Ejemplo n.º 1
0
    def prepare_vacuum_edge(self, ff_params):
        """
        Prepares the vacuum system.
        Parameters
        ----------
        ff_params: tuple of np.array
            Exactly equal to bond_params, angle_params, proper_params, improper_params, charge_params, lj_params
        Returns
        -------
        4 tuple
            unbound_potentials, system_parameters, combined_masses, combined_coords
        """
        ligand_masses_a = [a.GetMass() for a in self.mol_a.GetAtoms()]
        ligand_masses_b = [b.GetMass() for b in self.mol_b.GetAtoms()]

        ligand_coords_a = get_romol_conf(self.mol_a)
        ligand_coords_b = get_romol_conf(self.mol_b)

        final_params, final_potentials = self._get_system_params_and_potentials(
            ff_params, self.top)

        combined_masses = np.mean(self.top.interpolate_params(
            ligand_masses_a, ligand_masses_b),
                                  axis=0)
        combined_coords = np.mean(self.top.interpolate_params(
            ligand_coords_a, ligand_coords_b),
                                  axis=0)

        return final_potentials, final_params, combined_masses, combined_coords
Ejemplo n.º 2
0
def test_setting_up_restraints_using_distance():
    seed = 814
    smi_a = "CCCONNN"
    smi_b = "CCCNNN"
    mol_a = Chem.MolFromSmiles(smi_a)
    mol_a = Chem.AddHs(mol_a)

    mol_b = Chem.MolFromSmiles(smi_b)
    mol_b = Chem.AddHs(mol_b)
    for mol in [mol_a, mol_b]:
        AllChem.EmbedMolecule(mol, randomSeed=seed)

    mol_a_coords = get_romol_conf(mol_a)
    mol_b_coords = get_romol_conf(mol_b)

    core = setup_relative_restraints_by_distance(mol_a, mol_b)
    assert core.shape == (5, 2)

    # If we have a 0 cutoff, expect nothing to overlap
    core = setup_relative_restraints_by_distance(mol_a, mol_b, cutoff=0.0)
    assert core.shape == (0, )

    for cutoff in [0.08, 0.1, 0.2, 1.0]:
        core = setup_relative_restraints_by_distance(mol_a,
                                                     mol_b,
                                                     cutoff=cutoff)
        assert core.size > 0
        for a, b in core.tolist():
            assert np.linalg.norm(mol_a_coords[a] - mol_b_coords[b]) < cutoff

    # Adds seven hydrogen (terminal) atoms if allow terminal matches
    core = setup_relative_restraints_by_distance(mol_a, mol_b, terminal=True)
    assert core.shape == (12, 2)
Ejemplo n.º 3
0
    def test_nonbonded_optimal_map(self):
        """Similar test as test_nonbonbed, ie. assert that coordinates and nonbonded parameters
        can be averaged in benzene -> phenol transformation. However, use the maximal mapping possible."""

        # map benzene H to phenol O, leaving a dangling phenol H
        core = np.array(
            [[0, 0], [1, 1], [2, 2], [3, 3], [4, 4], [5, 5], [6, 6]],
            dtype=np.int32)

        st = topology.SingleTopology(self.mol_a, self.mol_b, core, self.ff)
        x_a = get_romol_conf(self.mol_a)
        x_b = get_romol_conf(self.mol_b)

        # test interpolation of coordinates.
        x_src, x_dst = st.interpolate_params(x_a, x_b)
        x_avg = np.mean([x_src, x_dst], axis=0)

        assert x_avg.shape == (st.get_num_atoms(), 3)

        np.testing.assert_array_equal((x_a[:7] + x_b[:7]) / 2,
                                      x_avg[:7])  # core parts
        np.testing.assert_array_equal(x_b[-1], x_avg[7])  # dangling H

        params, vjp_fn, pot_c = jax.vjp(st.parameterize_nonbonded,
                                        self.ff.q_handle.params,
                                        self.ff.lj_handle.params,
                                        has_aux=True)

        vjp_fn(np.random.rand(*params.shape))

        assert params.shape == (2 * st.get_num_atoms(), 3)  # qlj

        # test interpolation of parameters
        bt_a = topology.BaseTopology(self.mol_a, self.ff)
        qlj_a, pot_a = bt_a.parameterize_nonbonded(self.ff.q_handle.params,
                                                   self.ff.lj_handle.params)
        bt_b = topology.BaseTopology(self.mol_b, self.ff)
        qlj_b, pot_b = bt_b.parameterize_nonbonded(self.ff.q_handle.params,
                                                   self.ff.lj_handle.params)

        n_base_params = len(
            params
        ) // 2  # params is actually interpolated, so its 2x number of base params

        # qlj_c = np.mean([params[:n_base_params], params[n_base_params:]], axis=0)

        params_src = params[:n_base_params]
        params_dst = params[n_base_params:]

        # core testing
        np.testing.assert_array_equal(qlj_a[:7], params_src[:7])
        np.testing.assert_array_equal(qlj_b[:7], params_dst[:7])

        # r-group atoms in A are all part of the core. so no testing is needed.

        # test r-group in B
        np.testing.assert_array_equal(qlj_b[7], params_dst[8])
        np.testing.assert_array_equal(np.array([0, qlj_b[7][1], 0]),
                                      params_src[8])
Ejemplo n.º 4
0
def setup_relative_restraints_by_distance(mol_a: Chem.Mol,
                                          mol_b: Chem.Mol,
                                          cutoff: float = 0.1,
                                          terminal: bool = False):
    """
    Setup restraints between atoms in two molecules using
    a cutoff distance between atoms

    Parameters
    ----------
    mol_a: Chem.Mol
        First molecule

    mol_b: Chem.Mol
        Second molecule

    cutoff: float=0.1
        Distance between atoms to consider as a match

    terminal: bool=false
        Map terminal atoms

    Returns
    -------
    np.array (N, 2)
        Atom mapping between atoms in mol_a to atoms in mol_b.
    """

    ligand_coords_a = get_romol_conf(mol_a)
    ligand_coords_b = get_romol_conf(mol_b)
    core_idxs_a = []
    core_idxs_b = []

    for idx, a in enumerate(mol_a.GetAtoms()):
        if not terminal and a.GetDegree() == 1:
            continue
        for b_idx, b in enumerate(mol_b.GetAtoms()):
            if not terminal and b.GetDegree() == 1:
                continue
            if np.linalg.norm(ligand_coords_a[idx] -
                              ligand_coords_b[b_idx]) < cutoff:
                core_idxs_a.append(idx)
                core_idxs_b.append(b_idx)
    assert len(core_idxs_a) == len(core_idxs_b), "Core sizes were inconsistent"

    rij = cdist(ligand_coords_a[core_idxs_a], ligand_coords_b[core_idxs_b])

    row_idxs, col_idxs = linear_sum_assignment(rij)

    core_idxs = []

    for core_a, core_b in zip(row_idxs, col_idxs):
        core_idxs.append((core_idxs_a[core_a], core_idxs_b[core_b]))

    core_idxs = np.array(core_idxs, dtype=np.int32)

    return core_idxs
Ejemplo n.º 5
0
    def prepare_host_edge(self, ff_params, host_system, host_coords):
        """
        Prepares the host-edge system
        Parameters
        ----------
        ff_params: tuple of np.array
            Exactly equal to bond_params, angle_params, proper_params, improper_params, charge_params, lj_params
        host_system: openmm.System
            openmm System object to be deserialized
        host_coords: np.array
            Nx3 array of atomic coordinates
        Returns
        -------
        4 tuple
            unbound_potentials, system_params, combined_masses, combined_coords
        """

        ligand_masses_a = [a.GetMass() for a in self.mol_a.GetAtoms()]
        ligand_masses_b = [b.GetMass() for b in self.mol_b.GetAtoms()]

        # extract the 0th conformer
        ligand_coords_a = get_romol_conf(self.mol_a)
        ligand_coords_b = get_romol_conf(self.mol_b)

        host_bps, host_masses = openmm_deserializer.deserialize_system(
            host_system, cutoff=1.2)

        hgt = topology.HostGuestTopology(host_bps, self.top)

        final_params, final_potentials = self._get_system_params_and_potentials(
            ff_params, hgt)
        if isinstance(self.top, topology.SingleTopology):
            combined_masses = np.concatenate([
                host_masses,
                np.mean(self.top.interpolate_params(ligand_masses_a,
                                                    ligand_masses_b),
                        axis=0)
            ])
            combined_coords = np.concatenate([
                host_coords,
                np.mean(self.top.interpolate_params(ligand_coords_a,
                                                    ligand_coords_b),
                        axis=0)
            ])
        else:
            combined_masses = np.concatenate(
                [host_masses, ligand_masses_a, ligand_masses_b])
            combined_coords = np.concatenate(
                [host_coords, ligand_coords_a, ligand_coords_b])

        return final_potentials, final_params, combined_masses, combined_coords
Ejemplo n.º 6
0
def _wrap_simulate(args):
    print("IN WRAP SIMULATE")
    (
        mol,
        U_proposal,
        U_target,
        temperature,
        masses,
        steps_per_batch,
        batches_per_worker,
        burn_in_batches,
        num_workers,
        seed,
    ) = args

    # wraps a callable fn so it runs in a subprocess with the device_count set explicitly
    assert multiprocessing.get_start_method() == "spawn"
    os.environ["XLA_FLAGS"] = "--xla_force_host_platform_device_count=" + str(num_workers)

    kT = temperature * BOLTZ

    x0 = get_romol_conf(mol)
    xs_proposal = simulate(
        x0,
        U_proposal,
        temperature,
        masses,
        steps_per_batch,
        batches_per_worker + burn_in_batches,
        num_workers,
        seed,
    )

    num_atoms = mol.GetNumAtoms()

    # discard burn-in batches and reshape into a single flat array
    xs_proposal = xs_proposal[:, burn_in_batches:, :, :]

    batch_U_proposal_fn = jax.pmap(jax.vmap(U_proposal))
    batch_U_target_fn = jax.pmap(jax.vmap(U_target))

    Us_target = batch_U_target_fn(xs_proposal)
    Us_proposal = batch_U_proposal_fn(xs_proposal)

    log_numerator = -Us_target.reshape(-1) / kT
    log_denominator = -Us_proposal.reshape(-1) / kT

    log_weights = log_numerator - log_denominator

    # reshape into flat array by removing num_workers dimension
    xs_proposal = xs_proposal.reshape(-1, num_atoms, 3)

    return xs_proposal, log_weights
Ejemplo n.º 7
0
    def prepare_host_edge(self, ff_params, host_system, host_coords):
        """
        Prepares the host-edge system

        Parameters
        ----------
        ff_params: tuple of np.array
            Exactly equal to bond_params, angle_params, proper_params, improper_params, charge_params, lj_params

        host_system: openmm.System
            openmm System object to be deserialized

        host_coords: np.array
            Nx3 array of atomic coordinates

        Returns
        -------
        4 tuple
            unbound_potentials, system_params, combined_masses, combined_coords

        """
        ligand_masses = [a.GetMass() for a in self.mol.GetAtoms()]
        ligand_coords = get_romol_conf(self.mol)

        host_bps, host_masses = openmm_deserializer.deserialize_system(
            host_system, cutoff=1.2)

        hgt = topology.HostGuestTopology(host_bps, self.top)

        final_params, final_potentials = self._get_system_params_and_potentials(
            ff_params, hgt)

        combined_masses = np.concatenate([host_masses, ligand_masses])
        combined_coords = np.concatenate([host_coords, ligand_coords])

        return final_potentials, final_params, combined_masses, combined_coords
Ejemplo n.º 8
0
def test_neighborlist_ligand_host():
    ligand = hif2a_ligand_pair.mol_a
    ligand_coords = get_romol_conf(ligand)

    system, host_coords, box, top = build_water_system(4.0)
    num_host_atoms = host_coords.shape[0]
    host_coords = np.array(host_coords)

    coords = np.concatenate([host_coords, ligand_coords])

    N = coords.shape[0]
    D = 3
    cutoff = 1.0
    block_size = 32
    padding = 0.1

    np.random.seed(1234)
    diag = np.amax(coords, axis=0) - np.amin(coords, axis=0) + padding
    box = np.diag(diag)

    # Can only sort the host coords, but not the row/ligand
    sort = True
    if sort:
        perm = hilbert_sort(
            coords[:num_host_atoms] + np.argmin(coords[:num_host_atoms]), D)
        coords[:num_host_atoms] = coords[:num_host_atoms][perm]

    col_coords = np.expand_dims(coords[:num_host_atoms], axis=0)
    # Compute the reference interactions of the ligand
    ref_ixn_list = []
    num_ligand_atoms = coords[num_host_atoms:].shape[0]
    num_blocks_of_32 = (num_ligand_atoms + block_size - 1) // block_size
    box_diag = np.diag(box)
    for rbidx in range(num_blocks_of_32):
        row_start = num_host_atoms + (rbidx * block_size)
        row_end = min(num_host_atoms + ((rbidx + 1) * block_size), N)
        row_coords = coords[row_start:row_end]
        row_coords = np.expand_dims(row_coords, axis=1)
        deltas = row_coords - col_coords
        deltas -= box_diag * np.floor(deltas / box_diag + 0.5)

        dij = np.linalg.norm(deltas, axis=-1)
        # Since the row and columns are unique, don't need to handle duplicates
        idxs = np.argwhere(np.any(dij < cutoff, axis=0))
        ref_ixn_list.append(idxs.reshape(-1).tolist())

    for nblist in (
            custom_ops.Neighborlist_f32(num_host_atoms, num_ligand_atoms),
            custom_ops.Neighborlist_f64(num_host_atoms, num_ligand_atoms),
    ):
        for _ in range(2):

            test_ixn_list = nblist.get_nblist_host_ligand(
                coords[:num_host_atoms], coords[num_host_atoms:], box, cutoff)
            # compute the sparsity of the tile
            assert len(ref_ixn_list) == len(
                test_ixn_list
            ), "Number of blocks with interactions don't agree"

            for bidx, (a, b) in enumerate(zip(ref_ixn_list, test_ixn_list)):
                if sorted(a) != sorted(b):
                    print("TESTING bidx", bidx)
                    print(sorted(a))
                    print(sorted(b))
                np.testing.assert_equal(sorted(a), sorted(b))
Ejemplo n.º 9
0
def main(args, stage):

    # benzene = Chem.AddHs(Chem.MolFromSmiles("c1ccccc1")) # a
    # phenol = Chem.AddHs(Chem.MolFromSmiles("Oc1ccccc1")) # b
    # 01234567890
    benzene = Chem.AddHs(Chem.MolFromSmiles("C1=CC=C2C=CC=CC2=C1"))  # a
    phenol = Chem.AddHs(Chem.MolFromSmiles("C1=CC=C2C=CC=CC2=C1"))  # b

    AllChem.EmbedMolecule(benzene)
    AllChem.EmbedMolecule(phenol)

    ff_handlers = Forcefield.load_from_file(
        "smirnoff_1_1_0_ccc.py").get_ordered_handles()
    r_benzene = Recipe.from_rdkit(benzene, ff_handlers)
    r_phenol = Recipe.from_rdkit(phenol, ff_handlers)

    r_combined = r_benzene.combine(r_phenol)
    core_pairs = np.array(
        [
            [0, 0],
            [1, 1],
            [2, 2],
            [3, 3],
            [4, 4],
            [5, 5],
            [6, 6],
            [7, 7],
            [8, 8],
            [9, 9],
            # [10,10]
        ],
        dtype=np.int32,
    )
    core_pairs[:, 1] += benzene.GetNumAtoms()

    a_idxs = np.arange(benzene.GetNumAtoms())
    b_idxs = np.arange(phenol.GetNumAtoms()) + benzene.GetNumAtoms()

    core_k = 20.0

    if stage == 0:
        centroid_k = 200.0
        rbfe.stage_0(r_combined, b_idxs, core_pairs, centroid_k, core_k)
        # lambda_schedule = np.linspace(0.0, 1.0, 2)
        # lambda_schedule = np.array([0.0, 0.0, 0.0, 0.0, 0.0])
        lambda_schedule = np.array([0.0, 0.0, 0.0, 0.0, 0.0])
    elif stage == 1:
        rbfe.stage_1(r_combined, a_idxs, b_idxs, core_pairs, core_k)
        lambda_schedule = np.linspace(0.0, 1.2, 60)
    else:
        assert 0

    system, host_coords, box, topology = builders.build_water_system(4.0)

    r_host = Recipe.from_openmm(system)
    r_final = r_host.combine(r_combined)

    # minimize coordinates of host + ligand A
    ha_coords = np.concatenate([host_coords, get_romol_conf(benzene)])

    pool = Pool(args.num_gpus)

    # we need to run this in a subprocess since the cuda runtime
    # must not be initialized in the master thread due to lack of
    # fork safety
    r_minimize = minimize_setup(r_host, r_benzene)
    ha_coords = pool.map(
        minimize,
        [(r_minimize.bound_potentials, r_minimize.masses, ha_coords, box)],
        chunksize=1)
    # this is a list
    ha_coords = ha_coords[0]
    pool.close()

    pool = Pool(args.num_gpus)

    x0 = np.concatenate([ha_coords, get_romol_conf(phenol)])

    masses = np.concatenate([r_host.masses, r_benzene.masses, r_phenol.masses])

    seed = np.random.randint(np.iinfo(np.int32).max)

    intg = LangevinIntegrator(300.0, 1.5e-3, 1.0, masses, seed)

    # production run at various values of lambda
    for epoch in range(10):
        avg_du_dls = []

        run_args = []
        for lamb_idx, lamb in enumerate(lambda_schedule):
            run_args.append(
                (lamb, intg, r_final.bound_potentials, r_final.masses, x0, box,
                 lamb_idx % args.num_gpus, stage))

        avg_du_dls = pool.map(run, run_args, chunksize=1)

        print("stage", stage, "epoch", epoch, "dG",
              np.trapz(avg_du_dls, lambda_schedule))
Ejemplo n.º 10
0
    def test_nonbonded(self):

        # leaving benzene H unmapped, and phenol OH unmapped
        core = np.array(
            [
                [0, 0],
                [1, 1],
                [2, 2],
                [3, 3],
                [4, 4],
                [5, 5],
            ],
            dtype=np.int32,
        )

        st = topology.SingleTopology(self.mol_a, self.mol_b, core, self.ff)
        x_a = get_romol_conf(self.mol_a)
        x_b = get_romol_conf(self.mol_b)

        # test interpolation of coordinates.
        x_src, x_dst = st.interpolate_params(x_a, x_b)
        x_avg = np.mean([x_src, x_dst], axis=0)

        assert x_avg.shape == (st.get_num_atoms(), 3)

        np.testing.assert_array_equal((x_a[:6] + x_b[:6]) / 2, x_avg[:6])  # C
        np.testing.assert_array_equal(x_a[6], x_avg[6])  # H
        np.testing.assert_array_equal(x_b[6:], x_avg[7:])  # OH

        # NOTE: unused result
        st.parameterize_nonbonded(self.ff.q_handle.params,
                                  self.ff.lj_handle.params)

        params, vjp_fn, pot_c = jax.vjp(st.parameterize_nonbonded,
                                        self.ff.q_handle.params,
                                        self.ff.lj_handle.params,
                                        has_aux=True)

        vjp_fn(np.random.rand(*params.shape))

        assert params.shape == (2 * st.get_num_atoms(), 3)  # qlj

        # test interpolation of parameters
        bt_a = topology.BaseTopology(self.mol_a, self.ff)
        qlj_a, pot_a = bt_a.parameterize_nonbonded(self.ff.q_handle.params,
                                                   self.ff.lj_handle.params)
        bt_b = topology.BaseTopology(self.mol_b, self.ff)
        qlj_b, pot_b = bt_b.parameterize_nonbonded(self.ff.q_handle.params,
                                                   self.ff.lj_handle.params)

        n_base_params = len(
            params
        ) // 2  # params is actually interpolated, so its 2x number of base params

        # qlj_c = np.mean([params[:n_base_params], params[n_base_params:]], axis=0)

        params_src = params[:n_base_params]
        params_dst = params[n_base_params:]

        # core testing
        np.testing.assert_array_equal(qlj_a[:6], params_src[:6])
        np.testing.assert_array_equal(qlj_b[:6], params_dst[:6])

        # test r-group in A
        np.testing.assert_array_equal(qlj_a[6], params_src[6])
        np.testing.assert_array_equal(np.array([0, qlj_a[6][1], 0]),
                                      params_dst[6])

        # test r-group in B
        np.testing.assert_array_equal(qlj_b[6:], params_dst[7:])
        np.testing.assert_array_equal(
            np.array([[0, qlj_b[6][1], 0], [0, qlj_b[7][1], 0]]),
            params_src[7:])
Ejemplo n.º 11
0
def setup_relative_restraints_using_smarts(mol_a, mol_b, smarts):
    """
    Setup restraints between atoms in two molecules using
    a pre-defined SMARTS pattern.

    Parameters
    ----------
    mol_a: Chem.Mol
        First molecule

    mol_b: Chem.Mol
        Second molecule

    smarts: string
        Smarts pattern defining the common core.

    Returns
    -------
    np.array (N, 2)
        Atom mapping between atoms in mol_a to atoms in mol_b.

    """

    # check to ensure the core is connected
    # technically allow for this but we need to do more validation before
    # we can be fully comfortable
    assert "." not in smarts

    core = Chem.MolFromSmarts(smarts)

    # we want *all* possible combinations.
    limit = 1000
    all_core_idxs_a = np.array(
        mol_a.GetSubstructMatches(core, uniquify=False, maxMatches=limit))
    all_core_idxs_b = np.array(
        mol_b.GetSubstructMatches(core, uniquify=False, maxMatches=limit))

    assert len(all_core_idxs_a) < limit
    assert len(all_core_idxs_b) < limit

    best_rmsd = np.inf
    best_core_idxs_a = None
    best_core_idxs_b = None

    ligand_coords_a = get_romol_conf(mol_a)
    ligand_coords_b = get_romol_conf(mol_b)

    # setup relative orientational restraints
    # rough sketch of algorithm:
    # find core atoms in mol_a
    # find core atoms in mol_b
    # for all matches in mol_a
    #    for all matches in mol_b
    #       use the hungarian algorithm to assign matching
    #       if sum is smaller than best, then store.

    for core_idxs_a in all_core_idxs_a:
        for core_idxs_b in all_core_idxs_b:

            ri = np.expand_dims(ligand_coords_a[core_idxs_a], 1)
            rj = np.expand_dims(ligand_coords_b[core_idxs_b], 0)
            rij = np.sqrt(np.sum(np.power(ri - rj, 2), axis=-1))

            row_idxs, col_idxs = linear_sum_assignment(rij)

            rmsd = np.linalg.norm(ligand_coords_a[core_idxs_a[row_idxs]] -
                                  ligand_coords_b[core_idxs_b[col_idxs]])

            if rmsd < best_rmsd:
                best_rmsd = rmsd
                best_core_idxs_a = core_idxs_a
                best_core_idxs_b = core_idxs_b

    core_idxs = np.stack([best_core_idxs_a, best_core_idxs_b],
                         axis=1).astype(np.int32)
    print("core_idxs", core_idxs, "rmsd", best_rmsd)

    return core_idxs
Ejemplo n.º 12
0
# 1. build water box
# 2. build ligand
# 3. convert to recipe

# construct an RDKit molecule of aspirin
# note: not using OpenFF Molecule because want to avoid the dependency (YTZ?)
romol = Chem.AddHs(Chem.MolFromSmiles("CC(=O)OC1=CC=CC=C1C(=O)O"))

ligand_masses = [a.GetMass() for a in romol.GetAtoms()]

# generate conformers
AllChem.EmbedMolecule(romol)

# extract the 0th conformer
ligand_coords = get_romol_conf(romol)

# construct a 4-nanometer water box (from openmmtools approach: selecting out
#   of a large pre-equilibrated water box snapshot)
system, host_coords, box, omm_topology = builders.build_water_system(4.0)

host_bps, host_masses = openmm_deserializer.deserialize_system(system,
                                                               cutoff=1.2)

combined_masses = np.concatenate([host_masses, ligand_masses])

# write some conformations into this PDB file
writer = pdb_writer.PDBWriter([omm_topology, romol], "debug.pdb")

# note the order in which the coordinates are concatenated in this step --
#   in a later step we will need to combine recipes in the same order
Ejemplo n.º 13
0
def minimize_host_4d(mols, host_system, host_coords, ff, box, mol_coords=None) -> np.ndarray:
    """
    Insert mols into a host system via 4D decoupling using Fire minimizer at lambda=1.0,
    0 Kelvin Langevin integration at a sequence of lambda from 1.0 to 0.0, and Fire minimizer again at lambda=0.0

    The ligand coordinates are fixed during this, and only host_coords are minimized.

    Parameters
    ----------
    mols: list of Chem.Mol
        Ligands to be inserted. This must be of length 1 or 2 for now.

    host_system: openmm.System
        OpenMM System representing the host

    host_coords: np.ndarray
        N x 3 coordinates of the host. units of nanometers.

    ff: ff.Forcefield
        Wrapper class around a list of handlers

    box: np.ndarray [3,3]
        Box matrix for periodic boundary conditions. units of nanometers.

    mol_coords: list of np.ndarray
        Pre-specify a list of mol coords. Else use the mol.GetConformer(0)

    Returns
    -------
    np.ndarray
        This returns minimized host_coords.

    """

    assert box.shape == (3, 3)

    host_bps, host_masses = openmm_deserializer.deserialize_system(host_system, cutoff=1.2)

    num_host_atoms = host_coords.shape[0]

    if len(mols) == 1:
        top = topology.BaseTopology(mols[0], ff)
    elif len(mols) == 2:
        top = topology.DualTopologyMinimization(mols[0], mols[1], ff)
    else:
        raise ValueError("mols must be length 1 or 2")

    mass_list = [np.array(host_masses)]
    conf_list = [np.array(host_coords)]
    for mol in mols:
        # mass increase is to keep the ligand fixed
        mass_list.append(np.array([a.GetMass() * 100000 for a in mol.GetAtoms()]))

    if mol_coords is not None:
        for mc in mol_coords:
            conf_list.append(mc)
    else:
        for mol in mols:
            conf_list.append(get_romol_conf(mol))

    combined_masses = np.concatenate(mass_list)
    combined_coords = np.concatenate(conf_list)

    hgt = topology.HostGuestTopology(host_bps, top)

    u_impls = bind_potentials(hgt, ff)

    # this value doesn't matter since we will turn off the noise.
    seed = 0

    intg = LangevinIntegrator(0.0, 1.5e-3, 1.0, combined_masses, seed).impl()

    x0 = combined_coords
    v0 = np.zeros_like(x0)

    x0 = fire_minimize(x0, u_impls, box, np.ones(50))
    # context components: positions, velocities, box, integrator, energy fxns
    ctxt = custom_ops.Context(x0, v0, box, intg, u_impls)
    ctxt.multiple_steps(np.linspace(1.0, 0, 1000))

    final_coords = fire_minimize(ctxt.get_x_t(), u_impls, box, np.zeros(50))
    for impl in u_impls:
        du_dx, _, _ = impl.execute(final_coords, box, 0.0)
        norm = np.linalg.norm(du_dx, axis=-1)
        assert np.all(norm < 25000)

    return final_coords[:num_host_atoms]
Ejemplo n.º 14
0
def equilibrate_host(
    mol: Chem.Mol,
    host_system: openmm.System,
    host_coords: NDArray,
    temperature: float,
    pressure: float,
    ff: Forcefield,
    box: NDArray,
    n_steps: int,
    seed: Optional[int] = None,
) -> Tuple[NDArray, NDArray]:
    """
    Equilibrate a host system given a reference molecule using the MonteCarloBarostat.

    Useful for preparing a host that will be used for multiple FEP calculations using the same reference, IE a starmap.

    Performs the following:
    - Minimize host with rigid mol
    - Minimize host and mol
    - Run n_steps with HMR enabled and MonteCarloBarostat every 5 steps

    Parameters
    ----------
    mol: Chem.Mol
        Ligand for the host to equilibrate with.

    host_system: openmm.System
        OpenMM System representing the host.

    host_coords: np.ndarray
        N x 3 coordinates of the host. units of nanometers.

    temperature: float
        Temperature at which to run the simulation. Units of kelvins.

    pressure: float
        Pressure at which to run the simulation. Units of bars.

    ff: ff.Forcefield
        Wrapper class around a list of handlers.

    box: np.ndarray [3,3]
        Box matrix for periodic boundary conditions. units of nanometers.

    n_steps: int
        Number of steps to run the simulation for.

    seed: int or None
        Value to seed simulation with

    Returns
    -------
    tuple (coords, box)
        Returns equilibrated system coords as well as the box.

    """
    # insert mol into the binding pocket.
    host_bps, host_masses = openmm_deserializer.deserialize_system(host_system, cutoff=1.2)

    min_host_coords = minimize_host_4d([mol], host_system, host_coords, ff, box)

    ligand_masses = [a.GetMass() for a in mol.GetAtoms()]
    ligand_coords = get_romol_conf(mol)

    combined_masses = np.concatenate([host_masses, ligand_masses])
    combined_coords = np.concatenate([min_host_coords, ligand_coords])

    top = topology.BaseTopology(mol, ff)
    hgt = topology.HostGuestTopology(host_bps, top)

    # setup the parameter handlers for the ligand
    tuples = [
        [hgt.parameterize_harmonic_bond, [ff.hb_handle]],
        [hgt.parameterize_harmonic_angle, [ff.ha_handle]],
        [hgt.parameterize_periodic_torsion, [ff.pt_handle, ff.it_handle]],
        [hgt.parameterize_nonbonded, [ff.q_handle, ff.lj_handle]],
    ]

    u_impls = []
    bound_potentials = []

    for fn, handles in tuples:
        params, potential = fn(*[h.params for h in handles])
        bp = potential.bind(params)
        bound_potentials.append(bp)
        u_impls.append(bp.bound_impl(precision=np.float32))

    bond_list = get_bond_list(bound_potentials[0])
    combined_masses = model_utils.apply_hmr(combined_masses, bond_list)

    dt = 2.5e-3
    friction = 1.0

    if seed is None:
        seed = np.random.randint(np.iinfo(np.int32).max)

    integrator = LangevinIntegrator(temperature, dt, friction, combined_masses, seed).impl()

    x0 = combined_coords
    v0 = np.zeros_like(x0)

    group_indices = get_group_indices(bond_list)
    barostat_interval = 5
    barostat = MonteCarloBarostat(x0.shape[0], pressure, temperature, group_indices, barostat_interval, seed).impl(
        u_impls
    )

    # Re-minimize with the mol being flexible
    x0 = fire_minimize(x0, u_impls, box, np.ones(50))
    # context components: positions, velocities, box, integrator, energy fxns
    ctxt = custom_ops.Context(x0, v0, box, integrator, u_impls, barostat)

    ctxt.multiple_steps(np.linspace(0.0, 0.0, n_steps))

    return ctxt.get_x_t(), ctxt.get_box()
Ejemplo n.º 15
0
from timemachine.md import builders, minimizer

# construct an RDKit molecule of aspirin
# note: not using OpenFF Molecule because want to avoid the dependency (YTZ?)
romol_a = Chem.AddHs(Chem.MolFromSmiles("CC(=O)OC1=CC=CC=C1C(=O)O"))
romol_b = Chem.AddHs(Chem.MolFromSmiles("CC(=O)OC1=CC=CC=C1C(=O)OC"))

ligand_masses_a = [a.GetMass() for a in romol_a.GetAtoms()]
ligand_masses_b = [a.GetMass() for a in romol_b.GetAtoms()]

# generate conformers
AllChem.EmbedMolecule(romol_a)
AllChem.EmbedMolecule(romol_b)

# extract the 0th conformer
ligand_coords_a = get_romol_conf(romol_a)
ligand_coords_b = get_romol_conf(romol_b)

# construct a 4-nanometer water box (from openmmtools approach: selecting out
#   of a large pre-equilibrated water box snapshot)
system, host_coords, box, omm_topology = builders.build_water_system(4.0)

# padding to avoid jank
box = box + np.eye(3) * 0.1

host_bps, host_masses = openmm_deserializer.deserialize_system(system, cutoff=1.2)

combined_masses = np.concatenate([host_masses, ligand_masses_a, ligand_masses_b])


# minimize coordinates