def learn( env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=0, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None, clipping=False, entropy='none', positive_return=False, reward_clustering='none', capacity=10, warm_start=True): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() # Building the environment ob_space = env.observation_space ac_space = env.action_space # Creating the memory buffer memory = Memory(capacity=capacity, batch_size=n_episodes, horizon=horizon, ob_space=ob_space, ac_space=ac_space) # Building the target policy and saving its parameters pi = make_policy('pi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [ v for v in all_var_list if v.name.split('/')[1].startswith('pol') ] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) # Building a set of behavioral policies behavioral_policies = memory.build_policies(make_policy, pi) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([None], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(None), name='mask') rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='rew') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='disc_rew') clustered_rew_ = tf.placeholder(dtype=tf.float32, shape=(None)) gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') iter_number_ = tf.placeholder(dtype=tf.int32, name='iter_number') active_policies = tf.placeholder(dtype=tf.float32, shape=(capacity), name='active_policies') losses_with_name = [] # Total number of trajectories N_total = tf.reduce_sum(active_policies) * n_episodes # Split operations disc_rew_split = tf.reshape(disc_rew_ * mask_, [-1, horizon]) rew_split = tf.reshape(rew_ * mask_, [-1, horizon]) mask_split = tf.reshape(mask_, [-1, horizon]) # Policy densities target_log_pdf = pi.pd.logp(ac_) * mask_ target_log_pdf_split = tf.reshape(target_log_pdf, [-1, horizon]) behavioral_log_pdfs = tf.stack([ bpi.pd.logp(ac_) * mask_ for bpi in memory.policies ]) # Shape is (capacity, ntraj*horizon) behavioral_log_pdfs_split = tf.reshape(behavioral_log_pdfs, [memory.capacity, -1, horizon]) # Compute renyi divergencies and sum over time, then exponentiate emp_d2_split = tf.reshape( tf.stack([pi.pd.renyi(bpi.pd, 2) * mask_ for bpi in memory.policies]), [memory.capacity, -1, horizon]) emp_d2_split_cum = tf.exp(tf.reduce_sum(emp_d2_split, axis=2)) # Compute arithmetic and harmonic mean of emp_d2 emp_d2_mean = tf.reduce_mean(emp_d2_split_cum, axis=1) emp_d2_arithmetic = tf.reduce_sum( emp_d2_mean * active_policies) / tf.reduce_sum(active_policies) emp_d2_harmonic = tf.reduce_sum(active_policies) / tf.reduce_sum( 1 / emp_d2_mean) # Return processing: clipping, centering, discounting ep_return = clustered_rew_ #tf.reduce_sum(mask_split * disc_rew_split, axis=1) if clipping: rew_split = tf.clip_by_value(rew_split, -1, 1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) rew_split = rew_split - (tf.reduce_sum(rew_split) / (tf.reduce_sum(mask_split) + 1e-24)) discounter = [pow(gamma, i) for i in range(0, horizon)] # Decreasing gamma discounter_tf = tf.constant(discounter) disc_rew_split = rew_split * discounter_tf # Reward statistics return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) return_step_max = tf.reduce_max(tf.abs(rew_split)) # Max step reward return_step_mean = tf.abs(tf.reduce_mean(rew_split)) positive_step_return_max = tf.maximum(0.0, tf.reduce_max(rew_split)) negative_step_return_max = tf.maximum(0.0, tf.reduce_max(-rew_split)) return_step_maxmin = tf.abs(positive_step_return_max - negative_step_return_max) losses_with_name.extend([(return_mean, 'InitialReturnMean'), (return_max, 'InitialReturnMax'), (return_min, 'InitialReturnMin'), (return_std, 'InitialReturnStd'), (emp_d2_arithmetic, 'EmpiricalD2Arithmetic'), (emp_d2_harmonic, 'EmpiricalD2Harmonic'), (return_step_max, 'ReturnStepMax'), (return_step_maxmin, 'ReturnStepMaxmin')]) if iw_method == 'is': # Sum the log prob over time. Shapes: target(Nep, H), behav (Cap, Nep, H) target_log_pdf_episode = tf.reduce_sum(target_log_pdf_split, axis=1) behavioral_log_pdf_episode = tf.reduce_sum(behavioral_log_pdfs_split, axis=2) # To avoid numerical instability, compute the inversed ratio log_ratio = target_log_pdf_split - behavioral_log_pdfs_split inverse_log_ratio_episode = -tf.reduce_sum(log_ratio, axis=2) iw = 1 / tf.reduce_sum(tf.exp(inverse_log_ratio_episode) * tf.expand_dims(active_policies, -1), axis=0) # Compute also the balance-heuristic weights iw_split = tf.reshape(iw, (memory.capacity, -1)) iw_by_behavioral = tf.reduce_mean(iw_split, axis=1) losses_with_name.append( (iw_by_behavioral[0] / tf.reduce_sum(iw_by_behavioral), 'MultiIWFirstRatio')) losses_with_name.append( (tf.reduce_max(iw_by_behavioral), 'MultiIWMax')) losses_with_name.append( (tf.reduce_sum(iw_by_behavioral), 'MultiIWSum')) losses_with_name.append( (tf.reduce_min(iw_by_behavioral), 'MultiIWMin')) # Get the probability by exponentiation #target_pdf_episode = tf.exp(target_log_pdf_episode) #behavioral_pdf_episode = tf.exp(behavioral_log_pdf_episode) # Get the denominator by averaging over behavioral policies #behavioral_pdf_mixture = tf.reduce_mean(behavioral_pdf_episode, axis=0) + 1e-24 #iw = target_pdf_episode / behavioral_pdf_mixture iwn = iw / n_episodes # Compute the J w_return_mean = tf.reduce_sum(ep_return * iwn) # Empirical D2 of the mixture and relative ESS ess_renyi_arithmetic = N_total / emp_d2_arithmetic ess_renyi_harmonic = N_total / emp_d2_harmonic # Log quantities losses_with_name.extend([ (tf.reduce_max(iw), 'MaxIW'), (tf.reduce_min(iw), 'MinIW'), (tf.reduce_mean(iw), 'MeanIW'), (U.reduce_std(iw), 'StdIW'), (tf.reduce_min(target_log_pdf_episode), 'MinTargetPdf'), (tf.reduce_min(behavioral_log_pdf_episode), 'MinBehavPdf'), (ess_renyi_arithmetic, 'ESSRenyiArithmetic'), (ess_renyi_harmonic, 'ESSRenyiHarmonic') ]) else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'max-d2-harmonic': bound_ = w_return_mean - tf.sqrt( (1 - delta) / (delta * ess_renyi_harmonic)) * return_abs_max elif bound == 'max-d2-arithmetic': bound_ = w_return_mean - tf.sqrt( (1 - delta) / (delta * ess_renyi_arithmetic)) * return_abs_max else: raise NotImplementedError() # Policy entropy for exploration ent = pi.pd.entropy() meanent = tf.reduce_mean(ent) losses_with_name.append((meanent, 'MeanEntropy')) # Add policy entropy bonus if entropy != 'none': scheme, v1, v2 = entropy.split(':') if scheme == 'step': entcoeff = tf.cond(iter_number_ < int(v2), lambda: float(v1), lambda: float(0.0)) losses_with_name.append((entcoeff, 'EntropyCoefficient')) entbonus = entcoeff * meanent bound_ = bound_ + entbonus elif scheme == 'lin': ip = tf.cast(iter_number_ / max_iters, tf.float32) entcoeff_decay = tf.maximum( 0.0, float(v2) + (float(v1) - float(v2)) * (1.0 - ip)) losses_with_name.append((entcoeff_decay, 'EntropyCoefficient')) entbonus = entcoeff_decay * meanent bound_ = bound_ + entbonus elif scheme == 'exp': ent_f = tf.exp( -tf.abs(tf.reduce_mean(iw) - 1) * float(v2)) * float(v1) losses_with_name.append((ent_f, 'EntropyCoefficient')) bound_ = bound_ + ent_f * meanent else: raise Exception('Unrecognized entropy scheme.') losses_with_name.append((w_return_mean, 'ReturnMeanIW')) losses_with_name.append((bound_, 'Bound')) losses, loss_names = map(list, zip(*losses_with_name)) ''' if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad(tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) ''' assert_ops = tf.group(*tf.get_collection('asserts')) print_ops = tf.group(*tf.get_collection('prints')) compute_lossandgrad = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], losses + [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_grad = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_bound = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], [bound_, assert_ops, print_ops]) compute_losses = U.function([ ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies ], losses) #compute_temp = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], [log_inverse_ratio, abc, iw]) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) policy_reinit = tf.variables_initializer(var_list) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True, gamma=gamma) sampler = type("SequentialSampler", (object, ), { "collect": lambda self, _: seg_gen.__next__() })() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finished...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) # Adding batch of trajectories to memory memory.add_trajectory_batch(seg) # Get multiple batches from memory seg_with_memory = memory.get_trajectories() # Get clustered reward reward_matrix = np.reshape( seg_with_memory['disc_rew'] * seg_with_memory['mask'], (-1, horizon)) ep_reward = np.sum(reward_matrix, axis=1) ep_reward = cluster_rewards(ep_reward, reward_clustering) args = ob, ac, rew, disc_rew, clustered_rew, mask, iter_number, active_policies = ( seg_with_memory['ob'], seg_with_memory['ac'], seg_with_memory['rew'], seg_with_memory['disc_rew'], ep_reward, seg_with_memory['mask'], iters_so_far, memory.get_active_policies_mask()) def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Iteration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights > 0 and iters_so_far % save_weights == 0: logger.record_tabular('Weights', str(get_parameter())) import pickle file = open('checkpoint' + str(iters_so_far) + '.pkl', 'wb') pickle.dump(theta, file) if not warm_start or memory.get_current_load() == capacity: # Optimize with timed("offline optimization"): theta, improvement = optimize_offline( theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) print(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) else: # Reinitialize the policy tf.get_default_session().run(policy_reinit) logger.dump_tabular() env.close()
def learn( make_env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=False, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None, clipping=False, entropy='none', positive_return=False, reward_clustering='none'): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() # Building the environment env = make_env() ob_space = env.observation_space ac_space = env.action_space # Building the policy pi = make_policy('pi', ob_space, ac_space) oldpi = make_policy('oldpi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [ v for v in all_var_list if v.name.split('/')[1].startswith('pol') ] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([max_samples], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='mask') rew_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='rew') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='disc_rew') gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') iter_number_ = tf.placeholder(dtype=tf.int32, name='iter_number') losses_with_name = [] # Policy densities target_log_pdf = pi.pd.logp(ac_) behavioral_log_pdf = oldpi.pd.logp(ac_) log_ratio = target_log_pdf - behavioral_log_pdf # Split operations disc_rew_split = tf.stack(tf.split(disc_rew_ * mask_, n_episodes)) rew_split = tf.stack(tf.split(rew_ * mask_, n_episodes)) log_ratio_split = tf.stack(tf.split(log_ratio * mask_, n_episodes)) target_log_pdf_split = tf.stack( tf.split(target_log_pdf * mask_, n_episodes)) behavioral_log_pdf_split = tf.stack( tf.split(behavioral_log_pdf * mask_, n_episodes)) mask_split = tf.stack(tf.split(mask_, n_episodes)) # Renyi divergence emp_d2_split = tf.stack( tf.split(pi.pd.renyi(oldpi.pd, 2) * mask_, n_episodes)) emp_d2_cum_split = tf.reduce_sum(emp_d2_split, axis=1) empirical_d2 = tf.reduce_mean(tf.exp(emp_d2_cum_split)) # Return ep_return = tf.reduce_sum(mask_split * disc_rew_split, axis=1) if clipping: rew_split = tf.clip_by_value(rew_split, -1, 1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) rew_split = rew_split - (tf.reduce_sum(rew_split) / (tf.reduce_sum(mask_split) + 1e-24)) discounter = [pow(gamma, i) for i in range(0, horizon)] # Decreasing gamma discounter_tf = tf.constant(discounter) disc_rew_split = rew_split * discounter_tf return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) return_step_max = tf.reduce_max(tf.abs(rew_split)) # Max step reward return_step_mean = tf.abs(tf.reduce_mean(rew_split)) positive_step_return_max = tf.maximum(0.0, tf.reduce_max(rew_split)) negative_step_return_max = tf.maximum(0.0, tf.reduce_max(-rew_split)) return_step_maxmin = tf.abs(positive_step_return_max - negative_step_return_max) losses_with_name.extend([(return_mean, 'InitialReturnMean'), (return_max, 'InitialReturnMax'), (return_min, 'InitialReturnMin'), (return_std, 'InitialReturnStd'), (empirical_d2, 'EmpiricalD2'), (return_step_max, 'ReturnStepMax'), (return_step_maxmin, 'ReturnStepMaxmin')]) if iw_method == 'pdis': # log_ratio_split cumulative sum log_ratio_cumsum = tf.cumsum(log_ratio_split, axis=1) # Exponentiate ratio_cumsum = tf.exp(log_ratio_cumsum) # Multiply by the step-wise reward (not episode) ratio_reward = ratio_cumsum * disc_rew_split # Average on episodes ratio_reward_per_episode = tf.reduce_sum(ratio_reward, axis=1) w_return_mean = tf.reduce_sum(ratio_reward_per_episode, axis=0) / n_episodes # Get d2(w0:t) with mask d2_w_0t = tf.exp(tf.cumsum(emp_d2_split, axis=1)) * mask_split # LEAVE THIS OUTSIDE # Sum d2(w0:t) over timesteps episode_d2_0t = tf.reduce_sum(d2_w_0t, axis=1) # Sample variance J_sample_variance = (1 / (n_episodes - 1)) * tf.reduce_sum( tf.square(ratio_reward_per_episode - w_return_mean)) losses_with_name.append((J_sample_variance, 'J_sample_variance')) losses_with_name.extend([(tf.reduce_max(ratio_cumsum), 'MaxIW'), (tf.reduce_min(ratio_cumsum), 'MinIW'), (tf.reduce_mean(ratio_cumsum), 'MeanIW'), (U.reduce_std(ratio_cumsum), 'StdIW')]) losses_with_name.extend([(tf.reduce_max(d2_w_0t), 'MaxD2w0t'), (tf.reduce_min(d2_w_0t), 'MinD2w0t'), (tf.reduce_mean(d2_w_0t), 'MeanD2w0t'), (U.reduce_std(d2_w_0t), 'StdD2w0t')]) elif iw_method == 'is': iw = tf.exp(tf.reduce_sum(log_ratio_split, axis=1)) if iw_norm == 'none': iwn = iw / n_episodes w_return_mean = tf.reduce_sum(iwn * ep_return) J_sample_variance = (1 / (n_episodes - 1)) * tf.reduce_sum( tf.square(iw * ep_return - w_return_mean)) losses_with_name.append((J_sample_variance, 'J_sample_variance')) elif iw_norm == 'sn': iwn = iw / tf.reduce_sum(iw) w_return_mean = tf.reduce_sum(iwn * ep_return) elif iw_norm == 'regression': iwn = iw / n_episodes mean_iw = tf.reduce_mean(iw) beta = tf.reduce_sum( (iw - mean_iw) * ep_return * iw) / (tf.reduce_sum( (iw - mean_iw)**2) + 1e-24) w_return_mean = tf.reduce_mean(iw * ep_return - beta * (iw - 1)) else: raise NotImplementedError() ess_classic = tf.linalg.norm(iw, 1)**2 / tf.linalg.norm(iw, 2)**2 sqrt_ess_classic = tf.linalg.norm(iw, 1) / tf.linalg.norm(iw, 2) ess_renyi = n_episodes / empirical_d2 losses_with_name.extend([(tf.reduce_max(iwn), 'MaxIWNorm'), (tf.reduce_min(iwn), 'MinIWNorm'), (tf.reduce_mean(iwn), 'MeanIWNorm'), (U.reduce_std(iwn), 'StdIWNorm'), (tf.reduce_max(iw), 'MaxIW'), (tf.reduce_min(iw), 'MinIW'), (tf.reduce_mean(iw), 'MeanIW'), (U.reduce_std(iw), 'StdIW'), (ess_classic, 'ESSClassic'), (ess_renyi, 'ESSRenyi')]) elif iw_method == 'rbis': # Check if we need to cluster rewards rew_clustering_options = reward_clustering.split(':') if reward_clustering == 'none': pass # Do nothing elif rew_clustering_options[0] == 'global': assert len( rew_clustering_options ) == 2, "Reward clustering: Provide the correct number of parameters" N = int(rew_clustering_options[1]) tf.add_to_collection( 'prints', tf.Print(ep_return, [ep_return], 'ep_return', summarize=20)) global_rew_min = tf.Variable(float('+inf'), trainable=False) global_rew_max = tf.Variable(float('-inf'), trainable=False) rew_min = tf.reduce_min(ep_return) rew_max = tf.reduce_max(ep_return) global_rew_min = tf.assign(global_rew_min, tf.minimum(global_rew_min, rew_min)) global_rew_max = tf.assign(global_rew_max, tf.maximum(global_rew_max, rew_max)) interval_size = (global_rew_max - global_rew_min) / N ep_return = tf.floordiv(ep_return, interval_size) * interval_size elif rew_clustering_options[0] == 'batch': assert len( rew_clustering_options ) == 2, "Reward clustering: Provide the correct number of parameters" N = int(rew_clustering_options[1]) rew_min = tf.reduce_min(ep_return) rew_max = tf.reduce_max(ep_return) interval_size = (rew_max - rew_min) / N ep_return = tf.floordiv(ep_return, interval_size) * interval_size elif rew_clustering_options[0] == 'manual': assert len( rew_clustering_options ) == 4, "Reward clustering: Provide the correct number of parameters" N, rew_min, rew_max = map(int, rew_clustering_options[1:]) interval_size = (rew_max - rew_min) / N # Clip to avoid overflow and cluster ep_return = tf.clip_by_value(ep_return, rew_min, rew_max) ep_return = tf.floordiv(ep_return, interval_size) * interval_size else: raise Exception('Unrecognized reward clustering scheme.') # Get pdfs for episodes target_log_pdf_episode = tf.reduce_sum(target_log_pdf_split, axis=1) behavioral_log_pdf_episode = tf.reduce_sum(behavioral_log_pdf_split, axis=1) # Normalize log_proba (avoid as overflows as possible) normalization_factor = tf.reduce_mean( tf.stack([target_log_pdf_episode, behavioral_log_pdf_episode])) target_norm_log_pdf_episode = target_log_pdf_episode - normalization_factor behavioral_norm_log_pdf_episode = behavioral_log_pdf_episode - normalization_factor # Exponentiate target_pdf_episode = tf.clip_by_value( tf.cast(tf.exp(target_norm_log_pdf_episode), tf.float64), 1e-300, 1e+300) behavioral_pdf_episode = tf.clip_by_value( tf.cast(tf.exp(behavioral_norm_log_pdf_episode), tf.float64), 1e-300, 1e+300) tf.add_to_collection( 'asserts', tf.assert_positive(target_pdf_episode, name='target_pdf_positive')) tf.add_to_collection( 'asserts', tf.assert_positive(behavioral_pdf_episode, name='behavioral_pdf_positive')) # Compute the merging matrix (reward-clustering) and the number of clusters reward_unique, reward_indexes = tf.unique(ep_return) episode_clustering_matrix = tf.cast( tf.one_hot(reward_indexes, n_episodes), tf.float64) max_index = tf.reduce_max(reward_indexes) + 1 trajectories_per_cluster = tf.reduce_sum(episode_clustering_matrix, axis=0)[:max_index] tf.add_to_collection( 'asserts', tf.assert_positive(tf.reduce_sum(episode_clustering_matrix, axis=0)[:max_index], name='clustering_matrix')) # Get the clustered pdfs clustered_target_pdf = tf.matmul( tf.reshape(target_pdf_episode, (1, -1)), episode_clustering_matrix)[0][:max_index] clustered_behavioral_pdf = tf.matmul( tf.reshape(behavioral_pdf_episode, (1, -1)), episode_clustering_matrix)[0][:max_index] tf.add_to_collection( 'asserts', tf.assert_positive(clustered_target_pdf, name='clust_target_pdf_positive')) tf.add_to_collection( 'asserts', tf.assert_positive(clustered_behavioral_pdf, name='clust_behavioral_pdf_positive')) # Compute the J ratio_clustered = clustered_target_pdf / clustered_behavioral_pdf #ratio_reward = tf.cast(ratio_clustered, tf.float32) * reward_unique # ---- No cluster cardinality ratio_reward = tf.cast(ratio_clustered, tf.float32) * reward_unique * tf.cast( trajectories_per_cluster, tf.float32) # ---- Cluster cardinality #w_return_mean = tf.reduce_sum(ratio_reward) / tf.cast(max_index, tf.float32) # ---- No cluster cardinality w_return_mean = tf.reduce_sum(ratio_reward) / tf.cast( n_episodes, tf.float32) # ---- Cluster cardinality # Divergences ess_classic = tf.linalg.norm(ratio_reward, 1)**2 / tf.linalg.norm( ratio_reward, 2)**2 sqrt_ess_classic = tf.linalg.norm(ratio_reward, 1) / tf.linalg.norm( ratio_reward, 2) ess_renyi = n_episodes / empirical_d2 # Summaries losses_with_name.extend([(tf.reduce_max(ratio_clustered), 'MaxIW'), (tf.reduce_min(ratio_clustered), 'MinIW'), (tf.reduce_mean(ratio_clustered), 'MeanIW'), (U.reduce_std(ratio_clustered), 'StdIW'), (1 - (max_index / n_episodes), 'RewardCompression'), (ess_classic, 'ESSClassic'), (ess_renyi, 'ESSRenyi')]) else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'std-d2': bound_ = w_return_mean - tf.sqrt( (1 - delta) / (delta * ess_renyi)) * return_std elif bound == 'max-d2': var_estimate = tf.sqrt( (1 - delta) / (delta * ess_renyi)) * return_abs_max bound_ = w_return_mean - tf.sqrt( (1 - delta) / (delta * ess_renyi)) * return_abs_max elif bound == 'max-ess': bound_ = w_return_mean - tf.sqrt( (1 - delta) / delta) / sqrt_ess_classic * return_abs_max elif bound == 'std-ess': bound_ = w_return_mean - tf.sqrt( (1 - delta) / delta) / sqrt_ess_classic * return_std elif bound == 'pdis-max-d2': # Discount factor if gamma >= 1: discounter = [ float(1 + 2 * (horizon - t - 1)) for t in range(0, horizon) ] else: def f(t): return pow(gamma, 2 * t) + ( 2 * pow(gamma, t) * (pow(gamma, t + 1) - pow(gamma, horizon))) / (1 - gamma) discounter = [f(t) for t in range(0, horizon)] discounter_tf = tf.constant(discounter) mean_episode_d2 = tf.reduce_sum( d2_w_0t, axis=0) / (tf.reduce_sum(mask_split, axis=0) + 1e-24) discounted_d2 = mean_episode_d2 * discounter_tf # Discounted d2 discounted_total_d2 = tf.reduce_sum(discounted_d2, axis=0) # Sum over time bound_ = w_return_mean - tf.sqrt( (1 - delta) * discounted_total_d2 / (delta * n_episodes)) * return_step_max elif bound == 'pdis-mean-d2': # Discount factor if gamma >= 1: discounter = [ float(1 + 2 * (horizon - t - 1)) for t in range(0, horizon) ] else: def f(t): return pow(gamma, 2 * t) + ( 2 * pow(gamma, t) * (pow(gamma, t + 1) - pow(gamma, horizon))) / (1 - gamma) discounter = [f(t) for t in range(0, horizon)] discounter_tf = tf.constant(discounter) mean_episode_d2 = tf.reduce_sum( d2_w_0t, axis=0) / (tf.reduce_sum(mask_split, axis=0) + 1e-24) discounted_d2 = mean_episode_d2 * discounter_tf # Discounted d2 discounted_total_d2 = tf.reduce_sum(discounted_d2, axis=0) # Sum over time bound_ = w_return_mean - tf.sqrt( (1 - delta) * discounted_total_d2 / (delta * n_episodes)) * return_step_mean else: raise NotImplementedError() # Policy entropy for exploration ent = pi.pd.entropy() meanent = tf.reduce_mean(ent) losses_with_name.append((meanent, 'MeanEntropy')) # Add policy entropy bonus if entropy != 'none': scheme, v1, v2 = entropy.split(':') if scheme == 'step': entcoeff = tf.cond(iter_number_ < int(v2), lambda: float(v1), lambda: float(0.0)) losses_with_name.append((entcoeff, 'EntropyCoefficient')) entbonus = entcoeff * meanent bound_ = bound_ + entbonus elif scheme == 'lin': ip = tf.cast(iter_number_ / max_iters, tf.float32) entcoeff_decay = tf.maximum( 0.0, float(v2) + (float(v1) - float(v2)) * (1.0 - ip)) losses_with_name.append((entcoeff_decay, 'EntropyCoefficient')) entbonus = entcoeff_decay * meanent bound_ = bound_ + entbonus elif scheme == 'exp': ent_f = tf.exp( -tf.abs(tf.reduce_mean(iw) - 1) * float(v2)) * float(v1) losses_with_name.append((ent_f, 'EntropyCoefficient')) bound_ = bound_ + ent_f * meanent else: raise Exception('Unrecognized entropy scheme.') losses_with_name.append((w_return_mean, 'ReturnMeanIW')) losses_with_name.append((bound_, 'Bound')) losses, loss_names = map(list, zip(*losses_with_name)) if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad( tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) assign_old_eq_new = U.function( [], [], updates=[ tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables()) ]) assert_ops = tf.group(*tf.get_collection('asserts')) print_ops = tf.group(*tf.get_collection('prints')) compute_lossandgrad = U.function( [ob_, ac_, rew_, disc_rew_, mask_, iter_number_], losses + [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_grad = U.function( [ob_, ac_, rew_, disc_rew_, mask_, iter_number_], [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_bound = U.function( [ob_, ac_, rew_, disc_rew_, mask_, iter_number_], [bound_, assert_ops, print_ops]) compute_losses = U.function( [ob_, ac_, rew_, disc_rew_, mask_, iter_number_], losses) #compute_temp = U.function([ob_, ac_, rew_, disc_rew_, mask_], [ratio_cumsum, discounted_ratio]) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True) sampler = type("SequentialSampler", (object, ), { "collect": lambda self, _: seg_gen.__next__() })() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finised...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) add_disc_rew(seg, gamma) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) args = ob, ac, rew, disc_rew, mask, iter_number = seg['ob'], seg[ 'ac'], seg['rew'], seg['disc_rew'], seg['mask'], iters_so_far assign_old_eq_new() def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Iteration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights: logger.record_tabular('Weights', str(get_parameter())) import pickle file = open('checkpoint.pkl', 'wb') pickle.dump(theta, file) with timed("offline optimization"): theta, improvement = optimize_offline( theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) logger.dump_tabular() env.close()
def learn(env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=False, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() # Building the environment ob_space = env.observation_space ac_space = env.action_space # Building the policy pi = make_policy('pi', ob_space, ac_space) oldpi = make_policy('oldpi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split('/')[1].startswith('pol')] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([max_samples], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='mask') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(max_samples), name='disc_rew') gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') # Policy densities target_log_pdf = pi.pd.logp(ac_) behavioral_log_pdf = oldpi.pd.logp(ac_) log_ratio = target_log_pdf - behavioral_log_pdf # Split operations disc_rew_split = tf.stack(tf.split(disc_rew_ * mask_, n_episodes)) log_ratio_split = tf.stack(tf.split(log_ratio * mask_, n_episodes)) target_log_pdf_split = tf.stack(tf.split(target_log_pdf * mask_, n_episodes)) mask_split = tf.stack(tf.split(mask_, n_episodes)) # Renyi divergence emp_d2_split = tf.stack(tf.split(pi.pd.renyi(oldpi.pd, 2) * mask_, n_episodes)) emp_d2_cum_split = tf.reduce_sum(emp_d2_split, axis=1) empirical_d2 = tf.reduce_mean(tf.exp(emp_d2_cum_split)) # Return ep_return = tf.reduce_sum(mask_split * disc_rew_split, axis=1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) if iw_method == 'pdis': raise NotImplementedError() elif iw_method == 'is': iw = tf.exp(tf.reduce_sum(log_ratio_split, axis=1)) if iw_norm == 'none': iwn = iw / n_episodes w_return_mean = tf.reduce_sum(iwn * ep_return) elif iw_norm == 'sn': iwn = iw / tf.reduce_sum(iw) w_return_mean = tf.reduce_sum(iwn * ep_return) elif iw_norm == 'regression': iwn = iw / n_episodes mean_iw = tf.reduce_mean(iw) beta = tf.reduce_sum((iw - mean_iw) * ep_return * iw) / (tf.reduce_sum((iw - mean_iw) ** 2) + 1e-24) w_return_mean = tf.reduce_mean(iw * ep_return - beta * (iw - 1)) else: raise NotImplementedError() ess_classic = tf.linalg.norm(iw, 1) ** 2 / tf.linalg.norm(iw, 2) ** 2 sqrt_ess_classic = tf.linalg.norm(iw, 1) / tf.linalg.norm(iw, 2) ess_renyi = n_episodes / empirical_d2 else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'std-d2': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_std elif bound == 'max-d2': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi)) * return_abs_max elif bound == 'max-ess': bound_ = w_return_mean - tf.sqrt((1 - delta) / delta) / sqrt_ess_classic * return_abs_max elif bound == 'std-ess': bound_ = w_return_mean - tf.sqrt((1 - delta) / delta) / sqrt_ess_classic * return_std else: raise NotImplementedError() losses = [bound_, return_mean, return_max, return_min, return_std, empirical_d2, w_return_mean, tf.reduce_max(iwn), tf.reduce_min(iwn), tf.reduce_mean(iwn), U.reduce_std(iwn), tf.reduce_max(iw), tf.reduce_min(iw), tf.reduce_mean(iw), U.reduce_std(iw), ess_classic, ess_renyi] loss_names = ['Bound', 'InitialReturnMean', 'InitialReturnMax', 'InitialReturnMin', 'InitialReturnStd', 'EmpiricalD2', 'ReturnMeanIW', 'MaxIWNorm', 'MinIWNorm', 'MeanIWNorm', 'StdIWNorm', 'MaxIW', 'MinIW', 'MeanIW', 'StdIW', 'ESSClassic', 'ESSRenyi'] if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad(tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) assign_old_eq_new = U.function([], [], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())]) compute_lossandgrad = U.function([ob_, ac_, disc_rew_, mask_], losses + [U.flatgrad(bound_, var_list)]) compute_grad = U.function([ob_, ac_, disc_rew_, mask_], [U.flatgrad(bound_, var_list)]) compute_bound = U.function([ob_, ac_, disc_rew_, mask_], [bound_]) compute_losses = U.function([ob_, ac_, disc_rew_, mask_], losses) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True, gamma=gamma) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finised...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) args = ob, ac, disc_rew, mask = seg['ob'], seg['ac'], seg['disc_rew'], seg['mask'] assign_old_eq_new() def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Itaration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights: logger.record_tabular('Weights', str(get_parameter())) with timed("offline optimization"): theta, improvement = optimize_offline(theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) logger.dump_tabular() env.close()