def save_as(self): import tkinter.messagebox as messagebox import tkinter.filedialog as filedialog import my_constant import my_io import traceback try: if self.clan.h: path = filedialog.asksaveasfilename(**my_constant.history_opt) if path: my_io.append_history(None, path, mode='clear') for item in self.clan.hv: my_io.append_history(item, path, check_exist=False) messagebox.showinfo('保存成功!', '已保存至' + path) if self.clan.d: path = filedialog.asksaveasfilename(**my_constant.donate_opt) if path: my_io.append_donate(None, path, mode='clear') for item in self.clan.dv: my_io.append_donate(item, path, check_exist=False) messagebox.showinfo('保存成功!', '已保存至' + path) except Exception as e: traceback.print_exc() messagebox.showerror('出错了!', '保存失败') self.master.master.focus_force()
def convertLib(): fileName=askopenfilename(title = "Input Library",filetypes=[('Eagle V6 Library', '.lbr'), ('all files', '.*')], defaultextension='.lbr') modFileName=asksaveasfilename(title="Module Output Filename", filetypes=[('KiCad Module', '.mod'), ('all files', '.*')], defaultextension='.mod') symFileName=asksaveasfilename(title="Symbol Output Filename", filetypes=[('KiCad Symbol', '.lib'), ('all files', '.*')], defaultextension='.lib') logFile.write("*******************************************\n") logFile.write("Converting Lib: "+fileName+"\n") logFile.write("Module Output: "+modFileName+"\n") logFile.write("Symbol Output: "+symFileName+"\n") name=fileName.replace("/","\\") name=name.split("\\")[-1] name=name.split(".")[0] logFile.write("Lib name: "+name+"\n") try: node = getRootNode(fileName) node=node.find("drawing").find("library") lib=Library(node,name) modFile=open(modFileName,"a") symFile=open(symFileName,"a") lib.writeLibrary(modFile,symFile) except Exception as e: showerror("Error",str(e)+"\nSee Log.txt for more info") logFile.write("Conversion Failed\n\n") logFile.write(traceback.format_exc()) logFile.write("*******************************************\n\n\n") return logFile.write("Conversion Successfull\n") logFile.write("*******************************************\n\n\n") showinfo("Library Complete","The Modules and Symbols Have Finished Converting \n Check Console for Errors")
def save_sol(save_choice): global location location=StringVar() check_block=True check_acc_clue=True check_dwn_clue=True for i in range(0,height): for j in range(0,width): if(cellblock[i][j]=="-"): check_block=False break for i in range(0,acc): if(across[i][1]==""): check_acc_clue=False break for i in range(0,dwn): if(down[i][1]==""): check_dwn_clue=False break if(check_block==False): messagebox.showinfo("Sorry!", "Solution grid has not been filled completely") if(check_acc_clue==False): messagebox.showinfo("Sorry!", "Across cluelist has not been filled completely") if(check_dwn_clue==False): messagebox.showinfo("Sorry!", "Down cluelist has not been filled completely") if(check_block==True and check_acc_clue==True and check_dwn_clue==True): file_opt=opt = {} if (save_choice==0): opt['filetypes'] = [('all files', '.*'), ('binary files', '.puz')] #options['initialfile'] = 'My_CW_File.puz' opt['parent'] = master fileloc = filedialog.asksaveasfilename(filetypes=opt['filetypes']) else: opt['filetypes'] = [('all files', '.*'), ('ipuz files', '.ipuz')] #options['initialfile'] = 'My_CW_File.ipuz' opt['parent'] = master fileloc = filedialog.asksaveasfilename(filetypes=opt['filetypes']) File.title=title File.author=author File.cpyrt=cpyrt File.notes=notes File.width=width File.height=height File.solnblock=cellblock File.acc=acc File.dwn=dwn File.across=across File.down=down File.cellno=cellno File.loc=fileloc if (save_choice==0): filewrite(File) else: write_ipuz(File) master.destroy() sys.exit(0)
def exportEntry(self): self.selected = self.listbox.curselection() if self.selected: e = self.listitems[int(self.selected[0])] if hasattr(e, "filename"): fn = asksaveasfilename(initialfile=e.filename + ".mft") else: fn = asksaveasfilename() with open(fn, "wb") as mftfile: mftfile.write(e.dump())
def writeFile(key, chunks, overwrite): failure = True filename = "{}.todo".format(key) while failure: try: with open(filename) as f: pass except OSError as e: try: with open(filename, "w") as f: for chunk in chunks: for line in chunk: f.write(line) f.write("\n") except OSError as f: print("""\ The file {} exists and the file system doesn't want me to touch it. Please enter a different one.""".format(filename)) filename = filedialog.asksaveasfilename() continue else: failure = False else: if overwrite: with open(filename, "w") as f: for chunk in chunks: for line in chunk: f.write(line) f.write("\n") failure = False else: answer = input("""\ Yo, {} exists. Do you want to overwrite it? y/n > """.format(filename)) if answer in "yY": print("""\ Okay, your funeral I guess.""") with open(filename, "w") as f: for chunk in chunks: for line in chunk: f.write(line) f.write("\n") failure = False elif answer in "nN": print("""\ Okay, enter a new one.""") filename = filedialog.asksaveasfilename() continue else: print("""\ Didn't get that, so I'm assuming "no." (Aren't you glad this is my default behavior for garbled input?)""") filename = filedialog.asksaveasfilename() continue
def on_key_pressed(self, key_pressed_event): key = key_pressed_event.keysym if "Shift" in key or "Control" in key: return print(key_pressed_event.keysym) self.pressed_keys.append(key) if self.pressed_keys == self.easteregg_keys: print('A winner is you!') filedialog.asksaveasfilename()
def save(self): self.paused = True try: if platform.system() == 'Windows': game = filedialog.asksaveasfilename(initialdir = "./saves",title = "choose your file",filetypes = (("all files","*.*"),("p files","*.p"))) else: game = filedialog.asksaveasfilename(initialdir = "./saves",title = "choose your file",filetypes = (("p files","*.p"),("all files","*.*"))) self.root.title('Warriors & Gatherers - '+shortString(game)) # Copy logs for string in self.playerNames: shutil.copyfile(string+'.log',game[:-2]+'_'+string+'.log') pickle.dump(self.data, open(game, "wb" ) ) except: return None
def ask_save(filepath, filetypes=None): """ Pop-up to get path to save a new file """ if filetypes is None: filename = filedialog.asksaveasfilename() else: # In case filetypes were not configured properly in the # arguments_list try: filename = filedialog.asksaveasfilename(filetypes=filetypes) except TclError as te1: filetypes = FileFullPaths.prep_filetypes(filetypes) filename = filedialog.asksaveasfilename(filetypes=filetypes) except TclError as te2: filename = filedialog.asksaveasfilename() if filename: filepath.set(filename)
def savefile(master, text): try: filename = filedialog.asksaveasfilename(filetypes=(("Text files", "*.txt"), ("All files", "*.*") )) if bAppendtxtwhensaving == 1: filename = filename + ".txt" if not filename == "": txtcontent = iolib.writetotextfile(text, filename) if txtcontent == 1: print("Something went wrong while saving : %s.\n Does this user have to approrite permissions to the file?" % (filename)) messagebox.showerror("Error", "Something went wrong while saving to: %s.\n Do you have the approrite permissions to the file?" % (filename)) else: conversionsaved=1 print("Saved conversion to %s." % (filename)) messagebox.showinfo("Saved", "Saved conversion to %s." % (filename)) # print(txtcontent) # debugging purposes. else: # print("passed") # debugging purposes. pass except Exception as e: print("Error while loading file picker.\n %s." % (str(e))) messagebox.showerror("Error", "Error while loading file save.\n %s." % (str(e))) filename = 1 return filename
def _save_theme_as(self, event=None): """Save current changes to a file.""" fname = asksaveasfilename() if not fname: return self.__save_changes(fname) return fname
def write_refl(headers, q, refl, drefl, path): ''' Open a file where the previous was located, and drop a refl with the same name as default. ''' # we don't want a full GUI, so keep the root window from appearing Tk().withdraw() fullpath=asksaveasfilename(initialdir=path, initialfile=headers['title']+'.refl', defaultextension='.refl', filetypes=[('reflectivity','.refl')]) # fullpath = re.findall('\{(.*?)\}', s) if len(fullpath)==0: print('Results not saved') return textlist = ['#pythonfootprintcorrect 1 1 2014-09-11'] for header in headers: textlist.append('#'+header+' '+headers[header]) textlist.append('#columns Qz R dR') for point in tuple(zip(q,refl,drefl)): textlist.append('{:.12g} {:.12g} {:.12g}'.format(*point)) # print('\n'.join(textlist)) with open(fullpath, 'w') as reflfile: reflfile.writelines('\n'.join(textlist)) print('Saved successfully as:', fullpath)
def process_file(self): if self.station_id is None or self.station_id == '': easygui.msgbox("Please fill in a site id", "Error") return #exception handling for the export process try: out_fname = filedialog.asksaveasfilename() if out_fname == '': return # #get the beginning and end of the selection site = self.station_id.get() date1 = self.date1.get() date2 = self.date2.get() tz = self.tzstringvar.get() daylight_savings = self.daylightSavings.get() get_wind_data(out_fname, site, date1, date2, tz, daylight_savings) #convert string to date time, then convert to matplotlib number #tz = pytz.timezone(str(self.tzstringvar.get())) easygui.msgbox("Success grabbing file!", "Success") except: easygui.msgbox("Could not process file, please check station id and date time entries.", "Error")
def start_window(): import import_from_xlsx if not hasattr(import_from_xlsx, 'load_state'): setattr(import_from_xlsx, 'load_state', True) else: reload(import_from_xlsx) ''' tag library ''' ''' each tag library corresponds to sqlite table name each tag corresponds to sqlite database column name ''' ''' config file ''' config = configparser.ConfigParser() config.read(controllers + 'config.ini', encoding='utf-8') def convert_to_db(): source = import_from_xlsx.import_xlsx_path.get_() destination = import_from_xlsx.destination_path.get_() convert_xlsx_to_db.convert_database(source, destination) import_from_xlsx.import_from_xlsx.destroy() import_from_xlsx.import_browse_button.settings(\ command=lambda: import_from_xlsx.import_xlsx_path.set(filedialog.askopenfile().name)) import_from_xlsx.time_browse_button.settings(\ command=lambda: import_from_xlsx.time_xlsx_path.set(filedialog.askopenfile().name)) import_from_xlsx.destination_browse_button.settings(\ command=lambda: import_from_xlsx.destination_path.set(filedialog.asksaveasfilename() + '.db')) import_from_xlsx.cancel_button.settings(command=import_from_xlsx.import_from_xlsx.destroy) import_from_xlsx.import_button.settings(command=convert_to_db)
def h2d(self): import my_constant import tkinter.messagebox as messagebox import tkinter.filedialog as filedialog import my_io import traceback play = self.master.master.play if not self.clan.h: FileMenu.read_h(self) if not self.clan.h: return path = filedialog.asksaveasfilename(**my_constant.donate_opt) if path: try: my_io.append_donate(None, path, mode='clear') my_io.append_history(None, path + '.clh', mode='clear') for item in self.clan.hv: self.clan.imah.copyfrom(item) play.InitFlag[0] = True play.flash() play.InitFlag[0] = False my_io.append_donate(self.clan.imad, path, check_exist=False) my_io.append_history(self.clan.imah, path+ '.clh', check_exist=False) play.cls() except Exception as e: print('path=%s\n%s'%(path,e)) traceback.print_exc() messagebox.showerror('出错了!', '保存失败') else: messagebox.showinfo('保存成功!', '已保存至' + path)
def export_to_csv(self): """ asksaveasfilename Dialog für den Export der Ansicht als CSV Datei. """ all_items = self.columntree.get_children() all_items = list(all_items) all_items.sort() data = [("Id", "Datum", "Projekt", "Startzeit", "Endzeit", "Protokoll", "Bezahlt", "Stunden")] for item in all_items: t_id = self.columntree.set(item, column="id") datum = self.columntree.set(item, column="datum") projekt = self.columntree.set(item, column="projekt") startzeit = self.columntree.set(item, column="startzeit") endzeit = self.columntree.set(item, column="endzeit") protokoll = self.columntree.set(item, column="protokoll") bezahlt = self.columntree.set(item, column="bezahlt") stunden = self.columntree.set(item, column="stunden") stunden = stunden.replace('.', ',') data.append((t_id, datum, projekt, startzeit, endzeit, protokoll, bezahlt, stunden)) filename = filedialog.asksaveasfilename( defaultextension=".csv", initialdir=os.path.expanduser('~'), title="Export alle Daten als CSV Datei", initialfile="pystunden_alle_daten", filetypes=[("CSV Datei", ".csv"), ("Alle Dateien", ".*")]) if filename: with open(filename, "w", newline='') as f: writer = csv.writer(f, delimiter=';') writer.writerows(data)
def browse_o(self): path = filedialog.asksaveasfilename() if path: self.entry_o.delete(0, 'end') self.entry_o.insert(0, path) self.entry_changed() self.fcd_dir = os.path.dirname(path)#????????
def gravar(self): f = open('output.wav','w') path = f.name f.close() recorder.record(path) self.path = filedialog.asksaveasfilename(defaultextension='wav') os.rename(path, self.path)
def onCreate(self): filename = asksaveasfilename() if filename: alltext = self.gettext() open(filename,"w").write(alltext) self._commitTask(command = "kubectl create -f ", filename = filename)
def __call__(self): filename = filedialog.asksaveasfilename( initialdir="/", title="ログの保存", filetypes=(("テキスト ファイル", "*.txt"), ("全ての ファイル", "*.*"))) log = LogController.LogController().get() f = open(filename, 'w') f.write(log) f.close()
def fileDialog(self, fileOptions=None, mode='r', openMode=True): defaultFileOptions = {} defaultFileOptions['defaultextension'] = '' defaultFileOptions['filetypes'] = [] defaultFileOptions['initialdir'] = '' defaultFileOptions['initialfile'] = '' defaultFileOptions['parent'] = self.root defaultFileOptions['title'] = '' if fileOptions is not None: for key in fileOptions: defaultFileOptions[key] = fileOptions[key] if openMode is True: file = askopenfilename(**defaultFileOptions) if file is not None and file is not '': try : self.compressionCore.openImage(file) self.compressionCore.imageSquaring(self.NValue.get()) except Exception: messagebox.showerror( _("Error"), "It's impossible open the image.") return self.updateGUI(original=True) else: file = asksaveasfilename(**defaultFileOptions) if file is not None and file is not '': try: self.compressionCore.compressedImage.save(fp=file, format="bmp") except Exception: messagebox.showwarning( _("Error"), "Fail to save compressed image. Please try again.")
def save_inst(self): instance_name = self.get_selected_instance_name() if instance_name != '': file_name = asksaveasfilename( parent=self, filetypes=[('lbk', '.lbk'), ('*', '.*')]) if file_name != '': self.save_instance(instance_name, file_name)
def do_save_as(self): options = { 'defaultextension': '.ui', 'filetypes': ((_('pygubu ui'), '*.ui'), (_('All'), '*.*'))} fname = filedialog.asksaveasfilename(**options) if fname: self.do_save(fname)
def set_file(textbox): out_file = filedialog.asksaveasfilename() if len(out_file) != 0: textbox.setData(out_file + '.rybdb') out_file = out_file.split('/') file_name = out_file[-1] dest_path = '/'.join(out_file[:-1])
def write_css(*args): global item_list m = find("id", content) for match in m: item_list.append(clean(match, 'id', '#')) #find all classes, assign to variable m = find("class", content) for match in m: item_list.append(clean(match, 'class', '.')) #remove duplicate items in list items = set(item_list) #open file to write CSS to f = open(asksaveasfilename(), "w") #write tag selectorrs to CSS file for tag in tags: f.write(tag + "{\n\n}\n\n") #for each item in list, print item to CSS file for i in items: f.write(i) #close the opened file f.close()
def save_session_dialog(self,*event): path_list = [] for tab_not_closed_index in range(len(self.model.tabs_html)-1,-1,-1): if self.model.tabs_html[tab_not_closed_index].save_path: path_list.insert(0,self.model.tabs_html[tab_not_closed_index].save_path) # True False or None answer = messagebox.askyesnocancel( title=_(u"Question"), message=_(u"Voulez vous sauvegarder la session dans un fichier spécifique ?") ) if answer: file_path = filedialog.asksaveasfilename(defaultextension=JSON["defaultextension"], initialdir=self.model.guess_dir(), filetypes=JSON["filetypes"], initialfile="webspree_session.json") if file_path: session_object = { "webspree":"webspree_session", "version": "1.1.0", "path_list": path_list, "tab_index": self.model.selected_tab, "zoom": self.zoom_level, "edit_mod": self.mode.get() } JSON_TEXT = json.dumps(session_object,sort_keys=False, indent=4, separators=(',',':')) codecs.open(file_path, 'w', "utf-8").write(JSON_TEXT) elif not answer: self.model.set_option("previous_files_opened", path_list) elif answer is None: pass
def getfilepath(): """Calls tk to create a file dialog that asks the user where they want to place the file.""" # If root.withdraw() is added, window is only accessible by alt-tab. root = tk.Tk() return filedialog.asksaveasfilename(initialdir='C:/', defaultextension='.csv', initialfile='Inventory ' + str(datetime.date.today()), filetypes=(("Comma Separated Values",'*.csv'),("All Files", '*.*')))
def generate_by_date_2(): try: cur=dbconn.cursor() cur.execute("select distinct mc.ministry_county_name,c.course_name, r.first_name, r.middle_name, r.sur_name, r.personal_id, r.national_id, r.mobile_no, r.email_id,r.scheduled_from,r.scheduled_to,r.attended_from,r.attended_to from register r join ministry_county mc on mc.ministry_county_id = r.ministry_county_id join courses c on c.course_id = r.course_id where scheduled_from between '%s' and '%s' order by scheduled_from;"%(fromentry.get(),toentry.get())) get_sch_report=cur.fetchall() if get_sch_report ==[]: messagebox.showwarning('Warning', "No data found from period '%s' to '%s'" %(fromentry.get(),toentry.get())) else: file_format = [("CSV files","*.csv"),("Text files","*.txt"),("All files","*.*")] all_trained_mdac_report = asksaveasfilename( title ="Save As='.csv'", initialdir="C:\\Users\\usrname", initialfile ='Generate by date All Trained MDAC Report', defaultextension=".csv", filetypes= file_format) outfile = open(all_trained_mdac_report, "w") writer = csv.writer(outfile, delimiter=',', quotechar='"', quoting=csv.QUOTE_ALL) writer.writerow( ['ministry_county_name','course_name','first_name','middle_name','sur_name','personal_id','national_id','mobile_no','email_id','scheduled_from','scheduled_to','attended_from','attended_to']) for i in get_sch_report: writer.writerows([i]) outfile.close() gui.destroy() except psycopg2.InternalError: messagebox.showerror('Error', 'You need to input dates') messagebox.showerror('Error', 'Fatal Error occured') sys.exit(0) except: pass
def btn_save_command(self): save_filename = asksaveasfilename(filetypes=(("Excel file", "*.xls"), )) if not save_filename: return filename, file_extension = os.path.splitext(save_filename) if file_extension == '': save_filename += '.xls' wb = xlwt.Workbook() ws = wb.add_sheet('Найденные телефоны') phone_style = xlwt.XFStyle() phone_style.num_format_str = '0000000000' ws.col(0).width = 256 * 11 line = 0 for k in Parser.phones.keys(): if k not in Parser.source_excel.keys(): try: v = Parser.phones[k] except EOFError: v = '' ws.write(line, 0, int(k), phone_style) ws.write(line, 1, v) line += 1 wb.save(save_filename) os.startfile(save_filename, 'open')
def main(): # By default Tk shows an empty window, remove it tkinter.Tk().withdraw() input('Press enter to select the base file') baseFilePath = askopenfilename(title='Select the base file to read') print('Base file: ' + baseFilePath) input('Press enter to select the merge file') mergeFilePath = askopenfilename(title='Select the merge file to read') print('Merge file: ' + mergeFilePath) input('Press enter to select the save file') saveFilePath = asksaveasfilename() print('Save file: ' + saveFilePath) baseFile = csv.reader(open(baseFilePath, 'r', encoding='utf-8')) mergeFile = deque(csv.reader(open(mergeFilePath, 'r', encoding='utf-8'))) saveFile = csv.writer(open(saveFilePath, 'w', encoding='utf-8'), delimiter=';', quoting=csv.QUOTE_NONE) mergeRow = mergeFile.popleft() for baseRow in baseFile: if mergeRow[0] == baseRow[0]: mergeCol = mergeRow[1] try: mergeRow = mergeFile.popleft() except: pass else: mergeCol = '' saveFile.writerow([baseRow[0], mergeCol, baseRow[1]])
def export(self, fullRes = True): """Exports the image with bounding boxes drawn on it. A save-file dialog will be shown to the user to select the target file name. fullRes - If this set to true and the DetectionFrame instance has been constructed with an image given by filename, a full-resolution image will be exported, otherwise just the thumbnail will be used. """ filename = tkFileDialog.asksaveasfilename(parent = self, title = 'Export image', defaultextension = '.png', filetypes = [('Portable Network Graphics', '.png'), ('JPEG image', '.jpg .jpeg')]) if filename: if not self._detectionFrame._filepath is None: img = Image.open(self._detectionFrame._filepath) if not fullRes: img.thumbnail((180,512), Image.ANTIALIAS) else: img = self._detectionFrame.thumb.copy() # Draw bounding boxes of the detected objects for i, det in enumerate(self._detectionFrame.detections): img = det.scale(float(img.size[0]) / self._detectionFrame.thumb.orig_size[0]).drawToImage(img, gui_utils.getAnnotationColor(i), 2) # Save file try: options = {} ext = os.path.splitext(filename)[1].lower() if ext == '.jpg': options['quality'] = 96 elif ext == '.png': options['compress'] = True img.save(filename, **options) except Exception as e: tkMessageBox.showerror(title = 'Export failed', message = 'Could not save image:\n{!r}'.format(e))
raise SystemExit(0) threshMax = int(d.threshMax) threshMin = int(d.threshMin) binSize = int(d.binSize) # Get .csv files to work with fileList = filedialog.askopenfilenames(parent=root, title="Select raw data files", filetypes=(("comma-separated values", "*.csv"), ("all files","*.*"))) if not len(fileList) > 0: print("No input files provided - exiting.") raise SystemExit(0) # Select save location for output outputFile = filedialog.asksaveasfilename(title="Save output file as", defaultextension=".csv", filetypes=(("comma-separated values", "*.csv"), ("all files","*.*"))) if not outputFile: print("No output file - exiting.") raise SystemExit(0) # initalise some variables - why do I do this in python? Habit, I guess. cleanlines = [] # list for csv entries summary = {} # dictionary for bins and their sizes i = 0 # track # of files so we can look cool skippedFiles = [] # files we couldn't process startTime = time.time() # we'll record the time so we can look really smug at the end for someFile in fileList: # iterate the file list print("Processing " + os.path.basename(someFile))
def save_as_button_func(): save_path = filedialog.asksaveasfilename(filetypes=[('MIDI files', '*.mid')]) save_path += '.mid' if save_path[-4:] != '.mid' else '' save_as_label.config(text=save_path) info['save_path'] = save_path
def _btnReadClick(self, event): if self._validIp(): self.path = asksaveasfilename(filetypes=[('All', '.*')], title="Read<----Server") Request().Get(self.path, self.txtIp.get())
def save_file(self): filename = asksaveasfilename() if len(filename) > 0 and filename.endswith(".json"): self.save_config(filename)
import tkinter as tk from tkinter import filedialog import os application_window = tk.Tk() my_filetypes = [('all files', '.*'), ('text files', '.*txt')] answer = filedialog.askdirectory(parent = application_window, initialdir = os.getcwd(), title = "Please select a folder") amswer = filedialog.askopenfilename(parent = application_window, initialdir = os.getcwd(), title = "Please select a file", filetypes = my_filetypes) answer = filedialog.askopenfilenames(parent = application_window, initialdir = os.getcwd(), title = "Please select one or more files", filetypes = my_filetypes) answer = filedialog.asksaveasfilename(parent = application_window, initialdir = os.getcwd(), title = "Please select a file name for saving:", filetypes = my_filetypes)
) #the r must be included to avoid unicode errors wherein the SMILES code starts a unicodeescape. #In the future a line of code must add this r to files which are read in. mcy = input("Enter a SMILES value for the structure:") # example smiles to use: mcy-DASP3-LR = r'O=C([C@@H](CC(N[C@@H](CCC/N=C(N)\N)C(N[C@@H](/C=C/C(C)=C/[C@H](C)[C@@H](OC)CC1=CC=CC=C1)[C@H](C)C(N[C@@H](C(O)=O)CC2)=O)=O)=O)NC([C@H](CC(C)C)NC([C@@H](C)NC(C(N(C)C2=O)=C)=O)=O)=O)O' m = Chem.MolFromSmiles(mcy) print('') print('') print('Please select an output folder for the data.') input('Press Enter to select a file') from tkinter.filedialog import asksaveasfilename root = tk.Tk() root.withdraw() fragments = asksaveasfilename() print( '--------------------------------------------------------------------------------------------------------------------------------------' ) print('') print('') print('') print( 'SMARTS manual is available at Daylight Chemical Information Systems https://www.daylight.com/dayhtml/doc/theory/theory.smarts.html' ) print('') print('') print('Examples for peptide analysis:') print('Methoxy = $([CHX4][O][CH3])') print('benzylic = $([CH2X4][c])') print('methyl-methoxy-ethane = $([CH3][CHX4][CHX4][O][CH3])')
def inpo3(): namein = filedialog.asksaveasfilename(parent=win) e3.insert(END, namein) print(e3.get())
def load_raw_data_excel(raw_data_path) -> pd.DataFrame: """ ritorna un pandas Dataframe dal file excel specificato dal percorso :param raw_data_path: :return: """ data = pd.read_excel(raw_data_path, sheet_name=0, header=0, index_col=False, keep_default_na=True) return data # ignore all warnings if not sys.warnoptions: warnings.simplefilter("ignore") print("Selezionare il file xlsx da convertire:") Tk().withdraw( ) # we don't want a full GUI, so keep the root window from appearing filename = fd.askopenfilename(initialdir="/", title="Seleziona csv", filetypes=(("xlxs files", "*.xlsx"), ("all files", "*.*"))) print("Conversione del file in corso...") data = load_raw_data_excel(filename) print("Selezionare la destinazione su cui salvare il file come csv:") export_file_path = filedialog.asksaveasfilename(defaultextension='.csv') data.to_csv(export_file_path, index=None, header=True)
def pickle_gui(to_be_pickled, extension=".pickle"): """ Uses gui for learning path where object will be pickled. """ pickle(to_be_pickled, asksaveasfilename(), extension)
def diskRead(): # Draw parameter entry window parameterWindow = Toplevel(mainWindow) parameterWindow.title('Copy Disk Parameters') parameterWindow.resizable(width=False, height=False) parameterWindow.transient(mainWindow) parameterWindow.grab_set() r_extend_var = IntVar() Checkbutton(parameterWindow, text="Copy only blocks with BAM entry", variable=r_bam_var).grid(row=0, sticky=W, padx=10, pady=4) Checkbutton(parameterWindow, text="Copy 40 tracks", variable=r_extend_var).grid(row=1, sticky=W, padx=10, pady=4) Checkbutton(parameterWindow, text="Verify after copying", variable=r_verify_var).grid(row=2, sticky=W, padx=10, pady=4) Button(parameterWindow, text='Select output file', command=parameterWindow.quit).grid(row=3, columnspan=2, sticky=EW, padx=4, pady=4) parameterWindow.mainloop() bamcopy = r_bam_var.get() verify = r_verify_var.get() if r_extend_var.get() > 0: tracks = 40 allocated = 768 else: tracks = 35 allocated = 683 parameterWindow.destroy() # Get output file filename = filedialog.asksaveasfilename(title='Select output file', filetypes=(("D64 files", "*.d64"), ('All files', '*.*'))) if not filename: return # Establish serial connection diskbuddy = Adapter() if not diskbuddy.is_open: messagebox.showerror('Error', 'DiskBuddy64 Adapter not found !') return # Check if IEC device ist present if not diskbuddy.checkdevice(device.get()): diskbuddy.close() messagebox.showerror( 'Error', 'IEC device ' + str(device.get()) + ' not found !') return # Upload fast loader to disk drive RAM if diskbuddy.uploadbin(FASTUPLOAD_LOADADDR, FASTUPLOAD_BIN) > 0 \ or diskbuddy.fastuploadbin(FASTREAD_LOADADDR, FASTREAD_BIN) > 0: diskbuddy.close() messagebox.showerror('Error', 'Failed to upload fastread.bin !') return # Create output file try: f = open(filename, 'wb') except: diskbuddy.close() messagebox.showerror('Error', 'Failed to create output file !') return # Fill output file with default values for track in range(1, tracks + 1): for sector in range(getsectors(track)): f.write(b'\x4B' + b'\x01' * 255) # Read BAM if necessary progress = Progressbox(mainWindow, 'DiskBuddy64 - Reading disk', 'Copy disk to D64 file ...') if bamcopy > 0: dbam = BAM(diskbuddy.readblock(18, 0)) if not dbam.bam: f.close() diskbuddy.close() progress.destroy() messagebox.showerror('Error', 'Failed to read the BAM !') return allocated = dbam.getallocated() if tracks > 35: allocated += 85 # Read disk copied = 0 errors = 0 starttime = time.time() for track in range(1, tracks + 1): secnum = getsectors(track) sectors = [x for x in range(secnum)] seclist = [] # Cancel sectors without BAM entry if bamcopy > 0 and track < 36: for x in range(secnum): if dbam.blockisfree(track, x): sectors.remove(x) # Optimize order of sectors for speed sector = trackgap * (track - 1) counter = len(sectors) while counter: sector %= secnum while not sector in sectors: sector += 1 if sector >= secnum: sector = 0 seclist.append(sector) sectors.remove(sector) sector += interleave counter -= 1 # Send command to disk drive, if there's something to read on track progress.setactivity('Copy disk to D64 file ...' + '\nTrack: ' + str(track) + ' of ' + str(tracks)) seclen = len(seclist) if seclen > 0: if diskbuddy.startfastread(track, seclist) > 0: f.close() diskbuddy.close() progress.destroy() messagebox.showerror('Error', 'Failed to read from disk !') return # Read track diskbuddy.timeout = 3 for sector in seclist: f.seek(getfilepointer(track, sector)) block = diskbuddy.getblockgcr() if not block: f.close() diskbuddy.close() progress.destroy() messagebox.showerror('Error', 'Failed to read from disk !') return if not len(block) == 256: errors += 1 else: f.write(block) diskbuddy.timeout = 1 copied += 1 progress.setvalue(copied * 100 // allocated) # Finish all up if verify == 0: diskbuddy.executememory(MEMCMD_SETTRACK18) duration = time.time() - starttime f.close() diskbuddy.close() progress.destroy() if verify > 0: diskVerify(filename, bamcopy, tracks) else: messagebox.showinfo( 'Mission accomplished', 'Copying finished !\nRead Errors: ' + str(errors) + '\nDuration: ' + str(round(duration)) + ' sec')
def saveSnapshot(app): path = filedialog.asksaveasfilename(initialdir=os.getcwd(), title='Select file: ',filetypes = (('png files','*.png'),('all files','*.*'))) if (path): # defer call to let filedialog close (and not grab those pixels) if (not path.endswith('.png')): path += '.png' app._deferredMethodCall(afterId='saveSnapshot', afterDelay=0, afterFn=lambda:app.getSnapshot().save(path))
def save_as(self): name1 = asksaveasfilename(filetypes=[(("Log files"), "*.*")]) self.new_img.save(str(name1) + '.png')
def go(self): sound_name_list = self.sound_name_list key_presses = self.key_presses ops = self.ops quorum = self.quorum play_duration = self.play_duration jitter_range = self.jitter_range practice = self.practice monitor_idx = self.monitor_idx beamer_idx = self.beamer_idx monitor_fps = self.monitor_fps beamer_fps = self.beamer_fps back_color = self.back_color thresh_results = [] abort = 0 # set up the monitors beamer = None monitor = visual.Window(size=self.monsize, color=self.back_color, screen=monitor_idx, winType="pyglet", useFPO=False, waitBlanking=False) print("Monitor fps: " + str(monitor_fps)) if beamer_idx > -1: beamer = visual.Window(size=self.beamsize, color=back_color, screen=beamer_idx, winType="pyglet", useFPO=False, waitBlanking=False) print("Beamer fps: " + str(beamer_fps)) visobjs = {} beamobjs = {} # set up the complex of visual objects # text visobjs["tonepress_label"] = visual.TextStim(win=monitor, text="Sound/Press", pos=(-0.9, 0.9), height=0.07, color=self.text_color, alignHoriz="left") visobjs["tonepress_l"] = visual.TextStim(win=monitor, text="L", pos=(-0.8, 0.8), height=0.1, color=self.text_color) visobjs["tonepress_r"] = visual.TextStim(win=monitor, text="R", pos=(-0.7, 0.8), height=0.1, color=self.text_color) visobjs["tonelabel"] = visual.TextStim(win=monitor, text="S", pos=(-0.9, 0.7), height=0.1, color=self.text_color) visobjs["presslabel"] = visual.TextStim(win=monitor, text="P", pos=(-0.9, 0.6), height=0.1, color=self.text_color) visobjs["acclabel"] = visual.TextStim(win=monitor, text="Accuracy", pos=(-0.9, 0.4), height=0.07, color=self.text_color, alignHoriz="left") visobjs["acclabel_l"] = visual.TextStim(win=monitor, text="L", pos=(-0.9, 0.3), height=0.1, color=self.text_color) visobjs["acclabel_r"] = visual.TextStim(win=monitor, text="R", pos=(-0.9, 0.15), height=0.1, color=self.text_color) visobjs["filename"] = visual.TextStim(win=monitor, text="", pos=(-0.95, -0.1), height=0.06, color=self.text_color, alignHoriz="left") visobjs["progress"] = visual.TextStim(win=monitor, text="", pos=(-0.95, -0.2), height=0.06, color=self.text_color, alignHoriz="left") visobjs["mode"] = visual.TextStim(win=monitor, text="Normal Mode", pos=(-0.95, -0.5), height=0.08, color=self.text_color, alignHoriz="left") visobjs["status"] = visual.TextStim(win=monitor, text="Running", pos=(0.05, -0.5), height=0.08, color=self.text_color, alignHoriz="left") visobjs["message"] = visual.TextStim( win=monitor, text="press p to pause, a to abort", pos=(-0.95, -0.8), height=0.06, color=self.text_color, alignHoriz="left") if practice: visobjs["mode"].text = "Practice" visobjs["mode"].color = (1, -1, -1) if beamer is not None: beamobjs["befehl"] = visual.TextStim( win=beamer, text= "Drücke sofort RECHTS bei einem Ton im rechten Ohr.\n\n\nDrücke sofort LINKS bei einem Ton im linken Ohr.", pos=(0, 0), height=0.07, color=self.text_color) beamobjs["bericht"] = VisObj( visual.TextStim(win=beamer, text="", pos=(0, 0), height=0.1, color=back_color)) self.draw_visobjs(beamobjs) beamer.flip() # tone/press squares visobjs["lefttone"] = VisObj( visual.Rect(win=monitor, units="norm", width=0.1, height=0.1, pos=(-0.8, 0.7), lineColor=[-1, -1, -1])) visobjs["righttone"] = VisObj( visual.Rect(win=monitor, units="norm", width=0.1, height=0.1, pos=(-0.7, 0.7), lineColor=[-1, -1, -1])) visobjs["leftpress"] = VisObj( visual.Rect(win=monitor, units="norm", width=0.1, height=0.1, pos=(-0.8, 0.6), lineColor=[-1, -1, -1])) visobjs["rightpress"] = VisObj( visual.Rect(win=monitor, units="norm", width=0.1, height=0.1, pos=(-0.7, 0.6), lineColor=[-1, -1, -1])) # accuracy squares acc_pane_names = [[], []] for s_idx, s in enumerate(zip(["left", "right"], [0.3, 0.15])): for p_idx in range(quorum): acc_pane_names[s_idx].append(s[0] + "acc" + str(p_idx)) visobjs[acc_pane_names[s_idx][-1]] = VisObj( visual.Rect(win=monitor, units="norm", width=0.1, height=0.1, pos=(-0.8 + (p_idx * 0.1), s[1]), lineColor=(-1, -1, -1), fillColor=back_color)) # threshold chart thresh_height_cent = 0.25 thresh_width_cent = 0.3 thresh_height = 1 thresh_width = 0.7 thresh_height_min = thresh_height_cent - thresh_height / 2 visobjs["thresh_back"] = VisObj( visual.Rect(win=monitor, units="norm", width=thresh_width, height=thresh_height, pos=(thresh_width_cent, thresh_height_cent), lineColor=[-1, -1, -1], fillColor=(1, 1, 1))) visobjs["thresh_left"] = VisObj( visual.Rect(win=monitor, units="norm", width=thresh_width / 4, height=0.08, pos=(thresh_width_cent - thresh_width / 4, thresh_height_cent), lineColor=[-1, -1, -1], fillColor=(-1, -1, 1))) visobjs["thresh_right"] = VisObj( visual.Rect(win=monitor, units="norm", width=thresh_width / 4, height=0.08, pos=(thresh_width_cent + thresh_width / 4, thresh_height_cent), lineColor=[-1, -1, -1], fillColor=(-1, -1, 1))) visobjs["thresh_label"] = visual.TextStim(win=monitor, text="Hearing Threshold", pos=(0.3, 0.9), height=0.07, color=self.text_color) visobjs["thresh_label_l"] = visual.TextStim( win=monitor, text="L", pos=(thresh_width_cent - thresh_width / 4, 0.8), height=0.1, color=self.text_color) visobjs["thresh_label_r"] = visual.TextStim( win=monitor, text="R", pos=(thresh_width_cent + thresh_width / 4, 0.8), height=0.1, color=self.text_color) visobjs["thresh_label_dB"] = visual.TextStim( win=monitor, text="dB", pos=(thresh_width_cent - thresh_width / 2 - 0.13, thresh_height_cent), height=0.1, color=self.text_color) visobjs["thresh_label_max"] = visual.TextStim( win=monitor, text="0", pos=(thresh_width_cent - thresh_width / 2 - 0.13, thresh_height_cent + thresh_height / 2), height=0.1, color=self.text_color) visobjs["thresh_label_min"] = visual.TextStim( win=monitor, text="-160", pos=(thresh_width_cent - thresh_width / 2 - 0.13, thresh_height_cent - thresh_height / 2), height=0.1, color=self.text_color) # for every file name,convert to stereo, # and normalise to [-1,1] range, build the SoundWrap objects sound_list = [] for sound_name in sound_name_list: snd = audio_load(sound_name) sound_list.append( SoundWrap(sound_name, snd, incr_dcb, [ops.copy(), ops.copy()])) # randomise order of sounds reihenfolge = np.array(range(len(sound_name_list))) np.random.shuffle(reihenfolge) runde = np.concatenate( (np.zeros(quorum), np.ones(quorum))).astype(np.int) # cycle through sounds randomly for abs_idx, sound_idx in enumerate(np.nditer(reihenfolge)): swr = sound_list[sound_idx] visobjs["filename"].text = sound_name_list[sound_idx] visobjs["progress"].text = "File: " + str(abs_idx + 1) + " of " + str( len(sound_name_list)) # already do a reduction before we begin swr.operate(0, dcb_delta=swr.ops[0].pop(0), direction=-1) swr.operate(1, dcb_delta=swr.ops[1].pop(0), direction=-1) ear_thresh = dec2dcb((np.max(swr.data[:, 0]), np.max(swr.data[:, 1]))) visobjs["thresh_left"].pos = pos_anim( visobjs["thresh_left"].visobj.pos, (visobjs["thresh_left"].visobj.pos[0], thresh_height_min + thresh_height * (-160 - ear_thresh[0]) / -160), int(monitor_fps * 0.5)) visobjs["thresh_right"].pos = pos_anim( visobjs["thresh_right"].visobj.pos, (visobjs["thresh_right"].visobj.pos[0], thresh_height_min + thresh_height * (-160 - ear_thresh[1]) / -160), int(monitor_fps * 0.5)) # do until ops are exhausted in both ears while swr.ops[0] or swr.ops[1]: # make versions with sound only in left or right sounds = [] for s_idx in range(quorum): d = swr.data.copy() d[:, 1 - s_idx] = 0 sounds.append(sound.Sound(d)) # present to each ear twice in random order, record accuracy np.random.shuffle(runde) accs = [[], []] for r_idx, r in enumerate(np.nditer(runde)): # play sound and update tone squares sounds[r].play() if r: visobjs["righttone"].visobj.fillColor = (-1, 1, -1) else: visobjs["lefttone"].visobj.fillColor = (-1, 1, -1) for f_idx in range(int(monitor_fps * play_duration)): response = event.getKeys(key_presses) # update press squares self.draw_visobjs(visobjs) monitor.flip() if response: break sounds[r].stop() # turn off sound and update tone squares # allow a short grace period to respond if not response: for f_idx in range(int(monitor_fps * 0.75)): grace_response = event.getKeys(key_presses) self.draw_visobjs(visobjs) monitor.flip() if grace_response: break response = response + grace_response anim_pattern = col_anim( (-1, 1, -1), (-1, 1, -1), int(monitor_fps * 0.15)) + col_anim( (0, 1, 0), back_color, int(monitor_fps * 0.2)) if r: visobjs["righttone"].fillColor = anim_pattern else: visobjs["lefttone"].fillColor = anim_pattern # mark accuracy, update press squares if key_presses[r] in response and key_presses[ 1 - r] not in response: accs[r].append(1) anim_pattern = col_anim(back_color,(-1,1,-1),int(monitor_fps*0.15)) + \ col_anim((-1,1,-1),back_color,int(monitor_fps*0.2)) if r: visobjs["rightpress"].fillColor = anim_pattern else: visobjs["leftpress"].fillColor = anim_pattern if practice and beamer_idx > -1: beamobjs["bericht"].visobj.text = "Richtig!" beamobjs["bericht"].color = col_anim(back_color,(-1,1,-1),beamer_fps*0.35) + \ col_anim((-1,1,-1),back_color,beamer_fps*0.35) elif key_presses[1 - r] in response: accs[r].append(0) anim_pattern = col_anim(back_color,(1,-1,-1),int(monitor_fps*0.15)) + \ col_anim((1,-1,-1),back_color,int(monitor_fps*0.3)) if r: visobjs["leftpress"].fillColor = anim_pattern.copy( ) else: visobjs[ "rightpress"].fillColor = anim_pattern.copy() if practice and beamer_idx > -1: beamobjs["bericht"].visobj.text = "Falsch!" beamobjs["bericht"].color = col_anim(back_color,(1,-1,-1),beamer_fps*0.35) + \ col_anim((1,-1,-1),back_color,beamer_fps*0.35) else: accs[r].append(0) if practice and beamer_idx > -1: beamobjs["bericht"].visobj.text = "Verpasst!" beamobjs["bericht"].color = col_anim(back_color,(1,-1,-1),beamer_fps*0.35) + \ col_anim((1,-1,-1),back_color,beamer_fps*0.35) # update acc squares if accs[r][-1]: anim_pattern = col_anim(back_color, (-1, 1, -1), monitor_fps * 0.2) else: anim_pattern = col_anim(back_color, (1, -1, -1), monitor_fps * 0.2) visobjs[acc_pane_names[r][ len(accs[r]) - 1]].fillColor = anim_pattern.copy() # ISI jitter = jitter_range[0] + np.random.rand() * ( jitter_range[1] - jitter_range[0]) for f_idx in range(int(monitor_fps * jitter)): self.draw_visobjs(visobjs) if beamer_idx > -1: self.draw_visobjs(beamobjs) beamer.flip() monitor.flip() if "p" in event.getKeys(["p"]): visobjs["status"].text = "Paused" visobjs["status"].color = (1, -1, -1) visobjs["message"].text = "press p again to resume" self.draw_visobjs(visobjs) monitor.flip() event.waitKeys(keyList=["p"]) visobjs["status"].text = "Running" visobjs["status"].color = self.text_color visobjs[ "message"].text = "press p to pause, a to abort" self.draw_visobjs(visobjs) monitor.flip if "a" in event.getKeys(["a"]): abort += 1 if abort == 1: visobjs[ "message"].text = "press a again to abort, n to cancel" visobjs["message"].color = (1, -1, -1) if abort == 2: monitor.close() if beamer_idx > -1: beamer.close() return ([], 0) if abort == 1 and "n" in event.getKeys(["n"]): abort = 0 visobjs[ "message"].text = "press p to pause, a to abort" visobjs["message"].color = self.text_color event.clearEvents() # assess accuracy and act accordingly accs = np.array(accs) for r_idx in range(accs.shape[0]): line_flash = col_anim( (-1, -1, -1), (1, 1, 1), monitor_fps * 0.2) + col_anim( (1, 1, 1), (-1, -1, -1), monitor_fps * 0.4) green_flash = col_anim( (-1, 1, -1), (1, 1, 1), monitor_fps * 0.2) + col_anim( (1, 1, 1), back_color, monitor_fps * 0.4) red_flash = col_anim( (1, -1, -1), (1, 1, 1), monitor_fps * 0.2) + col_anim( (1, 1, 1), back_color, monitor_fps * 0.4) if accs[r_idx, ].all() and swr.ops[ r_idx]: # all correct, decrease volume, flash squares swr.operate(r_idx, dcb_delta=swr.ops[r_idx].pop(0), direction=-1) for accp in acc_pane_names[r_idx]: visobjs[accp].fillColor = green_flash.copy() visobjs[accp].lineColor = line_flash.copy() elif not accs[r_idx, ].any( ) and swr.ops[r_idx]: # all false, increase swr.operate(r_idx, dcb_delta=swr.ops[r_idx].pop(0), direction=1) for accp in acc_pane_names[r_idx]: visobjs[accp].fillColor = red_flash.copy() visobjs[accp].lineColor = line_flash.copy() else: # ambiguous result, just clear acc squares for accp in acc_pane_names[r_idx]: visobjs[accp].fillColor = col_anim( visobjs[accp].visobj.fillColor, back_color, monitor_fps * 0.4) # update threshold chart ear_thresh = dec2dcb( (np.max(swr.data[:, 0]), np.max(swr.data[:, 1]))) visobjs["thresh_left"].pos = pos_anim( visobjs["thresh_left"].visobj.pos, (visobjs["thresh_left"].visobj.pos[0], thresh_height_min + thresh_height * (-160 - ear_thresh[0]) / -160), int(monitor_fps * 0.5)) visobjs["thresh_right"].pos = pos_anim( visobjs["thresh_right"].visobj.pos, (visobjs["thresh_right"].visobj.pos[0], thresh_height_min + thresh_height * (-160 - ear_thresh[1]) / -160), int(monitor_fps * 0.5)) # store threshold for item thresh_results.append( [sound_idx, swr.name, ear_thresh[0], ear_thresh[1]]) for f_idx in range(int(monitor_fps * 0.35)): self.draw_visobjs(visobjs) monitor.flip() # write to file if not practice: now = datetime.datetime.now() Tk().withdraw() filename = filedialog.asksaveasfilename( filetypes=(("Hearing test files", "*.hrt"), ("All files", "*.*"))) if filename: with open(filename, "w") as file: file.write( "Subject {sub}, recorded on {d}.{m}.{y}, {h}:{mi}\n". format(sub="test", d=now.day, m=now.month, y=now.year, h=now.hour, mi=now.minute)) file.write("Index\tWavfile\tLeftEar\tRightEar\n") for thrsh in thresh_results: file.write("{idx}\t{name}\t{right}\t{left}\n".format( idx=thrsh[0], name=thrsh[1], right=thrsh[2], left=thrsh[3])) monitor.close() if not beamer_idx == -1: # for some reason closing the beamer crashes it beamer.close() return thresh_results
def onSave(self): filename = asksaveasfilename() if filename: alltext = self.gettext() # first through last open(filename, 'w').write(alltext) # store text in file
def overide_browse_button(self): global save_file self.save_filename = filedialog.asksaveasfilename(defaultextension='*.png*') self.save_file.delete(0, tk.END) self.save_file.insert(0, self.save_filename) save_file = self.save_file.get()
def save_mask(self, filename=None): if filename is None: filename = asksaveasfilename() imsave(filename + ".png", self.mask)
def convertToExcel(): global read_file export_file_path = filedialog.asksaveasfilename( defaultextension=".xlsx") read_file.to_excel(export_file_path, index=None, header=True)
"CTID", "Staff Providing The Service", "Service Date" ]] # tracking those who graduated a RentWell Class graduate = spsc[spsc["Provider Specific Code"].str.contains("Graduation")][[ "CTID", "Staff Providing The Service", "Service Date" ]] # tracking those who were referred to a RentWell Class referred = spsc[spsc["Provider Specific Code"].str.contains("Referral")][[ "CTID", "Staff Providing The Service", "Service Date" ]] # create a summary summary = spsc.pivot_table(index=["Provider Specific Code"], values=["CTID"], aggfunc=len) writer = pd.ExcelWriter(asksaveasfilename( title="RentWell Monthly Data", initialdir="//tproserver/Reports/Monthly Report", initialfile="RentWell Monthly Data.xlsx", defaultextension=".xlsx"), engine="xlsxwriter") summary.to_excel(writer, sheet_name="Summary") graduate.to_excel(writer, sheet_name="RentWell Graduates", index=False) attendee.to_excel(writer, sheet_name="RentWell Attendees", index=False) referred.to_excel(writer, sheet_name="RentWell Referrals", index=False) spsc_is_blank.to_excel(writer, sheet_name="Errors", index=False) writer.save()
__author__ = 'iamhssingh' import sqlite3 from tkinter import Tk from tkinter import filedialog from tkinter import messagebox root = Tk() c = filedialog.asksaveasfilename(defaultextension='.db', filetypes=[('database files', '.db')], initialfile='bmngmnt', title="Choose your databasefile", initialdir=".", parent=root) success = False create = False cursor = None try: db = sqlite3.connect(c) cursor = db.cursor() success = True except sqlite3.Error as err: messagebox.showwarning(title="Database Connection Error", message="Something went wrong: {}".format(err)) if success: try: cursor.execute("""CREATE TABLE `user_master` ( `userID` INTEGER NOT NULL PRIMARY KEY AUTOINCREMENT UNIQUE, `userName` TEXT NOT NULL, `userFName` TEXT NOT NULL, `userLName` TEXT NOT NULL, `userPassword` TEXT NOT NULL );""")
def pick_export_path(self): self.export_path = filedialog.asksaveasfilename() self.label_export_path['text'] = self.export_path self.master.lift() self.master.focus_force()
NbFiles += MyKML.ScanFolder(Folder=Foldername) print("Imported " + str(NbFiles) + " files from folders.") if (NbFiles == 0): # Canceled by user print("No GPS info found in folder. Aborting.") sys.exit() # FilteredQty = MyKML.FilterPlacemarks(MinDistance) MyKML.MinDistanceBetweenPlacemarks = MinDistance # Export KML file if (KMLFileName == ""): KMLFileName = filedialog.asksaveasfilename(title="Select KML output file", filetypes={("KML files", "*.kml")}) file, ext = os.path.splitext(KMLFileName) if (KMLFileName == ""): # Canceled by user print("No KML file provided. Aborting.") sys.exit() # enforce kml extension if (ext.lower() != ".kml"): KMLFileName = file + ".kml" _, MyKML.MapName = os.path.split(KMLFileName) MyKML.MinDistanceBetweenPlacemark = MinDistance FileSaved = MyKML.SaveKMLFile(KMLFileName)
def guardar_como(self): guardar_info = asksaveasfilename(title='Guardar Archivo') write_file = open(guardar_info, 'w+') write_file.write(self.entrada.get('1.0', END)) write_file.close() self.archivo = guardar_info
def save_image(): path = filedialog.asksaveasfilename() print(path) cv2.imwrite(path + "-edged.jpg", can)
def export(): exportfile = fd.asksaveasfilename() config.library.to_csv(exportfile, index=False)
def save_map_as(self): self.file = filedialog.asksaveasfilename(initialdir="~", title="Save map") if self.file != None and len(self.file) > 0: self.lscr.lmap.write_to_file(self.file)
def save_departs_csv(): filename = filedialog.asksaveasfilename(initialdir=" ", title="Введите название среза", filetypes=( ("csv files", "*.csv"), ("csv files", "*.csv"))) df_to_save.to_csv(filename + '.csv', index=False)
def salvar_imagem(self): filename = filedialog.asksaveasfilename() self.fig.savefig(filename)
def file_save(self): default_dir = os.path.expandvars(r'%USERPROFILE%\Desktop') out_file = filedialog.asksaveasfilename(title='选择文件', initialdir=(default_dir), initialfile='new.gjf', defaultextension='.gjf', filetypes=(('Gaussian files', '.gjf'), ('Text files', '.txt'))) if out_file!='': self.parent.fio.output_gaussian_file(out_file)
def save_game(self): file_name = filedialog.asksaveasfilename(defaultextension=".txt", initialdir="/", title="Select file", filetypes=(("Text file", "*.txt"), ("All Files", "*.*"))) if file_name is not None: self.world.save_game(file_name)
def save_to_file(): global dic_grids fout = filedialog.asksaveasfilename() with open(fout, 'wb') as f: pickle.dump(dic_grids, f, 3)