Exemple #1
0
def molExport():
    """
Implements Marvin 4 js MolConvert web service. Converts compound from one format to another, including Marvin's
*.mrv.
    """

    params = json.loads(request.body.read())
    structure = params['structure']
    input_f = params.get('inputFormat')
    output_f = params.get('parameters', 'mrv')

    res = _molExport(structure, input=input_f, output=output_f)
    response.content_type = 'application/json'
    return json.dumps(res)
Exemple #2
0
def molExport():
    """
Implements Marvin 4 js MolConvert web service. Converts compound from one format to another, including Marvin's
*.mrv.
    """

    params = json.loads(request.body.read())
    structure = params['structure']
    input_f = params.get('inputFormat')
    output_f = params.get('parameters','mrv')

    res = _molExport(structure, input=input_f, output=output_f)
    response.content_type = 'application/json'
    return json.dumps(res)
Exemple #3
0
def hydrogenize():
    """
Implements Marvin 4 js Hydrogenize web service. Adds or removes hydrogen atoms. The compound is in
Marvin's *.mrv format. Dim is an optional parameter specifying if 2D or 3D coordinates should be computed
    """

    params = json.loads(request.body.read())
    structure = params['structure']
    input_format = params.get('inputFormat', 'mrv')
    parameters = params.get('parameters')
    method = 'hydrogenize'
    if parameters:
        method = parameters.get('method', 'hydrogenize')
        method = method.lower()
    response.content_type = 'text/plain'
    return _hydrogenize(_molExport(structure, input=input_format, output='mol')["structure"], method == 'hydrogenize')
Exemple #4
0
def hydrogenize():
    """
Implements Marvin 4 js Hydrogenize web service. Adds or removes hydrogen atoms. The compound is in
Marvin's *.mrv format. Dim is an optional parameter specifying if 2D or 3D coordinates should be computed
    """

    params = json.loads(request.body.read())
    structure = params['structure']
    input_format = params.get('inputFormat', 'mrv')
    parameters = params.get('parameters')
    method = 'hydrogenize'
    if parameters:
        method = parameters.get('method', 'hydrogenize')
        method = method.lower()
    response.content_type = 'text/plain'
    return _hydrogenize(_molExport(structure, input=input_format, output='mol')["structure"], method == 'hydrogenize')
Exemple #5
0
def molExport():
    """
Implements Marvin 4 js MolConvert web service. Converts compound from one format to another, including Marvin's
*.mrv.

    curl '${BEAKER_ROOT_URL}/molExport' --data '{"structure":"O.CCN1C(=O)c2cccc3c(ccc(C1=O)c23)N4C=C5CN67CCCN8CCN9%10
    CCCN(CC6)[Cu]789(N%11=NN(C=C%11C%10)c%12ccc%13C(=O)N(CC)C(=O)c%14cccc%12c%13%14)N5=N4.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)
    (=O)=O", "parameters":"mrv"}'
    """

    params = json.loads(request.body.read())
    structure = params['structure']
    input_f = params.get('inputFormat')
    output_f = params.get('parameters', 'mrv')

    res = _molExport(structure, input=input_f, output=output_f)
    response.content_type = 'application/json'
    return json.dumps(res)