def __init__(self, device='dut', why='ssh:', *args, **kwargs):
# differed import of flogging since we are inside the plugin
# structure:
from flogging import get_loggers
self.__logs = get_loggers()
self.__stream_to_log = None
if 'logfile' not in kwargs:
stream_to_log = StreamToLogger(self.__logs.idl, why)
kwargs['logfile'] = stream_to_log
self.__stream_to_log = stream_to_log
super(SSHHelper, self).__init__(*args, **kwargs)
assert device == 'dut', \
'multiple targets not supported yet'
assert self._parser_options is not None, \
'attempt to create ssh helper before nose-plugin-begin step called'
host = self._parser_options.sm_dut_ssh_host
port = self._parser_options.sm_dut_ssh_port
user = self._parser_options.sm_dut_ssh_user
password = self._parser_options.sm_dut_ssh_password
self.login(host, user, password, port=port)
self.sendline('sudo su -')
index = self.expect(['assword', '#'])
if index == 0:
self.sendline(password)
self.expect(['#'])
self.set_unique_prompt()
self.dut_ssh_host = host
self.dut_ssh_port = port
def __setup_generated_amqp(self, generate_string):
"""
Handle the case where we are told to generate an AMQP user
and even set it up on the DUT.
"""
port = int(generate_string.split(':')[1])
uid = str(uuid.uuid4())
auser = '******'.format(uid)
apw = uid
try:
fixed = SSHHelper('dut', 'amqp-user-setup-ssh-stdouterr: ')
cmd_text, ecode, output = fixed.sendline_and_stat('rabbitmqctl delete_user {}'.format(auser))
# the user probably WON'T be there, so don't worry much.
assert ecode == 0 or 'no_such_user' in output, \
"{} failed with something other than 'no_such_user':"******".*" ".*" ".*"'''.format(auser), must_be_0=True)
fixed.logout()
return 'amqp://{}:{}@{}:{}'.format(auser, apw, fixed.dut_ssh_host, port), auser
except ExceptionPxssh as ex:
# the PR in-queue behind with one sets up better logging in the sources.
# Rather than try to pull that forward, manually grab flogging and
# update this block in next merge.
from flogging import get_loggers
logs = get_loggers()
logs.irl.debug('unable to set up amqp user. AMQP monitors disabled: %s', ex)
return None, None
def begin(self):
self.__take_step('begin')
# tood: check class "enabled_for_nose()"
SSHHelper.set_options(self.conf.options)
if len(self.__stream_plugins) == 0:
self.__stream_plugins['logging'] = LoggingMarker()
self.__stream_plugins['self-test'] = SelfTestStreamMonitor()
self.__stream_plugins['amqp'] = AMQPStreamMonitor()
else:
# This is basically for self-testing the plugin, since the
# logging monitor stays around between test-classes. If we don't do
# this, the prior logging settings "stick".
self.__stream_plugins['logging'].reset_configuration()
self.__flogger_opts_helper.process_parsed(self.conf.options)
self.__stream_plugins['amqp'].set_options(self.conf.options)
self.__call_all_plugin_by_attr('handle_set_flogging', get_loggers())
self.__call_all_plugin_by_attr('handle_begin')
- checks pollers for data
'''
import fit_path # NOQA: unused import
import os
import subprocess
import json
import time
import unittest
import fit_common
import pdu_lib
import flogging
import test_api_utils
log = flogging.get_loggers()
# Locals
MAX_CYCLES = 60
class rackhd_stack_init(unittest.TestCase):
def test01_set_auth_user(self):
auth_json = open('auth.json', 'w')
auth_json.write('{"username":"******"api"][0]["admin_user"] + '", "password":"******"api"][0]["admin_pass"] + '", "role":"Administrator"}')
auth_json.close()
try:
# add first user to remote rackhd directly
return_code = ""
rackhd_hostname = fit_common.fitargs()['rackhd_host']
UCS test script that tests:
-All the ucs service APIs
-The Discovery workflow
-The Catalog workflow
'''
import fit_path # NOQA: unused import
import unittest
from common import fit_common
from nosedep import depends
import flogging
from nose.plugins.attrib import attr
logs = flogging.get_loggers()
UCSM_IP = fit_common.fitcfg().get('ucsm_ip')
UCSM_USER = fit_common.fitcfg().get('ucsm_user')
UCSM_PASS = fit_common.fitcfg().get('ucsm_pass')
UCS_SERVICE_URI = fit_common.fitcfg().get('ucs_service_uri')
@attr(all=True, regression=True, smoke=True, ucs=True)
class ucs_api(unittest.TestCase):
def ucs_url_factory(self, api, identifier=None):
"""
returns a fully qualified UCS API
:param api:UCS API
:param identifier: identify the ucs element in the catalog API
"""
Copyright (c) 2016-2017 Dell Inc. or its subsidiaries. All Rights Reserved.
"""
import fit_path # NOQA: unused import
import unittest
import flogging
from config.redfish1_0_config import config
from on_http_redfish_1_0 import RedfishvApi as redfish
from on_http_redfish_1_0 import rest
from json import loads, dumps
from nosedep import depends
from nose.plugins.attrib import attr
logs = flogging.get_loggers()
# @test(groups=['redfish.schema.tests'], depends_on_groups=['obm.tests'])
@attr(regression=True, smoke=True, schema_rf1_tests=True)
class SchemaTests(unittest.TestCase):
@classmethod
def setUpClass(cls):
cls.__client = config.api_client
cls.__schemaList = None
cls.__membersList = None
cls.__locationUri = []
def __get_data(self):
return loads(self.__client.last_response.data)
}
Example command line using external payload file:
python run_tests.py -stack 4 -test tests/bootstrap/test_api20_esxi_bootstrap.py -extra base_esxi_55_install.json
'''
import fit_path # NOQA: unused import
from nose.plugins.attrib import attr
import fit_common
import flogging
import random
import time
from nosedep import depends
log = flogging.get_loggers()
# sample default base payload
PAYLOAD = {
"name": "Graph.InstallESXi",
"options": {
"defaults": {
"version":
"6",
"repo":
"http://172.31.128.1:8080/ESXi/6.0",
"rootPassword":
"******",
"hostname":
"rackhdnode",
"users": [{
