Ejemplo n.º 1
0
    def test9EmbedParams(self):
        mol = Chem.AddHs(Chem.MolFromSmiles('OCCC'))
        fn = os.path.join(RDConfig.RDBaseDir, 'Code', 'GraphMol',
                          'DistGeomHelpers', 'test_data',
                          'simple_torsion.dg.mol')
        ref = Chem.MolFromMolFile(fn, removeHs=False)
        params = rdDistGeom.EmbedParameters()
        params.randomSeed = 42
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)

        fn = os.path.join(RDConfig.RDBaseDir, 'Code', 'GraphMol',
                          'DistGeomHelpers', 'test_data',
                          'simple_torsion.etdg.mol')
        ref = Chem.MolFromMolFile(fn, removeHs=False)
        params = rdDistGeom.EmbedParameters()
        params.randomSeed = 42
        params.useExpTorsionAnglePrefs = True
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)
        params = rdDistGeom.ETDG()
        params.randomSeed = 42
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)

        fn = os.path.join(RDConfig.RDBaseDir, 'Code', 'GraphMol',
                          'DistGeomHelpers', 'test_data',
                          'simple_torsion.etkdg.mol')
        ref = Chem.MolFromMolFile(fn, removeHs=False)
        params = rdDistGeom.EmbedParameters()
        params.randomSeed = 42
        params.useExpTorsionAnglePrefs = True
        params.useBasicKnowledge = True
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)
        params = rdDistGeom.ETKDG()
        params.randomSeed = 42
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)

        fn = os.path.join(RDConfig.RDBaseDir, 'Code', 'GraphMol',
                          'DistGeomHelpers', 'test_data',
                          'simple_torsion.kdg.mol')
        ref = Chem.MolFromMolFile(fn, removeHs=False)
        params = rdDistGeom.EmbedParameters()
        params.randomSeed = 42
        params.useBasicKnowledge = True
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)
        params = rdDistGeom.KDG()
        params.randomSeed = 42
        self.assertEqual(rdDistGeom.EmbedMolecule(mol, params), 0)
        self._compareConfs(mol, ref, 0, 0)
Ejemplo n.º 2
0
def test_mols():
    mols = []
    all_smiles = [
        'CN=C=O', 'Cc1ccccc1', 'CC1=CC2CC(CC1)O2', 'CCCCCCCCCCCCCCCC'
    ]
    for smiles in all_smiles:
        mol = rdmolfiles.MolFromSmiles(smiles)
        mol = rdmolops.AddHs(mol, addCoords=True)
        rdDistGeom.EmbedMolecule(mol, rdDistGeom.ETKDG())
        mol = rdmolops.RemoveHs(mol)
        mol.SetProp('Fitness', str(np.random.rand(1)[0]))
        mols.append(mol)
    return mols
Ejemplo n.º 3
0
    def test6RmsPruning(self):
        smiles = [
            'CC(C)CC(NC(C1[N+]CCC1)=O)C([O-])=O',
            'CC(NC(CO)C(O)c1ccc([N+]([O-])=O)cc1)=O',
            'CC([N+])C(NC(C)C(N1C(C=O)CCC1)=O)=O',
            'CC(NC1C(O)C=C(C([O-])=O)OC1C(O)C(O)CO)=O',
            'CCCC=C(NC(C1CC1(C)C)=O)C([O-])=O',
            'OCC(O)C(O)C(Cn1c2c(cc(C)c(C)c2)nc-2c(=O)[nH]c(=O)nc12)O'
        ]

        nconfs = []
        expected = [4, 5, 5, 4, 5, 4]
        expected = [3, 3, 5, 4, 4, 4]
        for smi in smiles:
            mol = Chem.MolFromSmiles(smi)
            cids = rdDistGeom.EmbedMultipleConfs(mol,
                                                 50,
                                                 maxAttempts=30,
                                                 randomSeed=100,
                                                 pruneRmsThresh=1.5)
            nconfs.append(len(cids))

        d = [abs(x - y) for x, y in zip(expected, nconfs)]
        # print(nconfs)
        self.assertTrue(max(d) <= 1)

        # previous settings
        params = rdDistGeom.ETKDG()
        params.randomSeed = 100
        params.maxIterations = 30
        params.pruneRmsThresh = 1.5
        params.useSymmetryForPruning = False
        nconfs = []
        expected = [4, 5, 5, 4, 5, 4]
        for smi in smiles:
            mol = Chem.MolFromSmiles(smi)
            cids = rdDistGeom.EmbedMultipleConfs(mol, 50, params)
            nconfs.append(len(cids))

        d = [abs(x - y) for x, y in zip(expected, nconfs)]
        # print(nconfs)
        self.assertTrue(max(d) <= 1)
Ejemplo n.º 4
0
def construct_pos_matrix(mol: rdchem.Mol,
                         out_size: Optional[int] = -1) -> np.ndarray:
    """Construct relative positions from each atom within the molecule.

    Params:
    -------
    mol: rdkit.Chem.rdchem.Mol
        Molecule of interest. 

    out_size: int, optional, default=-1
        The size of the returned array. If this option is negative, it 
        does not take any effect. Otherwise, it must be larger than or 
        equal to the number of atoms in the input molecule. If so, the 
        end of the array is padded with zeros.

    Returns:
    --------
    pos_matrix: np.ndarray, shape=(n,n,3)
        Relative position (XYZ) coordinates from one atom the others in 
        the mol. 

    Examples:
    ---------
    ```python
    >>> from rdkit import Chem
    >>> from rdkit.Chem import AllChem
    >>> smiles = 'N[C@@]([H])([C@]([H])(O2)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])' \
                 '(O)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)2'
    >>> mol = Chem.MolFromSmiles(smiles)
    >>> mol = Chem.AddHs(mol, addCoords=True)
    >>> AllChem.EmbedMolecule(mol, AllChem.ETKDG())
    >>> mol = Chem.RemoveHs(mol)
    >>> pos_matrix = construct_pos_matrix(mol, out_size=-1)
    >>> pos_matrix.shape
    (34,34,3)

    >>> pos_matrix = construct_pos_matrix(mol, out_size=49)
    >>> pos_matrix.shape
    (49,49,3)
    ```
    """
    # Obtain initial distance geometry between atoms, if unavilable
    if mol.GetNumConformers() == 0:
        mol = rdmolops.AddHs(mol, addCoords=True)
        rdDistGeom.EmbedMolecule(mol, rdDistGeom.ETKDG())
        mol = rdmolops.RemoveHs(mol)
    coords = mol.GetConformer().GetPositions()  # shape=(N,3)
    N = mol.GetNumAtoms()

    # Determine appropiate output size to generate feature matrix of same size for all mols.
    if out_size < 0:
        size = N
    elif out_size >= N:
        size = out_size
    else:
        raise ValueError(
            '`out_size` (N={}) is smaller than number of atoms in mol (N={})'.
            format(out_size, N))

    pos_matrix = np.zeros(shape=(size, size, 3), dtype=np.float)
    for atom_idx in range(N):
        atom_pos = coords[atom_idx]  # central atom of interest
        for neighbor_idx in range(N):
            neigh_pos = coords[neighbor_idx]  # neighboring atom
            pos_matrix[
                atom_idx,
                neighbor_idx] = atom_pos - neigh_pos  # dist between neighbor -> center
    return pos_matrix
Ejemplo n.º 5
0
def sample_mol():
    mol = rdmolfiles.MolFromSmiles('CN=C=O')
    mol = rdmolops.AddHs(mol, addCoords=True)
    rdDistGeom.EmbedMolecule(mol, rdDistGeom.ETKDG())
    return rdmolops.RemoveHs(mol)
Ejemplo n.º 6
0
                #print("({}, {}) {} < x < {}".format(i, j, bm[j, i], bm[i, j]))
                if bm[i, j] < bm[j, i]:
                    print(
                        "   ***** Assertion failed !! (Before smoothing) *****"
                    )
                assert (bm[i, j] >= bm[j, i])

        if DG.DoTriangleSmoothing(bm) == False:
            print("Smoothing failed")

        for i in range(len(bm)):
            for j in range(i + 1, len(bm)):
                #print("({}, {}) {} < x < {}".format(i, j, bm[j, i], bm[i, j]))
                if bm[i, j] < bm[j, i]:
                    print(
                        "   ***** Assertion failed !! (After smoothing) *****")
                assert (bm[i, j] >= bm[j, i])
        ps = rdDistGeom.EmbedParameters()
        ps.useRandomCoords = True
        ps.SetBoundsMat(bm)
        ps.randomSeed = 0xf00d
        try:
            rdDistGeom.EmbedMolecule(mol, ps)
        except:
            print("Failed to generate coordinates")
            ps = rdDistGeom.ETKDG()
            ps.useRandomCoords = True
            ps.randomSeed = 0xf00d
            rdDistGeom.EmbedMolecule(mol, ps)
        w.write(mol)