def test_allow_empty_def(self): import mbuild as mb ethane = mb.load(get_fn("ethane.mol2")) with pytest.warns(ValidationWarning): ff = Forcefield(forcefield_files=get_fn("empty_def.xml")) ff.apply(ethane)
def test_non_zero_charge(self): import mbuild as mb compound = mb.load("C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)C(=O)O", smiles=True) oplsaa = Forcefield(name="oplsaa") with pytest.warns(UserWarning): oplsaa.apply(compound, assert_dihedral_params=False)
def test_write_xml(self, filename): mol = pmd.load_file(get_fn(filename), structure=True) oplsaa = Forcefield(name="oplsaa") typed = oplsaa.apply(mol) typed.write_foyer(filename="opls-snippet.xml", forcefield=oplsaa, unique=True) oplsaa_partial = Forcefield("opls-snippet.xml") typed_by_partial = oplsaa_partial.apply(mol) for adj in typed.adjusts: type1 = adj.atom1.atom_type type2 = adj.atom1.atom_type sigma_factor_pre = adj.type.sigma / ( (type1.sigma + type2.sigma) / 2) epsilon_factor_pre = adj.type.epsilon / ( (type1.epsilon * type2.epsilon)**0.5) for adj in typed_by_partial.adjusts: type1 = adj.atom1.atom_type type2 = adj.atom1.atom_type sigma_factor_post = adj.type.sigma / ( (type1.sigma + type2.sigma) / 2) epsilon_factor_post = adj.type.epsilon / ( (type1.epsilon * type2.epsilon)**0.5) assert sigma_factor_pre == sigma_factor_post assert epsilon_factor_pre == epsilon_factor_post # Do it again but with an XML including periodic dihedrals mol = pmd.load_file(get_fn(filename), structure=True) oplsaa = Forcefield(get_fn("oplsaa-periodic.xml")) typed = oplsaa.apply(mol) typed.write_foyer(filename="opls-snippet.xml", forcefield=oplsaa, unique=True) oplsaa_partial = Forcefield("opls-snippet.xml") typed_by_partial = oplsaa_partial.apply(mol) for adj in typed.adjusts: type1 = adj.atom1.atom_type type2 = adj.atom1.atom_type sigma_factor_pre = adj.type.sigma / ( (type1.sigma + type2.sigma) / 2) epsilon_factor_pre = adj.type.epsilon / ( (type1.epsilon * type2.epsilon)**0.5) for adj in typed_by_partial.adjusts: type1 = adj.atom1.atom_type type2 = adj.atom1.atom_type sigma_factor_post = adj.type.sigma / ( (type1.sigma + type2.sigma) / 2) epsilon_factor_post = adj.type.epsilon / ( (type1.epsilon * type2.epsilon)**0.5) assert sigma_factor_pre == sigma_factor_post assert epsilon_factor_pre == epsilon_factor_post
def test_missing_overrides(): top = os.path.join(OPLS_TESTFILES_DIR, 'benzene/benzene.top') gro = os.path.join(OPLS_TESTFILES_DIR, 'benzene/benzene.gro') structure = pmd.load_file(top, xyz=gro) forcefield = Forcefield(get_fn('missing_overrides.xml')) with pytest.raises(FoyerError): forcefield.apply(structure)
def test_missing_topo_params(ff_filename, kwargs): """Test that the user is notified if not all topology parameters are found.""" ethane = mb.load(get_fn('ethane.mol2')) oplsaa_with_typo = Forcefield(forcefield_files=get_fn(ff_filename)) with pytest.raises(Exception): ethane = oplsaa_with_typo.apply(ethane) with pytest.warns(UserWarning): ethane = oplsaa_with_typo.apply(ethane, **kwargs)
def test_missing_topo_params(ff_filename, kwargs): """Test that the user is notified if not all topology parameters are found.""" ethane = mb.load(get_fn('ethane.mol2')) oplsaa_with_typo = Forcefield(forcefield_files=get_fn(ff_filename)) with pytest.raises(Exception): ethane = oplsaa_with_typo.apply(ethane) with pytest.warns(UserWarning): ethane = oplsaa_with_typo.apply(ethane, **kwargs)
def test_missing_overrides(): top = os.path.join(OPLS_TESTFILES_DIR, 'benzene/benzene.top') gro = os.path.join(OPLS_TESTFILES_DIR, 'benzene/benzene.gro') structure = pmd.load_file(top, xyz=gro) forcefield = Forcefield(get_fn('bad_ff.xml')) with pytest.raises(FoyerError): forcefield.apply(structure)
def test_topology_precedence(): """Test to see if topology precedence is properly adhered to. This test uses a force field file where bond, angle, and dihedral parameters are present with different counts of `type` definitions. It checks that: 1. The parameters with the higher number of `type` definitions are assigned (because they are given the highest precedence) 2. That if multiple definitions exist with the same number of `type` definitions, that the convention from OpenMM is followed whereby the definitions that occurs earliest in the XML is assigned. """ import mbuild as mb ethane = mb.load(get_fn('ethane.mol2')) ff = Forcefield(forcefield_files=get_fn('ethane-topo-precedence.xml')) typed_ethane = ff.apply(ethane) assert len([bond for bond in typed_ethane.bonds if round(bond.type.req, 2) == 1.15]) == 6 assert len([bond for bond in typed_ethane.bonds if round(bond.type.req, 2) == 1.6]) == 1 assert len([angle for angle in typed_ethane.angles if round(angle.type.theteq, 3) == 120.321]) == 6 assert len([angle for angle in typed_ethane.angles if round(angle.type.theteq, 3) == 97.403]) == 6 assert len([rb for rb in typed_ethane.rb_torsions if round(rb.type.c0, 3) == 0.287]) == 9
def test_apply_subfuncs(): mol2 = pmd.load_file(get_fn('ethane.mol2'), structure=True) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2) typemap = oplsaa.run_atomtyping(mol2, use_residue_map=False) oplsaa._apply_typemap(mol2, typemap) ethane2 = oplsaa.parametrize_system(mol2) # Note: Check ParmEd issue #1067 to see if __eq__ is implemented # assert ethane == ethane2 assert ethane.box == ethane2.box assert ethane.positions == ethane2.positions for a1, a2 in zip(ethane.atoms, ethane2.atoms): assert a1.name == a2.name assert a1.idx == a2.idx assert a1.atom_type == a2.atom_type for b1, b2 in zip(ethane.bonds, ethane2.bonds): assert b1.atom1.atom_type == b2.atom1.atom_type assert b1.atom2.atom_type == b2.atom2.atom_type assert b1.type == b2.type for ang1, ang2 in zip(ethane.angles, ethane2.angles): assert ang1.type == ang2.type
def test_save_charmm(self): cmpd = mb.load(get_fn('charmm_dihedral.mol2')) for i in cmpd.particles(): i.name = "_{}".format(i.name) structure = cmpd.to_parmed(box=cmpd.boundingbox, residues=set([p.parent.name for \ p in cmpd.particles()])) from foyer import Forcefield ff = Forcefield(forcefield_files=[get_fn('charmm_truncated.xml')]) structure = ff.apply(structure, assert_dihedral_params=False) from mbuild.formats.lammpsdata import write_lammpsdata write_lammpsdata(structure, 'charmm_dihedral.lammps') out_lammps = open('charmm_dihedral.lammps', 'r').readlines() for i, line in enumerate(out_lammps): if 'Angle Coeffs' in line: assert '# charmm' in line assert '#\tk(kcal/mol/rad^2)\t\ttheteq(deg)\tk(kcal/mol/angstrom^2)\treq(angstrom)\n' in out_lammps[ i + 1] assert len(out_lammps[i + 2].split('#')[0].split()) == 5 elif 'Dihedral Coeffs' in line: assert '# charmm' in line assert '#k, n, phi, weight' in out_lammps[i + 1] assert len(out_lammps[i + 2].split('#')[0].split()) == 5 else: pass
def test_preserve_resname(): untyped_ethane = pmd.load_file(get_fn('ethane.mol2'), structure=True) untyped_resname = untyped_ethane.residues[0].name oplsaa = Forcefield(name='oplsaa') typed_ethane = oplsaa.apply(untyped_ethane) typed_resname = typed_ethane.residues[0].name assert typed_resname == untyped_resname
def test_assert_bonds(): ff = Forcefield(name='trappe-ua') derponium = mb.Compound() at1 = mb.Particle(name='H') at2 = mb.Particle(name='O') at3 = mb.Particle(name='_CH4') derponium.add([at1, at2, at3]) derponium.add_bond((at1, at2)) derponium.add_bond((at2, at3)) with pytest.raises(Exception): ff.apply(derponium) thing = ff.apply(derponium, assert_bond_params=False, assert_angle_params=False) assert any(b.type is None for b in thing.bonds)
def test_topology_precedence(): """Test to see if topology precedence is properly adhered to. This test uses a force field file where bond, angle, and dihedral parameters are present with different counts of `type` definitions. It checks that: 1. The parameters with the higher number of `type` definitions are assigned (because they are given the highest precedence) 2. That if multiple definitions exist with the same number of `type` definitions, that the convention from OpenMM is followed whereby the definitions that occurs earliest in the XML is assigned. """ ethane = mb.load(get_fn('ethane.mol2')) ff = Forcefield(forcefield_files=get_fn('ethane-topo-precedence.xml')) typed_ethane = ff.apply(ethane) assert len([bond for bond in typed_ethane.bonds if round(bond.type.req, 2) == 1.15]) == 6 assert len([bond for bond in typed_ethane.bonds if round(bond.type.req, 2) == 1.6]) == 1 assert len([angle for angle in typed_ethane.angles if round(angle.type.theteq, 3) == 120.321]) == 6 assert len([angle for angle in typed_ethane.angles if round(angle.type.theteq, 3) == 97.403]) == 6 assert len([rb for rb in typed_ethane.rb_torsions if round(rb.type.c0, 3) == 0.287]) == 9
def test_improper_dihedral(): untyped_benzene = pmd.load_file(get_fn('benzene.mol2'), structure=True) ff_improper = Forcefield(forcefield_files=get_fn('improper_dihedral.xml')) benzene = ff_improper.apply(untyped_benzene, assert_dihedral_params=False) assert len(benzene.dihedrals) == 18 assert len([dih for dih in benzene.dihedrals if dih.improper]) == 6 assert len([dih for dih in benzene.dihedrals if not dih.improper]) == 12
def test_nbfix(self, ethane): from foyer import Forcefield OPLSAA = Forcefield(name="oplsaa") structure = OPLSAA.apply(ethane) # Add nbfixes types = list(set([a.atom_type for a in structure.atoms])) types[0].add_nbfix(types[1].name, 1.2, 2.1) types[1].add_nbfix(types[0].name, 1.2, 2.1) write_lammpsdata(filename="nbfix.lammps", structure=structure) checked_section = False with open("nbfix.lammps", "r") as fi: while not checked_section: line = fi.readline() if "PairIJ Coeffs" in line: fi.readline() line = fi.readline().partition("#")[0] assert np.allclose( np.asarray(line.split(), dtype=float), [1, 1, 0.066, 3.5], ) line = fi.readline().partition("#")[0] assert np.allclose( np.asarray(line.split(), dtype=float), [1, 2, 2.1, 1.06907846], ) line = fi.readline().partition("#")[0] assert np.allclose(np.asarray(line.split(), dtype=float), [2, 2, 0.03, 2.5]) line = fi.readline() checked_section = True # Break if PairIJ Coeffs is not found if "Atoms" in line: break
def test_write_refs_multiple(self, requests_mock): import mbuild as mb register_mock_request( mocker=requests_mock, url="http://api.crossref.org/", path="works/10.1021/ja9621760/transform/application/x-bibtex", headers={"accept": "application/x-bibtex"}, text=RESPONSE_BIB_ETHANE_JA962170, ) register_mock_request( mocker=requests_mock, url="http://api.crossref.org/", path="works/10.1021/jp0484579/transform/application/x-bibtex", headers={"accept": "application/x-bibtex"}, text=RESPONSE_BIB_ETHANE_JP0484579, ) mol2 = mb.load(get_fn("ethane.mol2")) oplsaa = Forcefield(forcefield_files=get_fn("refs-multi.xml")) ethane = oplsaa.apply(mol2, references_file="ethane-multi.bib") assert os.path.isfile("ethane-multi.bib") with open(get_fn("ethane-multi.bib")) as file1: with open("ethane-multi.bib") as file2: diff = list( difflib.unified_diff(file1.readlines(), file2.readlines(), n=0)) assert not diff
def test_apply_residues(): import mbuild as mb from mbuild.examples import Ethane ethane = Ethane() opls = Forcefield(name='oplsaa') typed = opls.apply(ethane, residues='CH3') assert len([res for res in typed.residues if res.name == 'CH3']) == 2
def test_save_forcefield_with_same_struct(self): from foyer import Forcefield from mbuild.formats.lammpsdata import write_lammpsdata system = mb.load("C1(=CC=CC=C1)F", smiles=True) ff = Forcefield(forcefield_files=[get_fn("gaff_test.xml")]) struc = ff.apply( system, assert_angle_params=False, assert_dihedral_params=False, assert_improper_params=False, ) write_lammpsdata(struc, "charmm_improper.lammps", zero_dihedral_weighting_factor=True) for i in range(3): xyz = struc.coordinates xyz = xyz + np.array([1, 1, 1]) struc.coordinates = xyz write_lammpsdata( struc, f"charmm_improper{i}.lammps", zero_dihedral_weighting_factor=True, )
def test_improper_dihedral(): untyped_benzene = pmd.load_file(get_fn('benzene.mol2'), structure=True) ff_improper = Forcefield(forcefield_files=get_fn('improper_dihedral.xml')) benzene = ff_improper.apply(untyped_benzene, assert_dihedral_params=False) assert len(benzene.dihedrals) == 18 assert len([dih for dih in benzene.dihedrals if dih.improper]) == 6 assert len([dih for dih in benzene.dihedrals if not dih.improper]) == 12
def test_singleterm_charmm(self): from foyer import Forcefield from mbuild.formats.lammpsdata import write_lammpsdata cmpd = mb.load(get_fn("charmm_dihedral.mol2")) for i in cmpd.particles(): i.name = "_{}".format(i.name) structure = cmpd.to_parmed( box=cmpd.get_boundingbox(), residues=set([p.parent.name for p in cmpd.particles()]), ) ff = Forcefield( forcefield_files=[get_fn("charmm_truncated_singleterm.xml")]) structure = ff.apply(structure, assert_dihedral_params=False) write_lammpsdata(structure, "charmm_dihedral_singleterm.lammps") out_lammps = open("charmm_dihedral_singleterm.lammps", "r").readlines() found_dihedrals = False for i, line in enumerate(out_lammps): if "Dihedral Coeffs" in line: assert "# charmm" in line assert "#k, n, phi, weight" in out_lammps[i + 1] assert len(out_lammps[i + 2].split("#")[0].split()) == 5 assert float( out_lammps[i + 2].split("#")[0].split()[4]) == float("1.0") found_dihedrals = True else: pass assert found_dihedrals
def test_comb_rule(self, mixing_rule): import mbuild as mb mol2 = mb.load(get_fn("ethane.mol2")) oplsaa = Forcefield(name="oplsaa") ethane = oplsaa.apply(mol2, combining_rule=mixing_rule) assert ethane.combining_rule == mixing_rule
def test_save_charmm(self): from foyer import Forcefield cmpd = mb.load(get_fn("charmm_dihedral.mol2")) for i in cmpd.particles(): i.name = "_{}".format(i.name) structure = cmpd.to_parmed( box=cmpd.get_boundingbox(), residues=set([p.parent.name for p in cmpd.particles()]), ) ff = Forcefield(forcefield_files=[get_fn("charmm_truncated.xml")]) structure = ff.apply(structure, assert_dihedral_params=False) write_lammpsdata(structure, "charmm_dihedral.lammps") out_lammps = open("charmm_dihedral.lammps", "r").readlines() found_angles = False found_dihedrals = False for i, line in enumerate(out_lammps): if "Angle Coeffs" in line: assert "# charmm" in line assert ( "#\tk(kcal/mol/rad^2)\t\ttheteq(deg)\tk(kcal/mol/angstrom^2)\treq(angstrom)\n" in out_lammps[i + 1]) assert len(out_lammps[i + 2].split("#")[0].split()) == 5 found_angles = True elif "Dihedral Coeffs" in line: assert "# charmm" in line assert "#k, n, phi, weight" in out_lammps[i + 1] assert len(out_lammps[i + 2].split("#")[0].split()) == 5 found_dihedrals = True else: pass assert found_angles assert found_dihedrals
def test_overrides_space(self): import mbuild as mb ethane = mb.load(get_fn("ethane.mol2")) ff = Forcefield(forcefield_files=get_fn("overrides-space.xml")) typed_ethane = ff.apply(ethane) assert typed_ethane.atoms[0].type == "CT3"
def test_assert_bonds(): ff = Forcefield(name='trappe-ua') derponium = mb.Compound() at1 = mb.Particle(name='H') at2 = mb.Particle(name='O') at3 = mb.Particle(name='_CH4') derponium.add([at1, at2, at3]) derponium.add_bond((at1, at2)) derponium.add_bond((at2, at3)) with pytest.raises(Exception): ff.apply(derponium) thing = ff.apply(derponium, assert_bond_params=False, assert_angle_params=False) assert any(b.type is None for b in thing.bonds)
def test_preserve_resname(): untyped_ethane = pmd.load_file(get_fn('ethane.mol2'), structure=True) untyped_resname = untyped_ethane.residues[0].name oplsaa = Forcefield(name='oplsaa') typed_ethane = oplsaa.apply(untyped_ethane) typed_resname = typed_ethane.residues[0].name assert typed_resname == untyped_resname
def test_apply_residues(): import mbuild.recipes propane = mbuild.recipes.Alkane(n=3) opls = Forcefield(name='oplsaa') typed = opls.apply(propane, residues='CH3') assert len([res for res in typed.residues if res.name == 'CH3']) == 2
def test_apply_residues(self): import mbuild.recipes propane = mbuild.recipes.Alkane(n=3) opls = Forcefield(name="oplsaa") typed = opls.apply(propane, residues="CH3") assert len([res for res in typed.residues if res.name == "CH3"]) == 2
def test_write_xml_multiple_periodictorsions(filename): cmpd = pmd.load_file(get_fn(filename), structure=True) ff = Forcefield(forcefield_files=get_fn('oplsaa_multiperiodicitytorsion.xml')) typed_struc = ff.apply(cmpd, assert_dihedral_params=False) typed_struc.write_foyer(filename='multi-periodictorsions.xml', forcefield=ff, unique=True) partial_ff = Forcefield(forcefield_files='multi-periodictorsions.xml') typed_by_partial = partial_ff.apply(cmpd, assert_dihedral_params=False) assert len(typed_struc.bonds) == len(typed_by_partial.bonds) assert len(typed_struc.angles) == len(typed_by_partial.angles) assert len(typed_struc.dihedrals) == len(typed_by_partial.dihedrals) root = ET.parse('multi-periodictorsions.xml') periodic_element = root.find('PeriodicTorsionForce') assert 'periodicity2' in periodic_element[0].attrib assert 'k2' in periodic_element[0].attrib assert 'phase2' in periodic_element[0].attrib
def write_lammps(self, filename): cgff = Forcefield(forcefield_files='mbuild_ONA/ONA.xml') #apply it to the mbuild structure test_box_typed = cgff.apply(self, assert_dihedral_params=False) #Output a LAMMPS data file mb.formats.lammpsdata.write_lammpsdata(test_box_typed, filename, atom_style='full')
def test_load_xml(filename): mol = pmd.load_file(get_fn(filename), structure=True) if filename == 'ethane.mol2': ff = Forcefield(get_fn('ethane-multiple.xml')) else: ff = Forcefield(name='oplsaa') typed = ff.apply(mol) typed.write_foyer(filename='snippet.xml', forcefield=ff, unique=True) generated_ff = Forcefield('snippet.xml')
def test_load_xml(self, filename, oplsaa): mol = pmd.load_file(get_fn(filename), structure=True) if filename == "ethane.mol2": ff = Forcefield(get_fn("ethane-multiple.xml")) else: ff = oplsaa typed = ff.apply(mol) typed.write_foyer(filename="snippet.xml", forcefield=ff, unique=True) generated_ff = Forcefield("snippet.xml")
def _create_lammps(ethane, tmp): from foyer import Forcefield OPLSAA = Forcefield(name="oplsaa") structure = OPLSAA.apply(ethane) fn = tmpdir_factory.mktemp("data").join("lj.lammps") write_lammpsdata(filename=str(fn), structure=structure, unit_style="real") return str(fn)
def convert(correct_structure, forcefield_files=['foyer_charmm.xml', 'foyer_water.xml']): """ Convert gmx to lmp structure via foyer Parameters --------- correct_structure : str filename of the correct structure we are pulling xyz from forcefield_files : To be passed to foyer Notes ----- We are making a 'fake' mbuild compound and then updating the coordinates. This is done to preserve compound hierarchies and residue names Note the generation of an extra box according to the correct_structure's periodicity. This is because update_coordinates doesn't carry over box/periodicity information. The fake mbuild compound is then converted to parmed structure and then atomtyped It is *necessary* to update how we are making this fakae mbuild compound It will help to look at the gmx top file to see the order of the molecules Remember to specify `use_atom_name` to false in order for the ffxml to succesfully ientify atoms in the mb Compound and pmd Structure """ system = mb.Compound() for i in range(64): system.add(DSPC.DSPC(use_atom_name=False)) for i in range(1280): system.add(SOL.SOL(use_atom_name=False)) for i in range(64): system.add(DSPC.DSPC(use_atom_name=False)) for i in range(1280): system.add(SOL.SOL(use_atom_name=False)) system.update_coordinates(correct_structure) system_box = mb.Box(lengths=mb.load(correct_structure).periodicity) # In order to avoid using smarts, define custom elements in parmed # by adding underscores to mb particle names for num, i in enumerate(system.particles()): i.name = "_{}".format(i.name) structure = system.to_parmed( box=system_box, residues=set([p.parent.name for p in system.particles()])) ff = Forcefield(forcefield_files=forcefield_files) structure = ff.apply(structure, assert_dihedral_params=False) # Because mbuild compounds don't pass charges to parmed structures, need to # manuallly set the charges AFTER the force field has been applied for i, j in zip(system.particles(), structure.atoms): j.charge = i.charge write_lammpsdata(structure, correct_structure[:-4] + '.lammpsdata')
def test_write_refs_multiple(): mol2 = mb.load(get_fn('ethane.mol2')) oplsaa = Forcefield(forcefield_files=get_fn('refs-multi.xml')) ethane = oplsaa.apply(mol2, references_file='ethane-multi.bib') assert os.path.isfile('ethane-multi.bib') with open(get_fn('ethane-multi.bib')) as file1: with open('ethane-multi.bib') as file2: diff = list(difflib.unified_diff(file1.readlines(), file2.readlines(), n=0)) assert not diff
def test_from_parmed(): mol2 = pmd.load_file(get_fn('ethane.mol2'), structure=True) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2) assert sum((1 for at in ethane.atoms if at.type == 'opls_135')) == 2 assert sum((1 for at in ethane.atoms if at.type == 'opls_140')) == 6 assert len(ethane.bonds) == 7 assert all(x.type for x in ethane.bonds) assert len(ethane.angles) == 12 assert all(x.type for x in ethane.angles) assert len(ethane.rb_torsions) == 9 assert all(x.type for x in ethane.dihedrals) mol2 = pmd.load_file(get_fn('ethane.mol2'), structure=True) mol2.box_vectors = [[2, 0, 0], [0, 2, 0], [0, 0, 2]] oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2) assert ethane.box_vectors == mol2.box_vectors
def test_from_parmed(): mol2 = pmd.load_file(get_fn('ethane.mol2'), structure=True) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2) assert sum((1 for at in ethane.atoms if at.type == 'opls_135')) == 2 assert sum((1 for at in ethane.atoms if at.type == 'opls_140')) == 6 assert len(ethane.bonds) == 7 assert all(x.type for x in ethane.bonds) assert len(ethane.angles) == 12 assert all(x.type for x in ethane.angles) assert len(ethane.rb_torsions) == 9 assert all(x.type for x in ethane.dihedrals) mol2 = pmd.load_file(get_fn('ethane.mol2'), structure=True) mol2.box_vectors = [[2, 0, 0], [0, 2, 0], [0, 0, 2]] oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2) assert ethane.box_vectors == mol2.box_vectors
def test_write_refs_multiple(): mol2 = mb.load(get_fn('ethane.mol2')) oplsaa = Forcefield(forcefield_files=get_fn('refs-multi.xml')) ethane = oplsaa.apply(mol2, references_file='ethane-multi.bib') assert os.path.isfile('ethane-multi.bib') with open(get_fn('ethane-multi.bib')) as file1: with open('ethane-multi.bib') as file2: diff = list( difflib.unified_diff(file1.readlines(), file2.readlines(), n=0)) assert not diff
def test_write_bad_ref(requests_mock): import mbuild as mb register_mock_request(mocker=requests_mock, url='http://api.crossref.org/', path='works/10.1021/garbage_bad_44444444jjjj/transform/application/x-bibtex', headers={'accept': 'application/x-bibtex'}, status_code=404) mol2 = mb.load(get_fn('ethane.mol2')) oplsaa = Forcefield(forcefield_files=get_fn('refs-bad.xml')) with pytest.warns(UserWarning): ethane = oplsaa.apply(mol2, references_file='ethane.bib')
def test_from_mbuild(): mol2 = mb.load(get_fn('ethane.mol2')) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2) assert sum((1 for at in ethane.atoms if at.type == 'opls_135')) == 2 assert sum((1 for at in ethane.atoms if at.type == 'opls_140')) == 6 assert len(ethane.bonds) == 7 assert all(x.type for x in ethane.bonds) assert len(ethane.angles) == 12 assert all(x.type for x in ethane.angles) assert len(ethane.rb_torsions) == 9 assert all(x.type for x in ethane.dihedrals)
def test_from_mbuild_customtype(): mol2 = mb.load(get_fn('ethane_customtype.pdb')) customtype_ff = Forcefield(forcefield_files=get_fn('validate_customtypes.xml')) ethane = customtype_ff.apply(mol2) assert sum((1 for at in ethane.atoms if at.type == 'C3')) == 2 assert sum((1 for at in ethane.atoms if at.type == 'Hb')) == 6 assert len(ethane.bonds) == 7 assert all(x.type for x in ethane.bonds) assert len(ethane.angles) == 12 assert all(x.type for x in ethane.angles) assert len(ethane.rb_torsions) == 9 assert all(x.type for x in ethane.dihedrals)
def test_pairs(self, benzene): from foyer import Forcefield import gsd, gsd.pygsd benzene.save(filename='benzene.gsd', forcefield_name='oplsaa') gsd_file = gsd.pygsd.GSDFile(open('benzene.gsd', 'rb')) frame = gsd.hoomd.HOOMDTrajectory(gsd_file).read_frame(0) structure = benzene.to_parmed() forcefield = Forcefield(name='oplsaa') structure = forcefield.apply(structure) # Pairs assert len(frame.pairs.types) == 3 assert frame.pairs.N == 21
def test_nbfix(self, ethane): from foyer import Forcefield OPLSAA = Forcefield(name='oplsaa') structure = OPLSAA.apply(ethane) # Add nbfixes types = list(set([a.atom_type for a in structure.atoms])) types[0].add_nbfix(types[1].name, 1.2, 2.1) types[1].add_nbfix(types[0].name, 1.2, 2.1) write_lammpsdata(filename='nbfix.lammps', structure=structure) checked_section = False with open('nbfix.lammps', 'r') as fi: while not checked_section: line = fi.readline() if 'PairIJ Coeffs' in line: fi.readline() fi.readline() fi.readline() line = fi.readline().partition('#')[0] assert np.allclose( np.asarray(line.split(), dtype=float), [1, 1, 0.066, 3.5]) line = fi.readline().partition('#')[0] assert np.allclose( np.asarray(line.split(), dtype=float), [1, 2, 2.1, 1.06907846]) line = fi.readline().partition('#')[0] assert np.allclose( np.asarray(line.split(), dtype=float), [2, 2, 0.03, 2.5]) line = fi.readline() checked_section = True # Break if PairIJ Coeffs is not found if 'Atoms' in line: break
def test_missing_type_definitions(): with pytest.raises(FoyerError): FF = Forcefield() ethane = pmd.load_file(get_fn('ethane.mol2'), structure=True) FF.apply(ethane)
import parmed as pmd from foyer import Forcefield from foyer.tests.utils import get_fn mol2_path = get_fn('ethane.mol2') untyped_ethane = pmd.load_file(mol2_path, structure=True) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(untyped_ethane) print("Atoms:") for atom in ethane.atoms: print('Atom {} is typed as {}'.format(atom, atom.type)) print("Bonds:") for bond in ethane.bonds: print('{} '.format(bond)) print("Angles:") for angle in ethane.angles: print('{} '.format(angle)) print("Dihedrals:") for dihedral in ethane.dihedrals: print('{} '.format(dihedral)) # Save to GROMACS ethane.save('ethane.gro') ethane.save('ethane.top')
def test_missing_definition(): structure = pmd.load_file(get_fn('silly_chemistry.mol2'), structure=True) forcefield = Forcefield(get_fn('missing_overrides.xml')) with pytest.raises(FoyerError): forcefield.apply(structure)
def test_write_refs(): mol2 = mb.load(get_fn('ethane.mol2')) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(mol2, references_file='ethane.bib') assert os.path.isfile('ethane.bib')
import parmed as pmd from foyer import Forcefield from foyer.tests.utils import get_fn if __name__ == '__main__': mol2_path = get_fn('ethane.mol2') untyped_ethane = pmd.load_file(mol2_path, structure=True) oplsaa = Forcefield(name='oplsaa') ethane = oplsaa.apply(untyped_ethane, references_file='ethane.bib') print("Atoms:") for atom in ethane.atoms: print('Atom {} is typed as {}'.format(atom, atom.type)) print("Bonds:") for bond in ethane.bonds: print('{} '.format(bond)) print("Angles:") for angle in ethane.angles: print('{} '.format(angle)) print("Dihedrals:") for dihedral in ethane.dihedrals: print('{} '.format(dihedral)) # Save to GROMACS ethane.save('ethane.gro') ethane.save('ethane.top') # Within the `Forcefield.apply` method, an intermediate OpenMM system is
def test_fullerene(): fullerene = pmd.load_file(get_fn('fullerene.pdb'), structure=True) forcefield = Forcefield(get_fn('fullerene.xml')) forcefield.apply(fullerene, assert_dihedral_params=False)
def test_surface(): surface = mb.load(get_fn('silica.mol2')) forcefield = Forcefield(get_fn('opls-silica.xml')) forcefield.apply(surface, assert_bond_params=False)
def test_polymer(): peg100 = mb.load(get_fn('peg100.mol2')) forcefield = Forcefield(name='oplsaa') forcefield.apply(peg100)
def test_overrides_space(): ethane = mb.load(get_fn('ethane.mol2')) ff = Forcefield(forcefield_files=get_fn('overrides-space.xml')) typed_ethane = ff.apply(ethane) assert typed_ethane.atoms[0].type == 'CT3'
def test_apply_residues(): from mbuild.examples import Ethane ethane = Ethane() opls = Forcefield(name='oplsaa') typed = opls.apply(ethane, residues='CH3') assert len([res for res in typed.residues if res.name == 'CH3']) == 2
def test_bonded(self, ethane): from foyer import Forcefield import gsd, gsd.pygsd ethane.save(filename='ethane.gsd', forcefield_name='oplsaa') gsd_file = gsd.pygsd.GSDFile(open('ethane.gsd', 'rb')) frame = gsd.hoomd.HOOMDTrajectory(gsd_file).read_frame(0) structure = ethane.to_parmed() forcefield = Forcefield(name='oplsaa') structure = forcefield.apply(structure) # Bonds n_bonds = frame.bonds.N assert n_bonds == len(structure.bonds) expected_unique_bond_types = ['opls_135-opls_135', 'opls_135-opls_140'] bond_types = frame.bonds.types assert np.array_equal(bond_types, expected_unique_bond_types) bond_typeids = frame.bonds.typeid bond_atoms = frame.bonds.group expected_bond_atoms = [[bond.atom1.idx, bond.atom2.idx] for bond in structure.bonds] assert np.array_equal(bond_atoms, expected_bond_atoms) bond_type_dict = {('C', 'C') : 0, ('C', 'H') : 1, ('H', 'C') : 1} expected_bond_typeids = [] for bond in structure.bonds: expected_bond_typeids.append(bond_type_dict[(bond.atom1.name, bond.atom2.name)]) assert np.array_equal(bond_typeids, expected_bond_typeids) # Angles n_angles = frame.angles.N assert n_angles == len(structure.angles) expected_unique_angle_types = ['opls_135-opls_135-opls_140', 'opls_140-opls_135-opls_140'] angle_types = frame.angles.types assert np.array_equal(angle_types, expected_unique_angle_types) angle_typeids = frame.angles.typeid angle_atoms = frame.angles.group expected_angle_atoms = [[angle.atom1.idx, angle.atom2.idx, angle.atom3.idx] for angle in structure.angles] assert np.array_equal(angle_atoms, expected_angle_atoms) angle_type_dict = {('C', 'C', 'H') : 0, ('H', 'C', 'C') : 0, ('H', 'C', 'H') : 1} expected_angle_typeids = [] for angle in structure.angles: expected_angle_typeids.append(angle_type_dict[(angle.atom1.name, angle.atom2.name, angle.atom3.name)]) assert np.array_equal(angle_typeids, expected_angle_typeids) # Dihedrals n_dihedrals = frame.dihedrals.N assert n_dihedrals == len(structure.rb_torsions) expected_unique_dihedral_types = ['opls_140-opls_135-opls_135-opls_140'] dihedral_types = frame.dihedrals.types assert np.array_equal(dihedral_types, expected_unique_dihedral_types) dihedral_typeids = frame.dihedrals.typeid dihedral_atoms = frame.dihedrals.group expected_dihedral_atoms = [] for dihedral in structure.rb_torsions: expected_dihedral_atoms.append([dihedral.atom1.idx, dihedral.atom2.idx, dihedral.atom3.idx, dihedral.atom4.idx]) assert np.array_equal(dihedral_atoms, expected_dihedral_atoms) assert np.array_equal(dihedral_typeids, np.zeros(n_dihedrals))