from sequence_handler import SequenceHandler from reagent import * import utils from user_handler import UserHandler from project_database_handler import ProjectDatabaseHandler from session import Session from exception import * dbConn = DatabaseConn() db = dbConn.databaseConnect() cursor = db.cursor() hostname = dbConn.getHostname() root_path = dbConn.getRootDir() dnaHandler = DNAHandler(db, cursor) protHandler = ProteinHandler(db, cursor) rHandler = ReagentHandler(db, cursor) oHandler = OligoHandler(db, cursor) propHandler = ReagentPropertyHandler(db, cursor) packetHandler = ProjectDatabaseHandler(db, cursor) propMapper = ReagentPropertyMapper(db, cursor) prop_Name_ID_Map = propMapper.mapPropNameID() # (prop name, prop id) prop_Category_Name_ID_Map = propMapper.mapPropCategoryNameID() # currUser is an INT user ID
def drawMap(): dbConn = DatabaseConn() db = dbConn.databaseConnect() cursor = db.cursor() hostname = dbConn.getHostname() root_path = dbConn.getRootDir() form = cgi.FieldStorage(keep_blank_values="True") #print "Content-type:text/html" #print #print `form` if form.has_key("rID"): rID = form.getvalue("rID") else: # script executed from command line # Worst-case scenarios #rID = 260 # V260 #rID = 230 # V260 #rID = 80 # V80 - ok #rID = 69661 # V2412 - not bad at all, just one of the oligos overlaps exactly with promoter (1 nt difference) #rID = 23999 # V59541 rID = 97918 #print rID if form.has_key("user_id_hidden"): userID = form.getvalue("user_id_hidden") else: # command-line execution userID = 1 # debug reagentID = rHandler.convertDatabaseToReagentID(rID) uPackets = getCurrentUserProjects(userID) #print "Content-type:text/html" #print #print reagentID uPackets.sort() #print `uPackets` namePropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["name"], prop_Category_Name_ID_Map["General Properties"]) statusPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["status"], prop_Category_Name_ID_Map["General Properties"]) projectPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["packet id"], prop_Category_Name_ID_Map["General Properties"]) rName = rHandler.findSimplePropertyValue(rID, namePropID) rTypeID = rHandler.findReagentTypeID(rID) try: os.remove(root_path + "Reagent/vector_maps/" + reagentID + "_Oligo_map.pdf") except OSError: pass #print root_path c = Canvas(root_path + "Reagent/vector_maps/" + reagentID + "_Oligo_map.pdf") c.setPageSize((1500,1500)) c.setStrokeColorRGB(0,0,0) c.saveState() # Draw circle origin = 0 origin_x = 750 origin_y = 750 radius = 200 c.circle(origin_x, origin_y, radius) c.restoreState() # Divide circle into 100-unit sectors rSeqID = rHandler.findDNASequenceKey(rID) rSeq = sHandler.findSequenceByID(rSeqID) seqLen = len(rSeq) #print "Content-type:text/html" #print #print `rID` unit_angle_measure = float(360) / float(seqLen) #print unit_angle_measure # Mark 1 on the circle - KEEP, Karen said! c.setLineWidth(1) c.setStrokeColor(black) c.setFillColor(black) c.saveState() path = c.beginPath() # Draw a triangle pointing down above the circle #path.moveTo(origin_x, origin_y+radius+7) #path.lineTo(origin_x-5, origin_y+radius+14) #path.lineTo(origin_x+5, origin_y+radius+14) #path.lineTo(origin_x, origin_y+radius+7) # Draw a triangle pointing up inside the circle #path.moveTo(origin_x, origin_y+radius-10) #path.lineTo(origin_x-5, origin_y+radius-14) #path.lineTo(origin_x+5, origin_y+radius-14) #path.lineTo(origin_x, origin_y+radius-10) # Draw a triangle pointing right inside the circle path.moveTo(origin_x, origin_y+radius-14) path.lineTo(origin_x, origin_y+radius-28) path.lineTo(origin_x+8, origin_y+radius-21) path.lineTo(origin_x, origin_y+radius-14) c.drawPath(path, True, True) # label 1 t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 16) #t.setTextOrigin(origin_x-5, origin_y+radius+19) # above circle t.setTextOrigin(origin_x-3, origin_y+radius-50) # above circle t.textOut("1") c.drawText(t) c.restoreState() # Calculate feature segment sizes sequenceFeatures = rHandler.findReagentSequenceFeatures(rID) #print `sequenceFeatures` # Draw legend ox_legend = 1280 oy_legend = 1465 prev_legend = oy_legend # draw frame c.setStrokeColor(darkgray) c.setFillColor(white) c.saveState() featureNames = rtPropHandler.findReagentTypeAttributeNamesByCategory(rTypeID, prop_Category_Name_ID_Map["DNA Sequence Features"]) featureNames.sort() if len(featureNames) > 15: origin_spacer = -19 coeff = 12 else: origin_spacer = 65 coeff = 15 origin_legend = prev_legend+origin_spacer-len(featureNames)*coeff x = (990 - origin_legend) / len(featureNames) #print x if x < 12: x = 12 # WHEN WANT TO ADJUST LEGEND GREY BOX HEIGHT: UPDATE THE VALUE ADDED TO legend_height AND THE VALUE SUBTRACTED FROM origin_legend legend_height = len(featureNames)*x + 55 c.rect(ox_legend-25, origin_legend-35, 215, legend_height, 1, 1) # good for specific rtype attributes c.restoreState() protocolPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["protocol"], prop_Category_Name_ID_Map["Classifiers"]) seqPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["sequence"], prop_Category_Name_ID_Map["DNA Sequence"]) sequenceFeatures = rHandler.findAllReagentFeatures(Vector(rID), rID) # Print reagent ID and size at the centre of the circle and print name at the top of the page c.setFont("Helvetica-Bold", 32) c.setFillColor(black) c.saveState() c.drawCentredString(origin_x, origin_y+35, reagentID) c.drawCentredString(origin_x, origin_y+10, "nt 1 - " + `seqLen`) if rName: c.setFillColor(blue) c.drawCentredString(origin_x, 1415, rName) c.restoreState() # find all Oligos whose protocol is 'sequencing' # April 26, 2010: Do not include status in this query, as it might just not be recorded for the oligo at all (early entries) cursor.execute("SELECT r.reagentID, r.groupID, s.sequence FROM Sequences_tbl s, ReagentPropList_tbl p1, ReagentPropList_tbl p2, Reagents_tbl r WHERE p1.propertyID=" + `protocolPropID` + " AND p1.propertyValue='sequencing' AND p1.reagentID=r.reagentID AND r.reagentTypeID='3' AND p1.reagentID=p2.reagentID AND p2.propertyID=" + `seqPropID` + " AND p2.propertyValue=s.seqID AND p1.status='ACTIVE' AND p2.status='ACTIVE' AND r.status='ACTIVE' AND s.status='ACTIVE'") #print "SELECT r.reagentID, r.groupID, s.sequence FROM Sequences_tbl s, ReagentPropList_tbl p1, ReagentPropList_tbl p2, Reagents_tbl r WHERE p1.propertyID=" + `protocolPropID` + " AND p1.propertyValue='sequencing' AND p1.reagentID=r.reagentID AND r.reagentTypeID='3' AND p1.reagentID=p2.reagentID AND p2.propertyID=" + `seqPropID` + " AND p2.propertyValue=s.seqID AND p1.status='ACTIVE' AND p2.status='ACTIVE' AND r.status='ACTIVE' AND s.status='ACTIVE'" results = cursor.fetchall() rSeq = utils.squeeze(rSeq).lower() #print rSeq oligoFeatures = [] oligoIDsDict = {} # O123 => 123 oligoNamesDict = {} # 123 => "O123 Name" oligoProjectDict = {} # 123 => 7 for result in results: if result: oligoID = int(result[0]) groupID = int(result[1]) oligo_lims_id = "O" + `groupID` oligoIDsDict[oligo_lims_id] = oligoID #print oligo_lims_id oligoName = rHandler.findSimplePropertyValue(oligoID, namePropID) # April 26, 2010, Karen's request: Ignore Oligos whose status is 'Failed' or 'Do Not Use' oligoStatus = rHandler.findSimplePropertyValue(oligoID, statusPropID) if oligoStatus: #print oligoStatus if oligoStatus.lower() == 'failed' or oligoStatus.lower() == 'do not use': continue if oligoName: oligoNamesDict[oligoID] = oligoName else: oligoNamesDict[oligoID] = "" #cursor.execute("SELECT propertyValue FROM ReagentPropList_tbl WHERE reagentID=" + `oligoID` + " AND propertyID=" + `namePropID` + " AND status='ACTIVE'") #result2 = cursor.fetchone() #if result2: #oligoName = result2[0] #oligoNamesDict[oligoID] = oligoName #else: #oligoNamesDict[oligoID] = "" # PROJECT - MUST CAST TO INT oligoPacket = int(rHandler.findSimplePropertyValue(oligoID, projectPropID)) #print oligoPacket if oligoPacket: if oligoPacket not in uPackets: #print oligoPacket continue #cursor.execute("SELECT propertyValue FROM ReagentPropList_tbl WHERE reagentID=" + `oligoID` + " AND propertyID=" + `projectPropID` + " AND status='ACTIVE'") #result3 = cursor.fetchone() #if result3: #oligoPacket = int(result3[0]) ##print oligoPacket #if oligoPacket not in uPackets: ##print oligoPacket #continue #oligoProjectDict[oligoID] = oligoPacket #else: #oligoProjectDict[oligoID] = 0 if len(result) == 3: oligoSeq = result[2].strip().lower() #print oligoSeq tm = sHandler.calculateTm(oligoSeq) # Changes made April 26, 2010: Karen caught that the sense/antisense check does not work for T3 and T7 vectors and said to check oligo sequence both ways #if rSeq.find(oligoSeq) < 0: #continue if rSeq.find(oligoSeq) >= 0: fStart = rSeq.find(oligoSeq) + 1 fEnd = fStart + len(oligoSeq) - 1 #if oHandler.isSenseOligo(oligoID): oFeature = SequenceFeature("sequencing primer", oligo_lims_id, fStart, fEnd, 'forward', oligoSeq, tm) #else: #oFeature = SequenceFeature("sequencing primer", oligo_lims_id, fStart, fEnd, 'reverse', oligoSeq, tm) else: revSeq = sHandler.reverse_complement(oligoSeq) if rSeq.find(revSeq) < 0: continue fStart = rSeq.find(revSeq) + 1 fEnd = fStart + len(revSeq) # Note: start pos > end pos, as we're talking about reverse Oligo sequence revStart = fEnd - 1 revEnd = fStart # Still, record sense/antisense for displaying on the map ('forward' and 'reverse' here are just static values in Feature class, it doesn't reflect sequence orientation in our case - just use as a temporary placeholder) #if oHandler.isSenseOligo(oligoID): #oligoFeatures.append(oFeature) #oFeature = SequenceFeature("sequencing primer", oligo_lims_id, revStart, revEnd, 'forward', oligoSeq, tm) #else: oFeature = SequenceFeature("sequencing primer", oligo_lims_id, revStart, revEnd, 'reverse', oligoSeq, tm) oligoFeatures.append(oFeature) sequenceFeatures.append(oFeature) # SORT features by size, so that short features are not hidden behind the long ones fSizes = [] sortedFeatures = [] fSortedPos = {} fStartPos = [] fEndPos = [] for feature in sequenceFeatures: fSize = int(feature.getFeatureSize()) if fSize > 0: fSizes.append(fSize) #if fSize > 150: f_start_tmp = int(feature.getFeatureStartPos()) fStartPos.append(f_start_tmp) fSortedPos[f_start_tmp] = feature f_end_tmp = int(feature.getFeatureEndPos()) fEndPos.append(f_end_tmp) fEndPos.sort() fStartPos.sort() #print `fStartPos` #print `fEndPos` fSizes.sort(reverse=True) #print `fSizes` for fs in fSizes: for feature in sequenceFeatures: fSize = feature.getFeatureSize() # added existence check July 17/08 - different features may have same sizes so end up with duplicate features in list (e.g. cloning sizes appeared twice on the map) if fs == fSize and feature not in sortedFeatures: sortedFeatures.append(feature) # Order: 5' site, 3' site, 5' linker, 3' linker, then the rest sites_color = featureNameColorMap["5' cloning site"] # same for 3' site # 5' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(sites_color) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "5' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # 3' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(sites_color) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "3' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Show legend for linkers linkers_color = featureNameColorMap["5' linker"] # 5' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "5' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # 3' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "3' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Output the rest of the features in alphabetical order featureNames = featureNameColorMap.keys() featureNames.sort() #print `featureNames` for featureName in featureNames: #print featureName if featureNameColorMap.has_key(featureName): color = featureNameColorMap[featureName] if featureName != "5' cloning site" and featureName != "3' cloning site" and featureName != "5' linker" and featureName != "3' linker" and color != None: #print featureName c.setStrokeColor(color) c.setFillColor(color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(color) t.setFillColor(color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + featureName.upper()) c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Sequencing Primer oligoColor = "#7cfc00" c.setStrokeColor(oligoColor) c.setFillColor(oligoColor) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(oligoColor) t.setFillColor(oligoColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "SEQUENCING PRIMER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 ox_labels = 40 oy_labels = 40 #prev_legend = oy_labels for feature in sortedFeatures: fType = feature.getFeatureType() fValue = feature.getFeatureName() fSize = feature.getFeatureSize() #print fType #print fValue #print fSize # color if featureNameColorMap.has_key(fType): fColor = featureNameColorMap[fType] textColor = fColor elif fType == 'sequencing primer': fColor = "#7cfc00" textColor = "black" o_id = oligoIDsDict[fValue] oligoName = oligoNamesDict[o_id] if len(oligoName) > 0: fValue += " " + oligoName # property name if fType == 'cdna insert': fValue = "cDNA Insert" elif fType == 'promoter': fValue = fValue + " " + fType fStart = feature.getFeatureStartPos() fEnd = feature.getFeatureEndPos() fDir = feature.getFeatureDirection() # value #if fType == 'sequencing primer': #oligoDir = feature.getFeatureDirection() #if oligoDir == 'forward': #oligoType = 'Sense' #else: #oligoType = 'Antisense' #fTxt = fValue + " (" + `fStart` + "-" + `fEnd` + "), " + oligoDir #else: fTxt = fValue + " (" + `fStart` + "-" + `fEnd` + ")" if fSize > 0: f_start = fStart * unit_angle_measure #print "Start " + `fStart` #print "End " + `fEnd` startAngle = 90 - f_start #print "Start angle " + `startAngle` f_end = fEnd * unit_angle_measure endAngle = 90 - f_end #print "End angle " + `endAngle` extAngle = -1*(f_end - f_start) #print "Ext angle " + `extAngle` x1 = origin_x - radius y1 = origin_y - radius x2 = origin_x + radius y2 = origin_y + radius p = c.beginPath() c.setLineWidth(10) c.setLineJoin(1) c.setStrokeColor(fColor) c.saveState() p.arc(x1, y1, x2, y2, startAngle, extAngle) c.drawPath(p) c.restoreState() # common to all startAngle_rad = (startAngle * math.pi) / 180.0 endAngle_rad = (endAngle * math.pi) / 180.0 c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 9) c.saveState() arc_x_start = origin_x + (radius+5)*math.cos(startAngle_rad) arc_y_start = origin_y + (radius+5)*math.sin(startAngle_rad) arc_x_end = origin_x+(radius+5)*math.cos(endAngle_rad) arc_y_end = origin_y+(radius+5)*math.sin(endAngle_rad) # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 12) c.saveState() # draw line delta = 45 if fStart < seqLen/2: if arc_y_start > origin_y: # THIS WORKS!!!! c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.line(arc_x_start, arc_y_start, arc_x_start+math.fabs(math.sin(delta))*(fInd*10), arc_y_start+math.fabs(math.cos(delta))*(fY*10)) #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fInd*10)+2, arc_y_start+math.fabs(math.cos(delta))*(fY*10)-math.cos(delta)*0.9, fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fInd*10)+2, arc_y_start+math.fabs(math.cos(delta))*(fY*10)-math.cos(delta)*0.9, fTxt) c.restoreState() else: fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() c.line(arc_x_start, arc_y_start, arc_x_start+math.fabs(math.sin(delta))*(fY*10), arc_y_start-math.fabs(math.cos(delta))*(fInd*10)) c.restoreState() #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fY*10)+2, arc_y_start-math.fabs(math.cos(delta))*(fInd*10)-math.cos(delta)*13, fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fY*10)+2, arc_y_start-math.fabs(math.cos(delta))*(fInd*10)-math.cos(delta)*13, fTxt) c.restoreState() else: if arc_y_start > origin_y: fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() c.line(arc_x_start, arc_y_start, arc_x_start-math.fabs(math.sin(delta)*(fY*10)), arc_y_start+math.fabs(math.cos(delta)*(fInd*10))) c.restoreState() # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fY*10))+2, arc_y_start+math.fabs(math.cos(delta)*(fInd*10)), fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fY*10))+2, arc_y_start+math.fabs(math.cos(delta)*(fInd*10)), fTxt) c.restoreState() else: fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() c.line(arc_x_start, arc_y_start, arc_x_start-math.fabs(math.sin(delta)*(fInd*10)), arc_y_start-math.fabs(math.cos(delta)*(fY*10))) c.restoreState() # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fInd*10))-2, arc_y_start-math.fabs(math.cos(delta)*(fY*10))-math.cos(delta)*12, fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fInd*10))-2, arc_y_start-math.fabs(math.cos(delta)*(fY*10))-math.cos(delta)*12, fTxt) c.restoreState() # print Oligo info #prev_legend = prev_legend-10 prev_legend = 1365 t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels, prev_legend-15) t.textOut("Sequencing primers for " + reagentID + ":") c.drawText(t) c.restoreState prev_legend = prev_legend-18 fColor = "#7cfc00" # sort oligos tmp_oligos = {} #print `oligoFeatures` for oFeature in oligoFeatures: oligoID = oFeature.getFeatureName() #print oligoID oligoStart = oFeature.getFeatureStartPos() #print oligoStart if tmp_oligos.has_key(oligoStart): tmp_o_list = tmp_oligos[oligoStart] else: tmp_o_list = [] tmp_oligos[oligoStart] = oFeature tmp_o_list.append(oFeature) tmp_oligos[oligoStart] = tmp_o_list oligoSeq = oFeature.getFeatureDescrType() #print oligoSeq #print `tmp_oligos` for oligoStart in sorted(tmp_oligos.keys()): oFeatures = tmp_oligos[oligoStart] for oFeature in oFeatures: oligoID = oFeature.getFeatureName() #oligoSeq = oFeature.getFeatureDescrType() oligoTm = oFeature.getFeatureDescrName() oligoEnd = oFeature.getFeatureEndPos() oligoDir = oFeature.getFeatureDirection() o_rID = oligoIDsDict[oligoID] oligoName = oligoNamesDict[o_rID] #if oligoDir == 'forward': #oligoType = 'Sense' #else: #oligoType = 'Antisense' c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels+5, prev_legend-15, 15,6, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels+25, prev_legend-15) if len(oligoName) > 0: #t.textOut(oligoID + ": " + oligoName + " (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoType) t.textOut(oligoID + ": " + oligoName + " (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoDir) else: #t.textOut(oligoID + ": (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoType) t.textOut(oligoID + ": (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoDir) #print oligoID + ": (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoType c.drawText(t) c.restoreState prev_legend = prev_legend-15 c.restoreState() c.showPage() c.save()
from sequence_handler import SequenceHandler from reagent import * import utils from user_handler import UserHandler from project_database_handler import ProjectDatabaseHandler from session import Session from exception import * dbConn = DatabaseConn() db = dbConn.databaseConnect() cursor = db.cursor() hostname = dbConn.getHostname() root_path = dbConn.getRootDir() dnaHandler = DNAHandler(db, cursor) protHandler = ProteinHandler(db, cursor) rHandler = ReagentHandler(db, cursor) oHandler = OligoHandler(db, cursor) propHandler = ReagentPropertyHandler(db, cursor) packetHandler = ProjectDatabaseHandler(db, cursor) propMapper = ReagentPropertyMapper(db, cursor) prop_Name_ID_Map = propMapper.mapPropNameID() # (prop name, prop id) prop_Category_Name_ID_Map = propMapper.mapPropCategoryNameID() # currUser is an INT user ID
def drawMap(): dbConn = DatabaseConn() db = dbConn.databaseConnect() cursor = db.cursor() hostname = dbConn.getHostname() root_path = dbConn.getRootDir() form = cgi.FieldStorage(keep_blank_values="True") #print "Content-type:text/html" #print #print `form` if form.has_key("rID"): rID = form.getvalue("rID") else: #rID = 148913 # V4550 rID = 29125 #rID = 72 #rID = 309 #rID = 1901 # small feature labels @ start of seq. overlap #rID = 36415 #print rID reagentID = rHandler.convertDatabaseToReagentID(rID) #print "Content-type:text/html" #print #print reagentID namePropID = pHandler.findReagentPropertyInCategoryID( prop_Name_ID_Map["name"], prop_Category_Name_ID_Map["General Properties"]) rName = rHandler.findSimplePropertyValue(rID, namePropID) #rName = rHandler.findSimplePropertyValue(rID, prop_Name_ID_Map["name"]) rTypeID = rHandler.findReagentTypeID(rID) try: os.remove(root_path + "Reagent/vector_maps/" + reagentID + "_map.pdf") except OSError: pass #print root_path c = Canvas(root_path + "Reagent/vector_maps/" + reagentID + "_map.pdf") c.setPageSize((1000, 1000)) c.setStrokeColorRGB(0, 0, 0) c.saveState() # Draw circle origin = 0 origin_x = 500 origin_y = 470 radius = 200 c.circle(origin_x, origin_y, radius) c.restoreState() # Divide circle into 100-unit sectors rSeqID = rHandler.findDNASequenceKey(rID) rSeq = sHandler.findSequenceByID(rSeqID) seqLen = len(rSeq) #print "Content-type:text/html" #print #print `rID` unit_angle_measure = float(360) / float(seqLen) #print unit_angle_measure # Mark 1 on the circle - KEEP, Karen said! c.setLineWidth(1) c.setStrokeColor(black) c.setFillColor(black) c.saveState() path = c.beginPath() path.moveTo(origin_x, origin_y + radius + 7) path.lineTo(origin_x - 5, origin_y + radius + 14) path.lineTo(origin_x + 5, origin_y + radius + 14) path.lineTo(origin_x, origin_y + radius + 7) c.drawPath(path, True, True) # label 1 t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 16) t.setTextOrigin(origin_x - 5, origin_y + radius + 19) t.textOut("1") c.drawText(t) c.restoreState() # Calculate feature segment sizes sequenceFeatures = rHandler.findReagentSequenceFeatures(rID) #print `sequenceFeatures` # Draw legend ox_legend = 800 oy_legend = 985 prev_legend = oy_legend # draw frame c.setStrokeColor(darkgray) #c.setStrokeColor(white) #c.setFillColor(lightgrey) c.setFillColor(white) c.saveState() # Output the rest of the features in alphabetical order - Moved here Jan. 26/10 #featureNames = featureNameColorMap.keys() #print `featureNameColorMap.keys()` #print len(featureNameColorMap.keys()) #fnames = rtPropHandler.findReagentTypeAttributeNamesByCategory(rTypeID, prop_Category_Name_ID_Map["DNA Sequence Features"]) #fnames.remove('expression system') #fnames.remove('tag position') #print `fnames` #print len(fnames) featureNames = rtPropHandler.findReagentTypeAttributeNamesByCategory( rTypeID, prop_Category_Name_ID_Map["DNA Sequence Features"]) featureNames.sort() #print `featureNames` #print prev_legend-240 #print prev_legend-15-len(featureNames)*15 #c.rect(ox_legend-25, prev_legend-240, 215, 235, 1, 1) #c.rect(ox_legend-25, prev_legend-15-len(featureNames)*15, 215, 10+len(featureNames)*15, 1, 1) # good for list of all db features if len(featureNames) > 15: origin_spacer = -19 coeff = 12 else: origin_spacer = 65 coeff = 15 #origin_legend = prev_legend+65-len(featureNames)*15 origin_legend = prev_legend + origin_spacer - len(featureNames) * coeff x = (990 - origin_legend) / len(featureNames) #print x if x < 12: x = 12 legend_height = len(featureNames) * x + 15 #print legend_height c.rect(ox_legend - 25, origin_legend - 17, 215, legend_height, 1, 1) # good for specific rtype attributes c.restoreState() # Order: 5' site, 3' site, 5' linker, 3' linker, then the rest sites_color = featureNameColorMap["5' cloning site"] # same for 3' site # 5' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend - 15, prev_legend - 20, 25, 8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) t.setStrokeColor(sites_color) #t.setFillColor(black) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend + 12, prev_legend - 20) t.textOut(" - " + "5' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 # 3' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend - 15, prev_legend - 20, 25, 8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(sites_color) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend + 12, prev_legend - 20) t.textOut(" - " + "3' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 # Show legend for linkers linkers_color = featureNameColorMap["5' linker"] # 5' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend - 15, prev_legend - 20, 25, 8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend + 12, prev_legend - 20) t.textOut(" - " + "5' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 # 3' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend - 15, prev_legend - 20, 25, 8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend + 12, prev_legend - 20) t.textOut(" - " + "3' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 ## Output the rest of the features in alphabetical order #featureNames = featureNameColorMap.keys() #featureNames.sort() #print `featureNames` for featureName in featureNames: if featureNameColorMap.has_key(featureName): color = featureNameColorMap[featureName] #else: #continue if featureName != "5' cloning site" and featureName != "3' cloning site" and featureName != "5' linker" and featureName != "3' linker" and color != None: #print featureName c.setStrokeColor(color) c.setFillColor(color) c.saveState() c.rect(ox_legend - 15, prev_legend - 20, 25, 8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(color) t.setFillColor(color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend + 12, prev_legend - 20) t.textOut(" - " + featureName.upper()) c.drawText(t) c.restoreState prev_legend = prev_legend - 15 #print prev_legend # Print reagent ID and size at the centre of the circle and print name at the top of the page c.setFont("Helvetica-Bold", 32) c.setFillColor(black) c.saveState() c.drawCentredString(origin_x, origin_y + 35, reagentID) c.drawCentredString(origin_x, origin_y + 10, "nt 1 - " + ` seqLen `) if rName: c.setFillColor(blue) c.drawCentredString(origin_x, 935, rName) c.restoreState() # SORT features by size, so that short features are not hidden behind the long ones fSizes = [] sortedFeatures = [] for feature in sequenceFeatures: fSize = int(feature.getFeatureSize()) if fSize > 0: fSizes.append(fSize) fSizes.sort(reverse=True) #print `fSizes` for fs in fSizes: for feature in sequenceFeatures: fSize = feature.getFeatureSize() # added existence check July 17/08 - different features may have same sizes so end up with duplicate features in list (e.g. cloning sizes appeared twice on the map) if fs == fSize and feature not in sortedFeatures: sortedFeatures.append(feature) #print `sortedFeatures` ox_labels = 40 oy_labels = 910 prev_legend = oy_labels t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels, prev_legend - 15) t.textOut("Features shorter than 150 nt:") c.drawText(t) c.restoreState prev_legend = prev_legend - 18 #for feature in sequenceFeatures: for feature in sortedFeatures: fType = feature.getFeatureType() fValue = feature.getFeatureName() fSize = feature.getFeatureSize() #print fType #print fValue #print fSize fColor = featureNameColorMap[fType] if fType == 'cdna insert': fValue = "cDNA Insert" elif fType == 'promoter': fValue = fValue + " " + fType fStart = feature.getFeatureStartPos() fEnd = feature.getFeatureEndPos() fDir = feature.getFeatureDirection() if fSize > 0: f_start = fStart * unit_angle_measure #print "Start " + `fStart` #print "End " + `fEnd` startAngle = 90 - f_start #print "Start angle " + `startAngle` f_end = fEnd * unit_angle_measure endAngle = 90 - f_end #print "End angle " + `endAngle` extAngle = -1 * (f_end - f_start) #print "Ext angle " + `extAngle` x1 = origin_x - radius y1 = origin_y - radius x2 = origin_x + radius y2 = origin_y + radius p = c.beginPath() #t = c.beginText() c.setLineWidth(10) c.setLineJoin(1) fColor = featureNameColorMap[fType] c.setStrokeColor(fColor) c.saveState() p.arc(x1, y1, x2, y2, startAngle, extAngle) c.drawPath(p) c.restoreState() ## jan. 27/10: this makes a contour for each arc #p = c.beginPath() #c.setLineWidth(1) ##fColor = featureNameColorMap[fType] #c.setStrokeColor(black) #c.setFillColor(fColor) #c.saveState() #p.arc(x1+5, y1+5, x2-5, y2-5, startAngle, extAngle) #c.drawPath(p) ##c.restoreState() ##c.setLineWidth(1) ##fColor = featureNameColorMap[fType] ##c.setStrokeColor(black) ##c.setFillColor(fColor) ##c.saveState() #p.arc(x1-5, y1-5, x2+5, y2+5, startAngle, extAngle) #c.drawPath(p) #c.restoreState() # jan. 27/10 modification ends here # common to all startAngle_rad = (startAngle * math.pi) / 180.0 endAngle_rad = (endAngle * math.pi) / 180.0 #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 9) c.saveState() arc_x_start = origin_x + (radius + 5) * math.cos(startAngle_rad) arc_y_start = origin_y + (radius + 5) * math.sin(startAngle_rad) arc_x_end = origin_x + (radius + 5) * math.cos(endAngle_rad) arc_y_end = origin_y + (radius + 5) * math.sin(endAngle_rad) # draw label c.setStrokeColorRGB(0, 0, 1) c.setFillColorRGB(0, 0, 1) c.setFont("Helvetica-Bold", 12) c.saveState() # draw line delta = 45 # Rotate labels only for SMALL features (they can be crammed together) #if fSize > 100: #delta = 45 #else: #delta = 32 if fStart < seqLen / 2: if arc_y_start > origin_y: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() #if fSize <= 100: #c.line(arc_x_start, arc_y_start, arc_x_start+50*math.fabs(math.sin(delta)), arc_y_start+55*math.fabs(math.cos(delta))) #else: # July 17/08: Show labels for long features only if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start + 50 * math.fabs(math.sin(delta)), arc_y_start + 55 * math.fabs(math.cos(delta))) c.restoreState() # July 17/08: Show labels for long features only if fSize > 150: # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawString( arc_x_start + 50 * math.fabs(math.sin(delta)), arc_y_start + 55 * math.fabs(math.cos(delta)), fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels + 5, prev_legend - 15, 15, 6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels + 25, prev_legend - 15) t.textOut(fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 c.restoreState() else: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start + 50 * math.fabs(math.sin(delta)), arc_y_start - 55 * math.fabs(math.cos(delta))) c.restoreState() # draw label if fSize > 150: #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawString( arc_x_start + 50 * math.fabs(math.sin(delta)), arc_y_start - 55 * math.fabs(math.cos(delta)), fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels + 5, prev_legend - 15, 15, 6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels + 25, prev_legend - 15) t.textOut(fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 c.restoreState() else: if arc_y_start > origin_y: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start - 50 * math.fabs(math.sin(delta)), arc_y_start + 55 * math.fabs(math.cos(delta))) #c.line(arc_x_start, arc_y_start, arc_x_start+10*math.fabs(math.sin(delta)), arc_y_start-10*math.fabs(math.cos(delta))) c.restoreState() # draw label if fSize > 150: #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawRightString( arc_x_start - 50 * math.fabs(math.sin(delta)), arc_y_start + 55 * math.fabs(math.cos(delta)), fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels + 5, prev_legend - 15, 15, 6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels + 25, prev_legend - 15) t.textOut(fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 c.restoreState() else: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start - 50 * math.fabs(math.sin(delta)), arc_y_start - 55 * math.fabs(math.cos(delta))) c.restoreState() # draw label if fSize > 150: #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawRightString( arc_x_start - 50 * math.fabs(math.sin(delta)), arc_y_start - 55 * math.fabs(math.cos(delta)), fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") c.restoreState() else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels + 5, prev_legend - 15, 15, 6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels + 25, prev_legend - 15) t.textOut(fValue + " (" + ` fStart ` + "-" + ` fEnd ` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend - 15 c.showPage() c.save()
def drawMap(): dbConn = DatabaseConn() db = dbConn.databaseConnect() cursor = db.cursor() hostname = dbConn.getHostname() root_path = dbConn.getRootDir() form = cgi.FieldStorage(keep_blank_values="True") #print "Content-type:text/html" #print #print `form` if form.has_key("rID"): rID = form.getvalue("rID") else: #rID = 148913 # V4550 rID = 29125 #rID = 72 #rID = 309 #rID = 1901 # small feature labels @ start of seq. overlap #rID = 36415 #print rID reagentID = rHandler.convertDatabaseToReagentID(rID) #print "Content-type:text/html" #print #print reagentID namePropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["name"], prop_Category_Name_ID_Map["General Properties"]) rName = rHandler.findSimplePropertyValue(rID, namePropID) #rName = rHandler.findSimplePropertyValue(rID, prop_Name_ID_Map["name"]) rTypeID = rHandler.findReagentTypeID(rID) try: os.remove(root_path + "Reagent/vector_maps/" + reagentID + "_map.pdf") except OSError: pass #print root_path c = Canvas(root_path + "Reagent/vector_maps/" + reagentID + "_map.pdf") c.setPageSize((1000,1000)) c.setStrokeColorRGB(0,0,0) c.saveState() # Draw circle origin = 0 origin_x = 500 origin_y = 470 radius = 200 c.circle(origin_x, origin_y, radius) c.restoreState() # Divide circle into 100-unit sectors rSeqID = rHandler.findDNASequenceKey(rID) rSeq = sHandler.findSequenceByID(rSeqID) seqLen = len(rSeq) #print "Content-type:text/html" #print #print `rID` unit_angle_measure = float(360) / float(seqLen) #print unit_angle_measure # Mark 1 on the circle - KEEP, Karen said! c.setLineWidth(1) c.setStrokeColor(black) c.setFillColor(black) c.saveState() path = c.beginPath() path.moveTo(origin_x, origin_y+radius+7) path.lineTo(origin_x-5, origin_y+radius+14) path.lineTo(origin_x+5, origin_y+radius+14) path.lineTo(origin_x, origin_y+radius+7) c.drawPath(path, True, True) # label 1 t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 16) t.setTextOrigin(origin_x-5, origin_y+radius+19) t.textOut("1") c.drawText(t) c.restoreState() # Calculate feature segment sizes sequenceFeatures = rHandler.findReagentSequenceFeatures(rID) #print `sequenceFeatures` # Draw legend ox_legend = 800 oy_legend = 985 prev_legend = oy_legend # draw frame c.setStrokeColor(darkgray) #c.setStrokeColor(white) #c.setFillColor(lightgrey) c.setFillColor(white) c.saveState() # Output the rest of the features in alphabetical order - Moved here Jan. 26/10 #featureNames = featureNameColorMap.keys() #print `featureNameColorMap.keys()` #print len(featureNameColorMap.keys()) #fnames = rtPropHandler.findReagentTypeAttributeNamesByCategory(rTypeID, prop_Category_Name_ID_Map["DNA Sequence Features"]) #fnames.remove('expression system') #fnames.remove('tag position') #print `fnames` #print len(fnames) featureNames = rtPropHandler.findReagentTypeAttributeNamesByCategory(rTypeID, prop_Category_Name_ID_Map["DNA Sequence Features"]) featureNames.sort() #print `featureNames` #print prev_legend-240 #print prev_legend-15-len(featureNames)*15 #c.rect(ox_legend-25, prev_legend-240, 215, 235, 1, 1) #c.rect(ox_legend-25, prev_legend-15-len(featureNames)*15, 215, 10+len(featureNames)*15, 1, 1) # good for list of all db features if len(featureNames) > 15: origin_spacer = -19 coeff = 12 else: origin_spacer = 65 coeff = 15 #origin_legend = prev_legend+65-len(featureNames)*15 origin_legend = prev_legend+origin_spacer-len(featureNames)*coeff x = (990 - origin_legend) / len(featureNames) #print x if x < 12: x = 12 legend_height = len(featureNames)*x + 15 #print legend_height c.rect(ox_legend-25, origin_legend-17, 215, legend_height, 1, 1) # good for specific rtype attributes c.restoreState() # Order: 5' site, 3' site, 5' linker, 3' linker, then the rest sites_color = featureNameColorMap["5' cloning site"] # same for 3' site # 5' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) t.setStrokeColor(sites_color) #t.setFillColor(black) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "5' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # 3' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(sites_color) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "3' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Show legend for linkers linkers_color = featureNameColorMap["5' linker"] # 5' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "5' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # 3' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "3' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 ## Output the rest of the features in alphabetical order #featureNames = featureNameColorMap.keys() #featureNames.sort() #print `featureNames` for featureName in featureNames: if featureNameColorMap.has_key(featureName): color = featureNameColorMap[featureName] #else: #continue if featureName != "5' cloning site" and featureName != "3' cloning site" and featureName != "5' linker" and featureName != "3' linker" and color != None: #print featureName c.setStrokeColor(color) c.setFillColor(color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(color) t.setFillColor(color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + featureName.upper()) c.drawText(t) c.restoreState prev_legend = prev_legend-15 #print prev_legend # Print reagent ID and size at the centre of the circle and print name at the top of the page c.setFont("Helvetica-Bold", 32) c.setFillColor(black) c.saveState() c.drawCentredString(origin_x, origin_y+35, reagentID) c.drawCentredString(origin_x, origin_y+10, "nt 1 - " + `seqLen`) if rName: c.setFillColor(blue) c.drawCentredString(origin_x, 935, rName) c.restoreState() # SORT features by size, so that short features are not hidden behind the long ones fSizes = [] sortedFeatures = [] for feature in sequenceFeatures: fSize = int(feature.getFeatureSize()) if fSize > 0: fSizes.append(fSize) fSizes.sort(reverse=True) #print `fSizes` for fs in fSizes: for feature in sequenceFeatures: fSize = feature.getFeatureSize() # added existence check July 17/08 - different features may have same sizes so end up with duplicate features in list (e.g. cloning sizes appeared twice on the map) if fs == fSize and feature not in sortedFeatures: sortedFeatures.append(feature) #print `sortedFeatures` ox_labels = 40 oy_labels = 910 prev_legend = oy_labels t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels, prev_legend-15) t.textOut("Features shorter than 150 nt:") c.drawText(t) c.restoreState prev_legend = prev_legend-18 #for feature in sequenceFeatures: for feature in sortedFeatures: fType = feature.getFeatureType() fValue = feature.getFeatureName() fSize = feature.getFeatureSize() #print fType #print fValue #print fSize fColor = featureNameColorMap[fType] if fType == 'cdna insert': fValue = "cDNA Insert" elif fType == 'promoter': fValue = fValue + " " + fType fStart = feature.getFeatureStartPos() fEnd = feature.getFeatureEndPos() fDir = feature.getFeatureDirection() if fSize > 0: f_start = fStart * unit_angle_measure #print "Start " + `fStart` #print "End " + `fEnd` startAngle = 90 - f_start #print "Start angle " + `startAngle` f_end = fEnd * unit_angle_measure endAngle = 90 - f_end #print "End angle " + `endAngle` extAngle = -1*(f_end - f_start) #print "Ext angle " + `extAngle` x1 = origin_x - radius y1 = origin_y - radius x2 = origin_x + radius y2 = origin_y + radius p = c.beginPath() #t = c.beginText() c.setLineWidth(10) c.setLineJoin(1) fColor = featureNameColorMap[fType] c.setStrokeColor(fColor) c.saveState() p.arc(x1, y1, x2, y2, startAngle, extAngle) c.drawPath(p) c.restoreState() ## jan. 27/10: this makes a contour for each arc #p = c.beginPath() #c.setLineWidth(1) ##fColor = featureNameColorMap[fType] #c.setStrokeColor(black) #c.setFillColor(fColor) #c.saveState() #p.arc(x1+5, y1+5, x2-5, y2-5, startAngle, extAngle) #c.drawPath(p) ##c.restoreState() ##c.setLineWidth(1) ##fColor = featureNameColorMap[fType] ##c.setStrokeColor(black) ##c.setFillColor(fColor) ##c.saveState() #p.arc(x1-5, y1-5, x2+5, y2+5, startAngle, extAngle) #c.drawPath(p) #c.restoreState() # jan. 27/10 modification ends here # common to all startAngle_rad = (startAngle * math.pi) / 180.0 endAngle_rad = (endAngle * math.pi) / 180.0 #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 9) c.saveState() arc_x_start = origin_x + (radius+5)*math.cos(startAngle_rad) arc_y_start = origin_y + (radius+5)*math.sin(startAngle_rad) arc_x_end = origin_x+(radius+5)*math.cos(endAngle_rad) arc_y_end = origin_y+(radius+5)*math.sin(endAngle_rad) # draw label c.setStrokeColorRGB(0,0,1) c.setFillColorRGB(0,0,1) c.setFont("Helvetica-Bold", 12) c.saveState() # draw line delta = 45 # Rotate labels only for SMALL features (they can be crammed together) #if fSize > 100: #delta = 45 #else: #delta = 32 if fStart < seqLen/2: if arc_y_start > origin_y: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() #if fSize <= 100: #c.line(arc_x_start, arc_y_start, arc_x_start+50*math.fabs(math.sin(delta)), arc_y_start+55*math.fabs(math.cos(delta))) #else: # July 17/08: Show labels for long features only if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start+50*math.fabs(math.sin(delta)), arc_y_start+55*math.fabs(math.cos(delta))) c.restoreState() # July 17/08: Show labels for long features only if fSize > 150: # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawString(arc_x_start+50*math.fabs(math.sin(delta)), arc_y_start+55*math.fabs(math.cos(delta)), fValue + " (" + `fStart` + "-" + `fEnd` + ")") else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels+5, prev_legend-15, 15,6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels+25, prev_legend-15) t.textOut(fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend-15 c.restoreState() else: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start+50*math.fabs(math.sin(delta)), arc_y_start-55*math.fabs(math.cos(delta))) c.restoreState() # draw label if fSize > 150: #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawString(arc_x_start+50*math.fabs(math.sin(delta)), arc_y_start-55*math.fabs(math.cos(delta)), fValue + " (" + `fStart` + "-" + `fEnd` + ")") else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels+5, prev_legend-15, 15,6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels+25, prev_legend-15) t.textOut(fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend-15 c.restoreState() else: if arc_y_start > origin_y: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start-50*math.fabs(math.sin(delta)), arc_y_start+55*math.fabs(math.cos(delta))) #c.line(arc_x_start, arc_y_start, arc_x_start+10*math.fabs(math.sin(delta)), arc_y_start-10*math.fabs(math.cos(delta))) c.restoreState() # draw label if fSize > 150: #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawRightString(arc_x_start-50*math.fabs(math.sin(delta)), arc_y_start+55*math.fabs(math.cos(delta)), fValue + " (" + `fStart` + "-" + `fEnd` + ")") else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels+5, prev_legend-15, 15,6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels+25, prev_legend-15) t.textOut(fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend-15 c.restoreState() else: #c.setStrokeColor(black) #c.setFillColor(black) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() if fSize > 150: c.line(arc_x_start, arc_y_start, arc_x_start-50*math.fabs(math.sin(delta)), arc_y_start-55*math.fabs(math.cos(delta))) c.restoreState() # draw label if fSize > 150: #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 11) c.saveState() c.drawRightString(arc_x_start-50*math.fabs(math.sin(delta)), arc_y_start-55*math.fabs(math.cos(delta)), fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.restoreState() else: c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels+5, prev_legend-15, 15,6, 1, 1) c.restoreState t = c.beginText() #t.setStrokeColor(black) #t.setFillColor(black) t.setStrokeColor(fColor) t.setFillColor(fColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels+25, prev_legend-15) t.textOut(fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawText(t) c.restoreState prev_legend = prev_legend-15 c.showPage() c.save()