def SmilesToFragments(smiles, fgroup_smarts, bondOrderThreshold=1.2, chargesMol=True): """ Fragment molecule at bonds below Bond Order Threshold Parameters ---------- smiles: str smiles string of molecule to fragment Returns ------- frags: list of OE AtomBondSets """ # Charge molecule mol = oechem.OEGraphMol() oemol = openeye.smiles_to_oemol(smiles) charged = openeye.get_charges(oemol, keep_confs=1) # Tag functional groups _tag_fgroups(charged, fgroups_smarts=fgroup_smarts) # Generate fragments G = OeMolToGraph(charged) subraphs = FragGraph(G, bondOrderThreshold=bondOrderThreshold) frags = [] for subraph in subraphs: frags.append(subgraphToAtomBondSet(G, subraph, charged)) if chargesMol: return frags, charged else: return frags
def generate_fragments(mol): """ This function generates fragments from a molecule. Parameters ---------- mol: OEMol Returns ------- charged: charged OEMOl frags: dict of AtomBondSet mapped to rotatable bond index the fragment was built up from. """ charged = openeye.get_charges(mol, keep_confs=1) tagged_rings, tagged_fgroups = tag_molecule(charged) # Iterate over bonds frags = {} for bond in charged.GetBonds(): if bond.IsRotor(): atoms, bonds = _build_frag(bond=bond, mol=charged, tagged_fgroups=tagged_fgroups, tagged_rings=tagged_rings) atom_bond_set = _to_AtomBondSet(charged, atoms, bonds) frags[bond.GetIdx()] = atom_bond_set return charged, frags
def enumerate_conformations(name, smiles): """Generate geometry and run epik.""" # Generate molecule geometry with OpenEye print "Generating molecule {}".format(name) oe_molecule = openeye.smiles_to_oemol(smiles) try: oe_molecule = openeye.get_charges(oe_molecule, keep_confs=1) except RuntimeError as e: traceback.print_exc() print "Skipping molecule " + name return # Create output subfolder output_basepath = os.path.join(output_dir, name) if not os.path.isdir(output_basepath): os.mkdir(output_basepath) output_basepath = os.path.join(output_basepath, name) # Save mol2 file with residue name = first three uppercase letters print "Running epik on molecule {}".format(name) mol2_file_path = output_basepath + '-input.mol2' residue_name = re.sub('[^A-Za-z]+', '', name.upper())[:3] openeye.molecule_to_mol2(oe_molecule, mol2_file_path, residue_name=residue_name) # Run epik on mol2 file mae_file_path = output_basepath + '-epik.mae' schrodinger.run_epik(mol2_file_path, mae_file_path, tautomerize=True, max_structures=32, ph_tolerance=10.0) # Convert maestro file to sdf and mol2 schrodinger.run_structconvert(mae_file_path, output_basepath + '-epik.sdf') schrodinger.run_structconvert(mae_file_path, output_basepath + '-epik.mol2')
def generateSMIRNOFFStructure(molecule): """ Given an OpenEye molecule (oechem.OEMol), create an OpenMM System and use to generate a ParmEd structure using the SMIRNOFF forcefield parameters. """ from openforcefield.typing.engines.smirnoff import ForceField from openforcefield.typing.engines.smirnoff.forcefield_utils import create_system_from_molecule ff = get_data_filename('forcefield/smirnoff99Frosst.ffxml') with open(ff) as ffxml: mol_ff = ForceField(ffxml) if not checkCharges(molecule): from openmoltools.openeye import get_charges print("Assigning charges to molecule.") charged_molecule = get_charges(molecule) else: charged_molecule = molecule mol_top, mol_sys, mol_pos = create_system_from_molecule( mol_ff, charged_molecule) molecule_structure = parmed.openmm.load_topology(mol_top, mol_sys, xyz=mol_pos) return molecule_structure
def create_molecule(iupac_name): molecule = openeye.iupac_to_oemol(iupac_name) molecule = openeye.get_charges(molecule, max_confs=1) #import openeye.oeomega as om #omega = om.OEOmega() #omega.SetMaxConfs(1) #omega(molecule) return molecule
def _generate_fragments(mol, strict_stereo=True): """ This function generates fragments from a molecule. Parameters ---------- mol: OEMol Returns ------- charged: charged OEMOl frags: dict of AtomBondSet mapped to rotatable bond index the fragment was built up from. """ charged = openeye.get_charges(mol, keep_confs=1, strictStereo=strict_stereo) # Check if WBO were calculated bonds = [bond for bond in charged.GetBonds()] for bond in bonds[:1]: try: bond.GetData('WibergBondOrder') except ValueError: logger().warn( "WBO were not calculate. Cannot fragment molecule {}".format( charged.GetTitle())) return False tagged_rings, tagged_fgroups = tag_molecule(charged) # Iterate over bonds frags = {} for bond in charged.GetBonds(): if bond.IsRotor(): atoms, bonds = _build_frag(bond=bond, mol=charged, tagged_fgroups=tagged_fgroups, tagged_rings=tagged_rings) atom_bond_set = _to_AtomBondSet(charged, atoms, bonds) frags[bond.GetIdx()] = atom_bond_set return charged, frags
def oemol_to_antechamber(m, gaff_mol2_filename, frcmod_filename, residue_name="MOL", strictStereo=False): """ Build a molecule from a mol2 file and run antechamber, generating GAFF mol2 and frcmod files from a smiles string. Charges will be generated using the OpenEye QuacPac AM1-BCC implementation. Created by hacking openmoltools/openeye.py Parameters ---------- m : oechem molecule object Molecule to construct and charge gaff_mol2_filename : str Filename of mol2 file output of antechamber, with charges created from openeye frcmod_filename : str Filename of frcmod file output of antechamber. Most likely this file will be almost empty, at least for typical molecules. residue_name : str, optional, default="MOL" OpenEye writes mol2 files with <0> as the residue / ligand name. This chokes many mol2 parsers, so we replace it with a string of your choosing. This might be useful for downstream applications if the residue names are required to be unique. strictStereo : bool, optional, default=False If False, permits smiles strings with unspecified stereochemistry. See https://docs.eyesopen.com/omega/usage.html """ #oechem = import_("openeye.oechem") #if not oechem.OEChemIsLicensed(): raise(ImportError("Need License for oechem!")) # Get the absolute path so we can find these filenames from inside a temporary directory. gaff_mol2_filename = os.path.abspath(gaff_mol2_filename) frcmod_filename = os.path.abspath(frcmod_filename) m = openeye.get_charges(m, strictStereo=strictStereo, keep_confs=1) with enter_temp_directory(): # Avoid dumping 50 antechamber files in local directory. _unused = openeye.molecule_to_mol2(m, "./tmp.mol2", residue_name=residue_name) net_charge = oechem.OENetCharge(m) tmp_gaff_mol2_filename, tmp_frcmod_filename = amber.run_antechamber("tmp", "./tmp.mol2", charge_method=None, net_charge=net_charge) # USE OE AM1BCC charges! shutil.copy(tmp_gaff_mol2_filename, gaff_mol2_filename) shutil.copy(tmp_frcmod_filename, frcmod_filename)
def __init__(self, cas_or_aa, min_atoms=6): """ Initialize using cas numbers OR amino acid name Requires openmoltools.openeye and cirpy Arguments cas_or_aa (list of strings) either cas number or name of amino acid Optional Arguments min_atoms (int) - a minimum number of atoms for substructure match (default: 6) Creates class variables: self.cas_or_aa (list of strings) input representing molecules to be combined self.smiles_strings (list of strings) smiles representation of molecules to be combined self.ligands (list of OEMol) openeye molecule representation of molecules to be combined self.title (string) used as an identifier for input group of molecules self.min_atoms (int) minimum number of common atoms to constitute a substructure match (default: 6) """ self.cas_or_aa = cas_or_aa self.smiles_strings = [] self.ligands = [] for cas in cas_or_aa: smiles = cirpy.resolve(cas, 'smiles') self.smiles_strings.append(smiles) ligand = openeye.smiles_to_oemol(smiles) ligand = openeye.get_charges(ligand, strictStereo=False) self.ligands.append(ligand) self.title = self.cas_or_aa[0] + "_and_analogs" self.min_atoms = min_atoms self.common_substructure = None self.dual_topology = None self.each_molecule_N = [] self.mapping_dictionaries = [] self.pdb_filename = None self.ffxml_filename = None
def __init__(self, cas_or_aa, min_atoms=6): """ Initialize using cas numbers OR amino acid name Requires openmoltools.openeye and cirpy Arguments cas_or_aa (list of strings) either cas number or name of amino acid Optional Arguments min_atoms (int) - a minimum number of atoms for substructure match (default: 6) Creates class variables: self.cas_or_aa (list of strings) input representing molecules to be combined self.smiles_strings (list of strings) smiles representation of molecules to be combined self.ligands (list of OEMol) openeye molecule representation of molecules to be combined self.title (string) used as an identifier for input group of molecules self.min_atoms (int) minimum number of common atoms to constitute a substructure match (default: 6) """ self.cas_or_aa = cas_or_aa self.smiles_strings = [] self.ligands = [] for cas in cas_or_aa: smiles = cirpy.resolve(cas,'smiles') self.smiles_strings.append(smiles) ligand = openeye.smiles_to_oemol(smiles) ligand = openeye.get_charges(ligand, strictStereo=False) self.ligands.append(ligand) self.title = self.cas_or_aa[0]+"_and_analogs" self.min_atoms = min_atoms self.common_substructure = None self.dual_topology = None self.each_molecule_N = [] self.mapping_dictionaries = [] self.pdb_filename = None self.ffxml_filename = None
def _generate_fragments(mol, strict_stereo=True): """ This function generates fragments from a molecule. Parameters ---------- mol: OEMol Returns ------- charged: charged OEMOl frags: dict of AtomBondSet mapped to rotatable bond index the fragment was built up from. """ charged = openeye.get_charges(mol, keep_confs=1, strictStereo=strict_stereo) # Check if WBO were calculated bonds = [bond for bond in charged.GetBonds()] for bond in bonds[:1]: try: bond.GetData('WibergBondOrder') except ValueError: logger().warn("WBO were not calculate. Cannot fragment molecule {}".format(charged.GetTitle())) return False tagged_rings, tagged_fgroups = tag_molecule(charged) # Iterate over bonds frags = {} for bond in charged.GetBonds(): if bond.IsRotor(): atoms, bonds = _build_frag(bond=bond, mol=charged, tagged_fgroups=tagged_fgroups, tagged_rings=tagged_rings) atom_bond_set = _to_AtomBondSet(charged, atoms, bonds) frags[bond.GetIdx()] = atom_bond_set return charged, frags
def run_epik(name, filename, residue_name, perceive_bonds=False): """Generate conformer with OpenEye omega, protonation states with Schrodinger Epik, and charges with OpenEye AM1-BCC. Parameters ---------- name : str The name of the output directory to generate. filename : str The mol2, PDB, or SDF file to read in. residue_name : str Three uppercase letters to name residue. perceive_bonds : bool, optional, default=False If True, will use geometry to perceive connectivity. This is necessary for PDB files. """ # Generate molecule geometry with OpenEye print("Generating molecule %s from %s" % (name, filename)) oe_molecule = read_molecules(filename) if perceive_bonds: oechem.OEDetermineConnectivity(oe_molecule) # Assign geometry and charges with Omega oe_molecule = openeye.get_charges(oe_molecule, max_confs=1, strictStereo=False, normalize=True, keep_confs=1) # Create output subfolder output_basepath = os.path.join(output_dir, name) if not os.path.isdir(output_basepath): os.mkdir(output_basepath) output_basepath = os.path.join(output_basepath, name) # Save mol2 file with residue name = first three uppercase letters print "Running epik on molecule {}".format(name) mol2_file_path = output_basepath + '-input.mol2' residue_name = re.sub('[^A-Za-z]+', '', name.upper())[:3] #openeye.molecule_to_mol2(oe_molecule, mol2_file_path, residue_name=residue_name) from openeye import oechem ofs = oechem.oemolostream(mol2_file_path) oechem.OEWriteMol2File(ofs, oe_molecule, True, False) ofs.close() # Run epik on mol2 file mae_file_path = output_basepath + '-epik.mae' schrodinger.run_epik(mol2_file_path, mae_file_path, tautomerize=False, max_structures=100, min_probability=np.exp(-6), ph=7.4) # Convert maestro file to sdf and mol2 output_sdf_filename = output_basepath + '-epik.sdf' output_mol2_filename = output_basepath + '-epik.mol2' schrodinger.run_structconvert(mae_file_path, output_sdf_filename) schrodinger.run_structconvert(mae_file_path, output_mol2_filename) # Read SDF file. ifs_sdf = oechem.oemolistream() ifs_sdf.SetFormat(oechem.OEFormat_SDF) ifs_sdf.open(output_sdf_filename) sdf_molecule = oechem.OEMol() uncharged_molecules = read_molecules(output_sdf_filename) # Read MOL2 file. ifs_mol2 = oechem.oemolistream() ifs_mol2.open(output_mol2_filename) mol2_molecule = oechem.OEMol() uncharged_molecules = read_molecules(output_sdf_filename) # Assign charges. charged_molecules = list() index = 0 while oechem.OEReadMolecule(ifs_sdf, sdf_molecule): molecule = oechem.OEReadMolecule(ifs_mol2, mol2_molecule) index += 1 print "Charging molecule %d / %d" % (index, len(uncharged_molecules)) try: # Charge molecule. charged_molecule = openeye.get_charges(sdf_molecule, max_confs=800, strictStereo=False, normalize=True, keep_confs=None) # Store tags. oechem.OECopySDData(charged_molecule, sdf_molecule) charged_molecules.append(charged_molecule) except Exception as e: print(e) print("Skipping protomer/tautomer because of failed charging.") # Clean up ifs_sdf.close() ifs_mol2.close() # Write molecules. charged_mol2_filename = output_basepath + '-epik-charged.mol2' ofs = oechem.oemolostream(charged_mol2_filename) for (index, charged_molecule) in enumerate(charged_molecules): oechem.OEWriteMolecule(ofs, charged_molecule) ofs.close() # Write state penalites. outfile = open(output_basepath + '-state-penalties.out', 'w') for (index, charged_molecule) in enumerate(charged_molecules): # Get Epik data. epik_Ionization_Penalty = float(oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty")) epik_Ionization_Penalty_Charging = float(oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty_Charging")) epik_Ionization_Penalty_Neutral = float(oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty_Neutral")) epik_State_Penalty = float(oechem.OEGetSDData(charged_molecule, "r_epik_State_Penalty")) epik_Tot_Q = int(oechem.OEGetSDData(charged_molecule, "i_epik_Tot_Q")) outfile.write('%16.8f\n' % epik_State_Penalty) outfile.close()
def generateResidueTemplate(molecule, residue_atoms=None): """ Generate an residue template for simtk.openmm.app.ForceField using GAFF/AM1-BCC. This requires the OpenEye toolkit. Parameters ---------- molecule : openeye.oechem.OEMol The molecule to be parameterized. The molecule must have explicit hydrogens. Charge will be inferred from the net formal charge. residue_atomset : set of OEAtom, optional, default=None If not None, only the atoms in this set will be used to construct the residue template Returns ------- template : simtk.openmm.app.forcefield._TemplateData Residue template for ForceField using atom types and parameters from `gaff.xml`. additional_parameters_ffxml : str Contents of ForceField `ffxml` file defining additional parameters from parmchk(2). Note that this method preserves stereochemistry during AM1-BCC charge parameterization. """ # Generate a unique residue template name to avoid namespace collisions. # TODO: Can we come up with a more intelligent name? #from uuid import uuid4 #template_name = str(uuid4()) template_name = molecule.GetTitle() # Compute net formal charge. from openeye import oechem oechem.OEAssignFormalCharges(molecule) charges = [ atom.GetFormalCharge() for atom in molecule.GetAtoms() ] net_charge = np.array(charges).sum() # Generate canonical AM1-BCC charges and a reference conformation. molecule = get_charges(molecule, strictStereo=False, keep_confs=1) # Create temporary directory for running antechamber. import tempfile tmpdir = tempfile.mkdtemp() input_mol2_filename = os.path.join(tmpdir, template_name + '.tripos.mol2') gaff_mol2_filename = os.path.join(tmpdir, template_name + '.gaff.mol2') frcmod_filename = os.path.join(tmpdir, template_name + '.frcmod') # Write Tripos mol2 file as antechamber input. ofs = oechem.oemolostream(input_mol2_filename) oechem.OEWriteMolecule(ofs, molecule) ofs.close() # Parameterize the molecule with antechamber. run_antechamber(template_name, input_mol2_filename, charge_method=None, net_charge=net_charge, gaff_mol2_filename=gaff_mol2_filename, frcmod_filename=frcmod_filename) # Read the resulting GAFF mol2 file as a ParmEd structure. ifs = oechem.oemolistream(gaff_mol2_filename) ifs.SetFlavor(oechem.OEFormat_MOL2, oechem.OEIFlavor_MOL2_DEFAULT | oechem.OEIFlavor_MOL2_M2H | oechem.OEIFlavor_MOL2_Forcefield) m2h = True oechem.OEReadMolecule(ifs, molecule) ifs.close() # If residue_atoms = None, add all atoms to the residues if residue_atoms == None: residue_atoms = [ atom for atom in molecule.GetAtoms() ] # Modify partial charges so that charge on residue atoms is integral. residue_charge = 0.0 sum_of_absolute_charge = 0.0 for atom in residue_atoms: charge = atom.GetPartialCharge() residue_charge += charge sum_of_absolute_charge += abs(charge) excess_charge = residue_charge - net_charge if sum_of_absolute_charge == 0.0: sum_of_absolute_charge = 1.0 for atom in residue_atoms: charge = atom.GetPartialCharge() atom.SetPartialCharge( charge + excess_charge * (abs(charge) / sum_of_absolute_charge) ) # Create residue template. template = ForceField._TemplateData(template_name) for (index, atom) in enumerate(molecule.GetAtoms()): atomname = atom.GetName() typename = atom.GetType() element = Element.getByAtomicNumber(atom.GetAtomicNum()) charge = atom.GetPartialCharge() parameters = { 'charge' : charge } atom_template = ForceField._TemplateAtomData(atomname, typename, element, parameters) template.atoms.append(atom_template) for bond in molecule.GetBonds(): if (bond.GetBgn() in residue_atoms) and (bond.GetEnd() in residue_atoms): template.addBondByName(bond.GetBgn().GetName(), bond.GetEnd().GetName()) elif (bond.GetBgn() in residue_atoms) and (bond.GetEnd() not in residue_atoms): template.addExternalBondByName(bond.GetBgn().GetName()) elif (bond.GetBgn() not in residue_atoms) and (bond.GetEnd() in residue_atoms): template.addExternalBondByName(bond.GetEnd().GetName()) # Generate ffxml file contents for parmchk-generated frcmod output. leaprc = StringIO("parm = loadamberparams %s" % frcmod_filename) params = parmed.amber.AmberParameterSet.from_leaprc(leaprc) params = parmed.openmm.OpenMMParameterSet.from_parameterset(params) ffxml = StringIO() params.write(ffxml) return template, ffxml.getvalue()
def generateResidueTemplate(molecule, residue_atoms=None, normalize=True, gaff_version='gaff'): """ Generate an residue template for simtk.openmm.app.ForceField using GAFF/AM1-BCC. This requires the OpenEye toolkit. Parameters ---------- molecule : openeye.oechem.OEMol The molecule to be parameterized. The molecule must have explicit hydrogens. Net charge will be inferred from the net formal charge on each molecule. Partial charges will be determined automatically using oequacpac and canonical AM1-BCC charging rules. residue_atomset : set of OEAtom, optional, default=None If not None, only the atoms in this set will be used to construct the residue template normalize : bool, optional, default=True If True, normalize the molecule by checking aromaticity, adding explicit hydrogens, and renaming by IUPAC name. gaff_version : str, default = 'gaff' One of ['gaff', 'gaff2']; selects which atom types to use. Returns ------- template : simtk.openmm.app.forcefield._TemplateData Residue template for ForceField using atom types and parameters from `gaff.xml` or `gaff2.xml`. additional_parameters_ffxml : str Contents of ForceField `ffxml` file defining additional parameters from parmchk(2). Notes ----- The residue template will be named after the molecule title. This method preserves stereochemistry during AM1-BCC charge parameterization. Atom names in molecules will be assigned Tripos atom names if any are blank or not unique. """ # Set the template name based on the molecule title plus a globally unique UUID. from uuid import uuid4 template_name = molecule.GetTitle() + '-' + str(uuid4()) # If any atom names are not unique, atom names _ensureUniqueAtomNames(molecule) # Compute net formal charge. net_charge = _computeNetCharge(molecule) # Generate canonical AM1-BCC charges and a reference conformation. molecule = get_charges(molecule, strictStereo=False, keep_confs=1, normalize=normalize) # DEBUG: This may be necessary. molecule.SetTitle('MOL') # Create temporary directory for running antechamber. import tempfile tmpdir = tempfile.mkdtemp() prefix = 'molecule' input_mol2_filename = os.path.join(tmpdir, prefix + '.tripos.mol2') gaff_mol2_filename = os.path.join(tmpdir, prefix + '.gaff.mol2') frcmod_filename = os.path.join(tmpdir, prefix + '.frcmod') # Write Tripos mol2 file as antechamber input. _writeMolecule(molecule, input_mol2_filename, standardize=normalize) # Parameterize the molecule with antechamber. run_antechamber(template_name, input_mol2_filename, charge_method=None, net_charge=net_charge, gaff_mol2_filename=gaff_mol2_filename, frcmod_filename=frcmod_filename, gaff_version=gaff_version) # Read the resulting GAFF mol2 file as a ParmEd structure. from openeye import oechem ifs = oechem.oemolistream(gaff_mol2_filename) ifs.SetFlavor(oechem.OEFormat_MOL2, oechem.OEIFlavor_MOL2_DEFAULT | oechem.OEIFlavor_MOL2_M2H | oechem.OEIFlavor_MOL2_Forcefield) m2h = True oechem.OEReadMolecule(ifs, molecule) ifs.close() # If residue_atoms = None, add all atoms to the residues if residue_atoms == None: residue_atoms = [ atom for atom in molecule.GetAtoms() ] # Modify partial charges so that charge on residue atoms is integral. residue_charge = 0.0 sum_of_absolute_charge = 0.0 for atom in residue_atoms: charge = atom.GetPartialCharge() residue_charge += charge sum_of_absolute_charge += abs(charge) excess_charge = residue_charge - net_charge if sum_of_absolute_charge == 0.0: sum_of_absolute_charge = 1.0 for atom in residue_atoms: charge = atom.GetPartialCharge() atom.SetPartialCharge( charge + excess_charge * (abs(charge) / sum_of_absolute_charge) ) # Create residue template. template = ForceField._TemplateData(template_name) for (index, atom) in enumerate(molecule.GetAtoms()): atomname = atom.GetName() typename = atom.GetType() element = Element.getByAtomicNumber(atom.GetAtomicNum()) charge = atom.GetPartialCharge() parameters = { 'charge' : charge } atom_template = ForceField._TemplateAtomData(atomname, typename, element, parameters) template.atoms.append(atom_template) for bond in molecule.GetBonds(): if (bond.GetBgn() in residue_atoms) and (bond.GetEnd() in residue_atoms): template.addBondByName(bond.GetBgn().GetName(), bond.GetEnd().GetName()) elif (bond.GetBgn() in residue_atoms) and (bond.GetEnd() not in residue_atoms): template.addExternalBondByName(bond.GetBgn().GetName()) elif (bond.GetBgn() not in residue_atoms) and (bond.GetEnd() in residue_atoms): template.addExternalBondByName(bond.GetEnd().GetName()) # Generate ffxml file contents for parmchk-generated frcmod output. leaprc = StringIO('parm = loadamberparams %s' % frcmod_filename) params = parmed.amber.AmberParameterSet.from_leaprc(leaprc) params = parmed.openmm.OpenMMParameterSet.from_parameterset(params) ffxml = StringIO() params.write(ffxml) return template, ffxml.getvalue()
def generateForceFieldFromMolecules(molecules): """ Generate ffxml file containing additional parameters and residue templates for simtk.openmm.app.ForceField using GAFF/AM1-BCC. This requires the OpenEye toolkit. Parameters ---------- molecules : list of openeye.oechem.OEMol The molecules to be parameterized. All molecules must have explicit hydrogens. Net charge will be inferred from the net formal charge on each molecule. Partial charges will be determined automatically using oequacpac and canonical AM1-BCC charging rules. Returns ------- ffxml : str Contents of ForceField `ffxml` file defining additional parameters from parmchk(2) and residue templates. Notes ----- This method preserves stereochemistry during AM1-BCC charge parameterization. Residue template names will be set from molecule names. Atom names in molecules will be assigned Tripos atom names if any are blank or not unique. """ # Check template names are unique. template_names = set() for molecule in molecules: template_name = molecule.GetTitle() if template_name == '<0>': raise Exception("Molecule '%s' has invalid name" % template_name) if template_name in template_names: raise Exception("Molecule '%s' has template name collision." % template_name) template_names.add(template_name) # Process molecules. import tempfile tmpdir = tempfile.mkdtemp() olddir = os.getcwd() os.chdir(tmpdir) leaprc = "" for (molecule_index, molecule) in enumerate(molecules): # Set the template name based on the molecule title. template_name = molecule.GetTitle() # If any atom names are not unique, atom names _ensureUniqueAtomNames(molecule) # Compute net formal charge. net_charge = _computeNetCharge(molecule) # Generate canonical AM1-BCC charges and a reference conformation. molecule = get_charges(molecule, strictStereo=False, keep_confs=1) # Create a unique prefix. prefix = 'molecule%010d' % molecule_index # Create temporary directory for running antechamber. input_mol2_filename = prefix + '.tripos.mol2' gaff_mol2_filename = prefix + '.gaff.mol2' frcmod_filename = prefix + '.frcmod' # Write Tripos mol2 file as antechamber input. _writeMolecule(molecule, input_mol2_filename) # Parameterize the molecule with antechamber. run_antechamber(prefix, input_mol2_filename, charge_method=None, net_charge=net_charge, gaff_mol2_filename=gaff_mol2_filename, frcmod_filename=frcmod_filename) # Append to leaprc input for parmed. leaprc += '%s = loadmol2 %s\n' % (prefix, gaff_mol2_filename) leaprc += 'loadamberparams %s\n' % frcmod_filename # Generate ffxml file contents for parmchk-generated frcmod output. leaprc = StringIO(leaprc) params = parmed.amber.AmberParameterSet.from_leaprc(leaprc) params = parmed.openmm.OpenMMParameterSet.from_parameterset(params) ffxml = StringIO() params.write(ffxml) # TODO: Clean up temporary directory. os.chdir(olddir) return ffxml.getvalue()
def enumerate_conformations(name, pdbfile=None, smiles=None, pdbname=None, pH=7.4): """Run Epik to get protonation states using PDB residue templates for naming. Parameters ---------- name : str Common name of molecule (used to create subdirectory) smiles : str Isomeric SMILES string pdbname : str Three-letter PDB code (e.g. 'DB8') """ # Create output subfolder # output_basepath = os.path.join(output_dir, name) # if not os.path.isdir(output_basepath): # os.mkdir(output_basepath) # output_basepath = os.path.join(output_basepath, name) oehandler = openeye.oechem.OEThrow # String stream output oss = oechem.oeosstream() oehandler.SetOutputStream(oss) log = "New run:\nPDB code: {pdbname}; Molecule: {name}; pH {pH}\n".format( **locals()) success_status = True if pdbname: # Make sure to only use one entry if there are multiple if ' ' in pdbname: pdbnames = pdbname.split(' ') log += "Splitting '%s' into first entry only: '%s'" % (pdbname, pdbnames[0]) pdbname = pdbnames[0] # Retrieve PDB (for atom names) url = 'http://ligand-expo.rcsb.org/reports/%s/%s/%s_model.pdb' % ( pdbname[0], pdbname, pdbname) pdb_filename = name + '-rcsb_download.pdb' log += "Retrieving PDB structure from RCSB ligand expo: {}.\n".format( pdb_filename) retrieve_url(url, pdb_filename) log += "Parsing PDB file.\n" pdb_molecule = read_molecule(pdb_filename) # Retrieve SDF (for everything else) url = 'http://ligand-expo.rcsb.org/reports/%s/%s/%s_model.sdf' % ( pdbname[0], pdbname, pdbname) sdf_filename = name + '-rcsb_download.sdf' log += "Retrieving SDF structure from RCSB ligand expo: {}.\n".format( sdf_filename) retrieve_url(url, sdf_filename) log += "Parsing SDF file.\n" sdf_molecule = read_molecule(sdf_filename) # Replace atom names in SDF log += "Canonicalizing atom names.\n" for (sdf_atom, pdb_atom) in zip(sdf_molecule.GetAtoms(), pdb_molecule.GetAtoms()): sdf_atom.SetName(pdb_atom.GetName()) # Assign Tripos atom types log += "Assign atom type names.\n" oechem.OETriposAtomTypeNames(sdf_molecule) oechem.OETriposBondTypeNames(sdf_molecule) oe_molecule = sdf_molecule # We already know the residue name residue_name = pdbname # For the moment, disabling these two types of input # elif smiles: # # Generate molecule geometry with OpenEye # logging.info(("Generating molecule {}".format(name))) # oe_molecule = openeye.smiles_to_oemol(smiles) # # Assign Tripos atom types # oechem.OETriposAtomTypeNames(oe_molecule) # oechem.OETriposBondTypeNames(oe_molecule) # try: # logging.info("Charging initial") # write_mol2_preserving_atomnames(name + '-debug.mol2', oe_molecule, 'debug') # oe_molecule = openeye.get_charges(oe_molecule, keep_confs=1) # except RuntimeError as e: # traceback.print_exc() # logging.info(("Skipping molecule " + name)) # return # residue_name = re.sub('[^A-Za-z]+', '', name.upper())[:3] # logging.info("resname = %s", residue_name) # oe_molecule.SetTitle(residue_name) # fix iupac name issue with mol2convert # elif pdbfile: # residue_name = re.sub('[^A-Za-z]+', '', name.upper())[:3] # logging.info("Loading molecule molecule {0} from {1}".format(name, pdbfile)) # oe_molecule = read_molecule(pdbfile) # # Assign Tripos atom types # oechem.OETriposAtomTypeNames(oe_molecule) # oechem.OETriposBondTypeNames(oe_molecule) # try: # logging.info("Charging initial") # write_mol2_preserving_atomnames(name + '-debug.mol2', oe_molecule, 'debug') # oe_molecule = openeye.get_charges(oe_molecule, keep_confs=1) # except RuntimeError as e: # traceback.print_exc() # logging.info(("Skipping molecule " + name)) # return else: raise Exception('Must provide SMILES string or pdbname, or pdbfile') # Save mol2 file, preserving atom names log += "Running Epik.\n" mol2_file_path = name + '-before_epik.mol2' write_mol2_preserving_atomnames(mol2_file_path, oe_molecule, residue_name) # Run epik on mol2 file mae_file_path = name + '-epik.mae' schrodinger.run_epik(mol2_file_path, mae_file_path, tautomerize=False, max_structures=50, min_probability=np.exp(-MAX_ENERGY_PENALTY), ph=pH) log += "Epik run completed.\n" # Convert maestro file to sdf and mol2 output_sdf_filename = name + '-after_epik.sdf' output_mol2_filename = name + '-after_epik.mol2' # logging.info("Creating sdf") schrodinger.run_structconvert(mae_file_path, output_sdf_filename) # logging.info("Creating mol2") schrodinger.run_structconvert(mae_file_path, output_mol2_filename) # Read SDF file. ifs_sdf = oechem.oemolistream() ifs_sdf.SetFormat(oechem.OEFormat_SDF) ifs_sdf.open(output_sdf_filename) sdf_molecule = oechem.OEGraphMol() # Read MOL2 file. ifs_mol2 = oechem.oemolistream() ifs_mol2.open(output_mol2_filename) mol2_molecule = oechem.OEMol() # Assign charges. # reset count of error handler oehandler.Clear() log += "Assigning charges to protonation states.\n" charged_molecules = list() index = 0 failed_states = set() while oechem.OEReadMolecule(ifs_sdf, sdf_molecule): oechem.OEReadMolecule(ifs_mol2, mol2_molecule) index += 1 log += "State {0:d}\n".format(index) try: # Charge molecule. charged_molecule_conformers = omtoe.get_charges(mol2_molecule, max_confs=800, strictStereo=False, normalize=True, keep_confs=-1) log += "Charging stage output:\n" OEOutput = str(oss) log += OEOutput log += "\nCharging state completed.\n" # Restore coordinates to original charged_molecule = select_conformers(charged_molecule_conformers, mol2_molecule, keep_confs=None) # Assign Tripos types oechem.OETriposAtomTypeNames(charged_molecule) oechem.OETriposBondTypeNames(charged_molecule) # Store tags. oechem.OECopySDData(charged_molecule, sdf_molecule) # Store molecule charged_molecules.append(charged_molecule) # Check for failure in the log openeye_charge_log_parser(OEOutput, True) oehandler.Clear() except Exception as e: failed_states.add(index) logging.info(e) log += "State failed charging.\n" log += str(e) log += "\n" filename_failure = name + '-conformers-failed-state-{}-.mol2'.format( index) try: write_mol2_preserving_atomnames(filename_failure, charged_molecule_conformers, residue_name) except: log += "Could not store result, most likely failed during Omega step!\n" success_status = False oehandler.Clear() # Clean up ifs_sdf.close() ifs_mol2.close() # Write state penalties. outfile = open(name + '-state-penalties.out', 'w') for (index, charged_molecule) in enumerate(charged_molecules): # Get Epik data. log += "Writing Epik data for state {:d}\n".format(index + 1) epik_Ionization_Penalty = float( oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty")) epik_Ionization_Penalty_Charging = float( oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty_Charging")) epik_Ionization_Penalty_Neutral = float( oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty_Neutral")) epik_State_Penalty = float( oechem.OEGetSDData(charged_molecule, "r_epik_State_Penalty")) epik_Tot_Q = int(oechem.OEGetSDData(charged_molecule, "i_epik_Tot_Q")) outfile.write('%16.8f\n' % epik_State_Penalty) outfile.close() # Write as PDB charged_pdb_filename = name + '-charged_output.pdb' ofs = oechem.oemolostream(charged_pdb_filename) flavor = oechem.OEOFlavor_PDB_CurrentResidues | oechem.OEOFlavor_PDB_ELEMENT | oechem.OEOFlavor_PDB_BONDS | oechem.OEOFlavor_PDB_HETBONDS | oechem.OEOFlavor_PDB_BOTH ofs.SetFlavor(oechem.OEFormat_PDB, flavor) for (index, charged_molecule) in enumerate(charged_molecules): # Fix residue names for atom in charged_molecule.GetAtoms(): residue = oechem.OEAtomGetResidue(atom) residue.SetName(residue_name) oechem.OEAtomSetResidue(atom, residue) oechem.OEWriteMolecule(ofs, charged_molecule) ofs.close() # Write molecules as mol2. charged_mol2_filename = name + '-charged_output.mol2' write_mol2_preserving_atomnames(charged_mol2_filename, charged_molecules, residue_name) log += "Run completed.\n" if success_status: log += "Status: Success\n" else: log += "Status: Failure\n" log += "Failed states: {}\n".format(" ".join( [str(state) for state in sorted(list(failed_states))])) with open("log.txt", 'w') as logfile: logfile.write(log) return log, success_status
return_molecules=True) # Generate figure atom_indices = utils.tag_conjugated_bond(molecule, tautomers=tautomers) utils.depict_conjugation(molecule, height=700, width=1000, fname='images/{}_oe_conj.png'.format( molecule.GetTitle()), label=None) # In[9]: # Add OpenEye WBO to depiction for molecule in mollist: # Generate charges charged = openeye.get_charges(molecule) charged.SetTitle(molecule.GetName()) atom_indices = utils.tag_conjugated_bond(charged, tag='WibergBondOrder', threshold=1.05) utils.depict_conjugation(charged, height=700, width=1000, fname='images/{}_oe_labeled_1.05.png'.format( molecule.GetTitle()), label='WibergBondOrder') atom_indices = utils.tag_conjugated_bond(charged, tag='WibergBondOrder', threshold=1.2) utils.depict_conjugation(charged, height=700,
if not os.path.exists(mol2_directory_path): os.makedirs(mol2_directory_path) print("{} directory created.".format(mol2_directory_path)) print("Generating charged OEMol molecules...") # Dictionary to keep track of failed molecules failed_molecules_dict = {} # Generate charges for an OpenEye OEMol molecule. It will return molecule with OpenEye's recommended AM1BCC # charge selection scheme. for key, value in eMolID_oemol_dict.items(): print("Generating conformer for ", key, "...") try: oe_molecule = omtoe.get_charges(value, keep_confs=1) except RuntimeError: print("Conformation generation failed for {}.".format(key)) # Save failed molecule to failed_molecules_dict failed_molecules_dict[key] = value mol2_filename = mol2_directory_path + "/" + str(key) + ".mol2" omtoe.molecule_to_mol2(oe_molecule, tripos_mol2_filename=mol2_filename) print("Mol2 file {} generated.".format(mol2_filename)) print("") print("Conformer generation for {} molecules failed.".format( len(failed_molecules_dict))) # Remove failed molecules from oMolID_oemol_dict dictionary for key, value in failed_molecules_dict.items():
def generateResidueTemplate(molecule, residue_atoms=None, normalize=True, gaff_version='gaff'): """ Generate an residue template for simtk.openmm.app.ForceField using GAFF/AM1-BCC. This requires the OpenEye toolkit. Parameters ---------- molecule : openeye.oechem.OEMol The molecule to be parameterized. The molecule must have explicit hydrogens. Net charge will be inferred from the net formal charge on each molecule. Partial charges will be determined automatically using oequacpac and canonical AM1-BCC charging rules. residue_atomset : set of OEAtom, optional, default=None If not None, only the atoms in this set will be used to construct the residue template normalize : bool, optional, default=True If True, normalize the molecule by checking aromaticity, adding explicit hydrogens, and renaming by IUPAC name. gaff_version : str, default = 'gaff' One of ['gaff', 'gaff2']; selects which atom types to use. Returns ------- template : simtk.openmm.app.forcefield._TemplateData Residue template for ForceField using atom types and parameters from `gaff.xml` or `gaff2.xml`. additional_parameters_ffxml : str Contents of ForceField `ffxml` file defining additional parameters from parmchk(2). Notes ----- The residue template will be named after the molecule title. This method preserves stereochemistry during AM1-BCC charge parameterization. Atom names in molecules will be assigned Tripos atom names if any are blank or not unique. """ # Set the template name based on the molecule title plus a globally unique UUID. from uuid import uuid4 template_name = molecule.GetTitle() + '-' + str(uuid4()) # If any atom names are not unique, atom names _ensureUniqueAtomNames(molecule) # Compute net formal charge. net_charge = _computeNetCharge(molecule) # Generate canonical AM1-BCC charges and a reference conformation. molecule = get_charges(molecule, strictStereo=False, keep_confs=1, normalize=normalize) # DEBUG: This may be necessary. molecule.SetTitle('MOL') # Create temporary directory for running antechamber. import tempfile tmpdir = tempfile.mkdtemp() prefix = 'molecule' input_mol2_filename = os.path.join(tmpdir, prefix + '.tripos.mol2') gaff_mol2_filename = os.path.join(tmpdir, prefix + '.gaff.mol2') frcmod_filename = os.path.join(tmpdir, prefix + '.frcmod') # Write Tripos mol2 file as antechamber input. _writeMolecule(molecule, input_mol2_filename, standardize=normalize) # Parameterize the molecule with antechamber. run_antechamber(template_name, input_mol2_filename, charge_method=None, net_charge=net_charge, gaff_mol2_filename=gaff_mol2_filename, frcmod_filename=frcmod_filename, gaff_version=gaff_version) # Read the resulting GAFF mol2 file as a ParmEd structure. from openeye import oechem ifs = oechem.oemolistream(gaff_mol2_filename) ifs.SetFlavor( oechem.OEFormat_MOL2, oechem.OEIFlavor_MOL2_DEFAULT | oechem.OEIFlavor_MOL2_M2H | oechem.OEIFlavor_MOL2_Forcefield) m2h = True oechem.OEReadMolecule(ifs, molecule) ifs.close() # If residue_atoms = None, add all atoms to the residues if residue_atoms == None: residue_atoms = [atom for atom in molecule.GetAtoms()] # Modify partial charges so that charge on residue atoms is integral. residue_charge = 0.0 sum_of_absolute_charge = 0.0 for atom in residue_atoms: charge = atom.GetPartialCharge() residue_charge += charge sum_of_absolute_charge += abs(charge) excess_charge = residue_charge - net_charge if sum_of_absolute_charge == 0.0: sum_of_absolute_charge = 1.0 for atom in residue_atoms: charge = atom.GetPartialCharge() atom.SetPartialCharge(charge + excess_charge * (abs(charge) / sum_of_absolute_charge)) # Create residue template. template = ForceField._TemplateData(template_name) for (index, atom) in enumerate(molecule.GetAtoms()): atomname = atom.GetName() typename = atom.GetType() element = Element.getByAtomicNumber(atom.GetAtomicNum()) charge = atom.GetPartialCharge() parameters = {'charge': charge} atom_template = ForceField._TemplateAtomData(atomname, typename, element, parameters) template.atoms.append(atom_template) for bond in molecule.GetBonds(): if (bond.GetBgn() in residue_atoms) and (bond.GetEnd() in residue_atoms): template.addBondByName(bond.GetBgn().GetName(), bond.GetEnd().GetName()) elif (bond.GetBgn() in residue_atoms) and (bond.GetEnd() not in residue_atoms): template.addExternalBondByName(bond.GetBgn().GetName()) elif (bond.GetBgn() not in residue_atoms) and (bond.GetEnd() in residue_atoms): template.addExternalBondByName(bond.GetEnd().GetName()) # Generate ffxml file contents for parmchk-generated frcmod output. leaprc = StringIO('parm = loadamberparams %s' % frcmod_filename) params = parmed.amber.AmberParameterSet.from_leaprc(leaprc) params = parmed.openmm.OpenMMParameterSet.from_parameterset(params) ffxml = StringIO() params.write(ffxml) return template, ffxml.getvalue()
def generateForceFieldFromMolecules(molecules, ignoreFailures=False, generateUniqueNames=False, normalize=True, gaff_version='gaff'): """ Generate ffxml file containing additional parameters and residue templates for simtk.openmm.app.ForceField using GAFF/AM1-BCC. This requires the OpenEye toolkit. Parameters ---------- molecules : list of openeye.oechem.OEMol The molecules to be parameterized. All molecules must have explicit hydrogens. Net charge will be inferred from the net formal charge on each molecule. Partial charges will be determined automatically using oequacpac and canonical AM1-BCC charging rules. ignoreFailures: bool, optional, default=False Determines whether to add a failed molecule to the list of failed molecules (True), or raise an Exception (False). generateUniqueNames : bool, optional, default=False If True, will generate globally unique names for templates. normalize : bool, optional, default=True If True, normalize the molecule by checking aromaticity, adding explicit hydrogens, and renaming by IUPAC name. gaff_version : str, default = 'gaff' One of ['gaff', 'gaff2']; selects which atom types to use. Returns ------- ffxml : str Contents of ForceField `ffxml` file defining additional parameters from parmchk(2) and residue templates. failed_molecule_list : list of openeye.oechem.OEMol List of the oemols that could not be parameterized. Only returned if ignoreFailures=True Notes ----- This method preserves stereochemistry during AM1-BCC charge parameterization. Residue template names will be set from molecule names. Atom names in molecules will be assigned Tripos atom names if any are blank or not unique. """ if not generateUniqueNames: # Check template names are unique. template_names = set() for molecule in molecules: template_name = molecule.GetTitle() if template_name == '<0>': raise Exception("Molecule '%s' has invalid name" % template_name) if template_name in template_names: raise Exception("Molecule '%s' has template name collision." % template_name) template_names.add(template_name) # Process molecules. import tempfile tmpdir = tempfile.mkdtemp() olddir = os.getcwd() os.chdir(tmpdir) leaprc = "" failed_molecule_list = [] for (molecule_index, molecule) in enumerate(molecules): # Set the template name based on the molecule title. if generateUniqueNames: from uuid import uuid4 template_name = molecule.GetTitle() + '-' + str(uuid4()) else: template_name = molecule.GetTitle() # If any atom names are not unique, atom names _ensureUniqueAtomNames(molecule) # Compute net formal charge. net_charge = _computeNetCharge(molecule) # Generate canonical AM1-BCC charges and a reference conformation. if not ignoreFailures: molecule = get_charges(molecule, strictStereo=False, keep_confs=1, normalize=normalize) else: try: molecule = get_charges(molecule, strictStereo=False, keep_confs=1, normalize=normalize) except: failed_molecule_list.append(molecule) # Create a unique prefix. prefix = 'molecule%010d' % molecule_index # Create temporary directory for running antechamber. input_mol2_filename = prefix + '.tripos.mol2' gaff_mol2_filename = prefix + '.gaff.mol2' frcmod_filename = prefix + '.frcmod' # Write Tripos mol2 file as antechamber input. _writeMolecule(molecule, input_mol2_filename, standardize=normalize) # Parameterize the molecule with antechamber. run_antechamber(prefix, input_mol2_filename, charge_method=None, net_charge=net_charge, gaff_mol2_filename=gaff_mol2_filename, frcmod_filename=frcmod_filename, gaff_version=gaff_version) # Append to leaprc input for parmed. leaprc += '%s = loadmol2 %s\n' % (prefix, gaff_mol2_filename) leaprc += 'loadamberparams %s\n' % frcmod_filename # Generate ffxml file contents for parmchk-generated frcmod output. leaprc = StringIO(leaprc) params = parmed.amber.AmberParameterSet.from_leaprc(leaprc) params = parmed.openmm.OpenMMParameterSet.from_parameterset(params) ffxml = StringIO() params.write(ffxml) # TODO: Clean up temporary directory. os.chdir(olddir) if ignoreFailures: return ffxml.getvalue(), failed_molecule_list else: return ffxml.getvalue()
""" Test fragmentation """ __author__ = 'Chaya D. Stern' from torsionfit.tests.utils import get_fn, has_openeye, FileIOTestCase import unittest # TODO should I move this to SetUp? if has_openeye: from openmoltools.openeye import get_charges, smiles_to_oemol import openeye.oechem as oechem from torsionfit.qmscan import fragment mol = smiles_to_oemol( 'CN(C)C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@H]4CCOC4' ) charged = get_charges(mol, keep_confs=1) class TestFragments(FileIOTestCase): @unittest.skipUnless(has_openeye, "Cannot test without OpenEye") def test_tag_funcgroup(self): """ Test tag functional groups """ tagged_funcgroups = fragment._tag_fgroups(charged) self.assertEquals(len(tagged_funcgroups), 3) atom_idx = tagged_funcgroups['amide_0'][0].pop() atom = charged.GetAtom(oechem.OEHasAtomIdx(atom_idx)) fgroup = atom.GetData('fgroup') self.assertEquals('amide_0', fgroup) @unittest.skipUnless(has_openeye, "Cannot test without OpenEye") def test_tag_rings(self):
""" Test fragmentation """ __author__ = 'Chaya D. Stern' from torsionfit.tests.utils import get_fun, has_openeye import unittest if has_openeye: from openmoltools.openeye import get_charges, smiles_to_oemol import openeye.oechem as oechem from torsionfit.qmscan import fragment mol = smiles_to_oemol('CN(C)C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@H]4CCOC4') charged = get_charges(mol, keep_confs=1) class TestFragments(unittest.TestCase): @unittest.skipUnless(has_openeye, "Cannot test without OpenEye") def test_tag_funcgroup(self): """ Test tag functional groups """ tagged_funcgroups = fragment._tag_fgroups(charged) self.assertEquals(len(tagged_funcgroups), 3) atom_idx = tagged_funcgroups['amide_0'][0].pop() atom = charged.GetAtom(oechem.OEHasAtomIdx(atom_idx)) fgroup = atom.GetData('fgroup') self.assertEquals('amide_0', fgroup) @unittest.skipUnless(has_openeye, "Cannot test without OpenEye") def test_tag_rings(self): """ Test tag rings""" tagged_rings = fragment._tag_rings(charged) self.assertEquals(len(tagged_rings), 3)
def enumerate_conformations(name, smiles=None, pdbname=None): """Run Epik to get protonation states using PDB residue templates for naming. Parameters ---------- name : str Common name of molecule (used to create subdirectory) smiles : str Isomeric SMILES string pdbname : str Three-letter PDB code (e.g. 'DB8') """ # Create output subfolder output_basepath = os.path.join(output_dir, name) if not os.path.isdir(output_basepath): os.mkdir(output_basepath) output_basepath = os.path.join(output_basepath, name) if pdbname: # Make sure to only use one entry if there are mutliple if ' ' in pdbname: pdbnames = pdbname.split(' ') print("Splitting '%s' into first entry only: '%s'" % (pdbname, pdbnames[0])) pdbname = pdbnames[0] # Retrieve PDB (for atom names) url = 'http://ligand-expo.rcsb.org/reports/%s/%s/%s_model.pdb' % (pdbname[0], pdbname, pdbname) pdb_filename = output_basepath + '-input.pdb' retrieve_url(url, pdb_filename) pdb_molecule = read_molecule(pdb_filename) # Retrieve SDF (for everything else) url = 'http://ligand-expo.rcsb.org/reports/%s/%s/%s_model.sdf' % (pdbname[0], pdbname, pdbname) sdf_filename = output_basepath + '-input.sdf' retrieve_url(url, sdf_filename) sdf_molecule = read_molecule(sdf_filename) # Replace atom names in SDF for (sdf_atom, pdb_atom) in zip(sdf_molecule.GetAtoms(), pdb_molecule.GetAtoms()): sdf_atom.SetName(pdb_atom.GetName()) # Assign Tripos atom types oechem.OETriposAtomTypeNames(sdf_molecule) oechem.OETriposBondTypeNames(sdf_molecule) oe_molecule = sdf_molecule # We already know the residue name residue_name = pdbname elif smiles: # Generate molecule geometry with OpenEye print("Generating molecule {}".format(name)) oe_molecule = openeye.smiles_to_oemol(smiles) # Assign Tripos atom types oechem.OETriposAtomTypeNames(oe_molecule) oechem.OETriposBondTypeNames(oe_molecule) try: oe_molecule = openeye.get_charges(oe_molecule, keep_confs=1) except RuntimeError as e: traceback.print_exc() print("Skipping molecule " + name) return residue_name = re.sub('[^A-Za-z]+', '', name.upper())[:3] else: raise Exception('Must provide SMILES string or pdbname') # Save mol2 file, preserving atom names print("Running epik on molecule {}".format(name)) mol2_file_path = output_basepath + '-input.mol2' write_mol2_preserving_atomnames(mol2_file_path, oe_molecule, residue_name) # Run epik on mol2 file mae_file_path = output_basepath + '-epik.mae' schrodinger.run_epik(mol2_file_path, mae_file_path, tautomerize=False, max_structures=100, min_probability=np.exp(-MAX_ENERGY_PENALTY), ph=7.4) # Convert maestro file to sdf and mol2 output_sdf_filename = output_basepath + '-epik.sdf' output_mol2_filename = output_basepath + '-epik.mol2' schrodinger.run_structconvert(mae_file_path, output_sdf_filename) schrodinger.run_structconvert(mae_file_path, output_mol2_filename) # Read SDF file. ifs_sdf = oechem.oemolistream() ifs_sdf.SetFormat(oechem.OEFormat_SDF) ifs_sdf.open(output_sdf_filename) sdf_molecule = oechem.OEGraphMol() # Read MOL2 file. ifs_mol2 = oechem.oemolistream() ifs_mol2.open(output_mol2_filename) mol2_molecule = oechem.OEMol() # Assign charges. charged_molecules = list() index = 0 while oechem.OEReadMolecule(ifs_sdf, sdf_molecule): oechem.OEReadMolecule(ifs_mol2, mol2_molecule) index += 1 print("Charging molecule %d" % (index)) try: # Charge molecule. charged_molecule = openeye.get_charges(mol2_molecule, max_confs=800, strictStereo=False, normalize=True, keep_confs=None) # Assign Tripos types oechem.OETriposAtomTypeNames(charged_molecule) oechem.OETriposBondTypeNames(charged_molecule) # Store tags. oechem.OECopySDData(charged_molecule, sdf_molecule) # Store molecule charged_molecules.append(charged_molecule) except Exception as e: print(e) print("Skipping protomer/tautomer because of failed charging.") # Clean up ifs_sdf.close() ifs_mol2.close() # Write state penalites. outfile = open(output_basepath + '-state-penalties.out', 'w') for (index, charged_molecule) in enumerate(charged_molecules): # Get Epik data. epik_Ionization_Penalty = float(oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty")) epik_Ionization_Penalty_Charging = float(oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty_Charging")) epik_Ionization_Penalty_Neutral = float(oechem.OEGetSDData(charged_molecule, "r_epik_Ionization_Penalty_Neutral")) epik_State_Penalty = float(oechem.OEGetSDData(charged_molecule, "r_epik_State_Penalty")) epik_Tot_Q = int(oechem.OEGetSDData(charged_molecule, "i_epik_Tot_Q")) outfile.write('%16.8f\n' % epik_State_Penalty) outfile.close() # Write as PDB charged_pdb_filename = output_basepath + '-epik-charged.pdb' ofs = oechem.oemolostream(charged_pdb_filename) flavor = oechem.OEOFlavor_PDB_CurrentResidues | oechem.OEOFlavor_PDB_ELEMENT | oechem.OEOFlavor_PDB_BONDS | oechem.OEOFlavor_PDB_HETBONDS | oechem.OEOFlavor_PDB_BOTH ofs.SetFlavor(oechem.OEFormat_PDB, flavor) for (index, charged_molecule) in enumerate(charged_molecules): # Fix residue names for atom in charged_molecule.GetAtoms(): residue = oechem.OEAtomGetResidue(atom) residue.SetName(residue_name) oechem.OEAtomSetResidue(atom, residue) #oechem.OEWritePDBFile(ofs, charged_molecule, flavor) oechem.OEWriteMolecule(ofs, charged_molecule) ofs.close() # Write molecules as mol2. charged_mol2_filename = output_basepath + '-epik-charged.mol2' write_mol2_preserving_atomnames(charged_mol2_filename, charged_molecules, residue_name)