def do_avg(infile, inpath, variable, nodata, outfile): # for netcdf3: set flags to 0 cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(3) # note that this version will erase data whereever a nodata is found in the series avg=None nodatamask = None for ifile in infile: fname = os.path.join(inpath, ifile) if not os.path.exists(fname): messageOnExit('file {0} not found on path {1}. Exit(100).'.format(ifile, path), 100) thisfile = cdms2.open(fname, 'r') if avg is None: avg = numpy.array(thisfile[variable][:]) nodatamask = avg >= nodata else: avg = avg + numpy.array(thisfile[variable][:]) thisfile.close() avg = avg/len(infile) if nodatamask.any(): avg[nodatamask] = nodata if os.path.exists(outfile): os.remove(outfile) outfh = cdms2.open(outfile, 'w') outvar=cdms2.createVariable(avg, typecode='f', id=variable, fill_value=nodata ) outfh.write(outvar) outfh.close()
def save_ncfiles(set_num, test, ref, diff, parameter): """Saves the test, reference, and difference nc files.""" # Save files being plotted # Set cdms preferences - no compression, no shuffling, no complaining cdms2.setNetcdfDeflateFlag(1) # 1-9, min to max - Comes at heavy IO (read/write time cost) cdms2.setNetcdfDeflateLevelFlag(0) cdms2.setNetcdfShuffleFlag(0) cdms2.setCompressionWarnings(0) # Turn off warning messages # Save test file pth = get_output_dir(set_num, parameter) file_test = cdms2.open(pth + '/' + parameter.output_file + '_test.nc', 'w+') test.id = parameter.var_id file_test.write(test) file_test.close() # Save reference file file_ref = cdms2.open(pth + '/' + parameter.output_file + '_ref.nc', 'w+') ref.id = parameter.var_id file_ref.write(ref) file_ref.close() # Save difference file file_diff = cdms2.open(pth + '/' + parameter.output_file + '_diff.nc', 'w+') diff.id = parameter.var_id + '(test - reference)' file_diff.write(diff) file_diff.close()
def save_ncfiles(set_num, test, ref, diff, parameter): """ Saves the test, reference, and difference data being plotted as nc files. """ if parameter.save_netcdf: # Save files being plotted # Set cdms preferences - no compression, no shuffling, no complaining cdms2.setNetcdfDeflateFlag(1) # 1-9, min to max - Comes at heavy IO (read/write time cost) cdms2.setNetcdfDeflateLevelFlag(0) cdms2.setNetcdfShuffleFlag(0) cdms2.setCompressionWarnings(0) # Turn off warning messages pth = get_output_dir(set_num, parameter) # Save test file test.id = parameter.var_id test_pth = os.path.join(pth, parameter.output_file + '_test.nc') with cdms2.open(test_pth, 'w+') as file_test: file_test.write(test) # Save reference file ref.id = parameter.var_id ref_pth = os.path.join(pth, parameter.output_file + '_ref.nc') with cdms2.open(ref_pth, 'w+') as file_ref: file_ref.write(ref) # Save difference file diff.id = parameter.var_id + '(test - reference)' diff_pth = os.path.join(pth, parameter.output_file + '_diff.nc') with cdms2.open(diff_pth, 'w+') as file_diff: file_diff.write(diff)
def testInFileUnlimitedDimAlter(self): fnm = os.path.join(cdat_info.get_sampledata_path(), "clt.nc") f = cdms2.open(fnm) s = f("clt") f.close() cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdf4Flag(1) cdms2.setNetcdfClassicFlag(1) f = cdms2.open("nc4.nc", "w") f.write(s) f.close() timesValues = s.getTime()[:] f = cdms2.open("nc4.nc", "r+") t = f["time"] t[:] = t[:] * 100. f.close() f = cdms2.open("nc4.nc") s = f("clt") t = s.getTime() self.assertEqual(len(t), len(timesValues)) self.assertTrue(numpy.allclose(t[:], timesValues * 100.)) os.remove("nc4.nc")
def do_transform(infile, outfile, template): # for netcdf3: cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) with open(infile, mode='rb') as file: fileContent = file.read() (referenceGrid, latAxis, lonAxis, latBounds, lonBounds)=makeGrid() if os.path.exists(outfile):os.remove(outfile) fout = cdms2.open(outfile, "w") #thisData = struct.unpack(template['read_type'] * ((template['read_nl'] * template['read_ns']) // template['read_type_size']) , fileContent[template['skip_byte']:template['skip_byte']+(template['read_nl']*template['read_ns'])*template['read_type_size']] ) skip=4*8 thisData = numpy.array(struct.unpack('>64800f', fileContent[skip:skip + (180*360)*4])) thisVar = cdms2.createVariable(thisData.reshape( (template['read_ns'], template['read_nl']) ), typecode=template['read_type'], id=template['id'], \ fill_value=template['nodata'], grid=referenceGrid, copaxes=1 ) fout.write(thisVar) # thisData2 = numpy.array(struct.unpack('64800B', fileContent[skip + (180*360)*4 : skip + (180*360)*4 + 180*360])) # thisVar2 = cdms2.createVariable(thisData2.reshape( (template['read_ns'], template['read_nl']) ), typecode='B', id='ice', \ # fill_value=0, grid=referenceGrid, copaxes=1 ) # fout.write(thisVar2) fout.close()
def execute(self): import cdms2, vcs cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) start_time = time.time() dataIn=self.loadData()[0] location = self.loadDomain() cdms2keyargs = self.domain2cdms(location) url = dataIn["url"] id = dataIn["id"] var_cache_id = ":".join( [url,id] ) dataset = self.loadFileFromURL( url ) logging.debug( " $$$ Data Request: '%s', '%s' ", var_cache_id, str( cdms2keyargs ) ) variable = dataset[ id ] read_start_time = time.time() result_variable = variable(**cdms2keyargs) result_data = result_variable.squeeze()[...] time_axis = result_variable.getTime() read_end_time = time.time() x = vcs.init() bf = x.createboxfill('new') x.plot( result_data, bf, 'default', variable=result_variable, bg=1 ) x.gif( OutputPath + '/plot.gif' ) result_obj = {} result_obj['url'] = OutputDir + '/plot.gif' result_json = json.dumps( result_obj ) self.result.setValue( result_json ) final_end_time = time.time() logging.debug( " $$$ Execution time: %f (with init: %f) sec", (final_end_time-start_time), (final_end_time-self.init_time) )
def save_transient_variables_to_netcdf(set_num, variables_dict, label, parameter): """ Save the transient variables to nc file. """ if parameter.save_netcdf: for (variable_name, variable) in variables_dict.items(): # Set cdms preferences - no compression, no shuffling, no complaining cdms2.setNetcdfDeflateFlag(1) # 1-9, min to max - Comes at heavy IO (read/write time cost) cdms2.setNetcdfDeflateLevelFlag(0) cdms2.setNetcdfShuffleFlag(0) cdms2.setCompressionWarnings(0) # Turn off warning messages path = get_output_dir(set_num, parameter) # Save variable try: variable.id = parameter.var_id except AttributeError: print("Could not save variable.id for {}".format(variable_name)) file_name = "{}_{}_{}.nc".format( parameter.output_file, variable_name, label ) test_pth = os.path.join(path, file_name) with cdms2.open(test_pth, "w+") as file_test: try: file_test.write(variable) except AttributeError: print("Could not write variable {}".format(variable_name))
def execute(self, test_str, imagefilename, imagethreshold, ncfiles, rtol, atol): print test_str if imagethreshold is None: # user didn't specify a value imagethreshold = regression.defaultThreshold # Silence annoying messages about how to set the NetCDF file type. Anything will do. cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) # nonstandard, suitable for testing: proc = subprocess.Popen([self.diagstr], shell=True) proc_status = proc.wait() if proc_status != 0: raise DiagError("diags run failed") if self.keep: print "save ", imagefilename, ncfiles.keys() print "output directory is = ", self.outpath else: # Test of graphics (png) file match: # This just looks at combined plot, aka summary plot, which is a compound of three plots. imagefname = os.path.join(self.outpath, imagefilename) imagebaselinefname = os.path.join(self.baselinepath, imagefilename) #pdb.set_trace() print "OK THRESHOLD IS:", imagethreshold graphics_result = regression.check_result_image( imagefname, imagebaselinefname, imagethreshold) print "Graphics file", imagefname, "match difference:", graphics_result #initialize to successful graphics check GR_CLOSE = (graphics_result == 0) assert (GR_CLOSE), 'graphic images are not close' # Test of NetCDF data (nc) file match: NC_CLOSE = True for ncfilename, ncvars in ncfiles.items(): for var in ncvars: #print ncfilename, var try: #print ">>>>>>>>>>>>>", var, ncfilename close = self.closeness(var, ncfilename, rtol, atol) if not close: print var, ' in ', os.path.join( self.outpath, ncfilename ), ' is not close from the one in:', os.path.join( self.baselinepath, ncfilename) except: print 'NetCDF comparison failed for ', var, ' in file: ', os.path.join( self.outpath, ncfilename), "vs", os.path.join( self.baselinepath, ncfilename) close = False NC_CLOSE = NC_CLOSE and close assert (NC_CLOSE), 'NetCDF files are not close' #cleanup the temp files if GR_CLOSE and NC_CLOSE: shutil.rmtree(self.outpath)
def testJustDeflate6(self): a = cdms2.MV2.zeros((1000, 2100), 'd') cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(6) f = self.getTempFile("justdeflate6.nc", 'w') f.write(a)
def testZeroAllSettings(self): a = cdms2.MV2.zeros((1000, 2100), 'd') cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) f = self.getTempFile("nothing.nc", 'w') f.write(a)
def execute(self, test_str, imagefilename, imagethreshold, ncfiles, rtol, atol): print test_str if imagethreshold is None: # user didn't specify a value imagethreshold = regression.defaultThreshold # Silence annoying messages about how to set the NetCDF file type. Anything will do. cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) # nonstandard, suitable for testing: proc = subprocess.Popen([self.diagstr], shell=True) proc_status = proc.wait() if proc_status != 0: raise DiagError("diags run failed") if self.keep: print "save ", imagefilename, ncfiles.keys() print "output directory is = ", self.outpath else: # Test of graphics (png) file match: # This just looks at combined plot, aka summary plot, which is a compound of three plots. imagefname = os.path.join(self.outpath, imagefilename) imagebaselinefname = os.path.join(self.baselinepath, imagefilename) # pdb.set_trace() print "OK THRESHOLD IS:", imagethreshold graphics_result = regression.check_result_image(imagefname, imagebaselinefname, imagethreshold) print "Graphics file", imagefname, "match difference:", graphics_result # initialize to successful graphics check GR_CLOSE = graphics_result == 0 assert GR_CLOSE, "graphic images are not close" # Test of NetCDF data (nc) file match: NC_CLOSE = True for ncfilename, ncvars in ncfiles.items(): for var in ncvars: # print ncfilename, var try: # print ">>>>>>>>>>>>>", var, ncfilename close = self.closeness(var, ncfilename, rtol, atol) if not close: print var, " in ", os.path.join( self.outpath, ncfilename ), " is not close from the one in:", os.path.join(self.baselinepath, ncfilename) except: print "NetCDF comparison failed for ", var, " in file: ", os.path.join( self.outpath, ncfilename ), "vs", os.path.join(self.baselinepath, ncfilename) close = False NC_CLOSE = NC_CLOSE and close assert NC_CLOSE, "NetCDF files are not close" # cleanup the temp files if GR_CLOSE and NC_CLOSE: shutil.rmtree(self.outpath)
def testShuffleDeflateFlags(self): cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(4) self.assertEqual(cdms2.getNetcdfShuffleFlag(), 1) self.assertEqual(cdms2.getNetcdfDeflateFlag(), 1) self.assertEqual(cdms2.getNetcdfDeflateLevelFlag(), 4) cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) self.assertEqual(cdms2.getNetcdfShuffleFlag(), 0) self.assertEqual(cdms2.getNetcdfDeflateFlag(), 0)
def compute_and_write_climatologies_keepvars( varkeys, reduced_variables, season, case='', variant='', path='' ): """Computes climatologies and writes them to a file. Inputs: varkeys, names of variables whose climatologies are to be computed reduced_variables, dict (key:rv) where key is a variable name and rv an instance of the class reduced_variable season: the season on which the climatologies will be computed variant: a string to be inserted in the filename""" # Compute the value of every variable we need. varvals = {} # First compute all the reduced variables # Probably this loop consumes most of the running time. It's what has to read in all the data. for key in varkeys: if key in reduced_variables: varvals[key] = reduced_variables[key].reduce() for key in varkeys: if key in reduced_variables: var = reduced_variables[key] if varvals[key] is not None: if 'case' in var._file_attributes.keys(): case = var._file_attributes['case']+'_' break logger.info("writing climatology file for %s %s %s ",case,variant,season) if variant!='': variant = variant+'_' logger.info('case: %s',case) logger.info('variant: %s', variant) logger.info('season: %s', season) filename = case + variant + season + "_climo.nc" # ...actually we want to write this to a full directory structure like # root/institute/model/realm/run_name/season/ value=0 cdms2.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(value) ## where value is a integer between 0 and 9 included g = cdms2.open( os.path.join(path,filename), 'w' ) # later, choose a better name and a path! store_provenance(g) for key in varkeys: if key in reduced_variables: var = reduced_variables[key] if varvals[key] is not None: varvals[key].id = var.variableid varvals[key].reduced_variable=varvals[key].id if hasattr(var,'units'): varvals[key].units = var.units+'*'+var.units g.write(varvals[key]) for attr,val in var._file_attributes.items(): if not hasattr( g, attr ): setattr( g, attr, val ) g.season = season g.close() return varvals,case
def quickSave(data, name, path): # for netcdf3: set flags to 0 cdms2.setNetcdfShuffleFlag(0) #1 cdms2.setNetcdfDeflateFlag(0) #1 cdms2.setNetcdfDeflateLevelFlag(0) #3 outname=os.path.join(path, name) if os.path.exists(outname): os.remove(outname) fh = cdms2.open(outname, 'w') variable = cdms2.createVariable(data, id='data') fh.write(variable) fh.close()
def setUp(self): """ Move to a temporary directory before executing the test module. """ self._tmpdir = tempfile.mkdtemp('.tmp', 'test_cdms') os.chdir(self._tmpdir) # Enter NetCDF4 mode for these tests #!TODO: magically deactivate test if compiled with NetCDF3 cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(0)
def saveData(outfilename, data, typecode, id, fill_value, grid, copyaxes, attribute1, attribute2, latAxis, lonAxis): # for netcdf3: set flags to 0 cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(3) if os.path.exists(outfilename): os.remove(outfilename) outfile = cdms2.open( outfilename, 'w') var = cdms2.createVariable(data, typecode=typecode, id=id, fill_value=fill_value, grid=grid, copyaxes=copyaxes, attributes=dict(long_name=attribute1, units=attribute2) ) var.setAxisList((latAxis, lonAxis)) outfile.write(var) outfile.close()
def initCustomize(self, customPath, styles): if customPath is None: customPath = os.path.join(os.environ["HOME"], ".uvcdat", "customizeUVCDAT.py") if os.path.exists(customPath): execfile(customPath, customizeUVCDAT.__dict__, customizeUVCDAT.__dict__) if styles is None: styles = customizeUVCDAT.appStyles icon = QtGui.QIcon(customizeUVCDAT.appIcon) self.setWindowIcon(icon) ## cdms2 setup section cdms2.axis.time_aliases += customizeUVCDAT.timeAliases cdms2.axis.level_aliases += customizeUVCDAT.levelAliases cdms2.axis.latitude_aliases += customizeUVCDAT.latitudeAliases cdms2.axis.longitude_aliases += customizeUVCDAT.longitudeAliases cdms2.setNetcdfShuffleFlag(customizeUVCDAT.ncShuffle) cdms2.setNetcdfDeflateFlag(customizeUVCDAT.ncDeflate) cdms2.setNetcdfDeflateLevelFlag(customizeUVCDAT.ncDeflateLevel) ## StylesSheet st = "" if isinstance(styles, str): st = styles elif isinstance(styles, dict): for k in styles.keys(): val = styles[k] if isinstance(val, QtGui.QColor): val = str(val.name()) st += "%s:%s; " % (k, val) if len(st) > 0: self.setStyleSheet(st) ########################################################### ########################################################### ## Prettyness ########################################################### ########################################################### #self.setGeometry(0,0, 1100,800) self.setWindowTitle( 'The Ultrascale Visualization Climate Data Analysis Tools - (UV-CDAT)' ) ## self.resize(1100,800) #self.setMinimumWidth(1100) self.main_window_placement()
def initCustomize(self, customPath, styles): if customPath is None: customPath = os.path.join(os.environ["HOME"], ".uvcdat", "customizeUVCDAT.py") if os.path.exists(customPath): execfile(customPath, customizeUVCDAT.__dict__, customizeUVCDAT.__dict__) if styles is None: styles = customizeUVCDAT.appStyles icon = QtGui.QIcon(customizeUVCDAT.appIcon) self.setWindowIcon(icon) ## cdms2 setup section cdms2.axis.time_aliases += customizeUVCDAT.timeAliases cdms2.axis.level_aliases += customizeUVCDAT.levelAliases cdms2.axis.latitude_aliases += customizeUVCDAT.latitudeAliases cdms2.axis.longitude_aliases += customizeUVCDAT.longitudeAliases cdms2.setNetcdfShuffleFlag(customizeUVCDAT.ncShuffle) cdms2.setNetcdfDeflateFlag(customizeUVCDAT.ncDeflate) cdms2.setNetcdfDeflateLevelFlag(customizeUVCDAT.ncDeflateLevel) ## StylesSheet st = "" if isinstance(styles, str): st = styles elif isinstance(styles, dict): for k in styles.keys(): val = styles[k] if isinstance(val, QtGui.QColor): val = str(val.name()) st += "%s:%s; " % (k, val) if len(st) > 0: self.setStyleSheet(st) ########################################################### ########################################################### ## Prettyness ########################################################### ########################################################### # self.setGeometry(0,0, 1100,800) self.setWindowTitle("The Ultrascale Visualization Climate Data Analysis Tools - (UV-CDAT)") ## self.resize(1100,800) # self.setMinimumWidth(1100) self.main_window_placement()
def execute(self, test_str, imagefilename, imagethreshold, ncfiles, rtol, atol): print test_str # Silence annoying messages about how to set the NetCDF file type. Anything will do. cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) # nonstandard, suitable for testing: proc = subprocess.Popen([self.diagstr], shell=True) proc_status = proc.wait() if proc_status != 0: raise DiagError("diags run failed") if self.keep: print "save ", imagefilename, ncfiles.keys() print "output directory is = ", self.outpath else: # Test of graphics (png) file match: # This just looks at combined plot, aka summary plot, which is a compound of three plots. imagefname = os.path.join(self.outpath, imagefilename) imagebaselinefname = os.path.join(self.baselinepath, imagefilename) graphics_result = checkimage.check_result_image( imagefname, imagebaselinefname, imagethreshold) print "Graphics file", imagefname, "match difference:", graphics_result # Test of NetCDF data (nc) file match: CLOSE = True for ncfilename, ncvars in ncfiles.items(): for var in ncvars: #print ncfilename, var try: close = self.closeness(var, ncfilename, rtol, atol) if not close: print var, ' in ', ncfilename, ' is not close.' except: print 'comparison failed for ', var, ' in file: ', ncfilename close = False CLOSE = CLOSE and close #cleanup the temp files shutil.rmtree(self.outpath) assert (CLOSE), 'data are not close'
def save_ncfiles(set_num, test, ref, diff, parameter): """ Saves the test, reference, and difference data being plotted as nc files. """ if parameter.save_netcdf: # Save files being plotted # Set cdms preferences - no compression, no shuffling, no complaining cdms2.setNetcdfDeflateFlag(1) # 1-9, min to max - Comes at heavy IO (read/write time cost) cdms2.setNetcdfDeflateLevelFlag(0) cdms2.setNetcdfShuffleFlag(0) cdms2.setCompressionWarnings(0) # Turn off warning messages pth = get_output_dir(set_num, parameter) # Save test file if test.id.startswith("variable_"): test.id = parameter.var_id test_pth = os.path.join(pth, parameter.output_file + "_test.nc") cdms_arg = "w" if Path(test_pth).is_file(): cdms_arg = "a" with cdms2.open(test_pth, cdms_arg) as file_test: file_test.write(test) # Save reference file if ref.id.startswith("variable_"): ref.id = parameter.var_id ref_pth = os.path.join(pth, parameter.output_file + "_ref.nc") with cdms2.open(ref_pth, cdms_arg) as file_ref: file_ref.write(ref) # Save difference file if diff is not None: if diff.id.startswith("variable_"): diff.id = parameter.var_id + "_diff" diff_pth = os.path.join(pth, parameter.output_file + "_diff.nc") with cdms2.open(diff_pth, cdms_arg) as file_diff: file_diff.write(diff)
def nc(self): if self.netCDF3.isChecked(): cdms2.useNetcdf3() self.ncShuffle.setEnabled(False) self.ncDeflate.setEnabled(False) self.ncDeflateLevel.setEnabled(False) else: self.ncShuffle.setEnabled(True) self.ncDeflate.setEnabled(True) self.ncDeflateLevel.setEnabled(True) if self.ncShuffle.isChecked(): cdms2.setNetcdfShuffleFlag(1) else: cdms2.setNetcdfShuffleFlag(0) if self.ncDeflate.isChecked(): cdms2.setNetcdfDeflateFlag(1) else: cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(self.ncDeflateLevel.value())
def nc(self): if self.netCDF3.isChecked(): cdms2.useNetcdf3() self.ncShuffle.setEnabled(False) self.ncDeflate.setEnabled(False) self.ncDeflateLevel.setEnabled(False) else: self.ncShuffle.setEnabled(True) self.ncDeflate.setEnabled(True) self.ncDeflateLevel.setEnabled(True) if self.ncShuffle.isChecked(): cdms2.setNetcdfShuffleFlag(1) else: cdms2.setNetcdfShuffleFlag(0) if self.ncDeflate.isChecked(): cdms2.setNetcdfDeflateFlag(1) else: cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(self.ncDeflateLevel.value())
def execute(self, test_str, imagefilename, imagethreshold, ncfiles, rtol, atol): print test_str # Silence annoying messages about how to set the NetCDF file type. Anything will do. cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) # nonstandard, suitable for testing: proc = subprocess.Popen([self.diagstr], shell=True) proc_status = proc.wait() if proc_status!=0: raise DiagError("diags run failed") if self.keep: print "save ", imagefilename, ncfiles.keys() print "output directory is = ", self.outpath else: # Test of graphics (png) file match: # This just looks at combined plot, aka summary plot, which is a compound of three plots. imagefname = os.path.join( self.outpath, imagefilename ) imagebaselinefname = os.path.join( self.baselinepath, imagefilename ) graphics_result = checkimage.check_result_image( imagefname, imagebaselinefname, imagethreshold ) print "Graphics file", imagefname, "match difference:", graphics_result # Test of NetCDF data (nc) file match: CLOSE = True for ncfilename, ncvars in ncfiles.items(): for var in ncvars: #print ncfilename, var try: close = self.closeness( var, ncfilename, rtol, atol ) if not close: print var, ' in ', ncfilename, ' is not close.' except: print 'comparison failed for ', var, ' in file: ', ncfilename close = False CLOSE = CLOSE and close #cleanup the temp files shutil.rmtree(self.outpath) assert(CLOSE), 'data are not close'
def do_regrid(infileName, variable, outfileName, netcdfType=4): nodata = 1.e20 if netcdfType==4: cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(3) elif netcdfType==3: cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevel(0) else: exitWM('Unknown netcdf type {0}. Exit 2.'.format(netcdfType),2) infile = cdms2.open(infileName) unitsVar = infile[variable].units (referenceGrid, latAxis, lonAxis, latBounds, lonBounds, lvl_bounds, lvl) = makeGrid() regridded = infile[variable][:].regrid(referenceGrid) outvar = cdms2.createVariable(regridded, typecode='f', id=variable, fill_value=nodata, grid=referenceGrid, copyaxes=1, attributes=dict(long_name='regridded {0}'.format(variable), units=unitsVar)) #final = do_hyperInterp(regridded, infile[variable].getLevel()[:], lvl, nodata) #outvar = cdms2.createVariable(final, typecode='f', id=variable, fill_value=nodata, attributes=dict(long_name='regridded {0}'.format(variable), units=unitsVar) ) #gridBis = regridded.subSlice(longitude=0).crossSectionRegrid(lvl, latAxis, method="linear") #zregrid = tmpvar.crossSectionRegrid(lvl) #outvar.setAxisList((latAxis, lonAxis)) if os.path.exists(outfileName): os.remove(outfileName) outfile=cdms2.open(outfileName, 'w') outfile.write(outvar) outfile.history='Created with '+__file__.encode('utf8') outfile.close() infile.close()
def doRegrid(infile, varname, outfile, lon, lat, lon_bnds, lat_bnds): cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(2) fh = cdms2.open(infile) if fh is None: exitMessage("Could not open file {0}. Exit 2.".format(infile), 2) if varname not in fh.variables.keys(): exitMessage('variable named '+varname+' could not be found. Exit 4.', 4) yVar = fh(varname) latAxis = cdms2.createAxis(lat, lat_bnds) latAxis.designateLatitude(True) latAxis.units = 'degree_north' latAxis.long_name = 'Latitude' lonAxis = cdms2.createAxis(lon, lon_bnds) lonAxis.designateLongitude(True, 360.0) lonAxis.units = 'degree_east' lonAxis.long_name='Longitude' listAxisOrg = yVar.getAxisList() timeAxis = listAxisOrg[0] grid = cdms2.createGenericGrid(latAxis, lonAxis, lat_bnds, lon_bnds) regridded = yVar.regrid(grid) g=cdms2.open(outfile, 'w') #g.write(regridded, None, None, None, varname, None, 1.e20, None, cdms2.CdFloat) temp1 = cdms2.createVariable(regridded, typecode='f', id=varname, fill_value=1.e20, axes=[timeAxis, latAxis, lonAxis], copyaxes=0, attributes=dict(long_name=yVar.long_name, units=yVar.units) ) g.write(temp1) g.close()
def setup_cdms2(self): cdms2.setNetcdfShuffleFlag(0) # Argument is either 0 or 1 cdms2.setNetcdfDeflateFlag(0) # Argument is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(0) # Argument is int between 0 and 9
import cdms2 ###################################### value = 0 cdms2.setNetcdfShuffleFlag(value) cdms2.setNetcdfDeflateFlag(value) cdms2.setNetcdfDeflateLevelFlag(value) ###################################### ### EXECUTE MODULE WITH VARIOUS FUNCTIONS execfile('modules_and_functions/misc_module.py') execfile('modules_and_functions/getOurModelData.py') ### OPTIONS FOR REGRIDDING: METHOD AND TARGET GRID exp = 'cmip5' rgridMeth = 'regrid2' targetGrid = '4x5' targetGrid = '2.5x2.5' ### OUTPUT DIRECTORY outdir = '/work/metricspackage/130522/data/inhouse_model_clims/samplerun/atm/mo/ac/' ## SEE END OF THIS CODE FOR OUTPUT FILENAMES ### VARIABLES TO LOOP OVER (NAMES ASSUMED TO BE CONSISTENT WITH CMIP5) vars = ['rlut', 'pr'] ###################################### ############# GET OBS TARGET GRID obsg = get_target_grid(targetGrid) #############
def monthlyAvg(variable, indir, outdir, minYear=2006, maxYear=2059): nodata=1.e20 minVar=273.15 - 40 maxVar=273.15 + 100 unitsAvg=None # assume data are aligned pattern=re.compile('.*_BNU-ESM_.*') # problem on this grid (use shiftGrid to create a new version, discard this one). # maskpattern = re.compile('.*EC-EARTH.*') # nodate was set to 273.15 # for netcdf3: set flags to 0 cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(3) print minYear, maxYear dateList=[] for iyear in range(minYear, maxYear+1): for imonth in range(1,13): dateList.append('{0}{1:02}'.format(iyear,imonth)) for idate in dateList: print 'processing date ',idate # get list of files for this iyear, excluding one file: lstFiles = [f for f in glob.glob(indir+'/{0}_*{2}*_{1}.nc'.format(variable, idate,select)) if not pattern.match(f) ] print indir+'/{0}_*{2}*_{1}.nc'.format(variable, idate,select) if len(lstFiles) > 1: print 'Model ensemble mean for date {0} with {1} files'.format(idate, len(lstFiles)) # accumulate data accumVar=None accumN=None for iFile in lstFiles: print 'processing file ', iFile thisFile = cdms2.open(iFile) dimVar = numpy.squeeze(thisFile[variable][:]).shape # remove time-single dimension if exists thisVar = numpy.ravel(thisFile[variable][:]) if accumVar is None: accumVar = numpy.zeros( dimVar[0]*dimVar[1] ) + nodata accumN = numpy.zeros( dimVar[0]*dimVar[1] ) unitsAvg = thisFile[variable].units oneMatrix = numpy.ones(dimVar[0]*dimVar[1]) maxEnsemble = thisVar.copy() minEnsemble = thisVar.copy() # add to accumVar if accumVar is not no-data, and incoming data are in the range wtadd = (thisVar >= minVar ) * (thisVar <= maxVar) * (accumVar < nodata) # if the value in accumVar is no-data, replace it. wtreplace = (thisVar >= minVar ) * (thisVar <= maxVar) * ( accumVar >= nodata) # min, max wmax = (thisVar >= maxEnsemble) * (thisVar < nodata) * (thisVar >= minVar) * (thisVar <= maxVar) wmaxReplace = (maxEnsemble >= nodata) * (thisVar < nodata) * (thisVar >= minVar) wmin = (thisVar <= minEnsemble) * (thisVar >= minVar) * (thisVar <= maxVar) * (maxEnsemble < nodata) wminReplace = (minEnsemble >= nodata) * (thisVar < nodata) * (thisVar >= minVar) if wtadd.any(): accumVar[wtadd] = accumVar[wtadd] + thisVar[wtadd] accumN[wtadd] = accumN[wtadd] + oneMatrix[wtadd] if wtreplace.any(): accumVar[wtreplace] = thisVar[wtreplace] accumN[wtreplace] = oneMatrix[wtreplace] if wmax.any(): maxEnsemble[wmax] = thisVar[wmax] if wmin.any(): minEnsemble[wmin] = thisVar[wmin] if wmaxReplace.any(): maxEnsemble[wmaxReplace] = thisVar[wmaxReplace] if wminReplace.any(): minEnsemble[wminReplace] = thisVar[wminReplace] thisFile.close() # now compute the average, where accumN is not 0 wnz = accumN > 0 average = numpy.zeros(dimVar[0] * dimVar[1]) + nodata if wnz.any(): average[wnz] = accumVar[wnz] / accumN[wnz] # and let's compute the std std = numpy.zeros(dimVar[0] * dimVar[1]) + nodata stdN = numpy.zeros(dimVar[0] * dimVar[1]) for iFile in lstFiles: thisFile = cdms2.open(iFile) thisVar = numpy.ravel(thisFile[variable][:]) wtadd = (thisVar < nodata ) * (average < nodata ) * (thisVar >= minVar) * (thisVar <= maxVar) # average should be clean, no need to implement a 'replace' if wtadd.any(): std[wtadd] = (average[wtadd] - thisVar[wtadd]) * (average[wtadd] - thisVar[wtadd]) stdN[wtadd] = stdN[wtadd] + 1.0 thisFile.close() wtstd = (stdN > 0) * (std < nodata) std[wtstd] = numpy.sqrt( std[wtstd]/stdN[wtstd] ) # save to disk outfilename='{0}/modelmean_{1}_{2}.nc'.format(outdir, variable, idate) (referenceGrid, latAxis, lonAxis, latBounds, lonBounds) = makeGrid() avgOut = cdms2.createVariable(numpy.reshape(average,dimVar), typecode='f', id=variable, fill_value=1.e20, grid=referenceGrid, copyaxes=1, attributes=dict(long_name='model average for {0} at date {1}'.format(variable, idate), units=unitsAvg)) avgOut.setAxisList((latAxis, lonAxis)) accumOut = cdms2.createVariable(numpy.reshape(accumN,dimVar), typecode='i', id='count_{0}'.format(variable), fill_value=1.e20, grid=referenceGrid, copyaxes=1, attributes=dict(long_name='count of valid for {0} at date {1}'.format(variable, idate), units=None)) accumOut.setAxisList((latAxis, lonAxis)) maxEns = cdms2.createVariable(numpy.reshape(maxEnsemble,dimVar), typecode='f', id='max {0}'.format(variable), fill_value=1.e20, grid=referenceGrid, copyaxes=1, attributes=dict(long_name='max ensemble for {0} at date {1}'.format(variable, idate), units=unitsAvg)) maxEns.setAxisList((latAxis, lonAxis)) minEns = cdms2.createVariable(numpy.reshape(minEnsemble,dimVar), typecode='f', id='min {0}'.format(variable), fill_value=1.e20, grid=referenceGrid, copyaxes=1, attributes=dict(long_name='min ensemble for {0} at date {1}'.format(variable, idate), units=unitsAvg)) minEns.setAxisList((latAxis, lonAxis)) stdVar = cdms2.createVariable(numpy.reshape(std,dimVar), typecode='f', id='std_{0}'.format(variable), fill_value=1.e20, grid=referenceGrid, copyaxes=1, attributes=dict(long_name='model std for {0} at date {1}'.format(variable, idate), units=unitsAvg)) stdVar.setAxisList((latAxis, lonAxis)) if os.path.exists(outfilename): os.remove(outfilename) print 'saving to file ', outfilename outfile = cdms2.open(outfilename, 'w') outfile.write(avgOut) outfile.write(accumOut) outfile.write(minEns) outfile.write(maxEns) outfile.write(stdVar) outfile.history='Created with '+__file__.encode('utf8') outfile.close()
def surfTransf(fileFx, fileTos, fileSos, fileHef, fileWfo, varNames, outFile, debug=True, timeint='all',noInterp=False, domain='global'): ''' The surfTransf() function takes files and variable arguments and creates density bined surface transformation fields which are written to a specified outfile Author: Eric Guilyardi : [email protected] Co-author: Paul J. Durack : [email protected] : @durack1. Created on Wed Oct 8 09:15:59 CEST 2014 Inputs: ------ - fileTos(time,lat,lon) - 3D SST array - fileSos(time,lat,lon) - 3D SSS array - fileHef(time,lat,lon) - 3D net surface heat flux array - fileWfo(time,lat,lon) - 3D fresh water flux array - fileFx(lat,lon) - 2D array containing the cell area values - varNames[4] - 1D array containing the names of the variables - outFile(str) - output file with full path specified. - debug <optional> - boolean value - timeint <optional> - specify temporal step for binning <init_idx>,<ncount> - noInterp <optional> - if true no interpolation to target grid - domain <optional> - specify domain for averaging when interpolated to WOA grid ('global','north', 'north40', 'south' for now) Outputs: -------- - netCDF file with monthly surface rhon, density fluxes, transformation (global and per basin) - use cdo yearmean to compute annual mean Usage: ------ '>>> from binDensity import surfTransf '>>> surfTransf(file_fx, file_tos, file_sos, file_hef, file_wfo, [var1,var2,var3,var4]./output.nc, debug=True,timeint='all') Notes: ----- - EG 8 Oct 2014 - Initial function write and tests ok - PJD 22 Nov 2014 - Code cleanup - EG 4 Oct 2017 - code on ciclad, more cleanup and options - EG 12 Sep 2018 - Add North vs. South calculation ''' # Keep track of time (CPU and elapsed) cpu0 = timc.clock() # # netCDF compression (use 0 for netCDF3) comp = 1 cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # # == Inits # npy.set_printoptions(precision = 2) # Determine file name from inputs modeln = fileTos.split('/')[-1].split('.')[1] # if debug: print ' Debug - File names:' print ' ', fileTos print ' ', fileSos debugp = True else: debugp = False # # Open files ftos = cdm.open(fileTos) fsos = cdm.open(fileSos) fhef = cdm.open(fileHef) fwfo = cdm.open(fileWfo) #timeax = ftos.getAxis('time') timeax = ftos.getAxis('time_counter') #print 'timeax' #print timeax # # Dates to read if timeint == 'all': tmin = 0 tmax = timeax.shape[0] timeaxis = timeax else: tmin = int(timeint.split(',')[0]) - 1 tmax = tmin + int(timeint.split(',')[1]) # update time axis timeaxis = cdm.createAxis(timeax[tmin:tmax]) timeaxis.id = 'time' timeaxis.units = timeax.units timeaxis.designateTime() #print timeaxis if debugp: print; print ' Debug mode' # Read file attributes to carry on to output files list_file = ftos.attributes.keys() file_dic = {} for i in range(0,len(list_file)): file_dic[i]=list_file[i],ftos.attributes[list_file[i] ] # # Read data # varnames tos_name = varNames[0] sos_name = varNames[1] hef_name = varNames[2] wfo_name = varNames[3] if debugp: print' Read ',tos_name, sos_name,tmin,tmax tos = ftos(tos_name , time = slice(tmin,tmax)) sos = fsos(sos_name , time = slice(tmin,tmax)) if debugp: print' Read ',hef_name, wfo_name qnet = fhef(hef_name, time = slice(tmin,tmax)) try: emp = fwfo(wfo_name , time = slice(tmin,tmax)) empsw = 0 except Exception,err: emp = fwfo('wfos' , time = slice(tmin,tmax)) print ' Reading concentration dillution fresh water flux' empsw = 0
import os, sys #import socket import argparse import string import numpy as npy import numpy.ma as ma import cdutil as cdu from genutil import statistics import support_density as sd import time as timc import timeit #import matplotlib.pyplot as plt # # netCDF compression (use 0 for netCDF3) comp = 0 cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # # == Arguments # # # == Inits # home = os.getcwd() outdir = os.getcwd() hist_file_dir=home # # == Arguments #
from pywps.Process import WPSProcess import os,numpy,sys import logging, json import cdms2 import random from pywps import config import ConfigParser # Path where output will be stored/cached cdms2.setNetcdfShuffleFlag(0) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(0) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(0) ## where value is a integer between 0 and 9 included wps_config = ConfigParser.ConfigParser() wps_config.read(os.path.join(os.path.dirname(__file__),"..","wps.cfg")) try: DAP_DATA = wps_config.get("dapserver","dap_data") except: warnings.warn("Could not READ DAP_DATA from wps.cfg will store files in /tmp") DAP_DATA = "/tmp" try: DAP_INI = wps_config.get("dapserver","dap_ini") except: DAP_INI = None try: DAP_HOST = wps_config.get("dapserver","dap_host") except: DAP_HOST = None try: DAP_PORT = wps_config.get("dapserver","dap_port") except:
#!/usr/local/cdat5.2/bin/python """Module for computing temperature extreme stats mostly using CDO utilities""" from sys import exit from os import path, system, mkdir from cdms2 import setNetcdfShuffleFlag, setNetcdfDeflateLevelFlag, setNetcdfDeflateFlag from string import split from datetime import datetime from daily_stats_cdms_utils import MosaicFiles setNetcdfShuffleFlag(0) setNetcdfDeflateFlag(0) setNetcdfDeflateLevelFlag(0) # necesario para temperaturas promedio calculadas RootDir = '/mnt/BCSD' OUTROOT = '/mnt/out_stats' if not path.isdir(OUTROOT): mkdir(OUTROOT) OUTTEMP = '/home/edarague' if not path.isdir(OUTTEMP): mkdir(OUTTEMP) # added as fgobal institution attribute to output files txtinst = "Santa Clara U.,Climate Central,The Nature Conservancy" # input files are on 0->360 longitude convention. To switch to a -180->180 grid: # cdo sellonlatbox,-180,180,-90,90 ifile ofile # which works for global domains only.For smaller domains:
def processCmdLine(self): parser = argparse.ArgumentParser( description='UV-CDAT Climate Modeling Diagnostics', usage='%(prog)s --path1 [options]') parser.add_argument( '--path', '-p', action='append', nargs=1, help= "Path(s) to dataset(s). This is required. If two paths need different filters, set one here and one in path2." ) parser.add_argument('--path2', '-q', action='append', nargs=1, help="Path to a second dataset.") parser.add_argument('--obspath', action='append', nargs=1, help="Path to an observational dataset") parser.add_argument( '--cachepath', nargs=1, help="Path for temporary and cachced files. Defaults to /tmp") # parser.add_argument('--realm', '-r', nargs=1, choices=self.realm_types, # help="The realm type. Current valid options are 'land' and 'atmosphere'") parser.add_argument( '--filter', '-f', nargs=1, help= "A filespec filter. This will be applied to the dataset path(s) (--path option) to narrow down file choices." ) parser.add_argument( '--filter2', '-g', nargs=1, help= "A filespec filter. This will be applied to the second dataset path (--path2 option) to narrow down file choices." ) parser.add_argument( '--new_filter', '-F', action='append', nargs=1, help= "A filespec filter. This will be applied to the corresponding dataset path to narrow down file choices." ) parser.add_argument( '--packages', '--package', '-k', nargs='+', help= "The diagnostic packages to run against the dataset(s). Multiple packages can be specified." ) parser.add_argument( '--sets', '--set', '-s', nargs='+', help= "The sets within a diagnostic package to run. Multiple sets can be specified. If multiple packages were specified, the sets specified will be searched for in each package" ) parser.add_argument( '--vars', '--var', '-v', nargs='+', help= "Specify variables of interest to process. The default is all variables which can also be specified with the keyword ALL" ) parser.add_argument( '--list', '-l', nargs=1, choices=[ 'sets', 'vars', 'variables', 'packages', 'seasons', 'regions', 'translations', 'options' ], help= "Determine which packages, sets, regions, variables, and variable options are available" ) # maybe eventually add compression level too.... parser.add_argument( '--compress', nargs=1, choices=['no', 'yes'], help= "Turn off netCDF compression. This can be required for other utilities to be able to process the output files (e.g. parallel netCDF based tools" ) #no compression, add self state parser.add_argument( '--outputpre', nargs=1, help= "Specify an output filename prefix to be prepended to all file names created internally. For example --outputpre myout might generate myout-JAN.nc, etc" ) parser.add_argument( '--outputpost', nargs=1, help= "Specify an output filename postfix to be appended to all file names created internally. For example --outputpost _OBS might generate set1-JAN_OBS.nc, etc" ) parser.add_argument( '--outputdir', '-O', nargs=1, help="Directory in which output files will be written.") parser.add_argument( '--seasons', nargs='+', choices=all_seasons, help="Specify which seasons to generate climatoogies for") parser.add_argument( '--years', nargs='+', help="Specify which years to include when generating climatologies" ) parser.add_argument( '--months', nargs='+', choices=all_months, help="Specify which months to generate climatologies for") parser.add_argument( '--climatologies', '-c', nargs=1, choices=['no', 'yes'], help="Specifies whether or not climatologies should be generated") parser.add_argument( '--plots', '-t', nargs=1, choices=['no', 'yes'], help="Specifies whether or not plots should be generated") parser.add_argument('--plottype', nargs=1) parser.add_argument( '--precomputed', nargs=1, choices=['no', 'yes'], help= "Specifies whether standard climatologies are stored with the dataset (*-JAN.nc, *-FEB.nc, ... *-DJF.nc, *-year0.nc, etc" ) parser.add_argument( '--json', '-j', nargs=1, choices=['no', 'yes'], help= "Produce JSON output files as part of climatology/diags generation" ) # same parser.add_argument( '--netcdf', '-n', nargs=1, choices=['no', 'yes'], help= "Produce NetCDF output files as part of climatology/diags generation" ) # same parser.add_argument( '--xml', '-x', nargs=1, choices=['no', 'yes'], help= "Produce XML output files as part of climatology/diags generation") parser.add_argument( '--seasonally', action='store_true', help= "Produce climatologies for all of the defined seasons. To get a list of seasons, run --list seasons" ) parser.add_argument( '--monthly', action='store_true', help="Produce climatologies for all predefined months") parser.add_argument( '--yearly', action='store_true', help="Produce annual climatogolies for all years in the dataset") parser.add_argument( '--timestart', nargs=1, help= "Specify the starting time for the dataset, such as 'months since Jan 2000'" ) parser.add_argument('--timebounds', nargs=1, choices=['daily', 'monthly', 'yearly'], help="Specify the time boudns for the dataset") parser.add_argument( '--verbose', '-V', action='count', help= "Increase the verbosity level. Each -v option increases the verbosity more." ) # count parser.add_argument( '--name', action='append', nargs=1, help="Specify option names for the datasets for plot titles, etc" ) #optional name for the set # This will be the standard list of region names NCAR has parser.add_argument( '--regions', '--region', nargs='+', choices=all_regions.keys(), help= "Specify a geographical region of interest. Note: Multi-word regions need quoted, e.g. 'Central Canada'" ) parser.add_argument('--starttime', nargs=1, help="Specify a start time in the dataset") parser.add_argument('--endtime', nargs=1, help="Specify an end time in the dataset") parser.add_argument( '--translate', nargs='?', default='y', help= "Enable translation for obs sets to datasets. Optional provide a colon separated input to output list e.g. DSVAR1:OBSVAR1" ) parser.add_argument('--varopts', nargs='+', help="Variable auxillary options") args = parser.parse_args() if (args.list != None): if args.list[0] == 'translations': print "Default variable translations: " self.listTranslations() quit() if args.list[0] == 'regions': print "Available geographical regions: ", all_regions.keys() quit() if args.list[0] == 'seasons': print "Available seasons: ", all_seasons quit() if args.list[0] == 'packages': print "Listing available packages:" print self.all_packages.keys() quit() if args.list[0] == 'sets': if args.packages == None: print "Please specify package before requesting available diags sets" quit() for p in args.packages: print 'Avaialble sets for package ', p, ':' sets = self.listSets(p) keys = sets.keys() for k in keys: print 'Set', k, ' - ', sets[k] quit() if args.list[0] == 'variables' or args.list[0] == 'vars': if args.path != None: for i in args.path: self._opts['path'].append(i[0]) else: print 'Must provide a dataset when requesting a variable listing' quit() self.listVariables(args.packages, args.sets) quit() if args.list[0] == 'options': if args.path != None: for i in args.path: self._opts['path'].append(i[0]) else: print 'Must provide a dataset when requesting a variable listing' quit() self.listVarOptions(args.packages, args.sets, args.vars) quit() # Generally if we've gotten this far, it means no --list was specified. If we don't have # at least a path, we should exit. if (args.path != None): for i in args.path: self._opts['path'].append(i[0]) else: print 'Must specify a path or the --list option at a minimum.' print 'For help, type "diags --help".' quit() if (args.path2 != None): for i in args.path2: self._opts['path2'].append(i[0]) if (args.obspath != None): for i in args.obspath: self._opts['obspath'].append(i[0]) # TODO: Should some pre-defined filters be "nameable" here? if (args.filter != None): # Only supports one filter argument, see filter2. self._opts['filter'] = args.filter[0] self._opts['user_filter'] = True # for i in args.filter: # self._opts['filter'].append(i[0]) if (args.filter2 != None): # This is a second filter argument. self._opts['filter2'] = args.filter2[0] self._opts['user_filter'] = True if (args.new_filter != None): # like filter but with multiple arguments for i in args.new_filter: self._opts['new_filter'].append(i[0]) if (args.cachepath != None): self._opts['cachepath'] = args.cachepath[0] self._opts['seasonally'] = args.seasonally self._opts['monthly'] = args.monthly if (args.starttime != None): self._opts['start'] = args.starttime[0] if (args.endtime != None): self._opts['end'] = args.endtime[0] # I checked; these are global and it doesn't seem to matter if you import cdms2 multiple times; # they are still set after you set them once in the python process. if (args.compress != None): if (args.compress[0] == 'no'): self._opts['compress'] = False else: self._opts['compress'] = True if self._opts['compress'] == True: print 'Enabling compression for output netCDF files' cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(9) else: print 'Disabling compression for output netCDF files' cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) if (args.json != None): if (args.json[0] == 'no'): self._opts['json'] = False else: self._opts['json'] = True if (args.xml != None): if (args.xml[0] == 'no'): self._opts['xml'] = False else: self._opts['xml'] = True if (args.netcdf != None): if (args.netcdf[0] == 'no'): self._opts['netcdf'] = False else: self._opts['netcdf'] = True if (args.plots != None): if (args.plots[0].lower() == 'no' or args.plots[0] == 0): self._opts['plots'] = False else: self._opts['plots'] = True if (args.climatologies != None): if (args.climatologies[0] == 'no'): self._opts['climatologies'] = False else: self._opts['climatologies'] = True self._opts['verbose'] = args.verbose if (args.name != None): for i in args.name: self._opts['dsnames'].append(i[0]) # Help create output file names if (args.outputpre != None): self._opts['outputpre'] = args.outputpre[0] if (args.outputpost != None): self._opts['outputpost'] = args.outputpost[0] # Output directory if (args.outputdir != None): if not os.path.isdir(args.outputdir[0]): print "ERROR, output directory", args.outputdir[ 0], "does not exist!" quit() self._opts['outputdir'] = args.outputdir[0] if (args.translate != 'y'): print args.translate print self._opts['translate'] quit() # Timestart assumes a string like "months since 2000". I can't find documentation on # toRelativeTime() so I have no idea how to check for valid input # This is required for some of the land model sets I've seen if (args.timestart != None): self._opts['reltime'] = args.timestart # cdutil.setTimeBounds{bounds}(variable) if (args.timebounds != None): self._opts['bounds'] = args.timebounds # Check if a user specified package actually exists # Note: This is case sensitive..... if (args.packages != None): plist = [] for x in args.packages: if x.upper() in self.all_packages.keys(): plist.append(x) elif x in self.all_packages.keys(): plist.append(x.lower()) if plist == []: print 'Package name(s) ', args.packages, ' not valid' print 'Valid package names: ', self.all_packages.keys() quit() else: self._opts['packages'] = plist # TODO: Requires exact case; probably make this more user friendly and look for mixed case if (args.regions != None): rlist = [] for x in args.regions: if x in all_regions.keys(): rlist.append(x) print 'REGIONS: ', rlist self._opts['regions'] = rlist # Given user-selected packages, check for user specified sets # Note: If multiple packages have the same set names, then they are all added to the list. # This might be bad since there is no differentiation of lwmg['id==set'] and lmwg2['id==set'] if (self._opts['packages'] == None and args.sets != None): print 'No package specified' self._opts['sets'] = args.sets if (args.sets != None and self._opts['packages'] != None): # unfortuantely, we have to go through all of this.... # there should be a non-init of the class method to list sets/packages/etc, # ie a dictionary perhaps? sets = [] import metrics.fileio.filetable as ft import metrics.fileio.findfiles as fi import metrics.packages.diagnostic_groups package = self._opts['packages'] if package[0].lower() == 'lmwg': import metrics.packages.lmwg.lmwg elif package[0].lower() == 'amwg': import metrics.packages.amwg.amwg dtree = fi.dirtree_datafiles(self, pathid=0) filetable = ft.basic_filetable(dtree, self) dm = metrics.packages.diagnostic_groups.diagnostics_menu() pclass = dm[package[0].upper()]() slist = pclass.list_diagnostic_sets() keys = slist.keys() keys.sort() for k in keys: fields = k.split() for user in args.sets: if user == fields[0]: sets.append(user) self._opts['sets'] = sets if sets != args.sets: print 'sets requested ', args.sets print 'sets available: ', slist exit(1) # check for some varopts first. if (args.varopts != None): self._opts['varopts'] = args.varopts # Add some hackery here to convert pressure level vars to var+varopts if args.vars != None: self._opts['vars'] = args.vars vpl = ['Z3_300', 'Z3_500', 'U_200', 'T_200', 'T_850'] vl = list(set(args.vars) - set(vpl)) if vl == args.vars: # no pressure level vars made it this far. print 'No pressure level vars found in input vars list.' else: # more complicated.... print 'Pressure level vars found in input vars list.... Processing....' vopts = [] if self._opts['varopts'] != [] and self._opts[ 'varopts'] != None: # hopefully the user didn't also specify varopts.... print 'User passed in varopts but there are pressure-level variables in the vars list.' print 'This will append the pressure levels found to the varopts array' # see which pressure level vars were passed. this will be the super set of pressure levels. if 'Z3_300' in self._opts['vars']: vopts.append('300') self._opts['vars'] = [ x.replace('Z3_300', 'Z3') for x in self._opts['vars'] ] if 'Z3_500' in self._opts['vars']: vopts.append('500') self._opts['vars'] = [ x.replace('Z3_500', 'Z3') for x in self._opts['vars'] ] if 'T_200' in self._opts['vars']: vopts.append('200') self._opts['vars'] = [ x.replace('T_200', 'T') for x in self._opts['vars'] ] if 'T_850' in self._opts['vars']: vopts.append('850') self._opts['vars'] = [ x.replace('T_850', 'T') for x in self._opts['vars'] ] if 'U_200' in self._opts['vars']: vopts.append('200') self._opts['vars'] = [ x.replace('U_200', 'U') for x in self._opts['vars'] ] vopts = list(set(vopts)) if self._opts['varopts'] == [] or self._opts['varopts'] == None: self._opts['varopts'] = vopts else: self._opts['varopts'].extend(vopts) self._opts['varopts'] = list(set(self._opts['varopts'])) print 'Updated vars list: ', self._opts['vars'] # If --yearly is set, then we will add 'ANN' to the list of climatologies if (args.yearly == True): self._opts['yearly'] = True self._opts['times'].append('ANN') # If --monthly is set, we add all months to the list of climatologies if (args.monthly == True): self._opts['monthly'] = True self._opts['times'].extend(all_months) # If --seasonally is set, we add all 4 seasons to the list of climatologies if (args.seasonally == True): self._opts['seasonally'] = True self._opts['times'].extend(all_seasons) # This allows specific individual months to be added to the list of climatologies if (args.months != None): if (args.monthly == True): print "Please specify just one of --monthly or --months" quit() else: mlist = [x for x in all_months if x in args.months] self._opts['times'] = self._opts['times'] + mlist # This allows specific individual years to be added to the list of climatologies. # Note: Checkign for valid input is impossible until we look at the dataset # This has to be special cased since typically someone will be saying # "Generate climatologies for seasons for years X, Y, and Z of my dataset" if (args.years != None): if (args.yearly == True): print "Please specify just one of --yearly or --years" quit() else: self._opts['years'] = args.years if (args.seasons != None): if (args.seasonally == True): print "Please specify just one of --seasonally or --seasons" quit() else: slist = [x for x in all_seasons if x in args.seasons] self._opts['times'] = self._opts['times'] + slist
def displayCell(self, res30, row, column, sheet="Sheet 1", dropInfo=True): """Display result into one cell defined by row/col args""" import pdb projectController = self.parent().get_current_project_controller() if dropInfo: projectController.get_sheet_widget(sheet).deleteCell(row, column) projectController.enable_animation = False # I (JfP) don't know why I need this, it didn't # used to be necessary. if res30 is None: return if not hasattr( res30, 'presentation' ) or res30.presentation is None or res30.presentation is "text": return pvars = res30.vars labels = res30.labels title = res30.title presentation = res30.presentation Gtype = res30.type if Gtype == "Taylor": Gtype = "Taylordiagram" pm = projectController.plot_manager VCS_LIST = pm._plot_list["VCS"] gm = res30.presentation from packages.uvcdat_cdms.init import get_canvas, get_gm_attributes, original_gm_attributes from gui.uvcdat.uvcdatCommons import gmInfos if False: # standard diagnostics prints: print "pvars:", [p.id for p in pvars] print "labels:", labels print "title:", title print "presentation:", presentation print "x min,max:", getattr(presentation, 'datawc_x1', None), getattr(presentation, 'datawc_x2', None) print "y min,max:", getattr(presentation, 'datawc_y1', None), getattr(presentation, 'datawc_y2', None) print "res", res30.type #define where to drag and drop import cdms2 from packages.uvcdat_cdms.init import CDMSVariable from core.utils import InstanceObject from metrics.frontend.uvcdat import diagnostics_template tm = diagnostics_template() # template name is 'diagnostic' if dropInfo: tmplDropInfo = ('diagnostic', sheet, row, column) projectController.template_was_dropped(tmplDropInfo) if Gtype == 'Vector': pvars = pvars[0] for varindex, V in enumerate(pvars): if Gtype != 'Vector': V.title = title # VCS looks the title of the variable, not the plot. V.long_name = V.title # VCS overrides title with long_name! # Until I know better storing vars in tempfile.... f = tempfile.NamedTemporaryFile() filename = f.name f.close() value = 0 cdms2.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag( value) ## where value is a integer between 0 and 9 included fd = cdms2.open(filename, "w") fd.write(V) fd.close() cdmsFile = cdms2.open(filename) #define name of variable to appear in var widget if Gtype == 'Vector': name_in_var_widget = V[0].id else: name_in_var_widget = V.id #get uri if exists url = None if hasattr(cdmsFile, 'uri'): url = cdmsFile.uri #create vistrails module cdmsVar = CDMSVariable(filename=cdmsFile.id, url=url, name=name_in_var_widget, varNameInFile=name_in_var_widget) #V.id) #get variable widget and project controller definedVariableWidget = self.parent().dockVariable.widget() #add variable to display widget and controller definedVariableWidget.addVariable(V) projectController.add_defined_variable(cdmsVar) # simulate drop variable varDropInfo = (name_in_var_widget, sheet, row, column) projectController.variable_was_dropped(varDropInfo) # Trying to add method to plot list.... #from gui.application import get_vistrails_application #_app = get_vistrails_application() #d = _app.uvcdatWindow.dockPlot # simulate drop plot G = VCS_LIST[Gtype] if not gm.name in G.keys(): G[gm.name] = pm._registry.add_plot(gm.name, "VCS", None, None, Gtype) G[gm.name].varnum = int(gmInfos[Gtype]["nSlabs"]) #add initial attributes to global dict canvas = get_canvas() method_name = "get" + Gtype.lower() attributes = get_gm_attributes(Gtype) attrs = {} for attr in attributes: attrs[attr] = getattr(gm, attr) original_gm_attributes[Gtype][gm.name] = InstanceObject(**attrs) if Gtype in ["Scatter", "Vector"] and varindex == 0: #to plot a scatter plot or vector plot, requires both axes passed to plotspec. #so dont plot the 1st one until the 2nd variable is processed. pass else: # simulate drop plot plot = projectController.plot_manager.new_plot( 'VCS', Gtype, gm.name) #plot = projectController.plot_manager.new_plot('VCS', Gtype, "default" ) plotDropInfo = (plot, sheet, row, column) projectController.plot_was_dropped(plotDropInfo)
def surfTransf(fileFx, fileTos, fileSos, fileHef, fileWfo, varNames, outFile, debug=True, timeint='all', noInterp=False, domain='global'): ''' The surfTransf() function takes files and variable arguments and creates density bined surface transformation fields which are written to a specified outfile Author: Eric Guilyardi : [email protected] Co-author: Paul J. Durack : [email protected] : @durack1. Created on Wed Oct 8 09:15:59 CEST 2014 Inputs: ------ - fileTos(time,lat,lon) - 3D SST array - fileSos(time,lat,lon) - 3D SSS array - fileHef(time,lat,lon) - 3D net surface heat flux array - fileWfo(time,lat,lon) - 3D fresh water flux array - fileFx(lat,lon) - 2D array containing the cell area values - varNames[4] - 1D array containing the names of the variables - outFile(str) - output file with full path specified. - debug <optional> - boolean value - timeint <optional> - specify temporal step for binning <init_idx>,<ncount> - noInterp <optional> - if true no interpolation to target grid - domain <optional> - specify domain for averaging when interpolated to WOA grid ('global','north', 'north40', 'south' for now) Outputs: -------- - netCDF file with monthly surface rhon, density fluxes, transformation (global and per basin) - use cdo yearmean to compute annual mean Usage: ------ '>>> from binDensity import surfTransf '>>> surfTransf(file_fx, file_tos, file_sos, file_hef, file_wfo, [var1,var2,var3,var4]./output.nc, debug=True,timeint='all') Notes: ----- - EG 8 Oct 2014 - Initial function write and tests ok - PJD 22 Nov 2014 - Code cleanup - EG 4 Oct 2017 - code on ciclad, more cleanup and options - EG 12 Sep 2018 - Add North vs. South calculation ''' # Keep track of time (CPU and elapsed) cpu0 = timc.clock() # # netCDF compression (use 0 for netCDF3) comp = 1 cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # # == Inits # npy.set_printoptions(precision=2) # Determine file name from inputs modeln = fileTos.split('/')[-1].split('.')[1] # if debug: print ' Debug - File names:' print ' ', fileTos print ' ', fileSos debugp = True else: debugp = False # # Open files ftos = cdm.open(fileTos) fsos = cdm.open(fileSos) fhef = cdm.open(fileHef) fwfo = cdm.open(fileWfo) #timeax = ftos.getAxis('time') timeax = ftos.getAxis('time_counter') #print 'timeax' #print timeax # # Dates to read if timeint == 'all': tmin = 0 tmax = timeax.shape[0] timeaxis = timeax else: tmin = int(timeint.split(',')[0]) - 1 tmax = tmin + int(timeint.split(',')[1]) # update time axis timeaxis = cdm.createAxis(timeax[tmin:tmax]) timeaxis.id = 'time' timeaxis.units = timeax.units timeaxis.designateTime() #print timeaxis if debugp: print print ' Debug mode' # Read file attributes to carry on to output files list_file = ftos.attributes.keys() file_dic = {} for i in range(0, len(list_file)): file_dic[i] = list_file[i], ftos.attributes[list_file[i]] # # Read data # varnames tos_name = varNames[0] sos_name = varNames[1] hef_name = varNames[2] wfo_name = varNames[3] if debugp: print ' Read ', tos_name, sos_name, tmin, tmax tos = ftos(tos_name, time=slice(tmin, tmax)) sos = fsos(sos_name, time=slice(tmin, tmax)) if debugp: print ' Read ', hef_name, wfo_name qnet = fhef(hef_name, time=slice(tmin, tmax)) try: emp = fwfo(wfo_name, time=slice(tmin, tmax)) empsw = 0 except Exception, err: emp = fwfo('wfos', time=slice(tmin, tmax)) print ' Reading concentration dillution fresh water flux' empsw = 0
def test_driver( path1, path2=None, filt2=None ): """ Test driver for setting up data for plots""" # First, find and index the data files. datafiles1 = dirtree_datafiles( path1 ) logger.info("jfp datafiles1=%s",datafiles1) datafiles2 = dirtree_datafiles( path2, filt2 ) logger.info("jfp datafiles2=%s",datafiles2) filetable1 = basic_filetable( datafiles1 ) filetable2 = basic_filetable( datafiles2 ) # Next we'll compute reduced variables. They have generally been reduced by averaging in time, # and often more axes as well. Reducing the data first is the fastest way to compute, important # if we need to be interactive. And it is correct if whatever we plot is linear in the # variables, as is almost always the case. But if we want to plot a highly nonlinear function # of the data variables, the averaging will have to wait until later. # The reduced_variables dict names and contains all the reduced variables which we have defined. # They will be used in defining instances of plotspec. reduced_variables = { 'hyam_1': reduced_variable( variableid='hyam', filetable=filetable1, reduction_function=(lambda x,vid=None: x) ), 'hybm_1': reduced_variable( variableid='hybm', filetable=filetable1, reduction_function=(lambda x,vid=None: x) ), 'PS_ANN_1': reduced_variable( variableid='PS', filetable=filetable1, reduction_function=reduce2lat ), 'T_CAM_ANN_1': reduced_variable( variableid='T', filetable=filetable1, reduction_function=reduce2levlat ), 'T_CAM_ANN_2': reduced_variable( variableid='T', filetable=filetable2, reduction_function=reduce2levlat ), 'TREFHT_ANN_latlon_Npole_1': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x,vid=None: restrict_lat(reduce2latlon(x,vid=vid),50,90)) ), 'TREFHT_ANN_latlon_Npole_2': reduced_variable( variableid='TREFHT', filetable=filetable2, reduction_function=(lambda x,vid=None: restrict_lat(reduce2latlon(x,vid=vid),50,90)) ), 'TREFHT_ANN_lat_1': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=reduce2lat ), 'TREFHT_DJF_lat_1': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x,vid=None: reduce2lat_seasonal(x,seasonsDJF,vid=vid)) ), 'TREFHT_DJF_lat_2': reduced_variable( variableid='TREFHT', filetable=filetable2, reduction_function=(lambda x,vid=None: reduce2lat_seasonal(x,seasonsDJF,vid=vid)) ), 'TREFHT_DJF_latlon_1': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x,vid=None: reduce2latlon_seasonal(x,seasonsDJF,vid=vid)) ), 'TREFHT_DJF_latlon_2': reduced_variable( variableid='TREFHT', filetable=filetable2, reduction_function=(lambda x,vid=None: reduce2latlon_seasonal(x,seasonsDJF,vid=vid)) ), 'TREFHT_JJA': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x,vid=None: reduce2lat_seasonal(x,seasonsJJA,vid=vid)) ), 'PRECT_JJA_lat_1': reduced_variable( variableid='PRECT', filetable=filetable1, reduction_function=(lambda x,vid=None: reduce2lat_seasonal(x,seasonsJJA,vid=vid)) ), 'PRECT_JJA_lat_2': reduced_variable( variableid='PRECT', filetable=filetable2, reduction_function=(lambda x,vid=None: reduce2lat_seasonal(x,seasonsJJA,vid=vid)) ), # CAM variables needed for heat transport: # FSNS, FLNS, FLUT, FSNTOA, FLNT, FSNT, SHFLX, LHFLX, 'FSNS_1': reduced_variable( variableid='FSNS',filetable=filetable1,reduction_function=(lambda x,vid:x) ), 'FSNS_ANN_latlon_1': reduced_variable( variableid='FSNS', filetable=filetable1, reduction_function=reduce2latlon ), 'FLNS_1': reduced_variable( variableid='FLNS',filetable=filetable1,reduction_function=(lambda x,vid:x) ), 'FLNS_ANN_latlon_1': reduced_variable( variableid='FLNS', filetable=filetable1, reduction_function=reduce2latlon ), 'FLUT_ANN_latlon_1': reduced_variable( variableid='FLUT', filetable=filetable1, reduction_function=reduce2latlon ), 'FSNTOA_ANN_latlon_1': reduced_variable( variableid='FSNTOA', filetable=filetable1, reduction_function=reduce2latlon ), 'FLNT_1': reduced_variable( variableid='FLNT',filetable=filetable1,reduction_function=(lambda x,vid:x) ), 'FLNT_ANN_latlon_1': reduced_variable( variableid='FLNT', filetable=filetable1, reduction_function=reduce2latlon ), 'FSNT_1': reduced_variable( variableid='FSNT',filetable=filetable1,reduction_function=(lambda x,vid:x) ), 'FSNT_ANN_latlon_1': reduced_variable( variableid='FSNT', filetable=filetable1, reduction_function=reduce2latlon ), 'QFLX_1': reduced_variable( variableid='QFLX',filetable=filetable1,reduction_function=(lambda x,vid:x) ), 'SHFLX_1': reduced_variable( variableid='SHFLX',filetable=filetable1,reduction_function=(lambda x,vid:x) ), 'SHFLX_ANN_latlon_1': reduced_variable( variableid='SHFLX', filetable=filetable1, reduction_function=reduce2latlon ), 'LHFLX_ANN_latlon_1': reduced_variable( variableid='LHFLX', filetable=filetable1, reduction_function=reduce2latlon ), 'ORO_ANN_latlon_1': reduced_variable( variableid='ORO', filetable=filetable1, reduction_function=reduce2latlon ), 'OCNFRAC_ANN_latlon_1': reduced_variable( variableid='OCNFRAC', filetable=filetable1, reduction_function=reduce2latlon ), 'ts_lat_old': reduced_variable( variableid='surface_temperature', # normally a CF standard_name, even for non-CF data. filetable=filetable1, reduction_function=reduce2lat_old ), 'ts_lat_new': reduced_variable( variableid='surface_temperature', # normally a CF standard_name, even for non-CF data. filetable=filetable1, reduction_function=reduce2lat # The reduction function will take just one argument, a variable (MV). But it might # be expressed here as a lambda wrapping a more general function. # Often there will be ranges in time, space, etc. specified here. No range means # everything. ), 'ts_scalar_tropical_o': reduced_variable( variableid = 'surface_temperature', filetable=filetable1, reduction_function=(lambda mv,vid=None: reduce2scalar_zonal_old(mv,-20,20,vid=vid)) ), 'ts_scalar_tropical_n': reduced_variable( variableid = 'surface_temperature', filetable=filetable1, reduction_function=(lambda mv,vid=None: reduce2scalar_zonal(mv,-20,20,vid=vid)) ) } # Derived variables have to be treated separately from reduced variables # because derived variables generally depend on reduced variables. # But N.B.: the dicts reduced_variables and derived_variables # must never use the same key! derived_variables = { 'CAM_HEAT_TRANSPORT_ALL_1': derived_var( vid='CAM_HEAT_TRANSPORT_ALL_1', inputs=['FSNS_ANN_latlon_1', 'FLNS_ANN_latlon_1', 'FLUT_ANN_latlon_1', 'FSNTOA_ANN_latlon_1', 'FLNT_ANN_latlon_1', 'FSNT_ANN_latlon_1', 'SHFLX_ANN_latlon_1', 'LHFLX_ANN_latlon_1', 'OCNFRAC_ANN_latlon_1' ], outputs=['atlantic_heat_transport','pacific_heat_transport', 'indian_heat_transport', 'global_heat_transport' ], func=oceanic_heat_transport ), 'NCEP_OBS_HEAT_TRANSPORT_ALL_2': derived_var( vid='NCEP_OBS_HEAT_TRANSPORT_ALL_2', inputs=[], outputs=('latitude', ['atlantic_heat_transport','pacific_heat_transport', 'indian_heat_transport', 'global_heat_transport' ]), func=(lambda: ncep_ocean_heat_transport(path2) ) ), 'T_ANN_1': derived_var( vid='T_ANN_1', inputs=['T_CAM_ANN_1', 'hyam_1', 'hybm_1', 'PS_ANN_1', 'T_CAM_ANN_2'], outputs=('temperature'), func=verticalize ) } plotvars = dict( reduced_variables.items() + derived_variables.items() ) # The plotvspecs dict names and contains all plotspec objects which we have defined. # The plotspeckeys variable, below, names the ones for which we will generate output. # A dict value can be a plotspec object, or a list of such objects. A list of # plotspec instances specifies a page containing multiple plots in separate panes. plotspecs = { 'TREFHT_ANN_Npole_ALL': ['TREFHT_ANN_Npole_1', 'TREFHT_ANN_Npole_2', 'TREFHT_ANN_Npole_diff'], 'TREFHT_ANN_Npole_1': plotspec( vid='TREFHT_ANN_Npole_1', xvars=['TREFHT_ANN_latlon_Npole_1'], xfunc = lonvar, yvars=['TREFHT_ANN_latlon_Npole_1'], yfunc = latvar, zvars=['TREFHT_ANN_latlon_Npole_1'], zfunc = (lambda z: z), plottype='polar contour plot' ), 'TREFHT_ANN_Npole_2': plotspec( vid='TREFHT_ANN_Npole_2', xvars=['TREFHT_ANN_latlon_Npole_2'], xfunc = lonvar, yvars=['TREFHT_ANN_latlon_Npole_2'], yfunc = latvar, zvars=['TREFHT_ANN_latlon_Npole_2'], zfunc = (lambda z: z), plottype='polar contour plot' ), 'TREFHT_ANN_Npole_diff': plotspec( vid='TREFHT_ANN_Npole_diff', xvars=['TREFHT_ANN_latlon_Npole_1','TREFHT_ANN_latlon_Npole_2'], xfunc = lonvar_min, yvars=['TREFHT_ANN_latlon_Npole_1','TREFHT_ANN_latlon_Npole_2'], yfunc = latvar_min, zvars=['TREFHT_ANN_latlon_Npole_1','TREFHT_ANN_latlon_Npole_2'], zfunc = aminusb_2ax, plottype='polar contour plot' ), 'TREFHT_DJF_laton_ALL': ['TREFHT_DJF_latlon_1', 'TREFHT_DJF_latlon_2', 'TREFHT_DJF_latlon_diff'], 'TREFHT_DJF_latlon_1': plotspec( vid='TREFHT_DJF_latlon_1', xvars=['TREFHT_DJF_latlon_1'], xfunc = lonvar, yvars=['TREFHT_DJF_latlon_1'], yfunc = latvar, zvars=['TREFHT_DJF_latlon_1'], zfunc = (lambda z: z), plottype='contour plot' ), 'TREFHT_DJF_latlon_2': plotspec( vid='TREFHT_DJF_latlon_2', xvars=['TREFHT_DJF_latlon_2'], xfunc = lonvar, yvars=['TREFHT_DJF_latlon_2'], yfunc = latvar, zvars=['TREFHT_DJF_latlon_2'], zfunc = (lambda z: z), plottype='contour plot' ), 'TREFHT_DJF_latlon_diff': plotspec( vid='TREFHT_DJF_latlon_diff', xvars=['TREFHT_DJF_latlon_1','TREFHT_DJF_latlon_2'], xfunc=lonvar_min, yvars=['TREFHT_DJF_latlon_1','TREFHT_DJF_latlon_2'], yfunc=latvar_min, zvars=['TREFHT_DJF_latlon_1','TREFHT_DJF_latlon_2'], zfunc= aminusb_2ax, plottype='contour_plot' ), 'T_ANN_VERT_CAM_OBS_ALL': ['T_VERT_ANN_1', 'T_VERT_ANN_2', 'T_VERT_difference' ], 'T_VERT_difference': plotspec( vid='T_VERT_difference', xvars=['T_ANN_1','T_CAM_ANN_2'], xfunc = latvar_min, yvars=['T_ANN_1','T_CAM_ANN_2'], yfunc = levvar_min, ya1vars=['T_ANN_1','T_CAM_ANN_2'], ya1func = (lambda y1,y2: heightvar(levvar_min(y1,y2))), zvars=['T_ANN_1','T_CAM_ANN_2'], zfunc=aminusb_ax2, plottype="contour plot" ), 'T_VERT_ANN_2': plotspec( vid='T_ANN_2', xvars=['T_CAM_ANN_2'], xfunc=latvar, yvars=['T_CAM_ANN_2'], yfunc=levvar, ya1vars=['T_CAM_ANN_2'], ya1func=heightvar, zvars=['T_CAM_ANN_2'], plottype='contour plot', zrangevars=['T_ANN_1','T_CAM_ANN_2'], zrangefunc=minmin_maxmax ), 'T_VERT_ANN_1': plotspec( vid='T_ANN_1', xvars=['T_ANN_1'], xfunc=latvar, yvars=['T_ANN_1'], yfunc=levvar, ya1vars=['T_ANN_1'], ya1func=heightvar, zvars=['T_ANN_1'], plottype='contour plot', zrangevars=['T_ANN_1','T_CAM_ANN_2'], zrangefunc=minmin_maxmax ), 'NCEP_OBS_HEAT_TRANSPORT_GLOBAL_2': plotspec( vid='NCEP_OBS_HEAT_TRANSPORT_GLOBAL_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], yfunc=(lambda y: y[1][3]), plottype='line plot'), 'NCEP_OBS_HEAT_TRANSPORT_PACIFIC_2': plotspec( vid='NCEP_OBS_HEAT_TRANSPORT_PACIFIC_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], yfunc=(lambda y: y[1][0]), plottype='line plot'), 'NCEP_OBS_HEAT_TRANSPORT_ATLANTIC_2': plotspec( vid='NCEP_OBS_HEAT_TRANSPORT_ATLANTIC_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], yfunc=(lambda y: y[1][1]), plottype='line plot'), 'NCEP_OBS_HEAT_TRANSPORT_INDIAN_2': plotspec( vid='NCEP_OBS_HEAT_TRANSPORT_INDIAN_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], yfunc=(lambda y: y[1][2]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_GLOBAL_1': plotspec( vid='CAM_HEAT_TRANSPORT_GLOBAL_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1' ], yfunc=(lambda y: y[3]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_PACIFIC_1': plotspec( vid='CAM_HEAT_TRANSPORT_PACIFIC_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1' ], yfunc=(lambda y: y[0]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_ATLANTIC_1': plotspec( vid='CAM_HEAT_TRANSPORT_ATLANTIC_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1' ], yfunc=(lambda y: y[1]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_INDIAN_1': plotspec( vid='CAM_HEAT_TRANSPORT_INDIAN_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1' ], yfunc=(lambda y: y[2]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_ALL_1': ['CAM_HEAT_TRANSPORT_GLOBAL_1','CAM_HEAT_TRANSPORT_PACIFIC_1', 'CAM_HEAT_TRANSPORT_ATLANTIC_1','CAM_HEAT_TRANSPORT_INDIAN_1'], 'CAM_NCEP_HEAT_TRANSPORT_GLOBAL': plotspec( vid='CAM_NCEP_HEAT_TRANSPORT_GLOBAL', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1' ], y1func=(lambda y: y[3]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], y2func=(lambda y: y[1][3]), plottype='2 line plot' ), 'CAM_NCEP_HEAT_TRANSPORT_PACIFIC': plotspec( vid='CAM_NCEP_HEAT_TRANSPORT_PACIFIC', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1' ], y1func=(lambda y: y[0]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], y2func=(lambda y: y[1][0]), plottype='2 line plot' ), 'CAM_NCEP_HEAT_TRANSPORT_ATLANTIC': plotspec( vid='CAM_NCEP_HEAT_TRANSPORT_ATLANTIC', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1' ], y1func=(lambda y: y[0]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], y2func=(lambda y: y[1][1]), plottype='2 line plot' ), 'CAM_NCEP_HEAT_TRANSPORT_INDIAN': plotspec( vid='CAM_NCEP_HEAT_TRANSPORT_INDIAN', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1' ], y1func=(lambda y: y[0]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2' ], y2func=(lambda y: y[1][2]), plottype='2 line plot' ), 'CAM_NCEP_HEAT_TRANSPORT_ALL': ['CAM_NCEP_HEAT_TRANSPORT_GLOBAL','CAM_NCEP_HEAT_TRANSPORT_PACIFIC', 'CAM_NCEP_HEAT_TRANSPORT_ATLANTIC','CAM_NCEP_HEAT_TRANSPORT_INDIAN'], 'past_CAM_HEAT_TRANSPORT_GLOBAL_1': plotspec( vid='CAM_HEAT_TRANSPORT_GLOBAL_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['FSNS_ANN_latlon_1', 'FLNS_ANN_latlon_1', 'FLUT_ANN_latlon_1', 'FSNTOA_ANN_latlon_1', 'FLNT_ANN_latlon_1', 'FSNT_ANN_latlon_1', 'SHFLX_ANN_latlon_1', 'LHFLX_ANN_latlon_1', 'OCNFRAC_ANN_latlon_1' ], yfunc=oceanic_heat_transport, plottype='line plot'), 'PRECT_JJA': ['PRECT_JJA_2line','PRECT_JJA_diff'], 'PRECT_JJA_2line': plotspec( vid='PRECT_JJA_2line', x1vars=['PRECT_JJA_lat_1'], x1func = latvar, x2vars=['PRECT_JJA_lat_2'], x2func = latvar, y1vars=['PRECT_JJA_lat_1'], y1func=(lambda y: y), y2vars=['PRECT_JJA_lat_2'], y2func=(lambda y: y), plottype='2-line plot'), 'PRECT_JJA_diff': plotspec( vid='PRECT_JJA_difference', xvars=['PRECT_JJA_lat_1','PRECT_JJA_lat_2'], xfunc = latvar_min, yvars=['PRECT_JJA_lat_1','PRECT_JJA_lat_2'], yfunc=aminusb_1ax, # aminusb_1ax(y1,y2)=y1-y2; each y has 1 axis, use min axis plottype='line plot'), 'TREFHT_ANN': plotspec( vid='TREFHT_ANN',xvars=['TREFHT_ANN_lat_1'], xfunc = latvar, yvars=['TREFHT_ANN_lat_1'], yfunc=(lambda y: y), plottype='line plot'), 'TREFHT_DJF': ['TREFHT_DJF_2line','TREFHT_DJF_diff'], 'TREFHT_DJF_2line': plotspec( vid='TREFHT_DJF_2line', x1vars=['TREFHT_DJF_lat_1'], x1func = latvar, x2vars=['TREFHT_DJF_lat_2'], x2func = latvar, y1vars=['TREFHT_DJF_lat_1'], y1func=(lambda y: y), y2vars=['TREFHT_DJF_lat_2'], y2func=(lambda y: y), plottype='2-line plot'), 'TREFHT_DJF_diff': plotspec( vid='TREFHT_DJF_diff', xvars=['TREFHT_DJF_lat_1','TREFHT_DJF_lat_2'], xfunc = latvar_min, yvars=['TREFHT_DJF_lat_1','TREFHT_DJF_lat_2'], yfunc=aminusb_1ax, # aminusb_1ax(y1,y2)=y1-y2; each y has 1 axis, use min axis plottype='line plot'), 'TREFHT_DJF_line': plotspec( vid='TREFHT_DJF_line', xvars=['TREFHT_DJF_lat_1'], xfunc = latvar, yvars=['TREFHT_DJF_lat_1'], plottype='line plot'), 'TREFHT_DJF_contour': plotspec( vid='TREFHT_DJF_contour', xvars=['TREFHT_DJF_latlon_1'], xfunc = (lambda x: x), plottype='line plot'), #plotspec( vid='TREFHT_JJA',xvars=['TREFHT_JJA'], xfiletable=filetable1, xfunc = latvar, # yvars=['TREFHT_JJA'], yfunc=(lambda y: y), plottype='line plot'), #plotspec( # vid='ts_by_lat_old', # suitable for filenames # xfiletable=filetable1, # xfunc = latvar, # function to return x axis values # xvars = ['ts_lat_old'], # names of variables or axes, args of xfunc # yfiletable=filetable1, # can differ from xfiletable, e.g. comparing 2 runs # yfunc = (lambda y: y), # function to return y axis values # yvars = ['ts_lat_old'], # names of variables or axes, args of xfunc # zfiletable=filetable1, # zfunc = (lambda: None), # zvars = [], # would be needed for countour or 3D plot # # ... the ?vars variable will be converted (using the filetable and # # plotvars) to actual variables which become the arguments for a call # # of ?func, which returns the data we write out for plotting use. # plottype='line plot' ), 'ts_by_lat': plotspec( vid='ts_by_lat', # suitable for filenames xfunc = latvar, # function to return x axis values xvars = ['ts_lat_new'], # names of variables or axes, args of xfunc yfunc = (lambda y: y), # function to return y axis values yvars = ['ts_lat_new'], # names of variables or axes, args of xfunc zfunc = (lambda: None), zvars = [], # would be needed for countour or 3D plot # ... the ?vars variable will be converted (using the filetable and # plotvars) to actual variables which become the arguments for a call # of ?func, which returns the data we write out for plotting use. plottype='line plot' ), #plotspec( vid="ts_global_old",xvars=['ts_scalar_tropical_o'], xfiletable=filetable1 ), 'ts_global': plotspec( vid="ts_global",xvars=['ts_scalar_tropical_n'] ), } # Plotspeckeys specifies what plot data we will compute and write out. # In the future we may add a command line option, or provide other ways to # define plotspeckeys. #plotspeckeys = [['TREFHT_DJF_2line','TREFHT_DJF_difference']] #plotspeckeys = ['TREFHT_DJF_2line'] #plotspeckeys = ['NCEP_OBS_HEAT_TRANSPORT_GLOBAL_2','CAM_HEAT_TRANSPORT_ALL_1'] #plotspeckeys = ['CAM_NCEP_HEAT_TRANSPORT_GLOBAL'] #plotspeckeys = ['CAM_NCEP_HEAT_TRANSPORT_ALL'] #plotspeckeys = ['T_ANN_VERT_CAM_OBS_ALL'] #plotspeckeys = ['TREFHT_DJF_laton_ALL'] #plotspeckeys = ['TREFHT_ANN_Npole_ALL'] plotspeckeys = ['TREFHT_DJF'] #plotspeckeys = ['GLOBAL_AVERAGES'] # Find the variable names required by the plotspecs. varkeys = [] for psk in plotspeckeys: if type(psk) is str and type(plotspecs[psk]) is list: psk = plotspecs[psk] if type(psk) is str: write_xml = False psl = [ plotspecs[psk] ] else: write_xml = True psl = [ plotspecs[k] for k in psk ] xml_name = '_'.join( [ ps._strid for ps in psl ] ) +'.xml' h = open( xml_name, 'w' ) h.write("<plotdata>\n") for ps in psl: varkeys = varkeys+ps.xvars+ps.x1vars+ps.x2vars+ps.x3vars varkeys = varkeys+ps.yvars+ps.y1vars+ps.y2vars+ps.y3vars varkeys = varkeys + ps.zvars + ps.zrangevars for key in varkeys: if key in derived_variables.keys(): varkeys = varkeys + derived_variables[key]._inputs varkeys = list( set(varkeys) ) # Compute the value of every variable we need. varvals = {} # First compute all the reduced variables for key in varkeys: if key in reduced_variables.keys(): varvals[key] = reduced_variables[key].reduce() # Then use the reduced variables to compute the derived variables # Note that the derive() method is allowed to return a tuple. This way # we can use one function to compute what's really several variables. for key in varkeys: if key in derived_variables.keys(): varvals[key] = derived_variables[key].derive(varvals) # Now use the reduced and derived variables to compute the plot data. for psk in plotspeckeys: if type(psk) is str and type(plotspecs[psk]) is list: psk = plotspecs[psk] if type(psk) is str: write_xml = False psl = [ plotspecs[psk] ] else: write_xml = True psl = [ plotspecs[k] for k in psk ] xml_name = '_'.join( [ ps._strid for ps in psl ] ) +'.xml' h = open( xml_name, 'w' ) h.write("<plotdata>\n") varkeys = [] for ps in psl: logger.info("jfp preparing data for %s", ps._strid) xrv = [ varvals[k] for k in ps.xvars ] x1rv = [ varvals[k] for k in ps.x1vars ] x2rv = [ varvals[k] for k in ps.x2vars ] x3rv = [ varvals[k] for k in ps.x3vars ] yrv = [ varvals[k] for k in ps.yvars ] y1rv = [ varvals[k] for k in ps.y1vars ] y2rv = [ varvals[k] for k in ps.y2vars ] y3rv = [ varvals[k] for k in ps.y3vars ] yarv = [ varvals[k] for k in ps.yavars ] ya1rv = [ varvals[k] for k in ps.ya1vars ] zrv = [ varvals[k] for k in ps.zvars ] zrrv = [ varvals[k] for k in ps.zrangevars ] xax = apply( ps.xfunc, xrv ) x1ax = apply( ps.x1func, x1rv ) x2ax = apply( ps.x2func, x2rv ) x3ax = apply( ps.x3func, x3rv ) yax = apply( ps.yfunc, yrv ) y1ax = apply( ps.y1func, y1rv ) y2ax = apply( ps.y2func, y2rv ) y3ax = apply( ps.y3func, y3rv ) yaax = apply( ps.yafunc, yarv ) ya1ax = apply( ps.ya1func, ya1rv ) zax = apply( ps.zfunc, zrv ) zr = apply( ps.zrangefunc, zrrv ) if (xax is None or len(xrv)==0) and (x1ax is None or len(x1rv)==0)\ and (x2ax is None or len(x2rv)==0) and (x3ax is None or len(x3rv)==0)\ and (yax is None or len(yrv)==0) and (y1ax is None or len(y1rv)==0)\ and (y2ax is None or len(y2rv)==0) and (y3ax is None or len(y3rv)==0)\ and (zax is None or len(zrv)==0): continue filename = ps._strid+"_test.nc" value=0 cdms2.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(value) ## where value is a integer between 0 and 9 included g = cdms2.open( filename, 'w' ) # later, choose a better name and a path! store_provenance(g) # Much more belongs in g, e.g. axis and graph names. if xax is not None and len(xrv)>0: xax.id = 'X' g.write(xax) if x1ax is not None and len(x1rv)>0: x1ax.id = 'X1' g.write(x1ax) if x2ax is not None and len(x2rv)>0: x2ax.id = 'X2' g.write(x2ax) if x3ax is not None and len(x3rv)>0: x3ax.id = 'X3' g.write(x3ax) if yax is not None and len(yrv)>0: yax.id = 'Y' g.write(yax) if y1ax is not None and len(y1rv)>0: y1ax.id = 'Y1' g.write(y1ax) if y2ax is not None and len(y2rv)>0: y2ax.id = 'Y2' g.write(y2ax) if y3ax is not None and len(y3rv)>0: y3ax.id = 'Y3' g.write(y3ax) if yaax is not None and len(yarv)>0: yaax.id = 'YA' g.write(yaax) if ya1ax is not None and len(ya1rv)>0: ya1ax.id = 'YA1' g.write(ya1ax) if zax is not None and len(zrv)>0: zax.id = 'Z' g.write(zax) if zr is not None: zr.id = 'Zrange' g.write(zr) g.presentation = ps.plottype # Note: For table output, it would be convenient to use a string-valued variable X # to specify string parts of the table. Butcdms2 doesn't support them usefully. # Instead we'll manage with a convention that a table row plotspec's id is the name of # the row, thus available to be printed in, e.g., the first column. if ps.plottype=="table row": g.rowid = ps._strid g.close() if write_xml: h.write( "<ncfile>"+filename+"</ncfile>\n" ) if write_xml: h.write( "</plotdata>\n" ) h.close()
def execute(test_str, plotset, obstype, varid, season, imagefilename, imagethreshold, ncfiles, rtol, atol): print test_str # Silence annoying messages about how to set the NetCDF file type. Anything will do. cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) #get commmand line args p = argparse.ArgumentParser(description="Basic gm testing code for vcs") p.add_argument("--datadir", dest="datadir", help="root directory for model and obs data") p.add_argument("--baseline", dest="baseline", help="directory with baseline files for comparing results") p.add_argument("--keep", dest="keep", help="Iff True, will keep computed png and nc files") args = p.parse_args(sys.argv[1:]) datadir = args.datadir baselinepath = args.baseline keep = args.keep #setup paths to data modelpath = os.path.join(datadir, 'cam_output') obspath = os.path.join(datadir, 'obs_atmos') outpath = tempfile.mkdtemp() + "/" print "outpath=", outpath #setup string to be executed and run script #diagstr = "diags --outputdir '%s' --model path=%s,climos=no --obs path=%s,filter=\"f_contains('NCEP')\",climos=yes --package AMWG --set 3 --var T --seasons JJA" % (outpath, modelpath, obspath) diagstr_parts = [ " --outputdir %s " % (outpath), " --model path=%s,climos=no " % (modelpath), " --obs path=%s,filter=\"f_contains('%s')\",climos=yes " % (obspath, obstype), " --package AMWG ", " --set %s " % (str(plotset)), " --var %s" % (varid), " --seasons %s" % (season) ] diagstr = "diags " for part in diagstr_parts: diagstr += part print 'executing ' print diagstr # nonstandard, suitable for testing: proc = subprocess.Popen([diagstr], shell=True) proc_status = proc.wait() if proc_status != 0: raise DiagError("diags run failed") if keep: print "save ", imagefilename, ncfiles.keys() print "output directory is = ", outpath else: # Test of graphics (png) file match: # This just looks at combined plot, aka summary plot, which is a compound of three plots. imagefname = os.path.join(outpath, imagefilename) imagebaselinefname = os.path.join(baselinepath, imagefilename) graphics_result = checkimage.check_result_image( imagefname, imagebaselinefname, imagethreshold) print "Graphics file", imagefname, "match difference:", graphics_result # Test of NetCDF data (nc) file match: CLOSE = True for ncfilename, ncvars in ncfiles.items(): for var in ncvars: #print ncfilename, var print baselinepath try: close = closeness(var, ncfilename, outpath, baselinepath, rtol, atol) if not close: print var, ' in ', ncfilename, ' is not close.' except: print 'comparison failed ', ncfilename, var close = False CLOSE = CLOSE and close #cleanup the temp files shutil.rmtree(outpath) assert (CLOSE) #, 'data are not close'
from cdms2 import MV import numpy import glob import sys import os from os import path import re from scipy import interpolate import shutil # _______________ if __name__=="__main__": # for netcdf3: set flags to 0 cdms2.setNetcdfShuffleFlag(0) #1 cdms2.setNetcdfDeflateFlag(0) #1 cdms2.setNetcdfDeflateLevelFlag(0) #3 infile=None outfile=None variable=None ii=1 while ii < len(sys.argv): arg = sys.argv[ii] if arg=='-o': ii = ii + 1 outfile=sys.argv[ii] elif arg=='-v': ii=ii+1
def mmeAveMsk1D(listFiles, sw2d, years, inDir, outDir, outFile, timeInt, mme, ToeType, fullTS, debug=True): ''' The mmeAveMsk1D() function averages rhon or scalar density bined files with differing masks It ouputs the MME and a percentage of non-masked bins Created on Tue Nov 25 13:56:20 CET 2014 Inputs: ------- - listFiles(str) - the list of files to be averaged - sw2d - dimension of fields to consider (1 or 2) - years(t1,t2) - years for slice read - inDir(str) - input directory where files are stored - outDir(str) - output directory - outFile(str) - output file - timeInt(2xindices) - indices of init period to compare with (e.g. [1,20]) - mme(bool) - multi-model mean (will read in single model ensemble stats) - FfllTS - 0/1: if 1, uses full time serie (ignores years(t1,t2)) - debug <optional> - boolean value Notes: ----- - EG 25 Nov 2014 - Initial function write - EG 9 Dec 2014 - Add agreement on difference with init period - save as <var>Agree - EG 04 Oct 2016 - Add 3D files support TODO: ------ ''' # CDMS initialisation - netCDF compression comp = 1 # 0 for no compression cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # Numpy initialisation npy.set_printoptions(precision=2) if debug: debug = True else: debug = False # File dim and grid inits t1 = years[0] t2 = years[1] if t2 <= 0: useLastYears = True t2 = -t2 else: useLastYears = False # Bound of period average to remove peri1 = timeInt[0] peri2 = timeInt[1] # Find dimension runN = len(listFiles) try: fi = cdm.open(inDir[0] + '/' + listFiles[0]) except: print ' *** file not found ', inDir[0] + '/' + listFiles[0] sys.exit(' Abort') if sw2d == 1: ptopd0 = fi['ptopdepth'] # Create variable handle latN = ptopd0.shape[2] basN = ptopd0.shape[1] elif sw2d == 2: ptopd0 = fi['ptopdepthxy'] # Create variable handle lonN = ptopd0.shape[2] latN = ptopd0.shape[1] #timN = ptopd0.shape[0] timN = t2 - t1 if fullTS: print ' !!! Working on full Time Serie (fullTS = True)' timN = ptopd0.shape[0] t1 = 0 t2 = timN t10 = t1 t20 = t2 # Get grid objects axesList = ptopd0.getAxisList() # Declare and open files for writing if os.path.isfile(outDir + '/' + outFile): os.remove(outDir + '/' + outFile) outFile_f = cdm.open(outDir + '/' + outFile, 'w') print ' Number of members:', len(listFiles) valmask = ptopd0.missing_value # init time axis time = cdm.createAxis(npy.float32(range(timN))) time.id = 'time' time.units = 'years since 1861' time.designateTime() # loop on variables # init percent array if sw2d == 1: varList = [ 'ptopdepth', 'ptopsigma', 'ptopso', 'ptopthetao', 'volpers', 'salpers', 'tempers' ] #varList = ['ptopdepth'] varDim = [1, 1, 1, 1, 0, 0, 0] percent = npy.ma.ones([runN, timN, basN, latN], dtype='float32') * 0. elif sw2d == 2: varList = ['ptopdepthxy', 'ptopsigmaxy', 'ptopsoxy', 'ptopthetaoxy'] #varList = ['ptopdepthxy'] varDim = [2, 2, 2, 2] percent = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * 0. varFill = [ valmask, valmask, valmask, valmask, valmask, valmask, valmask, valmask, valmask ] axis1D = [time, axesList[1], axesList[2]] axis0D = [time, axesList[1]] print ' timN = ', timN # loop on 1D variables for iv, var in enumerate(varList): ti0 = timc.clock() # Array inits if varDim[iv] == 2: isonvar = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * valmask vardiff = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * valmask varones = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * 1. axisVar = axis1D elif varDim[iv] == 1: isonvar = npy.ma.ones([runN, timN, basN, latN], dtype='float32') * valmask vardiff = npy.ma.ones([runN, timN, basN, latN], dtype='float32') * valmask varones = npy.ma.ones([runN, timN, basN, latN], dtype='float32') * 1. axisVar = axis1D else: isonvar = npy.ma.ones([runN, timN, basN], dtype='float32') * valmask vardiff = npy.ma.ones([runN, timN, basN], dtype='float32') * valmask varones = npy.ma.ones([runN, timN, basN], dtype='float32') * 1. axisVar = axis0D print ' Variable ', iv, var, varDim[iv] # loop over files to fill up array for ic, file in enumerate(listFiles): ft = cdm.open(inDir[0] + '/' + file) timeax = ft.getAxis('time') try: tmax = timeax.shape[0] except: print ic, file, timeax if ic == 0: tmax0 = tmax #print ic,file, tmax #adapt [t1,t2] time bounds to piControl last NN years if useLastYears: t1 = tmax - t20 t2 = tmax else: if tmax != tmax0: print 'tmax <> tmax0', tmax, tmax0 print 'wrong time axis: exiting...' return #print 'Time dims:',ic, t1,t2,tmax # read array computeVar = True allVars = ft.variables.keys() if 'ptopsigmaxy' in allVars: computeVar = False if (var == 'ptopsigmaxy') & computeVar: #print ' ic = ',ic # reconstruct from isondepthg and ptopdepthxy isond = ft('isondepthg', time=slice(t1, t2)) #print isond.data.shape, timN*latN*lonN itest = 94 * 360 + 150 axesList = isond.getAxisList() levs = axesList[1][:] levN = len(levs) #ti02 = timc.clock() levs3d0 = mv.reshape(npy.tile(levs, latN * lonN), (latN * lonN, levN)) #ti05 = timc.clock() isonRead = npy.ma.ones([timN, latN, lonN], dtype='float32') * valmask for it in range(timN): # loop on time to limit memory usage levs3d = levs3d0 * 1. depthlo = mv.reshape(vardepth[ic, it, ...], latN * lonN) depth3d = npy.reshape(npy.repeat(depthlo, levN), (latN * lonN, levN)) isond3d = mv.reshape( npy.transpose(isond.data[it, ...], (1, 2, 0)), (latN * lonN, levN)) #print isond3d[itest,:] isond3d[isond3d > valmask / 10] = 0. #print isond3d[itest,:] isond3dp1 = npy.roll(isond3d, -1, axis=1) isond3dp1[:, -1] = isond3d[:, -1] #print isond3dp1[itest,:] #levs3d[levs3d > 30. ] = 0. # to distinguish bottom masked points from surface masked points #print levs3d[itest,:] levs3d[(depth3d <= isond3d)] = 0. #print levs3d[itest,:] levs3d[(depth3d > isond3dp1)] = 0. #print levs3d[itest,:] #isonwrk = npy.sum(levs3d,axis=1) isonwrk = npy.max(levs3d, axis=1) if it < 0: print ic, it print depthlo[itest] print isond3d[itest, :] print isonwrk[itest] print isonRead[it, ...] = mv.reshape(isonwrk, (latN, lonN)) # <-- end of loop on time del (isond3d, isond3dp1) gc.collect() # mask with depthxy and where sigmaxy = 0 isonRead.mask = vardepth.mask[ic, ...] isonRead = mv.masked_where(isonRead == 0, isonRead) isonRead.long_name = var isonRead.units = 'sigma_n' isonRead.id = var del (isond, depth3d, levs3d, levs3d0, isonwrk) gc.collect() #ti3 = timc.clock() #print ti02-ti0,ti05-ti02, ti1-ti05,ti12-ti1,ti15-ti12,ti2-ti15,ti3-ti2 #print ti3-ti0 # write ptopsigmaxy if os.path.isfile(inDir[0] + '/work_ptopsigmaxy/' + file): os.remove(inDir[0] + '/work_ptopsigmaxy/' + file) fiout = cdm.open(inDir[0] + '/work_ptopsigmaxy/' + file, 'w') if ic == 0: print ' Creating ', inDir[0] + '/work_ptopsigmaxy/' + file isonsigxy = cdm.createVariable(isonRead, axes=axis1D, id='ptopsigmaxy') isonsigxy.long_name = 'Density of shallowest persistent ocean on ison' isonsigxy.units = 'sigma_n' fiout.write(isonsigxy.astype('float32')) fiout.close() else: # Direct read of variable isonRead = ft(var, time=slice(t1, t2)) #print isonRead.shape, timN if varFill[iv] != valmask: isonvar[ic, ...] = isonRead.filled(varFill[iv]) else: isonvar[ic, ...] = isonRead #print isonvar[ic,:,40,100] # compute percentage of non-masked points accros MME if iv == 0: maskvar = mv.masked_values(isonRead.data, valmask).mask percent[ic, ...] = npy.float32(npy.equal(maskvar, 0)) if mme: # if mme then just average Bowl and Agree fields varst = var + 'Agree' vardiff[ic, ...] = ft(varst, time=slice(t1, t2)) else: # Compute difference with average of first initN years, use mask of last month varinit = cdu.averager(isonvar[ic, peri1:peri2, ...], axis=0) for tr in range(timN): vardiff[ic, tr, ...] = isonvar[ic, tr, ...] - varinit vardiff[ic, ...].mask = isonvar[ic, ...].mask ft.close() # <-- end of loop on files # TODO remove masked points at longitudes 0 or 180deg for some models # if ptopdepthxy, keep for ptopsigmaxy computation (reconstruct from isondepthg and ptopdepthxy) if var == 'ptopdepthxy': vardepth = isonvar # Compute percentage of bin presence # Only keep points where percent > 50% if iv == 0: percenta = (cdu.averager(percent, axis=0)) * 100. percenta = mv.masked_less(percenta, 50) percentw = cdm.createVariable(percenta, axes=axis1D, id='ptoppercent') percentw._FillValue = valmask percentw.long_name = 'percentage of MME bin' percentw.units = '%' outFile_f.write(percentw.astype('float32')) # Sign of difference if mme: vardiffsgSum = cdu.averager(vardiff, axis=0) vardiffsgSum = cdm.createVariable(vardiffsgSum, axes=axisVar, id='foo') vardiffsgSum = maskVal(vardiffsgSum, valmask) vardiffsgSum.mask = percentw.mask else: vardiffsg = npy.copysign(varones, vardiff) # average signs vardiffsgSum = cdu.averager(vardiffsg, axis=0) vardiffsgSum = mv.masked_greater(vardiffsgSum, 10000.) vardiffsgSum.mask = percentw.mask vardiffsgSum._FillValue = valmask # average accross members isonVarAve = cdu.averager(isonvar, axis=0) isonVarAve = cdm.createVariable(isonVarAve, axes=axisVar, id='foo') # mask if varFill[iv] == valmask: isonVarAve = maskVal(isonVarAve, valmask) isonVarAve.mask = percentw.mask # Write isonave = cdm.createVariable(isonVarAve, axes=axisVar, id=isonRead.id) isonave.long_name = isonRead.long_name isonave.units = isonRead.units isonavediff = cdm.createVariable(vardiffsgSum, axes=axisVar, id=isonRead.id + 'Agree') isonavediff.long_name = isonRead.long_name isonavediff.units = isonRead.units outFile_f.write(isonave.astype('float32')) outFile_f.write(isonavediff.astype('float32')) tf = timc.clock() #print ' time var',tf-ti0 # <--- end of loop on variables outFile_f.close() fi.close()
# Python module imports import os import shutil import subprocess import sys import cdms2 as cdm # Add durolib to path sys.path.insert(1, '/export/durack1/git/pylib') # Assumes crunchy/oceanonly from durolib import globalAttWrite # Set cdms preferences - no compression, no shuffling, no complaining cdm.setNetcdfDeflateFlag(1) # 1-9, min to max - Comes at heavy IO (read/write time cost) cdm.setNetcdfDeflateLevelFlag(9) cdm.setNetcdfShuffleFlag(0) cdm.setCompressionWarnings(0) # Turn off nag messages # Set bounds automagically # cdm.setAutoBounds(1) ; # Use with caution # Set build info once buildDate = '141126' outPath = '/work/durack1/Shared/141126_metrics-acme' # Create input variable lists uvcdatInstall = ''.join( ['/export/durack1/', buildDate, '_pcmdi_metrics/PCMDI_METRICS/bin/']) # Specify inputs: # Realm ModelId InputFiles SourceDirectory data = [ ['atmos', 'ACME-CAM5-SE_v0pt1',
def processCmdLine(self): parser = argparse.ArgumentParser( description='UV-CDAT Climate Modeling Diagnostics', usage='%(prog)s --path1 [options]') parser.add_argument('--path', '-p', action='append', nargs=1, help="Path(s) to dataset(s). This is required. If two paths need different filters, set one here and one in path2.") parser.add_argument('--path2', '-q', action='append', nargs=1, help="Path to a second dataset.") parser.add_argument('--obspath', action='append', nargs=1, help="Path to an observational dataset") parser.add_argument('--cachepath', nargs=1, help="Path for temporary and cachced files. Defaults to /tmp") # parser.add_argument('--realm', '-r', nargs=1, choices=self.realm_types, # help="The realm type. Current valid options are 'land' and 'atmosphere'") parser.add_argument('--filter', '-f', nargs=1, help="A filespec filter. This will be applied to the dataset path(s) (--path option) to narrow down file choices.") parser.add_argument('--filter2', '-g', nargs=1, help="A filespec filter. This will be applied to the second dataset path (--path2 option) to narrow down file choices.") parser.add_argument('--new_filter', '-F', action='append', nargs=1, help="A filespec filter. This will be applied to the corresponding dataset path to narrow down file choices.") parser.add_argument('--packages', '--package', '-k', nargs='+', help="The diagnostic packages to run against the dataset(s). Multiple packages can be specified.") parser.add_argument('--sets', '--set', '-s', nargs='+', help="The sets within a diagnostic package to run. Multiple sets can be specified. If multiple packages were specified, the sets specified will be searched for in each package") parser.add_argument('--vars', '--var', '-v', nargs='+', help="Specify variables of interest to process. The default is all variables which can also be specified with the keyword ALL") parser.add_argument('--list', '-l', nargs=1, choices=['sets', 'vars', 'variables', 'packages', 'seasons', 'regions', 'translations', 'options'], help="Determine which packages, sets, regions, variables, and variable options are available") # maybe eventually add compression level too.... parser.add_argument('--compress', nargs=1, choices=['no', 'yes'], help="Turn off netCDF compression. This can be required for other utilities to be able to process the output files (e.g. parallel netCDF based tools") #no compression, add self state parser.add_argument('--outputpre', nargs=1, help="Specify an output filename prefix to be prepended to all file names created internally. For example --outputpre myout might generate myout-JAN.nc, etc") parser.add_argument('--outputpost', nargs=1, help="Specify an output filename postfix to be appended to all file names created internally. For example --outputpost _OBS might generate set1-JAN_OBS.nc, etc") parser.add_argument('--outputdir', '-O', nargs=1, help="Directory in which output files will be written." ) parser.add_argument('--seasons', nargs='+', choices=all_seasons, help="Specify which seasons to generate climatoogies for") parser.add_argument('--years', nargs='+', help="Specify which years to include when generating climatologies") parser.add_argument('--months', nargs='+', choices=all_months, help="Specify which months to generate climatologies for") parser.add_argument('--climatologies', '-c', nargs=1, choices=['no','yes'], help="Specifies whether or not climatologies should be generated") parser.add_argument('--plots', '-t', nargs=1, choices=['no','yes'], help="Specifies whether or not plots should be generated") parser.add_argument('--plottype', nargs=1) parser.add_argument('--precomputed', nargs=1, choices=['no','yes'], help="Specifies whether standard climatologies are stored with the dataset (*-JAN.nc, *-FEB.nc, ... *-DJF.nc, *-year0.nc, etc") parser.add_argument('--json', '-j', nargs=1, choices=['no', 'yes'], help="Produce JSON output files as part of climatology/diags generation") # same parser.add_argument('--netcdf', '-n', nargs=1, choices=['no', 'yes'], help="Produce NetCDF output files as part of climatology/diags generation") # same parser.add_argument('--xml', '-x', nargs=1, choices=['no', 'yes'], help="Produce XML output files as part of climatology/diags generation") parser.add_argument('--seasonally', action='store_true', help="Produce climatologies for all of the defined seasons. To get a list of seasons, run --list seasons") parser.add_argument('--monthly', action='store_true', help="Produce climatologies for all predefined months") parser.add_argument('--yearly', action='store_true', help="Produce annual climatogolies for all years in the dataset") parser.add_argument('--timestart', nargs=1, help="Specify the starting time for the dataset, such as 'months since Jan 2000'") parser.add_argument('--timebounds', nargs=1, choices=['daily', 'monthly', 'yearly'], help="Specify the time boudns for the dataset") parser.add_argument('--verbose', '-V', action='count', help="Increase the verbosity level. Each -v option increases the verbosity more.") # count parser.add_argument('--name', action='append', nargs=1, help="Specify option names for the datasets for plot titles, etc") #optional name for the set # This will be the standard list of region names NCAR has parser.add_argument('--regions', '--region', nargs='+', choices=all_regions.keys(), help="Specify a geographical region of interest. Note: Multi-word regions need quoted, e.g. 'Central Canada'") parser.add_argument('--starttime', nargs=1, help="Specify a start time in the dataset") parser.add_argument('--endtime', nargs=1, help="Specify an end time in the dataset") parser.add_argument('--translate', nargs='?', default='y', help="Enable translation for obs sets to datasets. Optional provide a colon separated input to output list e.g. DSVAR1:OBSVAR1") parser.add_argument('--varopts', nargs='+', help="Variable auxillary options") args = parser.parse_args() if(args.list != None): if args.list[0] == 'translations': print "Default variable translations: " self.listTranslations() quit() if args.list[0] == 'regions': print "Available geographical regions: ", all_regions.keys() quit() if args.list[0] == 'seasons': print "Available seasons: ", all_seasons quit() if args.list[0] == 'packages': print "Listing available packages:" print self.all_packages.keys() quit() if args.list[0] == 'sets': if args.packages == None: print "Please specify package before requesting available diags sets" quit() for p in args.packages: print 'Avaialble sets for package ', p, ':' sets = self.listSets(p) keys = sets.keys() for k in keys: print 'Set',k, ' - ', sets[k] quit() if args.list[0] == 'variables' or args.list[0] == 'vars': if args.path != None: for i in args.path: self._opts['path'].append(i[0]) else: print 'Must provide a dataset when requesting a variable listing' quit() self.listVariables(args.packages, args.sets) quit() if args.list[0] == 'options': if args.path!= None: for i in args.path: self._opts['path'].append(i[0]) else: print 'Must provide a dataset when requesting a variable listing' quit() self.listVarOptions(args.packages, args.sets, args.vars) quit() # Generally if we've gotten this far, it means no --list was specified. If we don't have # at least a path, we should exit. if(args.path != None): for i in args.path: self._opts['path'].append(i[0]) else: print 'Must specify a path or the --list option at a minimum.' print 'For help, type "diags --help".' quit() if(args.path2 != None): for i in args.path2: self._opts['path2'].append(i[0]) if(args.obspath != None): for i in args.obspath: self._opts['obspath'].append(i[0]) # TODO: Should some pre-defined filters be "nameable" here? if(args.filter != None): # Only supports one filter argument, see filter2. self._opts['filter'] = args.filter[0] self._opts['user_filter'] = True # for i in args.filter: # self._opts['filter'].append(i[0]) if(args.filter2 != None): # This is a second filter argument. self._opts['filter2'] = args.filter2[0] self._opts['user_filter'] = True if(args.new_filter != None): # like filter but with multiple arguments for i in args.new_filter: self._opts['new_filter'].append(i[0]) if(args.cachepath != None): self._opts['cachepath'] = args.cachepath[0] self._opts['seasonally'] = args.seasonally self._opts['monthly'] = args.monthly if(args.varopts != None): self._opts['varopts'] = args.varopts if(args.starttime != None): self._opts['start'] = args.starttime[0] if(args.endtime != None): self._opts['end'] = args.endtime[0] # I checked; these are global and it doesn't seem to matter if you import cdms2 multiple times; # they are still set after you set them once in the python process. if(args.compress != None): if(args.compress[0] == 'no'): self._opts['compress'] = False else: self._opts['compress'] = True if self._opts['compress'] == True: print 'Enabling compression for output netCDF files' cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(9) else: print 'Disabling compression for output netCDF files' cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) if(args.json != None): if(args.json[0] == 'no'): self._opts['json'] = False else: self._opts['json'] = True if(args.xml != None): if(args.xml[0] == 'no'): self._opts['xml'] = False else: self._opts['xml'] = True if(args.netcdf != None): if(args.netcdf[0] == 'no'): self._opts['netcdf'] = False else: self._opts['netcdf'] = True if(args.plots != None): if(args.plots[0].lower() == 'no' or args.plots[0] == 0): self._opts['plots'] = False else: self._opts['plots'] = True if(args.climatologies != None): if(args.climatologies[0] == 'no'): self._opts['climatologies'] = False else: self._opts['climatologies'] = True self._opts['verbose'] = args.verbose if(args.name != None): for i in args.name: self._opts['dsnames'].append(i[0]) # Help create output file names if(args.outputpre != None): self._opts['outputpre'] = args.outputpre[0] if(args.outputpost != None): self._opts['outputpost'] = args.outputpost[0] # Output directory if(args.outputdir != None): if not os.path.isdir(args.outputdir[0]): print "ERROR, output directory",args.outputdir[0],"does not exist!" quit() self._opts['outputdir'] = args.outputdir[0] if(args.translate != 'y'): print args.translate print self._opts['translate'] quit() # Timestart assumes a string like "months since 2000". I can't find documentation on # toRelativeTime() so I have no idea how to check for valid input # This is required for some of the land model sets I've seen if(args.timestart != None): self._opts['reltime'] = args.timestart # cdutil.setTimeBounds{bounds}(variable) if(args.timebounds != None): self._opts['bounds'] = args.timebounds # Check if a user specified package actually exists # Note: This is case sensitive..... if(args.packages != None): plist = [] for x in args.packages: if x.upper() in self.all_packages.keys(): plist.append(x) elif x in self.all_packages.keys(): plist.append(x.lower()) if plist == []: print 'Package name(s) ', args.packages, ' not valid' print 'Valid package names: ', self.all_packages.keys() quit() else: self._opts['packages'] = plist # TODO: Requires exact case; probably make this more user friendly and look for mixed case if(args.regions != None): rlist = [] for x in args.regions: if x in all_regions.keys(): rlist.append(x) print 'REGIONS: ', rlist self._opts['regions'] = rlist # Given user-selected packages, check for user specified sets # Note: If multiple packages have the same set names, then they are all added to the list. # This might be bad since there is no differentiation of lwmg['id==set'] and lmwg2['id==set'] if(self._opts['packages'] == None and args.sets != None): print 'No package specified' self._opts['sets'] = args.sets if(args.sets != None and self._opts['packages'] != None): # unfortuantely, we have to go through all of this.... # there should be a non-init of the class method to list sets/packages/etc, # ie a dictionary perhaps? sets = [] import metrics.fileio.filetable as ft import metrics.fileio.findfiles as fi import metrics.packages.diagnostic_groups package = self._opts['packages'] if package[0].lower() == 'lmwg': import metrics.packages.lmwg.lmwg elif package[0].lower()=='amwg': import metrics.packages.amwg.amwg dtree = fi.dirtree_datafiles(self, pathid=0) filetable = ft.basic_filetable(dtree, self) dm = metrics.packages.diagnostic_groups.diagnostics_menu() pclass = dm[package[0].upper()]() slist = pclass.list_diagnostic_sets() keys = slist.keys() keys.sort() for k in keys: fields = k.split() for user in args.sets: if user == fields[0]: sets.append(user) self._opts['sets'] = sets if sets != args.sets: print 'sets requested ', args.sets print 'sets available: ', slist exit(1) # TODO: Check against an actual list of variables from the set if args.vars != None: self._opts['vars'] = args.vars # If --yearly is set, then we will add 'ANN' to the list of climatologies if(args.yearly == True): self._opts['yearly'] = True self._opts['times'].append('ANN') # If --monthly is set, we add all months to the list of climatologies if(args.monthly == True): self._opts['monthly'] = True self._opts['times'].extend(all_months) # If --seasonally is set, we add all 4 seasons to the list of climatologies if(args.seasonally == True): self._opts['seasonally'] = True self._opts['times'].extend(all_seasons) # This allows specific individual months to be added to the list of climatologies if(args.months != None): if(args.monthly == True): print "Please specify just one of --monthly or --months" quit() else: mlist = [x for x in all_months if x in args.months] self._opts['times'] = self._opts['times']+mlist # This allows specific individual years to be added to the list of climatologies. # Note: Checkign for valid input is impossible until we look at the dataset # This has to be special cased since typically someone will be saying # "Generate climatologies for seasons for years X, Y, and Z of my dataset" if(args.years != None): if(args.yearly == True): print "Please specify just one of --yearly or --years" quit() else: self._opts['years'] = args.years if(args.seasons != None): if(args.seasonally == True): print "Please specify just one of --seasonally or --seasons" quit() else: slist = [x for x in all_seasons if x in args.seasons] self._opts['times'] = self._opts['times']+slist
def mmeAveMsk3D(listFiles, years, inDir, outDir, outFile, timeInt, mme, ToeType, debug=True): ''' The mmeAveMsk3D() function averages rhon/lat density bined files with differing masks It ouputs - the MME - a percentage of non-masked bins - the sign agreement of period2-period1 differences - ToE per run and for MME Author: Eric Guilyardi : [email protected] Created on Tue Nov 21 2016 Inputs: ------- - listFiles(str) - the list of files to be averaged - years(t1,t2) - years for slice read - inDir[](str) - input directory where files are stored (add histnat as inDir[1] for ToE) - outDir(str) - output directory - outFile(str) - output file - timeInt(2xindices) - indices of init period to compare with (e.g. [1,20]) - mme(bool) - multi-model mean (will read in single model ensemble stats) - ToeType(str) - ToE type ('F': none, 'histnat') -> requires running first mm+mme without ToE to compute Stddev - debug <optional> - boolean value Notes: ----- - EG 21 Nov 2016 - Initial function write - TODO : - add computation of ToE per model (toe 1 and toe 2) see ticket #50 - add isonhtc (see ticket #48) ''' # CDMS initialisation - netCDF compression comp = 1 # 0 for no compression cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # Numpy initialisation npy.set_printoptions(precision=2) if debug: debug = True else: debug = False # File dim and grid inits t1 = years[0] t2 = years[1] # Bound of period average to remove peri1 = timeInt[0] peri2 = timeInt[1] fi = cdm.open(inDir[0] + '/' + listFiles[0]) # Switch if only variables below the bowl are present/treated nobowl = True if nobowl: isond0 = fi['isondepthgBowl'] # Create variable handle else: isond0 = fi['isondepthg'] # Create variable handle # Get grid objects axesList = isond0.getAxisList() sigmaGrd = isond0.getLevel() #time = isond0.getTime() lonN = isond0.shape[3] latN = isond0.shape[2] levN = isond0.shape[1] varsig = 'ptopsigmaxy' # Limit number of models to 3 for testing of mme #if mme: # listFiles = listFiles[0:2] # print ' !!! ### Testing 3 models ###', listFiles # Declare and open files for writing if os.path.isfile(outDir + '/' + outFile): os.remove(outDir + '/' + outFile) outFile_f = cdm.open(outDir + '/' + outFile, 'w') #timN = isond0.shape[0] timN = t2 - t1 runN = len(listFiles) print ' Number of members:', len(listFiles) valmask = isond0.missing_value varList = ['isondepthg', 'persistmxy', 'sog', 'thetaog', 'isonthickg'] varFill = [valmask, valmask, valmask, valmask, valmask] percent = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * 0. varbowl = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * 1. #varList = ['isondepthg'] #print ' !!! ### Testing one variable ###', varList # init sigma axis sigma = cdm.createAxis(npy.float32(range(1))) sigma.id = axesList[1].id sigma.units = axesList[1].units sigma.designateTime() # init time axis time = cdm.createAxis(npy.float32(range(timN))) time.id = 'time' time.units = 'years since 1861' # init ensemble axis ensembleAxis = cdm.createAxis(npy.float32(range(runN))) ensembleAxis.id = 'members' ensembleAxis.units = 'N' # Output axis sigmaList = [sigma, axesList[2], axesList[3]] # sigma, lat, lon sigmaTimeList = [sigma, time, axesList[2], axesList[3]] # sigma, time, lat, lon # init arrays isonvar = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * valmask varbowl2D = npy.ma.ones([runN, timN, latN, lonN], dtype='float32') * valmask varstd, varToE1, varToE2 = [ npy.ma.ones([runN, latN, lonN], dtype='float32') * valmask for _ in range(3) ] # Loop on density levels (for memory management, becomes UNLIMITED axis and requires a ncpq to reorder dimensions) delta_ib = 1 print ' Sigma index:' for ib in range(levN): ib1 = ib + delta_ib print ib, tim0 = timc.clock() # loop on variables for iv, var in enumerate(varList): if nobowl: varb = var + 'Bowl' else: varb = var if ib == 0: print ' Variable ', iv, varb # loop over files to fill up array for i, file in enumerate(listFiles): tim01 = timc.clock() ft = cdm.open(inDir[0] + '/' + file) model = file.split('.')[1] timeax = ft.getAxis('time') if i == 0: tmax0 = timeax.shape[0] tmax = timeax.shape[0] if tmax != tmax0: print 'wrong time axis: exiting...' return # read array isonRead = ft(varb, time=slice(t1, t2), lev=slice(ib, ib1)).squeeze() if varFill[iv] != valmask: isonvar[i, ...] = isonRead.filled(varFill[iv]) else: isonvar[i, ...] = isonRead tim02 = timc.clock() # compute percentage of non-masked points accros MME if iv == 0: maskvar = mv.masked_values(isonRead.data, valmask).mask percent[i, ...] = npy.float32(npy.equal(maskvar, 0)) tim03 = timc.clock() if mme: # if mme then just accumulate Bowl, Agree and Std fields #varst = var+'Agree' #vardiff[i,...] = ft(varst,time = slice(t1,t2),lev = slice(ib,ib1)).squeeze() isonRead = ft(varb, time=slice(t1, t2), lev=slice(ib, ib1)).squeeze() varbowl2D[i, ...] = isonRead else: # Compute difference with average of first initN years #varinit = cdu.averager(isonvar[i,peri1:peri2,...],axis=0) #for t in range(timN): # vardiff[i,t,...] = isonvar[i,t,...] - varinit #vardiff[i,...].mask = isonvar[i,...].mask # Read bowl to truncate field above bowl if ib == 0 and iv == 0: varbowl[i, ...] = ft(varsig, time=slice(t1, t2)) #varbowl[i,...] = bowlRead # Compute Stddev varstd[i, ...] = npy.ma.std(isonvar[i, ...], axis=0) # Compute ToE if ToeType == 'histnat': toto = 1 # TODO # Read mean and Std dev from histnat # if i == 0: # filehn = glob.glob(inDir[1]+'/cmip5.'+model+'.*zon2D*')[0] # #filehn = replace(outFile,'historical','historicalNat') # fthn = cdm.open(filehn) # varmeanhn = fthn(var) # varst = var+'Std' # varmaxstd = fthn(varst) # toemult = 1. # signal = npy.reshape(isonvar[i,...]-varmeanhn,(timN,basN*levN*latN)) # noise = npy.reshape(varmaxstd,(basN*levN*latN)) # varToE1[i,...] = npy.reshape(findToE(signal, noise, toemult),(basN,levN,latN)) # toemult = 2. # varToE2[i,...] = npy.reshape(findToE(signal, noise, toemult),(basN,levN,latN)) tim04 = timc.clock() ft.close() #print 'ib, section 1 timing',ib, tim02-tim01,tim03-tim02,tim04-tim03 # <-- end of loop on files (i) tim1 = timc.clock() # Compute percentage of bin presence # Only keep points where percent > 50% if iv == 0: percenta = (cdu.averager(percent, axis=0)) * 100. percenta = mv.masked_less(percenta, 50) percenta = npy.reshape(percenta, [delta_ib, timN, latN, lonN]) percentw = cdm.createVariable(percenta, axes=sigmaTimeList, id='isonpercent') percentw._FillValue = valmask percentw.long_name = 'percentage of MME bin' percentw.units = '%' outFile_f.write(percentw.astype('float32'), extend=1, index=ib) # Sign of difference #if mme: # vardiffsgSum = cdu.averager(vardiff, axis=0) # vardiffsgSum = cdm.createVariable(vardiffsgSum , axes = sigmaTimeList , id = 'foo') # vardiffsgSum = maskVal(vardiffsgSum, valmask) # vardiffsgSum.mask = percentw.mask #else: # vardiffsg = npy.copysign(varones,vardiff) # # average signs # vardiffsgSum = cdu.averager(vardiffsg, axis=0) # vardiffsgSum = mv.masked_greater(vardiffsgSum, 10000.) # vardiffsgSum.mask = percentw.mask # vardiffsgSum._FillValue = valmask # average variable accross members isonVarAve = cdu.averager(isonvar, axis=0) isonVarAve = npy.reshape(isonVarAve, [delta_ib, timN, latN, lonN]) isonVarAve = cdm.createVariable(isonVarAve, axes=sigmaTimeList, id='foo') # mask if varFill[iv] == valmask: isonVarAve = maskVal(isonVarAve, valmask) isonVarAve.mask = percentw.mask tim2 = timc.clock() # Only keep points with rhon > bowl-delta_rho delta_rho = 0. # mme case if mme: # start from average of <var>Agree isonVarBowl = cdu.averager(varbowl2D, axis=0) isonVarBowl = npy.reshape(isonVarBowl, [delta_ib, timN, latN, lonN]) isonVarBowl = cdm.createVariable(isonVarBowl, axes=sigmaTimeList, id='foo') isonVarBowl = maskVal(isonVarBowl, valmask) isonVarBowl.mask = percentw.mask # Compute intermodel stddev isonVarStd = statistics.std(varbowl2D, axis=0) isonVarStd = npy.reshape(isonVarStd, [delta_ib, timN, latN, lonN]) isonVarStd = cdm.createVariable(isonVarStd, axes=sigmaTimeList, id='foo') isonVarStd = maskVal(isonVarStd, valmask) isonVarStd.mask = percentw.mask # Write isonvarbowlw = cdm.createVariable(isonVarBowl, axes=sigmaTimeList, id=isonRead.id) isonvarbowlw.long_name = isonRead.long_name isonvarbowlw.units = isonRead.units isonvarstdw = cdm.createVariable(isonVarStd, axes=sigmaTimeList, id=isonRead.id + 'Std') isonvarstdw.long_name = isonRead.long_name + ' intermodel std' isonvarstdw.units = isonRead.units outFile_f.write(isonvarbowlw.astype('float32'), extend=1, index=ib) outFile_f.write(isonvarstdw.astype('float32'), extend=1, index=ib) #if ib == 0 and iv == 0: # # TODO review # # Read multimodel sigma on bowl and average in time # file1d = replace(outDir+'/'+outFile,'2D','1D') # if os.path.isfile(file1d): # f1d = cdm.open(file1d) # else: # print 'ERROR:',file1d,'missing (if mme, run 2D first)' # sys.exit(1) # bowlRead = f1d(varsig,time = slice(t1,t2),lev = slice(ib,ib1)) # f1d.close() # siglimit = cdu.averager(bowlRead, axis=0) - delta_rho # TODO: remove loop by building global array with 1/0 #if sw2d == 1: # for il in range(latN): # for ib in range(basN): # #if ib == 2: # # print il, siglimit[ib,il] # if siglimit[ib,il] < valmask/1000.: # # if mme bowl density defined, mask above bowl # index = (npy.argwhere(sigmaGrd[:] >= siglimit[ib,il])) # isonVarBowl [:,ib,0:index[0],il].mask = True # isonVarStd [:,ib,0:index[0],il].mask = True # vardiffsgSum[:,ib,0:index[0],il].mask = True # else: # # mask all points # isonVarBowl [:,ib,:,il].mask = True # isonVarStd [:,ib,:,il].mask = True # vardiffsgSum[:,ib,:,il].mask = True # mm case else: isonVarBowl = isonVarAve * 1. # start from variable #isonVarStd = isonVarAve*1. # start from variable if ib == 0 and iv == 0: # build bowl position siglimit = cdu.averager(varbowl, axis=0) # average accross members siglimit = npy.reshape(siglimit, [timN * latN * lonN]) - delta_rho if iv == 0: sigarr = siglimit * 1. sigarr[:] = sigmaGrd[ib] # test i = 60 j = 60 ij = j * lonN + i isonVarBowl = npy.reshape(isonVarBowl, [timN * latN * lonN]) #vardiffsgSum = npy.reshape(vardiffsgSum,[timN*latN*lonN]) isonVarBowl.mask = npy.where(sigarr < siglimit, True, isonVarBowl.mask) #vardiffsgSum.mask = npy.where(sigarr < siglimit, True, vardiffsgSum.mask) isonVarBowl = npy.reshape(isonVarBowl, [timN, latN, lonN]) #vardiffsgSum = npy.reshape(vardiffsgSum,[timN,latN,lonN]) isonVarBowl = maskVal(isonVarBowl, valmask) #vardiffsgSum = maskVal(vardiffsgSum, valmask) # Find max of Std dev of all members isonVarStd = npy.ma.max(varstd, axis=0) # mask isonVarStd = maskVal(isonVarStd, valmask) # Write #isonave = cdm.createVariable(isonVarAve, axes = sigmaTimeList, id = isonRead.id) #isonave.long_name = isonRead.long_name #isonave.units = isonRead.units #vardiffsgSum = npy.reshape(vardiffsgSum,[delta_ib,timN,latN,lonN]) #isonavediff = cdm.createVariable(vardiffsgSum, axes = sigmaTimeList, id = isonRead.id+'Agree') #isonavediff.long_name = isonRead.long_name #isonavediff.units = isonRead.units isonVarBowl = npy.reshape(isonVarBowl, [delta_ib, timN, latN, lonN]) isonavebowl = cdm.createVariable(isonVarBowl, axes=sigmaTimeList, id=isonRead.id + 'Bowl') isonavebowl.long_name = isonRead.long_name isonavebowl.units = isonRead.units isonVarStd = npy.reshape(isonVarStd, [delta_ib, latN, lonN]) isonmaxstd = cdm.createVariable(isonVarStd, axes=sigmaList, id=isonRead.id + 'Std') isonmaxstd.long_name = isonRead.long_name isonmaxstd.units = isonRead.units #outFile_f.write( isonave.astype('float32'), extend = 1, index = ib) #outFile_f.write(isonavediff.astype('float32'), extend = 1, index = ib) outFile_f.write(isonavebowl.astype('float32'), extend=1, index=ib) outFile_f.write(isonmaxstd.astype('float32'), extend=1, index=ib) tim3 = timc.clock() if ToeType == 'histnat': isontoe1 = cdm.createVariable( varToE1, axes=[ensembleAxis, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'ToE1') isontoe1.long_name = 'ToE 1 for ' + isonRead.long_name isontoe1.units = 'Year' isontoe2 = cdm.createVariable( varToE2, axes=[ensembleAxis, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'ToE2') isontoe2.long_name = 'ToE 2 for ' + isonRead.long_name isontoe2.units = 'Year' outFile_f.write(isontoe1.astype('float32'), extend=1, index=ib) outFile_f.write(isontoe2.astype('float32'), extend=1, index=ib) tim4 = timc.clock() # <--- end of loop on variables #print 'ib, timing',ib, tim01-tim0,tim1-tim01,tim2-tim1,tim3-tim2,tim4-tim3 # <--- end of loop on density print ' ' outFile_f.close() fi.close()
def setup_cdms2(self): cdms2.setNetcdfShuffleFlag(0) # Argument is either 0 or 1 cdms2.setNetcdfDeflateFlag(0) # Argument is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(0) # Argument is int between 0 and 9
def processCmdLine(self): parser = argparse.ArgumentParser( description="UV-CDAT Climate Modeling Diagnostics", usage="%(prog)s --path1 [options]" ) parser.add_argument( "--path", "-p", action="append", nargs=1, help="Path(s) to dataset(s). This is required. If two paths need different filters, set one here and one in path2.", ) parser.add_argument("--path2", "-q", action="append", nargs=1, help="Path to a second dataset.") parser.add_argument("--obspath", action="append", nargs=1, help="Path to an observational dataset") parser.add_argument("--cachepath", nargs=1, help="Path for temporary and cachced files. Defaults to /tmp") # parser.add_argument('--realm', '-r', nargs=1, choices=self.realm_types, # help="The realm type. Current valid options are 'land' and 'atmosphere'") parser.add_argument( "--filter", "-f", nargs=1, help="A filespec filter. This will be applied to the dataset path(s) (--path option) to narrow down file choices.", ) parser.add_argument( "--filter2", "-g", nargs=1, help="A filespec filter. This will be applied to the second dataset path (--path2 option) to narrow down file choices.", ) parser.add_argument( "--new_filter", "-F", action="append", nargs=1, help="A filespec filter. This will be applied to the corresponding dataset path to narrow down file choices.", ) parser.add_argument( "--packages", "--package", "-k", nargs="+", help="The diagnostic packages to run against the dataset(s). Multiple packages can be specified.", ) parser.add_argument( "--sets", "--set", "-s", nargs="+", help="The sets within a diagnostic package to run. Multiple sets can be specified. If multiple packages were specified, the sets specified will be searched for in each package", ) parser.add_argument( "--vars", "--var", "-v", nargs="+", help="Specify variables of interest to process. The default is all variables which can also be specified with the keyword ALL", ) parser.add_argument( "--list", "-l", nargs=1, choices=["sets", "vars", "variables", "packages", "seasons", "regions", "translations", "options"], help="Determine which packages, sets, regions, variables, and variable options are available", ) # maybe eventually add compression level too.... parser.add_argument( "--compress", nargs=1, choices=["no", "yes"], help="Turn off netCDF compression. This can be required for other utilities to be able to process the output files (e.g. parallel netCDF based tools", ) # no compression, add self state parser.add_argument( "--outputpre", nargs=1, help="Specify an output filename prefix to be prepended to all file names created internally. For example --outputpre myout might generate myout-JAN.nc, etc", ) parser.add_argument( "--outputpost", nargs=1, help="Specify an output filename postfix to be appended to all file names created internally. For example --outputpost _OBS might generate set1-JAN_OBS.nc, etc", ) parser.add_argument("--outputdir", "-O", nargs=1, help="Directory in which output files will be written.") parser.add_argument( "--seasons", nargs="+", choices=all_seasons, help="Specify which seasons to generate climatoogies for" ) parser.add_argument("--years", nargs="+", help="Specify which years to include when generating climatologies") parser.add_argument( "--months", nargs="+", choices=all_months, help="Specify which months to generate climatologies for" ) parser.add_argument( "--climatologies", "-c", nargs=1, choices=["no", "yes"], help="Specifies whether or not climatologies should be generated", ) parser.add_argument( "--plots", "-t", nargs=1, choices=["no", "yes"], help="Specifies whether or not plots should be generated" ) parser.add_argument("--plottype", nargs=1) parser.add_argument( "--precomputed", nargs=1, choices=["no", "yes"], help="Specifies whether standard climatologies are stored with the dataset (*-JAN.nc, *-FEB.nc, ... *-DJF.nc, *-year0.nc, etc", ) parser.add_argument( "--json", "-j", nargs=1, choices=["no", "yes"], help="Produce JSON output files as part of climatology/diags generation", ) # same parser.add_argument( "--netcdf", "-n", nargs=1, choices=["no", "yes"], help="Produce NetCDF output files as part of climatology/diags generation", ) # same parser.add_argument( "--xml", "-x", nargs=1, choices=["no", "yes"], help="Produce XML output files as part of climatology/diags generation", ) parser.add_argument( "--seasonally", action="store_true", help="Produce climatologies for all of the defined seasons. To get a list of seasons, run --list seasons", ) parser.add_argument("--monthly", action="store_true", help="Produce climatologies for all predefined months") parser.add_argument( "--yearly", action="store_true", help="Produce annual climatogolies for all years in the dataset" ) parser.add_argument( "--timestart", nargs=1, help="Specify the starting time for the dataset, such as 'months since Jan 2000'" ) parser.add_argument( "--timebounds", nargs=1, choices=["daily", "monthly", "yearly"], help="Specify the time boudns for the dataset", ) parser.add_argument( "--verbose", "-V", action="count", help="Increase the verbosity level. Each -v option increases the verbosity more.", ) # count parser.add_argument( "--name", action="append", nargs=1, help="Specify option names for the datasets for plot titles, etc" ) # optional name for the set # This will be the standard list of region names NCAR has parser.add_argument( "--regions", "--region", nargs="+", choices=all_regions.keys(), help="Specify a geographical region of interest. Note: Multi-word regions need quoted, e.g. 'Central Canada'", ) parser.add_argument("--starttime", nargs=1, help="Specify a start time in the dataset") parser.add_argument("--endtime", nargs=1, help="Specify an end time in the dataset") parser.add_argument( "--translate", nargs="?", default="y", help="Enable translation for obs sets to datasets. Optional provide a colon separated input to output list e.g. DSVAR1:OBSVAR1", ) parser.add_argument("--varopts", nargs="+", help="Variable auxillary options") args = parser.parse_args() if args.list != None: if args.list[0] == "translations": print "Default variable translations: " self.listTranslations() quit() if args.list[0] == "regions": print "Available geographical regions: ", all_regions.keys() quit() if args.list[0] == "seasons": print "Available seasons: ", all_seasons quit() if args.list[0] == "packages": print "Listing available packages:" print self.all_packages.keys() quit() if args.list[0] == "sets": if args.packages == None: print "Please specify package before requesting available diags sets" quit() for p in args.packages: print "Avaialble sets for package ", p, ":" sets = self.listSets(p) keys = sets.keys() for k in keys: print "Set", k, " - ", sets[k] quit() if args.list[0] == "variables" or args.list[0] == "vars": if args.path != None: for i in args.path: self._opts["path"].append(i[0]) else: print "Must provide a dataset when requesting a variable listing" quit() self.listVariables(args.packages, args.sets) quit() if args.list[0] == "options": if args.path != None: for i in args.path: self._opts["path"].append(i[0]) else: print "Must provide a dataset when requesting a variable listing" quit() self.listVarOptions(args.packages, args.sets, args.vars) quit() # Generally if we've gotten this far, it means no --list was specified. If we don't have # at least a path, we should exit. if args.path != None: for i in args.path: self._opts["path"].append(i[0]) else: print "Must specify a path or the --list option at a minimum." print 'For help, type "diags --help".' quit() if args.path2 != None: for i in args.path2: self._opts["path2"].append(i[0]) if args.obspath != None: for i in args.obspath: self._opts["obspath"].append(i[0]) # TODO: Should some pre-defined filters be "nameable" here? if args.filter != None: # Only supports one filter argument, see filter2. self._opts["filter"] = args.filter[0] self._opts["user_filter"] = True # for i in args.filter: # self._opts['filter'].append(i[0]) if args.filter2 != None: # This is a second filter argument. self._opts["filter2"] = args.filter2[0] self._opts["user_filter"] = True if args.new_filter != None: # like filter but with multiple arguments for i in args.new_filter: self._opts["new_filter"].append(i[0]) if args.cachepath != None: self._opts["cachepath"] = args.cachepath[0] self._opts["seasonally"] = args.seasonally self._opts["monthly"] = args.monthly if args.starttime != None: self._opts["start"] = args.starttime[0] if args.endtime != None: self._opts["end"] = args.endtime[0] # I checked; these are global and it doesn't seem to matter if you import cdms2 multiple times; # they are still set after you set them once in the python process. if args.compress != None: if args.compress[0] == "no": self._opts["compress"] = False else: self._opts["compress"] = True if self._opts["compress"] == True: print "Enabling compression for output netCDF files" cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(9) else: print "Disabling compression for output netCDF files" cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) if args.json != None: if args.json[0] == "no": self._opts["json"] = False else: self._opts["json"] = True if args.xml != None: if args.xml[0] == "no": self._opts["xml"] = False else: self._opts["xml"] = True if args.netcdf != None: if args.netcdf[0] == "no": self._opts["netcdf"] = False else: self._opts["netcdf"] = True if args.plots != None: if args.plots[0].lower() == "no" or args.plots[0] == 0: self._opts["plots"] = False else: self._opts["plots"] = True if args.climatologies != None: if args.climatologies[0] == "no": self._opts["climatologies"] = False else: self._opts["climatologies"] = True self._opts["verbose"] = args.verbose if args.name != None: for i in args.name: self._opts["dsnames"].append(i[0]) # Help create output file names if args.outputpre != None: self._opts["outputpre"] = args.outputpre[0] if args.outputpost != None: self._opts["outputpost"] = args.outputpost[0] # Output directory if args.outputdir != None: if not os.path.isdir(args.outputdir[0]): print "ERROR, output directory", args.outputdir[0], "does not exist!" quit() self._opts["outputdir"] = args.outputdir[0] if args.translate != "y": print args.translate print self._opts["translate"] quit() # Timestart assumes a string like "months since 2000". I can't find documentation on # toRelativeTime() so I have no idea how to check for valid input # This is required for some of the land model sets I've seen if args.timestart != None: self._opts["reltime"] = args.timestart # cdutil.setTimeBounds{bounds}(variable) if args.timebounds != None: self._opts["bounds"] = args.timebounds # Check if a user specified package actually exists # Note: This is case sensitive..... if args.packages != None: plist = [] for x in args.packages: if x.upper() in self.all_packages.keys(): plist.append(x) elif x in self.all_packages.keys(): plist.append(x.lower()) if plist == []: print "Package name(s) ", args.packages, " not valid" print "Valid package names: ", self.all_packages.keys() quit() else: self._opts["packages"] = plist # TODO: Requires exact case; probably make this more user friendly and look for mixed case if args.regions != None: rlist = [] for x in args.regions: if x in all_regions.keys(): rlist.append(x) print "REGIONS: ", rlist self._opts["regions"] = rlist # Given user-selected packages, check for user specified sets # Note: If multiple packages have the same set names, then they are all added to the list. # This might be bad since there is no differentiation of lwmg['id==set'] and lmwg2['id==set'] if self._opts["packages"] == None and args.sets != None: print "No package specified" self._opts["sets"] = args.sets if args.sets != None and self._opts["packages"] != None: # unfortuantely, we have to go through all of this.... # there should be a non-init of the class method to list sets/packages/etc, # ie a dictionary perhaps? sets = [] import metrics.fileio.filetable as ft import metrics.fileio.findfiles as fi import metrics.packages.diagnostic_groups package = self._opts["packages"] if package[0].lower() == "lmwg": import metrics.packages.lmwg.lmwg elif package[0].lower() == "amwg": import metrics.packages.amwg.amwg dtree = fi.dirtree_datafiles(self, pathid=0) filetable = ft.basic_filetable(dtree, self) dm = metrics.packages.diagnostic_groups.diagnostics_menu() pclass = dm[package[0].upper()]() slist = pclass.list_diagnostic_sets() keys = slist.keys() keys.sort() for k in keys: fields = k.split() for user in args.sets: if user == fields[0]: sets.append(user) self._opts["sets"] = sets if sets != args.sets: print "sets requested ", args.sets print "sets available: ", slist exit(1) # check for some varopts first. if args.varopts != None: self._opts["varopts"] = args.varopts # Add some hackery here to convert pressure level vars to var+varopts if args.vars != None: self._opts["vars"] = args.vars vpl = ["Z3_300", "Z3_500", "U_200", "T_200", "T_850"] vl = list(set(args.vars) - set(vpl)) if vl == args.vars: # no pressure level vars made it this far. print "No pressure level vars found in input vars list." else: # more complicated.... print "Pressure level vars found in input vars list.... Processing...." vopts = [] if ( self._opts["varopts"] != [] and self._opts["varopts"] != None ): # hopefully the user didn't also specify varopts.... print "User passed in varopts but there are pressure-level variables in the vars list." print "This will append the pressure levels found to the varopts array" # see which pressure level vars were passed. this will be the super set of pressure levels. if "Z3_300" in self._opts["vars"]: vopts.append("300") self._opts["vars"] = [x.replace("Z3_300", "Z3") for x in self._opts["vars"]] if "Z3_500" in self._opts["vars"]: vopts.append("500") self._opts["vars"] = [x.replace("Z3_500", "Z3") for x in self._opts["vars"]] if "T_200" in self._opts["vars"]: vopts.append("200") self._opts["vars"] = [x.replace("T_200", "T") for x in self._opts["vars"]] if "T_850" in self._opts["vars"]: vopts.append("850") self._opts["vars"] = [x.replace("T_850", "T") for x in self._opts["vars"]] if "U_200" in self._opts["vars"]: vopts.append("200") self._opts["vars"] = [x.replace("U_200", "U") for x in self._opts["vars"]] vopts = list(set(vopts)) if self._opts["varopts"] == [] or self._opts["varopts"] == None: self._opts["varopts"] = vopts else: self._opts["varopts"].extend(vopts) self._opts["varopts"] = list(set(self._opts["varopts"])) print "Updated vars list: ", self._opts["vars"] # If --yearly is set, then we will add 'ANN' to the list of climatologies if args.yearly == True: self._opts["yearly"] = True self._opts["times"].append("ANN") # If --monthly is set, we add all months to the list of climatologies if args.monthly == True: self._opts["monthly"] = True self._opts["times"].extend(all_months) # If --seasonally is set, we add all 4 seasons to the list of climatologies if args.seasonally == True: self._opts["seasonally"] = True self._opts["times"].extend(all_seasons) # This allows specific individual months to be added to the list of climatologies if args.months != None: if args.monthly == True: print "Please specify just one of --monthly or --months" quit() else: mlist = [x for x in all_months if x in args.months] self._opts["times"] = self._opts["times"] + mlist # This allows specific individual years to be added to the list of climatologies. # Note: Checkign for valid input is impossible until we look at the dataset # This has to be special cased since typically someone will be saying # "Generate climatologies for seasons for years X, Y, and Z of my dataset" if args.years != None: if args.yearly == True: print "Please specify just one of --yearly or --years" quit() else: self._opts["years"] = args.years if args.seasons != None: if args.seasonally == True: print "Please specify just one of --seasonally or --seasons" quit() else: slist = [x for x in all_seasons if x in args.seasons] self._opts["times"] = self._opts["times"] + slist
outdim=outGY.shape outvar=numpy.zeros( (dim[0], outdim[0], outdim[1] )) + 1.e20 for itime in range(dim[0]): tmp = interpolate.griddata(numpy.reshape(points, (dim[1]*dim[2],2)), numpy.ravel(yvar[itime]), (outGY, outGX), method=interpol) outvar[itime] = numpy.flipud(tmp) infile.close() return outvar # ______________________ if __name__=='__main__': nodata = 1.e20 (referenceGrid, latAxis, lonAxis, latBounds, lonBounds) = makeGrid() # for netcdf3: set flags to 0 cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(3) indir='/data/sst/reynolds_climatology/noaa_oist_v2/' outdir='/data/sst/reynolds_climatology/noaa_oist_v2/resized_fitted/' infile=indir+'/max_sst.ltm.1971-2000.nc' outvar = do_resize('sst', infile) saveData(outdir+'/max_sst.ltm.1971-2000_resized.nc', outvar, typecode='f', id='sst', fill_value=nodata, grid=referenceGrid, copyaxes=1, attribute1='real Climato max',attribute2='Degrees Celsius',latAxis=latAxis,lonAxis=lonAxis) infile=indir+'sst.ltm.1971-2000.nc' outvar = do_resize_multi('sst',infile) outfile=outdir+'sst.ltm.1971-2000_resized.nc' if os.path.exists(outfile): os.remove(outfile) fh=cdms2.open(outfile, 'w')
def correctFile(idxcorr, ncorr, inFile, inDir, outFile, outDir): ''' Correct density binned files (undefined ptop & long 0 issue) idxcorr = [idx_i,idx_i1,jmax] indices for longitude correction - if [0,0,0] ignore ncorr = number of corrections: 1 or 2 ''' # CDMS initialisation - netCDF compression comp = 1 # 0 for no compression cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # Numpy initialisation npy.set_printoptions(precision=2) varList3D = ['isondepthg', 'isonthickg', 'sog', 'thetaog'] varList2D = [ 'ptopsoxy', 'ptopdepthxy', 'ptopsigmaxy', 'ptopthetaoxy', 'persistmxy' ] # First test, read level by level and write level by level (memory management) # use ncpdq -a time,lev,lat,lon to recover the dimension order fi = cdm.open(inDir + '/' + inFile) fo = cdm.open(outDir + '/' + outFile, 'w') isondg = fi['isondepthg'] # Create variable handle # Get grid objects #axesList = isondg.getAxisList() #sigmaGrd = isondg.getLevel() lonN = isondg.shape[3] latN = isondg.shape[2] levN = isondg.shape[1] timN = isondg.shape[0] #valmask = isondg.missing_value if ncorr == 2: ic1 = idxcorr[0][0] ic2 = idxcorr[0][1] jcmax = idxcorr[0][2] ic12 = idxcorr[1][0] ic22 = idxcorr[1][1] jcmax2 = idxcorr[1][2] if ic2 >= lonN - 1: ic2 = 0 if ic22 >= lonN - 1: ic22 = 0 elif ncorr == 1: ic1 = idxcorr[0] ic2 = idxcorr[1] jcmax = idxcorr[2] if ic2 >= lonN - 1: ic2 = 0 #print ic1,ic2,jcmax corr_long = True if ic1 == 0 and ic2 == 0 and jcmax == 0: corr_long = False #testp = 10 for it in range(timN): #if it/testp*testp == it: # print ' year =',it # test #i = 90 #j = 90 #i2d = 6 #j2d = 12 #ij = j*lonN+i #ij2d = j2d*lonN+i2d #print 'ij=',ij # 3D variables for iv in varList3D: #print iv outVar = fi(iv, time=slice(it, it + 1)) # Correct for longitude interpolation issue if corr_long: for jt in range(jcmax): outVar[:, :, jt, ic1] = (outVar[:, :, jt, ic1 - 1] + outVar[:, :, jt, ic2 + 1]) / 2 outVar[:, :, jt, ic2] = outVar[:, :, jt, ic1] if ncorr == 2: for jt in range(jcmax2): outVar[:, :, jt, ic12] = (outVar[:, :, jt, ic12 - 1] + outVar[:, :, jt, ic22 + 1]) / 2 outVar[:, :, jt, ic22] = outVar[:, :, jt, ic12] # # Correct Bowl properties # if iv =='isondepthg': # vardepth = npy.reshape(outVar,(levN,latN*lonN)) # #print 'test' # #print outVar[:,:,j2d,i2d] # #print vardepth[:,ij2d] # # find values of surface points # vardepthBowl = npy.min(npy.reshape(outVar,(levN,latN*lonN)),axis=0) # vardepthBowlTile = npy.repeat(vardepthBowl,levN,axis=0).reshape((latN*lonN,levN)).transpose() # #print vardepthBowlTile.shape # #print vardepthBowl[ij2d], vardepthBowlTile[:,ij2d] # levs = outVar.getAxisList()[1][:] # #print 'levs',levs # levs3d = mv.reshape(npy.tile(levs,latN*lonN),(latN*lonN,levN)).transpose() # varsigmaBowl = npy.max(npy.where(vardepth == vardepthBowlTile,levs3d,0),axis=0) # #print varsigmaBowl[ij2d],levs3d[:,ij2d] # elif iv == 'sog': # varsog = npy.reshape(outVar,(levN,latN*lonN)) # varsoBowl = npy.max(npy.where(vardepth == vardepthBowlTile,varsog,0),axis=0) # #print varsoBowl[ij2d], varsog[:,ij2d] # #print vardepth[:,ij2d],vardepthBowlTile[:,ij2d] # del (varsog); gc.collect() # elif iv =='thetaog': # varthetao = npy.reshape(outVar,(levN,latN*lonN)) # varthetaoBowl = npy.max(npy.where(vardepth == vardepthBowlTile,varthetao,-1000),axis=0) # #print varthetaoBowl[ij2d],varthetao[:,ij2d] # del (varthetao); gc.collect() # Write fo.write(outVar.astype('float32'), extend=1, index=it) fo.sync() del (vardepth) gc.collect() # 2D variables and correct isondepthg = 0 for iv in varList2D: outVar = fi(iv, time=slice(it, it + 1)) # Correct for longitude interpolation issue if corr_long: for jt in range(jcmax): outVar[:, jt, ic1] = (outVar[:, jt, ic1 - 1] + outVar[:, jt, ic2 + 1]) / 2 outVar[:, jt, ic2] = outVar[:, jt, ic1] if ncorr == 2: for jt in range(jcmax2): outVar[:, jt, ic12] = (outVar[:, jt, ic12 - 1] + outVar[:, jt, ic22 + 1]) / 2 outVar[:, jt, ic22] = outVar[:, jt, ic12] # Correct for ptopsoxy < 30 #print 'before',outVar[:,j2d,i2d] # if iv == 'ptopsoxy': # testso = npy.reshape(outVar,(latN*lonN)) < 30. # #print 'testdepth', testdepth[ij2d] # #print npy.argwhere(testdepth)[0:10]/lonN, npy.argwhere(testdepth)[0:10]-npy.argwhere(testdepth)[0:10]/lonN*lonN # outVar.data[...] = npy.where(testso,varsoBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] # elif iv == 'ptopdepthxy': # outVar.data[...] = npy.where(testso,vardepthBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] # elif iv == 'ptopthetaoxy': # outVar.data[...] = npy.where(testso,varthetaoBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] # elif iv == 'ptopsigmaxy': # outVar.data[...] = npy.where(testso,varsigmaBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] #print 'after',outVar[:,j2d,i2d] # Write fo.write(outVar.astype('float32'), extend=1, index=it) fo.sync() fi.close() fo.close() # testing #model = 'CCSM4' #idxcorr=[139,140,145] #ncorr = 1 #inFile = 'cmip5.CCSM4.historical24.r1i1p1.an.ocn.Omon.density.ver-v20121128.nc' #inDir = '/Users/ericg/Projets/Density_bining/Raw_testing' #outFile = 'cmip5.CCSM4.historical24.outtest.nc' #model = 'CanESM2' #idxcorr=[179,180,180] #ncorr = 1 #inFile = 'cmip5.CanESM2.historical24.r1i1p1.an.ocn.Omon.density.ver-1.nc' #inDir = '/Users/ericg/Projets/Density_bining/Raw_testing' #outFile = 'cmip5.CanESM2.historical24.outtest.nc' #model = 'IPSL-CM5A-LR' #idxcorr=[0,0,0] #ncorr=1 #inFile = 'cmip5.IPSL-CM5A-LR.historical24.r1i1p1.an.ocn.Omon.density.ver-v20111119.nc' #inDir = '/Users/ericg/Projets/Density_bining/Raw_testing' #outFile = 'cmip5.IPSL-CM5A-LR.historical24.outtest.nc' #model = 'Ishii' #idxcorr=[[359,359,39],[180,180,180]] #idxcorr=[359,359,39] #ncorr = 1 #inFile = 'obs.Ishii.historical.r0i0p0.an.ocn.Omon.density.ver-1.latestX.nc' #inDir='/Volumes/hciclad/data/Density_binning/Prod_density_obs_april16' #outFile = 'obs.Ishii.historical.r0i0p0.an.ocn.Omon.density.ver-1.latestXCorr.nc' #model = 'EN4' #idxcorr=[[359,359,39],[180,180,180]] #idxcorr=[359,359,39] #ncorr = 2 #inFile = 'obs.EN4.historical.r0i0p0.mo.ocn.Omon.density.ver-1.latestX.nc' #inDir='/Volumes/hciclad/data/Density_binning/Prod_density_obs_april16' #outFile = 'obs.EN4.historical.r0i0p0.mo.ocn.Omon.density.ver-1.latestXCorr.nc' #outDir = inDir #correctFile(idxcorr, ncorr, inFile, inDir, outFile, outDir)
def _ERA5_2_N480(year_start, month_start, day_start, hr_start, year_end, month_end, day_end, hr_end, data_dir, cdo_path): #-------------------------------------------------------------- dt = datetime.datetime(year_start, month_start, day_start, hr_start) dt_end = datetime.datetime(year_end, month_end, day_end, hr_end) delt_1hr = datetime.timedelta(hours=1) print(dt) print(dt_end) print(delt_1hr) print(' ') while dt <= dt_end: ymd = '%04d%02d%02d' % (dt.year, dt.month, dt.day) filedate = '%04d-%02d-%02d' % (dt.year, dt.month, dt.day) hour_str = '%02d' % dt.hour in_filename = 'UVTQPS-' + ymd + '_' + hour_str + '.grib' print(in_filename) print(filedate) print(ymd) dirname = data_dir + '/' os.chdir(dirname) # cdo sinfon *.grib #check grib variable information # select spectral fields of sfc z(129), ln sfc p(152) #-------------------------------- sel2d_call = cdo_path + 'cdo selvar,z,lnsp' + ' ' + \ in_filename + ' ' + 'ml_2d.grib' print(sel2d_call) sel2d = subprocess.Popen(sel2d_call, shell=True) sel2d.wait() # select spectral fields of T(130) #-------------------------------- #selSp_call = cdo_path + 'cdo selcode,129,152,130' + ' ' + \ selt_call = cdo_path + 'cdo selvar,t' + ' ' + \ in_filename + ' ' + 'ml_t.grib' print(selt_call) selt = subprocess.Popen(selt_call, shell=True) selt.wait() # Convert spectral to full gg #-------------------------------- sp2gp_call = cdo_path + 'cdo sp2gp' + ' ' + \ 'ml_2d.grib' + ' ' + 'ml_2d_fgg.grib' print(sp2gp_call) spp = subprocess.Popen(sp2gp_call, shell=True) spp.wait() sp2gp_call = cdo_path + 'cdo sp2gp' + ' ' + \ 'ml_t.grib' + ' ' + 'ml_t_fgg.grib' print(sp2gp_call) spp = subprocess.Popen(sp2gp_call, shell=True) spp.wait() # select div(155), vor(138) in spectral #-------------------------------- divVor_call = cdo_path + 'cdo selvar,d,vo' + ' ' + \ in_filename + ' ' + 'ml_divvo.grib' print(divVor_call) divv = subprocess.Popen(divVor_call, shell=True) divv.wait() # convert div, vor spectral to u,v full gaussian #-------------------------------- dv2uv_call = cdo_path + 'cdo dv2uv' + ' ' + \ 'ml_divvo.grib' + ' ' + 'ml_uv_fgg.grib' print(dv2uv_call) dvuv = subprocess.Popen(dv2uv_call, shell=True) dvuv.wait() # select reduced gg fields Q (133) #-------------------------------- selRgg_call = cdo_path + 'cdo selvar,q' + ' ' + \ in_filename + ' ' + 'ml_q_rgg.grib' print(selRgg_call) slgg = subprocess.Popen(selRgg_call, shell=True) slgg.wait() # convert reduced gg to full gg #---------------------------- #fgg_call = cdo_path + 'cdo -R copy' + ' ' + \ fgg_call = cdo_path + 'cdo setgridtype,regular' + ' ' + \ 'ml_q_rgg.grib' + ' ' + 'ml_q_fggN320.grib' print(fgg_call) fgg = subprocess.Popen(fgg_call, shell=True) fgg.wait() # Remap Q onto N480 grid (Q is on a different grid). #------------------------------------------------ remap_call = cdo_path + 'cdo remapbil,n480' + ' ' + \ 'ml_q_fggN320.grib' + ' ' + 'ml_q_fgg.grib' print(remap_call) rmp = subprocess.Popen(remap_call, shell=True) rmp.wait() # Combine all the files #------------------------------------------------ cat2_call = 'cat ml_uv_fgg.grib ml_t_fgg.grib ml_2d_fgg.grib > ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_UVTn2D.grib' print(cat2_call) ct2 = subprocess.Popen(cat2_call, shell=True) ct2.wait() cp1_call = 'cp ml_q_fgg.grib' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_Q.grib' print(cp1_call) cp1 = subprocess.Popen(cp1_call, shell=True) cp1.wait() # Convert grib2 to grib1 and make grads ctl for hourly files. #---------------------------------- # Use cdo gradsdes to geneate ctls files # This only works for grib1 format. Have to convert grib2 to grib1 # In the processes, cdo -f grb copy would mess up the variable names so have to separate the variables into two files grib2to1_call = cdo_path + 'cdo -f grb copy' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_UVTn2D.grib' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_UVTn2D.grib1' print(grib2to1_call) grb21 = subprocess.Popen(grib2to1_call, shell=True) grb21.wait() grib2to1_call = cdo_path + 'cdo -f grb copy' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_Q.grib' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_Q.grib1' print(grib2to1_call) grb21 = subprocess.Popen(grib2to1_call, shell=True) grb21.wait() gradsdes1_call = cdo_path + 'cdo gradsdes' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_UVTn2D.grib1' print(gradsdes1_call) grd1 = subprocess.Popen(gradsdes1_call, shell=True) grd1.wait() gradsdes2_call = cdo_path + 'cdo gradsdes' + ' ' + \ 'UVTQPS-' + ymd + '_' + hour_str + '_N480_Q.grib1' print(gradsdes2_call) grd2 = subprocess.Popen(gradsdes2_call, shell=True) grd2.wait() # Generate NC file #---------------------------------- infile1 = 'UVTQPS-' + ymd + '_' + hour_str + '_N480_UVTn2D.grib1.ctl' infile2 = 'UVTQPS-' + ymd + '_' + hour_str + '_N480_Q.grib1.ctl' out_filename = 'UVTQPS-' + ymd + '_' + hour_str + '.nc' print(infile1) print(infile2) print(out_filename) fid1 = cdms2.open(infile1) fid2 = cdms2.open(infile2) var_u = fid1('var131') var_v = fid1('var132') var_t = fid1('var0') var_lnsp = fid1('var25') var_z = fid1('var4') var_q = fid2('var0') lev = var_u.getLevel() lat = var_u.getLatitude() lon = var_u.getLongitude() cdms2.setNetcdfShuffleFlag(0) cdms2.setNetcdfDeflateFlag(0) cdms2.setNetcdfDeflateLevelFlag(0) c = cdms2.open(out_filename, 'w') time = cdms2.createAxis([0.]) time.id = 'time' time.units = 'hours since ' + filedate + ' ' + hour_str + ':00:00' time.long_name = 'time' time.axis = 'T' time.calendar = 'gregorian' print(time.units) var1 = cdms2.createVariable(var_u, axes=(time, lev, lat, lon), typecode='f', id='U') var1.long_name = 'zonal wind component' var1.units = 'm/s' var2 = cdms2.createVariable(var_v, axes=(time, lev, lat, lon), typecode='f', id='V') var2.long_name = 'meridional wind component' var2.units = 'm/s' var3 = cdms2.createVariable(var_t, axes=(time, lev, lat, lon), typecode='f', id='T') var3.long_name = 'temperature' var3.units = 'K' var4 = cdms2.createVariable(var_q, axes=(time, lev, lat, lon), typecode='f', id='Q') var4.long_name = 'specific humidity' var4.units = 'kg/kg' var5 = cdms2.createVariable(var_lnsp, axes=(time, lat, lon), typecode='f', id='PS') var5.long_name = 'surface pressure' var5.units = 'Pa' var6 = cdms2.createVariable(var_z, axes=(time, lat, lon), typecode='f', id='PHIS') var6.long_name = 'surface geopotential' var6.units = 'm2/s2' c.write(var1) c.write(var2) c.write(var3) c.write(var4) c.write(var5) c.write(var6) fid1.close() fid2.close() c.close() ######### remove all temporary files and continue onto next day remove_call1 = 'rm -f' + ' ' + 'ml_2d.grib' + ' ' + 'ml_t.grib' + ' ' + \ 'ml_2d_fgg.grib' + ' ' + 'ml_t_fgg.grib' + ' ' + \ 'ml_divvo.grib' + ' ' + 'ml_uv_fgg.grib' + ' ' + \ 'ml_q_rgg.grib' + ' ' + 'ml_q_fggN320.grib' + ' ' + 'ml_q_fgg.grib' print(remove_call1) rmc1 = subprocess.Popen(remove_call1, shell=True) rmc1.wait() remove_call2 = 'rm -f' + ' ' + '*_N480_*grib*' print(remove_call2) rmc2 = subprocess.Popen(remove_call2, shell=True) rmc2.wait() ################################## dt = dt + delt_1hr return
nt = f['xe'].shape[0] print f['xe'].getTime().asComponentTime()[0:nt:nt - 1] # -> [2008-8-15 0:0:0.0, 2008-8-15 23:0:0.0] # Lire une selection de la variable import cdtime xe = f('xe', ('2008-8-15', cdtime.comptime(2008, 8, 15, 12), 'cc'), lon=slice(5, 6), lat=(48.1, 48.5), squeeze=1) print xe.shape # -> (13, 29) # squeeze a supprime l'axes des longitudes de dim 1 # Fermer le fichier lu f.close() # Definir la compression netcdf4 cdms2.setNetcdfShuffleFlag(1) cdms2.setNetcdfDeflateFlag(1) cdms2.setNetcdfDeflateLevelFlag(3) # Creer un nouveau fichier ncfile = 'misc-io-netcdf.nc' import os if os.path.exists(ncfile): os.remove(ncfile) f = cdms2.open('misc-io-netcdf.nc', 'w') # ouverture en ecriture f.write(xe) # ecriture d'une variable f.history = 'Created with ' + __file__.encode('utf8') # attribut global f.close() # fermeture
def test_driver(path1, path2=None, filt2=None): """ Test driver for setting up data for plots""" # First, find and index the data files. datafiles1 = dirtree_datafiles(path1) print "jfp datafiles1=", datafiles1 datafiles2 = dirtree_datafiles(path2, filt2) print "jfp datafiles2=", datafiles2 filetable1 = basic_filetable(datafiles1) filetable2 = basic_filetable(datafiles2) # Next we'll compute reduced variables. They have generally been reduced by averaging in time, # and often more axes as well. Reducing the data first is the fastest way to compute, important # if we need to be interactive. And it is correct if whatever we plot is linear in the # variables, as is almost always the case. But if we want to plot a highly nonlinear function # of the data variables, the averaging will have to wait until later. # The reduced_variables dict names and contains all the reduced variables which we have defined. # They will be used in defining instances of plotspec. reduced_variables = { 'hyam_1': reduced_variable(variableid='hyam', filetable=filetable1, reduction_function=(lambda x, vid=None: x)), 'hybm_1': reduced_variable(variableid='hybm', filetable=filetable1, reduction_function=(lambda x, vid=None: x)), 'PS_ANN_1': reduced_variable(variableid='PS', filetable=filetable1, reduction_function=reduce2lat), 'T_CAM_ANN_1': reduced_variable(variableid='T', filetable=filetable1, reduction_function=reduce2levlat), 'T_CAM_ANN_2': reduced_variable(variableid='T', filetable=filetable2, reduction_function=reduce2levlat), 'TREFHT_ANN_latlon_Npole_1': reduced_variable(variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x, vid=None: restrict_lat( reduce2latlon(x, vid=vid), 50, 90))), 'TREFHT_ANN_latlon_Npole_2': reduced_variable(variableid='TREFHT', filetable=filetable2, reduction_function=(lambda x, vid=None: restrict_lat( reduce2latlon(x, vid=vid), 50, 90))), 'TREFHT_ANN_lat_1': reduced_variable(variableid='TREFHT', filetable=filetable1, reduction_function=reduce2lat), 'TREFHT_DJF_lat_1': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x, vid=None: reduce2lat_seasonal( x, seasonsDJF, vid=vid))), 'TREFHT_DJF_lat_2': reduced_variable( variableid='TREFHT', filetable=filetable2, reduction_function=(lambda x, vid=None: reduce2lat_seasonal( x, seasonsDJF, vid=vid))), 'TREFHT_DJF_latlon_1': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x, vid=None: reduce2latlon_seasonal( x, seasonsDJF, vid=vid))), 'TREFHT_DJF_latlon_2': reduced_variable( variableid='TREFHT', filetable=filetable2, reduction_function=(lambda x, vid=None: reduce2latlon_seasonal( x, seasonsDJF, vid=vid))), 'TREFHT_JJA': reduced_variable( variableid='TREFHT', filetable=filetable1, reduction_function=(lambda x, vid=None: reduce2lat_seasonal( x, seasonsJJA, vid=vid))), 'PRECT_JJA_lat_1': reduced_variable( variableid='PRECT', filetable=filetable1, reduction_function=(lambda x, vid=None: reduce2lat_seasonal( x, seasonsJJA, vid=vid))), 'PRECT_JJA_lat_2': reduced_variable( variableid='PRECT', filetable=filetable2, reduction_function=(lambda x, vid=None: reduce2lat_seasonal( x, seasonsJJA, vid=vid))), # CAM variables needed for heat transport: # FSNS, FLNS, FLUT, FSNTOA, FLNT, FSNT, SHFLX, LHFLX, 'FSNS_1': reduced_variable(variableid='FSNS', filetable=filetable1, reduction_function=(lambda x, vid: x)), 'FSNS_ANN_latlon_1': reduced_variable(variableid='FSNS', filetable=filetable1, reduction_function=reduce2latlon), 'FLNS_1': reduced_variable(variableid='FLNS', filetable=filetable1, reduction_function=(lambda x, vid: x)), 'FLNS_ANN_latlon_1': reduced_variable(variableid='FLNS', filetable=filetable1, reduction_function=reduce2latlon), 'FLUT_ANN_latlon_1': reduced_variable(variableid='FLUT', filetable=filetable1, reduction_function=reduce2latlon), 'FSNTOA_ANN_latlon_1': reduced_variable(variableid='FSNTOA', filetable=filetable1, reduction_function=reduce2latlon), 'FLNT_1': reduced_variable(variableid='FLNT', filetable=filetable1, reduction_function=(lambda x, vid: x)), 'FLNT_ANN_latlon_1': reduced_variable(variableid='FLNT', filetable=filetable1, reduction_function=reduce2latlon), 'FSNT_1': reduced_variable(variableid='FSNT', filetable=filetable1, reduction_function=(lambda x, vid: x)), 'FSNT_ANN_latlon_1': reduced_variable(variableid='FSNT', filetable=filetable1, reduction_function=reduce2latlon), 'QFLX_1': reduced_variable(variableid='QFLX', filetable=filetable1, reduction_function=(lambda x, vid: x)), 'SHFLX_1': reduced_variable(variableid='SHFLX', filetable=filetable1, reduction_function=(lambda x, vid: x)), 'SHFLX_ANN_latlon_1': reduced_variable(variableid='SHFLX', filetable=filetable1, reduction_function=reduce2latlon), 'LHFLX_ANN_latlon_1': reduced_variable(variableid='LHFLX', filetable=filetable1, reduction_function=reduce2latlon), 'ORO_ANN_latlon_1': reduced_variable(variableid='ORO', filetable=filetable1, reduction_function=reduce2latlon), 'OCNFRAC_ANN_latlon_1': reduced_variable(variableid='OCNFRAC', filetable=filetable1, reduction_function=reduce2latlon), 'ts_lat_old': reduced_variable( variableid= 'surface_temperature', # normally a CF standard_name, even for non-CF data. filetable=filetable1, reduction_function=reduce2lat_old), 'ts_lat_new': reduced_variable( variableid= 'surface_temperature', # normally a CF standard_name, even for non-CF data. filetable=filetable1, reduction_function=reduce2lat # The reduction function will take just one argument, a variable (MV). But it might # be expressed here as a lambda wrapping a more general function. # Often there will be ranges in time, space, etc. specified here. No range means # everything. ), 'ts_scalar_tropical_o': reduced_variable( variableid='surface_temperature', filetable=filetable1, reduction_function=(lambda mv, vid=None: reduce2scalar_zonal_old( mv, -20, 20, vid=vid))), 'ts_scalar_tropical_n': reduced_variable( variableid='surface_temperature', filetable=filetable1, reduction_function=(lambda mv, vid=None: reduce2scalar_zonal( mv, -20, 20, vid=vid))) } # Derived variables have to be treated separately from reduced variables # because derived variables generally depend on reduced variables. # But N.B.: the dicts reduced_variables and derived_variables # must never use the same key! derived_variables = { 'CAM_HEAT_TRANSPORT_ALL_1': derived_var(vid='CAM_HEAT_TRANSPORT_ALL_1', inputs=[ 'FSNS_ANN_latlon_1', 'FLNS_ANN_latlon_1', 'FLUT_ANN_latlon_1', 'FSNTOA_ANN_latlon_1', 'FLNT_ANN_latlon_1', 'FSNT_ANN_latlon_1', 'SHFLX_ANN_latlon_1', 'LHFLX_ANN_latlon_1', 'OCNFRAC_ANN_latlon_1' ], outputs=[ 'atlantic_heat_transport', 'pacific_heat_transport', 'indian_heat_transport', 'global_heat_transport' ], func=oceanic_heat_transport), 'NCEP_OBS_HEAT_TRANSPORT_ALL_2': derived_var(vid='NCEP_OBS_HEAT_TRANSPORT_ALL_2', inputs=[], outputs=('latitude', [ 'atlantic_heat_transport', 'pacific_heat_transport', 'indian_heat_transport', 'global_heat_transport' ]), func=(lambda: ncep_ocean_heat_transport(path2))), 'T_ANN_1': derived_var(vid='T_ANN_1', inputs=[ 'T_CAM_ANN_1', 'hyam_1', 'hybm_1', 'PS_ANN_1', 'T_CAM_ANN_2' ], outputs=('temperature'), func=verticalize) } plotvars = dict(reduced_variables.items() + derived_variables.items()) # The plotvspecs dict names and contains all plotspec objects which we have defined. # The plotspeckeys variable, below, names the ones for which we will generate output. # A dict value can be a plotspec object, or a list of such objects. A list of # plotspec instances specifies a page containing multiple plots in separate panes. plotspecs = { 'TREFHT_ANN_Npole_ALL': ['TREFHT_ANN_Npole_1', 'TREFHT_ANN_Npole_2', 'TREFHT_ANN_Npole_diff'], 'TREFHT_ANN_Npole_1': plotspec(vid='TREFHT_ANN_Npole_1', xvars=['TREFHT_ANN_latlon_Npole_1'], xfunc=lonvar, yvars=['TREFHT_ANN_latlon_Npole_1'], yfunc=latvar, zvars=['TREFHT_ANN_latlon_Npole_1'], zfunc=(lambda z: z), plottype='polar contour plot'), 'TREFHT_ANN_Npole_2': plotspec(vid='TREFHT_ANN_Npole_2', xvars=['TREFHT_ANN_latlon_Npole_2'], xfunc=lonvar, yvars=['TREFHT_ANN_latlon_Npole_2'], yfunc=latvar, zvars=['TREFHT_ANN_latlon_Npole_2'], zfunc=(lambda z: z), plottype='polar contour plot'), 'TREFHT_ANN_Npole_diff': plotspec( vid='TREFHT_ANN_Npole_diff', xvars=['TREFHT_ANN_latlon_Npole_1', 'TREFHT_ANN_latlon_Npole_2'], xfunc=lonvar_min, yvars=['TREFHT_ANN_latlon_Npole_1', 'TREFHT_ANN_latlon_Npole_2'], yfunc=latvar_min, zvars=['TREFHT_ANN_latlon_Npole_1', 'TREFHT_ANN_latlon_Npole_2'], zfunc=aminusb_2ax, plottype='polar contour plot'), 'TREFHT_DJF_laton_ALL': [ 'TREFHT_DJF_latlon_1', 'TREFHT_DJF_latlon_2', 'TREFHT_DJF_latlon_diff' ], 'TREFHT_DJF_latlon_1': plotspec(vid='TREFHT_DJF_latlon_1', xvars=['TREFHT_DJF_latlon_1'], xfunc=lonvar, yvars=['TREFHT_DJF_latlon_1'], yfunc=latvar, zvars=['TREFHT_DJF_latlon_1'], zfunc=(lambda z: z), plottype='contour plot'), 'TREFHT_DJF_latlon_2': plotspec(vid='TREFHT_DJF_latlon_2', xvars=['TREFHT_DJF_latlon_2'], xfunc=lonvar, yvars=['TREFHT_DJF_latlon_2'], yfunc=latvar, zvars=['TREFHT_DJF_latlon_2'], zfunc=(lambda z: z), plottype='contour plot'), 'TREFHT_DJF_latlon_diff': plotspec(vid='TREFHT_DJF_latlon_diff', xvars=['TREFHT_DJF_latlon_1', 'TREFHT_DJF_latlon_2'], xfunc=lonvar_min, yvars=['TREFHT_DJF_latlon_1', 'TREFHT_DJF_latlon_2'], yfunc=latvar_min, zvars=['TREFHT_DJF_latlon_1', 'TREFHT_DJF_latlon_2'], zfunc=aminusb_2ax, plottype='contour_plot'), 'T_ANN_VERT_CAM_OBS_ALL': ['T_VERT_ANN_1', 'T_VERT_ANN_2', 'T_VERT_difference'], 'T_VERT_difference': plotspec(vid='T_VERT_difference', xvars=['T_ANN_1', 'T_CAM_ANN_2'], xfunc=latvar_min, yvars=['T_ANN_1', 'T_CAM_ANN_2'], yfunc=levvar_min, ya1vars=['T_ANN_1', 'T_CAM_ANN_2'], ya1func=(lambda y1, y2: heightvar(levvar_min(y1, y2))), zvars=['T_ANN_1', 'T_CAM_ANN_2'], zfunc=aminusb_ax2, plottype="contour plot"), 'T_VERT_ANN_2': plotspec(vid='T_ANN_2', xvars=['T_CAM_ANN_2'], xfunc=latvar, yvars=['T_CAM_ANN_2'], yfunc=levvar, ya1vars=['T_CAM_ANN_2'], ya1func=heightvar, zvars=['T_CAM_ANN_2'], plottype='contour plot', zrangevars=['T_ANN_1', 'T_CAM_ANN_2'], zrangefunc=minmin_maxmax), 'T_VERT_ANN_1': plotspec(vid='T_ANN_1', xvars=['T_ANN_1'], xfunc=latvar, yvars=['T_ANN_1'], yfunc=levvar, ya1vars=['T_ANN_1'], ya1func=heightvar, zvars=['T_ANN_1'], plottype='contour plot', zrangevars=['T_ANN_1', 'T_CAM_ANN_2'], zrangefunc=minmin_maxmax), 'NCEP_OBS_HEAT_TRANSPORT_GLOBAL_2': plotspec(vid='NCEP_OBS_HEAT_TRANSPORT_GLOBAL_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], yfunc=(lambda y: y[1][3]), plottype='line plot'), 'NCEP_OBS_HEAT_TRANSPORT_PACIFIC_2': plotspec(vid='NCEP_OBS_HEAT_TRANSPORT_PACIFIC_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], yfunc=(lambda y: y[1][0]), plottype='line plot'), 'NCEP_OBS_HEAT_TRANSPORT_ATLANTIC_2': plotspec(vid='NCEP_OBS_HEAT_TRANSPORT_ATLANTIC_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], yfunc=(lambda y: y[1][1]), plottype='line plot'), 'NCEP_OBS_HEAT_TRANSPORT_INDIAN_2': plotspec(vid='NCEP_OBS_HEAT_TRANSPORT_INDIAN_2', xvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], xfunc=(lambda x: x[0]), yvars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], yfunc=(lambda y: y[1][2]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_GLOBAL_1': plotspec(vid='CAM_HEAT_TRANSPORT_GLOBAL_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1'], yfunc=(lambda y: y[3]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_PACIFIC_1': plotspec(vid='CAM_HEAT_TRANSPORT_PACIFIC_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1'], yfunc=(lambda y: y[0]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_ATLANTIC_1': plotspec(vid='CAM_HEAT_TRANSPORT_ATLANTIC_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1'], yfunc=(lambda y: y[1]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_INDIAN_1': plotspec(vid='CAM_HEAT_TRANSPORT_INDIAN_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=['CAM_HEAT_TRANSPORT_ALL_1'], yfunc=(lambda y: y[2]), plottype='line plot'), 'CAM_HEAT_TRANSPORT_ALL_1': [ 'CAM_HEAT_TRANSPORT_GLOBAL_1', 'CAM_HEAT_TRANSPORT_PACIFIC_1', 'CAM_HEAT_TRANSPORT_ATLANTIC_1', 'CAM_HEAT_TRANSPORT_INDIAN_1' ], 'CAM_NCEP_HEAT_TRANSPORT_GLOBAL': plotspec(vid='CAM_NCEP_HEAT_TRANSPORT_GLOBAL', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1'], y1func=(lambda y: y[3]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], y2func=(lambda y: y[1][3]), plottype='2 line plot'), 'CAM_NCEP_HEAT_TRANSPORT_PACIFIC': plotspec(vid='CAM_NCEP_HEAT_TRANSPORT_PACIFIC', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1'], y1func=(lambda y: y[0]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], y2func=(lambda y: y[1][0]), plottype='2 line plot'), 'CAM_NCEP_HEAT_TRANSPORT_ATLANTIC': plotspec(vid='CAM_NCEP_HEAT_TRANSPORT_ATLANTIC', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1'], y1func=(lambda y: y[0]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], y2func=(lambda y: y[1][1]), plottype='2 line plot'), 'CAM_NCEP_HEAT_TRANSPORT_INDIAN': plotspec(vid='CAM_NCEP_HEAT_TRANSPORT_INDIAN', x1vars=['FSNS_ANN_latlon_1'], x1func=latvar, y1vars=['CAM_HEAT_TRANSPORT_ALL_1'], y1func=(lambda y: y[0]), x2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], x2func=(lambda x: x[0]), y2vars=['NCEP_OBS_HEAT_TRANSPORT_ALL_2'], y2func=(lambda y: y[1][2]), plottype='2 line plot'), 'CAM_NCEP_HEAT_TRANSPORT_ALL': [ 'CAM_NCEP_HEAT_TRANSPORT_GLOBAL', 'CAM_NCEP_HEAT_TRANSPORT_PACIFIC', 'CAM_NCEP_HEAT_TRANSPORT_ATLANTIC', 'CAM_NCEP_HEAT_TRANSPORT_INDIAN' ], 'past_CAM_HEAT_TRANSPORT_GLOBAL_1': plotspec(vid='CAM_HEAT_TRANSPORT_GLOBAL_1', xvars=['FSNS_ANN_latlon_1'], xfunc=latvar, yvars=[ 'FSNS_ANN_latlon_1', 'FLNS_ANN_latlon_1', 'FLUT_ANN_latlon_1', 'FSNTOA_ANN_latlon_1', 'FLNT_ANN_latlon_1', 'FSNT_ANN_latlon_1', 'SHFLX_ANN_latlon_1', 'LHFLX_ANN_latlon_1', 'OCNFRAC_ANN_latlon_1' ], yfunc=oceanic_heat_transport, plottype='line plot'), 'PRECT_JJA': ['PRECT_JJA_2line', 'PRECT_JJA_diff'], 'PRECT_JJA_2line': plotspec(vid='PRECT_JJA_2line', x1vars=['PRECT_JJA_lat_1'], x1func=latvar, x2vars=['PRECT_JJA_lat_2'], x2func=latvar, y1vars=['PRECT_JJA_lat_1'], y1func=(lambda y: y), y2vars=['PRECT_JJA_lat_2'], y2func=(lambda y: y), plottype='2-line plot'), 'PRECT_JJA_diff': plotspec( vid='PRECT_JJA_difference', xvars=['PRECT_JJA_lat_1', 'PRECT_JJA_lat_2'], xfunc=latvar_min, yvars=['PRECT_JJA_lat_1', 'PRECT_JJA_lat_2'], yfunc= aminusb_1ax, # aminusb_1ax(y1,y2)=y1-y2; each y has 1 axis, use min axis plottype='line plot'), 'TREFHT_ANN': plotspec(vid='TREFHT_ANN', xvars=['TREFHT_ANN_lat_1'], xfunc=latvar, yvars=['TREFHT_ANN_lat_1'], yfunc=(lambda y: y), plottype='line plot'), 'TREFHT_DJF': ['TREFHT_DJF_2line', 'TREFHT_DJF_diff'], 'TREFHT_DJF_2line': plotspec(vid='TREFHT_DJF_2line', x1vars=['TREFHT_DJF_lat_1'], x1func=latvar, x2vars=['TREFHT_DJF_lat_2'], x2func=latvar, y1vars=['TREFHT_DJF_lat_1'], y1func=(lambda y: y), y2vars=['TREFHT_DJF_lat_2'], y2func=(lambda y: y), plottype='2-line plot'), 'TREFHT_DJF_diff': plotspec( vid='TREFHT_DJF_diff', xvars=['TREFHT_DJF_lat_1', 'TREFHT_DJF_lat_2'], xfunc=latvar_min, yvars=['TREFHT_DJF_lat_1', 'TREFHT_DJF_lat_2'], yfunc= aminusb_1ax, # aminusb_1ax(y1,y2)=y1-y2; each y has 1 axis, use min axis plottype='line plot'), 'TREFHT_DJF_line': plotspec(vid='TREFHT_DJF_line', xvars=['TREFHT_DJF_lat_1'], xfunc=latvar, yvars=['TREFHT_DJF_lat_1'], plottype='line plot'), 'TREFHT_DJF_contour': plotspec(vid='TREFHT_DJF_contour', xvars=['TREFHT_DJF_latlon_1'], xfunc=(lambda x: x), plottype='line plot'), #plotspec( vid='TREFHT_JJA',xvars=['TREFHT_JJA'], xfiletable=filetable1, xfunc = latvar, # yvars=['TREFHT_JJA'], yfunc=(lambda y: y), plottype='line plot'), #plotspec( # vid='ts_by_lat_old', # suitable for filenames # xfiletable=filetable1, # xfunc = latvar, # function to return x axis values # xvars = ['ts_lat_old'], # names of variables or axes, args of xfunc # yfiletable=filetable1, # can differ from xfiletable, e.g. comparing 2 runs # yfunc = (lambda y: y), # function to return y axis values # yvars = ['ts_lat_old'], # names of variables or axes, args of xfunc # zfiletable=filetable1, # zfunc = (lambda: None), # zvars = [], # would be needed for countour or 3D plot # # ... the ?vars variable will be converted (using the filetable and # # plotvars) to actual variables which become the arguments for a call # # of ?func, which returns the data we write out for plotting use. # plottype='line plot' ), 'ts_by_lat': plotspec( vid='ts_by_lat', # suitable for filenames xfunc=latvar, # function to return x axis values xvars=['ts_lat_new'], # names of variables or axes, args of xfunc yfunc=(lambda y: y), # function to return y axis values yvars=['ts_lat_new'], # names of variables or axes, args of xfunc zfunc=(lambda: None), zvars=[], # would be needed for countour or 3D plot # ... the ?vars variable will be converted (using the filetable and # plotvars) to actual variables which become the arguments for a call # of ?func, which returns the data we write out for plotting use. plottype='line plot'), #plotspec( vid="ts_global_old",xvars=['ts_scalar_tropical_o'], xfiletable=filetable1 ), 'ts_global': plotspec(vid="ts_global", xvars=['ts_scalar_tropical_n']), } # Plotspeckeys specifies what plot data we will compute and write out. # In the future we may add a command line option, or provide other ways to # define plotspeckeys. #plotspeckeys = [['TREFHT_DJF_2line','TREFHT_DJF_difference']] #plotspeckeys = ['TREFHT_DJF_2line'] #plotspeckeys = ['NCEP_OBS_HEAT_TRANSPORT_GLOBAL_2','CAM_HEAT_TRANSPORT_ALL_1'] #plotspeckeys = ['CAM_NCEP_HEAT_TRANSPORT_GLOBAL'] #plotspeckeys = ['CAM_NCEP_HEAT_TRANSPORT_ALL'] #plotspeckeys = ['T_ANN_VERT_CAM_OBS_ALL'] #plotspeckeys = ['TREFHT_DJF_laton_ALL'] #plotspeckeys = ['TREFHT_ANN_Npole_ALL'] plotspeckeys = ['TREFHT_DJF'] #plotspeckeys = ['GLOBAL_AVERAGES'] # Find the variable names required by the plotspecs. varkeys = [] for psk in plotspeckeys: if type(psk) is str and type(plotspecs[psk]) is list: psk = plotspecs[psk] if type(psk) is str: write_xml = False psl = [plotspecs[psk]] else: write_xml = True psl = [plotspecs[k] for k in psk] xml_name = '_'.join([ps._strid for ps in psl]) + '.xml' h = open(xml_name, 'w') h.write("<plotdata>\n") for ps in psl: varkeys = varkeys + ps.xvars + ps.x1vars + ps.x2vars + ps.x3vars varkeys = varkeys + ps.yvars + ps.y1vars + ps.y2vars + ps.y3vars varkeys = varkeys + ps.zvars + ps.zrangevars for key in varkeys: if key in derived_variables.keys(): varkeys = varkeys + derived_variables[key]._inputs varkeys = list(set(varkeys)) # Compute the value of every variable we need. varvals = {} # First compute all the reduced variables for key in varkeys: if key in reduced_variables.keys(): varvals[key] = reduced_variables[key].reduce() # Then use the reduced variables to compute the derived variables # Note that the derive() method is allowed to return a tuple. This way # we can use one function to compute what's really several variables. for key in varkeys: if key in derived_variables.keys(): varvals[key] = derived_variables[key].derive(varvals) # Now use the reduced and derived variables to compute the plot data. for psk in plotspeckeys: if type(psk) is str and type(plotspecs[psk]) is list: psk = plotspecs[psk] if type(psk) is str: write_xml = False psl = [plotspecs[psk]] else: write_xml = True psl = [plotspecs[k] for k in psk] xml_name = '_'.join([ps._strid for ps in psl]) + '.xml' h = open(xml_name, 'w') h.write("<plotdata>\n") varkeys = [] for ps in psl: print "jfp preparing data for", ps._strid xrv = [varvals[k] for k in ps.xvars] x1rv = [varvals[k] for k in ps.x1vars] x2rv = [varvals[k] for k in ps.x2vars] x3rv = [varvals[k] for k in ps.x3vars] yrv = [varvals[k] for k in ps.yvars] y1rv = [varvals[k] for k in ps.y1vars] y2rv = [varvals[k] for k in ps.y2vars] y3rv = [varvals[k] for k in ps.y3vars] yarv = [varvals[k] for k in ps.yavars] ya1rv = [varvals[k] for k in ps.ya1vars] zrv = [varvals[k] for k in ps.zvars] zrrv = [varvals[k] for k in ps.zrangevars] xax = apply(ps.xfunc, xrv) x1ax = apply(ps.x1func, x1rv) x2ax = apply(ps.x2func, x2rv) x3ax = apply(ps.x3func, x3rv) yax = apply(ps.yfunc, yrv) y1ax = apply(ps.y1func, y1rv) y2ax = apply(ps.y2func, y2rv) y3ax = apply(ps.y3func, y3rv) yaax = apply(ps.yafunc, yarv) ya1ax = apply(ps.ya1func, ya1rv) zax = apply(ps.zfunc, zrv) zr = apply(ps.zrangefunc, zrrv) if (xax is None or len(xrv)==0) and (x1ax is None or len(x1rv)==0)\ and (x2ax is None or len(x2rv)==0) and (x3ax is None or len(x3rv)==0)\ and (yax is None or len(yrv)==0) and (y1ax is None or len(y1rv)==0)\ and (y2ax is None or len(y2rv)==0) and (y3ax is None or len(y3rv)==0)\ and (zax is None or len(zrv)==0): continue filename = ps._strid + "_test.nc" value = 0 cdms2.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag( value) ## where value is a integer between 0 and 9 included g = cdms2.open(filename, 'w') # later, choose a better name and a path! store_provenance(g) # Much more belongs in g, e.g. axis and graph names. if xax is not None and len(xrv) > 0: xax.id = 'X' g.write(xax) if x1ax is not None and len(x1rv) > 0: x1ax.id = 'X1' g.write(x1ax) if x2ax is not None and len(x2rv) > 0: x2ax.id = 'X2' g.write(x2ax) if x3ax is not None and len(x3rv) > 0: x3ax.id = 'X3' g.write(x3ax) if yax is not None and len(yrv) > 0: yax.id = 'Y' g.write(yax) if y1ax is not None and len(y1rv) > 0: y1ax.id = 'Y1' g.write(y1ax) if y2ax is not None and len(y2rv) > 0: y2ax.id = 'Y2' g.write(y2ax) if y3ax is not None and len(y3rv) > 0: y3ax.id = 'Y3' g.write(y3ax) if yaax is not None and len(yarv) > 0: yaax.id = 'YA' g.write(yaax) if ya1ax is not None and len(ya1rv) > 0: ya1ax.id = 'YA1' g.write(ya1ax) if zax is not None and len(zrv) > 0: zax.id = 'Z' g.write(zax) if zr is not None: zr.id = 'Zrange' g.write(zr) g.presentation = ps.plottype # Note: For table output, it would be convenient to use a string-valued variable X # to specify string parts of the table. Butcdms2 doesn't support them usefully. # Instead we'll manage with a convention that a table row plotspec's id is the name of # the row, thus available to be printed in, e.g., the first column. if ps.plottype == "table row": g.rowid = ps._strid g.close() if write_xml: h.write("<ncfile>" + filename + "</ncfile>\n") if write_xml: h.write("</plotdata>\n") h.close()
import cdms2 ###################################### value = 0 cdms2.setNetcdfShuffleFlag(value) cdms2.setNetcdfDeflateFlag(value) cdms2.setNetcdfDeflateLevelFlag(value) ###################################### ### EXECUTE MODULE WITH VARIOUS FUNCTIONS execfile('modules_and_functions/misc_module.py') execfile('modules_and_functions/getOurModelData.py') ### OPTIONS FOR REGRIDDING: METHOD AND TARGET GRID exp = 'cmip5' rgridMeth = 'regrid2' targetGrid = '4x5' targetGrid = '2.5x2.5' ### OUTPUT DIRECTORY outdir = '/work/metricspackage/130522/data/inhouse_model_clims/samplerun/atm/mo/ac/' ## SEE END OF THIS CODE FOR OUTPUT FILENAMES ### VARIABLES TO LOOP OVER (NAMES ASSUMED TO BE CONSISTENT WITH CMIP5) vars = ['rlut','pr'] ###################################### ############# GET OBS TARGET GRID obsg = get_target_grid(targetGrid) #############
from Scientific.IO.NetCDF import * from pyclimate.svdeofs import * from pyclimate.ncstruct import * sys.path.insert(0,"/export/bonfils2/NEWPYFORT/TRANSFO/build/lib.linux-i686-2.5") #import Lynch import numpy.oldnumeric as Numeric import time from Scientific.IO import FortranFormat import numpy.oldnumeric.ma as MA import sys,getopt # for external loop value=0 cdms.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms.setNetcdfDeflateLevelFlag(value) ## where value is a integer between 0 and 9 included ################################################### args=sys.argv[1:] letters='e:i:f:r' keywords=['exper=','ice=','filt=','rang='] oexpt='default' oice='default' lowpass='******' Pdateclimo='default' opts,pargs=getopt.getopt(args,letters,keywords)
leap_year = 0 f_mask = cdms.open('SWGDN.nc') v = f_mask('SWGDN') lat = v.getAxis(1) lon = v.getAxis(2) f_mask.close() fw = cdms.open(data_patch + case_name) wcf = MV.array(fw('wcf', squeeze=1)) wcf[wcf < 0] = 0. wcf[wcf > 1] = 1. fw.close() # use NetCDF3 Classic format cdms.setNetcdfShuffleFlag(0) # netcdf3 classic... cdms.setNetcdfDeflateFlag(0) # netcdf3 classic... cdms.setNetcdfDeflateLevelFlag(0) # netcdf3 classic... fm = cdms.open('selected_mask_NYS.nc') region_mask_list = {0: 'wmask_NYS'} mask_idx = MV.array(fm(region_mask_list[idx])) # Pre-define the output variable and output file g = cdms.open('averaged_NYS_wcf' + str(year) + '.nc', 'w') new_data = MV.array(np.zeros(len_axis)) new_data.id = 'averaged_' + region_mask_list[0] for i in range(len_axis): scf_idx = scf[i] * mask_idx scf_idx.setAxis(0, lat) scf_idx.setAxis(1, lon) # If lat/lon info is given, the following average function calculate the
def compute_and_write_climatologies( varkeys, reduced_variables, season, case='', variant='', path='' ): """Computes climatologies and writes them to a file. Inputs: varkeys, names of variables whose climatologies are to be computed reduced_variables, dict (key:rv) where key is a variable name and rv an instance of the class reduced_variable season: the season on which the climatologies will be computed variant: a string to be inserted in the filename""" # Compute the value of every variable we need. # This function does not return the variable values, or even keep them. # First compute all the reduced variables # Probably this loop consumes most of the running time. It's what has to read in all the data. firsttime = True for key in varkeys: if key in reduced_variables: time0 = time.time() #print "jfp",time.ctime() varval = reduced_variables[key].reduce() #print "jfp",time.ctime(),"reduced",key,"in time",time.time()-time0 pmemusg = resource.getrusage(resource.RUSAGE_SELF).ru_maxrss # "maximum resident set size" pmemusg = pmemusg / 1024./1024. # On Linux, should be 1024 for MB #print "jfp peak memory",pmemusg,"MB (GB on Linux)" #requires psutil process = psutil.Process(os.getpid()) #requires psutil mem = process.get_memory_info()[0] / float(2**20) #print "jfp process memory",mem,"MB" else: continue if varval is None: continue var = reduced_variables[key] if firsttime: firsttime = False if case=='': case = getattr( var, 'case', '' ) if case!='': case = var._file_attributes['case']+'_' if case=='': case = 'nocase_' if variant!='': variant = variant+'_' filename = case + variant + season + "_climo.nc" value=0 cdms2.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(value) ## where value is a integer between 0 and 9 included g = cdms2.open( os.path.join(path,filename), 'w' ) # later, choose a better name and a path! # ...actually we want to write this to a full directory structure like # root/institute/model/realm/run_name/season/ logger.info("writing %s",key,"in climatology file %s",filename) varval.id = var.variableid varval.reduced_variable=varval.id if hasattr(var,'units'): varval.units = var.units+'*'+var.units g.write(varval) for attr,val in var._file_attributes.items(): if not hasattr( g, attr ): setattr( g, attr, val ) if firsttime: logger.error("No variables found. Did you specify the right input data?") else: g.season = season g.close() return case
import cdms2 import hashlib import numpy from collections import OrderedDict, Mapping import pcmdi_metrics import cdp.cdp_io import subprocess import sys import shlex import datetime from pcmdi_metrics import LOG_LEVEL import copy import re value = 0 cdms2.setNetcdfShuffleFlag(value) # where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) # where value is either 0 or 1 # where value is a integer between 0 and 9 included cdms2.setNetcdfDeflateLevelFlag(value) logging.getLogger("pcmdi_metrics").setLevel(LOG_LEVEL) try: basestring # noqa except Exception: basestring = str # Convert cdms MVs to json def MV2Json(data, dic={}, struct=None): if struct is None: struct = []
def correctFile(idxcorr, ncorr, inFile, inDir, outFile, outDir): ''' Correct density binned files (undefined ptop & long 0 issue) idxcorr = [idx_i,idx_i1,jmax] indices for longitude correction - if [0,0,0] ignore ncorr = number of corrections: 1 or 2 ''' # CDMS initialisation - netCDF compression comp = 1 # 0 for no compression cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # Numpy initialisation npy.set_printoptions(precision=2) varList3D = ['isondepthg','isonthickg', 'sog','thetaog'] varList2D = ['ptopsoxy','ptopdepthxy','ptopsigmaxy','ptopthetaoxy','persistmxy'] # First test, read level by level and write level by level (memory management) # use ncpdq -a time,lev,lat,lon to recover the dimension order fi = cdm.open(inDir+'/'+inFile) fo = cdm.open(outDir+'/'+outFile,'w') isondg = fi['isondepthg'] ; # Create variable handle # Get grid objects #axesList = isondg.getAxisList() #sigmaGrd = isondg.getLevel() lonN = isondg.shape[3] latN = isondg.shape[2] levN = isondg.shape[1] timN = isondg.shape[0] #valmask = isondg.missing_value if ncorr == 2: ic1 = idxcorr[0][0] ic2 = idxcorr[0][1] jcmax = idxcorr[0][2] ic12 = idxcorr[1][0] ic22 = idxcorr[1][1] jcmax2 = idxcorr[1][2] if ic2 >= lonN-1: ic2 = 0 if ic22 >= lonN-1: ic22 = 0 elif ncorr == 1: ic1 = idxcorr[0] ic2 = idxcorr[1] jcmax = idxcorr[2] if ic2 >= lonN-1: ic2 = 0 #print ic1,ic2,jcmax corr_long = True if ic1 == 0 and ic2 == 0 and jcmax == 0: corr_long = False #testp = 10 for it in range(timN): #if it/testp*testp == it: # print ' year =',it # test #i = 90 #j = 90 #i2d = 6 #j2d = 12 #ij = j*lonN+i #ij2d = j2d*lonN+i2d #print 'ij=',ij # 3D variables for iv in varList3D: #print iv outVar = fi(iv,time = slice(it,it+1)) # Correct for longitude interpolation issue if corr_long: for jt in range(jcmax): outVar[:,:,jt,ic1] = (outVar[:,:,jt,ic1-1]+outVar[:,:,jt,ic2+1])/2 outVar[:,:,jt,ic2] = outVar[:,:,jt,ic1] if ncorr == 2: for jt in range(jcmax2): outVar[:,:,jt,ic12] = (outVar[:,:,jt,ic12-1]+outVar[:,:,jt,ic22+1])/2 outVar[:,:,jt,ic22] = outVar[:,:,jt,ic12] # Correct Bowl properties if iv =='isondepthg': vardepth = npy.reshape(outVar,(levN,latN*lonN)) #print 'test' #print outVar[:,:,j2d,i2d] #print vardepth[:,ij2d] # find values of surface points vardepthBowl = npy.min(npy.reshape(outVar,(levN,latN*lonN)),axis=0) vardepthBowlTile = npy.repeat(vardepthBowl,levN,axis=0).reshape((latN*lonN,levN)).transpose() #print vardepthBowlTile.shape #print vardepthBowl[ij2d], vardepthBowlTile[:,ij2d] levs = outVar.getAxisList()[1][:] #print 'levs',levs levs3d = mv.reshape(npy.tile(levs,latN*lonN),(latN*lonN,levN)).transpose() varsigmaBowl = npy.max(npy.where(vardepth == vardepthBowlTile,levs3d,0),axis=0) #print varsigmaBowl[ij2d],levs3d[:,ij2d] elif iv == 'sog': varsog = npy.reshape(outVar,(levN,latN*lonN)) varsoBowl = npy.max(npy.where(vardepth == vardepthBowlTile,varsog,0),axis=0) #print varsoBowl[ij2d], varsog[:,ij2d] #print vardepth[:,ij2d],vardepthBowlTile[:,ij2d] del (varsog); gc.collect() elif iv =='thetaog': varthetao = npy.reshape(outVar,(levN,latN*lonN)) varthetaoBowl = npy.max(npy.where(vardepth == vardepthBowlTile,varthetao,-1000),axis=0) #print varthetaoBowl[ij2d],varthetao[:,ij2d] del (varthetao); gc.collect() # Write fo.write(outVar.astype('float32'), extend = 1, index = it) fo.sync() del (vardepth); gc.collect() # 2D variables and correct isondepthg = 0 for iv in varList2D: outVar = fi(iv,time = slice(it,it+1)) # Correct for longitude interpolation issue if corr_long: for jt in range(jcmax): outVar[:,jt,ic1] = (outVar[:,jt,ic1-1]+outVar[:,jt,ic2+1])/2 outVar[:,jt,ic2] = outVar[:,jt,ic1] if ncorr == 2: for jt in range(jcmax2): outVar[:,jt,ic12] = (outVar[:,jt,ic12-1]+outVar[:,jt,ic22+1])/2 outVar[:,jt,ic22] = outVar[:,jt,ic12] # Correct for ptopsoxy < 30 #print 'before',outVar[:,j2d,i2d] if iv == 'ptopsoxy': testso = npy.reshape(outVar,(latN*lonN)) < 30. #print 'testdepth', testdepth[ij2d] #print npy.argwhere(testdepth)[0:10]/lonN, npy.argwhere(testdepth)[0:10]-npy.argwhere(testdepth)[0:10]/lonN*lonN outVar.data[...] = npy.where(testso,varsoBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] elif iv == 'ptopdepthxy': outVar.data[...] = npy.where(testso,vardepthBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] elif iv == 'ptopthetaoxy': outVar.data[...] = npy.where(testso,varthetaoBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] elif iv == 'ptopsigmaxy': outVar.data[...] = npy.where(testso,varsigmaBowl,npy.reshape(outVar,(latN*lonN))).reshape(outVar.shape)[...] #print 'after',outVar[:,j2d,i2d] # Write fo.write(outVar.astype('float32'), extend = 1, index = it) fo.sync() fi.close() fo.close() # testing #model = 'CCSM4' #idxcorr=[139,140,145] #ncorr = 1 #inFile = 'cmip5.CCSM4.historical24.r1i1p1.an.ocn.Omon.density.ver-v20121128.nc' #inDir = '/Users/ericg/Projets/Density_bining/Raw_testing' #outFile = 'cmip5.CCSM4.historical24.outtest.nc' #model = 'CanESM2' #idxcorr=[179,180,180] #ncorr = 1 #inFile = 'cmip5.CanESM2.historical24.r1i1p1.an.ocn.Omon.density.ver-1.nc' #inDir = '/Users/ericg/Projets/Density_bining/Raw_testing' #outFile = 'cmip5.CanESM2.historical24.outtest.nc' #model = 'IPSL-CM5A-LR' #idxcorr=[0,0,0] #ncorr=1 #inFile = 'cmip5.IPSL-CM5A-LR.historical24.r1i1p1.an.ocn.Omon.density.ver-v20111119.nc' #inDir = '/Users/ericg/Projets/Density_bining/Raw_testing' #outFile = 'cmip5.IPSL-CM5A-LR.historical24.outtest.nc' #model = 'Ishii' #idxcorr=[[359,359,39],[180,180,180]] #idxcorr=[359,359,39] #ncorr = 1 #inFile = 'obs.Ishii.historical.r0i0p0.an.ocn.Omon.density.ver-1.latestX.nc' #inDir='/Volumes/hciclad/data/Density_binning/Prod_density_obs_april16' #outFile = 'obs.Ishii.historical.r0i0p0.an.ocn.Omon.density.ver-1.latestXCorr.nc' #model = 'EN4' #idxcorr=[[359,359,39],[180,180,180]] #idxcorr=[359,359,39] #ncorr = 2 #inFile = 'obs.EN4.historical.r0i0p0.mo.ocn.Omon.density.ver-1.latestX.nc' #inDir='/Volumes/hciclad/data/Density_binning/Prod_density_obs_april16' #outFile = 'obs.EN4.historical.r0i0p0.mo.ocn.Omon.density.ver-1.latestXCorr.nc' #outDir = inDir #correctFile(idxcorr, ncorr, inFile, inDir, outFile, outDir)
#!/usr/local/cdat5.2/bin/python # v2 adds seasonal and quarters calculations for ptot, r02, sdii function # For sdii it's neccesary run everything again """Module for computing precipitation extreme stats mostly using CDO utilities""" from sys import exit from os import path, system, mkdir from cdms2 import setNetcdfShuffleFlag, setNetcdfDeflateLevelFlag, setNetcdfDeflateFlag from string import split from datetime import datetime from daily_stats_cdms_utils import MosaicFiles setNetcdfShuffleFlag(0) setNetcdfDeflateFlag(0) setNetcdfDeflateLevelFlag(0) RootDir = '/mnt/BCSD' OUTROOT = '/mnt/data_climatewizard/AR5_Global_Daily_25k/out_stats' if not path.isdir(OUTROOT): mkdir(OUTROOT) OUTTEMP = '/mnt/workspace_cluster_12/ClimateWizard/AR5_Global_Daily_25k'#'/mnt/data_climatewizard/AR5_Global_Daily_25k' if not path.isdir(OUTTEMP): mkdir(OUTTEMP) # added as fgobal institution attribute to output files txtinst = "Santa Clara U.,Climate Central,The Nature Conservancy,International Center for Tropical Agriculture"
def write_plot_data( self, format="", where="" ): """Writes the plot's data in the specified file format and to the location given.""" if format=="" or format=="NetCDF" or format=="NetCDF file": format = "NetCDF file" elif format=="JSON string": pass elif format=="JSON file": pass else: logger.warning("write_plot_data cannot recognize format name %s",format) logger.warning("will write a NetCDF file.") format = "NetCDF file" filename = self.outfile( format, where ) if format=="NetCDF file": value=0 cdms2.setNetcdfShuffleFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateFlag(value) ## where value is either 0 or 1 cdms2.setNetcdfDeflateLevelFlag(value) ## where value is a integer between 0 and 9 included writer = cdms2.open( filename, 'w' ) # later, choose a better name and a path! store_provenance(writer) elif format=="JSON file": logger.error("JSON file not implemented yet") elif format=="JSON string": return json.dumps(self,cls=DiagsEncoder) writer.source = "UV-CDAT Diagnostics" writer.presentation = self.ptype plot_these = [] for zax in self.vars: try: if not hasattr(zax,'filetableid'): zax.filetableid = zax.filetable.id() del zax.filetable # we'll write var soon, and can't write a filetable if hasattr(zax,'filetable2'): zax.filetable2id = zax.filetable2.id() del zax.filetable2 # we'll write var soon, and can't write a filetable except: pass try: zax._filetableid= zax.filetableid # and the named tuple ids aren't writeable as such zax.filetableid= str(zax.filetableid) # and the named tuple ids aren't writeable as such except: pass try: zax._filetable2id= zax.filetable2id # and the named tuple ids aren't writeable as such zax.filetable2id= str(zax.filetable2id) # and the named tuple ids aren't writeable as such except: pass for ax in zax.getAxisList(): try: del ax.filetable except: pass writer.write( zax ) plot_these.append( str(seqgetattr(zax,'id','')) ) writer.plot_these = ' '.join(plot_these) # Once the finalized method guarantees that varmax,varmin are numbers... #if self.finalized==True: # writer.varmax = self.varmax # writer.varmin = self.varmin writer.close() return [filename]
#!/usr/bin/env python # Adapted for numpy/ma/cdms2 by convertcdms.py import numpy.oldnumeric as Numeric # Input arguments to the script import sys, numpy.ma as MA, string, cdms2 as cdms, cdtime, cdutil, numpy.oldnumeric as Numeric from cdtime import reltime # reset DefaultCalendar below cdtime.DefaultCalendar = cdtime.NoLeapCalendar cdms.setNetcdfShuffleFlag(0) cdms.setNetcdfDeflateFlag(0) cdms.setNetcdfDeflateLevelFlag(0) pth = sys.argv[1] infile = sys.argv[2] varin = sys.argv[3] ABfile = sys.argv[4] outfile = 'x' + sys.argv[2] varout = varin psfile = sys.argv[5] levels = string.join(sys.argv[6:]) Avar = 'hyam' Bvar = 'hybm' P0var = 'P0' varps = 'PS' levels = string.join(sys.argv[6:]) levels = eval(levels) # evaluate the string levels = MA.asarray(list(levels)) * 100.
def mmeAveMsk2D(listFiles, years, inDir, outDir, outFile, timeInt, mme, timeBowl, ToeType, debug=True): ''' The mmeAveMsk2D() function averages rhon/lat density bined files with differing masks It ouputs - the MME - a percentage of non-masked bins - the sign agreement of period2-period1 differences - ToE per run and for MME Author: Eric Guilyardi : [email protected] Created on Tue Nov 25 13:56:20 CET 2014 Inputs: ------- - listFiles(str) - the list of files to be averaged - years(t1,t2) - years for slice read - inDir[](str) - input directory where files are stored (add histnat as inDir[1] for ToE) - outDir(str) - output directory - outFile(str) - output file - timeInt(2xindices) - indices of init period to compare with (e.g. [1,20]) - mme(bool) - multi-model mean (will read in single model ensemble stats) - timeBowl - either time 'mean' or time 'max' bowl used to mask out bowl - ToeType(str) - ToE type ('F': none, 'histnat') -> requires running first mm+mme without ToE to compute Stddev - debug <optional> - boolean value Notes: ----- - EG 25 Nov 2014 - Initial function write - EG 27 Nov 2014 - Rewrite with loop on variables - EG 06 Dec 2014 - Added agreement on difference with init period - save as <var>Agree - EG 07 Dec 2014 - Read bowl to remove points above bowl - save as <var>Bowl - EG 19 Apr 2016 - ToE computation (just for 2D files) - EG 07 Oct 2016 - add 3D file support - EG 21 Nov 2016 - move 3D support to new function - EG 10 jan 2017 - added timeBowl option - TODO : - remove loops - add computation of ToE per model (toe 1 and toe 2) see ticket #50 - add isonhtc (see ticket #48) ''' # CDMS initialisation - netCDF compression comp = 1 # 0 for no compression cdm.setNetcdfShuffleFlag(comp) cdm.setNetcdfDeflateFlag(comp) cdm.setNetcdfDeflateLevelFlag(comp) cdm.setAutoBounds('on') # Numpy initialisation npy.set_printoptions(precision=2) if debug: debug = True else: debug = False # File dim and grid inits t1 = years[0] t2 = years[1] if t2 <= 0: useLastYears = True t2 = -t2 else: useLastYears = False t10 = t1 t20 = t2 # Bound of period average to remove peri1 = timeInt[0] peri2 = timeInt[1] fi = cdm.open(inDir[0] + '/' + listFiles[0]) isond0 = fi['isondepth'] # Create variable handle # Get grid objects axesList = isond0.getAxisList() sigmaGrd = isond0.getLevel() latN = isond0.shape[3] levN = isond0.shape[2] basN = isond0.shape[1] varsig = 'ptopsigma' # Declare and open files for writing if os.path.isfile(outDir + '/' + outFile): os.remove(outDir + '/' + outFile) outFile_f = cdm.open(outDir + '/' + outFile, 'w') # Testing mme with less models #listFiles=listFiles[0:4] #timN = isond0.shape[0] timN = t2 - t1 runN = len(listFiles) print ' Number of members:', len(listFiles) valmask = isond0.missing_value[0] varList = [ 'isondepth', 'isonpers', 'isonso', 'isonthetao', 'isonthick', 'isonvol' ] varFill = [0., 0., valmask, valmask, 0., 0.] # init arrays (2D rho/lat) percent = npy.ma.ones([runN, timN, basN, levN, latN], dtype='float32') * 0. #minbowl = npy.ma.ones([basN,latN], dtype='float32')*1000. varbowl = npy.ma.ones([runN, timN, basN, latN], dtype='float32') * 1. #varList = ['isondepth'] #print ' !!! ### Testing one variable ###' #varList = ['isonthetao'] # init time axis time = cdm.createAxis(npy.float32(range(timN))) time.id = 'time' time.units = 'years since 1861' time.designateTime() # init ensemble axis ensembleAxis = cdm.createAxis(npy.float32(range(runN))) ensembleAxis.id = 'members' ensembleAxis.units = 'N' # loop on variables for iv, var in enumerate(varList): # Array inits (2D rho/lat 3D rho/lat/lon) #shapeR = [basN,levN,latN] isonvar = npy.ma.ones([runN, timN, basN, levN, latN], dtype='float32') * valmask print('isonvar shape: ', isonvar.shape) vardiff, varbowl2D = [ npy.ma.ones([runN, timN, basN, levN, latN], dtype='float32') for _ in range(2) ] varstd, varToE1, varToE2 = [ npy.ma.ones([runN, basN, levN, latN], dtype='float32') * valmask for _ in range(3) ] varones = npy.ma.ones([runN, timN, basN, levN, latN], dtype='float32') * 1. print ' Variable ', iv, var # loop over files to fill up array for i, file in enumerate(listFiles): ft = cdm.open(inDir[0] + '/' + file) model = file.split('.')[1] timeax = ft.getAxis('time') file1d = replace(inDir[0] + '/' + file, '2D', '1D') if os.path.isfile(file1d): f1d = cdm.open(file1d) else: print 'ERROR:', file1d, 'missing (if mme, run 1D first)' sys.exit(1) tmax = timeax.shape[0] if i == 0: tmax0 = tmax #adapt [t1,t2] time bounds to piControl last NN years if useLastYears: t1 = tmax - t20 t2 = tmax else: if tmax != tmax0: print 'wrong time axis: exiting...' return # read array # loop over time/density for memory management for it in range(timN): t1r = t1 + it t2r = t1r + 1 isonRead = ft(var, time=slice(t1r, t2r)) if varFill[iv] != valmask: isonvar[i, it, ...] = isonRead.filled(varFill[iv]) else: isonvar[i, it, ...] = isonRead # compute percentage of non-masked points accros MME if iv == 0: maskvar = mv.masked_values(isonRead.data, valmask).mask percent[i, ...] = npy.float32(npy.equal(maskvar, 0)) if mme: # if mme then just accumulate Bowl, Agree fields varst = var + 'Agree' vardiff[i, ...] = ft(varst, time=slice(t1, t2)) varb = var + 'Bowl' varbowl2D[i, ...] = ft(varb, time=slice(t1, t2)) else: # Compute difference with average of first initN years varinit = cdu.averager(isonvar[i, peri1:peri2, ...], axis=0) for t in range(timN): vardiff[i, t, ...] = isonvar[i, t, ...] - varinit vardiff[i, ...].mask = isonvar[i, ...].mask # Read bowl and truncate 2D field above bowl if iv == 0: bowlRead = f1d(varsig, time=slice(t1, t2)) varbowl[i, ...] = bowlRead # Compute Stddev varstd[i, ...] = npy.ma.std(isonvar[i, ...], axis=0) # Compute ToE if ToeType == 'histnat': # Read mean and Std dev from histnat if i == 0: filehn = glob.glob(inDir[1] + '/cmip5.' + model + '.*zon2D*')[0] #filehn = replace(outFile,'historical','historicalNat') fthn = cdm.open(filehn) varmeanhn = fthn(var) varst = var + 'Std' varmaxstd = fthn(varst) toemult = 1. signal = npy.reshape(isonvar[i, ...] - varmeanhn, (timN, basN * levN * latN)) noise = npy.reshape(varmaxstd, (basN * levN * latN)) varToE1[i, ...] = npy.reshape(findToE(signal, noise, toemult), (basN, levN, latN)) toemult = 2. varToE2[i, ...] = npy.reshape(findToE(signal, noise, toemult), (basN, levN, latN)) ft.close() f1d.close() # <-- end of loop on files # Compute percentage of bin presence # Only keep points where percent > 50% if iv == 0: percenta = (cdu.averager(percent, axis=0)) * 100. percenta = mv.masked_less(percenta, 50) percentw = cdm.createVariable( percenta, axes=[time, axesList[1], axesList[2], axesList[3]], id='isonpercent') percentw._FillValue = valmask percentw.long_name = 'percentage of MME bin' percentw.units = '%' outFile_f.write(percentw.astype('float32')) # Sign of difference if mme: vardiffsgSum = cdu.averager(vardiff, axis=0) vardiffsgSum = cdm.createVariable( vardiffsgSum, axes=[time, axesList[1], axesList[2], axesList[3]], id='foo') vardiffsgSum = maskVal(vardiffsgSum, valmask) vardiffsgSum.mask = percentw.mask else: vardiffsg = npy.copysign(varones, vardiff) # average signs vardiffsgSum = cdu.averager(vardiffsg, axis=0) vardiffsgSum = mv.masked_greater(vardiffsgSum, 10000.) vardiffsgSum.mask = percentw.mask vardiffsgSum._FillValue = valmask # average variable accross members isonVarAve = cdu.averager(isonvar, axis=0) isonVarAve = cdm.createVariable( isonVarAve, axes=[time, axesList[1], axesList[2], axesList[3]], id='foo') # mask if varFill[iv] == valmask: isonVarAve = maskVal(isonVarAve, valmask) isonVarAve.mask = percentw.mask # Only keep points with rhon > bowl-delta_rho delta_rho = 0. if mme: # start from average of <var>Agree isonVarBowl = cdu.averager(varbowl2D, axis=0) isonVarBowl = cdm.createVariable( isonVarBowl, axes=[time, axesList[1], axesList[2], axesList[3]], id='foo') isonVarBowl = maskVal(isonVarBowl, valmask) isonVarBowl.mask = percentw.mask # Compute intermodel stddev isonVarStd = statistics.std(varbowl2D, axis=0) isonVarStd = cdm.createVariable( isonVarStd, axes=[time, axesList[1], axesList[2], axesList[3]], id='foo') isonVarStd = maskVal(isonVarStd, valmask) isonVarStd.mask = percentw.mask if iv == 0: # Read mulitmodel sigma on bowl and average in time file1d = replace(outDir + '/' + outFile, '2D', '1D') if os.path.isfile(file1d): f1d = cdm.open(file1d) else: print 'ERROR:', file1d, 'missing (if mme, run 1D first)' sys.exit(1) bowlRead = f1d(varsig, time=slice(t1, t2)) f1d.close() siglimit = cdu.averager(bowlRead, axis=0) - delta_rho # TODO: remove loop by building global array with 1/0 for il in range(latN): for ib in range(basN): #if ib == 2: # print il, siglimit[ib,il] if siglimit[ib, il] < valmask / 1000.: # if mme bowl density defined, mask above bowl index = (npy.argwhere(sigmaGrd[:] >= siglimit[ib, il])) isonVarBowl[:, ib, 0:index[0], il].mask = True isonVarStd[:, ib, 0:index[0], il].mask = True vardiffsgSum[:, ib, 0:index[0], il].mask = True else: # mask all points isonVarBowl[:, ib, :, il].mask = True isonVarStd[:, ib, :, il].mask = True vardiffsgSum[:, ib, :, il].mask = True else: isonVarBowl = isonVarAve * 1. # start from variable isonVarStd = isonVarAve * 1. # start from variable if iv == 0: siglimit = cdu.averager(varbowl, axis=0) # average accross members # Average bowl in time if timeBowl == 'mean': siglimit = cdu.averager(siglimit, axis=0) - delta_rho # or take largest sigma over time else: siglimit = npy.ma.max(siglimit, axis=0) - delta_rho # TODO: remove loop by building global array with 1/0 for il in range(latN): for ib in range(basN): if siglimit[ib, il] < valmask / 1000.: # if bowl density defined, mask above bowl index = (npy.argwhere(sigmaGrd[:] >= siglimit[ib, il]) )[:, 0] #Add [:,0] for python Yona #import code #code.interact(banner='index', local=dict(locals(), **globals())) isonVarBowl[:, ib, 0:index[0], il].mask = True vardiffsgSum[:, ib, 0:index[0], il].mask = True else: # mask all points vardiffsgSum[:, ib, :, il].mask = True isonVarBowl = maskVal(isonVarBowl, valmask) # Find max of Std dev of all members isonVarStd = npy.ma.max(varstd, axis=0) # mask if varFill[iv] == valmask: isonVarStd = maskVal(isonVarStd, valmask) # Write isonave = cdm.createVariable( isonVarAve, axes=[time, axesList[1], axesList[2], axesList[3]], id=isonRead.id) isonave.long_name = isonRead.long_name isonave.units = isonRead.units isonavediff = cdm.createVariable( vardiffsgSum, axes=[time, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'Agree') isonavediff.long_name = isonRead.long_name isonavediff.units = isonRead.units isonavebowl = cdm.createVariable( isonVarBowl, axes=[time, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'Bowl') isonavebowl.long_name = isonRead.long_name isonavebowl.units = isonRead.units if not mme: isonmaxstd = cdm.createVariable( isonVarStd, axes=[axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'Std') isonmaxstd.long_name = isonRead.long_name isonmaxstd.units = isonRead.units outFile_f.write(isonave.astype('float32')) outFile_f.write(isonavediff.astype('float32')) outFile_f.write(isonavebowl.astype('float32')) if not mme: outFile_f.write(isonmaxstd.astype('float32')) if ToeType == 'histnat': isontoe1 = cdm.createVariable( varToE1, axes=[ensembleAxis, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'ToE1') isontoe1.long_name = 'ToE 1 for ' + isonRead.long_name isontoe1.units = 'Year' isontoe2 = cdm.createVariable( varToE2, axes=[ensembleAxis, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'ToE2') isontoe2.long_name = 'ToE 2 for ' + isonRead.long_name isontoe2.units = 'Year' outFile_f.write(isontoe1.astype('float32')) outFile_f.write(isontoe2.astype('float32')) if mme: isonvarstd = cdm.createVariable( isonVarStd, axes=[time, axesList[1], axesList[2], axesList[3]], id=isonRead.id + 'ModStd') isonvarstd.long_name = isonRead.long_name + ' intermodel std' isonvarstd.units = isonRead.units outFile_f.write(isonvarstd.astype('float32')) # <--- end of loop on variables outFile_f.close() fi.close()