def test_whiteningnode(): line_x = numx.zeros((1000, 2), "d") line_y = numx.zeros((1000, 2), "d") line_x[:, 0] = numx.linspace(-1, 1, num=1000, endpoint=1) line_y[:, 1] = numx.linspace(-0.2, 0.2, num=1000, endpoint=1) mat = numx.concatenate((line_x, line_y)) utils.rotate(mat, uniform() * 2 * numx.pi) mat += uniform(2) mat -= mat.mean(axis=0) pca = CCIPCAWhiteningNode() for i in range(5): pca.train(mat) bpca = WhiteningNode() bpca.train(mat) bpca.stop_training() v = pca.get_projmatrix() bv = bpca.get_projmatrix() dcosines = numx.zeros(v.shape[1]) for dim in range(v.shape[1]): dcosines[dim] = numx.fabs(numx.dot(v[:, dim], bv[:, dim].T)) / ( numx.linalg.norm(v[:, dim]) * numx.linalg.norm(bv[:, dim])) assert_almost_equal(numx.ones(v.shape[1]), dcosines)
def test_whiteningnode(): line_x = numx.zeros((1000, 2), "d") line_y = numx.zeros((1000, 2), "d") line_x[:, 0] = numx.linspace(-1, 1, num=1000, endpoint=1) line_y[:, 1] = numx.linspace(-0.2, 0.2, num=1000, endpoint=1) mat = numx.concatenate((line_x, line_y)) utils.rotate(mat, uniform() * 2 * numx.pi) mat += uniform(2) mat -= mat.mean(axis=0) pca = CCIPCAWhiteningNode() for i in xrange(5): pca.train(mat) bpca = WhiteningNode() bpca.train(mat) bpca.stop_training() v = pca.get_projmatrix() bv = bpca.get_projmatrix() dcosines = numx.zeros(v.shape[1]) for dim in xrange(v.shape[1]): dcosines[dim] = numx.fabs(numx.dot(v[:, dim], bv[:, dim].T)) / ( numx.linalg.norm(v[:, dim]) * numx.linalg.norm(bv[:, dim])) assert_almost_equal(numx.ones(v.shape[1]), dcosines)
class ISFANode(Node): """ Perform Independent Slow Feature Analysis on the input data. **Internal variables of interest** ``self.RP`` The global rotation-permutation matrix. This is the filter applied on input_data to get output_data ``self.RPC`` The *complete* global rotation-permutation matrix. This is a matrix of dimension input_dim x input_dim (the 'outer space' is retained) ``self.covs`` A `mdp.utils.MultipleCovarianceMatrices` instance containing the current time-delayed covariance matrices of the input_data. After convergence the uppermost ``output_dim`` x ``output_dim`` submatrices should be almost diagonal. ``self.covs[n-1]`` is the covariance matrix relative to the ``n``-th time-lag Note: they are not cleared after convergence. If you need to free some memory, you can safely delete them with:: >>> del self.covs ``self.initial_contrast`` A dictionary with the starting contrast and the SFA and ICA parts of it. ``self.final_contrast`` Like the above but after convergence. Note: If you intend to use this node for large datasets please have a look at the ``stop_training`` method documentation for speeding things up. References: Blaschke, T. , Zito, T., and Wiskott, L. (2007). Independent Slow Feature Analysis and Nonlinear Blind Source Separation. Neural Computation 19(4):994-1021 (2007) http://itb.biologie.hu-berlin.de/~wiskott/Publications/BlasZitoWisk2007-ISFA-NeurComp.pdf """ def __init__(self, lags=1, sfa_ica_coeff=(1., 1.), icaweights=None, sfaweights=None, whitened=False, white_comp = None, white_parm = None, eps_contrast=1e-6, max_iter=10000, RP=None, verbose=False, input_dim=None, output_dim=None, dtype=None): """ Perform Independent Slow Feature Analysis. The notation is the same used in the paper by Blaschke et al. Please refer to the paper for more information. :Parameters: lags list of time-lags to generate the time-delayed covariance matrices (in the paper this is the set of \tau). If lags is an integer, time-lags 1,2,...,'lags' are used. Note that time-lag == 0 (instantaneous correlation) is always implicitly used. sfa_ica_coeff a list of float with two entries, which defines the weights of the SFA and ICA part of the objective function. They are called b_{SFA} and b_{ICA} in the paper. sfaweights weighting factors for the covariance matrices relative to the SFA part of the objective function (called \kappa_{SFA}^{\tau} in the paper). Default is [1., 0., ..., 0.] For possible values see the description of icaweights. icaweights weighting factors for the cov matrices relative to the ICA part of the objective function (called \kappa_{ICA}^{\tau} in the paper). Default is 1. Possible values are: - an integer ``n``: all matrices are weighted the same (note that it does not make sense to have ``n != 1``) - a list or array of floats of ``len == len(lags)``: each element of the list is used for weighting the corresponding matrix - ``None``: use the default values. whitened ``True`` if input data is already white, ``False`` otherwise (the data will be whitened internally). white_comp If whitened is false, you can set ``white_comp`` to the number of whitened components to keep during the calculation (i.e., the input dimensions are reduced to ``white_comp`` by keeping the components of largest variance). white_parm a dictionary with additional parameters for whitening. It is passed directly to the WhiteningNode constructor. Ex: white_parm = { 'svd' : True } eps_contrast Convergence is achieved when the relative improvement in the contrast is below this threshold. Values in the range [1E-4, 1E-10] are usually reasonable. max_iter If the algorithms does not achieve convergence within max_iter iterations raise an Exception. Should be larger than 100. RP Starting rotation-permutation matrix. It is an input_dim x input_dim matrix used to initially rotate the input components. If not set, the identity matrix is used. In the paper this is used to start the algorithm at the SFA solution (which is often quite near to the optimum). verbose print progress information during convergence. This can slow down the algorithm, but it's the only way to see the rate of improvement and immediately spot if something is going wrong. output_dim sets the number of independent components that have to be extracted. Note that if this is not smaller than input_dim, the problem is solved linearly and SFA would give the same solution only much faster. """ # check that the "lags" argument has some meaningful value if isinstance(lags, (int, int)): lags = list(range(1, lags+1)) elif isinstance(lags, (list, tuple)): lags = numx.array(lags, "i") elif isinstance(lags, numx.ndarray): if not (lags.dtype.char in ['i', 'l']): err_str = "lags must be integer!" raise NodeException(err_str) else: pass else: err_str = ("Lags must be int, list or array. Found " "%s!" % (type(lags).__name__)) raise NodeException(err_str) self.lags = lags # sanity checks for weights if icaweights is None: self.icaweights = 1. else: if (len(icaweights) != len(lags)): err = ("icaweights vector length is %d, " "should be %d" % (str(len(icaweights)), str(len(lags)))) raise NodeException(err) self.icaweights = icaweights if sfaweights is None: self.sfaweights = [0]*len(lags) self.sfaweights[0] = 1. else: if (len(sfaweights) != len(lags)): err = ("sfaweights vector length is %d, " "should be %d" % (str(len(sfaweights)), str(len(lags)))) raise NodeException(err) self.sfaweights = sfaweights # store attributes self.sfa_ica_coeff = sfa_ica_coeff self.max_iter = max_iter self.verbose = verbose self.eps_contrast = eps_contrast # if input is not white, insert a WhiteningNode self.whitened = whitened if not whitened: if white_parm is None: white_parm = {} if output_dim is not None: white_comp = output_dim elif white_comp is not None: output_dim = white_comp self.white = WhiteningNode(input_dim=input_dim, output_dim=white_comp, dtype=dtype, **white_parm) # initialize covariance matrices self.covs = [ DelayCovarianceMatrix(dt, dtype=dtype) for dt in lags ] # initialize the global rotation-permutation matrix # if not set that we'll eventually be an identity matrix self.RP = RP # initialize verbose structure to print nice and useful progress info if verbose: info = { 'sweep' : max(len(str(self.max_iter)), 5), 'perturbe': max(len(str(self.max_iter)), 5), 'float' : 5+8, 'fmt' : "%.5e", 'sep' : " | "} f1 = "Sweep".center(info['sweep']) f1_2 = "Pertb". center(info['perturbe']) f2 = "SFA part".center(info['float']) f3 = "ICA part".center(info['float']) f4 = "Contrast".center(info['float']) header = info['sep'].join([f1, f1_2, f2, f3, f4]) info['header'] = header+'\n' info['line'] = len(header)*"-" self._info = info # finally call base class constructor super(ISFANode, self).__init__(input_dim, output_dim, dtype) def _get_supported_dtypes(self): """Return the list of dtypes supported by this node. Support floating point types with size larger or equal than 64 bits. """ return [t for t in mdp.utils.get_dtypes('Float') if t.itemsize>=8] def _set_dtype(self, dtype): # when typecode is set, we set the whitening node if needed and # the SFA and ICA weights self._dtype = dtype if not self.whitened and self.white.dtype is None: self.white.dtype = dtype self.icaweights = numx.array(self.icaweights, dtype) self.sfaweights = numx.array(self.sfaweights, dtype) def _set_input_dim(self, n): self._input_dim = n if not self.whitened and self.white.output_dim is not None: self._effective_input_dim = self.white.output_dim else: self._effective_input_dim = n def _train(self, x): # train the whitening node if needed if not self.whitened: self.white.train(x) # update the covariance matrices [self.covs[i].update(x) for i in range(len(self.lags))] def _execute(self, x): # filter through whitening node if needed if not self.whitened: x = self.white.execute(x) # rotate input return mult(x, self.RP) def _inverse(self, y): # counter-rotate input x = mult(y, self.RP.T) # invert whitening node if needed if not self.whitened: x = self.white.inverse(x) return x def _fmt_prog_info(self, sweep, pert, contrast, sfa = None, ica = None): # for internal use only! # format the progress information # don't try to understand this code: it Just Works (TM) fmt = self._info sweep_str = str(sweep).rjust(fmt['sweep']) pert_str = str(pert).rjust(fmt['perturbe']) if sfa is None: sfa_str = fmt['float']*' ' else: sfa_str = (fmt['fmt']%(sfa)).rjust(fmt['float']) if ica is None: ica_str = fmt['float']*' ' else: ica_str = (fmt['fmt'] % (ica)).rjust(fmt['float']) contrast_str = (fmt['fmt'] % (contrast)).rjust(fmt['float']) table_entry = fmt['sep'].join([sweep_str, pert_str, sfa_str, ica_str, contrast_str]) return table_entry def _get_eye(self): # return an identity matrix with the right dimensions and type return numx.eye(self._effective_input_dim, dtype=self.dtype) def _get_rnd_rotation(self, dim): # return a random rot matrix with the right dimensions and type return mdp.utils.random_rot(dim, self.dtype) def _get_rnd_permutation(self, dim): # return a random permut matrix with the right dimensions and type zero = numx.zeros((dim, dim), dtype=self.dtype) row = numx_rand.permutation(dim) for col in range(dim): zero[row[col], col] = 1. return zero def _givens_angle(self, i, j, covs, bica_bsfa=None, complete=0): # Return the Givens rotation angle for which the contrast function # is minimal if bica_bsfa is None: bica_bsfa = self._bica_bsfa if j < self.output_dim: return self._givens_angle_case1(i, j, covs, bica_bsfa, complete=complete) else: return self._givens_angle_case2(i, j, covs, bica_bsfa, complete=complete) def _givens_angle_case2(self, m, n, covs, bica_bsfa, complete=0): # This function makes use of the constants computed in the paper # # R -> R # m -> \mu # n -> \nu # # Note that the minus sign before the angle phi is there because # in the paper the rotation convention is the opposite of ours. ncovs = covs.ncovs covs = covs.covs icaweights = self.icaweights sfaweights = self.sfaweights R = self.output_dim bica, bsfa = bica_bsfa Cmm, Cmn, Cnn = covs[m, m, :], covs[m, n, :], covs[n, n, :] d0 = (sfaweights * Cmm*Cmm).sum() d1 = 4*(sfaweights * Cmn*Cmm).sum() d2 = 2*(sfaweights * (2*Cmn*Cmn + Cmm*Cnn)).sum() d3 = 4*(sfaweights * Cmn*Cnn).sum() d4 = (sfaweights * Cnn*Cnn).sum() e0 = 2*(icaweights * ((covs[:R, m, :]*covs[:R, m, :]).sum(axis=0) - Cmm*Cmm)).sum() e1 = 4*(icaweights * ((covs[:R, m, :]*covs[:R, n, :]).sum(axis=0) - Cmm*Cmn)).sum() e2 = 2*(icaweights * ((covs[:R, n, :]*covs[:R, n, :]).sum(axis=0) - Cmn*Cmn)).sum() s22 = 0.25 * bsfa*(d1+d3) + 0.5* bica*(e1) c22 = 0.5 * bsfa*(d0-d4) + 0.5* bica*(e0-e2) s24 = 0.125* bsfa*(d1-d3) c24 = 0.125* bsfa*(d0-d2+d4) # Compute the contrast function in a grid of angles to find a # first approximation for the minimum. Repeat two times # (effectively doubling the resolution). Note that we can do # that because we know we have a single minimum. # # npoints should not be too large otherwise the contrast # funtion appears to be constant. This is because we hit the # maximum resolution for the cosine function (ca. 1e-15) npoints = 100 left = old_div(-PI,2) - old_div(PI,(npoints+1)) right = old_div(PI,2) + old_div(PI,(npoints+1)) for iter in (1, 2): phi = numx.linspace(left, right, npoints+3) contrast = c22*cos(-2*phi)+s22*sin(-2*phi)+\ c24*cos(-4*phi)+s24*sin(-4*phi) minidx = contrast.argmin() left = phi[max(minidx-1, 0)] right = phi[min(minidx+1, len(phi)-1)] # The contrast is almost a parabola around the minimum. # To find the minimum we can therefore compute the derivative # (which should be a line) and calculate its root. # This step helps to overcome the resolution limit of the # cosine function and clearly improve the final result. der_left = 2*c22*sin(-2*left)- 2*s22*cos(-2*left)+\ 4*c24*sin(-4*left)- 4*s24*cos(-4*left) der_right = 2*c22*sin(-2*right)-2*s22*cos(-2*right)+\ 4*c24*sin(-4*right)-4*s24*cos(-4*right) if abs(der_left - der_right) < SQRT_EPS_D: minimum = phi[minidx] else: minimum = right - der_right*(right-left)/(der_right-der_left) dc = numx.zeros((ncovs,), dtype = self.dtype) for t in range(ncovs): dg = covs[:R, :R, t].diagonal() dc[t] = (dg*dg).sum(axis=0) dc = ((dc-Cmm*Cmm)*sfaweights).sum() ec = numx.zeros((ncovs, ), dtype = self.dtype) for t in range(ncovs): ec[t] = sum([covs[i, j, t]*covs[i, j, t] for i in range(R-1) for j in range(i+1, R) if i != m and j != m]) ec = 2*(ec*icaweights).sum() a20 = 0.125*bsfa*(3*d0+d2+3*d4+8*dc)+0.5*bica*(e0+e2+2*ec) minimum_contrast = a20+c22*cos(-2*minimum)+s22*sin(-2*minimum)+\ c24*cos(-4*minimum)+s24*sin(-4*minimum) if complete: # Compute the contrast between -pi/2 and pi/2 # (useful for testing purposes) npoints = 1000 phi = numx.linspace(old_div(-PI,2), old_div(PI,2), npoints+1) contrast = a20 + c22*cos(-2*phi) + s22*sin(-2*phi) +\ c24*cos(-4*phi) + s24*sin(-4*phi) return phi, contrast, minimum, minimum_contrast else: return minimum, minimum_contrast def _givens_angle_case1(self, m, n, covs, bica_bsfa, complete=0): # This function makes use of the constants computed in the paper # # R -> R # m -> \mu # n -> \nu # # Note that the minus sign before the angle phi is there because # in the paper the rotation convention is the opposite of ours. ncovs = covs.ncovs covs = covs.covs icaweights = self.icaweights sfaweights = self.sfaweights bica, bsfa = bica_bsfa Cmm, Cmn, Cnn = covs[m, m, :], covs[m, n, :], covs[n, n, :] d0 = (sfaweights * (Cmm*Cmm+Cnn*Cnn)).sum() d1 = 4*(sfaweights * (Cmm*Cmn-Cmn*Cnn)).sum() d2 = 2*(sfaweights * (2*Cmn*Cmn+Cmm*Cnn)).sum() e0 = 2*(icaweights * Cmn*Cmn).sum() e1 = 4*(icaweights * (Cmn*Cnn-Cmm*Cmn)).sum() e2 = (icaweights * ((Cmm-Cnn)*(Cmm-Cnn)-2*Cmn*Cmn)).sum() s24 = 0.25* (bsfa * d1 + bica * e1) c24 = 0.25* (bsfa *(d0-d2)+ bica *(e0-e2)) # compute the exact minimum # Note that 'arctan' finds always the first maximum # because s24sin(4p)+c24cos(4p)=const*cos(4p-arctan) # the minimum lies +pi/4 apart (period = pi/2). # In other words we want that: abs(minimum) < pi/4 phi4 = numx.arctan2(s24, c24) # use if-structure until bug in numx.sign is solved if phi4 >= 0: minimum = -0.25*(phi4-PI) else: minimum = -0.25*(phi4+PI) # compute all constants: R = self.output_dim dc = numx.zeros((ncovs, ), dtype = self.dtype) for t in range(ncovs): dg = covs[:R, :R, t].diagonal() dc[t] = (dg*dg).sum(axis=0) dc = ((dc-Cnn*Cnn-Cmm*Cmm)*sfaweights).sum() ec = numx.zeros((ncovs, ), dtype = self.dtype) for t in range(ncovs): triu_covs = _triu(covs[:R, :R, t], 1).ravel() ec[t] = ((triu_covs*triu_covs).sum() - covs[m, n, t]*covs[m, n, t]) ec = 2*(icaweights*ec).sum() a20 = 0.25*(bsfa*(4*dc+d2+3*d0)+bica*(4*ec+e2+3*e0)) minimum_contrast = a20+c24*cos(-4*minimum)+s24*sin(-4*minimum) npoints = 1000 if complete == 1: # Compute the contrast between -pi/2 and pi/2 # (useful for testing purposes) phi = numx.linspace(old_div(-PI,2), old_div(PI,2), npoints+1) contrast = a20 + c24*cos(-4*phi) + s24*sin(-4*phi) return phi, contrast, minimum, minimum_contrast elif complete == 2: phi = numx.linspace(old_div(-PI,4), old_div(PI,4), npoints+1) contrast = a20 + c24*cos(-4*phi) + s24*sin(-4*phi) return phi, contrast, minimum, minimum_contrast else: return minimum, minimum_contrast def _get_contrast(self, covs, bica_bsfa = None): if bica_bsfa is None: bica_bsfa = self._bica_bsfa # return current value of the contrast R = self.output_dim ncovs = covs.ncovs covs = covs.covs icaweights = self.icaweights sfaweights = self.sfaweights # unpack the bsfa and bica coefficients bica, bsfa = bica_bsfa sfa = numx.zeros((ncovs, ), dtype=self.dtype) ica = numx.zeros((ncovs, ), dtype=self.dtype) for t in range(ncovs): sq_corr = covs[:R, :R, t]*covs[:R, :R, t] sfa[t] = sq_corr.trace() ica[t] = 2*_triu(sq_corr, 1).ravel().sum() return (bsfa*sfaweights*sfa).sum(), (bica*icaweights*ica).sum() def _adjust_ica_sfa_coeff(self): # adjust sfa/ica ratio. ica and sfa term are scaled # differently because sfa accounts for the diagonal terms # whereas ica accounts for the off-diagonal terms ncomp = self.output_dim if ncomp > 1: bica = old_div(self.sfa_ica_coeff[1],(ncomp*(ncomp-1))) bsfa = old_div(-self.sfa_ica_coeff[0],ncomp) else: bica = 0.#self.sfa_ica_coeff[1] bsfa = -self.sfa_ica_coeff[0] self._bica_bsfa = [bica, bsfa] def _fix_covs(self, covs=None): # fiv covariance matrices if covs is None: covs = self.covs if not self.whitened: white = self.white white.stop_training() proj = white.get_projmatrix(transposed=0) else: proj = None # fix and whiten the covariance matrices for i in range(len(self.lags)): covs[i], avg, avg_dt, tlen = covs[i].fix(proj) # send the matrices to the container class covs = MultipleCovarianceMatrices(covs) # symmetrize the cov matrices covs.symmetrize() self.covs = covs def _optimize(self): # optimize contrast function # save initial contrast sfa, ica = self._get_contrast(self.covs) self.initial_contrast = {'SFA': sfa, 'ICA': ica, 'TOT': sfa + ica} # info headers if self.verbose: print(self._info['header']+self._info['line']) # initialize control variables # contrast contrast = sfa+ica # local rotation matrix Q = self._get_eye() # local copy of correlation matrices covs = self.covs.copy() # maximum improvement in the contrast function max_increase = self.eps_contrast # Number of sweeps sweep = 0 # flag for stopping sweeping sweeping = True # flag to check if we already perturbed the outer space # - negative means that we exit from this routine # because we hit numerical precision or because # there's no outer space to be perturbed (input_dim == outpu_dim) # - positive means the number of perturbations done # before finding no further improvement perturbed = 0 # size of the perturbation matrix psize = self._effective_input_dim-self.output_dim # if there is no outer space don't perturbe if self._effective_input_dim == self.output_dim: perturbed = -1 # local eye matrix eye = self._get_eye() # main loop # we'll keep on sweeping until the contrast has improved less # then self.eps_contrast part_sweep = 0 while sweeping: # update number of sweeps sweep += 1 # perform a single sweep max_increase, covs, Q, contrast = self._do_sweep(covs, Q, contrast) if max_increase < 0 or contrast == 0: # we hit numerical precision, exit! sweeping = False if perturbed == 0: perturbed = -1 else: perturbed = -perturbed if (max_increase < self.eps_contrast) and (max_increase) >= 0 : # rate of change is small for all pairs in a sweep if perturbed == 0: # perturbe the outer space one time with a random rotation perturbed = 1 elif perturbed >= 1 and part_sweep == sweep-1: # after the last pertubation no useful step has # been done. exit! sweeping = False elif perturbed < 0: # we can't perturbe anymore sweeping = False # keep track of the last sweep we perturbed part_sweep = sweep # perform perturbation if needed if perturbed >= 1 and sweeping is True: # generate a random rotation matrix for the external subspace PRT = eye.copy() rot = self._get_rnd_rotation(psize) # generate a random permutation matrix for the ext. subspace perm = self._get_rnd_permutation(psize) # combine rotation and permutation rot_perm = mult(rot, perm) # apply rotation+permutation PRT[self.output_dim:, self.output_dim:] = rot_perm covs.transform(PRT) Q = mult(Q, PRT) # increment perturbation counter perturbed += 1 # verbose progress information if self.verbose: table_entry = self._fmt_prog_info(sweep, perturbed, contrast) _sys.stdout.write(table_entry+len(table_entry)*'\b') _sys.stdout.flush() # if we made too many sweeps exit with error! if sweep == self.max_iter: err_str = ("Failed to converge, maximum increase= " "%.5e" % (max_increase)) raise NodeException(err_str) # if we land here, we have converged! # calculate output contrast sfa, ica = self._get_contrast(covs) contrast = sfa+ica # print final information if self.verbose: print(self._fmt_prog_info(sweep, perturbed, contrast, sfa, ica)) print(self._info['line']) self.final_contrast = {'SFA': sfa, 'ICA': ica, 'TOT': sfa + ica} # finally return optimal rotation matrix return Q def _do_sweep(self, covs, Q, prev_contrast): # perform a single sweep # initialize maximal improvement in a single sweep max_increase = -1 # shuffle rotation order numx_rand.shuffle(self.rot_axis) # sweep through all axes combinations for (i, j) in self.rot_axis: # get the angle that minimizes the contrast # and the contrast value angle, contrast = self._givens_angle(i, j, covs) if contrast == 0: # we hit numerical precision in case when b_sfa == 0 # we can only break things from here on, better quit! max_increase = -1 break # relative improvement in the contrast function relative_diff = old_div((prev_contrast-contrast),abs(prev_contrast)) if relative_diff < 0: # if rate of change is negative we hit numerical precision # or we already sit on the optimum for this pair of axis. # don't rotate anymore and go to the next pair continue # update the rotation matrix rotate(Q, angle, [i, j]) # rotate the covariance matrices covs.rotate(angle, [i, j]) # store maximum and previous rate of change max_increase = max(max_increase, relative_diff) prev_contrast = contrast return max_increase, covs, Q, contrast def _stop_training(self, covs=None): """Stop the training phase. If the node is used on large datasets it may be wise to first learn the covariance matrices, and then tune the parameters until a suitable parameter set has been found (learning the covariance matrices is the slowest part in this case). This could be done for example in the following way (assuming the data is already white): >>> covs=[mdp.utils.DelayCovarianceMatrix(dt, dtype=dtype) ... for dt in lags] >>> for block in data: ... [covs[i].update(block) for i in range(len(lags))] You can then initialize the ISFANode with the desired parameters, do a fake training with some random data to set the internal node structure and then call stop_training with the stored covariance matrices. For example: >>> isfa = ISFANode(lags, .....) >>> x = mdp.numx_rand.random((100, input_dim)).astype(dtype) >>> isfa.train(x) >>> isfa.stop_training(covs=covs) This trick has been used in the paper to apply ISFA to surrogate matrices, i.e. covariance matrices that were not learnt on a real dataset. """ # fix, whiten, symmetrize and weight the covariance matrices # the functions sets also the number of input components self.ncomp self._fix_covs(covs) # if output_dim were not set, set it to be the number of input comps if self.output_dim is None: self.output_dim = self._effective_input_dim # adjust b_sfa and b_ica self._adjust_ica_sfa_coeff() # initialize all possible rotation axes self.rot_axis = [(i, j) for i in range(0, self.output_dim) for j in range(i+1, self._effective_input_dim)] # initialize the global rotation-permutation matrix (RP): RP = self.RP if RP is None: RP = self._get_eye() else: # apply the global rotation matrix self.covs.transform(RP) # find optimal rotation Q = self._optimize() RP = mult(RP, Q) # rotate and permute the covariance matrices # we do it here in one step, to avoid the cumulative errors # of multiple rotations in _optimize self.covs.transform(Q) # keep the complete rotation-permutation matrix self.RPC = RP.copy() # Reduce dimension to match output_dim# RP = RP[:, :self.output_dim] # the variance for the derivative of a whitened signal is # 0 <= v <= 4, therefore the diagonal elements of the delayed # covariance matrice with time lag = 1 (covs[:,:,0]) are # -1 <= v' <= +1 # reorder the components to have them ordered by slowness d = (self.covs.covs[:self.output_dim, :self.output_dim, 0]).diagonal() idx = d.argsort()[::-1] self.RP = RP.take(idx, axis=1)
class ISFANode(Node): """ Perform Independent Slow Feature Analysis on the input data. .. attribute:: RP The global rotation-permutation matrix. This is the filter applied on input_data to get output_data .. attribute:: RPC The *complete* global rotation-permutation matrix. This is a matrix of dimension input_dim x input_dim (the 'outer space' is retained) .. attribute:: covs A `mdp.utils.MultipleCovarianceMatrices` instance input_data. After convergence the uppermost ``output_dim`` x ``output_dim`` submatrices should be almost diagonal. ``self.covs[n-1]`` is the covariance matrix relative to the ``n``-th time-lag .. note:: They are not cleared after convergence. If you need to free some memory, you can safely delete them with:: >>> del self.covs .. attribute:: initial_contrast A dictionary with the starting contrast and the SFA and ICA parts of it. .. attribute:: final_contrast Like the above but after convergence. .. note:: If you intend to use this node for large datasets please have a look at the ``stop_training`` method documentation for speeding things up. .. admonition:: Reference Blaschke, T. , Zito, T., and Wiskott, L. (2007). Independent Slow Feature Analysis and Nonlinear Blind Source Separation. Neural Computation 19(4):994-1021 (2007) http://itb.biologie.hu-berlin.de/~wiskott/Publications/BlasZitoWisk2007-ISFA-NeurComp.pdf """ def __init__(self, lags=1, sfa_ica_coeff=(1., 1.), icaweights=None, sfaweights=None, whitened=False, white_comp = None, white_parm = None, eps_contrast=1e-6, max_iter=10000, RP=None, verbose=False, input_dim=None, output_dim=None, dtype=None): """Initializes an object of type 'ISFANode' to perform Independent Slow Feature Analysis. The notation is the same used in the paper by Blaschke et al. Please refer to the paper for more information. :param lags: A list of time-lags to generate the time-delayed covariance matrices (in the paper this is the set of \tau). If lags is an integer, time-lags 1,2,...,'lags' are used. Note that time-lag == 0 (instantaneous correlation) is always implicitly used. :type lags: list or int :param sfa_ica_coeff: A list of float with two entries, which defines the weights of the SFA and ICA part of the objective function. They are called b_{SFA} and b_{ICA} in the paper. :type sfa_ica_coeff: list :param icaweights: Weighting factors for the cov matrices relative to the ICA part of the objective function (called \kappa_{ICA}^{\tau} in the paper). Default is 1. Possible values are: - An integer ``n``: All matrices are weighted the same (note that it does not make sense to have ``n != 1``). - A list or array of floats of ``len == len(lags)``: Each element of the list is used for weighting the corresponding matrix. - ``None``: Use the default values. :type icaweights: int, list or array :param sfaweights: Weighting factors for the covariance matrices relative to the SFA part of the objective function (called \kappa_{SFA}^{\tau} in the paper). Default is [1., 0., ..., 0.] For possible values see the description of icaweights. :type sfaweights: int, list or array :param whitened: ``True`` if input data is already white, ``False`` otherwise (the data will be whitened internally). :type whitened: bool :param white_comp: If whitened is false, you can set ``white_comp`` to the number of whitened components to keep during the calculation (i.e., the input dimensions are reduced to `white_comp`` by keeping the components of largest variance). :type white_comp: int :param white_parm: A dictionary with additional parameters for whitening. It is passed directly to the WhiteningNode constructor. Ex: white_parm = { 'svd' : True } :type white_parm: dict :param eps_contrast: Convergence is achieved when the relative improvement in the contrast is below this threshold. Values in the range [1E-4, 1E-10] are usually reasonable. :type eps_contrast: float :param max_iter: If the algorithms does not achieve convergence within max_iter iterations raise an Exception. Should be larger than 100. :type max_iter: int :param RP: Starting rotation-permutation matrix. It is an input_dim x input_dim matrix used to initially rotate the input components. If not set, the identity matrix is used. In the paper this is used to start the algorithm at the SFA solution (which is often quite near to the optimum). :param verbose: Print progress information during convergence. This can slow down the algorithm, but it's the only way to see the rate of improvement and immediately spot if something is going wrong. :type verbose: bool :param input_dim: The input dimensionality. :type input_dim: int :param output_dim: Sets the number of independent components that have to be extracted. Note that if this is not smaller than input_dim, the problem is solved linearly and SFA would give the same solution only much faster. :type output_dim: int :param dtype: Datatype to be used. :type dtype: numpy.dtype or str """ # check that the "lags" argument has some meaningful value if isinstance(lags, (int, int)): lags = list(range(1, lags+1)) elif isinstance(lags, (list, tuple)): lags = numx.array(lags, "i") elif isinstance(lags, numx.ndarray): if not (lags.dtype.char in ['i', 'l']): err_str = "lags must be integer!" raise NodeException(err_str) else: pass else: err_str = ("Lags must be int, list or array. Found " "%s!" % (type(lags).__name__)) raise NodeException(err_str) self.lags = lags # sanity checks for weights if icaweights is None: self.icaweights = 1. else: if (len(icaweights) != len(lags)): err = ("icaweights vector length is %d, " "should be %d" % (str(len(icaweights)), str(len(lags)))) raise NodeException(err) self.icaweights = icaweights if sfaweights is None: self.sfaweights = [0]*len(lags) self.sfaweights[0] = 1. else: if (len(sfaweights) != len(lags)): err = ("sfaweights vector length is %d, " "should be %d" % (str(len(sfaweights)), str(len(lags)))) raise NodeException(err) self.sfaweights = sfaweights # store attributes self.sfa_ica_coeff = sfa_ica_coeff self.max_iter = max_iter self.verbose = verbose self.eps_contrast = eps_contrast # if input is not white, insert a WhiteningNode self.whitened = whitened if not whitened: if white_parm is None: white_parm = {} if output_dim is not None: white_comp = output_dim elif white_comp is not None: output_dim = white_comp self.white = WhiteningNode(input_dim=input_dim, output_dim=white_comp, dtype=dtype, **white_parm) # initialize covariance matrices self.covs = [ DelayCovarianceMatrix(dt, dtype=dtype) for dt in lags ] # initialize the global rotation-permutation matrix # if not set that we'll eventually be an identity matrix self.RP = RP # initialize verbose structure to print nice and useful progress info if verbose: info = { 'sweep' : max(len(str(self.max_iter)), 5), 'perturbe': max(len(str(self.max_iter)), 5), 'float' : 5+8, 'fmt' : "%.5e", 'sep' : " | "} f1 = "Sweep".center(info['sweep']) f1_2 = "Pertb". center(info['perturbe']) f2 = "SFA part".center(info['float']) f3 = "ICA part".center(info['float']) f4 = "Contrast".center(info['float']) header = info['sep'].join([f1, f1_2, f2, f3, f4]) info['header'] = header+'\n' info['line'] = len(header)*"-" self._info = info # finally call base class constructor super(ISFANode, self).__init__(input_dim, output_dim, dtype) def _get_supported_dtypes(self): """Return the list of dtypes supported by this node. Support floating point types with size larger or equal than 64 bits. """ return [t for t in mdp.utils.get_dtypes('Float') if t.itemsize>=8] def _set_dtype(self, dtype): # when typecode is set, we set the whitening node if needed and # the SFA and ICA weights self._dtype = dtype if not self.whitened and self.white.dtype is None: self.white.dtype = dtype self.icaweights = numx.array(self.icaweights, dtype) self.sfaweights = numx.array(self.sfaweights, dtype) def _set_input_dim(self, n): self._input_dim = n if not self.whitened and self.white.output_dim is not None: self._effective_input_dim = self.white.output_dim else: self._effective_input_dim = n def _train(self, x): # train the whitening node if needed if not self.whitened: self.white.train(x) # update the covariance matrices [self.covs[i].update(x) for i in range(len(self.lags))] def _execute(self, x): # filter through whitening node if needed if not self.whitened: x = self.white.execute(x) # rotate input return mult(x, self.RP) def _inverse(self, y): # counter-rotate input x = mult(y, self.RP.T) # invert whitening node if needed if not self.whitened: x = self.white.inverse(x) return x def _fmt_prog_info(self, sweep, pert, contrast, sfa = None, ica = None): # for internal use only! # format the progress information # don't try to understand this code: it Just Works (TM) fmt = self._info sweep_str = str(sweep).rjust(fmt['sweep']) pert_str = str(pert).rjust(fmt['perturbe']) if sfa is None: sfa_str = fmt['float']*' ' else: sfa_str = (fmt['fmt']%(sfa)).rjust(fmt['float']) if ica is None: ica_str = fmt['float']*' ' else: ica_str = (fmt['fmt'] % (ica)).rjust(fmt['float']) contrast_str = (fmt['fmt'] % (contrast)).rjust(fmt['float']) table_entry = fmt['sep'].join([sweep_str, pert_str, sfa_str, ica_str, contrast_str]) return table_entry def _get_eye(self): # return an identity matrix with the right dimensions and type return numx.eye(self._effective_input_dim, dtype=self.dtype) def _get_rnd_rotation(self, dim): # return a random rot matrix with the right dimensions and type return mdp.utils.random_rot(dim, self.dtype) def _get_rnd_permutation(self, dim): # return a random permut matrix with the right dimensions and type zero = numx.zeros((dim, dim), dtype=self.dtype) row = numx_rand.permutation(dim) for col in range(dim): zero[row[col], col] = 1. return zero def _givens_angle(self, i, j, covs, bica_bsfa=None, complete=0): # Return the Givens rotation angle for which the contrast function # is minimal if bica_bsfa is None: bica_bsfa = self._bica_bsfa if j < self.output_dim: return self._givens_angle_case1(i, j, covs, bica_bsfa, complete=complete) else: return self._givens_angle_case2(i, j, covs, bica_bsfa, complete=complete) def _givens_angle_case2(self, m, n, covs, bica_bsfa, complete=0): # This function makes use of the constants computed in the paper # # R -> R # m -> \mu # n -> \nu # # Note that the minus sign before the angle phi is there because # in the paper the rotation convention is the opposite of ours. ncovs = covs.ncovs covs = covs.covs icaweights = self.icaweights sfaweights = self.sfaweights R = self.output_dim bica, bsfa = bica_bsfa Cmm, Cmn, Cnn = covs[m, m, :], covs[m, n, :], covs[n, n, :] d0 = (sfaweights * Cmm*Cmm).sum() d1 = 4*(sfaweights * Cmn*Cmm).sum() d2 = 2*(sfaweights * (2*Cmn*Cmn + Cmm*Cnn)).sum() d3 = 4*(sfaweights * Cmn*Cnn).sum() d4 = (sfaweights * Cnn*Cnn).sum() e0 = 2*(icaweights * ((covs[:R, m, :]*covs[:R, m, :]).sum(axis=0) - Cmm*Cmm)).sum() e1 = 4*(icaweights * ((covs[:R, m, :]*covs[:R, n, :]).sum(axis=0) - Cmm*Cmn)).sum() e2 = 2*(icaweights * ((covs[:R, n, :]*covs[:R, n, :]).sum(axis=0) - Cmn*Cmn)).sum() s22 = 0.25 * bsfa*(d1+d3) + 0.5* bica*(e1) c22 = 0.5 * bsfa*(d0-d4) + 0.5* bica*(e0-e2) s24 = 0.125* bsfa*(d1-d3) c24 = 0.125* bsfa*(d0-d2+d4) # Compute the contrast function in a grid of angles to find a # first approximation for the minimum. Repeat two times # (effectively doubling the resolution). Note that we can do # that because we know we have a single minimum. # # npoints should not be too large otherwise the contrast # funtion appears to be constant. This is because we hit the # maximum resolution for the cosine function (ca. 1e-15) npoints = 100 left = old_div(-PI,2) - old_div(PI,(npoints+1)) right = old_div(PI,2) + old_div(PI,(npoints+1)) for iter in (1, 2): phi = numx.linspace(left, right, npoints+3) contrast = c22*cos(-2*phi)+s22*sin(-2*phi)+\ c24*cos(-4*phi)+s24*sin(-4*phi) minidx = contrast.argmin() left = phi[max(minidx-1, 0)] right = phi[min(minidx+1, len(phi)-1)] # The contrast is almost a parabola around the minimum. # To find the minimum we can therefore compute the derivative # (which should be a line) and calculate its root. # This step helps to overcome the resolution limit of the # cosine function and clearly improve the final result. der_left = 2*c22*sin(-2*left)- 2*s22*cos(-2*left)+\ 4*c24*sin(-4*left)- 4*s24*cos(-4*left) der_right = 2*c22*sin(-2*right)-2*s22*cos(-2*right)+\ 4*c24*sin(-4*right)-4*s24*cos(-4*right) if abs(der_left - der_right) < SQRT_EPS_D: minimum = phi[minidx] else: minimum = right - der_right*(right-left)/(der_right-der_left) dc = numx.zeros((ncovs,), dtype = self.dtype) for t in range(ncovs): dg = covs[:R, :R, t].diagonal() dc[t] = (dg*dg).sum(axis=0) dc = ((dc-Cmm*Cmm)*sfaweights).sum() ec = numx.zeros((ncovs, ), dtype = self.dtype) for t in range(ncovs): ec[t] = sum([covs[i, j, t]*covs[i, j, t] for i in range(R-1) for j in range(i+1, R) if i != m and j != m]) ec = 2*(ec*icaweights).sum() a20 = 0.125*bsfa*(3*d0+d2+3*d4+8*dc)+0.5*bica*(e0+e2+2*ec) minimum_contrast = a20+c22*cos(-2*minimum)+s22*sin(-2*minimum)+\ c24*cos(-4*minimum)+s24*sin(-4*minimum) if complete: # Compute the contrast between -pi/2 and pi/2 # (useful for testing purposes) npoints = 1000 phi = numx.linspace(old_div(-PI,2), old_div(PI,2), npoints+1) contrast = a20 + c22*cos(-2*phi) + s22*sin(-2*phi) +\ c24*cos(-4*phi) + s24*sin(-4*phi) return phi, contrast, minimum, minimum_contrast else: return minimum, minimum_contrast def _givens_angle_case1(self, m, n, covs, bica_bsfa, complete=0): # This function makes use of the constants computed in the paper # # R -> R # m -> \mu # n -> \nu # # Note that the minus sign before the angle phi is there because # in the paper the rotation convention is the opposite of ours. ncovs = covs.ncovs covs = covs.covs icaweights = self.icaweights sfaweights = self.sfaweights bica, bsfa = bica_bsfa Cmm, Cmn, Cnn = covs[m, m, :], covs[m, n, :], covs[n, n, :] d0 = (sfaweights * (Cmm*Cmm+Cnn*Cnn)).sum() d1 = 4*(sfaweights * (Cmm*Cmn-Cmn*Cnn)).sum() d2 = 2*(sfaweights * (2*Cmn*Cmn+Cmm*Cnn)).sum() e0 = 2*(icaweights * Cmn*Cmn).sum() e1 = 4*(icaweights * (Cmn*Cnn-Cmm*Cmn)).sum() e2 = (icaweights * ((Cmm-Cnn)*(Cmm-Cnn)-2*Cmn*Cmn)).sum() s24 = 0.25* (bsfa * d1 + bica * e1) c24 = 0.25* (bsfa *(d0-d2)+ bica *(e0-e2)) # compute the exact minimum # Note that 'arctan' finds always the first maximum # because s24sin(4p)+c24cos(4p)=const*cos(4p-arctan) # the minimum lies +pi/4 apart (period = pi/2). # In other words we want that: abs(minimum) < pi/4 phi4 = numx.arctan2(s24, c24) # use if-structure until bug in numx.sign is solved if phi4 >= 0: minimum = -0.25*(phi4-PI) else: minimum = -0.25*(phi4+PI) # compute all constants: R = self.output_dim dc = numx.zeros((ncovs, ), dtype = self.dtype) for t in range(ncovs): dg = covs[:R, :R, t].diagonal() dc[t] = (dg*dg).sum(axis=0) dc = ((dc-Cnn*Cnn-Cmm*Cmm)*sfaweights).sum() ec = numx.zeros((ncovs, ), dtype = self.dtype) for t in range(ncovs): triu_covs = _triu(covs[:R, :R, t], 1).ravel() ec[t] = ((triu_covs*triu_covs).sum() - covs[m, n, t]*covs[m, n, t]) ec = 2*(icaweights*ec).sum() a20 = 0.25*(bsfa*(4*dc+d2+3*d0)+bica*(4*ec+e2+3*e0)) minimum_contrast = a20+c24*cos(-4*minimum)+s24*sin(-4*minimum) npoints = 1000 if complete == 1: # Compute the contrast between -pi/2 and pi/2 # (useful for testing purposes) phi = numx.linspace(old_div(-PI,2), old_div(PI,2), npoints+1) contrast = a20 + c24*cos(-4*phi) + s24*sin(-4*phi) return phi, contrast, minimum, minimum_contrast elif complete == 2: phi = numx.linspace(old_div(-PI,4), old_div(PI,4), npoints+1) contrast = a20 + c24*cos(-4*phi) + s24*sin(-4*phi) return phi, contrast, minimum, minimum_contrast else: return minimum, minimum_contrast def _get_contrast(self, covs, bica_bsfa = None): if bica_bsfa is None: bica_bsfa = self._bica_bsfa # return current value of the contrast R = self.output_dim ncovs = covs.ncovs covs = covs.covs icaweights = self.icaweights sfaweights = self.sfaweights # unpack the bsfa and bica coefficients bica, bsfa = bica_bsfa sfa = numx.zeros((ncovs, ), dtype=self.dtype) ica = numx.zeros((ncovs, ), dtype=self.dtype) for t in range(ncovs): sq_corr = covs[:R, :R, t]*covs[:R, :R, t] sfa[t] = sq_corr.trace() ica[t] = 2*_triu(sq_corr, 1).ravel().sum() return (bsfa*sfaweights*sfa).sum(), (bica*icaweights*ica).sum() def _adjust_ica_sfa_coeff(self): """ Adjust SFA/ICA ratio. The ICA and SFA terms are scaled differently because SFA accounts for the diagonal terms whereas ICA accounts for the off-diagonal terms. """ ncomp = self.output_dim if ncomp > 1: bica = old_div(self.sfa_ica_coeff[1],(ncomp*(ncomp-1))) bsfa = old_div(-self.sfa_ica_coeff[0],ncomp) else: bica = 0.#self.sfa_ica_coeff[1] bsfa = -self.sfa_ica_coeff[0] self._bica_bsfa = [bica, bsfa] def _fix_covs(self, covs=None): # fiv covariance matrices if covs is None: covs = self.covs if not self.whitened: white = self.white white.stop_training() proj = white.get_projmatrix(transposed=0) else: proj = None # fix and whiten the covariance matrices for i in range(len(self.lags)): covs[i], avg, avg_dt, tlen = covs[i].fix(proj) # send the matrices to the container class covs = MultipleCovarianceMatrices(covs) # symmetrize the cov matrices covs.symmetrize() self.covs = covs def _optimize(self): """ Optimizes the contrast function. :return: The optimal rotation matrix. """ # optimize contrast function # save initial contrast sfa, ica = self._get_contrast(self.covs) self.initial_contrast = {'SFA': sfa, 'ICA': ica, 'TOT': sfa + ica} # info headers if self.verbose: print(self._info['header']+self._info['line']) # initialize control variables # contrast contrast = sfa+ica # local rotation matrix Q = self._get_eye() # local copy of correlation matrices covs = self.covs.copy() # maximum improvement in the contrast function max_increase = self.eps_contrast # Number of sweeps sweep = 0 # flag for stopping sweeping sweeping = True # flag to check if we already perturbed the outer space # - negative means that we exit from this routine # because we hit numerical precision or because # there's no outer space to be perturbed (input_dim == outpu_dim) # - positive means the number of perturbations done # before finding no further improvement perturbed = 0 # size of the perturbation matrix psize = self._effective_input_dim-self.output_dim # if there is no outer space don't perturbe if self._effective_input_dim == self.output_dim: perturbed = -1 # local eye matrix eye = self._get_eye() # main loop # we'll keep on sweeping until the contrast has improved less # then self.eps_contrast part_sweep = 0 while sweeping: # update number of sweeps sweep += 1 # perform a single sweep max_increase, covs, Q, contrast = self._do_sweep(covs, Q, contrast) if max_increase < 0 or contrast == 0: # we hit numerical precision, exit! sweeping = False if perturbed == 0: perturbed = -1 else: perturbed = -perturbed if (max_increase < self.eps_contrast) and (max_increase) >= 0 : # rate of change is small for all pairs in a sweep if perturbed == 0: # perturbe the outer space one time with a random rotation perturbed = 1 elif perturbed >= 1 and part_sweep == sweep-1: # after the last pertubation no useful step has # been done. exit! sweeping = False elif perturbed < 0: # we can't perturbe anymore sweeping = False # keep track of the last sweep we perturbed part_sweep = sweep # perform perturbation if needed if perturbed >= 1 and sweeping is True: # generate a random rotation matrix for the external subspace PRT = eye.copy() rot = self._get_rnd_rotation(psize) # generate a random permutation matrix for the ext. subspace perm = self._get_rnd_permutation(psize) # combine rotation and permutation rot_perm = mult(rot, perm) # apply rotation+permutation PRT[self.output_dim:, self.output_dim:] = rot_perm covs.transform(PRT) Q = mult(Q, PRT) # increment perturbation counter perturbed += 1 # verbose progress information if self.verbose: table_entry = self._fmt_prog_info(sweep, perturbed, contrast) _sys.stdout.write(table_entry+len(table_entry)*'\b') _sys.stdout.flush() # if we made too many sweeps exit with error! if sweep == self.max_iter: err_str = ("Failed to converge, maximum increase= " "%.5e" % (max_increase)) raise NodeException(err_str) # if we land here, we have converged! # calculate output contrast sfa, ica = self._get_contrast(covs) contrast = sfa+ica # print final information if self.verbose: print(self._fmt_prog_info(sweep, perturbed, contrast, sfa, ica)) print(self._info['line']) self.final_contrast = {'SFA': sfa, 'ICA': ica, 'TOT': sfa + ica} # finally return optimal rotation matrix return Q def _do_sweep(self, covs, Q, prev_contrast): """ Perform a single sweep. :param covs: The covariance matrices. :param Q: he rotation matrix. :param prev_contrast: The previous contrast. :return: The maximum improvement in contrast, rotated matrices, the current contrast. """ # perform a single sweep # initialize maximal improvement in a single sweep max_increase = -1 # shuffle rotation order numx_rand.shuffle(self.rot_axis) # sweep through all axes combinations for (i, j) in self.rot_axis: # get the angle that minimizes the contrast # and the contrast value angle, contrast = self._givens_angle(i, j, covs) if contrast == 0: # we hit numerical precision in case when b_sfa == 0 # we can only break things from here on, better quit! max_increase = -1 break # relative improvement in the contrast function relative_diff = old_div((prev_contrast-contrast),abs(prev_contrast)) if relative_diff < 0: # if rate of change is negative we hit numerical precision # or we already sit on the optimum for this pair of axis. # don't rotate anymore and go to the next pair continue # update the rotation matrix rotate(Q, angle, [i, j]) # rotate the covariance matrices covs.rotate(angle, [i, j]) # store maximum and previous rate of change max_increase = max(max_increase, relative_diff) prev_contrast = contrast return max_increase, covs, Q, contrast def _stop_training(self, covs=None): """Stop the training phase. :param covs: The covariance matrices. .. note:: If the node is used on large datasets it may be wise to first learn the covariance matrices, and then tune the parameters until a suitable parameter set has been found (learning the covariance matrices is the slowest part in this case). This could be done for example in the following way (assuming the data is already white):: >>> covs=[mdp.utils.DelayCovarianceMatrix(dt, dtype=dtype) ... for dt in lags] >>> for block in data: ... [covs[i].update(block) for i in range(len(lags))] You can then initialize the ISFANode with the desired parameters, do a fake training with some random data to set the internal node structure and then call stop_training with the stored covariance matrices. For example:: >>> isfa = ISFANode(lags, .....) >>> x = mdp.numx_rand.random((100, input_dim)).astype(dtype) >>> isfa.train(x) >>> isfa.stop_training(covs=covs) This trick has been used in the paper to apply ISFA to surrogate matrices, i.e. covariance matrices that were not learnt on a real dataset. """ # fix, whiten, symmetrize and weight the covariance matrices # the functions sets also the number of input components self.ncomp self._fix_covs(covs) # if output_dim were not set, set it to be the number of input comps if self.output_dim is None: self.output_dim = self._effective_input_dim # adjust b_sfa and b_ica self._adjust_ica_sfa_coeff() # initialize all possible rotation axes self.rot_axis = [(i, j) for i in range(0, self.output_dim) for j in range(i+1, self._effective_input_dim)] # initialize the global rotation-permutation matrix (RP): RP = self.RP if RP is None: RP = self._get_eye() else: # apply the global rotation matrix self.covs.transform(RP) # find optimal rotation Q = self._optimize() RP = mult(RP, Q) # rotate and permute the covariance matrices # we do it here in one step, to avoid the cumulative errors # of multiple rotations in _optimize self.covs.transform(Q) # keep the complete rotation-permutation matrix self.RPC = RP.copy() # Reduce dimension to match output_dim# RP = RP[:, :self.output_dim] # the variance for the derivative of a whitened signal is # 0 <= v <= 4, therefore the diagonal elements of the delayed # covariance matrice with time lag = 1 (covs[:,:,0]) are # -1 <= v' <= +1 # reorder the components to have them ordered by slowness d = (self.covs.covs[:self.output_dim, :self.output_dim, 0]).diagonal() idx = d.argsort()[::-1] self.RP = RP.take(idx, axis=1)