_list: layer_set_operate_list.append(U.SetFromFlat(var)) layer_get_operate_list.append(U.GetFlat(var)) global timesteps_so_far, episodes_so_far, iters_so_far, \ tstart, lenbuffer, rewbuffer, best_fitness episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer = deque(maxlen=100) # rolling buffer for episode rewards assign_backup_eq_new = U.function( [], [], updates=[ tf.assign(backup_v, newv) for ( backup_v, newv) in zipsame(backup_pi.get_variables(), pi.get_variables()) ]) assign_new_eq_backup = U.function( [], [], updates=[ tf.assign(newv, backup_v) for (newv, backup_v ) in zipsame(pi.get_variables(), backup_pi.get_variables()) ]) assert sum( [max_iters > 0, max_timesteps > 0, max_episodes > 0, max_seconds > 0]) == 1, "Only one time constraint permitted" # Build generator for all solutions seg_gen = traj_segment_generator_eval(backup_pi, base_env, timesteps_per_actorbatch, stochastic=True) actors = [] for i in range(popsize): newActor = traj_segment_generator(pi, base_env, timesteps_per_actorbatch, stochastic=True, eval_iters=eval_iters, seg_gen=seg_gen) actors.append(newActor) best_fitness = -np.inf opt = cma.CMAOptions() opt['tolfun'] = max_fitness opt['popsize'] = popsize opt['maxiter'] = gensize opt['verb_disp'] = 0 opt['verb_log'] = 0 # opt['seed'] = seed opt['AdaptSigma'] = True # opt['bounds'] = bounds while True: if max_timesteps and timesteps_so_far >= max_timesteps: logger.log("Max time steps") break elif max_episodes and episodes_so_far >= max_episodes: logger.log("Max episodes") break elif max_iters and iters_so_far >= max_iters: logger.log("Max iterations") break elif max_seconds and time.time() - tstart >= max_seconds: logger.log("Max time") break # Linearly decay the exploration sigma_adapted = max(sigma - float(timesteps_so_far) / max_timesteps, 0) logger.log("********** Iteration %i ************" % iters_so_far) eval_seg = seg_gen.__next__() rewbuffer.extend(eval_seg["ep_rets"]) lenbuffer.extend(eval_seg["ep_lens"]) if iters_so_far == 0: result_record() for i in range(len(layer_var_list)): assign_backup_eq_new() # backup current policy logger.log("Current Layer:" + str(layer_var_list[i])) flatten_weights = layer_get_operate_list[i]() es = cma.CMAEvolutionStrategy(flatten_weights, sigma, opt) costs = None best_solution = None die_out_count = 0 while True: if es.countiter >= gensize: logger.log("Max generations for current layer") break solutions = es.ask() ob_segs = None segs = [] costs = [] lens = [] for id, solution in enumerate(solutions): layer_set_operate_list[i](solution) seg = actors[id].__next__() costs.append(-np.mean(seg["ep_rets"])) lens.append(np.sum(seg["ep_lens"])) segs.append(seg) if ob_segs is None: ob_segs = {'ob': np.copy(seg['ob'])} else: ob_segs['ob'] = np.append(ob_segs['ob'], seg['ob'], axis=0) assign_new_eq_backup() # Weights decay l2_decay = compute_weight_decay(0.01, solutions) costs += l2_decay costs, real_costs = fitness_normalization(costs) es.tell_real_seg(solutions=solutions, function_values=costs, real_f=real_costs, segs=segs) best_solution = np.copy(es.result[0]) best_fitness = -es.result[1] rewbuffer.extend(es.result[3]["ep_rets"]) lenbuffer.extend(es.result[3]["ep_lens"]) layer_set_operate_list[i](best_solution) logger.log("Update the layer") logger.log("Generation:", es.countiter) logger.log("Best Solution Fitness:", best_fitness) ob = ob_segs["ob"] if hasattr(pi, "ob_rms"): pi.ob_rms.update( ob ) # update running mean/std for observation normalization episodes_so_far += sum(lens) es = None import gc gc.collect() iters_so_far += 1
def learn(env, network, seed=None, lr=5e-4, total_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=100, checkpoint_freq=10000, checkpoint_path=None, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, param_noise=False, callback=None, load_path=None, **network_kwargs): """Train a deepq model. Parameters ------- env: gym.Env environment to train on network: string or a function neural network to use as a q function approximator. If string, has to be one of the names of registered models in baselines.common.models (mlp, cnn, conv_only). If a function, should take an observation tensor and return a latent variable tensor, which will be mapped to the Q function heads (see build_q_func in baselines.deepq.models for details on that) seed: int or None prng seed. The runs with the same seed "should" give the same results. If None, no seeding is used. lr: float learning rate for adam optimizer total_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to total_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. param_noise: bool whether or not to use parameter space noise (https://arxiv.org/abs/1706.01905) callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. load_path: str path to load the model from. (default: None) **network_kwargs additional keyword arguments to pass to the network builder. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = get_session() set_global_seeds(seed) q_func = build_q_func(network, **network_kwargs) # capture the shape outside the closure so that the env object is not serialized # by cloudpickle when serializing make_obs_ph observation_space = env.observation_space def make_obs_ph(name): return ObservationInput(observation_space, name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, param_noise=param_noise) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } act = ActWrapper(act, act_params) # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = total_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * total_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize Checkpoint buffer current_episode_memory = deque([], maxlen=10000) current_episode_full_state = deque([], maxlen=10000) # proportion_lag = .3 assert 0 < proportion_lag < 1 #min_trajectory_len = 2 * int(1./args.proportion_lag) checkpoint_buffer = [] # def compute_score(): transition_scores = [tupl[2] for tupl in current_episode_memory] # Max-sort transition_scores.sort(reverse=True) keep = int(len(transition_scores) * .10) return np.mean(transition_scores[:keep]) bench_used = False # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() reset = True with tempfile.TemporaryDirectory() as td: td = checkpoint_path or td model_file = os.path.join(td, "model") model_saved = False if tf.train.latest_checkpoint(td) is not None: load_variables(model_file) logger.log('Loaded model from {}'.format(model_file)) model_saved = True elif load_path is not None: load_variables(load_path) logger.log('Loaded model from {}'.format(load_path)) for t in range(total_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log(1. - exploration.value( t) + exploration.value(t) / float(env.action_space.n)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act(np.array(obs)[None], update_eps=update_eps, **kwargs)[0] env_action = action reset = False old_cloned_state = env.env.unwrapped.clone_full_state() new_obs, rew, done, _ = env.step(env_action) # Store transition in the replay buffer. replay_buffer.add(obs, action, rew, new_obs, float(done)) obs = new_obs episode_rewards[-1] += rew current_episode_memory.append((obs, action, rew, new_obs, done)) current_episode_full_state.append(old_cloned_state) if done: checkpt_used = False #if (not benchmark): # state = env.reset() if np.random.random() < exploration.value(t / 2): obs = env.reset() else: #if args.bb_size != len(checkpoint_buffer): if 40 != len(checkpoint_buffer): obs = env.reset() else: checkpt_used = True bench_restore_idx = np.random.randint( len(checkpoint_buffer)) rscore, restore_state, restore_cloned, rcount = checkpoint_buffer[ bench_restore_idx] obs = restore_state env.env.unwrapped.restore_full_state(restore_cloned) #if rcount >= args.bb_freshness: if rcount >= 8: checkpoint_buffer.pop(bench_restore_idx) else: checkpoint_buffer[bench_restore_idx] = ( rscore, restore_state, restore_cloned, rcount + 1) #if len(current_episode_memory) > min_trajectory_len: if len(current_episode_memory) > 12: # Dont use this again #if bench_used and returnn < .1 * mean_returns: # checkpoint_buffer.pop(bench_restore_idx) #idx = int(args.proportion_lag * reverse_scaled_eps(step/2) * len(current_episode_memory)) idx = int(proportion_lag * len(current_episode_memory)) bench_replay = current_episode_memory[idx][0] bench_state = current_episode_full_state[idx] bench_score = compute_score() checkpoint_buffer.append( (bench_score, bench_replay, bench_state, 0)) # Handmade heap :/ #while len(checkpoint_buffer) > args.bb_size: while len(checkpoint_buffer) > 40: min_score = checkpoint_buffer[0][0] mr_index = 0 for i in range(len(checkpoint_buffer)): tupl = checkpoint_buffer[i] if tupl[0] < min_score: min_score = tupl[0] mr_index = i checkpoint_buffer.pop(i) current_episode_memory.clear() current_episode_full_state.clear() episode_rewards.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len( episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}" .format(saved_mean_reward, mean_100ep_reward)) save_variables(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) load_variables(model_file) return act
def learn( env, test_env, policy_func, *, timesteps_per_batch, # timesteps per actor per update clip_param, optim_epochs, optim_stepsize, optim_batchsize, # optimization hypers gamma, lam, # advantage estimation max_timesteps=0, max_episodes=0, max_iters=0, max_seconds=0, # time constraint entcoeff=0.0, vf_coef=0.5, callback=None, # you can do anything in the callback, since it takes locals(), globals() adam_epsilon=1e-5, schedule='constant', # annealing for stepsize parameters (epsilon and adam) save_interval=50, #load_path = "C:\\Users\\Yangang REN\\AppData\\Local\\Temp\\openai-2019-11-21-10-40-10-039590\\checkpoints\\00351" load_path=None): """ :param env: :param test_env: :param policy_func: :param timesteps_per_batch: :param clip_param: :param optim_epochs: :param optim_stepsize: :param optim_batchsize: :param gamma: :param lam: :param max_timesteps: :param max_episodes: :param max_iters: :param max_seconds: :param entcoeff: :param vf_coef: float value function loss coefficient in the optimization objective :param callback: :param adam_epsilon: :param schedule: :param save_interval: :param load_path: :return: """ assert sum( [max_iters > 0, max_timesteps > 0, max_episodes > 0, max_seconds > 0]) == 1, "Only one time constraint permitted" rew_mean = [] # get state and action space ob_space = env.observation_space pro_ac_space = env.action_space adv_ac_space = env.adv_action_space # Construct network for new policy pro_pi = policy_func("pro_pi", ob_space, pro_ac_space) pro_oldpi = policy_func("pro_oldpi", ob_space, pro_ac_space) adv_pi = policy_func("adv_pi", ob_space, adv_ac_space) adv_oldpi = policy_func("adv_oldpi", ob_space, adv_ac_space) pro_atarg = tf.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) adv_atarg = tf.placeholder(dtype=tf.float32, shape=[None]) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return lrmult = tf.placeholder( name='lrmult', dtype=tf.float32, shape=[]) # learning rate multiplier, updated with schedule # Annealed cliping parameter epislon clip_param = clip_param * lrmult ob = U.get_placeholder_cached(name="ob") pro_ac = pro_pi.pdtype.sample_placeholder([None]) adv_ac = adv_pi.pdtype.sample_placeholder([None]) pro_kloldnew = pro_oldpi.pd.kl(pro_pi.pd) # compute kl difference adv_kloldnew = adv_oldpi.pd.kl(adv_pi.pd) pro_ent = pro_pi.pd.entropy() adv_ent = adv_pi.pd.entropy() pro_meankl = tf.reduce_mean(pro_kloldnew) adv_meankl = tf.reduce_mean(adv_kloldnew) pro_meanent = tf.reduce_mean(pro_ent) adv_meanent = tf.reduce_mean(adv_ent) pro_pol_entpen = (-entcoeff) * pro_meanent adv_pol_entpen = (-entcoeff) * adv_meanent pro_ratio = tf.exp(pro_pi.pd.logp(pro_ac) - pro_oldpi.pd.logp(pro_ac)) adv_ratio = tf.exp(adv_pi.pd.logp(adv_ac) - adv_oldpi.pd.logp(adv_ac)) pro_surr1 = pro_ratio * pro_atarg # surrogate from conservative policy iteration adv_surr1 = adv_ratio * adv_atarg pro_surr2 = tf.clip_by_value(pro_ratio, 1.0 - clip_param, 1.0 + clip_param) * pro_atarg adv_surr2 = tf.clip_by_value(adv_ratio, 1.0 - clip_param, 1.0 + clip_param) * adv_atarg # TODO:check this code carefully pro_pol_surr = -tf.reduce_mean(tf.minimum(pro_surr1, pro_surr2)) adv_pol_surr = tf.reduce_mean(tf.minimum(adv_surr1, adv_surr2)) pro_vf_loss = tf.reduce_mean(tf.square(pro_pi.vpred - ret)) adv_vf_loss = tf.reduce_mean(tf.square(adv_pi.vpred - ret)) # FIXME: do not forget cofficient between different loss pro_total_loss = pro_pol_surr + pro_pol_entpen + vf_coef * pro_vf_loss adv_total_loss = adv_pol_surr + adv_pol_entpen + vf_coef * adv_vf_loss pro_losses = [ pro_pol_surr, pro_pol_entpen, pro_vf_loss, pro_meankl, pro_meanent ] pro_loss_names = [ "pro_pol_surr", "pro_pol_entpen", "pro_vf_loss", "pro_kl", "pro_ent" ] adv_losses = [ adv_pol_surr, adv_pol_entpen, adv_vf_loss, adv_meankl, adv_meanent ] adv_loss_names = [ "adv_pol_surr", "adv_pol_entpen", "adv_vf_loss", "adv_kl", "adv_ent" ] pro_var_list = pro_pi.get_trainable_variables() adv_var_list = adv_pi.get_trainable_variables() pro_lossandgrad = U.function([ob, pro_ac, pro_atarg, ret, lrmult], pro_losses + [U.flatgrad(pro_total_loss, pro_var_list)]) adv_lossandgrad = U.function([ob, adv_ac, adv_atarg, ret, lrmult], adv_losses + [U.flatgrad(adv_total_loss, adv_var_list)]) pro_adam = MpiAdam(pro_var_list, epsilon=adam_epsilon) adv_adam = MpiAdam(adv_var_list, epsilon=adam_epsilon) pro_assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame( pro_oldpi.get_variables(), pro_pi.get_variables()) ]) adv_assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame( adv_oldpi.get_variables(), adv_pi.get_variables()) ]) # U.function(inputs, outputs) pro_compute_losses = U.function([ob, pro_ac, pro_atarg, ret, lrmult], pro_losses) adv_compute_losses = U.function([ob, adv_ac, adv_atarg, ret, lrmult], adv_losses) U.initialize() pro_adam.sync() adv_adam.sync() save = functools.partial(save_variables, sess=get_session()) load = functools.partial(load_variables, sess=get_session()) # TODO: load save the path if load_path is not None: load(load_path) print('Loading model and running it…') max_iters = 0 # Prepare for rollouts seg_gen = traj_segment_generator(pro_pi, adv_pi, env, timesteps_per_batch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=100) # rolling buffer for episode lengths rewbuffer = deque(maxlen=100) # rolling buffer for episode rewards # Begin to update the loss function for update in range(1, max_iters + 1): if callback: callback(locals(), globals()) if max_timesteps and timesteps_so_far >= max_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break elif max_seconds and time.time() - tstart >= max_seconds: break # adjusting the learning rate if schedule == 'constant': cur_lrmult = 1.0 elif schedule == 'linear': cur_lrmult = 1.0 - (update - 1.0) / max_iters else: raise NotImplementedError logger.log("********** Iteration %i ************" % (iters_so_far + 1)) seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, pro_ac, adv_ac, pro_atarg, adv_atarg, pro_tdlamret, adv_tdlamret = seg[ "ob"], seg["pro_ac"], seg["adv_ac"], seg["pro_adv"], seg[ "adv_adv"], seg["pro_tdlamret"], seg["adv_tdlamret"] pro_vpredbefore = seg[ "pro_vpred"] # predicted value function before udpate adv_vpredbefore = seg["adv_vpred"] # standardized advantage function estimate pro_atarg = (pro_atarg - pro_atarg.mean()) / (pro_atarg.std() + 1e-8) adv_atarg = (adv_atarg - adv_atarg.mean()) / (adv_atarg.std() + 1e-8) # TODO d = Dataset(dict(ob=ob, ac=pro_ac, atarg=pro_atarg, vtarg=pro_tdlamret), shuffle=not pro_pi.recurrent) optim_batchsize = optim_batchsize or ob.shape[0] if hasattr(pro_pi, "ob_rms"): pro_pi.ob_rms.update(ob) # update running mean/std for policy pro_assign_old_eq_new( ) # set old parameter values to new parameter values # Here we do a bunch of optimization epochs over the data for _ in range(optim_epochs): pro_losses = [ ] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = pro_lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) pro_adam.update(g, optim_stepsize * cur_lrmult) pro_losses.append(newlosses) pro_losses = [] for batch in d.iterate_once(optim_batchsize): newlosses = pro_compute_losses(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) pro_losses.append(newlosses) pro_meanlosses, _, _ = mpi_moments(pro_losses, axis=0) # Training the adversary agent d = Dataset(dict(ob=ob, ac=adv_ac, atarg=adv_atarg, vtarg=adv_tdlamret), shuffle=not adv_pi.recurrent) if hasattr(adv_pi, "ob_rms"): adv_pi.ob_rms.update(ob) adv_assign_old_eq_new() # logger.log(fmt_row(13, adv_loss_names)) for _ in range(optim_epochs): adv_losses = [ ] # list of tuples, each of which gives the loss for a minibatch for batch in d.iterate_once(optim_batchsize): *newlosses, g = adv_lossandgrad(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adv_adam.update(g, optim_stepsize * cur_lrmult) adv_losses.append(newlosses) adv_losses = [] for batch in d.iterate_once(optim_batchsize): newlosses = adv_compute_losses(batch["ob"], batch["ac"], batch["atarg"], batch["vtarg"], cur_lrmult) adv_losses.append(newlosses) adv_meanlosses, _, _ = mpi_moments(adv_losses, axis=0) # print the results logger.logkv("pro_policy_vf", pro_meanlosses[2]) logger.logkv("adv_policy_vf", adv_meanlosses[2]) # test # curr_rew = evaluate(pro_pi, test_env) # rew_mean.append(curr_rew) # print(curr_rew) curr_rew = evaluate(pro_pi, adv_pi, test_env) rew_mean.append(curr_rew) logger.logkv("test reward", curr_rew) # logger.record_tabular("ev_tdlam_before", explained_variance(pro_vpredbefore, pro_tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.logkv('eprewmean', safemean(rewbuffer)) logger.logkv('eplenmean', safemean(lenbuffer)) logger.dumpkvs() if save_interval and (update == 1 or iters_so_far % save_interval == 0) and logger.get_dir(): checkdir = osp.join(logger.get_dir(), 'checkpoints') os.makedirs(checkdir, exist_ok=True) savepath = osp.join(checkdir, '%.5i' % update) print('Saving to…', savepath) save(savepath) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 # return np.array(rew_mean) return pro_pi, adv_pi
def learn(make_env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=False, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None, clipping=False, entropy='none', positive_return=False, reward_clustering='none'): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() # Building the environment env = make_env() ob_space = env.observation_space ac_space = env.action_space # Building the policy pi = make_policy('pi', ob_space, ac_space) oldpi = make_policy('oldpi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split('/')[1].startswith('pol')] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([max_samples], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='mask') rew_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='rew') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='disc_rew') clustered_rew_ = tf.placeholder(dtype=tf.float32, shape=(n_episodes)) gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') iter_number_ = tf.placeholder(dtype=tf.int32, name='iter_number') losses_with_name = [] # Policy densities target_log_pdf = pi.pd.logp(ac_) behavioral_log_pdf = oldpi.pd.logp(ac_) log_ratio = target_log_pdf - behavioral_log_pdf # Split operations disc_rew_split = tf.stack(tf.split(disc_rew_ * mask_, n_episodes)) rew_split = tf.stack(tf.split(rew_ * mask_, n_episodes)) log_ratio_split = tf.stack(tf.split(log_ratio * mask_, n_episodes)) target_log_pdf_split = tf.stack(tf.split(target_log_pdf * mask_, n_episodes)) behavioral_log_pdf_split = tf.stack(tf.split(behavioral_log_pdf * mask_, n_episodes)) mask_split = tf.stack(tf.split(mask_, n_episodes)) # Renyi divergence emp_d2_split = tf.stack(tf.split(pi.pd.renyi(oldpi.pd, 2) * mask_, n_episodes)) emp_d2_cum_split = tf.reduce_sum(emp_d2_split, axis=1) empirical_d2 = tf.reduce_mean(tf.exp(emp_d2_cum_split)) # Return ep_return = clustered_rew_ #tf.reduce_sum(mask_split * disc_rew_split, axis=1) if clipping: rew_split = tf.clip_by_value(rew_split, -1, 1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) rew_split = rew_split - (tf.reduce_sum(rew_split) / (tf.reduce_sum(mask_split) + 1e-24)) discounter = [pow(gamma, i) for i in range(0, horizon)] # Decreasing gamma discounter_tf = tf.constant(discounter) disc_rew_split = rew_split * discounter_tf #tf.add_to_collection('prints', tf.Print(ep_return, [ep_return], 'ep_return_not_clustered', summarize=20)) # Reward clustering ''' rew_clustering_options = reward_clustering.split(':') if reward_clustering == 'none': pass # Do nothing elif rew_clustering_options[0] == 'global': assert len(rew_clustering_options) == 2, "Reward clustering: Provide the correct number of parameters" N = int(rew_clustering_options[1]) tf.add_to_collection('prints', tf.Print(ep_return, [ep_return], 'ep_return', summarize=20)) global_rew_min = tf.Variable(float('+inf'), trainable=False) global_rew_max = tf.Variable(float('-inf'), trainable=False) rew_min = tf.reduce_min(ep_return) rew_max = tf.reduce_max(ep_return) global_rew_min = tf.assign(global_rew_min, tf.minimum(global_rew_min, rew_min)) global_rew_max = tf.assign(global_rew_max, tf.maximum(global_rew_max, rew_max)) interval_size = (global_rew_max - global_rew_min) / N ep_return = tf.floordiv(ep_return, interval_size) * interval_size elif rew_clustering_options[0] == 'batch': assert len(rew_clustering_options) == 2, "Reward clustering: Provide the correct number of parameters" N = int(rew_clustering_options[1]) rew_min = tf.reduce_min(ep_return) rew_max = tf.reduce_max(ep_return) interval_size = (rew_max - rew_min) / N ep_return = tf.floordiv(ep_return, interval_size) * interval_size elif rew_clustering_options[0] == 'manual': assert len(rew_clustering_options) == 4, "Reward clustering: Provide the correct number of parameters" N, rew_min, rew_max = map(int, rew_clustering_options[1:]) print("N:", N) print("Min reward:", rew_min) print("Max reward:", rew_max) interval_size = (rew_max - rew_min) / N print("Interval size:", interval_size) # Clip to avoid overflow and cluster ep_return = tf.clip_by_value(ep_return, rew_min, rew_max) ep_return = tf.cast(tf.floordiv(ep_return, interval_size) * interval_size, tf.float32) tf.add_to_collection('prints', tf.Print(ep_return, [ep_return], 'ep_return_clustered', summarize=20)) else: raise Exception('Unrecognized reward clustering scheme.') ''' return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) return_step_max = tf.reduce_max(tf.abs(rew_split)) # Max step reward return_step_mean = tf.abs(tf.reduce_mean(rew_split)) positive_step_return_max = tf.maximum(0.0, tf.reduce_max(rew_split)) negative_step_return_max = tf.maximum(0.0, tf.reduce_max(-rew_split)) return_step_maxmin = tf.abs(positive_step_return_max - negative_step_return_max) losses_with_name.extend([(return_mean, 'InitialReturnMean'), (return_max, 'InitialReturnMax'), (return_min, 'InitialReturnMin'), (return_std, 'InitialReturnStd'), (empirical_d2, 'EmpiricalD2'), (return_step_max, 'ReturnStepMax'), (return_step_maxmin, 'ReturnStepMaxmin')]) if iw_method == 'pdis': # log_ratio_split cumulative sum log_ratio_cumsum = tf.cumsum(log_ratio_split, axis=1) # Exponentiate ratio_cumsum = tf.exp(log_ratio_cumsum) # Multiply by the step-wise reward (not episode) ratio_reward = ratio_cumsum * disc_rew_split # Average on episodes ratio_reward_per_episode = tf.reduce_sum(ratio_reward, axis=1) w_return_mean = tf.reduce_sum(ratio_reward_per_episode, axis=0) / n_episodes # Get d2(w0:t) with mask d2_w_0t = tf.exp(tf.cumsum(emp_d2_split, axis=1)) * mask_split # LEAVE THIS OUTSIDE # Sum d2(w0:t) over timesteps episode_d2_0t = tf.reduce_sum(d2_w_0t, axis=1) # Sample variance J_sample_variance = (1/(n_episodes-1)) * tf.reduce_sum(tf.square(ratio_reward_per_episode - w_return_mean)) losses_with_name.append((J_sample_variance, 'J_sample_variance')) losses_with_name.extend([(tf.reduce_max(ratio_cumsum), 'MaxIW'), (tf.reduce_min(ratio_cumsum), 'MinIW'), (tf.reduce_mean(ratio_cumsum), 'MeanIW'), (U.reduce_std(ratio_cumsum), 'StdIW')]) losses_with_name.extend([(tf.reduce_max(d2_w_0t), 'MaxD2w0t'), (tf.reduce_min(d2_w_0t), 'MinD2w0t'), (tf.reduce_mean(d2_w_0t), 'MeanD2w0t'), (U.reduce_std(d2_w_0t), 'StdD2w0t')]) elif iw_method == 'is': iw = tf.exp(tf.reduce_sum(log_ratio_split, axis=1)) if iw_norm == 'none': iwn = iw / n_episodes w_return_mean = tf.reduce_sum(iwn * ep_return) J_sample_variance = (1/(n_episodes-1)) * tf.reduce_sum(tf.square(iw * ep_return - w_return_mean)) losses_with_name.append((J_sample_variance, 'J_sample_variance')) elif iw_norm == 'sn': iwn = iw / tf.reduce_sum(iw) w_return_mean = tf.reduce_sum(iwn * ep_return) elif iw_norm == 'regression': iwn = iw / n_episodes mean_iw = tf.reduce_mean(iw) beta = tf.reduce_sum((iw - mean_iw) * ep_return * iw) / (tf.reduce_sum((iw - mean_iw) ** 2) + 1e-24) w_return_mean = tf.reduce_mean(iw * ep_return - beta * (iw - 1)) else: raise NotImplementedError() ess_classic = tf.linalg.norm(iw, 1) ** 2 / tf.linalg.norm(iw, 2) ** 2 sqrt_ess_classic = tf.linalg.norm(iw, 1) / tf.linalg.norm(iw, 2) ess_renyi = n_episodes / empirical_d2 losses_with_name.extend([(tf.reduce_max(iwn), 'MaxIWNorm'), (tf.reduce_min(iwn), 'MinIWNorm'), (tf.reduce_mean(iwn), 'MeanIWNorm'), (U.reduce_std(iwn), 'StdIWNorm'), (tf.reduce_max(iw), 'MaxIW'), (tf.reduce_min(iw), 'MinIW'), (tf.reduce_mean(iw), 'MeanIW'), (U.reduce_std(iw), 'StdIW'), (ess_classic, 'ESSClassic'), (ess_renyi, 'ESSRenyi')]) elif iw_method == 'rbis': # Get pdfs for episodes target_log_pdf_episode = tf.reduce_sum(target_log_pdf_split, axis=1) behavioral_log_pdf_episode = tf.reduce_sum(behavioral_log_pdf_split, axis=1) # Normalize log_proba (avoid as overflows as possible) normalization_factor = tf.reduce_mean(tf.stack([target_log_pdf_episode, behavioral_log_pdf_episode])) target_norm_log_pdf_episode = target_log_pdf_episode - normalization_factor behavioral_norm_log_pdf_episode = behavioral_log_pdf_episode - normalization_factor # Exponentiate target_pdf_episode = tf.clip_by_value(tf.cast(tf.exp(target_norm_log_pdf_episode), tf.float64), 1e-300, 1e+300) behavioral_pdf_episode = tf.clip_by_value(tf.cast(tf.exp(behavioral_norm_log_pdf_episode), tf.float64), 1e-300, 1e+300) tf.add_to_collection('asserts', tf.assert_positive(target_pdf_episode, name='target_pdf_positive')) tf.add_to_collection('asserts', tf.assert_positive(behavioral_pdf_episode, name='behavioral_pdf_positive')) # Compute the merging matrix (reward-clustering) and the number of clusters reward_unique, reward_indexes = tf.unique(ep_return) episode_clustering_matrix = tf.cast(tf.one_hot(reward_indexes, n_episodes), tf.float64) max_index = tf.reduce_max(reward_indexes) + 1 trajectories_per_cluster = tf.reduce_sum(episode_clustering_matrix, axis=0)[:max_index] tf.add_to_collection('asserts', tf.assert_positive(tf.reduce_sum(episode_clustering_matrix, axis=0)[:max_index], name='clustering_matrix')) # Get the clustered pdfs clustered_target_pdf = tf.matmul(tf.reshape(target_pdf_episode, (1, -1)), episode_clustering_matrix)[0][:max_index] clustered_behavioral_pdf = tf.matmul(tf.reshape(behavioral_pdf_episode, (1, -1)), episode_clustering_matrix)[0][:max_index] tf.add_to_collection('asserts', tf.assert_positive(clustered_target_pdf, name='clust_target_pdf_positive')) tf.add_to_collection('asserts', tf.assert_positive(clustered_behavioral_pdf, name='clust_behavioral_pdf_positive')) # Compute the J ratio_clustered = clustered_target_pdf / clustered_behavioral_pdf #ratio_reward = tf.cast(ratio_clustered, tf.float32) * reward_unique # ---- No cluster cardinality ratio_reward = tf.cast(ratio_clustered, tf.float32) * reward_unique * tf.cast(trajectories_per_cluster, tf.float32) # ---- Cluster cardinality #w_return_mean = tf.reduce_sum(ratio_reward) / tf.cast(max_index, tf.float32) # ---- No cluster cardinality w_return_mean = tf.reduce_sum(ratio_reward) / tf.cast(n_episodes, tf.float32) # ---- Cluster cardinality # Divergences ess_classic = tf.linalg.norm(ratio_reward, 1) ** 2 / tf.linalg.norm(ratio_reward, 2) ** 2 sqrt_ess_classic = tf.linalg.norm(ratio_reward, 1) / tf.linalg.norm(ratio_reward, 2) ess_renyi = n_episodes / empirical_d2 # Summaries losses_with_name.extend([(tf.reduce_max(ratio_clustered), 'MaxIW'), (tf.reduce_min(ratio_clustered), 'MinIW'), (tf.reduce_mean(ratio_clustered), 'MeanIW'), (U.reduce_std(ratio_clustered), 'StdIW'), (1-(max_index / n_episodes), 'RewardCompression'), (ess_classic, 'ESSClassic'), (ess_renyi, 'ESSRenyi')]) else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'std-d2': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_std elif bound == 'max-d2': var_estimate = tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_abs_max bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_abs_max elif bound == 'max-ess': bound_ = w_return_mean - tf.sqrt((1 - delta) / delta) / sqrt_ess_classic * return_abs_max elif bound == 'std-ess': bound_ = w_return_mean - tf.sqrt((1 - delta) / delta) / sqrt_ess_classic * return_std elif bound == 'pdis-max-d2': # Discount factor if gamma >= 1: discounter = [float(1+2*(horizon-t-1)) for t in range(0, horizon)] else: def f(t): return pow(gamma, 2*t) + (2*pow(gamma,t)*(pow(gamma, t+1) - pow(gamma, horizon))) / (1-gamma) discounter = [f(t) for t in range(0, horizon)] discounter_tf = tf.constant(discounter) mean_episode_d2 = tf.reduce_sum(d2_w_0t, axis=0) / (tf.reduce_sum(mask_split, axis=0) + 1e-24) discounted_d2 = mean_episode_d2 * discounter_tf # Discounted d2 discounted_total_d2 = tf.reduce_sum(discounted_d2, axis=0) # Sum over time bound_ = w_return_mean - tf.sqrt((1-delta) * discounted_total_d2 / (delta*n_episodes)) * return_step_max elif bound == 'pdis-mean-d2': # Discount factor if gamma >= 1: discounter = [float(1+2*(horizon-t-1)) for t in range(0, horizon)] else: def f(t): return pow(gamma, 2*t) + (2*pow(gamma,t)*(pow(gamma, t+1) - pow(gamma, horizon))) / (1-gamma) discounter = [f(t) for t in range(0, horizon)] discounter_tf = tf.constant(discounter) mean_episode_d2 = tf.reduce_sum(d2_w_0t, axis=0) / (tf.reduce_sum(mask_split, axis=0) + 1e-24) discounted_d2 = mean_episode_d2 * discounter_tf # Discounted d2 discounted_total_d2 = tf.reduce_sum(discounted_d2, axis=0) # Sum over time bound_ = w_return_mean - tf.sqrt((1-delta) * discounted_total_d2 / (delta*n_episodes)) * return_step_mean else: raise NotImplementedError() # Policy entropy for exploration ent = pi.pd.entropy() meanent = tf.reduce_mean(ent) losses_with_name.append((meanent, 'MeanEntropy')) # Add policy entropy bonus if entropy != 'none': scheme, v1, v2 = entropy.split(':') if scheme == 'step': entcoeff = tf.cond(iter_number_ < int(v2), lambda: float(v1), lambda: float(0.0)) losses_with_name.append((entcoeff, 'EntropyCoefficient')) entbonus = entcoeff * meanent bound_ = bound_ + entbonus elif scheme == 'lin': ip = tf.cast(iter_number_ / max_iters, tf.float32) entcoeff_decay = tf.maximum(0.0, float(v2) + (float(v1) - float(v2)) * (1.0 - ip)) losses_with_name.append((entcoeff_decay, 'EntropyCoefficient')) entbonus = entcoeff_decay * meanent bound_ = bound_ + entbonus elif scheme == 'exp': ent_f = tf.exp(-tf.abs(tf.reduce_mean(iw) - 1) * float(v2)) * float(v1) losses_with_name.append((ent_f, 'EntropyCoefficient')) bound_ = bound_ + ent_f * meanent else: raise Exception('Unrecognized entropy scheme.') losses_with_name.append((w_return_mean, 'ReturnMeanIW')) losses_with_name.append((bound_, 'Bound')) losses, loss_names = map(list, zip(*losses_with_name)) if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad(tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) assign_old_eq_new = U.function([], [], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())]) assert_ops = tf.group(*tf.get_collection('asserts')) print_ops = tf.group(*tf.get_collection('prints')) compute_lossandgrad = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_], losses + [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_grad = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_], [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_bound = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_], [bound_, assert_ops, print_ops]) compute_losses = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_], losses) #compute_temp = U.function([ob_, ac_, rew_, disc_rew_, mask_], [ratio_cumsum, discounted_ratio]) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finised...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) add_disc_rew(seg, gamma) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) # Get clustered reward reward_matrix = np.reshape(seg['disc_rew'] * seg['mask'], (n_episodes, horizon)) ep_reward = np.sum(reward_matrix, axis=1) if reward_clustering == 'none': pass elif reward_clustering == 'floor': ep_reward = np.floor(ep_reward) elif reward_clustering == 'ceil': ep_reward = np.ceil(ep_reward) elif reward_clustering == 'floor10': ep_reward = np.floor(ep_reward * 10) / 10 elif reward_clustering == 'ceil10': ep_reward = np.ceil(ep_reward * 10) / 10 elif reward_clustering == 'floor100': ep_reward = np.floor(ep_reward * 100) / 100 elif reward_clustering == 'ceil100': ep_reward = np.ceil(ep_reward * 100) / 100 args = ob, ac, rew, disc_rew, clustered_rew, mask, iter_number = seg['ob'], seg['ac'], seg['rew'], seg['disc_rew'], ep_reward, seg['mask'], iters_so_far assign_old_eq_new() def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Iteration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights: logger.record_tabular('Weights', str(get_parameter())) import pickle file = open('checkpoint.pkl', 'wb') pickle.dump(theta, file) with timed("offline optimization"): theta, improvement = optimize_offline(theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) logger.dump_tabular() env.close()
def learn(*, network, env, total_timesteps, eval_env=None, seed=None, nsteps=2048, ent_coef=0.0, lr=3e-4, vf_coef=0.5, superv_coef=0.0, max_grad_norm=0.5, gamma=0.99, lam=0.95, log_interval=10, nminibatches=4, noptepochs=4, cliprange=0.2, save_interval=100, load_path=None, model_fn=None, update_fn=None, init_fn=None, mpi_rank_weight=1, comm=None, sil_update=10, sil_value=0.01, sil_alpha=0.6, sil_beta=0.1, **network_kwargs): ''' Learn policy using PPO algorithm (https://arxiv.org/abs/1707.06347) Parameters: ---------- network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list) specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets. See common/models.py/lstm for more details on using recurrent nets in policies env: baselines.common.vec_env.VecEnv environment. Needs to be vectorized for parallel environment simulation. The environments produced by gym.make can be wrapped using baselines.common.vec_env.DummyVecEnv class. nsteps: int number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where nenv is number of environment copies simulated in parallel) total_timesteps: int number of timesteps (i.e. number of actions taken in the environment) ent_coef: float policy entropy coefficient in the optimization objective lr: float or function learning rate, constant or a schedule function [0,1] -> R+ where 1 is beginning of the training and 0 is the end of the training. vf_coef: float value function loss coefficient in the optimization objective max_grad_norm: float or None gradient norm clipping coefficient gamma: float discounting factor lam: float advantage estimation discounting factor (lambda in the paper) log_interval: int number of timesteps between logging events nminibatches: int number of training minibatches per update. For recurrent policies, should be smaller or equal than number of environments run in parallel. noptepochs: int number of training epochs per update cliprange: float or function clipping range, constant or schedule function [0,1] -> R+ where 1 is beginning of the training and 0 is the end of the training save_interval: int number of timesteps between saving events load_path: str path to load the model from **network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network For instance, 'mlp' network architecture has arguments num_hidden and num_layers. ''' set_global_seeds(seed) if isinstance(lr, float): lr = constfn(lr) else: assert callable(lr) if isinstance(cliprange, float): cliprange = constfn(cliprange) else: assert callable(cliprange) total_timesteps = int(total_timesteps) if MPI is not None and comm is None: comm = MPI.COMM_WORLD policy = build_policy(env, network, **network_kwargs) # Get the nb of env nenvs = env.num_envs # Get state_space and action_space ob_space = env.observation_space ac_space = env.action_space # Calculate the batch_size counter = 1 if comm.Get_size() > 1 else nenvs nbatch = counter * nsteps total_batch_size = nsteps * comm.Get_size() if comm.Get_size( ) > 1 else nbatch # 用于计算update数 nbatch_train = nbatch // nminibatches is_mpi_root = (MPI is None or comm.Get_rank() == 0) # Instantiate the model object (that creates act_model and train_model) if model_fn is None: from baselines.ppo2.model_sil import Model model_fn = Model model = model_fn(policy=policy, ob_space=ob_space, ac_space=ac_space, nbatch_act=nenvs, nbatch_train=nbatch_train, nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef, superv_coef=superv_coef, max_grad_norm=max_grad_norm, comm=comm, mpi_rank_weight=mpi_rank_weight, sil_update=sil_update, sil_value=sil_value, sil_alpha=sil_alpha, sil_beta=sil_beta, fn_reward=lambda x: x, fn_obs=lambda x: x) if load_path is not None: model.load(load_path) # Instantiate the runner object runner = Runner(env=env, model=model, nsteps=nsteps, gamma=gamma, lam=lam) if eval_env is not None: eval_runner = Runner(env=eval_env, model=model, nsteps=nsteps, gamma=gamma, lam=lam) epinfobuf = deque(maxlen=100) if eval_env is not None: eval_epinfobuf = deque(maxlen=100) if init_fn is not None: init_fn() # Start total timer tfirststart = time.perf_counter() nupdates = total_timesteps // total_batch_size for update in range(1, nupdates + 1): assert nbatch % nminibatches == 0 # Start timer tstart = time.perf_counter() frac = 1.0 - (update - 1.0) / nupdates # Calculate the learning rate lrnow = lr(frac) # Calculate the cliprange cliprangenow = cliprange(frac) if update % log_interval == 0 and is_mpi_root: logger.info('Stepping environment...') # Get minibatch obs, returns, masks, actions, values, neglogpacs, states, epinfos = runner.run( ) #pylint: disable=E0632 if eval_env is not None: eval_obs, eval_returns, eval_masks, eval_actions, eval_values, eval_neglogpacs, eval_states, eval_epinfos = eval_runner.run( ) #pylint: disable=E0632 if update % log_interval == 0 and is_mpi_root: logger.info('Done.') epinfobuf.extend(epinfos) if eval_env is not None: eval_epinfobuf.extend(eval_epinfos) # Here what we're going to do is for each minibatch calculate the loss and append it. mblossvals = [] if states is None: # nonrecurrent version # Index of each element of batch_size # Create the indices array inds = np.arange(nbatch) for _ in range(noptepochs): # Randomize the indexes np.random.shuffle(inds) # 0 to batch_size with batch_train_size step for start in range(0, nbatch, nbatch_train): end = start + nbatch_train mbinds = inds[start:end] slices = (arr[mbinds] for arr in (obs, returns, masks, actions, values, neglogpacs)) mblossvals.append(model.train(lrnow, cliprangenow, *slices)) sil_mblossvals, sil_samples = model.sil_train(lrnow) else: # recurrent version assert nenvs % nminibatches == 0 envsperbatch = nenvs // nminibatches envinds = np.arange(nenvs) flatinds = np.arange(nenvs * nsteps).reshape(nenvs, nsteps) for _ in range(noptepochs): np.random.shuffle(envinds) for start in range(0, nenvs, envsperbatch): end = start + envsperbatch mbenvinds = envinds[start:end] mbflatinds = flatinds[mbenvinds].ravel() slices = (arr[mbflatinds] for arr in (obs, returns, masks, actions, values, neglogpacs)) mbstates = states[mbenvinds] mblossvals.append( model.train(lrnow, cliprangenow, *slices, mbstates)) # Feedforward --> get losses --> update lossvals = np.mean(mblossvals, axis=0) sil_lossvals = np.mean(sil_mblossvals, axis=0) sil_samples_mean = np.mean(sil_samples) # End timer tnow = time.perf_counter() # Calculate the fps (frame per second) fps = int(nbatch / (tnow - tstart)) if update_fn is not None: update_fn(update) if update % log_interval == 0 or update == 1: # Calculates if value function is a good predicator of the returns (ev > 1) # or if it's just worse than predicting nothing (ev =< 0) local_eprewmean = safemean([epinfo['r'] for epinfo in epinfobuf]) local_eplenmean = safemean([epinfo['l'] for epinfo in epinfobuf]) global_eprewmean = comm.allreduce(local_eprewmean, op=MPI.SUM) / comm.Get_size() global_eplenmean = comm.allreduce(local_eplenmean, op=MPI.SUM) / comm.Get_size() ev = explained_variance(values, returns) logger.logkv("misc/serial_timesteps", update * nsteps) logger.logkv("misc/nupdates", update) logger.logkv("misc/num_env", comm.Get_size()) logger.logkv("misc/total_timesteps", update * total_batch_size) logger.logkv("fps", fps) logger.logkv("misc/explained_variance", float(ev)) logger.logkv('local/eprewmean', local_eprewmean) logger.logkv('local/eplenmean', local_eplenmean) logger.logkv('global/eprewmean', global_eprewmean) logger.logkv('global/eplenmean', global_eplenmean) if eval_env is not None: logger.logkv( 'eval_eprewmean', safemean([epinfo['r'] for epinfo in eval_epinfobuf])) logger.logkv( 'eval_eplenmean', safemean([epinfo['l'] for epinfo in eval_epinfobuf])) logger.logkv('misc/time_elapsed', tnow - tfirststart) for (lossval, lossname) in zip(lossvals, model.loss_names): logger.logkv('local/loss/' + lossname, lossval) logger.logkv( 'global/loss/' + lossname, comm.allreduce(lossval, op=MPI.SUM) / comm.Get_size()) if sil_update > 0: for (sil_lossval, sil_lossname) in zip(sil_lossvals, model.sil.sil_loss_names): logger.logkv('local/sil_loss/' + sil_lossname, sil_lossval) logger.logkv( 'global/sil_loss/' + sil_lossname, comm.allreduce(sil_lossval, op=MPI.SUM) / comm.Get_size()) logger.logkv("local/sil_samples_mean", sil_samples_mean) logger.logkv( "global/sil_samples_mean", comm.allreduce(sil_samples_mean, op=MPI.SUM) / comm.Get_size()) logger.dumpkvs() logger.log("global/all_sil_samples_mean", ', '.join(map(str, comm.allgather(sil_samples_mean)))) if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir() and is_mpi_root: checkdir = osp.join(logger.get_dir(), 'checkpoints') os.makedirs(checkdir, exist_ok=True) savepath = osp.join(checkdir, '%.5i' % update) print('Saving to', savepath) model.save(savepath) return model
def learn( *, network, env, total_timesteps, timesteps_per_batch=1024, # what to train on max_kl=0.001, cg_iters=10, gamma=0.99, lam=1.0, # advantage estimation seed=None, ent_coef=0.0, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters=3, max_episodes=0, max_iters=0, # time constraint callback=None, load_path=None, **network_kwargs): ''' learn a policy function with TRPO algorithm Parameters: ---------- network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types) or function that takes input placeholder and returns tuple (output, None) for feedforward nets or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class timesteps_per_batch timesteps per gradient estimation batch max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) ) ent_coef coefficient of policy entropy term in the optimization objective cg_iters number of iterations of conjugate gradient algorithm cg_damping conjugate gradient damping vf_stepsize learning rate for adam optimizer used to optimie value function loss vf_iters number of iterations of value function optimization iterations per each policy optimization step total_timesteps max number of timesteps max_episodes max number of episodes max_iters maximum number of policy optimization iterations callback function to be called with (locals(), globals()) each policy optimization step load_path str, path to load the model from (default: None, i.e. no model is loaded) **network_kwargs keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network Returns: ------- learnt model ''' if MPI is not None: nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() else: nworkers = 1 rank = 0 cpus_per_worker = 1 U.get_session(config=tf.compat.v1.ConfigProto( allow_soft_placement=True, inter_op_parallelism_threads=cpus_per_worker, intra_op_parallelism_threads=cpus_per_worker)) policy = build_policy(env, network, value_network='copy', **network_kwargs) set_global_seeds(seed) np.set_printoptions(precision=3) # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space ob = observation_placeholder(ob_space) with tf.compat.v1.variable_scope("pi"): pi = policy(observ_placeholder=ob) with tf.compat.v1.variable_scope("oldpi"): oldpi = policy(observ_placeholder=ob) atarg = tf.compat.v1.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.compat.v1.placeholder(dtype=tf.float32, shape=[None]) # Empirical return ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) entbonus = ent_coef * meanent vferr = tf.reduce_mean(tf.square(pi.vf - ret)) ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold surrgain = tf.reduce_mean(ratio * atarg) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = get_trainable_variables("pi") # var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")] # vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")] var_list = get_pi_trainable_variables("pi") vf_var_list = get_vf_trainable_variables("pi") vfadam = MpiAdam(vf_var_list) get_flat = U.GetFlat(var_list) set_from_flat = U.SetFromFlat(var_list) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.compat.v1.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: sz = U.intprod(shape) tangents.append(tf.reshape(flat_tangent[start:start + sz], shape)) start += sz gvp = tf.add_n([ tf.reduce_sum(g * tangent) for (g, tangent) in zipsame(klgrads, tangents) ]) # pylint: disable=E1111 fvp = U.flatgrad(gvp, var_list) assign_old_eq_new = U.function( [], [], updates=[ tf.compat.v1.assign(oldv, newv) for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi")) ]) compute_losses = U.function([ob, ac, atarg], losses) compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)]) compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp) compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if rank == 0: print(colorize(msg, color='magenta')) tstart = time.time() yield print( colorize("done in %.3f seconds" % (time.time() - tstart), color='magenta')) else: yield def allmean(x): assert isinstance(x, np.ndarray) if MPI is not None: out = np.empty_like(x) MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM) out /= nworkers else: out = np.copy(x) return out U.initialize() if load_path is not None: pi.load(load_path) th_init = get_flat() if MPI is not None: MPI.COMM_WORLD.Bcast(th_init, root=0) set_from_flat(th_init) vfadam.sync() print("Init param sum", th_init.sum(), flush=True) # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards if sum([max_iters > 0, total_timesteps > 0, max_episodes > 0]) == 0: # noththing to be done return pi assert sum([max_iters > 0, total_timesteps > 0, max_episodes > 0]) < 2, \ 'out of max_iters, total_timesteps, and max_episodes only one should be specified' while True: if callback: callback(locals(), globals()) if total_timesteps and timesteps_so_far >= total_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break logger.log("********** Iteration %i ************" % iters_so_far) with timed("sampling"): seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg[ "tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean() ) / atarg.std() # standardized advantage function estimate if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret) if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy args = seg["ob"], seg["ac"], atarg fvpargs = [arr[::5] for arr in args] def fisher_vector_product(p): return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p assign_old_eq_new() # set old parameter values to new parameter values with timed("computegrad"): *lossbefore, g = compute_lossandgrad(*args) lossbefore = allmean(np.array(lossbefore)) g = allmean(g) if np.allclose(g, 0): logger.log("Got zero gradient. not updating") else: with timed("cg"): stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank == 0) assert np.isfinite(stepdir).all() shs = .5 * stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm expectedimprove = g.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize set_from_flat(thnew) meanlosses = surr, kl, *_ = allmean( np.array(compute_losses(*args))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f" % (expectedimprove, improve)) if not np.isfinite(meanlosses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl > max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") set_from_flat(thbefore) if nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather( (thnew.sum(), vfadam.getflat().sum())) # list of tuples assert all( np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) with timed("vf"): for _ in range(vf_iters): for (mbob, mbret) in dataset.iterbatches( (seg["ob"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=64): g = allmean(compute_vflossandgrad(mbob, mbret)) vfadam.update(g, vf_stepsize) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values if MPI is not None: listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples else: listoflrpairs = [lrlocal] lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if rank == 0: logger.dump_tabular() return pi
def learn( update_flag, end_train_flag, total_step, net_list, net_list_lock, mem_queue, env, q_func, lr=5e-4, max_timesteps=1000000, buffer_size=100000, batch_size=32, checkpoint_freq=10000, checkpoint_path=None, learning_starts=5000, gamma=1.0, target_network_update_freq=500, # asyn中 trainer要比正常运行快,这些参数都有待商议 actor_network_update_freq=500, # 最好比actor那边小点(到也没必要,trainer这边运行速度肯定比actor快得多) prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, param_noise=False, callback=None): """Train a deepq model. Parameters ------- env: gym.Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer max_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability batch_size: int size of a batched sampled from replay buffer for training checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts asyn 之下该参数修改为在replay_buffer的数据大小下开始? gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model # sess = tf.Session() config = tf.ConfigProto() config.gpu_options.per_process_gpu_memory_fraction = 0.2 # 占用GPU20%的显存 sess = tf.Session(config=config) # sess = U.single_threaded_session() # 限制使用单核心 sess.__enter__() # capture the shape outside the closure so that the env object is not serialized # by cloudpickle when serializing make_obs_ph def make_obs_ph(name): return ObservationInput(env.observation_space, name=name) act, train, update_target, init_actor_qfunc, update_actor_qfunc, debug = build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, param_noise=param_noise) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } act = ActWrapper(act, act_params) # Create the replay buffer replay_buffer = MemBufferThread( mem_queue, max_timesteps=max_timesteps, buffer_size=buffer_size, batch_size=batch_size, prioritized_replay=prioritized_replay, prioritized_replay_alpha=prioritized_replay_alpha, prioritized_replay_beta0=prioritized_replay_beta0, prioritized_replay_beta_iters=prioritized_replay_beta_iters, prioritized_replay_eps=prioritized_replay_eps) replay_buffer.setDaemon(True) # 设置子线程与主线程一起退出,需在start之前 replay_buffer.start() # Initialize the parameters and copy them to the target network. U.initialize() update_target() init_actor_qfunc(sess=sess, net_list=net_list) # 初始化结束后,先为actor传递一次网络 # update_actor_qfunc(sess=sess, net_list=net_list, net_list_lock=net_list_lock) update_flag.value += 1 # 设置标志位,允许各actor复制初始网络 with tempfile.TemporaryDirectory() as td: td = checkpoint_path or td model_file = os.path.join(td, "model_tn") # 将两端路径名/文件名 合在一起 model_saved = False if tf.train.latest_checkpoint(td) is not None: load_state(model_file) logger.log('Loaded model from {}'.format(model_file)) model_saved = True t = 0 # 在最大步数内训练, infinite # for t in range(max_timesteps): while True: if callback is not None: if callback(locals(), globals()): break # 一直等待replay_buffer的数据足够多,才开始训练网络 while replay_buffer.__len__() < learning_starts: # print(replay_buffer.__len__()) time.sleep(1) # Minimize the error in Bellman's equation on a batch sampled from replay buffer. obses_t, actions, rewards, obses_tp1, dones, weights = replay_buffer.sample( total_step.value) td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) # print(td_errors) if prioritized_replay: replay_buffer.update_priorities(td_errors) if t % target_network_update_freq == 0: # Update target network periodically. update_target() # 更新actor_network if t % actor_network_update_freq == 0: update_actor_qfunc(sess=sess, net_list=net_list, net_list_lock=net_list_lock) # time.sleep(0.05) # 不应该存在 # checkpoint_freq轮数保存模型 if (checkpoint_freq is not None and t % checkpoint_freq == 0): logger.log("Saving model") save_state(model_file) # 这里是tensorflow的保存方式,是为了继续训练的 model_saved = True act.save("n_robot_model.pkl") # 这里只保存了act相关内容,可以用来检查运行结果 # act.save("cartpole_model.pkl") # 这里只保存了act相关内容,可以用来检查运行结果 # act.save("MountainCar_model.pkl") t += 1 # # 4 是actor数量, max_timesteps 是每个actor的最大步数,意味着actor训练结束,train随之结束(not work well) # if (total_step.value+4)/4 + 1000 >= max_timesteps: # break if end_train_flag.value == 4: # 4 是actor数量 break # 至此,训练结束 # 返回一个ActWrapper,用来act.save("cartpole_model.pkl")或其它的动作 print("end training") if model_saved: # logger.log("Restored model with mean reward: {}".format(saved_mean_reward)) logger.log("Restored model") load_state(model_file) # replay_buffer.join() return act
def log_info(self): logger.log("Total trajectorues: %d" % self.num_traj) logger.log("Total transitions: %d" % self.num_transition) logger.log("Average returns: %f" % self.avg_ret) logger.log("Std for returns: %f" % self.std_ret)
def save_args(args): for arg in vars(args): logger.log("{}:".format(arg), getattr(args, arg))
def learn( make_env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=0, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None, clipping=False, entropy='none', positive_return=False, reward_clustering='none', capacity=10, inner=10, penalization=True, learnable_variance=True, variance_initializer=-1, constant_step_size=0, shift_return=False, power=1, warm_start=True): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() if constant_step_size != 0: line_search = line_search_constant # Building the environment env = make_env() ob_space = env.observation_space ac_space = env.action_space # Creating the memory buffer memory = Memory(capacity=capacity, batch_size=n_episodes, horizon=horizon, ob_space=ob_space, ac_space=ac_space) # Building the target policy and saving its parameters pi = make_policy('pi', ob_space, ac_space) nu = make_policy('nu', ob_space, ac_space) all_var_list = nu.get_trainable_variables() var_list = [ v for v in all_var_list if v.name.split('/')[1].startswith('pol') ] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) all_var_list_pi = pi.get_trainable_variables() var_list_pi = [ v for v in all_var_list_pi if v.name.split('/')[1].startswith('pol') ] # Building a set of behavioral policies memory.build_policies(make_policy, nu) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([None], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(None), name='mask') rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='rew') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='disc_rew') clustered_rew_ = tf.placeholder(dtype=tf.float32, shape=(None)) gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') iter_number_ = tf.placeholder(dtype=tf.int32, name='iter_number') active_policies = tf.placeholder(dtype=tf.float32, shape=(capacity), name='active_policies') losses_with_name = [] # Total number of trajectories N_total = tf.reduce_sum(active_policies) * n_episodes # Split operations disc_rew_split = tf.reshape(disc_rew_ * mask_, [-1, horizon]) rew_split = tf.reshape(rew_ * mask_, [-1, horizon]) mask_split = tf.reshape(mask_, [-1, horizon]) # Policy densities target_log_pdf = pi.pd.logp(ac_) * mask_ target_log_pdf_split = tf.reshape(target_log_pdf, [-1, horizon]) behavioral_log_pdfs = tf.stack([ bpi.pd.logp(ac_) * mask_ for bpi in memory.policies ]) # Shape is (capacity, ntraj*horizon) behavioral_log_pdfs_split = tf.reshape(behavioral_log_pdfs, [memory.capacity, -1, horizon]) new_behavioural_log_pdf = nu.pd.logp(ac_) * mask_ new_behavioural_log_pdf_split = tf.reshape(new_behavioural_log_pdf, [-1, horizon]) divergence_split = tf.reshape( tf.stack([ tf.log(pi.pd.compute_divergence(bpi.pd, nu.pd)) * mask_ for bpi in memory.policies ]), [memory.capacity, -1, horizon]) divergence_split_cum = tf.exp(tf.reduce_sum(divergence_split, axis=2)) divergence_mean = tf.reduce_mean(divergence_split_cum, axis=1) divergence_harmonic = tf.reduce_sum(active_policies) / tf.reduce_sum( 1 / divergence_mean) # Compute renyi divergencies and sum over time, then exponentiate emp_d2_split = tf.reshape( tf.stack([pi.pd.renyi(bpi.pd, 2) * mask_ for bpi in memory.policies]), [memory.capacity, -1, horizon]) emp_d2_split_cum = tf.exp(tf.reduce_sum(emp_d2_split, axis=2)) # Compute arithmetic and harmonic mean of emp_d2 emp_d2_mean = tf.reduce_mean(emp_d2_split_cum, axis=1) emp_d2_arithmetic = tf.reduce_sum( emp_d2_mean * active_policies) / tf.reduce_sum(active_policies) emp_d2_harmonic = tf.reduce_sum(active_policies) / tf.reduce_sum( 1 / emp_d2_mean) # Return processing: clipping, centering, discounting ep_return = clustered_rew_ #tf.reduce_sum(mask_split * disc_rew_split, axis=1) ep_return_optimization = (ep_return - tf.reduce_min(ep_return))**power if clipping: rew_split = tf.clip_by_value(rew_split, -1, 1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) rew_split = rew_split - (tf.reduce_sum(rew_split) / (tf.reduce_sum(mask_split) + 1e-24)) discounter = [pow(gamma, i) for i in range(0, horizon)] # Decreasing gamma discounter_tf = tf.constant(discounter) disc_rew_split = rew_split * discounter_tf # Reward statistics return_mean = tf.reduce_mean(ep_return) optimization_return_mean = tf.reduce_mean(ep_return_optimization) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) optimization_return_max = tf.reduce_max(ep_return_optimization) return_min = tf.reduce_min(ep_return) optimization_return_min = tf.reduce_min(ep_return_optimization) return_abs_max = tf.reduce_max(tf.abs(ep_return)) optimization_return_abs_max = tf.reduce_max(tf.abs(ep_return_optimization)) return_step_max = tf.reduce_max(tf.abs(rew_split)) # Max step reward return_step_mean = tf.abs(tf.reduce_mean(rew_split)) positive_step_return_max = tf.maximum(0.0, tf.reduce_max(rew_split)) negative_step_return_max = tf.maximum(0.0, tf.reduce_max(-rew_split)) return_step_maxmin = tf.abs(positive_step_return_max - negative_step_return_max) losses_with_name.extend([ (return_mean, 'InitialReturnMean'), (return_max, 'InitialReturnMax'), (return_min, 'InitialReturnMin'), (optimization_return_mean, 'OptimizationReturnMean'), (optimization_return_max, 'OptimizationReturnMax'), (optimization_return_min, 'OptimizationReturnMin'), (return_std, 'InitialReturnStd'), (divergence_harmonic, 'DivergenceHarmonic'), (emp_d2_arithmetic, 'EmpiricalD2Arithmetic'), (emp_d2_harmonic, 'EmpiricalD2Harmonic'), (return_step_max, 'ReturnStepMax'), (return_step_maxmin, 'ReturnStepMaxmin') ]) # Add D2 statistics for each memory cell for i in range(capacity): losses_with_name.extend([(tf.reduce_mean(emp_d2_split_cum, axis=1)[i], 'MeanD2-' + str(i))]) if iw_method == 'is': # Sum the log prob over time. Shapes: target(Nep, H), behav (Cap, Nep, H) target_log_pdf_episode = tf.reduce_sum(target_log_pdf_split, axis=1) behavioral_log_pdf_episode = tf.reduce_sum(behavioral_log_pdfs_split, axis=2) new_behavioural_log_pdf_episode = tf.reduce_sum( new_behavioural_log_pdf_split, axis=1) # To avoid numerical instability, compute the inversed ratio log_inverse_ratio = behavioral_log_pdf_episode + new_behavioural_log_pdf_episode - 2 * target_log_pdf_episode abc = tf.exp(log_inverse_ratio) * tf.expand_dims(active_policies, -1) iw = 1 / tf.reduce_sum( tf.exp(log_inverse_ratio) * tf.expand_dims(active_policies, -1), axis=0) iwn = iw / n_episodes log_inverse_ratio_lb = behavioral_log_pdf_episode - target_log_pdf_episode iw_lb = 1 / tf.reduce_sum( tf.exp(log_inverse_ratio_lb) * tf.expand_dims(active_policies, -1), axis=0) iwn_lb = iw_lb / n_episodes w_return_mean_lb = tf.reduce_sum(ep_return**2 * iwn_lb) # Compute the J if shift_return: w_return_mean = tf.reduce_sum(ep_return_optimization**2 * iwn) else: w_return_mean = tf.reduce_sum(ep_return**2 * iwn) control_variate = tf.reduce_sum(return_min**2 * iwn) # Empirical D2 of the mixture and relative ESS ess_renyi_arithmetic = N_total / emp_d2_arithmetic ess_renyi_harmonic = N_total / emp_d2_harmonic ess_divergence_harmonic = N_total / divergence_harmonic # Log quantities losses_with_name.extend([ (tf.reduce_max(iw), 'MaxIW'), (tf.reduce_min(iw), 'MinIW'), (tf.reduce_mean(iw), 'MeanIW'), (U.reduce_std(iw), 'StdIW'), (U.reduce_std(w_return_mean), 'StdWReturnMean'), (tf.reduce_min(target_log_pdf_episode), 'MinTargetPdf'), (tf.reduce_min(behavioral_log_pdf_episode), 'MinBehavPdf'), (ess_renyi_arithmetic, 'ESSRenyiArithmetic'), (ess_renyi_harmonic, 'ESSRenyiHarmonic') ]) else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'max-d2-harmonic': if penalization: if shift_return: bound_ = -w_return_mean - tf.sqrt( (1 - delta) / (delta * ess_divergence_harmonic)) * optimization_return_abs_max**2 else: bound_ = -w_return_mean - tf.sqrt( (1 - delta) / (delta * ess_divergence_harmonic)) * return_abs_max**2 else: bound_ = -w_return_mean lower_bound = -w_return_mean_lb + tf.sqrt( (1 - delta) / (delta * ess_renyi_harmonic)) * return_abs_max**2 elif bound == 'max-d2-arithmetic': bound_ = -w_return_mean - tf.sqrt( 1 / (delta * ess_renyi_arithmetic)) * return_abs_max**2 else: raise NotImplementedError() # Policy entropy for exploration ent = pi.pd.entropy() meanent = tf.reduce_mean(ent) losses_with_name.append((meanent, 'MeanEntropy')) # Add policy entropy bonus if entropy != 'none': scheme, v1, v2 = entropy.split(':') if scheme == 'step': entcoeff = tf.cond(iter_number_ < int(v2), lambda: float(v1), lambda: float(0.0)) losses_with_name.append((entcoeff, 'EntropyCoefficient')) entbonus = entcoeff * meanent bound_ = bound_ + entbonus elif scheme == 'lin': ip = tf.cast(iter_number_ / max_iters, tf.float32) entcoeff_decay = tf.maximum( 0.0, float(v2) + (float(v1) - float(v2)) * (1.0 - ip)) losses_with_name.append((entcoeff_decay, 'EntropyCoefficient')) entbonus = entcoeff_decay * meanent bound_ = bound_ + entbonus elif scheme == 'exp': ent_f = tf.exp( -tf.abs(tf.reduce_mean(iw) - 1) * float(v2)) * float(v1) losses_with_name.append((ent_f, 'EntropyCoefficient')) bound_ = bound_ + ent_f * meanent else: raise Exception('Unrecognized entropy scheme.') losses_with_name.append((w_return_mean, 'ReturnMeanIW')) losses_with_name.append((bound_, 'Bound')) losses, loss_names = map(list, zip(*losses_with_name)) ''' if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad(tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) ''' assign_nu_eq_mu = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(nu.get_variables(), pi.get_variables()) ]) assign_mu_eq_nu = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(pi.get_variables(), nu.get_variables()) ]) assert_ops = tf.group(*tf.get_collection('asserts')) print_ops = tf.group(*tf.get_collection('prints')) compute_lossandgrad = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], losses + [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_grad = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_bound = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], [bound_, assert_ops, print_ops]) compute_losses = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], losses) compute_w_return = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], [w_return_mean, assert_ops, print_ops]) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) policy_reinit = tf.variables_initializer(var_list) get_parameter_pi = U.GetFlat(var_list_pi) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True) sampler = type("SequentialSampler", (object, ), { "collect": lambda self, _: seg_gen.__next__() })() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: #outer loop iters_so_far += 1 #index i if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finished...') break logger.log('********** Iteration %i ************' % iters_so_far) assign_nu_eq_mu() #print(get_parameter(), get_parameter_pi()) iters_so_far_inner = 0 while True: #inner loop iters_so_far_inner += 1 #index j if iters_so_far_inner >= inner + 1: print('Inner loop finished...') break logger.log('********** Inner Iteration %i ************' % iters_so_far_inner) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) add_disc_rew(seg, gamma) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) # Adding batch of trajectories to memory memory.add_trajectory_batch(seg) # Get multiple batches from memory seg_with_memory = memory.get_trajectories() # Get clustered reward reward_matrix = np.reshape( seg_with_memory['disc_rew'] * seg_with_memory['mask'], (-1, horizon)) ep_reward = np.sum(reward_matrix, axis=1) ep_reward = cluster_rewards(ep_reward, reward_clustering) args = ob, ac, rew, disc_rew, clustered_rew, mask, iter_number, active_policies = ( seg_with_memory['ob'], seg_with_memory['ac'], seg_with_memory['rew'], seg_with_memory['disc_rew'], ep_reward, seg_with_memory['mask'], iters_so_far, memory.get_active_policies_mask()) def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, * args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Iteration", iters_so_far) logger.record_tabular("Inner Iteration", iters_so_far_inner) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) logger.record_tabular("WReturnMean", compute_w_return(*args)[0]) logger.record_tabular("Penalization", penalization) logger.record_tabular("LearnableVariance", learnable_variance) logger.record_tabular("VarianceInitializer", variance_initializer) logger.record_tabular("Epsilon", constant_step_size) if save_weights > 0 and iters_so_far % save_weights == 0: logger.record_tabular('Weights', str(get_parameter())) #import pickle #file = open('checkpoint' + str(iters_so_far) + '.pkl', 'wb') #pickle.dump(theta, file) #print(get_parameter(), get_parameter_pi()) #memory.print_parameters() #print('check ', theta, get_parameter()) if not warm_start or memory.get_current_load() == capacity: # Optimize with timed("offline optimization"): theta, improvement = optimize_offline( theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters, constant_step_size=constant_step_size) set_parameter(theta) #print('new theta ', theta) #print(get_parameter_pi()) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) else: pass # Reinitialize the policy #tf.get_default_session().run(policy_reinit) logger.dump_tabular() assign_mu_eq_nu() env.close()
def eta_search(w_theta, w_beta, eta, omega, allmean, compute_losses, get_flat, set_from_flat, pi, epsilon, args, discrete_ac_space=False): """ Binary search for eta for finding both valid log-linear "theta" and non-linear "beta" parameter values :return: new eta """ w_theta = w_theta.reshape(-1, ) w_beta = w_beta.reshape(-1, ) all_params = get_flat() best_params = all_params param_theta, param_beta = pi.all_to_theta_beta(all_params) prev_param_theta = np.copy(param_theta) prev_param_beta = np.copy(param_beta) final_gain = -1e20 final_constraint_val = float('nan') gain_before, kl, *_ = allmean(np.array(compute_losses(*args))) min_ratio = 0.1 max_ratio = 10 # Note: increase in 'ratio' means decrease in KL divergence. # We start search from a high 'ratio' to start from a valid value. ratio = max_ratio for _ in range(10): cur_eta = ratio * eta cur_param_theta = (cur_eta * prev_param_theta + w_theta) / (cur_eta + omega) cur_param_beta = prev_param_beta + w_beta / cur_eta thnew = pi.theta_beta_to_all(cur_param_theta, cur_param_beta) set_from_flat(thnew) # TEST if not discrete_ac_space: if np.min(np.real(np.linalg.eigvals(pi.get_prec_matrix()))) < 0: print("Negative definite covariance!") #min????????????????? if np.min(np.imag(np.linalg.eigvals(pi.get_prec_matrix()))) != 0: print("Covariance has imaginary eigenvalues") gain, kl, *_ = allmean(np.array(compute_losses(*args))) if all((not np.isnan(kl), kl <= epsilon)): if all((not np.isnan(gain), gain > final_gain)): eta = cur_eta final_gain = gain final_constraint_val = kl best_params = thnew max_ratio = ratio ratio = 0.5 * (max_ratio + min_ratio) else: min_ratio = ratio ratio = 0.5 * (max_ratio + min_ratio) if any((np.isnan(final_gain), np.isnan(final_constraint_val), final_constraint_val >= epsilon)): logger.log( "eta_search: Line search condition violated. Rejecting the step!") if np.isnan(final_gain): logger.log("eta_search: Violated because gain is NaN") if np.isnan(final_constraint_val): logger.log("eta_search: Violated because KL is NaN") if final_gain < gain_before: logger.log("eta_search: Violated because gain not improving") if final_constraint_val >= epsilon: logger.log("eta_search: Violated because KL constraint violated") set_from_flat(all_params) else: set_from_flat(best_params) logger.log("eta optimization finished, final gain: " + str(final_gain)) return eta
def learn(env, policy_func, *, timesteps_per_batch, # what to train on max_kl, cg_iters, gamma, lam, # advantage estimation entcoeff=0.0, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters =3, max_timesteps=0, max_episodes=0, max_iters=0, # time constraint callback=None ): nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() np.set_printoptions(precision=3) # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space pi = policy_func("pi", ob_space, ac_space) oldpi = policy_func("oldpi", ob_space, ac_space) atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return ob = U.get_placeholder_cached(name="ob") ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = U.mean(kloldnew) meanent = U.mean(ent) entbonus = entcoeff * meanent vferr = U.mean(tf.square(pi.vpred - ret)) ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold surrgain = U.mean(ratio * atarg) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")] vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")] vfadam = MpiAdam(vf_var_list) get_flat = U.GetFlat(var_list) set_from_flat = U.SetFromFlat(var_list) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: sz = U.intprod(shape) tangents.append(tf.reshape(flat_tangent[start:start+sz], shape)) start += sz gvp = tf.add_n([U.sum(g*tangent) for (g, tangent) in zipsame(klgrads, tangents)]) #pylint: disable=E1111 fvp = U.flatgrad(gvp, var_list) assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())]) compute_losses = U.function([ob, ac, atarg], losses) compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)]) compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp) compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if rank == 0: print(colorize(msg, color='magenta')) tstart = time.time() yield print(colorize("done in %.3f seconds"%(time.time() - tstart), color='magenta')) else: yield def allmean(x): assert isinstance(x, np.ndarray) out = np.empty_like(x) MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM) out /= nworkers return out U.initialize() th_init = get_flat() MPI.COMM_WORLD.Bcast(th_init, root=0) set_from_flat(th_init) vfadam.sync() print("Init param sum", th_init.sum(), flush=True) # Prepare for rollouts # ---------------------------------------- seg_gen = traj_segment_generator(pi, env, timesteps_per_batch, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards assert sum([max_iters>0, max_timesteps>0, max_episodes>0])==1 while True: if callback: callback(locals(), globals()) if max_timesteps and timesteps_so_far >= max_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break logger.log("********** Iteration %i ************"%iters_so_far) with timed("sampling"): seg = seg_gen.__next__() add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg["tdlamret"] vpredbefore = seg["vpred"] # predicted value function before udpate atarg = (atarg - atarg.mean()) / atarg.std() # standardized advantage function estimate if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret) if hasattr(pi, "ob_rms"): pi.ob_rms.update(ob) # update running mean/std for policy args = seg["ob"], seg["ac"], atarg fvpargs = [arr[::5] for arr in args] def fisher_vector_product(p): return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p assign_old_eq_new() # set old parameter values to new parameter values with timed("computegrad"): *lossbefore, g = compute_lossandgrad(*args) lossbefore = allmean(np.array(lossbefore)) g = allmean(g) if np.allclose(g, 0): logger.log("Got zero gradient. not updating") else: with timed("cg"): stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank==0) assert np.isfinite(stepdir).all() shs = .5*stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm expectedimprove = g.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize set_from_flat(thnew) meanlosses = surr, kl, *_ = allmean(np.array(compute_losses(*args))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f"%(expectedimprove, improve)) if not np.isfinite(meanlosses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl > max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") set_from_flat(thbefore) if nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), vfadam.getflat().sum())) # list of tuples assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) with timed("vf"): for _ in range(vf_iters): for (mbob, mbret) in dataset.iterbatches((seg["ob"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=64): g = allmean(compute_vflossandgrad(mbob, mbret)) vfadam.update(g, vf_stepsize) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if rank==0: logger.dump_tabular()
discount_return[-return_len - 1:-1]) value_summary.value[1].simple_value = np.mean( non_discount_return[-return_len - 1:-1]) value_summary.value[3].simple_value = num_episodes # qec_summary.value[0].simple_value = np.mean(qecwatch) # qec_summary.value[1].simple_value = qec_found / (num_iters - start_steps) # if return_len > 1: # # np.mean(np.mean(episodic_return[-return_mean + 1:-1])) # tfout.write("%d, %.2f\n" % (num_iters, int(np.mean(discount_return[-return_len - 1:-1])))) # tfout.flush() logger.record_tabular("exploration", exploration.value(num_iters)) fps_estimate = (float(steps_per_iter) / (float(iteration_time_est) + 1e-6) if steps_per_iter._value is not None else 1 / (float(iteration_time_est) + 1e-6)) logger.dump_tabular() logger.log() logger.log("ETA: " + pretty_eta(int(steps_left / fps_estimate))) logger.log() start_steps = num_iters # qecwatch = [] # qec_found = 0 total_steps = num_iters - args.end_training tf_writer.add_summary(value_summary, global_step=total_steps) # tf_writer.add_summary(qec_summary, global_step=total_steps) cur_time = time.time()
def learn(env, policy, vf, gamma, lam, timesteps_per_batch, num_timesteps, animate=False, callback=None, desired_kl=0.002): obfilter = ZFilter(env.observation_space.shape) max_pathlength = env.spec.timestep_limit stepsize = tf.Variable(initial_value=np.float32(np.array(0.03)), name='stepsize') inputs, loss, loss_sampled = policy.update_info optim = kfac.KfacOptimizer(learning_rate=stepsize, cold_lr=stepsize*(1-0.9), momentum=0.9, kfac_update=2,\ epsilon=1e-2, stats_decay=0.99, async=1, cold_iter=1, weight_decay_dict=policy.wd_dict, max_grad_norm=None) pi_var_list = [] for var in tf.trainable_variables(): if "pi" in var.name: pi_var_list.append(var) update_op, q_runner = optim.minimize(loss, loss_sampled, var_list=pi_var_list) do_update = U.function(inputs, update_op) U.initialize() # start queue runners enqueue_threads = [] coord = tf.train.Coordinator() for qr in [q_runner, vf.q_runner]: assert (qr != None) enqueue_threads.extend(qr.create_threads(tf.get_default_session(), coord=coord, start=True)) i = 0 timesteps_so_far = 0 while True: if timesteps_so_far > num_timesteps: break logger.log("********** Iteration %i ************"%i) # Collect paths until we have enough timesteps timesteps_this_batch = 0 paths = [] while True: path = rollout(env, policy, max_pathlength, animate=(len(paths)==0 and (i % 10 == 0) and animate), obfilter=obfilter) paths.append(path) n = pathlength(path) timesteps_this_batch += n timesteps_so_far += n if timesteps_this_batch > timesteps_per_batch: break # Estimate advantage function vtargs = [] advs = [] for path in paths: rew_t = path["reward"] return_t = common.discount(rew_t, gamma) vtargs.append(return_t) vpred_t = vf.predict(path) vpred_t = np.append(vpred_t, 0.0 if path["terminated"] else vpred_t[-1]) delta_t = rew_t + gamma*vpred_t[1:] - vpred_t[:-1] adv_t = common.discount(delta_t, gamma * lam) advs.append(adv_t) # Update value function vf.fit(paths, vtargs) # Build arrays for policy update ob_no = np.concatenate([path["observation"] for path in paths]) action_na = np.concatenate([path["action"] for path in paths]) oldac_dist = np.concatenate([path["action_dist"] for path in paths]) adv_n = np.concatenate(advs) standardized_adv_n = (adv_n - adv_n.mean()) / (adv_n.std() + 1e-8) # Policy update do_update(ob_no, action_na, standardized_adv_n) min_stepsize = np.float32(1e-8) max_stepsize = np.float32(1e0) # Adjust stepsize kl = policy.compute_kl(ob_no, oldac_dist) if kl > desired_kl * 2: logger.log("kl too high") tf.assign(stepsize, tf.maximum(min_stepsize, stepsize / 1.5)).eval() elif kl < desired_kl / 2: logger.log("kl too low") tf.assign(stepsize, tf.minimum(max_stepsize, stepsize * 1.5)).eval() else: logger.log("kl just right!") logger.record_tabular("EpRewMean", np.mean([path["reward"].sum() for path in paths])) logger.record_tabular("EpRewSEM", np.std([path["reward"].sum()/np.sqrt(len(paths)) for path in paths])) logger.record_tabular("EpLenMean", np.mean([pathlength(path) for path in paths])) logger.record_tabular("KL", kl) if callback: callback() logger.dump_tabular() i += 1 coord.request_stop() coord.join(enqueue_threads)
def learn_neural_linear( env, network, seed=None, lr=5e-4, total_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=10, #100 checkpoint_freq=10000, checkpoint_path=None, learning_starts=999, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, param_noise=False, callback=None, load_path=None, ddqn=False, prior="no prior", actor="dqn", **network_kwargs): #Train a deepq model. # Create all the functions necessary to train the model checkpoint_path = logger.get_dir() sess = get_session() set_global_seeds(seed) blr_params = BLRParams() q_func = deepq.models.cnn_to_mlp( convs=[(32, 8, 4), (64, 4, 2), (64, 3, 1)], hiddens=[blr_params.feat_dim], dueling=bool(0), ) # q_func = build_q_func(network, **network_kwargs) # capture the shape outside the closure so that the env object is not serialized # by cloudpickle when serializing make_obs_ph observation_space = env.observation_space def make_obs_ph(name): return ObservationInput(observation_space, name=name) act, train, update_target, feat_dim, feat, feat_target, target, last_layer_weights, blr_ops, blr_helpers = deepq.build_train_neural_linear( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, param_noise=param_noise, double_q=ddqn, actor=actor) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } act = ActWrapper(act, act_params) # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = total_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * total_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() reset = True with tempfile.TemporaryDirectory() as td: td = checkpoint_path or td model_file = os.path.join(td, "model") model_saved = False if tf.train.latest_checkpoint(td) is not None: load_variables(model_file) logger.log('Loaded model from {}'.format(model_file)) model_saved = True elif load_path is not None: load_variables(load_path) logger.log('Loaded model from {}'.format(load_path)) # BLR # preliminearies num_actions = env.action_space.n w_mu = np.zeros((num_actions, feat_dim)) w_sample = np.random.normal(loc=0, scale=0.1, size=(num_actions, feat_dim)) w_target = np.random.normal(loc=0, scale=0.1, size=(num_actions, feat_dim)) w_cov = np.zeros((num_actions, feat_dim, feat_dim)) for a in range(num_actions): w_cov[a] = np.eye(feat_dim) phiphiT = np.zeros((num_actions, feat_dim, feat_dim)) phiY = np.zeros((num_actions, feat_dim)) a0 = 6 b0 = 6 a_sig = [a0 for _ in range(num_actions)] b_sig = [b0 for _ in range(num_actions)] yy = [0 for _ in range(num_actions)] blr_update = 0 for t in tqdm(range(total_timesteps)): if callback is not None: if callback(locals(), globals()): break # if t % 1000 == 0: # print("{}/{}".format(t,total_timesteps)) # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log(1. - exploration.value( t) + exploration.value(t) / float(env.action_space.n)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act(np.array(obs)[None], w_sample[None]) env_action = action reset = False new_obs, rew, done, _ = env.step(env_action) # clipping like in BDQN rew = np.sign(rew) # Store transition in the replay buffer. replay_buffer.add(obs, action, rew, new_obs, float(done)) obs = new_obs episode_rewards[-1] += rew if done: obs = env.reset() episode_rewards.append(0.0) reset = True # sample new w from posterior if t > 0 and t % blr_params.sample_w == 0: for i in range(num_actions): if blr_params.no_prior: w_sample[i] = np.random.multivariate_normal( w_mu[i], w_cov[i]) else: sigma2_s = b_sig[i] * invgamma.rvs(a_sig[i]) w_sample[i] = np.random.multivariate_normal( w_mu[i], sigma2_s * w_cov[i]) if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. # when target network updates we update our posterior belifes # and transfering information from the old target # to our new target blr_update += 1 if blr_update == 10: #10 print("updating posterior parameters") if blr_params.no_prior: phiphiT, phiY, w_mu, w_cov, a_sig, b_sig = BayesRegNoPrior( phiphiT, phiY, w_target, replay_buffer, feat, feat_target, target, num_actions, blr_params, w_mu, w_cov, sess.run(last_layer_weights), prior, blr_ops, blr_helpers) else: phiphiT, phiY, w_mu, w_cov, a_sig, b_sig = BayesRegWithPrior( phiphiT, phiY, w_target, replay_buffer, feat, feat_target, target, num_actions, blr_params, w_mu, w_cov, sess.run(last_layer_weights)) blr_update = 0 print("updateing target, steps {}".format(t)) update_target() w_target = w_mu mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) mean_10ep_reward = round(np.mean(episode_rewards[-11:-1]), 1) num_episodes = len(episode_rewards) # if done and print_freq is not None and len(episode_rewards) % print_freq == 0: if t % 10000 == 0: #1000 logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("mean 10 episode reward", mean_10ep_reward) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}" .format(saved_mean_reward, mean_100ep_reward)) save_variables(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) load_variables(model_file) return act
# Save the model and training state. if num_iters > 0 and (num_iters % args.save_freq == 0 or info["steps"] > args.num_steps): maybe_save_model(savedir, container, { 'replay_buffer': replay_buffer, 'num_iters': num_iters, 'monitor_state': monitored_env.get_state(), }) if info["steps"] > args.num_steps: break if done: steps_left = args.num_steps - info["steps"] completion = np.round(info["steps"] / args.num_steps, 1) logger.record_tabular("% completion", completion) logger.record_tabular("steps", info["steps"]) logger.record_tabular("iters", num_iters) logger.record_tabular("episodes", len(info["rewards"])) logger.record_tabular("reward (100 epi mean)", np.mean(info["rewards"][-100:])) logger.record_tabular("exploration", exploration.value(num_iters)) if args.prioritized: logger.record_tabular("max priority", replay_buffer._max_priority) fps_estimate = (float(steps_per_iter) / (float(iteration_time_est) + 1e-6) if steps_per_iter._value is not None else "calculating...") logger.dump_tabular() logger.log() logger.log("ETA: " + pretty_eta(int(steps_left / fps_estimate))) logger.log()
def learn( env, network, seed=None, lr=5e-4, total_timesteps=100000, buffer_size=1000000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=10, #100 checkpoint_freq=10000, checkpoint_path=None, learning_starts=50000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, param_noise=False, callback=None, load_path=None, ddqn=False, prior=False, save_freq=True, save_freq_rate=1000000, **network_kwargs): """Train a deepq model. Parameters ------- env: gym.Env environment to train on network: string or a function neural network to use as a q function approximator. If string, has to be one of the names of registered models in baselines.common.models (mlp, cnn, conv_only). If a function, should take an observation tensor and return a latent variable tensor, which will be mapped to the Q function heads (see build_q_func in baselines.deepq.models for details on that) seed: int or None prng seed. The runs with the same seed "should" give the same results. If None, no seeding is used. lr: float learning rate for adam optimizer total_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to total_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. param_noise: bool whether or not to use parameter space noise (https://arxiv.org/abs/1706.01905) callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. load_path: str path to load the model from. (default: None) **network_kwargs additional keyword arguments to pass to the network builder. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ checkpoint_path = logger.get_dir() # Create all the functions necessary to train the model sess = get_session() set_global_seeds(seed) blr_params = BLRParams() # q_func = build_q_func(network, **network_kwargs) q_func = deepq.models.cnn_to_mlp(convs=[(32, 8, 4), (64, 4, 2), (64, 3, 1)], hiddens=[blr_params.feat_dim], dueling=bool(0), neural_linear=True) # capture the shape outside the closure so that the env object is not serialized # by cloudpickle when serializing make_obs_ph observation_space = env.observation_space def make_obs_ph(name): return ObservationInput(observation_space, name=name) act, train, update_target, debug, feat, blr_ops = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=env.action_space.n, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, param_noise=param_noise, double_q=ddqn) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': env.action_space.n, } act = ActWrapper(act, act_params) # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = total_timesteps beta_schedule = LinearSchedule(prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) beta_schedule = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * total_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() reset = True with tempfile.TemporaryDirectory() as td: td = checkpoint_path or td model_file = os.path.join(td, "best_model") model_saved = False if tf.train.latest_checkpoint(td) is not None: load_variables(model_file) logger.log('Loaded model from {}'.format(model_file)) model_saved = True elif load_path is not None: load_variables(load_path) logger.log('Loaded model from {}'.format(load_path)) for t in range(total_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value # if t % 10000 == 0: # print("{}/{}".format(t,total_timesteps)) kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log(1. - exploration.value( t) + exploration.value(t) / float(env.action_space.n)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act(np.array(obs)[None], update_eps=update_eps, **kwargs)[0] env_action = action reset = False new_obs, rew, done, _ = env.step(env_action) # Store transition in the replay buffer. replay_buffer.add(obs, action, rew, new_obs, float(done)) obs = new_obs episode_rewards[-1] += rew if done: obs = env.reset() episode_rewards.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. print("updateing target, steps {}".format(t)) update_target() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) mean_10ep_reward = round(np.mean(episode_rewards[-11:-1]), 1) num_episodes = len(episode_rewards) # if done and print_freq is not None and len(episode_rewards) % print_freq == 0: if t % 1000 == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("mean 10 episode reward", mean_100ep_reward) logger.dump_tabular() if save_freq: if t > 0 and t % save_freq_rate == 0: print("saving model periodically") temp_model_file = os.path.join( checkpoint_path, "model_{}".format(t // checkpoint_freq)) save_variables(temp_model_file) phiphiT, phiY = calculate_precision(replay_buffer, env.action_space.n, blr_ops, blr_params, n_samples=100000) print("saving data to:") print( osp.join( checkpoint_path, "phiphiT_{}.pickle".format(t // checkpoint_freq))) with open( osp.join( checkpoint_path, "phiphiT_{}.pickle".format( t // checkpoint_freq)), 'wb') as f: pickle.dump(phiphiT, f) with open( osp.join( checkpoint_path, "phiY_{}.pickle".format(t // checkpoint_freq)), 'wb') as f: pickle.dump(phiphiT, f) if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}" .format(saved_mean_reward, mean_100ep_reward)) save_variables(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) load_variables(model_file) return act
def learn(env, q_func, num_actions=4, lr=5e-4, max_timesteps=100000, buffer_size=50000, exploration_fraction=0.1, exploration_final_eps=0.02, train_freq=1, batch_size=32, print_freq=1, checkpoint_freq=10000, learning_starts=1000, gamma=1.0, target_network_update_freq=500, prioritized_replay=False, prioritized_replay_alpha=0.6, prioritized_replay_beta0=0.4, prioritized_replay_beta_iters=None, prioritized_replay_eps=1e-6, num_cpu=16, param_noise=False, param_noise_threshold=0.05, callback=None): """Train a deepq model. Parameters ------- env: pysc2.env.SC2Env environment to train on q_func: (tf.Variable, int, str, bool) -> tf.Variable the model that takes the following inputs: observation_in: object the output of observation placeholder num_actions: int number of actions scope: str reuse: bool should be passed to outer variable scope and returns a tensor of shape (batch_size, num_actions) with values of every action. lr: float learning rate for adam optimizer max_timesteps: int number of env steps to optimizer for buffer_size: int size of the replay buffer exploration_fraction: float fraction of entire training period over which the exploration rate is annealed exploration_final_eps: float final value of random action probability train_freq: int update the model every `train_freq` steps. set to None to disable printing batch_size: int size of a batched sampled from replay buffer for training print_freq: int how often to print out training progress set to None to disable printing checkpoint_freq: int how often to save the model. This is so that the best version is restored at the end of the training. If you do not wish to restore the best version at the end of the training set this variable to None. learning_starts: int how many steps of the model to collect transitions for before learning starts gamma: float discount factor target_network_update_freq: int update the target network every `target_network_update_freq` steps. prioritized_replay: True if True prioritized replay buffer will be used. prioritized_replay_alpha: float alpha parameter for prioritized replay buffer prioritized_replay_beta0: float initial value of beta for prioritized replay buffer prioritized_replay_beta_iters: int number of iterations over which beta will be annealed from initial value to 1.0. If set to None equals to max_timesteps. prioritized_replay_eps: float epsilon to add to the TD errors when updating priorities. num_cpu: int number of cpus to use for training callback: (locals, globals) -> None function called at every steps with state of the algorithm. If callback returns true training stops. Returns ------- act: ActWrapper Wrapper over act function. Adds ability to save it and load it. See header of baselines/deepq/categorical.py for details on the act function. """ # Create all the functions necessary to train the model sess = U.make_session(num_cpu=num_cpu) sess.__enter__() def make_obs_ph(name): return U_b.BatchInput((32, 32), name=name) act, train, update_target, debug = deepq.build_train( make_obs_ph=make_obs_ph, q_func=q_func, num_actions=num_actions, optimizer=tf.train.AdamOptimizer(learning_rate=lr), gamma=gamma, grad_norm_clipping=10, scope="deepq") # # act_y, train_y, update_target_y, debug_y = deepq.build_train( # make_obs_ph=make_obs_ph, # q_func=q_func, # num_actions=num_actions, # optimizer=tf.train.AdamOptimizer(learning_rate=lr), # gamma=gamma, # grad_norm_clipping=10, # scope="deepq_y" # ) act_params = { 'make_obs_ph': make_obs_ph, 'q_func': q_func, 'num_actions': num_actions, } # Create the replay buffer if prioritized_replay: replay_buffer = PrioritizedReplayBuffer( buffer_size, alpha=prioritized_replay_alpha) # replay_buffer_y = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha) if prioritized_replay_beta_iters is None: prioritized_replay_beta_iters = max_timesteps beta_schedule = LinearSchedule( prioritized_replay_beta_iters, initial_p=prioritized_replay_beta0, final_p=1.0) # beta_schedule_y = LinearSchedule(prioritized_replay_beta_iters, # initial_p=prioritized_replay_beta0, # final_p=1.0) else: replay_buffer = ReplayBuffer(buffer_size) # replay_buffer_y = ReplayBuffer(buffer_size) beta_schedule = None # beta_schedule_y = None # Create the schedule for exploration starting from 1. exploration = LinearSchedule( schedule_timesteps=int(exploration_fraction * max_timesteps), initial_p=1.0, final_p=exploration_final_eps) # Initialize the parameters and copy them to the target network. U.initialize() update_target() # update_target_y() episode_rewards = [0.0] saved_mean_reward = None obs = env.reset() # Select all marines first obs = env.step( actions=[sc2_actions.FunctionCall(_SELECT_ARMY, [_SELECT_ALL])]) player_relative = obs[0].observation["feature_screen"][_PLAYER_RELATIVE] screen = (player_relative == _PLAYER_NEUTRAL).astype(int) #+ path_memory # print('screen.shape',screen.shape) player_y, player_x = (player_relative == _PLAYER_FRIENDLY).nonzero() player = [int(player_x.mean()), int(player_y.mean())] # shift函数就是对屏幕视角进行中心化移动, 因为player包含在screen里面 if (player[0] > 16): screen = shift(LEFT, player[0] - 16, screen) elif (player[0] < 16): screen = shift(RIGHT, 16 - player[0], screen) if (player[1] > 16): screen = shift(UP, player[1] - 16, screen) elif (player[1] < 16): screen = shift(DOWN, 16 - player[1], screen) reset = True with tempfile.TemporaryDirectory() as td: model_saved = False model_file = os.path.join("model/", "mineral_shards") print(model_file) for t in range(max_timesteps): if callback is not None: if callback(locals(), globals()): break # Take action and update exploration to the newest value kwargs = {} if not param_noise: update_eps = exploration.value(t) update_param_noise_threshold = 0. else: update_eps = 0. if param_noise_threshold >= 0.: update_param_noise_threshold = param_noise_threshold else: # Compute the threshold such that the KL divergence between perturbed and non-perturbed # policy is comparable to eps-greedy exploration with eps = exploration.value(t). # See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017 # for detailed explanation. update_param_noise_threshold = -np.log( 1. - exploration.value(t) + exploration.value(t) / float(num_actions)) kwargs['reset'] = reset kwargs[ 'update_param_noise_threshold'] = update_param_noise_threshold kwargs['update_param_noise_scale'] = True action = act( np.array(screen)[None], update_eps=update_eps, **kwargs)[0] # print(action) 0 1 2 3 # action_y = act_y(np.array(screen)[None], update_eps=update_eps, **kwargs)[0] reset = False coord = [player[0], player[1]] # print('player[0]=', player[0]) # print('player[1]=', player[1]) rew = 0 if (action == 0): #UP 往上到对称的地方或直接到边缘 #这里设置移动的步长都是8 if (player[1] >= 8): coord = [player[0], player[1] - 8] #path_memory_[player[1] - 16 : player[1], player[0]] = -1 elif (player[1] > 0): coord = [player[0], 0] #path_memory_[0 : player[1], player[0]] = -1 #else: # rew -= 1 elif (action == 1): #DOWN if (player[1] <= 23): coord = [player[0], player[1] + 8] #path_memory_[player[1] : player[1] + 16, player[0]] = -1 elif (player[1] > 23): coord = [player[0], 31] #path_memory_[player[1] : 63, player[0]] = -1 #else: # rew -= 1 elif (action == 2): #LEFT if (player[0] >= 8): coord = [player[0] - 8, player[1]] #path_memory_[player[1], player[0] - 16 : player[0]] = -1 elif (player[0] < 8): coord = [0, player[1]] #path_memory_[player[1], 0 : player[0]] = -1 #else: # rew -= 1 elif (action == 3): #RIGHT if (player[0] <= 23): coord = [player[0] + 8, player[1]] #path_memory_[player[1], player[0] : player[0] + 16] = -1 elif (player[0] > 23): coord = [31, player[1]] #path_memory_[player[1], player[0] : 63] = -1 if _MOVE_SCREEN not in obs[0].observation["available_actions"]: obs = env.step(actions=[ sc2_actions.FunctionCall(_SELECT_ARMY, [_SELECT_ALL]) ]) new_action = [ sc2_actions.FunctionCall(_MOVE_SCREEN, [_NOT_QUEUED, coord]) ] # else: # new_action = [sc2_actions.FunctionCall(_NO_OP, [])] obs = env.step(actions=new_action) player_relative = obs[0].observation["feature_screen"][_PLAYER_RELATIVE] new_screen = (player_relative == _PLAYER_NEUTRAL).astype( int) #+ path_memory # print(new_screen.shape) 32x32 player_y, player_x = ( player_relative == _PLAYER_FRIENDLY).nonzero() player = [int(player_x.mean()), int(player_y.mean())] if (player[0] > 16): new_screen = shift(LEFT, player[0] - 16, new_screen) elif (player[0] < 16): new_screen = shift(RIGHT, 16 - player[0], new_screen) if (player[1] > 16): new_screen = shift(UP, player[1] - 16, new_screen) elif (player[1] < 16): new_screen = shift(DOWN, 16 - player[1], new_screen) rew = obs[0].reward done = obs[0].step_type == environment.StepType.LAST # Store transition in the replay buffer. replay_buffer.add(screen, action, rew, new_screen, float(done)) # replay_buffer_y.add(screen, action_y, rew, new_screen, float(done)) screen = new_screen episode_rewards[-1] += rew reward = episode_rewards[-1] if done: obs = env.reset() player_relative = obs[0].observation["feature_screen"][ _PLAYER_RELATIVE] screen = (player_relative == _PLAYER_NEUTRAL).astype( int) #+ path_memory player_y, player_x = ( player_relative == _PLAYER_FRIENDLY).nonzero() player = [int(player_x.mean()), int(player_y.mean())] # Select all marines first env.step(actions=[ sc2_actions.FunctionCall(_SELECT_ARMY, [_SELECT_ALL]) ]) print('num_episodes is', len(episode_rewards)) episode_rewards.append(0.0) #episode_minerals.append(0.0) reset = True if t > learning_starts and t % train_freq == 0: # Minimize the error in Bellman's equation on a batch sampled from replay buffer. if prioritized_replay: experience = replay_buffer.sample( batch_size, beta=beta_schedule.value(t)) (obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience # experience_y = replay_buffer.sample(batch_size, beta=beta_schedule.value(t)) # (obses_t_y, actions_y, rewards_y, obses_tp1_y, dones_y, weights_y, batch_idxes_y) = experience_y else: obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample( batch_size) weights, batch_idxes = np.ones_like(rewards), None # obses_t_y, actions_y, rewards_y, obses_tp1_y, dones_y = replay_buffer_y.sample(batch_size) # weights_y, batch_idxes_y = np.ones_like(rewards_y), None td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights) # td_errors_y = train_x(obses_t_y, actions_y, rewards_y, obses_tp1_y, dones_y, weights_y) if prioritized_replay: new_priorities = np.abs(td_errors) + prioritized_replay_eps # new_priorities = np.abs(td_errors) + prioritized_replay_eps replay_buffer.update_priorities(batch_idxes, new_priorities) # replay_buffer.update_priorities(batch_idxes, new_priorities) if t > learning_starts and t % target_network_update_freq == 0: # Update target network periodically. update_target() # update_target_y() mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1) num_episodes = len(episode_rewards) if done and print_freq is not None and len( episode_rewards) % print_freq == 0: logger.record_tabular("steps", t) logger.record_tabular("episodes", num_episodes) logger.record_tabular("reward", reward) logger.record_tabular("mean 100 episode reward", mean_100ep_reward) logger.record_tabular("% time spent exploring", int(100 * exploration.value(t))) logger.dump_tabular() if (checkpoint_freq is not None and t > learning_starts and num_episodes > 100 and t % checkpoint_freq == 0): if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward: if print_freq is not None: logger.log( "Saving model due to mean reward increase: {} -> {}". format(saved_mean_reward, mean_100ep_reward)) U.save_state(model_file) model_saved = True saved_mean_reward = mean_100ep_reward if model_saved: if print_freq is not None: logger.log("Restored model with mean reward: {}".format( saved_mean_reward)) U.load_state(model_file) return ActWrapper(act)
def learn( *, network, env, eval_env, make_eval_env, env_id, seed, beta, total_timesteps, sil_update, sil_loss, timesteps_per_batch, # what to train on #num_samples=(1500,), num_samples=(1, ), #horizon=(5,), horizon=(2, ), #num_elites=(10,), num_elites=(1, ), max_kl=0.001, cg_iters=10, gamma=0.99, lam=1.0, # advantage estimation ent_coef=0.0, lr=3e-4, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters=5, sil_value=0.01, sil_alpha=0.6, sil_beta=0.1, max_episodes=0, max_iters=0, # time constraint callback=None, save_interval=0, load_path=None, model_fn=None, update_fn=None, init_fn=None, mpi_rank_weight=1, comm=None, vf_coef=0.5, max_grad_norm=0.5, log_interval=1, nminibatches=4, noptepochs=4, cliprange=0.2, TRPO=False, # MBL # For train mbl mbl_train_freq=5, # For eval num_eval_episodes=5, eval_freq=5, vis_eval=False, eval_targs=('mbmf', ), #eval_targs=('mf',), quant=2, # For mbl.step mbl_lamb=(1.0, ), mbl_gamma=0.99, #mbl_sh=1, # Number of step for stochastic sampling mbl_sh=10000, #vf_lookahead=-1, #use_max_vf=False, reset_per_step=(0, ), # For get_model num_fc=2, num_fwd_hidden=500, use_layer_norm=False, # For MBL num_warm_start=int(1e4), init_epochs=10, update_epochs=5, batch_size=512, update_with_validation=False, use_mean_elites=1, use_ent_adjust=0, adj_std_scale=0.5, # For data loading validation_set_path=None, # For data collect collect_val_data=False, # For traj collect traj_collect='mf', # For profile measure_time=True, eval_val_err=False, measure_rew=True, **network_kwargs): ''' learn a policy function with TRPO algorithm Parameters: ---------- network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types) or function that takes input placeholder and returns tuple (output, None) for feedforward nets or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class timesteps_per_batch timesteps per gradient estimation batch max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) ) ent_coef coefficient of policy entropy term in the optimization objective cg_iters number of iterations of conjugate gradient algorithm cg_damping conjugate gradient damping vf_stepsize learning rate for adam optimizer used to optimie value function loss vf_iters number of iterations of value function optimization iterations per each policy optimization step total_timesteps max number of timesteps max_episodes max number of episodes max_iters maximum number of policy optimization iterations callback function to be called with (locals(), globals()) each policy optimization step load_path str, path to load the model from (default: None, i.e. no model is loaded) **network_kwargs keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network Returns: ------- learnt model ''' if not isinstance(num_samples, tuple): num_samples = (num_samples, ) if not isinstance(horizon, tuple): horizon = (horizon, ) if not isinstance(num_elites, tuple): num_elites = (num_elites, ) if not isinstance(mbl_lamb, tuple): mbl_lamb = (mbl_lamb, ) if not isinstance(reset_per_step, tuple): reset_per_step = (reset_per_step, ) if validation_set_path is None: if collect_val_data: validation_set_path = os.path.join(logger.get_dir(), 'val.pkl') else: validation_set_path = os.path.join('dataset', '{}-val.pkl'.format(env_id)) if eval_val_err: eval_val_err_path = os.path.join('dataset', '{}-combine-val.pkl'.format(env_id)) logger.log(locals()) logger.log('MBL_SH', mbl_sh) logger.log('Traj_collect', traj_collect) set_global_seeds(seed) if isinstance(lr, float): lr = constfn(lr) else: assert callable(lr) if isinstance(cliprange, float): cliprange = constfn(cliprange) else: assert callable(cliprange) nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() if MPI is not None: nworkers = MPI.COMM_WORLD.Get_size() rank = MPI.COMM_WORLD.Get_rank() else: nworkers = 1 rank = 0 cpus_per_worker = 1 U.get_session( config=tf.ConfigProto(allow_soft_placement=True, inter_op_parallelism_threads=cpus_per_worker, intra_op_parallelism_threads=cpus_per_worker)) policy = build_policy(env, network, value_network='copy', copos=True, **network_kwargs) nenvs = env.num_envs np.set_printoptions(precision=3) # Setup losses and stuff # ---------------------------------------- ob_space = env.observation_space ac_space = env.action_space nbatch = nenvs * timesteps_per_batch nbatch_train = nbatch // nminibatches is_mpi_root = (MPI is None or MPI.COMM_WORLD.Get_rank() == 0) if model_fn is None: model_fn = Model discrete_ac_space = isinstance(ac_space, gym.spaces.Discrete) ob = observation_placeholder(ob_space) with tf.variable_scope("pi"): pi = policy(observ_placeholder=ob) make_model = lambda: Model( policy=policy, ob_space=ob_space, ac_space=ac_space, nbatch_act=nenvs, nbatch_train=nbatch_train, nsteps=timesteps_per_batch, ent_coef=ent_coef, vf_coef=vf_coef, max_grad_norm=max_grad_norm, sil_update=sil_update, sil_value=sil_value, sil_alpha=sil_alpha, sil_beta=sil_beta, sil_loss=sil_loss, # fn_reward=env.process_reward, fn_reward=None, # fn_obs=env.process_obs, fn_obs=None, ppo=False, prev_pi='pi', silm=pi) model = make_model() if load_path is not None: model.load(load_path) with tf.variable_scope("oldpi"): oldpi = policy(observ_placeholder=ob) make_old_model = lambda: Model( policy=policy, ob_space=ob_space, ac_space=ac_space, nbatch_act=nenvs, nbatch_train=nbatch_train, nsteps=timesteps_per_batch, ent_coef=ent_coef, vf_coef=vf_coef, max_grad_norm=max_grad_norm, sil_update=sil_update, sil_value=sil_value, sil_alpha=sil_alpha, sil_beta=sil_beta, sil_loss=sil_loss, # fn_reward=env.process_reward, fn_reward=None, # fn_obs=env.process_obs, fn_obs=None, ppo=False, prev_pi='oldpi', silm=oldpi) old_model = make_old_model() # MBL # --------------------------------------- #viz = Visdom(env=env_id) win = None eval_targs = list(eval_targs) logger.log(eval_targs) make_model_f = get_make_mlp_model(num_fc=num_fc, num_fwd_hidden=num_fwd_hidden, layer_norm=use_layer_norm) mbl = MBL(env=eval_env, env_id=env_id, make_model=make_model_f, num_warm_start=num_warm_start, init_epochs=init_epochs, update_epochs=update_epochs, batch_size=batch_size, **network_kwargs) val_dataset = {'ob': None, 'ac': None, 'ob_next': None} if update_with_validation: logger.log('Update with validation') val_dataset = load_val_data(validation_set_path) if eval_val_err: logger.log('Log val error') eval_val_dataset = load_val_data(eval_val_err_path) if collect_val_data: logger.log('Collect validation data') val_dataset_collect = [] def _mf_pi(ob, t=None): stochastic = True ac, vpred, _, _ = pi.step(ob, stochastic=stochastic) return ac, vpred def _mf_det_pi(ob, t=None): #ac, vpred, _, _ = pi.step(ob, stochastic=False) ac, vpred = pi._evaluate([pi.pd.mode(), pi.vf], ob) return ac, vpred def _mf_ent_pi(ob, t=None): mean, std, vpred = pi._evaluate([pi.pd.mode(), pi.pd.std, pi.vf], ob) ac = np.random.normal(mean, std * adj_std_scale, size=mean.shape) return ac, vpred ################### use_ent_adjust======> adj_std_scale????????pi action sample def _mbmf_inner_pi(ob, t=0): if use_ent_adjust: return _mf_ent_pi(ob) else: #return _mf_pi(ob) if t < mbl_sh: return _mf_pi(ob) else: return _mf_det_pi(ob) # --------------------------------------- # Run multiple configuration once all_eval_descs = [] def make_mbmf_pi(n, h, e, l): def _mbmf_pi(ob): ac, rew = mbl.step(ob=ob, pi=_mbmf_inner_pi, horizon=h, num_samples=n, num_elites=e, gamma=mbl_gamma, lamb=l, use_mean_elites=use_mean_elites) return ac[None], rew return Policy(step=_mbmf_pi, reset=None) for n in num_samples: for h in horizon: for l in mbl_lamb: for e in num_elites: if 'mbmf' in eval_targs: all_eval_descs.append(('MeanRew', 'MBL_COPOS_SIL', make_mbmf_pi(n, h, e, l))) #if 'mbmf' in eval_targs: all_eval_descs.append(('MeanRew-n-{}-h-{}-e-{}-l-{}-sh-{}-me-{}'.format(n, h, e, l, mbl_sh, use_mean_elites), 'MBL_TRPO-n-{}-h-{}-e-{}-l-{}-sh-{}-me-{}'.format(n, h, e, l, mbl_sh, use_mean_elites), make_mbmf_pi(n, h, e, l))) if 'mf' in eval_targs: all_eval_descs.append( ('MeanRew', 'COPOS_SIL', Policy(step=_mf_pi, reset=None))) logger.log('List of evaluation targets') for it in all_eval_descs: logger.log(it[0]) pool = Pool(mp.cpu_count()) warm_start_done = False # ---------------------------------------- atarg = tf.placeholder( dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return ac = pi.pdtype.sample_placeholder([None]) kloldnew = oldpi.pd.kl(pi.pd) ent = pi.pd.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) entbonus = ent_coef * meanent vferr = tf.reduce_mean(tf.square(pi.vf - ret)) ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold surrgain = tf.reduce_mean(ratio * atarg) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = get_trainable_variables("pi") # var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")] # vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")] var_list = get_pi_trainable_variables("pi") vf_var_list = get_vf_trainable_variables("pi") vfadam = MpiAdam(vf_var_list) get_flat = U.GetFlat(var_list) set_from_flat = U.SetFromFlat(var_list) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: sz = U.intprod(shape) tangents.append(tf.reshape(flat_tangent[start:start + sz], shape)) start += sz gvp = tf.add_n([ tf.reduce_sum(g * tangent) for (g, tangent) in zipsame(klgrads, tangents) ]) #pylint: disable=E1111 fvp = U.flatgrad(gvp, var_list) assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi")) ]) compute_losses = U.function([ob, ac, atarg], losses) compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)]) compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp) compute_vflossandgrad = U.function([ob, ret], U.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if rank == 0: print(colorize(msg, color='magenta')) tstart = time.time() yield print( colorize("done in %.3f seconds" % (time.time() - tstart), color='magenta')) else: yield def allmean(x): assert isinstance(x, np.ndarray) out = np.empty_like(x) MPI.COMM_WORLD.Allreduce(x, out, op=MPI.SUM) out /= nworkers return out U.initialize() if load_path is not None: pi.load(load_path) th_init = get_flat() MPI.COMM_WORLD.Bcast(th_init, root=0) set_from_flat(th_init) vfadam.sync() print("Init param sum", th_init.sum(), flush=True) # Initialize eta, omega optimizer if discrete_ac_space: init_eta = 1 init_omega = 0.5 eta_omega_optimizer = EtaOmegaOptimizerDiscrete( beta, max_kl, init_eta, init_omega) else: init_eta = 0.5 init_omega = 2.0 #????eta_omega_optimizer details????? eta_omega_optimizer = EtaOmegaOptimizer(beta, max_kl, init_eta, init_omega) # Prepare for rollouts # ---------------------------------------- if traj_collect == 'mf': seg_gen = traj_segment_generator(env, timesteps_per_batch, model, stochastic=True) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards if sum([max_iters > 0, total_timesteps > 0, max_episodes > 0]) == 0: # noththing to be done return pi assert sum([max_iters>0, total_timesteps>0, max_episodes>0]) < 2, \ 'out of max_iters, total_timesteps, and max_episodes only one should be specified' while True: if callback: callback(locals(), globals()) if total_timesteps and timesteps_so_far >= total_timesteps: break elif max_episodes and episodes_so_far >= max_episodes: break elif max_iters and iters_so_far >= max_iters: break logger.log("********** Iteration %i ************" % iters_so_far) with timed("sampling"): seg = seg_gen.__next__() if traj_collect == 'mf-random' or traj_collect == 'mf-mb': seg_mbl = seg_gen_mbl.__next__() else: seg_mbl = seg add_vtarg_and_adv(seg, gamma, lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) ob, ac, atarg, tdlamret = seg["ob"], seg["ac"], seg["adv"], seg[ "tdlamret"] # Val data collection if collect_val_data: for ob_, ac_, ob_next_ in zip(ob[:-1, 0, ...], ac[:-1, ...], ob[1:, 0, ...]): val_dataset_collect.append( (copy.copy(ob_), copy.copy(ac_), copy.copy(ob_next_))) # ----------------------------- # MBL update else: ob_mbl, ac_mbl = seg_mbl["ob"], seg_mbl["ac"] mbl.add_data_batch(ob_mbl[:-1, 0, ...], ac_mbl[:-1, ...], ob_mbl[1:, 0, ...]) mbl.update_forward_dynamic(require_update=iters_so_far % mbl_train_freq == 0, ob_val=val_dataset['ob'], ac_val=val_dataset['ac'], ob_next_val=val_dataset['ob_next']) # ----------------------------- if traj_collect == 'mf': #if traj_collect == 'mf' or traj_collect == 'mf-random' or traj_collect == 'mf-mb': vpredbefore = seg[ "vpred"] # predicted value function before udpate model = seg["model"] atarg = (atarg - atarg.mean()) / atarg.std( ) # standardized advantage function estimate if hasattr(pi, "ret_rms"): pi.ret_rms.update(tdlamret) if hasattr(pi, "rms"): pi.rms.update(ob) # update running mean/std for policy args = seg["ob"], seg["ac"], atarg fvpargs = [arr[::5] for arr in args] def fisher_vector_product(p): return allmean(compute_fvp(p, *fvpargs)) + cg_damping * p assign_old_eq_new( ) # set old parameter values to new parameter values with timed("computegrad"): *lossbefore, g = compute_lossandgrad(*args) lossbefore = allmean(np.array(lossbefore)) g = allmean(g) if np.allclose(g, 0): logger.log("Got zero gradient. not updating") else: with timed("cg"): stepdir = cg(fisher_vector_product, g, cg_iters=cg_iters, verbose=rank == 0) assert np.isfinite(stepdir).all() if TRPO: shs = .5 * stepdir.dot(fisher_vector_product(stepdir)) lm = np.sqrt(shs / max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lm expectedimprove = g.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize set_from_flat(thnew) meanlosses = surr, kl, *_ = allmean( np.array(compute_losses(*args))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f" % (expectedimprove, improve)) if not np.isfinite(meanlosses).all(): logger.log( "Got non-finite value of losses -- bad!") elif kl > max_kl * 1.5: logger.log( "violated KL constraint. shrinking step.") elif improve < 0: logger.log( "surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") set_from_flat(thbefore) else: copos_update_dir = stepdir # Split direction into log-linear 'w_theta' and non-linear 'w_beta' parts w_theta, w_beta = pi.split_w(copos_update_dir) tmp_ob = np.zeros( (1, ) + env.observation_space.shape ) # We assume that entropy does not depend on the NN # Optimize eta and omega if discrete_ac_space: entropy = lossbefore[4] #entropy = - 1/timesteps_per_batch * np.sum(np.sum(pi.get_action_prob(ob) * pi.get_log_action_prob(ob), axis=1)) eta, omega = eta_omega_optimizer.optimize( pi.compute_F_w(ob, copos_update_dir), pi.get_log_action_prob(ob), timesteps_per_batch, entropy) else: Waa, Wsa = pi.w2W(w_theta) wa = pi.get_wa(ob, w_beta) varphis = pi.get_varphis(ob) #old_ent = old_entropy.eval({oldpi.ob: tmp_ob})[0] old_ent = lossbefore[4] eta, omega = eta_omega_optimizer.optimize( w_theta, Waa, Wsa, wa, varphis, pi.get_kt(), pi.get_prec_matrix(), pi.is_new_policy_valid, old_ent) logger.log("Initial eta: " + str(eta) + " and omega: " + str(omega)) current_theta_beta = get_flat() prev_theta, prev_beta = pi.all_to_theta_beta( current_theta_beta) if discrete_ac_space: # Do a line search for both theta and beta parameters by adjusting only eta eta = eta_search(w_theta, w_beta, eta, omega, allmean, compute_losses, get_flat, set_from_flat, pi, max_kl, args, discrete_ac_space) logger.log("Updated eta, eta: " + str(eta)) set_from_flat( pi.theta_beta_to_all(prev_theta, prev_beta)) # Find proper omega for new eta. Use old policy parameters first. eta, omega = eta_omega_optimizer.optimize( pi.compute_F_w(ob, copos_update_dir), pi.get_log_action_prob(ob), timesteps_per_batch, entropy, eta) logger.log("Updated omega, eta: " + str(eta) + " and omega: " + str(omega)) # do line search for ratio for non-linear "beta" parameter values #ratio = beta_ratio_line_search(w_theta, w_beta, eta, omega, allmean, compute_losses, get_flat, set_from_flat, pi, # max_kl, beta, args) # set ratio to 1 if we do not use beta ratio line search ratio = 1 #print("ratio from line search: " + str(ratio)) cur_theta = (eta * prev_theta + w_theta.reshape(-1, )) / (eta + omega) cur_beta = prev_beta + ratio * w_beta.reshape( -1, ) / eta else: for i in range(2): # Do a line search for both theta and beta parameters by adjusting only eta eta = eta_search(w_theta, w_beta, eta, omega, allmean, compute_losses, get_flat, set_from_flat, pi, max_kl, args) logger.log("Updated eta, eta: " + str(eta) + " and omega: " + str(omega)) # Find proper omega for new eta. Use old policy parameters first. set_from_flat( pi.theta_beta_to_all(prev_theta, prev_beta)) eta, omega = \ eta_omega_optimizer.optimize(w_theta, Waa, Wsa, wa, varphis, pi.get_kt(), pi.get_prec_matrix(), pi.is_new_policy_valid, old_ent, eta) logger.log("Updated omega, eta: " + str(eta) + " and omega: " + str(omega)) # Use final policy logger.log("Final eta: " + str(eta) + " and omega: " + str(omega)) cur_theta = (eta * prev_theta + w_theta.reshape(-1, )) / (eta + omega) cur_beta = prev_beta + w_beta.reshape(-1, ) / eta set_from_flat(pi.theta_beta_to_all(cur_theta, cur_beta)) meanlosses = surr, kl, *_ = allmean( np.array(compute_losses(*args))) ##copos specific over if nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather( (thnew.sum(), vfadam.getflat().sum())) # list of tuples assert all( np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) #cg over for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) #policy update over with timed("vf"): for _ in range(vf_iters): for (mbob, mbret) in dataset.iterbatches( (seg["ob"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=64): g = allmean(compute_vflossandgrad(mbob, mbret)) vfadam.update(g, vf_stepsize) with timed("SIL"): lrnow = lr(1.0 - timesteps_so_far / total_timesteps) l_loss, sil_adv, sil_samples, sil_nlogp = model.sil_train( lrnow) logger.record_tabular("ev_tdlam_before", explained_variance(vpredbefore, tdlamret)) lrlocal = (seg["ep_lens"], seg["ep_rets"]) # local values if MPI is not None: listoflrpairs = MPI.COMM_WORLD.allgather(lrlocal) # list of tuples else: listoflrpairs = [lrlocal] lens, rews = map(flatten_lists, zip(*listoflrpairs)) lenbuffer.extend(lens) rewbuffer.extend(rews) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) timesteps_so_far += sum(lens) iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if sil_update > 0: logger.record_tabular("SilSamples", sil_samples) if rank == 0: # MBL evaluation if not collect_val_data: #set_global_seeds(seed) default_sess = tf.get_default_session() def multithread_eval_policy(env_, pi_, num_episodes_, vis_eval_, seed): with default_sess.as_default(): if hasattr(env, 'ob_rms') and hasattr(env_, 'ob_rms'): env_.ob_rms = env.ob_rms res = eval_policy(env_, pi_, num_episodes_, vis_eval_, seed, measure_time, measure_rew) try: env_.close() except: pass return res if mbl.is_warm_start_done() and iters_so_far % eval_freq == 0: warm_start_done = mbl.is_warm_start_done() if num_eval_episodes > 0: targs_names = {} with timed('eval'): num_descs = len(all_eval_descs) list_field_names = [e[0] for e in all_eval_descs] list_legend_names = [e[1] for e in all_eval_descs] list_pis = [e[2] for e in all_eval_descs] list_eval_envs = [ make_eval_env() for _ in range(num_descs) ] list_seed = [seed for _ in range(num_descs)] list_num_eval_episodes = [ num_eval_episodes for _ in range(num_descs) ] print(list_field_names) print(list_legend_names) list_vis_eval = [ vis_eval for _ in range(num_descs) ] for i in range(num_descs): field_name, legend_name = list_field_names[ i], list_legend_names[i], res = multithread_eval_policy( list_eval_envs[i], list_pis[i], list_num_eval_episodes[i], list_vis_eval[i], seed) #eval_results = pool.starmap(multithread_eval_policy, zip(list_eval_envs, list_pis, list_num_eval_episodes, list_vis_eval,list_seed)) #for field_name, legend_name, res in zip(list_field_names, list_legend_names, eval_results): perf, elapsed_time, eval_rew = res logger.record_tabular(field_name, perf) if measure_time: logger.record_tabular( 'Time-%s' % (field_name), elapsed_time) if measure_rew: logger.record_tabular( 'SimRew-%s' % (field_name), eval_rew) targs_names[field_name] = legend_name if eval_val_err: fwd_dynamics_err = mbl.eval_forward_dynamic( obs=eval_val_dataset['ob'], acs=eval_val_dataset['ac'], obs_next=eval_val_dataset['ob_next']) logger.record_tabular('FwdValError', fwd_dynamics_err) logger.dump_tabular() #print(logger.get_dir()) #print(targs_names) # if num_eval_episodes > 0: # win = plot(viz, win, logger.get_dir(), targs_names=targs_names, quant=quant, opt='best') # ----------- #logger.dump_tabular() yield pi if collect_val_data: with open(validation_set_path, 'wb') as f: pickle.dump(val_dataset_collect, f) logger.log('Save {} validation data'.format(len(val_dataset_collect)))