def test_keep_biggest(): mol = Filters.keep_biggest(MolFromSmiles('CCCC.CC')) assert MolToSmiles(mol) == 'CCCC' mol = Filters.keep_biggest(MolFromSmiles('CCCCC.CC.[H].CCC')) assert MolToSmiles(mol) == 'CCCCC' mol = Filters.keep_biggest( MolFromInchi( 'InChI=1S/C5H12N2O2.C4H7NO4/c6-3-1-2-4(7)5(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,6-7H2,(H,8,9);2H,1,5H2,(H,6,7)(H,8,9)/t4-;2-/m00/s1' )) assert MolToInchi( mol ) == 'InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1' mol = Filters.keep_biggest(MolFromInchi('InChI=1S/Mo.4O/q;;;2*-1')) assert MolToInchi(mol) == 'InChI=1S/Mo'
def sequence_rr_legacy(mol): """Sequence of filters applied for the first version of RetroRules """ F = Filters() Cleanup(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) AssignStereochemistry( mol, cleanIt=True, force=True, flagPossibleStereoCenters=True) # Fix bug TD201904.01 mol = F.remove_isotope(mol) mol = F.neutralise_charge(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) mol = F.keep_biggest(mol) mol = F.add_hydrogen(mol, addCoords=True) mol = F.kekulize(mol) return mol
def sequence_tunable(mol, OP_REMOVE_ISOTOPE=True, OP_NEUTRALISE_CHARGE=True, OP_REMOVE_STEREO=False, OP_COMMUTE_INCHI=False, OP_KEEP_BIGGEST=True, OP_ADD_HYDROGEN=True, OP_KEKULIZE=True, OP_NEUTRALISE_CHARGE_LATE=True): """Tunable sequence of filters for standardization. Operations will made in the following order: 1 RDKit Cleanup -- always 2 RDKIT SanitizeMol -- always 3 Remove isotope -- optional (default: True) 4 Neutralise charges -- optional (default: True) 5 RDKit SanitizeMol -- if 4 or 5 6 Remove stereo -- optional (default: False) 7 Commute Inchi -- if 6 or optional (default: False) 8 Keep biggest -- optional (default: True) 9 RDKit SanitizeMol -- if any (6, 7, 8) 10 Add hydrogens -- optional (default: True) 11 Kekulize -- optional (default: True) """ F = Filters() # Always perform the basics.. Cleanup(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) AssignStereochemistry( mol, cleanIt=True, force=True, flagPossibleStereoCenters=True) # Fix bug TD201904.01 # if OP_REMOVE_ISOTOPE: mol = F.remove_isotope(mol) if OP_NEUTRALISE_CHARGE: mol = F.neutralise_charge(mol) if any([OP_REMOVE_ISOTOPE, OP_REMOVE_ISOTOPE]): SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) # if OP_REMOVE_STEREO: mol = F.remove_stereo(mol) OP_COMMUTE_INCHI = True if OP_COMMUTE_INCHI: mol = F.commute_inchi(mol) if OP_KEEP_BIGGEST: mol = F.keep_biggest(mol) if any([OP_REMOVE_STEREO, OP_COMMUTE_INCHI, OP_KEEP_BIGGEST]): SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) # if OP_NEUTRALISE_CHARGE_LATE: mol = F.neutralise_charge(mol) SanitizeMol(mol, sanitizeOps=SanitizeFlags.SANITIZE_ALL, catchErrors=False) # if OP_ADD_HYDROGEN: mol = F.add_hydrogen(mol, addCoords=True) if OP_KEKULIZE: mol = F.kekulize(mol) # return mol