def nextJob(self): if self.currentParametersIndex >= len(self.parameterSets): return params = self.parameterSets[self.currentParametersIndex] self.currentParametersIndex += 1 # check if a job with parameters has already been around hash = getParamSetHash(params, self.strategy.copasiConfig["params"], not self.areParametersChangeable) if hash in self.strategy.startedJobs: g.log(LOG_DEBUG, "skipping a job, parameter set already processed: {}".format(params)) return self.strategy.startedJobs.add(hash) numFreeCores = self.numUsableCores with self.jobLock: for j in self.activeJobs: numFreeCores -= j.maxCores numFreeCores = max(1, numFreeCores) # setup a new job j = job.Job(self, params, # the set of parameters min(numFreeCores, self.numRunnersPerJob), # the number of simultaneous processes self.areParametersChangeable) # whether to enable optimization # add it to the list of active jobs with self.jobLock: self.activeJobs.append(j) # execute the job if not j.execute(g.workDir, self.strategy.copasiFile): g.log(LOG_DEBUG, "failed to execute {}".format(j.getName())) self.finishJob(j)
def prepare(self, isDummy): self.jobLock = threading.Lock() self.activeJobPool = None self.finishedJobs = {} self.startedJobs = set() self.doQuitFlag = False self.isExecutable = False self.lastNumJobsDumped = 0 # job counter, starting from 1 self.nextJobID = itertools.count(1) self.copasiConfig = {"params" : []} self.jobsByBestOfValue = [] self.topBaseline = 0.0 self.copasiFile = self.loadCopasiFile() if not self.copasiFile: return False g.log(LOG_DEBUG, "querying COPASI optimization parameters") self.copasiConfig["params"] = self.copasiFile.queryParameters() if not self.copasiConfig["params"]: return False self.jobsByBestOfValue = [[] for _ in range(1 + len(self.copasiConfig["params"]))] if not isDummy: self.isExecutable = True return True
def executeCopasi(runner): # a pseudo-loop for simpler error handling while True: if bool(g.getConfig("webTestMode")): if runner.job.id < 4: time.sleep(1.0) runner.ofValue = random.random() * 100 runner.isActive = False else: # wait for the strategy to quit while not runner.job.pool.strategy.doQuitFlag: time.sleep(1.0) runner.ofValue += random.random() runner.isActive = False break g.log(LOG_DEBUG, "executing " + " ".join(runner.process.args)) runner.isError = runner.process.run() # check report in order to update OF value (even if nonzero return value) with reportLock: runner.checkReport(hasTerminated=True, now=time.time()) # exit the loop without an error break # check termination conditions at the global run level g.log(LOG_DEBUG, "{}: terminated".format(runner.getName())) runner.isActive = False # disable this; do it from polling in the main thread instead #runner.job.checkIfHasTerminated() # overwrite the .cps file with best parameter values runner.cleanup()
def createRunners(self): # move the current runners, if any, to the array with old runners if self.runners: self.oldCpuTimes.append(max(r.currentCpuTime for r in self.runners)) self.oldRunners.extend(self.runners) self.runners = [] # reset other state self.convergenceTime = None self.lastOfUpdateTime = time.time() self.runnerGeneration += 1 bestParams = None if self.oldRunners and bool(g.getConfig("optimization.restartFromBestValue")): # get best params bestParams = self.getBestParams() for id in range(int(g.getConfig("optimization.runsPerJob"))): r = runner.Runner(self, id + 1, self.currentMethod, self.runnerGeneration) if not r.prepare(self.workDir, self.copasiFile, bestParams): g.log(LOG_ERROR, "{}: failed to create a runner".format(r.getName())) return False self.runners.append(r) # note that this may create more processes than the number of free CPU cores! for r in self.runners: r.execute() return True
def suspend(self, yes): if yes: g.log(LOG_DEBUG, "suspending process " + " ".join(self.args)) self.psutilProcess.suspend() else: g.log(LOG_DEBUG, "resuming process " + " ".join(self.args)) self.psutilProcess.resume()
def getAllStatsForGeneration(self, generation): result = [] try: filename = self.reportFilename if generation != self.generation: filename += "_gen" + str(generation) with open(filename, "r") as f: inValues = False for line in f: if startsWith(line, "CPU time"): inValues = True continue if not inValues: continue if startsWith(line, "Optimization Result"): break si = StatsItem(line) if si.isValid: result.append(si) except IOError as e: g.log(LOG_DEBUG, "failed to read a report file " + filename) return result
def getAllStatsForGeneration(self, generation): result = [] try: filename = self.reportFilename if generation != self.generation: filename += "_gen" + str(generation) with open(filename, "r") as f: inValues = False for line in f: if startsWith(line, "CPU time"): inValues = True continue if not inValues: continue if startsWith(line, "Optimization Result"): break si = StatsItem(line) if si.isValid: result.append(si) except IOError as e: g.log(LOG_DEBUG, "failed to read a report file " + filename) return result
def executeCopasi(runner): # a pseudo-loop for simpler error handling while True: if bool(g.getConfig("webTestMode")): if runner.job.id < 4: time.sleep(1.0) runner.ofValue = random.random() * 100 runner.isActive = False else: # wait for the strategy to quit while not runner.job.pool.strategy.doQuitFlag: time.sleep(1.0) runner.ofValue += random.random() runner.isActive = False break g.log(LOG_DEBUG, "executing " + " ".join(runner.process.args)) runner.isError = runner.process.run() # check report in order to update OF value (even if nonzero return value) with reportLock: runner.checkReport(hasTerminated=True, now=time.time()) # exit the loop without an error break # check termination conditions at the global run level g.log(LOG_DEBUG, "{}: terminated".format(runner.getName())) runner.isActive = False # disable this; do it from polling in the main thread instead # runner.job.checkIfHasTerminated() # overwrite the .cps file with best parameter values runner.cleanup()
def createRunners(self): # move the current runners, if any, to the array with old runners if self.runners: self.oldCpuTimes.append(max(r.currentCpuTime for r in self.runners)) self.oldRunners.extend(self.runners) self.runners = [] # reset other state self.convergenceTime = None self.lastOfUpdateTime = time.time() self.runnerGeneration += 1 bestParams = None if self.oldRunners and bool(g.getConfig("optimization.restartFromBestValue")): # get best params bestParams = self.getBestParams() for id in range(int(g.getConfig("optimization.runsPerJob"))): r = runner.Runner(self, id + 1, self.currentMethod, self.runnerGeneration) if not r.prepare(self.workDir, self.copasiFile, bestParams): g.log(LOG_ERROR, "{}: failed to create a runner".format(r.getName())) return False self.runners.append(r) # note that this may create more processes than the number of free CPU cores! for r in self.runners: r.execute() return True
def nextJob(self): if self.currentParametersIndex >= len(self.parameterSets): return params = self.parameterSets[self.currentParametersIndex] self.currentParametersIndex += 1 # check if a job with parameters has already been around hash = getParamSetHash(params, self.strategy.copasiConfig["params"]) if hash in self.strategy.startedJobs: g.log(LOG_DEBUG, "skipping a job, parameter set already processed: {}".format(params)) return self.strategy.startedJobs.add(hash) numFreeCores = self.numUsableCores with self.jobLock: for j in self.activeJobs: numFreeCores -= j.maxCores numFreeCores = max(1, numFreeCores) # setup a new job j = job.Job(self, params, # the set of parameters min(numFreeCores, self.numRunnersPerJob), # the number of simultaneous processes self.areParametersChangeable) # whether to enable optimization # add it to the list of active jobs with self.jobLock: self.activeJobs.append(j) # execute the job if not j.execute(g.workDir, self.strategy.copasiFile): g.log(LOG_DEBUG, "failed to execute {}".format(j.getName())) self.finishJob(j)
def prepare(self, isDummy): self.jobLock = threading.Lock() self.activeJobPool = None self.finishedJobs = {} self.startedJobs = set() self.doQuitFlag = False self.isExecutable = False self.lastNumJobsDumped = 0 # job counter, starting from 0 self.nextJobID = 0 self.copasiConfig = {"params": []} self.jobsByBestOfValue = [] self.topBaseline = 0.0 self.copasiFile = self.loadCopasiFile() if not self.copasiFile: return False g.log(LOG_DEBUG, "querying COPASI optimization parameters") self.copasiConfig["params"] = self.copasiFile.queryParameters() if not self.copasiConfig["params"]: return False self.jobsByBestOfValue = [ [] for _ in range(1 + len(self.copasiConfig["params"])) ] if not isDummy: self.isExecutable = True return True
def loadCopasiFile(self): copasiFile = copasifile.CopasiFile() filename = g.getConfig("copasi.modelFile") filename = filename.replace("@SELF@", SELF_PATH) g.log(LOG_INFO, "<spacescanner>: opening COPASI model file {}".format(filename)) if not copasiFile.read(filename): return None return copasiFile
def loadCopasiFile(self): copasiFile = copasifile.CopasiFile() filename = g.getConfig("copasi.modelFile") filename = filename.replace("@SELF@", SELF_PATH) g.log(LOG_INFO, "<spacescanner>: opening COPASI model file {}".format(filename)) if not copasiFile.read(filename): return None return copasiFile
def finishJob(self, j): g.log(LOG_DEBUG, "finished {}".format(j.getName())) with self.jobLock: if j not in self.activeJobs: return self.activeJobs.remove(j) if self.bestOfValue < j.getBestOfValue(): # improved on the OF value! Store the result now. self.bestOfValue = j.getBestOfValue() self.bestParams = copy.copy(j.params) self.strategy.finishJob(j)
def dumpResults(self, totalLimit=0, perParamLimit=0): if g.workDir is None: return None filename = g.getConfig("output.filename") # do not allow put the results in other directories because of security reasons if filename != os.path.basename(filename): g.log( LOG_INFO, "output file name should not include path, ignoring all but the last element in it" ) filename = os.path.basename(filename) (name, ext) = os.path.splitext(filename) if not ext: ext = ".csv" # default filename = os.path.join(g.workDir, "{}-{}{}".format(name, "-", g.taskName, ext)) with self.jobLock: if len(self.finishedJobs) <= self.lastNumJobsDumped: # all finished jobs already were saved, nothing to do return filename self.lastNumJobsDumped = len(self.finishedJobs) allJobsByBestOfValue = [] if perParamLimit == 0: numberOfBestCombinations = int( g.getConfig("output.numberOfBestCombinations")) else: numberOfBestCombinations = perParamLimit for joblist in self.jobsByBestOfValue: if numberOfBestCombinations: lst = joblist[:numberOfBestCombinations] else: lst = joblist for job in lst: allJobsByBestOfValue.append(job) allJobsByBestOfValue.sort(key=lambda x: x.getBestOfValue(), reverse=True) allParams = self.copasiConfig["params"] cnt = 0 with open(filename, "w") as f: self.dumpCsvFileHeader(f) for job in allJobsByBestOfValue: job.dumpResults(f, allParams) cnt += 1 if totalLimit and cnt >= totalLimit: break g.log( LOG_INFO, '<spacescanner>: results of finished jobs saved in "' + filename + '"') return filename
def finishJob(self, j): g.log(LOG_DEBUG, "finished {}".format(j.getName())) with self.jobLock: if j not in self.activeJobs: return self.activeJobs.remove(j) if self.bestOfValue < j.getBestOfValue(): # improved on the OF value! Store the result now. self.bestOfValue = j.getBestOfValue() self.bestParams = copy.copy(j.params) self.strategy.finishJob(j)
def execute(self, workDir, copasiFile): self.workDir = workDir self.copasiFile = copasiFile if bool(g.getConfig("optimization.randomizeMethodSelection")): self.currentMethod = random.choice(self.methods) else: self.currentMethod = self.methods[0] g.log(LOG_INFO, "starting " + self.getFullName()) return self.createRunners()
def execute(self, workDir, copasiFile): self.workDir = workDir self.copasiFile = copasiFile if bool(g.getConfig("optimization.randomizeMethodSelection")): self.currentMethod = random.choice(self.methods) else: self.currentMethod = self.methods[0] g.log(LOG_INFO, "starting " + self.getFullName()) return self.createRunners()
def getBestParameters(self, k): joblist = self.jobsByBestOfValue[k] if not joblist: if 0: g.log( LOG_ERROR, "Parameter ranges are invalid: best value of {} parameters requested, but no jobs finished" .format(k)) return None else: # this is fine and expected for preliminary calculations return self.copasiConfig["params"][:k] return joblist[0].params
def writeParam(self, outf, param, startParamValues, areParametersChangeable): xml = self.paramDict[param] if areParametersChangeable: if startParamValues is None or param not in startParamValues: # no need to preprocess; write directly back in the file outf.write(' ' + str(ElementTree.tostring(xml))) return else: if startParamValues is None: startParamValues = {} for sub in xml.iterfind("*", COPASI_NS): if "ParameterGroup" in sub.tag: continue if sub.get("name").lower( ) == "startvalue" and param not in startParamValues: # read it directly from the file try: v = sub.get("value") startParamValues[param] = float(v) except: g.log( LOG_ERROR, "Getting start value of a parameter " + param + " failed:" + sub.get("value")) outf.write(' <ParameterGroup name="OptimizationItem">\n') for sub in xml.iterfind("*", COPASI_NS): if "ParameterGroup" in sub.tag: continue if sub.get("name").lower() == "startvalue" \ and startParamValues is not None \ and param in startParamValues: outf.write( ' <Parameter name="StartValue" type="float" value="{}"/>\n' .format(startParamValues[param])) continue if sub.get("name").lower() in ["lowerbound", "upperbound"] \ and not areParametersChangeable \ and startParamValues is not None \ and param in startParamValues: # unchangeable; set the bounds to the start value val = startParamValues[param] outf.write( ' <Parameter name="{}" type="cn" value="{}"/>\n'. format(sub.get("name"), val)) continue # by default, just write back whatever was in the file outf.write(' ' + str(ElementTree.tostring(sub))) outf.write(' </ParameterGroup>\n')
def ioGetResults(self, qs): totalLimit = int(qs.get("totallimit", 0)) perParamLimit = int(qs.get("perparamlimit", 0)) filename = self.dumpResults(totalLimit, perParamLimit) contents = "" try: with open(filename) as f: contents = f.read() except IOError as e: g.log(LOG_DEBUG, "failed to read result .csv file {}".format(filename)) except Exception as e: g.log(LOG_INFO, "failed to read result .csv file {}: {}".format(filename, e)) return contents
def read(self, filename): if not isReadable(filename): g.log(LOG_ERROR, "error while loading COPASI model: file not found or not readable") return False self.optimizationTask = None self.xmlroot = ElementTree.parse(filename).getroot() # Example XML structure: # <xml><ListOfTasks><Task type="optimization">... for tasklist in self.xmlroot.findall('copasi:ListOfTasks', COPASI_NS): for task in tasklist.findall('copasi:Task', COPASI_NS): if task.get("type").lower() == "optimization": self.optimizationTask = task if self.optimizationTask is None: g.log(LOG_ERROR, "error while loading COPASI model: optimization task not found in COPASI file") return False self.loadParameters() if len(self.paramDict) == 0: g.log(LOG_ERROR, "error while loading COPASI model: optimization parameters not defined in COPASI file") return False if not self.objectiveFunction: g.log(LOG_ERROR, "error while loading COPASI model: objective function not defined in COPASI file") return False return True
def executeWebserver(strategyManager): try: port = int(g.getConfig("web.port")) g.log(LOG_INFO, "<spacescanner>: starting webserver, port: " + str(port)) server = webserver.InterruptibleHTTPServer(('', port), webserver.HttpServerHandler) server.strategyManager = strategyManager # report ok and enter the main loop g.log(LOG_DEBUG, "<spacescanner>: webserver started, listening to port {}".format(port)) server.serve_forever() except Exception as e: g.log(LOG_ERROR, "<spacescanner>: exception occurred in webserver:") g.log(LOG_ERROR, str(e)) g.log(LOG_ERROR, traceback.format_exc()) sys.exit(1) sys.exit(0)
def startFromWeb(configFileName): if not g.prepare(configFileName): g.log(LOG_ERROR, "Preparing from config file failed: " + configFileName) return None # read COPASI model file etc. strategyManager = strategy.StrategyManager() if not strategyManager.prepare(isDummy = False): g.log(LOG_ERROR, "Preparing for execution failed") return None # start the selected parameter sweep strategy asynchronously process.createBackgroundThread(lambda s: s.execute(), strategyManager) return strategyManager
def loadParameters(self): assert self.optimizationTask is not None problem = self.optimizationTask.find('copasi:Problem', COPASI_NS) if problem is None: g.log(LOG_ERROR, "'Problem' not found in the optimization task") return [] self.paramDict = {} self.methodDict = {} # Example XML structure: # Task type="optimization"><ParameterGroup name="OptimizationItem"><Parameter> ... for paramGroup in problem.findall('copasi:ParameterGroup', COPASI_NS): if paramGroup.get("name").lower() == "optimizationitemlist": for paramGroup2 in paramGroup.findall('copasi:ParameterGroup', COPASI_NS): if paramGroup2.get("name").lower() != "optimizationitem": continue # Example XML syntax: # <Parameter name="ObjectCN" type="cn" value="CN=Root,Model=Galazzo1990_FermentationPathwayKinetics,Vector=Reactions[Pyruvate kinase],ParameterGroup=Parameters,Parameter=Vm6,Reference=Value"/> for param in paramGroup2.findall('copasi:Parameter', COPASI_NS): if param.get("name").lower() != "objectcn": continue val = param.get("value") if not val: continue val = [x.split("=") for x in val.split(",")] for (k, v) in val: if 0: if k.lower() == "parameter": self.paramDict["'" + v + "'"] = paramGroup2 else: if k.lower() == "vector": if "[" in v and "]" in v: v = v[v.find("[") + 1:v.find("]")] self.paramDict["'" + v + "'"] = paramGroup2 self.objectiveFunction = None for paramText in problem.findall('copasi:ParameterText', COPASI_NS): if paramText.get("name").lower() == "objectiveexpression": self.objectiveFunction = paramText.text.strip() # parse methods as well for method in self.optimizationTask.findall('copasi:Method', COPASI_NS): mtype = method.get("type").lower() self.methodDict[mtype] = method
def serializeOptimizationTask(self, reportFilename, outf, parameters, methodNames, startParamValues, areParametersChangeable): # Note: 'scheduled' is always set to true, as is 'update model' to save the final parameter values in the .cps file. outf.write(' <Task key="{}" name="Optimization" type="optimization" scheduled="true" updateModel="true">\n'.format(self.optimizationTask.get("key"))) # 1. Fix report target file name # <Report reference="Report_10" target="./report.log" append="1"/> report = self.optimizationTask.find('copasi:Report', COPASI_NS) if report is not None: report.set("target", reportFilename) report.set("reference", "optimization_report") outf.write(' ' + str(ElementTree.tostring(report))) # 2. Include only required parameters problem = self.optimizationTask.find('copasi:Problem', COPASI_NS) outf.write(' <Problem>\n') for elem in problem.iterfind("*", COPASI_NS): if "Problem" in elem.tag: continue if "ParameterGroup" not in elem.tag or elem.get("name").lower() != "optimizationitemlist": if "Parameter" in elem.tag and elem.get("name").lower() == "randomize start values": # never randomize them outf.write(' <Parameter name="Randomize Start Values" type="bool" value="0"/>\n') else: outf.write(' ' + str(ElementTree.tostring(elem))) continue #print("parameters in the file:", self.paramDict.keys()) outf.write(' <ParameterGroup name="OptimizationItemList">\n') for p in parameters: if p in self.paramDict: self.writeParam(outf, p, startParamValues, areParametersChangeable) outf.write(' </ParameterGroup>\n') outf.write(' </Problem>\n') # 3. Include only required methods #print("methods in the file:", self.methodDict.keys()) for m in methodNames: methodFromFile = self.methodDict.get(m.lower()) if bool(g.getConfig("methodParametersFromFile")) and methodFromFile is not None: outf.write(' ' + str(ElementTree.tostring(methodFromFile))) else: predefinedMethod = PREDEFINED_METHODS.get(m) if predefinedMethod is None: g.log(LOG_ERROR, "Unknown or unsupported optimization method {}".format(m)) else: outf.write(' ' + predefinedMethod) # finish off outf.write('\n </Task>\n')
def prepare(self, workDir, copasiFile, startParamValues): filename = "job{}_runner{}".format(self.job.id, self.id) # Use separate directory for each run to avoid too many files per directory # or at least not hit this issue too early. # Note: there are just 65535 max files per directory on FAT32! dirname = os.path.join(workDir, "job{}".format(self.job.id)) try: os.mkdir(dirname) except: pass # may already exist, that's fine self.inputFilename = os.path.join(dirname, "input_" + filename + ".cps") self.reportFilename = os.path.join(dirname, "output_" + filename + ".log") self.copasiFile = copasiFile if not copasiFile.createCopy(self.inputFilename, self.reportFilename, self.job.params, [self.methodName], startParamValues, self.job.areParametersChangeable): return False # rename the old report file, if any expected try: if self.generation > 1: shutil.move( self.reportFilename, self.reportFilename + "_gen" + str(self.generation - 1)) else: os.remove(self.reportFilename) except IOError as e: pass except: pass # may not exist, that's fine copasiExe = os.path.join(COPASI_DIR, COPASI_EXECUTABLE) if not isExecutable(copasiExe): g.log( LOG_ERROR, 'COPASI binary is not executable or does not exist under "' + copasiExe + '"') return False args = [copasiExe, "--nologo", self.inputFilename] self.process = process.Process(args, self) return True
def ioGetResults(self, qs): totalLimit = int(qs.get("totallimit", 0)) perParamLimit = int(qs.get("perparamlimit", 0)) filename = self.dumpResults(totalLimit, perParamLimit) contents = "" try: with open(filename) as f: contents = f.read() except IOError as e: g.log(LOG_DEBUG, "failed to read result .csv file {}".format(filename)) except Exception as e: g.log(LOG_INFO, "failed to read result .csv file {}: {}".format(filename, e)) return contents
def startFromWeb(configFileName): if not g.prepare(configFileName): g.log(LOG_ERROR, "Preparing from config file failed: " + configFileName) return None # read COPASI model file etc. strategyManager = strategy.StrategyManager() if not strategyManager.prepare(isDummy=False): g.log(LOG_ERROR, "Preparing for execution failed") return None # start the selected parameter sweep strategy asynchronously process.createBackgroundThread(lambda s: s.execute(), strategyManager) return strategyManager
def dumpResults(self, totalLimit = 0, perParamLimit = 0): if g.workDir is None: return None filename = g.getConfig("output.filename") # do not allow put the results in other directories because of security reasons if filename != os.path.basename(filename): g.log(LOG_INFO, "output file name should not include path, ignoring all but the last element in it") filename = os.path.basename(filename) (name, ext) = os.path.splitext(filename) if not ext: ext = ".csv" # default filename = os.path.join(g.workDir, "{}-{}{}".format(name, "-", g.taskName, ext)) with self.jobLock: if len(self.finishedJobs) <= self.lastNumJobsDumped: # all finished jobs already were saved, nothing to do return filename self.lastNumJobsDumped = len(self.finishedJobs) allJobsByBestOfValue = [] if perParamLimit == 0: numberOfBestCombinations = int(g.getConfig("output.numberOfBestCombinations")) else: numberOfBestCombinations = perParamLimit for joblist in self.jobsByBestOfValue: if numberOfBestCombinations: lst = joblist[:numberOfBestCombinations] else: lst = joblist for job in lst: allJobsByBestOfValue.append(job) allJobsByBestOfValue.sort(key=lambda x: x.getBestOfValue(), reverse=True) allParams = self.copasiConfig["params"] cnt = 0 with open(filename, "w") as f: self.dumpCsvFileHeader(f) for job in allJobsByBestOfValue: job.dumpResults(f, allParams) cnt += 1 if totalLimit and cnt >= totalLimit: break g.log(LOG_INFO, '<spacescanner>: results of finished jobs saved in "' + filename + '"') return filename
def prepare(self, workDir, copasiFile, startParamValues): filename = "job{}_runner{}".format(self.job.id, self.id) # Use separate directory for each run to avoid too many files per directory # or at least not hit this issue too early. # Note: there are just 65535 max files per directory on FAT32! dirname = os.path.join(workDir, "job{}".format(self.job.id)) try: os.mkdir(dirname) except: pass # may already exist, that's fine self.inputFilename = os.path.join(dirname, "input_" + filename + ".cps") self.reportFilename = os.path.join(dirname, "output_" + filename + ".log") self.copasiFile = copasiFile if not copasiFile.createCopy( self.inputFilename, self.reportFilename, self.job.params, [self.methodName], startParamValues, self.job.areParametersChangeable, ): return False # rename the old report file, if any expected try: if self.generation > 1: shutil.move(self.reportFilename, self.reportFilename + "_gen" + str(self.generation - 1)) else: os.remove(self.reportFilename) except IOError as e: pass except: pass # may not exist, that's fine copasiExe = os.path.join(COPASI_DIR, COPASI_EXECUTABLE) if not isExecutable(copasiExe): g.log(LOG_ERROR, 'COPASI binary is not executable or does not exist under "' + copasiExe + '"') return False args = [copasiExe, "--nologo", self.inputFilename] self.process = process.Process(args, self) return True
def totalOptimizationPotentialReached(self, numParameters): if not self.isTOPEnabled(): return False targetFraction = g.getConfig("optimization.targetFractionOfTOP") # calculate the target value, looking at both config and at the job with all parameters, if any try: configTarget = float(g.getConfig("optimization.bestOfValue")) except: g.log( LOG_INFO, "Bad bestOfValue in config: {}".format( g.getConfig("optimization.bestOfValue"))) return False joblist = self.jobsByBestOfValue[-1] if joblist: calculatedTarget = joblist[0].getBestOfValue() else: calculatedTarget = MIN_OF_VALUE targetValue = max(configTarget, calculatedTarget) if targetValue == MIN_OF_VALUE: g.log( LOG_DEBUG, "TOP: no target value: {} {}".format(configTarget, calculatedTarget)) return False achievedValue = MIN_OF_VALUE for joblist in self.jobsByBestOfValue[:numParameters + 1]: if joblist: achievedValue = max(achievedValue, joblist[0].getBestOfValue()) isReached = False if self.topBaseline > targetValue: isReached = True requiredValue = targetValue else: requiredValue = (targetValue - self.topBaseline ) * targetFraction + self.topBaseline isReached = achievedValue >= requiredValue g.log( LOG_DEBUG, "TOP: {} parameters, {} achieved, {} required, {} target, {} configTarget, {} calculatedTarget" .format(numParameters, achievedValue, requiredValue, targetValue, configTarget, calculatedTarget)) if isReached: g.log( LOG_INFO, "Terminating optimization at {} parameters: good-enough-value criteria reached (required {})" .format(numParameters, requiredValue)) return True return False
def loadParameters(self): assert self.optimizationTask is not None problem = self.optimizationTask.find('copasi:Problem', COPASI_NS) if problem is None: g.log(LOG_ERROR, "'Problem' not found in the optimization task") return [] self.paramDict = {} self.methodDict = {} # Example XML structure: # Task type="optimization"><ParameterGroup name="OptimizationItem"><Parameter> ... for paramGroup in problem.findall('copasi:ParameterGroup', COPASI_NS): if paramGroup.get("name").lower() == "optimizationitemlist": for paramGroup2 in paramGroup.findall('copasi:ParameterGroup', COPASI_NS): if paramGroup2.get("name").lower() != "optimizationitem": continue # Example XML syntax: # <Parameter name="ObjectCN" type="cn" value="CN=Root,Model=Galazzo1990_FermentationPathwayKinetics,Vector=Reactions[Pyruvate kinase],ParameterGroup=Parameters,Parameter=Vm6,Reference=Value"/> for param in paramGroup2.findall('copasi:Parameter', COPASI_NS): if param.get("name").lower() != "objectcn": continue val = param.get("value") if not val: continue val = [x.split("=") for x in val.split(",")] for (k,v) in val: if 0: if k.lower() == "parameter": self.paramDict["'" + v + "'"] = paramGroup2 else: if k.lower() == "vector": if "[" in v and "]" in v: v = v[v.find("[")+1:v.find("]")] self.paramDict["'" + v + "'"] = paramGroup2 self.objectiveFunction = None for paramText in problem.findall('copasi:ParameterText', COPASI_NS): if paramText.get("name").lower() == "objectiveexpression": self.objectiveFunction = paramText.text.strip() # parse methods as well for method in self.optimizationTask.findall('copasi:Method', COPASI_NS): mtype = method.get("type").lower() self.methodDict[mtype] = method
def __init__(self, line): # input example: # CPU time [Best Value] [Function Evaluations] [Best Parameters] maximum real part # 0.043704 3.24353 1 ( 74.248 2.27805 ) -1.81914 self.isValid = True self.params = [] self.cpuTime = 0.0 self.ofValue = MIN_OF_VALUE self.numOfEvaluations = 0 self.maxRealPart = 0.0 line = line.strip() if not line: self.isValid = False return if "\t" in line: numbers = line.split("\t") else: numbers = line.split(" ") try: self.cpuTime = float(numbers[0]) self.ofValue = float(numbers[1]) # check for NaN and +inf, but allow -inf, as it's # sometimes returned as the "no solution found" value if math.isnan(self.ofValue) or \ (math.isinf(self.ofValue) and self.ofValue > 0.0): # XXX: something went wrong, what's the best action? g.log( LOG_ERROR, "invalid objective function value {}, using -infinity instead" .format(self.ofValue)) self.ofValue = MIN_OF_VALUE self.numOfEvaluations = int(numbers[2]) self.maxRealPart = float(numbers[-1]) # param value list starts with "(", finishes with ")" for i in range(4, len(numbers) - 2): self.params.append(float(numbers[i])) except ValueError as e: g.log(LOG_DEBUG, "value error {} in line".format(e)) g.log(LOG_DEBUG, line) except: g.log(LOG_DEBUG, "unexpected error {} in line".format(sys.exc_info()[0])) g.log(LOG_DEBUG, line) self.isValid = False
def writeParam(self, outf, param, startParamValues, areParametersChangeable): xml = self.paramDict[param] if areParametersChangeable: if startParamValues is None or param not in startParamValues: # no need to preprocess; write directly back in the file outf.write(' ' + str(ElementTree.tostring(xml))) return else: if startParamValues is None: startParamValues = {} for sub in xml.iterfind("*", COPASI_NS): if "ParameterGroup" in sub.tag: continue if sub.get("name").lower() == "startvalue" and param not in startParamValues: # read it directly from the file try: v = sub.get("value") startParamValues[param] = float(v) except: g.log(LOG_ERROR, "Getting start value of a parameter " + param + " failed:" + sub.get("value")) outf.write(' <ParameterGroup name="OptimizationItem">\n') for sub in xml.iterfind("*", COPASI_NS): if "ParameterGroup" in sub.tag: continue if sub.get("name").lower() == "startvalue" \ and startParamValues is not None \ and param in startParamValues: outf.write(' <Parameter name="StartValue" type="float" value="{}"/>\n'.format(startParamValues[param])) continue if sub.get("name").lower() in ["lowerbound", "upperbound"] \ and not areParametersChangeable \ and startParamValues is not None \ and param in startParamValues: # unchangeable; set the bounds to the start value val = startParamValues[param] outf.write(' <Parameter name="{}" type="cn" value="{}"/>\n'.format(sub.get("name"), val)) continue # by default, just write back whatever was in the file outf.write(' ' + str(ElementTree.tostring(sub))) outf.write(' </ParameterGroup>\n')
def executeWebserver(strategyManager): try: port = int(g.getConfig("web.port")) g.log(LOG_INFO, "<spacescanner>: starting webserver, port: " + str(port)) server = webserver.InterruptibleHTTPServer(('', port), webserver.HttpServerHandler) server.strategyManager = strategyManager # report ok and enter the main loop g.log( LOG_DEBUG, "<spacescanner>: webserver started, listening to port {}".format( port)) server.serve_forever() except Exception as e: g.log(LOG_ERROR, "<spacescanner>: exception occurred in webserver:") g.log(LOG_ERROR, str(e)) g.log(LOG_ERROR, traceback.format_exc()) sys.exit(1) sys.exit(0)
def run(self): #g.log(LOG_DEBUG, "Run subprocess: " + " ".join(self.args) + "\n") retcode = -1 try: with open(os.devnull, 'w') as fp: self.process = Popen(self.args, stdout = fp, stderr = STDOUT) self.psutilProcess = psutil.Process(self.process.pid) while self.process.poll() is None: if self.runner.shouldTerminate(): self.process.kill() time.sleep(Process.POLL_INTERVAL) retcode = self.process.returncode except Exception as e: g.log(LOG_ERROR, "run subprocess exception: " + str(e)) except: g.log(LOG_ERROR, "run subprocess unexpected error: {}".format(sys.exc_info()[0])) #g.log(LOG_DEBUG, "subprocess done, return code: " + str(retcode)) return retcode
def serve_forever(self, poll_interval = 0.5): """Handle one request at a time until shutdown. Polls for shutdown every poll_interval seconds. Ignores self.timeout. If you need to do periodic tasks, do them in another thread. """ self._BaseServer__is_shut_down.clear() try: while not self._BaseServer__shutdown_request: # XXX: Consider using another file descriptor or # connecting to the socket to wake this up instead of # polling. Polling reduces our responsiveness to a # shutdown request and wastes cpu at all other times. r, w, e = select.select([self], [], [], poll_interval) if self in r: self._handle_request_noblock() except Exception as e: g.log(LOG_ERROR, "base server exception:") g.log(LOG_ERROR, str(e)) g.log(LOG_ERROR, traceback.format_exc()) finally: self._BaseServer__shutdown_request = False self._BaseServer__is_shut_down.set() if os.name == "posix": # kill the process to make sure it exits os.kill(os.getpid(), signal.SIGKILL)
def serve_forever(self, poll_interval=0.5): """Handle one request at a time until shutdown. Polls for shutdown every poll_interval seconds. Ignores self.timeout. If you need to do periodic tasks, do them in another thread. """ self._BaseServer__is_shut_down.clear() try: while not self._BaseServer__shutdown_request: # XXX: Consider using another file descriptor or # connecting to the socket to wake this up instead of # polling. Polling reduces our responsiveness to a # shutdown request and wastes cpu at all other times. r, w, e = select.select([self], [], [], poll_interval) if self in r: self._handle_request_noblock() except Exception as e: g.log(LOG_ERROR, "base server exception:") g.log(LOG_ERROR, str(e)) g.log(LOG_ERROR, traceback.format_exc()) finally: self._BaseServer__shutdown_request = False self._BaseServer__is_shut_down.set() if os.name == "posix": # kill the process to make sure it exits os.kill(os.getpid(), signal.SIGKILL)
def __init__(self, line): # input example: # CPU time [Best Value] [Function Evaluations] [Best Parameters] maximum real part # 0.043704 3.24353 1 ( 74.248 2.27805 ) -1.81914 self.isValid = True self.params = [] self.cpuTime = 0.0 self.ofValue = MIN_OF_VALUE self.numOfEvaluations = 0 self.maxRealPart = 0.0 line = line.strip() if not line: self.isValid = False return if "\t" in line: numbers = line.split("\t") else: numbers = line.split(" ") try: self.cpuTime = float(numbers[0]) self.ofValue = float(numbers[1]) # check for NaN and +inf, but allow -inf, as it's # sometimes returned as the "no solution found" value if math.isnan(self.ofValue) or (math.isinf(self.ofValue) and self.ofValue > 0.0): # XXX: something went wrong, what's the best action? g.log(LOG_ERROR, "invalid objective function value {}, using -infinity instead".format(self.ofValue)) self.ofValue = MIN_OF_VALUE self.numOfEvaluations = int(numbers[2]) self.maxRealPart = float(numbers[-1]) # param value list starts with "(", finishes with ")" for i in range(4, len(numbers) - 2): self.params.append(float(numbers[i])) except ValueError as e: g.log(LOG_DEBUG, "value error {} in line".format(e)) g.log(LOG_DEBUG, line) except: g.log(LOG_DEBUG, "unexpected error {} in line".format(sys.exc_info()[0])) g.log(LOG_DEBUG, line) self.isValid = False
def totalOptimizationPotentialReached(self, numParameters): if not self.isTOPEnabled(): return False optimality = g.getConfig("optimization.optimalityRelativeError") # calculate the target value, looking at both config and at the job with all parameters, if any try: configTarget = float(g.getConfig("optimization.bestOfValue")) except: g.log(LOG_INFO, "Bad bestOfValue in config: {}".format(g.getConfig("optimization.bestOfValue"))) return False joblist = self.jobsByBestOfValue[-1] if joblist: calculatedTarget = joblist[0].getBestOfValue() else: calculatedTarget = MIN_OF_VALUE targetValue = max(configTarget, calculatedTarget) if targetValue == MIN_OF_VALUE: return False achievedValue = MIN_OF_VALUE for joblist in self.jobsByBestOfValue[:numParameters + 1]: if joblist: achievedValue = max(achievedValue, joblist[0].getBestOfValue()) proportion = 1.0 - float(optimality) isReached = False if self.topBaseline > targetValue: isReached = True requiredValue = targetValue else: requiredValue = (targetValue - self.topBaseline) * proportion + self.topBaseline isReached = achievedValue >= requiredValue if isReached: g.log(LOG_INFO, "terminating optimization at {} parameters: good-enough-value criteria reached (required {})".format(numParameters, requiredValue)) return True return False
def create(specification, strategy): if "type" not in specification: return None isReverse = False start = 0; end = 0 if "range" in specification: numParams = len(strategy.copasiConfig["params"]) range = specification["range"] start = range[0] if len(range) >= 2: end = range[1] else: end = start if start < 0: # negative range start = numParams - start if end < 0: end = numParams - end if start == 0 or end == 0: g.log(LOG_ERROR, "parameter selection ranges must contain numbers in the range [1 .. n]") return None if specification["type"] == "full-set": x = ParamSelectionFullSet(strategy) elif specification["type"] == "zero": x = ParamSelectionZero(strategy) elif specification["type"] == "explicit": # use a singleton instance if ParamSelection.instanceOfExplicit is None: ParamSelection.instanceOfExplicit = ParamSelectionExplicit(strategy) x = ParamSelection.instanceOfExplicit if specification.get("parameters"): names = [] for p in specification["parameters"]: p = "'" + p + "'" if p not in strategy.copasiConfig["params"]: g.log(LOG_ERROR, "'explicit' parameter range contains nonexistent parameter name {}".format(p)) return None names.append(p) x.explicitParameterSets.append(names) else: g.log(LOG_ERROR, "'explicit' parameter range must contain a list of parameter names") return None elif specification["type"] == "exhaustive": x = ParamSelectionExhaustive(strategy, start, end) elif specification["type"] == "greedy": newstart = min(start, end) newend = max(start, end) x = ParamSelectionGreedy(strategy, newstart, newend) elif specification["type"] == "greedy-reverse": newstart = max(start, end) newend = min(start, end) x = ParamSelectionGreedyReverse(strategy, newstart, newend) else: return None return x
def read(self, filename): if not isReadable(filename): g.log( LOG_ERROR, "error while loading COPASI model: file not found or not readable" ) return False self.optimizationTask = None self.xmlroot = ElementTree.parse(filename).getroot() # Example XML structure: # <xml><ListOfTasks><Task type="optimization">... for tasklist in self.xmlroot.findall('copasi:ListOfTasks', COPASI_NS): for task in tasklist.findall('copasi:Task', COPASI_NS): if task.get("type").lower() == "optimization": self.optimizationTask = task if self.optimizationTask is None: g.log( LOG_ERROR, "error while loading COPASI model: optimization task not found in COPASI file" ) return False self.loadParameters() if len(self.paramDict) == 0: g.log( LOG_ERROR, "error while loading COPASI model: optimization parameters not defined in COPASI file" ) return False if not self.objectiveFunction: g.log( LOG_ERROR, "error while loading COPASI model: objective function not defined in COPASI file" ) return False return True
def checkReport(self, hasTerminated, now): assert self.isActive if not hasTerminated: if self.lastReportCheckTime is not None and now - self.lastReportCheckTime < MIN_REPORT_CHECK_INTERVAL: # too soon, skip return True if now - self.startTime < 3.0: # too soon after start (copasi may not be launched yet), return return True self.lastReportCheckTime = now oldOfValue = self.ofValue try: st = os.stat(self.reportFilename) if self.lastReportModificationTime is None or st.st_mtime > self.lastReportModificationTime: self.lastReportModificationTime = st.st_mtime with open(self.reportFilename, "r") as f: self.stats.isValid = False inValues = False for line in f: if startsWith(line, "CPU time"): inValues = True continue if not inValues: continue if startsWith(line, "Optimization Result"): break si = StatsItem(line) if si.isValid: self.stats = si if self.stats.isValid: self.ofValue = self.getLastStats().ofValue if oldOfValue != self.ofValue: g.log(LOG_INFO, "{}: new OF value {}".format(self.getName(), self.ofValue)) # Check for CPU time end condition using the report file self.currentCpuTime = self.getLastStats().cpuTime else: # no report file update; check for CPU time end condition using OS measurements if not hasTerminated: try: self.currentCpuTime = self.process.getCpuTime() except psutil.NoSuchProcess: pass # has already quit except OSError as e: g.log(LOG_ERROR, "accessing report file {} failed: {}".format(self.reportFilename, os.strerror(e.errno))) except IOError as e: g.log(LOG_ERROR, "parsing report file {} failed: {}".format(self.reportFilename, os.strerror(e.errno))) if not hasTerminated and not self.terminationReason: g.log(LOG_DEBUG, "checked {}, CPU time: {}".format(self.getName(), self.currentCpuTime)) # XXX: hardcoded "slow" method names if self.methodName not in ["ScatterSearch", "SimulatedAnnealing"]: # XXX: reuse consensus time for this maxTimeWithNoValue = float(g.getConfig("optimization.consensusMinDurationSec")) + 10.0 if self.job.timeDiffExceeded(now - self.startTime, maxTimeWithNoValue) and ( not self.stats.isValid or self.ofValue == MIN_OF_VALUE ): g.log( LOG_DEBUG, "terminating {}: no value found in CPU time: {}".format(self.getName(), self.currentCpuTime), ) self.terminationReason = TERMINATION_REASON_CPU_TIME_LIMIT if oldOfValue != self.ofValue: # the OF value was updated return True return False # the OF value was not updated
def create(specification, strategy): if "type" not in specification: return None isReverse = False start = 0 end = 0 if "range" in specification: numParams = len(strategy.copasiConfig["params"]) range = specification["range"] start = range[0] if len(range) >= 2: end = range[1] else: end = start if start < 0: # negative range start = numParams - start if end < 0: end = numParams - end if start == 0 or end == 0: g.log( LOG_ERROR, "parameter selection ranges must contain numbers in the range [1 .. n]" ) return None if specification["type"] == "full-set": x = ParamSelectionFullSet(strategy) elif specification["type"] == "zero": x = ParamSelectionZero(strategy) elif specification["type"] == "explicit": # use a singleton instance if ParamSelection.instanceOfExplicit is None: ParamSelection.instanceOfExplicit = ParamSelectionExplicit( strategy) x = ParamSelection.instanceOfExplicit if specification.get("parameters"): names = [] for p in specification["parameters"]: p = "'" + p + "'" if p not in strategy.copasiConfig["params"]: g.log( LOG_ERROR, "'explicit' parameter range contains nonexistent parameter name {}" .format(p)) return None names.append(p) x.explicitParameterSets.append(names) else: g.log( LOG_ERROR, "'explicit' parameter range must contain a list of parameter names" ) return None elif specification["type"] == "exhaustive": x = ParamSelectionExhaustive(strategy, start, end) elif specification["type"] == "greedy": newstart = min(start, end) newend = max(start, end) x = ParamSelectionGreedy(strategy, newstart, newend) elif specification["type"] == "greedy-reverse": newstart = max(start, end) newend = min(start, end) x = ParamSelectionGreedyReverse(strategy, newstart, newend) else: return None return x
def execute(self): parameterSelections = [] if g.getConfig("restartOnFile"): # Guess which parameters have not been optimized yet based on the .csv result file filename = g.getConfig("restartOnFile").replace("@SELF@", SELF_PATH) parameterSets = getNonconvergedResults(filename) for ps in parameterSets: spec = {"type" : "explicit", "parameters" : ps} x = ParamSelection.create(spec, self) if x not in parameterSelections: parameterSelections.append(x) elif g.getConfig("parameters"): # Deal with TOP, if required if self.isTOPEnabled(): # add the "zero" at the start g.log(LOG_INFO, "optimizing for zero parameters initially to find the baseline") spec = {"type" : "zero"} parameterSelections.append(ParamSelection.create(spec, self)) # The take the other sets from the file for spec in g.getConfig("parameters"): x = ParamSelection.create(spec, self) if x is None: g.log(LOG_ERROR, "invalid parameter specification: {}".format(ENC.encode(spec))) continue if x not in parameterSelections: parameterSelections.append(x) else: # add the default optimization target: all parameters g.log(LOG_INFO, "optimizing only for all parameters") spec = {"type" : "full-set"} parameterSelections.append(ParamSelection.create(spec, self)) numCombinations = 0 for sel in parameterSelections: numCombinations += sel.getNumCombinations() g.log(LOG_INFO, "total {} parameter combination(s) to try out, parameters: {}".format(numCombinations, " ".join(self.copasiConfig["params"]))) g.log(LOG_INFO, "methods enabled: '" + "' '".join(g.getConfig("copasi.methods")) + "'") parameterSelections.sort(key = lambda x: x.getSortOrder()) for sel in parameterSelections: areParametersChangeable = sel.type != PARAM_SEL_ZERO for params in sel.getParameterSets(): g.log(LOG_DEBUG, "made a new pool of {} jobs".format(len(params))) pool = jobpool.JobPool(self, params, areParametersChangeable) with self.jobLock: self.activeJobPool = pool pool.start() while True: time.sleep(1.0) if self.doQuitFlag: return True try: pool.refresh() except Exception as e: g.log(LOG_INFO, "Exception while refreshing active joob pool status, terminating the pool: {}".format(e)) self.finishActivePool() break if pool.isDepleted(): self.finishActivePool() break return True
def checkReports(self): # if no runners are active, quit if not any([r.isActive for r in self.runners]): if self.convergenceTime is not None: minAbsoluteTime = float(g.getConfig("optimization.consensusMinDurationSec")) # XXX: do not check the relative time here if self.hasConsensus() and self.timeDiffExceeded(time.time() - self.convergenceTime, minAbsoluteTime): # count COPASI termination as consensus in this case # XXX: note that this does *not* overwrite "time limit exceeded" exit code! for r in self.runners: if r.terminationReason == TERMINATION_REASON_COPASI_FINISHED: r.terminationReason = TERMINATION_REASON_CONSENSUS # switch the methods if required self.decideTermination() return if not all([r.isActive for r in self.runners]): # some but not all have quit; quit the others with "stagnation" # (not technically true, but the best match from the existing codes) for r in self.runners: if r.isActive and not r.terminationReason: r.terminationReason = TERMINATION_REASON_STAGNATION return numActiveRunners = 0 now = time.time() cpuTimeLimit = float(g.getConfig("optimization.timeLimitSec")) maxCpuTime = 0 anyUpdated = False with runner.reportLock: for r in self.runners: if r.isActive: numActiveRunners += 1 if r.checkReport(hasTerminated=False, now=now): # the runner updated the OF time self.lastOfUpdateTime = now anyUpdated = True maxCpuTime = max(maxCpuTime, r.currentCpuTime) if not self.areParametersChangeable: # it is simple; as soon as the first value is read, return if anyUpdated: for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_CONSENSUS return consensusReached = self.hasConsensus() if all([r.terminationReason for r in self.runners]): return # use the old CPU time as a basis maxCpuTime += sum(self.oldCpuTimes) doKillOnTimeLimit = maxCpuTime >= cpuTimeLimit and not consensusReached if doKillOnTimeLimit: # kill all jobs immediately for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_CPU_TIME_LIMIT g.log( LOG_INFO, "terminating {}: CPU time limit exceeded ({} vs. {})".format( r.getName(), r.currentCpuTime, cpuTimeLimit ), ) return # check if the runs have reached consensus if consensusReached: if self.convergenceTime is None: g.log(LOG_DEBUG, self.getName() + ": reached consensus, waiting for guard time before termination") self.convergenceTime = now self.convergenceValue = min([r.ofValue for r in self.runners]) # if the runners have converged for long enough time, quit else: timeConverged = time.time() - self.convergenceTime minAbsoluteTime = float(g.getConfig("optimization.consensusMinDurationSec")) minRelativeTime = (time.time() - self.startTime) * float( g.getConfig("optimization.consensusMinProportionalDuration") ) if self.timeDiffExceeded(timeConverged, minAbsoluteTime) and timeConverged > minRelativeTime: g.log(LOG_INFO, "terminating {}: consensus reached".format(self.getName())) for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_CONSENSUS self.convergenceTime = now return # do not check other criteria else: # reset the timer self.convergenceTime = None # check for stagnation's time limit timeStagnated = time.time() - self.lastOfUpdateTime maxAbsoluteTime = float(g.getConfig("optimization.stagnationMaxDurationSec")) maxRelativeTime = (time.time() - self.startTime) * float( g.getConfig("optimization.stagnationMaxProportionalDuration") ) if self.timeDiffExceeded(timeStagnated, maxAbsoluteTime) and timeStagnated > maxRelativeTime: # stagnation detected for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_STAGNATION g.log( LOG_INFO, "terminating {}: Optimization stagnated (did not produce new results) for {} seconds".format( self.getName(), timeStagnated ), ) return # We will continue. Check if load balancing needs to be done if now - self.lastBalanceTime >= LOAD_BALANCE_INTERVAL: self.lastBalanceTime = now if numActiveRunners > self.maxCores: # not converged yet + too many active; limit some runners cpuTimes = [(r.currentCpuTime, r) for r in self.runners if r.isActive] cpuTimes.sort() # continue first `maxCores` runners, suspend the rest resumeRunners = cpuTimes[: self.maxCores] suspendRunners = cpuTimes[self.maxCores :] for _, j in resumeRunners: j.suspend(False) for _, j in suspendRunners: j.suspend(True) else: for r in self.runners: r.suspend(False)
def doQuit(): g.log(LOG_ERROR, "Terminating...") g.doQuit = True
def do_GET(self): o = urlparse(self.path) qs = parse_qs(o.query) isJSON = True contentType = "text/plain" sm = InterruptibleHTTPServer.serverInstance.strategyManager if o.path == '/index.html' or o.path == "/": isJSON = False contentType = "text/html" try: with open(os.path.join(SELF_PATH, "web", "index.html")) as f: response = f.read() except: self.serveError(qs) return elif o.path[-4:] == ".css": isJSON = False contentType = "text/css" try: with open(os.path.join(SELF_PATH, "web", o.path[1:])) as f: response = f.read() except: self.serveError(qs) return elif o.path[-3:] == ".js": isJSON = False contentType = "application/js" try: with open(os.path.join(SELF_PATH, "web", o.path[1:])) as f: response = f.read() except: self.serveError(qs) return elif o.path[-4:] == ".png": isJSON = False contentType = "image/png" try: with open(os.path.join(SELF_PATH, "web", o.path[1:])) as f: response = f.read() except: self.serveError(qs) return elif o.path[-4:] == ".jpg": isJSON = False contentType = "image/jpg" try: with open(os.path.join(SELF_PATH, "web", o.path[1:])) as f: response = f.read() except: self.serveError(qs) return elif "font" in o.path: isJSON = False contentType = "font/opentype" try: with open(os.path.join(SELF_PATH, "web", o.path[1:])) as f: response = f.read() except: self.serveError(qs) return elif o.path == '/status': # active jobs response = { "isActive": sm.isActive(), "isExecutable": sm.isExecutable, "totalNumJobs": sm.getTotalNumJobs(), "totalNumParams": sm.getTotalNumParams(), "resultsPresent": sm.getNumFinishedJobs() > 0 } elif o.path == '/allstatus': response = sm.ioGetAllJobs(qs) elif o.path == '/activestatus': response = sm.ioGetActiveJobs(qs) elif o.path[:4] == '/job': # specific job response = sm.ioGetJob(qs, o.path[5:]) elif o.path[:7] == '/config': response = sm.ioGetConfig(qs) print("config=", response) elif o.path[:8] == '/results': response = sm.ioGetResults(qs) isJSON = False # the results are in .csv format contentType = "text/csv" elif o.path == '/stopall': response = sm.ioStopAll(qs) elif o.path[:5] == '/stop': response = sm.ioStop(qs, o.path[6:]) elif o.path == '/terminate': g.log(LOG_ERROR, "Terminating upon user request") response = {"status": "ok"} threading.Timer(1.0, doQuit).start() else: self.serveError(qs) return if isJSON: response = ENC.encode(response) self.send_response(200) self.sendDefaultHeaders(response, isJSON, contentType) self.end_headers() self.serveBody(response, qs)
def serializeOptimizationTask(self, reportFilename, outf, parameters, methodNames, startParamValues, areParametersChangeable): # Note: 'scheduled' is always set to true, as is 'update model' to save the final parameter values in the .cps file. outf.write( ' <Task key="{}" name="Optimization" type="optimization" scheduled="true" updateModel="true">\n' .format(self.optimizationTask.get("key"))) # 1. Fix report target file name # <Report reference="Report_10" target="./report.log" append="1"/> report = self.optimizationTask.find('copasi:Report', COPASI_NS) if report is not None: report.set("target", reportFilename) report.set("reference", "optimization_report") outf.write(' ' + str(ElementTree.tostring(report))) # 2. Include only required parameters problem = self.optimizationTask.find('copasi:Problem', COPASI_NS) outf.write(' <Problem>\n') for elem in problem.iterfind("*", COPASI_NS): if "Problem" in elem.tag: continue if "ParameterGroup" not in elem.tag or elem.get( "name").lower() != "optimizationitemlist": if "Parameter" in elem.tag and elem.get( "name").lower() == "randomize start values": # never randomize them outf.write( ' <Parameter name="Randomize Start Values" type="bool" value="0"/>\n' ) else: outf.write(' ' + str(ElementTree.tostring(elem))) continue #print("parameters in the file:", self.paramDict.keys()) outf.write(' <ParameterGroup name="OptimizationItemList">\n') for p in parameters: if p in self.paramDict: self.writeParam(outf, p, startParamValues, areParametersChangeable) outf.write(' </ParameterGroup>\n') outf.write(' </Problem>\n') # 3. Include only required methods #print("methods in the file:", self.methodDict.keys()) for m in methodNames: methodFromFile = self.methodDict.get(m.lower()) if bool(g.getConfig("methodParametersFromFile") ) and methodFromFile is not None: outf.write(' ' + str(ElementTree.tostring(methodFromFile))) else: predefinedMethod = PREDEFINED_METHODS.get(m) if predefinedMethod is None: g.log( LOG_ERROR, "Unknown or unsupported optimization method {}".format( m)) else: outf.write(' ' + predefinedMethod) # finish off outf.write('\n </Task>\n')
def checkReport(self, hasTerminated, now): assert self.isActive if not hasTerminated: if self.lastReportCheckTime is not None \ and now - self.lastReportCheckTime < MIN_REPORT_CHECK_INTERVAL: # too soon, skip return False if now - self.startTime < 3.0: # too soon after start (copasi may not be launched yet), return return False self.lastReportCheckTime = now oldOfValue = self.ofValue try: st = os.stat(self.reportFilename) if self.lastReportModificationTime is None \ or st.st_mtime > self.lastReportModificationTime: self.lastReportModificationTime = st.st_mtime with open(self.reportFilename, "r") as f: self.stats.isValid = False inValues = False for line in f: if startsWith(line, "CPU time"): inValues = True continue if not inValues: continue if startsWith(line, "Optimization Result"): break si = StatsItem(line) if si.isValid: self.stats = si if self.stats.isValid: self.ofValue = self.getLastStats().ofValue if oldOfValue != self.ofValue: g.log( LOG_INFO, "{}: new OF value {}".format( self.getName(), self.ofValue)) # Check for CPU time end condition using the report file reportCpuTime = self.getLastStats().cpuTime if self.currentCpuTime < reportCpuTime: self.currentCpuTime = reportCpuTime else: # no report file update; check for CPU time end condition using OS measurements if not hasTerminated: try: t = self.process.getCpuTime() except psutil.NoSuchProcess: pass # has already quit else: self.currentCpuTime = t except OSError as e: g.log( LOG_ERROR, "accessing report file {} failed: {}".format( self.reportFilename, os.strerror(e.errno))) except IOError as e: g.log( LOG_ERROR, "parsing report file {} failed: {}".format( self.reportFilename, os.strerror(e.errno))) if oldOfValue != self.ofValue: # the OF value was updated return True return False # the OF value was not updated
def getBestParameters(self, k): joblist = self.jobsByBestOfValue[k] if not joblist: g.log(LOG_ERROR, "Parameter ranges are invalid: best value of {} parameters requested, but no jobs finished".format(k)) return None return joblist[0].params
def decideTermination(self): continuableReasons = [TERMINATION_REASON_STAGNATION, TERMINATION_REASON_COPASI_FINISHED] if not any([r.terminationReason in continuableReasons for r in self.runners]): # all terminated with consensus, because asked by the user, or with time limit self.pool.finishJob(self) return # So we have at least one termination with either: # a) the stagnation limit was exceeded, or # b) Copasi stopped without consensus. # Actions now: # 1) if no solution found: use a fallback method; # 2) else switch to the next method; # 3) if no more methods are available, quit. if self.currentMethod in self.fallbackMethods: # remove the already-used method to avoid infinite looping between methods self.fallbackMethods.remove(self.currentMethod) assert (self.currentMethod in self.methods) self.methods.remove(self.currentMethod) anyNotFound = any([math.isinf(r.ofValue) for r in self.runners]) if anyNotFound or self.isUsingFallback: if len(self.fallbackMethods) == 0: if anyNotFound: g.log(LOG_INFO, "terminating {}: failed to evaluate the objective function".format(self.getName())) else: g.log(LOG_INFO, "terminating {}: all fallback methods exhausted without reaching consensus".format(self.getName())) self.pool.finishJob(self) return self.pastMethods.append(self.currentMethod) if bool(g.getConfig("optimization.randomizeMethodSelection")): self.currentMethod = random.choice(self.fallbackMethods) else: self.currentMethod = self.fallbackMethods[0] # make sure the fallback methods are also in methods if self.currentMethod not in self.methods: self.methods.append(self.currentMethod) g.log(LOG_INFO, "switching {} to a fallback method {}".format(self.getName(), self.currentMethod)) self.isUsingFallback = True # switch to the fallback method if not self.createRunners(): self.pool.finishJob(self) return if len(self.methods) == 0: g.log(LOG_INFO, "terminating {}: all methods exhausted without reaching consensus".format(self.getName())) self.pool.finishJob(self) return # go for the next method self.pastMethods.append(self.currentMethod) if bool(g.getConfig("optimization.randomizeMethodSelection")): self.currentMethod = random.choice(self.methods) else: self.currentMethod = self.methods[0] g.log(LOG_INFO, "switching {} to the next method {}".format( self.getName(), self.currentMethod)) if not self.createRunners(): self.pool.finishJob(self) return
def log_message(self, format, *args): g.log(LOG_DEBUG, "%s - - [%s] %s" % (self.client_address[0], self.log_date_time_string(), format % args))
def decideTermination(self): continuableReasons = [TERMINATION_REASON_STAGNATION, TERMINATION_REASON_COPASI_FINISHED] if not any([r.terminationReason in continuableReasons for r in self.runners]): # all terminated with consensus, because asked by the user, or with time limit self.pool.finishJob(self) return # So we have at least one termination with either: # a) the stagnation limit was exceeded, or # b) Copasi stopped without consensus. # Actions now: # 1) if no solution found: use a fallback method; # 2) else switch to the next method; # 3) if no more methods are available, quit. if self.currentMethod in self.fallbackMethods: # remove the already-used method to avoid infinite looping between methods self.fallbackMethods.remove(self.currentMethod) assert self.currentMethod in self.methods self.methods.remove(self.currentMethod) anyNotFound = any([math.isinf(r.ofValue) for r in self.runners]) if anyNotFound or self.isUsingFallback: if len(self.fallbackMethods) == 0: if anyNotFound: g.log(LOG_INFO, "terminating {}: failed to evaluate the objective function".format(self.getName())) else: g.log( LOG_INFO, "terminating {}: all fallback methods exhausted without reaching consensus".format( self.getName() ), ) self.pool.finishJob(self) return if bool(g.getConfig("optimization.randomizeMethodSelection")): self.currentMethod = random.choice(self.fallbackMethods) else: self.currentMethod = self.fallbackMethods[0] # make sure the fallback methods are also in methods if self.currentMethod not in self.methods: self.methods.append(self.currentMethod) g.log(LOG_INFO, "switching {} to a fallback method {}".format(self.getName(), self.currentMethod)) self.isUsingFallback = True # switch to the fallback method if not self.createRunners(): self.pool.finishJob(self) return if len(self.methods) == 0: g.log(LOG_INFO, "terminating {}: all methods exhausted without reaching consensus".format(self.getName())) self.pool.finishJob(self) return # go for the next method if bool(g.getConfig("optimization.randomizeMethodSelection")): self.currentMethod = random.choice(self.methods) else: self.currentMethod = self.methods[0] g.log(LOG_INFO, "switching {} to the next method {}".format(self.getName(), self.currentMethod)) if not self.createRunners(): self.pool.finishJob(self) return
def log_message(self, format, *args): g.log( LOG_DEBUG, "%s - - [%s] %s" % (self.client_address[0], self.log_date_time_string(), format % args))
def checkReports(self): # if no runners are active, quit if not any([r.isActive for r in self.runners]): if self.convergenceTime is not None: minAbsoluteTime = float(g.getConfig("optimization.consensusDelaySec")) # XXX: do not check the relative time here if self.hasConsensus() and self.timeDiffExceeded(time.time() - self.convergenceTime, minAbsoluteTime): # count COPASI termination as consensus in this case # XXX: note that this does *not* overwrite "time limit exceeded" exit code! for r in self.runners: if r.terminationReason == TERMINATION_REASON_COPASI_FINISHED: r.terminationReason = TERMINATION_REASON_CONSENSUS # switch the methods if required self.decideTermination() return if not all([r.isActive for r in self.runners]): # some but not all have quit; quit the others with "stagnation" # (not technically true, but the best match from the existing codes) for r in self.runners: if r.isActive and not r.terminationReason: r.terminationReason = TERMINATION_REASON_STAGNATION return numActiveRunners = 0 now = time.time() cpuTimeLimit = float(g.getConfig("optimization.timeLimitSec")) maxCpuTime = 0 anyUpdated = False with runner.reportLock: for r in self.runners: if r.isActive: numActiveRunners += 1 if r.checkReport(hasTerminated = False, now = now): # the runner updated the OF time self.lastOfUpdateTime = now anyUpdated = True maxCpuTime = max(maxCpuTime, r.currentCpuTime) if not self.areParametersChangeable: # it is simple; as soon as the first value is read, return if anyUpdated: for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_CONSENSUS return consensusReached = self.hasConsensus() if all([r.terminationReason for r in self.runners]): return # use the old CPU time as a basis maxCpuTime += sum(self.oldCpuTimes) doKillOnTimeLimit = maxCpuTime >= cpuTimeLimit and not consensusReached if doKillOnTimeLimit: # kill all jobs immediately for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_CPU_TIME_LIMIT g.log(LOG_INFO, "terminating {}: CPU time limit exceeded ({} vs. {})".format( r.getName(), maxCpuTime, cpuTimeLimit)) return # check if the runs have reached consensus if consensusReached: if self.convergenceTime is None: g.log(LOG_DEBUG, self.getName() + ": reached consensus, waiting for guard time before termination") self.convergenceTime = now self.convergenceValue = min([r.ofValue for r in self.runners]) # if the runners have converged for long enough time, quit else: timeConverged = time.time() - self.convergenceTime minAbsoluteTime = float(g.getConfig("optimization.consensusDelaySec")) minRelativeTime = (time.time() - self.startTime) * float(g.getConfig("optimization.consensusProportionalDelay")) if self.timeDiffExceeded(timeConverged, minAbsoluteTime) and timeConverged > minRelativeTime: g.log(LOG_INFO, "terminating {}: consensus reached".format(self.getName())) for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_CONSENSUS self.convergenceTime = now return # do not check other criteria else: # reset the timer self.convergenceTime = None # check for stagnation's time limit timeStagnated = time.time() - self.lastOfUpdateTime maxAbsoluteTime = float(g.getConfig("optimization.stagnationDelaySec")) maxRelativeTime = (time.time() - self.startTime) * float(g.getConfig("optimization.stagnationProportionalDelay")) # XXX: specialcase for the non-parameters job: quit it quite quickly (in 10 seconds for each method) if not self.areParametersChangeable: maxAbsoluteTime = 10.0 maxRelativeTime = 0.0 if self.timeDiffExceeded(timeStagnated, maxAbsoluteTime) and timeStagnated > maxRelativeTime: # stagnation detected for r in self.runners: if r.isActive: r.terminationReason = TERMINATION_REASON_STAGNATION g.log(LOG_INFO, "terminating {}: Optimization stagnated (did not produce new results) for {} seconds".format(self.getName(), timeStagnated)) return # We will continue. Check if load balancing needs to be done if now - self.lastBalanceTime >= LOAD_BALANCE_INTERVAL: self.lastBalanceTime = now if numActiveRunners > self.maxCores: # not converged yet + too many active; limit some runners cpuTimes = [(r.currentCpuTime, r) for r in self.runners if r.isActive] cpuTimes.sort() # continue first `maxCores` runners, suspend the rest resumeRunners = cpuTimes[:self.maxCores] suspendRunners = cpuTimes[self.maxCores:] for _,j in resumeRunners: j.suspend(False) for _,j in suspendRunners: j.suspend(True) else: for r in self.runners: r.suspend(False)