def process(self, data, obs_vec): """ Solve optimization problem to get :math:`\\alpha`. :param phi_mat: Training data matrix :math:`\Phi\in\mathbb{R}^{d\\times n}` :type phi_mat: numpy array :param obs_vec: Observation vector :math:`y\in\mathbb{R}^{n}` :type obs_vec: numpy array :return: `alpha`: estimated state vector :math:`\\alpha\in\mathbb{R}^{d}` :rtype: numpy array """ # check consistency of data obs_num = obs_vec.shape[0] data_num = data.shape[0] if obs_num == data_num: self.data = data # take into account both options if self.lam is 0: k_mat = kernel(data, data, self.k_type) else: dim = data.shape[1] k_mat = kernel(data, data, self.k_type) + self.lam*eye(dim) self.alpha = lstsq(k_mat, obs_vec.transpose())[0] return self.alpha else: print "ERROR: number of samples for data and observations must be the same"
def predict(self, X_test): X_test = X_test.as_matrix() n = np.shape(X_test)[0] y_pred = np.zeros((n, 1)) for i in tqdm(range(n)): x = X_test[i, ] #dictionary of distances between x and all x_train x_dist = dict() #building dict for j in range(np.shape(self.X_train)[0]): #computing distance^2 x_dist[j] = kernel(self.kernel, x, x, self.sigma, self.k, self.d, self.e, self.beta) \ - 2 * kernel(self.kernel, self.X_train [i,], x, self.sigma, self.k, self.d, self.e, self.beta) \ + kernel(self.kernel, self.X_train [i,], self.X_train [i,], self.sigma, self.k, self.d, self.e, self.beta) #sorting dict by value and getting k nearest neighbors x_k = sorted((value, key) for (key, value) in x_dist.items())[:self.kn] #returns a list of length k #getting indices of k nearest neighbors x_k_ind = [z[1] for z in x_k] #getting labels of k nearest neighbors y_k = self.y_train[x_k_ind, ] #predicting label of x(i) y_pred[i, ] = np.argmax(pd.Series(y_k).value_counts()) y_pred_list = map(lambda x: x[0], y_pred) return (pd.Series(y_pred_list))
def mmd(self, data2): """ Compute the maximum mean discrepancy between :math:`D_1` and :math:`D_2`, i.e. :math:`\\|\\mu_{{D_1}} - \\mu_{{D_2}}\\|_{\mathcal{H}}` :param data2: data matrix :math:`D_2\in\mathbb{R}^{d \\times n}`, where :math:`d` is the dimensionality and :math:`n` is the number of training samples :type data: numpy array :return: diffused data :rtype: numpy array """ # parse data and ensure it meets requirements dim_data2 = data2.shape[0] ntest = data2.shape[1] if dim_data2 != self.dim: raise Exception("ERROR: dimensionality of data must be consistent with training set.") # now, compute MMD equation, using in-place computations kmat = kernel(data2,data2,self.kernel); ktestsum = npsum(npsum(kmat,axis=0),axis=1)/(pow(ntest,2)); kmat = kernel(self.data,self.data,self.kernel); ktrainsum = npsum(npsum(kmat,axis=0),axis=1)/(pow(self.nsamp,2)); kmat = kernel(self.data,data2,self.kernel); kcrossum = npsum(npsum(kmat,axis=0),axis=1)/(self.nsamp*ntest); mmdcomputed = ktestsum + ktrainsum - 2*kcrossum return mmdcomputed
def predict(self, te_data): """ Use GP model to compute regression values at data points, as well as posterior variance. :param D: Testing data matrix :math:`D\in\mathbb{R}^{m\\times d}` :type phi_mat: numpy array :return: `f`: estimated output values at data :math:`\hat{y}\in\mathbb{R}^{1 \\times m}` :rtype: numpy array :return: `sigma`: estimated output values at data :math:`\hat{sigma}\in\mathbb{R}^{1 \\times m}` :rtype: numpy array """ k_test = kernel(self.data, te_data, self.k_type) dim_test = te_data.shape[0] ntest = te_data.shape[1] # make sure dimensionality is consistent if dim_test != self.data_dim: raise Exception("Dimensions of training and test data must be the same") else: # compute posterior mean f = dot(k_test,self.mean_vec) # compute posterior variance var_m = lstsq(self.lmat, k_test) var_f = kernel(te_data,te_data,self.k_type) - dot(var_m,var_m) return f, var_f
def calculate(self,alldata_par, alldata_obs, alldata_wei): no_snapshots, no_parameters = alldata_par.shape TEMP = np.zeros([no_snapshots,no_snapshots]) for i in range(no_parameters): v = alldata_par[:,i] Q = npm.repmat(v,no_snapshots,1) T = np.transpose(Q) TEMP = TEMP + np.power(Q-T,2) np.sqrt(TEMP,out=TEMP) # distances between all points if self.no_keep>0: MAX = 2*np.max(TEMP) M = TEMP+MAX*np.eye(no_snapshots) to_keep = np.ones(no_snapshots,dtype=bool) for i in range(no_snapshots - self.no_keep): argmin = np.argmin(M) xx = argmin // no_snapshots if self.expensive>0: S=sum(M) yy = argmin % no_snapshots M[xx,yy]=MAX M[yy,xx]=MAX if S[yy]<S[xx]: yy=xx M[xx,:]=MAX M[:,xx]=MAX to_keep[xx]=False TEMP = TEMP[to_keep,:] TEMP = TEMP[:,to_keep] alldata_par = alldata_par[to_keep,:] alldata_obs = alldata_obs[to_keep,:] try: to_keep=np.append(to_keep,np.ones(no_parameters+1,dtype=bool)) self.initial_iteration = self.initial_iteration[to_keep] except: print("Exception!") kernel.kernel(TEMP,self.type_kernel) P = np.ones([no_snapshots,1]) # only constant polynomials # print(P.shape, no_evaluations, alldata_par.shape, TEMP.shape) P = np.append(alldata_par,P,axis=1) # plus linear polynomials no_polynomials = P.shape[1] TEMP = np.append(TEMP,P,axis=1) TEMP2 = np.append(np.transpose(P),np.zeros([no_polynomials,no_polynomials]),axis=1) TEMP2 = np.vstack([TEMP,TEMP2]) RHS = np.vstack([ alldata_obs, np.zeros([no_polynomials,1]) ]) # print("Condition_number:",np.linalg.cond(TEMP2)) # print("DEBUG2:", TEMP2.shape, np.linalg.matrix_rank(TEMP2), RHS.shape) if self.type_solver == 0: SOL=np.linalg.solve(TEMP2,RHS) else: SOL_=splin.minres(TEMP2,RHS,x0=self.initial_iteration,tol=pow(10,-self.type_solver),show=False) SOL=SOL_[0] # RES=RHS-np.reshape(np.matmul(TEMP2,SOL),(no_evaluations+no_polynomials,1)) # print("Residual norm:",np.linalg.norm(RES), "RHSnorm:", np.linalg.norm(RHS)) return SOL, no_snapshots, alldata_par, alldata_obs, alldata_wei, TEMP2, RHS
def train(self, X, y): DNA_chars = ["A", "T", "C", "G"] self.DNA_seq = [] self.X_train = X self.y = y self.alpha = np.zeros(y.shape) n = len(y) self.K = np.zeros((n, n)) if (self.kernel_name == "Linear"): self.K = (X @ X.T + 1)**2 else: for i in range(n): for j in range(i + 1): self.K[i, j] = kernel(X[i], X[j], kernel_name=self.kernel_name, substring_size=self.substring_size, substring_all=self.substring_all, degree=self.degree, gamma=self.gamma) self.K[j, i] = self.K[i, j] q = -self.y.reshape((-1, )) n = len(self.y) G = np.vstack((np.diag(self.y), -np.diag(self.y))) h = np.vstack((np.ones((n, 1)) * self.C, np.zeros((n, 1)))).reshape( (-1, )) sol = solvers.qp(matrix(self.K), matrix(q), matrix(G), matrix(h)) self.alpha = sol['x']
def __init__(self, camp_dist): pq.setConfigOption('background', 'w') self.widget = pq.PlotWidget() self.kernel = kernel('../data/csv/out.csv', camp_dist) self.kernel.pars() super(UI, self).__init__() self.initUI()
def _train(self, s, e): if s >= e: return sp = (s + e) // 2 print("Training step : ", s,"-",sp, " vs ", sp+1,"-",e) first_half = [] second_half = [] for part in self.cat_train_dataset[s: sp + 1]: first_half += part for part in self.cat_train_dataset[sp + 1: e + 1]: second_half += part for example in first_half: example[-1] = 0.0 for example in second_half: example[-1] = 1.0 sub_train_data = np.concatenate([np.array(first_half), np.array(second_half)], axis=0).astype("float64") np.random.shuffle(sub_train_data) sub_train_feature = sub_train_data[:, :-1] sub_train_label = sub_train_data[:, -1] if self.nn_kernel: print("Training NN kernel --- START") kernel_function = kernel.kernel(sub_train_feature, sub_train_label, sub_train_feature.shape[1]) sub_clf = svm.SVC(kernel=kernel_function) print("Training NN kernel --- END") else: sub_clf = svm.SVC(kernel="rbf") print("Training sub SVM --- START") sub_clf.fit(sub_train_feature, sub_train_label) print("Training sub SVM --- START") self.sub_svm_dict[(s, sp, e)] = sub_clf self._train(s, sp) self._train(sp + 1, e)
def process(self, data): """ This function builds the kernel matrix from the data, and generates the KPCA eigenspace. :param data: data matrix :math:`D\in\mathbb{R}^{d \\times n}`, where :math:`d` is the dimensionality and :math:`n` is the number of training samples :type data: numpy array """ # perform eigendecomposition k_mat = kernel(data, data, self.kernel) # if centered, need to perform extra computations if self.centered > 0: nsamp = data.shape[1] unit = ones((nsamp, 1), float) self.h_mat = eye(nsamp) - (1./nsamp)*dot(unit, unit.T) # centering matrix self.k_cent = (1./nsamp)*dot(k_mat, unit) # centering vector, used in reduction k_mat = dot(k_mat, self.h_mat) # augmented kernel matrix k_mat = dot(self.h_mat, k_mat) k_evals, k_evecs = eigsh(k_mat, k=self.neigs, which='LM') k_evals = sqrt(k_evals) k_scale = (ones((1, self.neigs), float)/k_evals) k_scale = diag(k_scale[0, :]) # create scaling matrix alpha = dot(k_evecs, k_scale) self.alpha = alpha # store copies of coefficients and data self.data = data
def train(self): print("Multiclass svm training -- START") # train one svm for each label pair for label1 in range(self.classes): for label2 in range(label1 + 1, self.classes): print("Training step : ", label1, " vs ", label2) sub_data1 = self.cat_train_dataset[label1] sub_data2 = self.cat_train_dataset[label2] sub_train_data1 = np.array(sub_data1).astype("float64") sub_train_data2 = np.array(sub_data2).astype("float64") sub_train_data = np.concatenate([sub_train_data1, sub_train_data2], axis=0) np.random.shuffle(sub_train_data) sub_train_feature = sub_train_data[:, :-1] sub_train_label = sub_train_data[:, -1] if self.nn_kernel: print("Training NN kernel --- START") kernel_function = kernel.kernel(sub_train_feature, sub_train_label, sub_train_feature.shape[1]) sub_clf = svm.SVC(kernel=kernel_function) print("Training NN kernel --- END") else: sub_clf = svm.SVC(kernel="rbf") print("Training sub SVM --- START") sub_clf.fit(sub_train_feature, sub_train_label) print("Training sub SVM --- END") self.sub_svm_list[label1].append(sub_clf) print("Multiclass svm training -- END")
def project(self, tdata): """ This function projects test data :math:`D'` onto the mean map, i.e. it computes and returns :math:`\\langle\mu_{{D_1}},\\psi(x)\\rangle_\mathcal{H}` for each :math:`x\in D'`, where :math:`\\psi:\mathbb{R}^{d}\\to\mathcal{H}` is the feature map associated to the RKHS :math:`\mathcal{H}`. :param data: testdata matrix :math:`D'\in\mathbb{R}^{d \\times n}`, where :math:`d` is the dimensionality and :math:`n` is the number of training samples :type data: numpy array :return: projected data :rtype: numpy array """ # parse data and ensure it meets requirements test_dim = tdata.shape[0] ntest = tdata.shape[1] if test_dim != self.dim: raise Exception("ERROR: dimensionality of data must be consistent with training set.") # compute kernel matrix between data and tdata kmat = kernel(self.data,tdata,self.kernel) kmat = npsum(kmat,axis=0) kmat = (1/self.nsamp)*kmat return kmat
def predict(self, te_data): """ Use Bayesian RBF model to compute regression values at data points, as well as posterior variance. :param D: Testing data matrix :math:`D\in\mathbb{R}^{m\\times d}` :type phi_mat: numpy array :return: `f`: estimated output values at data :math:`\hat{y}\in\mathbb{R}^{1 \\times m}` :rtype: numpy array :return: `sigma`: estimated output values at data :math:`\hat{sigma}\in\mathbb{R}^{1 \\times m}` :rtype: numpy array """ k_test = kernel(te_data, self.centers, self.k_type) dim_test = te_data.shape[0] ntest = te_data.shape[1] # make sure dimensionality is consistent if dim_test != self.centers_dim: raise Exception("Dimensions of data and centers must be the same") else: # compute posterior mean f = (dot(k_test,self.mn)).transpose() # compute posterior variance var_m = dot(k_test,self.precision) var_m = dot(var_m,k_test.transpose()) var_f = (diag(var_m)).transpose() one_mat = ones((1,ntest)) var_f = var_f + (1/self.beta)*one_mat return f, var_f
def reduce(self, tdata): """ This function builds the kernel matrix from the data, and the test data, and projects the test data onto the KPCA eigenspace. :param tdata: data matrix :math:`D\in\mathbb{R}^{d \\times m}`, where :math:`d` is the dimensionality and :math:`m` is the number of testing samples :type tdata: numpy array :return: eigenfunction coefficients :rtype: numpy array """ k_test = kernel(self.data, tdata, self.kernel) if self.centered > 0: ntest = tdata.shape[1] #print ntest #print (self.k_cent).shape #print k_test.shape #print tile(self.k_cent, (1, ntest)).shape k_test = k_test - tile(self.k_cent, (1, ntest)) k_test = dot(self.h_mat,k_test) coeff = dot(transpose(self.alpha), k_test) return coeff
def process(self, data_in, obs_vec): """ Generate function network model. :param data: Training data matrix :math:`\mathcal{X}\in\mathbb{R}^{d\\times n}` :type data: numpy array :param obs_vec: Observation vector :math:`y\in\mathbb{R}^{1 \\times n}` :type obs_vec: numpy array :return: none :rtype: none """ # check consistency of data obs_num = obs_vec.shape[1] data_num = data_in.shape[1] if obs_num != data_num: raise Exception("Number of samples for data and observations must be the same") else: # initialize variables self.data = data_in self.data_dim = data_in.shape[0] nsamp = data_num # peel off parameters ki = self.k_type bandwidth = ki.params[0] # compute regularized kernel matrix kmat = kernel(self.data, self.data, self.k_type) + (pow(self.noise,2))*eye(nsamp) # perform Cholesky factorization, and compute mean vector (for stable inverse computations) self.lmat = cholesky(kmat).transpose() self.mean_vec = lstsq(self.lmat, obs_vec) self.mean_vec = lstsq(self.lmat.transpose(), self.mean_vec)
def modfit(self, print_stat=True): self.sort_out_text() if(print_stat): # if requested by user (passing print_stat=True to modfit) prints out the output file of the fortran code describing best fit parameters (by default True) self.print_stat_array() self.save_stat_array() self.dismantle_keplerian_fit() self.dismantle_RV_kep() results = kernel(self.generate_summary(), self.jd, self.rv_obs, self.rv_error,self.o_c, self.model, self.JD_model, self.npl,self.semiM,self.masses,self.data_set,self.stat_array_saved,self.reduced_chi2,self.chi2,self.rms,self.loglik, self.mfit,self.omega_dot,self.omega_dot_err) return results
def getK(self): """ return Kinship matrix as kernel object """ if not self.isNormalised: self.impute() K = np.dot(self.GT, self.GT.T) K /= K.diagonal().mean() Kobj = kernel.kernel(self.SID, K) return Kobj
def getK(self): """ return Kinship matrix as kernel object """ if not self.isNormalised: self.impute() K = np.dot(self.GT, self.GT.T) K /= K.diagonal().mean() Kobj = kernel.kernel(self.SID, K) return Kobj
def predict(self,X_test): X_test = X_test.as_matrix() n = np.shape(X_test)[0] y_pred = np.zeros((n,1)) for i in tqdm(range(n)): x = X_test[i,] Kx = np.asarray([kernel(self.kernel, xi, x, self.sigma, self.k, self.d, self.e, self.beta) for xi in self.X_train]) y_pred[i,] = np.dot(Kx,self.alpha) y_pred = np.sign(y_pred).astype('int') y_pred_list = map(lambda x: x[0], y_pred) return(pd.Series(y_pred_list))
def apply(newdata_par, alldata_par, no_parameters, SOL, kernel_type): # print(SOL.shape, alldata_par.shape, no_parameters) no_new = newdata_par.shape[0] no_evaluations = alldata_par.shape[0] TEMP = np.zeros([no_new, no_evaluations]) for i in range(no_parameters): v = alldata_par[:, i] M = npm.repmat(v, no_new, 1) v_new = newdata_par[:, i] M_new = npm.repmat(v_new, no_evaluations, 1) T = np.transpose(M_new) TEMP = TEMP + np.power(M - T, 2) np.sqrt(TEMP, out=TEMP) kernel.kernel(TEMP, kernel_type) no_polynomials = 1 + no_parameters # plus linear polynomials newdata_surrogate = np.matmul(TEMP, SOL[:-no_polynomials]) pp = SOL[-1] + np.matmul(newdata_par, SOL[-no_parameters - 1:-1]) # print(pp.shape) newdata_surrogate = np.reshape(newdata_surrogate, (no_new, 1)) + np.reshape(pp, (no_new, 1)) return newdata_surrogate
def predict(self, te_data): """ Use :math:`\\alpha` to compute values at data points. :param D: Testing data matrix :math:`D\in\mathbb{R}^{m\\times d}` :type phi_mat: numpy array :return: `est_obs_vec`: estimated output values at data :math:`\hat{y}\in\mathbb{R}^{m}` :rtype: numpy array """ k_test = kernel(self.data, te_data, self.k_type) coeff = dot((self.alpha).transpose(), k_test) return coeff
def __init__(self, data_mat, label_mat, C, toler, kernel_type): self.data_mat = data_mat # Data Mat self.label_mat = label_mat # Label Mat self.C = C # Soft margin parameter self.toler = toler # toler for stop self.m = np.shape(data_mat)[0] # numbers of data mat self.alphas = np.mat(np.zeros((self.m, 1))) # alphas mat self.b = 0 # Initial as 0 self.eCache = np.mat(np.zeros((self.m, 2))) # Cache self.Kernel = np.mat(np.zeros((self.m, self.m))) for i in range(self.m): self.Kernel[:, i] = kernel(self.data_mat, self.data_mat[i, :], kernel_type)
def fit(self, Xs, Ys, Xt, Yt): Ns, Nt = len(Xs), len(Xt) X = np.vstack((Xs, Xt)) N, P = X.shape C = len(np.unique(Ys)) X /= np.expand_dims(np.linalg.norm(X, axis=1), P) # normalization E = np.vstack((1 / Ns * np.ones((Ns, 1)), -1 / Nt * np.ones((Nt, 1)))) H = np.eye(N) - 1 / N * np.ones((N, N)) Yp = None acc_list = [] for i in range(self.maxit): Mc = 0 M0 = E * E.T * C if Yp is not None and len(Yp) == Nt: for c in range(1, C + 1): E = np.zeros((N, 1)) tt = Ys == c E[np.where(tt == True)] = 1 / len(Ys[np.where(Ys == c)]) yy = Yp == c E[np.array(np.where(yy == True)) + Ns] = \ -1 / len(Yp[np.where(Yp == c)]) E[np.isinf(E)] = 0 Mc = Mc + np.dot(E, E.T) M = M0 + Mc if self.kernel is None: N_eye = P K = X.T else: N_eye = N K = kernel(np.asarray(X), np.asarray(X), self.kernel, self.kargs) A = np.linalg.multi_dot([K, M, K.T]) + self.beta * np.eye(N_eye) B = np.linalg.multi_dot([K, H, K.T]) V, U = sp.linalg.eig(A, B) ind = np.argsort(V) A = U[:, ind[:self.dim]] Z = np.dot(A.T, K) Z /= np.linalg.norm(Z, axis=0) Xs_new, Xt_new = Z[:, :Ns].T, Z[:, Ns:].T knn = KNeighborsClassifier(n_neighbors=1) knn.fit(Xs_new, Ys.ravel()) Yp = knn.predict(Xt_new) acc = sklearn.metrics.accuracy_score(Yt, Yp) acc_list.append(acc) print('JDA iteration [{}/{}]: Acc: {:.4f}' .format(i + 1, self.maxit, acc)) return Xs_new, Xt_new
def test(data_mat, label_mat_ref, support_vector_data, support_vector_label, support_vector_alphas, b, kernel_type): error_count = 0 m, n = np.shape(data_mat) for i in range(m): kernel_eval = kernel(support_vector_data, data_mat[i, :], kernel_type) predict = kernel_eval.T * np.multiply(support_vector_label, support_vector_alphas) + b if np.sign(predict) != np.sign(label_mat_ref[i]): error_count += 1 print(i) print("The Test error rate is: %d/%d" % (error_count, m)) return m, error_count
def tick(g): gp = g j = gp > 0 L = np.argwhere(j) D = np.argwhere(np.invert(j)) K_live = kernel(L, space=gp.shape[0]) K_dead = kernel(D, space=gp.shape[0]) N_live = neighbors(gp, K_live, L) N_dead = neighbors(gp, K_dead, D) S_live = np.array([np.sum(n) for n in N_live]) S_dead = np.array([np.sum(n) for n in N_dead]) rip = L[np.any([S_live < 2, S_live > 3], axis=0)] gp[rip[:, 0], rip[:, 1]] = 0 baby = D[S_dead == 3] gp[baby[:, 0], baby[:, 1]] = 1 return gp
def __init__(self): gk.init() self.kernel = kernel() self.choices = [] self.loading = False self.saving = True self.app = qt.QApplication() self.main = qt.QMainWindow() self.main.resize(400, 640) self.setMenu() self.font = gui.QFont() self.font.setPixelSize(14) self.font.setFamily("宋体") self.main.show() self.hello()
def project(self, tdata): """ This function uses the Nystrom extension to projects the test data onto the diffusion space. :param tdata: data matrix :math:`D\in\mathbb{R}^{d \\times m}`, where :math:`d` is the dimensionality and :math:`m` is the number of testing samples :type tdata: numpy array :return: projected test data :rtype: numpy array """ K_test = kernel(self.data, tdata, self.kernel) coeff = dot(transpose(self.alpha), K_test) return coeff
def init(config): ## Initialise jarvis kernel jarvis = kernel.kernel(config) ## Connect to data source jarvis.register('data', data.init(jarvis)) ## Initialise functions jarvis.register('function', load_modules('functions')) ## Set up interfaces jarvis.register('interface', load_modules('interfaces')) ## Finish setup jarvis.setup() return jarvis
def init(config): ## Initialise jarvis kernel jarvis = kernel.kernel(config) ## Connect to data source jarvis.register('data', data.init(jarvis)) ## Initialise functions jarvis.register('function', load_modules('functions')) ## Set up interfaces jarvis.register('interface', load_modules('interfaces')) ## Finish setup jarvis.setup() return jarvis
def draw_rfunc(self, te_data): """ Draw random function from current Bayesian RBF model. :param D: Testing data matrix :math:`D\in\mathbb{R}^{d \\times m}` :type phi_mat: numpy array :return: `f`: estimated output values at data :math:`\hat{y}\in\mathbb{R}^{1 \\times m}` :rtype: numpy array """ # sample a random weight vector from the Bayesian model w_random = rnd.multivariate_normal(self.mn_aslist,self.precision,1).transpose() k_test = kernel(self.centers, te_data, self.k_type) f_rand = dot(w_random.transpose(),k_test) f_rand = squeeze(asarray(f_rand)) return f_rand
def train(self, X, y): DNA_chars = ["A", "T", "C", "G"] self.DNA_seq = [] self.X_train = X self.y = y self.alpha = np.zeros(y.shape) n = len(y) self.K = np.zeros((n, n)) if (self.kernel_name == "Linear"): self.K = (X @ X.T) else: for i in range(n): for j in range(i + 1): self.K[i, j] = kernel(X[i], X[j], self.kernel_name) self.K[j, i] = self.K[i, j] self.alpha = scipy.optimize.minimize(self.logistic_regression, self.alpha)['x']
def process(self, data, obs_vec): """ Generate function network model. :param phi_mat: Training data matrix :math:`\mathcal{X}\in\mathbb{R}^{d\\times n}` :type phi_mat: numpy array :param obs_vec: Observation vector :math:`y\in\mathbb{R}^{1 \\times n}` :type obs_vec: numpy array :return: none :rtype: none """ # check consistency of data data_dim = data.shape[0] obs_num = obs_vec.shape[1] data_num = data.shape[1] if data_dim != self.centers_dim: raise Exception("Dimensions of data and centers must be the same") elif obs_num != data_num: raise Exception("Number of samples for data and observations must be the same") else: # peel off parameters ki = self.k_type bandwidth = ki.params[0] # create kernel feature matrix phi = kernel(data, self.centers, self.k_type) self.alpha = 1/(pow(bandwidth,2)) self.beta = 1/(pow(self.noise,2)) # take into account both options if self.noise is 0: # S = inv(alpha*eye(m) + beta*(Phi'*Phi)); # m_n = beta*(S*(Phi'*vals')); jitter = 0.00001 # add jitter factor to ensure inverse doesn't blow up self.precision = inv(jitter*eye(self.ncent) + self.beta*dot(phi.transpose(),phi)) else: self.precision = inv(self.alpha*eye(self.ncent) + self.beta*dot(phi.transpose(),phi)) self.mn = (dot(obs_vec,phi)).transpose() self.mn = self.beta*(dot(self.precision,self.mn)) self.mn_aslist = array((self.mn).transpose())[0].tolist() # store as list for use in multivariate normal sampling
def evaluate(self, tdata): """ This function computes the output of the kernel SVM using the kernel, current weight vector and bias. :param tdata: data matrix :math:`D\in\mathbb{R}^{d \\times m}`, where :math:`d` is the dimensionality and :math:`m` is the number of testing samples :type tdata: numpy array :return: projected test data :rtype: numpy array """ test_dim = tdata.shape[0] if self.dim != test_dim: raise Exception("ERROR: dimensionality of test data must be consistent.") K_test = kernel(self.svecs, tdata, self.kernel) weights = self.alpha*self.slabels f_eval = dot(weights, K_test) return f_eval
def classify_object(features, labels, test_feature, distance_function_type, kernel_function_type, window_type, window_parameter): distances_and_labels = [] # count distances between test_feature and others for index in range(len(features)): distances_and_labels.append({ 'distance': distance(test_feature, features[index], distance_function_type), 'label': labels[index] }) # sort by distance distances_and_labels = sorted(distances_and_labels, key=lambda k: k['distance']) # set radius if window_type == 'variable': # get radius as distance to vector number window_parameter (as they are sorted by distance) and if there are block of save vectors there do a little step out of them window_radius = distances_and_labels[window_parameter]['distance'] \ if distances_and_labels[window_parameter-1]['distance'] < distances_and_labels[window_parameter]['distance'] \ else distances_and_labels[window_parameter-1]['distance'] + 0.000001 else: window_radius = window_parameter weighted_class_sum = 0 kernels_sum = 0 for index in range(len(features)): kernel_value = kernel( distances_and_labels[index]['distance'] / window_radius if window_radius != 0 else 0, kernel_function_type) weighted_class_sum += distances_and_labels[index][ 'label'] * kernel_value kernels_sum += kernel_value predicted_value = weighted_class_sum / kernels_sum if kernels_sum != 0 else weighted_class_sum return predicted_value
def process(self, data): """ This function builds the diffusion matrix from the data, performs the random walk, and returns the diffused data points. :param data: data matrix :math:`D\in\mathbb{R}^{d \\times n}`, where :math:`d` is the dimensionality and :math:`n` is the number of training samples :type data: numpy array :return: diffused data :rtype: numpy array """ # perform eigendecomposition k_mat = kernel(data, data, self.kernel) k_evals, k_evecs = eigsh(k_mat, k=self.neigs, which='LM') k_evals = sqrt(k_evals) k_scale = (ones((1,self.neigs),float)/k_evals) k_scale = diag(k_scale[0,:]) # create scaling matrix alpha = dot(k_evecs, k_scale) self.alpha = alpha # store copies of coefficients and data self.data = data
def create_kernels(self): intervals = get_list_of_intervals(datetime(2015, 1, 1, 6, 0, 0), datetime(2015, 1, 1, 21, 5, 0), timedelta(minutes=5)) #intervals.append(datetime(2015, 1, 1, 23, 59, 59)) # list_of_times = get_list_of_times(self.trainingdata['dateAndTime']) # list_of_datasets = list() # for i in range(0, len(intervals)-1): #create data set for every 5-minute interval # indices = where((list_of_times >= intervals[i].time()) & # (list_of_times < intervals[i+1].time())) # dataset = self.create_dataset(indices) # list_of_datasets.append(dataset) list_of_trainingsets = self.split_dataset(self.trainingdata, intervals) list_of_testingsets = self.split_dataset(self.testingdata, intervals, True) for i in range(0, len(list_of_trainingsets)): #combine data sets with neighbors kernel_data = zeros((1, 3)) for j in range(-(self.window_size), self.window_size+1): kernel_data = vstack((kernel_data, list_of_trainingsets[(i+j)%len(list_of_trainingsets)])) kernel_data = delete(kernel_data, 0, axis=0) #delete first row k = kernel(kernel_data[:, [0,1]], kernel_data[:, 2]) #create kernel print intervals[i].time() k.tune(list_of_testingsets[i]) self.kernel_map[str(intervals[i].time())] = k #add kernel to kernel_map
def predict(self, X, val=False): nb = X.shape[0] result = [] for i in range(nb): pred = 0 for j in range(len(self.alpha)): pred = pred + (kernel(self.X_train[j], X[i], kernel_name=self.kernel_name, degree=self.degree, gamma=self.gamma) * self.alpha[j]) if (pred >= 0): result.append(1) else: if (val): result.append(-1) else: result.append(0) return result
def main(): dataset = pd.read_csv("./datasets/data.csv") dataset.drop(columns='id', inplace=True) dataset.dropna(axis=1, how='all', inplace=True) dataset.replace('M', 1, inplace=True) dataset.replace('B', 0, inplace=True) data = dataset.values np.random.shuffle(data) y, x = np.split(data, (1, ), axis=1) y = y.flatten() ratio = 0.8 index = int(ratio * len(data)) x_train, x_test, y_train, y_test = x[:index], x[index:], y[:index], y[ index:] kernel_function = kernel.kernel(x_train, y_train, 30) clf = svm.SVC(kernel=kernel_function) a = time.time() clf.fit(x_train, y_train.ravel()) b = time.time() print("time: ", b - a, " seconds") print("accuracy:", clf.score(x_test, y_test))
def classify_object(features, labels, test_features, distance_function_type, kernel_function_type, window_type, window_parameter): distances_and_labels = [] for index in range(len(features)): distances_and_labels.append({ 'distance': distance(test_features, features[index], distance_function_type), 'label': labels[index] }) distances_and_labels = sorted(distances_and_labels, key=lambda k: k['distance']) if window_type == 'variable': window_radius = distances_and_labels[window_parameter]['distance'] \ if distances_and_labels[window_parameter-1]['distance'] < distances_and_labels[window_parameter]['distance'] \ else distances_and_labels[window_parameter-1]['distance'] + 0.000001 else: window_radius = window_parameter weighted_class_sum = 0 kernels_sum = 0 for index in range(len(features)): kernel_value = kernel( distances_and_labels[index]['distance'] / window_radius if window_radius != 0 else 0, kernel_function_type) weighted_class_sum += distances_and_labels[index][ 'label'] * kernel_value kernels_sum += kernel_value predicted_value = weighted_class_sum / kernels_sum if kernels_sum != 0 else weighted_class_sum return predicted_value
def create_matching_kernel_ff(stars_source, stars_target, allstars=True): kern = kernel(81) nn = int(np.minimum(len(stars_source), len(stars_target))) starpairs = np.stack([stars_target[:nn], stars_source[:nn]]) _, nstars, nside, _ = np.shape(starpairs) npsf = nside - kern.nf pairs = [] for i in range(nstars): star1 = starpairs[1][i] star2 = starpairs[0][i] pairs.append([star1, star2]) if i > 0 and not allstars: continue sol = kern.solve(npsf, pairs) # sol[sol < 0] = 0 sol /= sol.sum() print sol.sum() print sol.shape return sol
def fit(self, Xs, Xt): Ns, Nt = len(Xs), len(Xt) X = np.vstack((Xs, Xt)) N, P = X.shape X /= np.expand_dims(np.linalg.norm(X, axis=1), P) # normalization E = np.vstack((1 / Ns * np.ones((Ns, 1)), -1 / Nt * np.ones((Nt, 1)))) M = E * E.T M = M / np.linalg.norm(M, 'fro') H = np.eye(N) - 1 / N * np.ones((N, N)) if self.kernel is None: N_eye = P K = X.T else: N_eye = N K = kernel(np.asarray(X), np.asarray(X), self.kernel, self.kargs) A = np.linalg.multi_dot([K, M, K.T]) + self.beta * np.eye(N_eye) B = np.linalg.multi_dot([K, H, K.T]) V, U = sp.linalg.eig(A, B) ind = np.argsort(V) A = U[:, ind[:self.dim]] Z = np.dot(A.T, K) Z /= np.linalg.norm(Z, axis=0) Xs_new, Xt_new = Z[:, :Ns].T, Z[:, Ns:].T return Xs_new, Xt_new
np.set_printoptions(precision=4) x = np.zeros([5, 5]) for fileName in sorted(glob('img/ts1/*.png')): print '_' * 60 print fileName img = imread(fileName) img = gray(img) a, b = fileName.split('/')[-1].split('.')[0].split('-') a, b = ord(a) - 65, ord(b) - 65 if img[0, 0] < 10: img = 255 - img KS = img / 1.0 sigma = 1 ki = kernel(KS, sigma) x[a][b] = ki x[b][a] = ki print x pca = PCA(n_components=2) pca.fit(x) print 'pca ratio', pca.explained_variance_ratio_ fig = plt.figure() ax = fig.add_subplot(121, projection='3d') ax.scatter(x[:, 0], x[:, 1], x[:, 2], color='bbrrr') ax = fig.add_subplot(122) x = pca.transform(x) print x ax.scatter(x[:, 0], x[:, 1], color='bbrrr')
#*****************************************************************************# ############################################################################### # Process Matrix Elements through kernel # ############################################################################### # Load shared library of kernel src/ files to ROOT ROOT.gROOT.SetBatch(0) ROOT.gSystem.Load('lib/libpdf.so') ROOT.gSystem.Load("lib/libme.so") # Set the parameters of the model using the parameter card(s) pobj = setparams() # Create kernel object MEObj = kernel.kernel(nexternal-dof, amtOfInfoPerEvent, pobj, mode = gpu, pdfsetn = 'CT10', kernelfn = "kernel/kernel.cl", pR = neval) # Initialize results arrays resultsVector = np.zeros(nevts, dtype = kernel.a_float_t) class batch_func(VEGAS.BatchIntegrand): def __init__(self, ME_kernel_object = None): self.ME_kernel_object = ME_kernel_object def __call__(self, neutrino_space): eval = self.ME_kernel_object.eval(xp = neutrino_space) return eval # Set the kinematic values for the each event in the kernel object in order to evaluate the ME. write_path = "/home/kvmu/vbf/vbf_plotting"
else: grovepi.digitalWrite(8,0) grovepi.digitalWrite(9,1) elif index==3: if r_or_g==0:#green grovepi.digitalWrite(16,1) grovepi.digitalWrite(17,0) else: grovepi.digitalWrite(16,0) grovepi.digitalWrite(17,1) initial_rgb() space_num = 8 # init Kernel = kernel(block_num=space_num) print('kernel ready') client = mqtt.Client() client.on_connect = on_connect client.on_message = on_message client.connect("192.168.0.104") client.loop_start() grovepi.pinMode(6,"OUTPUT") #led 1 R grovepi.pinMode(7,"OUTPUT") #led 2 R grovepi.pinMode(8,"OUTPUT") #led 3 R grovepi.pinMode(9,"OUTPUT") #led 3 G grovepi.pinMode(14,"OUTPUT") #led 1 G
# print the names of the kernels print k1 print k2 print k3 print k4 print k5 print k7 # now, generate plots for kernels x = np.arange(-5,5,0.1) x_rad = np.arange(-3,7,0.1) y = np.array([2]) # y vals k_gauss = kernel(x_rad,y,k1) k_sigm = kernel(x,y,k2) k_poly = kernel(x,y,k3) k_lap = kernel(x_rad,y,k4) k_cauchy = kernel(x_rad,y,k5) k_periodic = kernel(x_rad,y,k7) k_locally_periodic = kernel(x_rad,y,k8) # save files in test data directory if save_data: savemat('../data/unit_tests/test_kernel.mat', {'k_gauss':k_gauss,'k_sigm':k_sigm,'k_poly':k_poly,'k_lap':k_lap, 'k_cauchy':k_cauchy,'k_periodic':k_periodic,'k_locally_periodic':k_locally_periodic}) # plot Gaussian kernel values
def simplesmo(self, data, labels): """ This function uses a simplified version of the SMO algorithm to train the weight and bias vectors associated to solution to the maximum margin problem. If the data is nonlinearly separable, this algorithm will not converge. See Andrew Ng's notes for more information. A technical point: in the SMO algorithm, we need to refer to elements in the numpy arrays. Therefore we have to use the item function. :param data: data matrix :math:`D\in\mathbb{R}^{d \\times n}`, where :math:`d` is the dimensionality and :math:`n` is the number of training samples :type data: numpy array """ # initialize passes = 0 alpha_old = zeros((1,self.nsamp)) while (passes < self.max_its): num_changed_alphas = 0 # process data for i in xrange(1,self.nsamp): # compute the Ei variable datai = self.svecs[:,i-1:i] labeli = (self.slabels).item(i-1) f_evali = self.evaluate(datai) f_evalj = f_evali.item(0) Ei = f_evali - labeli # compute conditions required alphai = (self.alpha).item(i-1) cond1 = (labeli*Ei < -self.tol and alphai < self.C) cond2 = (labeli*Ei > self.tol and alphai > 0) # check to see if you have to keep going; if you have to, you must optimize a lagrange multiplier pair if cond1 or cond2: j = rnd.randint(1,self.nsamp,size=1) j = j.item(0) # compute eval_array[j] dataj = self.svecs[:,j-1:j] labelj = (self.slabels).item(j-1) f_evalj = self.evaluate(dataj) f_evalj = f_evali.item(0) # convert f_evali to scalar Ej = f_evalj - labelj alphaj = (self.alpha).item(j-1) # save old Lagrange multipliers alpha_old[:,i-1] = alphai alpha_old[:,j-1] = alphaj # compute L and H if labeli != labelj: L = amax([0,alphaj-alphai]) H = amin([self.C,self.C+alphaj-alphai]) else: L = amax([0,alphai+alphaj-self.C]) H = amin([self.C,alphai+alphaj]) if L == H: continue # compute eta eta = 2*kernel(datai,dataj,self.kernel) - kernel(datai,datai,self.kernel) - kernel(dataj,dataj,self.kernel) eta = eta.item(0) if eta >= 0: continue # compute new value for alphaj alphaj = alphaj - (labelj*(Ei-Ej))/eta # clip if necessary if alphaj > H: alphaj = H elif alphaj < L: alphaj = L # if no change, continue if (fabs(alphaj-alpha_old.item(j-1)) < self.tol): continue # otherwise, update alphai self.alpha[:,i-1] = alphai + labeli*labelj*(alpha_old.item(j-1) - alphaj) # compute threshold b1 = self.bias - Ei - labeli*(alphai-alpha_old.item(i-1))*kernel(datai,datai,self.kernel) b1 = b1 - labelj*(alphaj-alpha_old.item(j-1))*kernel(datai,dataj,self.kernel) b2 = self.bias - Ej - labeli*(alphai-alpha_old.item(i-1))*kernel(datai,dataj,self.kernel) b2 = b2 - labelj*(alphaj-alpha_old.item(j-1))*kernel(dataj,dataj,self.kernel) if alphai > 0 and alphai < self.C: self.bias = b1 elif alphaj > 0 and alphaj < self.C: self.bias = b2 else: self.bias = (b1+b2)/2 num_changed_alphas = num_changed_alphas + 1 if num_changed_alphas == 0: passes = passes + 1 else: passes = 0 print "Pass ", passes
def __init__(self, agent_num, time, render=True): self.game = kernel(car_num=agent_num, time=time, render=render) self.g_map = self.game.get_map() self.memory = [] sum
kern_dict_local['s_axis'][s_axis_idx]['master']['num'] = str(i + int(s_axis['master']['num'])) else: if kern_dict_local['s_axis']['scope'] == 'local': kern_dict_local['s_axis']['master']['num'] = str( i + int(kern_dict_local['s_axis']['master']['num'])) if 'wire_slave' in kern_dict_local: if type(kern_dict_local['wire_slave']) == type([]): for slave_idx, slave in enumerate(kern_dict_local['wire_slave']): kern_dict_local['wire_slave'][slave_idx]['master']['num'] = str(i + int(slave['master']['num'])) else: kern_dict_local['wire_slave']['master']['num'] = str(i + int(slave['master']['num'])) print("kern dicT " + str(kern_dict_local)) self.kernels.append(kernel(**kern_dict_local)) print("kernelONE object " + str(self.kernels[len(self.kernels) - 1].data)) else: kern_dict_local['rep'] = 1 kern_dict_local['num'] = int(kern_dict_local['num']) self.kernels.append(kernel(**kern_dict_local)) for kern in self.kernels: print("kernel object " + str(kern.data)) self.nodes = [] for node_idx, node_dict in enumerate(map_dict): node_inst = node(**node_dict) node_inst['kernel'] = []
from kernel import kernel import savitzky_golay_filter as sgf xkernels1 = [ kernel(sgf.makeIt(71, 5, 12, 12, 1, 0)), kernel(sgf.makeIt(25, 5, 12, 12, 1, 0)), kernel(sgf.makeIt(21, 3, 10, 10, 1, 0)), kernel(sgf.makeIt(9, 3, 4, 4, 1, 0)), kernel(sgf.makeIt(5, 3, 2, 2, 1, 0)), kernel(sgf.makeIt(3, 2, 1, 1, 1, 0)), kernel(sgf.makeIt(3, 2, 0, 1, 1, 0)), kernel(sgf.makeIt(3, 2, 1, 0, 1, 0)), kernel(sgf.makeIt(3, 2, 2, 1, 1, 0)), kernel(sgf.makeIt(3, 2, 1, 2, 1, 0)), kernel(sgf.makeIt(3, 2, 0, 0, 1, 0)), kernel(sgf.makeIt(3, 2, 0, 2, 1, 0)), kernel(sgf.makeIt(3, 2, 2, 0, 1, 0)), kernel(sgf.makeIt(3, 2, 2, 2, 1, 0)), ] ykernels1 = [ kernel(sgf.makeIt(71, 5, 12, 12, 0, 1)), kernel(sgf.makeIt(25, 5, 12, 12, 0, 1)), kernel(sgf.makeIt(21, 3, 10, 10, 0, 1)), kernel(sgf.makeIt(9, 3, 4, 4, 0, 1)), kernel(sgf.makeIt(5, 3, 2, 2, 0, 1)), kernel(sgf.makeIt(3, 2, 1, 1, 0, 1)), kernel(sgf.makeIt(3, 2, 0, 1, 0, 1)), kernel(sgf.makeIt(3, 2, 1, 0, 0, 1)), kernel(sgf.makeIt(3, 2, 2, 1, 0, 1)), kernel(sgf.makeIt(3, 2, 1, 2, 0, 1)),
lval = [training_label.count(i) for i in lkey] temp = lkey[lval.index(max(lval))] return [temp for i in test_data] """ """ #SVM def CLM(training_set, training_label, test_data): if len(set(training_label)) == 1: return [training_label[0] for i in test_data] clf = svm.SVC(decision_function_shape='ovo') clf.fit(training_set, training_label) return clf.predict(np.array(test_data)) """ trcl = treelet_CPM(trL, labeling(trdataextract)) ker = kernel("ra", [coi]) trcl.ker(ker) trcl.cor() trcl.target() trcl.CLM = CLM trcl.linkage("inf") print("start: tree") trcl.tree() print("start: train") trcl.train() print("start: predict") L = trcl.predict(tsL) realL = labeling(tsdataextract) with open("temp.csv", "w", newline="") as csvfile: writer = csv.writer(csvfile) writer.writerow(L)
import numpy as np from kernel import kernel import matplotlib.pyplot as plt from time import sleep A = np.random.randint(1,10,[6,6]) A loc = np.array([2,3]) order = 3 for k in range(order): dx = np.arange(loc[0]-order+k, loc[0]+order+1-k) dy = np.arange(loc[1]-order+k, loc[1]+order+1-k) ix = np.mod(dx,6) iy = np.mod(dy,6) print(ix) k = kernel(np.array([[3,3]]), type='square', order=0, space=8) k[:,:,0] a=[] r = 5 for t in range(360): x = 3+np.round(r*np.cos(t*np.pi/180)) y = 3+np.round(r*np.sin(t*np.pi/180)) a.append(np.array([x,y])) # for o in range(10): # kin = kernel(np.array([[33,33]]), type='circle', order=o, space=64) # plt.imshow(kin[:,:,0]) # plt.show()