def getTalkRect(self, startTime, duration, trackId, text): "Return shapes for a specific talk" g = Group() y_bottom = self.scaleTime(startTime + duration) y_top = self.scaleTime(startTime) y_height = y_top - y_bottom if trackId is None: #spans all columns x = self._colLeftEdges[1] width = self.width - self._colWidths[0] else: #trackId is 1-based and these arrays have the margin info in column #zero, so no need to add 1 x = self._colLeftEdges[trackId] width = self._colWidths[trackId] lab = Label() lab.setText(text) lab.setOrigin(x + 0.5*width, y_bottom+0.5*y_height) lab.boxAnchor = 'c' lab.width = width lab.height = y_height lab.fontSize = 6 r = Rect(x, y_bottom, width, y_height, fillColor=colors.cyan) g.add(r) g.add(lab) #now for a label # would expect to color-code and add text return g
def addScale(drawing, xmap, y, start, end, tickLen=10, dx=3, dy=6, textAnchor='middle', boxAnchor='s', fontSize=12, strokeWidth=1, strokeColor=colors.black, scale=1.0, format='%ibp'): x1 = xmap(start) x2 = xmap(end) line = Line(x1+dx,y,x2-dx,y, strokeWidth=strokeWidth, strokeColor=strokeColor) drawing.add(line) leftTick = Line(x1+dx,y-0.5*tickLen,x1+dx,y+0.5*tickLen, strokeWidth=strokeWidth, strokeColor=strokeColor) drawing.add(leftTick) rightTick = Line(x2-dx,y-0.5*tickLen,x2-dx,y+0.5*tickLen, strokeWidth=strokeWidth, strokeColor=strokeColor) drawing.add(rightTick) label = Label() label.setOrigin(0.5*(x1+x2), y+dy) distance = float(end-start)/scale label.setText(format % (distance/scale)) label.fontSize = fontSize label.textAnchor = textAnchor label.boxAnchor = boxAnchor drawing.add(label)
def draw(self): # general widget bits w = float(self.length) h = float(self.height) g = shapes.Group() body = shapes.Polygon( [self.x-0.5*w, self.y-0.5*w, self.x-0.5*w, self.y+0.5*w, self.x+0.5*w, self.y], fillColor=self.fillColor, strokeColor=self.strokeColor, strokeWidth=self.strokeWidth) g.add(body) if self.label: b = g.getBounds() s = Label() s.setText(self.label) s.setOrigin(self.x+0.5*w, self.y-h/2+b[3]-b[1]+4) s.boxAnchor = self.boxAnchor s.textAnchor = self.textAnchor s.fontName = 'Helvetica' s.fontSize = self.fontSize s.angle = self.labelAngle g.add(s) return g
def addChromosomes(drawing, chrNames, chrSizes, xmap, ymap, w=0.1*DPI, fillColor=colors.skyblue, strokeColor=colors.skyblue): for i,chrom in enumerate(chrNames): x = xmap(i+1) y = ymap(chrSizes[chrom]) h = ymap(1)-ymap(chrSizes[chrom]) chromosome = Rect(x,y,w,h, strokeColor=strokeColor, fillColor=fillColor) drawing.add(chromosome) topCap = Wedge(x+0.5*w, y+h, 0.5*w, 0, 180, strokeColor=strokeColor, fillColor=fillColor) bottomCap = Wedge(x+0.5*w, y, 0.5*w, 180, 0, strokeColor=strokeColor, fillColor=fillColor) drawing.add(topCap) drawing.add(bottomCap) label = Label() label.setOrigin(xmap(i+1)+w/2, ymap(0)) label.boxAnchor = 's' label.textAnchor = 'middle' label.dx = 0 label.dy = DPI/10 label.setText(chrom) label.fontSize = 36 label.fontName = 'Helvetica' drawing.add(label) chrLength = Label() chrLength.setOrigin(xmap(i+1)+w/2, ymap(chrSizes[chrom])) chrLength.boxAnchor = 'n' chrLength.textAnchor = 'middle' chrLength.dx = 0 chrLength.dy = -DPI/10 chrLength.setText('%iMb' % int(chrSizes[chrom]/1e6)) chrLength.fontSize = 24 chrLength.fontName = 'Helvetica' drawing.add(chrLength)
def graphout_stackedBar(data, labels, X, Y): drawing = Drawing(X*inch, Y*inch) bar = VerticalBarChart() bar.x = 50 bar.y = 50 bar.width = (X-2)*inch bar.height = (Y-1)*inch bar.data = data bar.bars.strokeWidth = 0 bar.categoryAxis.style='stacked' bar.categoryAxis.labels.boxAnchor = 'ne' bar.categoryAxis.labels.dx = -2 bar.categoryAxis.labels.dy = -2 bar.categoryAxis.labels.angle = 45 bar.categoryAxis.categoryNames = labels # ensure bar chart and legend coloring matches for i in range(len(data)): bar.bars[i].fillColor = colorList[i] # Create a title for the y-axis yLabel = Label() yLabel.setOrigin(0, 50) # for reference, the graph origin is (50, 50) yLabel.boxAnchor = 'c' yLabel.angle = 90 yLabel.setText('Data Storage [GB]') yLabel.fontSize=16 yLabel.dy = 1.25*inch drawing.add(yLabel) drawing.add(bar) return drawing
def getHumPlot(): drawing = Drawing(400, 200) humedad = [getHumedad()] lp = LinePlot() lp.x = 50 lp.y = 50 lp.height = 125 lp.width = 300 lp.data = humedad ydlabel = Label() ydlabel.setText("Humedad (%)") ydlabel.angle = 90 ydlabel.setOrigin(20, 120) lp.joinedLines = 2 lp.lines[0].symbol = makeMarker('Circle') lp.lines[0].strokeColor = colors.blue lp.xValueAxis.valueMin = 0 lp.xValueAxis.valueMax = 30 lp.yValueAxis.valueMin = 0 lp.yValueAxis.valueMax = 100 #lp.xValueAxis.visible=False #lp.yValueAxis.visible=False #Hide 2nd plot its Yaxis drawing.add(lp) drawing.add(ydlabel) drawing.add(String(130, 200, "Gráfico de humedad", fontSize=16)) return drawing
def getTalkRect(self, startTime, duration, trackId, text): "Return shapes for a specific talk" g = Group() y_bottom = self.scaleTime(startTime + duration) y_top = self.scaleTime(startTime) y_height = y_top - y_bottom if trackId is None: #spans all columns x = self._colLeftEdges[1] width = self.width - self._colWidths[0] else: #trackId is 1-based and these arrays have the margin info in column #zero, so no need to add 1 x = self._colLeftEdges[trackId] width = self._colWidths[trackId] lab = Label() lab.setText(text) lab.setOrigin(x + 0.5 * width, y_bottom + 0.5 * y_height) lab.boxAnchor = 'c' lab.width = width lab.height = y_height lab.fontSize = 6 r = Rect(x, y_bottom, width, y_height, fillColor=colors.cyan) g.add(r) g.add(lab) #now for a label # would expect to color-code and add text return g
def draw_travels(self): for p in self.world.packets: if self.detailed: txt = p.command() else: txt = "(%d) %s" % (p.number, p.description) last_action = (0,0) for ts in p.trip: action = self.packet_actions[ts.action] if ts.actor not in self.verticals: self.verticals[ts.actor] = self.verticals[ts.actor.node] x2,y2 = self.verticals[ts.actor], -ts.time*self.yzoom if action.sprite: self.sequence_diagram.add(shapes.Circle(x2, y2, action.size, fillColor=action.color, strokeWidth=1 )) if action.travel: if action.travel_desc: # self.sequence_diagram.add(shapes.String((last_action[0] + x)/2,(last_action[1]+y)/2, label, fill=colors.black, textAnchor = 'middle')) x1, y1 = last_action[0], last_action[1] l = Label() l.setText(txt) l.angle = atan2((y2-y1)/2, (x2-x1))*360.0/pi l.dy = 10 l.setOrigin((x1 + x2)/2,(y1+y2)/2) self.sequence_diagram.add(l) #anchor = Paragraph('<a name="diagram%d"/>' %p.number, styles['Normal']) self.sequence_diagram.add(shapes.Line(last_action[0],last_action[1],x2,y2, strokeColor=colors.black, strokeWidth=1)) self.max_y = min(y2, self.max_y, last_action[1]) last_action = (x2,y2)
def addChromosomes(drawing, chrNames, chrSizes, xmap, ymap, w=0.1 * DPI, fillColor=colors.skyblue, strokeColor=colors.skyblue): for i, chrom in enumerate(chrNames): x = xmap(i + 1) y = ymap(chrSizes[chrom]) h = ymap(1) - ymap(chrSizes[chrom]) chromosome = Rect(x, y, w, h, strokeColor=strokeColor, fillColor=fillColor) drawing.add(chromosome) topCap = Wedge(x + 0.5 * w, y + h, 0.5 * w, 0, 180, strokeColor=strokeColor, fillColor=fillColor) bottomCap = Wedge(x + 0.5 * w, y, 0.5 * w, 180, 0, strokeColor=strokeColor, fillColor=fillColor) drawing.add(topCap) drawing.add(bottomCap) label = Label() label.setOrigin(xmap(i + 1) + w / 2, ymap(0)) label.boxAnchor = 's' label.textAnchor = 'middle' label.dx = 0 label.dy = DPI / 10 label.setText(chrom) label.fontSize = 36 label.fontName = 'Helvetica' drawing.add(label) chrLength = Label() chrLength.setOrigin(xmap(i + 1) + w / 2, ymap(chrSizes[chrom])) chrLength.boxAnchor = 'n' chrLength.textAnchor = 'middle' chrLength.dx = 0 chrLength.dy = -DPI / 10 chrLength.setText('%iMb' % int(chrSizes[chrom] / 1e6)) chrLength.fontSize = 24 chrLength.fontName = 'Helvetica' drawing.add(chrLength)
def write_label(label, width, height, person): text = "\n".join((person['name'], person['addresses'][0])) lab = Label() lab.setOrigin(8, height - 5) lab.fontSize = 14 lab.setText(text) lab.boxAnchor = 'nw' label.add(lab)
def draw(self): # general widget bits w = float(self.length) h = float(self.height) # print self.label,w,h # Set minimum size if abs(w)<self.wmin: xmid = self.x+0.5*w w = w/abs(w) * self.wmin self.x = xmid-0.5*w g = shapes.Group() if abs(w)>self.wNoTail: # arrow specific bits body = shapes.Rect(x=self.x, y=self.y-self.aspectRatio*h/2, width=2*(w/3), height=self.aspectRatio*h, fillColor=self.fillColor, strokeColor=self.strokeColor, strokeWidth=self.strokeWidth) g.add(body) head = shapes.Polygon( points=[self.x+w, self.y, self.x+2*(w/3), self.y+h/2, self.x+2*(w/3), self.y-h/2, self.x+w, self.y], fillColor=self.fillColor, strokeColor=self.strokeColor, strokeWidth=self.strokeWidth) g.add(head) else: head = shapes.Polygon( points=[self.x+w, self.y, self.x, self.y+h/2, self.x, self.y-h/2, self.x+w, self.y], fillColor=self.fillColor, strokeColor=self.strokeColor, strokeWidth=self.strokeWidth) g.add(head) if self.label: b = g.getBounds() s = Label() s.setText(self.label) s.setOrigin(self.x+0.5*w+self.labeldx, self.y-h/2+b[3]-b[1]+self.labeldy) s.boxAnchor = self.boxAnchor s.textAnchor = self.textAnchor s.fontName = 'Helvetica' s.fontSize = self.fontSize s.angle = self.labelAngle g.add(s) return g
def addLabel(drawing, x, y, text, fontName='Helvetica', fontSize=11, dy=0, angle=0, boxAnchor='sw', textAnchor='start'): """Add a label to the drawing. This interface here is inconsistent in that it requires pixel coords. FIX This just sets convenient defaults for Label.""" label = Label() label.setText(text) label.setOrigin(x, y) label.fontName = fontName label.fontSize = fontSize label.boxAnchor = boxAnchor label.textAnchor = textAnchor label.dy = dy label.angle = angle drawing.add(label)
def addPointyCompoundFeature(drawing, xmap, y, gene, strokeColor=None, fillColor=colors.blue, intronColor=colors.blue, glyph=PointyBlock, height=12, utrHeight=6, rise=8, labeldy=10, fontSize=10, textAnchor='middle', boxAnchor='s'): """Adds a pointy compound feature to the drawing. This is typically several exons joined by zig-zag lines with an arrow showing strand.""" if gene.strand=='+': x1,x2 = xmap(gene.start), xmap(gene.end) else: x2,x1 = xmap(gene.start), xmap(gene.end) y = y+height/2 y1 = y line = Line(x1,y1,x2,y1,strokeColor=intronColor) drawing.add(line) for exon in gene: if exon.strand=='+': x1,x2 = xmap(exon.start), xmap(exon.end) else: x2,x1 = xmap(exon.start), xmap(exon.end) g = glyph() g.x = x1 g.y = y if exon.kind.lower()=='utr': g.height = utrHeight else: g.height = height g.length = x2-x1 g.fillColor = fillColor if strokeColor: g.strokeColor = strokeColor else: g.strokeColor = fillColor g.fontSize = fontSize drawing.add(g) label = Label() label.setText(gene.name) x = 0.5*(gene.start+gene.end) label.setOrigin(x,y) label.dy = labeldy label.textAnchor = textAnchor label.boxAnchor = boxAnchor drawing.add(label)
def genLayers2(ls): #ls =(titre, taille) c = ['#ffeea0', '#ff88ff', '#bbd5e8'] length = 4 * cm # ls = np.asarray(ls) l = [] for i in range(len(ls)): l.append((ls[i][0], ls[i][1])) ls = np.asarray(l, dtype=np.str) d = Drawing(4 * cm, 100) xpos = 0 ls[:, 1] = layersize2(ls[:, 1]) tickness = ls[:, 1].astype(np.float32) for i in range(len(ls)): lab = Label() lab.textAnchor = 'middle' color = c[0] labelTxt = str(ls[:, 0][i]) if '+' in labelTxt: color = c[1] elif '-' in labelTxt: color = c[2] lab.setText(ls[:, 0][i]) if i > 0: d.add( Rect(xpos, np.cumsum(tickness)[i - 1], length, tickness[i], fillColor=colors.HexColor(color))) lab.setOrigin(xpos + 2 * cm, np.cumsum(tickness)[i - 1] + tickness[i] / 2) else: d.add( Rect(xpos, 0, length, tickness[i], fillColor=colors.HexColor(color))) lab.setOrigin(xpos + 2 * cm, tickness[i] / 2) d.add(lab) return d
def addAxis(drawing, xmap, y, strokeWidth=1, minorStrokeWidth=0.5, tickDir='down', autoTicks=False, nTicks=20, tickLen=5, fontSize=10, nMinorTicks=80, minorTickLen=2, angle=0, dx=0, dy=-2, textAnchor='middle', boxAnchor=None, scale=1.0, format='%i'): """Add a horizontal axis to the drawing. To do: Round tick positions """ line = Line(xmap.x0, y, xmap.x1, y, strokeWidth=strokeWidth) drawing.add(line) if not boxAnchor: if tickDir=='down': boxAnchor = 'n' else: boxAnchor = 's' signum = {'up': -1, 'down': 1}[tickDir] if nTicks>0: ticks = tick_generator(xmap.start, xmap.end, n=nTicks, convert=int) for p in ticks: x = xmap(p) line = Line(x, y, x, y-signum*tickLen, strokeWidth=strokeWidth) drawing.add(line) s = Label() s.setOrigin(x, y-signum*tickLen) s.setText(format % (p/scale)) s.dx = dx s.dy = signum*dy s.fontName = 'Helvetica' s.fontSize = fontSize s.textAnchor = textAnchor s.boxAnchor = boxAnchor s.angle = angle drawing.add(s) minorticks = tick_generator(xmap.start, xmap.end, n=nMinorTicks, convert=int) for p in minorticks: x = xmap(p) line = Line(x, y, x, y-signum*minorTickLen, strokeWidth=minorStrokeWidth) drawing.add(line)
def simple_label(): drawing = shapes.Drawing(width=400, height=200) drawing.add(shapes.Rect(200, 100, 10, 10, fillColor=colors.red)) x = 50 angle = 0 for item in range(3): label = Label() label.setOrigin(200, 100) label.boxAnchor = 'se' label.angle = angle #label.boxStrokeColor = colors.black label.setText('ReportLab label') drawing.add(label) x += 25 angle += 45 renderPDF.drawToFile(drawing, 'simple_label.pdf')
def border(): draw = Drawing(1, 1) rect = Polygon(points=[ -12, cm / 6, (PAGE_WIDTH - (RIGHT_MARGIN + LEFT_MARGIN)), cm / 6, PAGE_WIDTH - (RIGHT_MARGIN + LEFT_MARGIN), -1 * (PAGE_HEIGHT - (TOP_MARGIN + BOTTOM_MARGIN + cm / 2)), -12, -1 * (PAGE_HEIGHT - (TOP_MARGIN + BOTTOM_MARGIN + cm / 2)) ], strokeColor=Color(*charts.BG_COLOR)) rect.fillColor = Color(*charts.BG_COLOR, 0.1) draw.add(rect) draw.add(Circle(100, 90, 5, fillColor=colors.green)) lab = Label() lab.setOrigin(350, -50) lab.boxAnchor = 'ne' lab.fillColor = Color(*charts.BG_COLOR, 0.15) lab.fontSize = 72 lab.angle = 60 lab.dx = 0 lab.dy = 0 lab.setText('Wisdom Tests') draw.add(lab) return draw
def barras(datos): alto = datos["alto"] ancho = datos["ancho"] data = datos["data"] labels = datos["labels"] colores = datos["colores"] grafico = VerticalBarChart() grafico.x = 30 grafico.y = 0 grafico.height = alto grafico.width = ancho grafico.data = data grafico.barSpacing = 1.25 for i in range(len(colores)): color = colors.HexColor(colores[i]) grafico.bars[i].strokeColor = color grafico.bars[i].fillColor = color grafico.valueAxis.labels.fontName = "Helvetica" grafico.valueAxis.labels.fontSize = FONTSIZE grafico.valueAxis.valueMin = 0 grafico.valueAxis.valueMax = 100 grafico.valueAxis.valueStep = 10 grafico.categoryAxis.categoryNames = labels grafico.categoryAxis.labels.fontName = "Helvetica" grafico.categoryAxis.labels.fontSize = FONTSIZE grafico.categoryAxis.labels.dy = -FONTSIZE grafico.categoryAxis.labels.boxAnchor = 'c' grafico.categoryAxis.labels.angle = 0 retorno = crearDrawing(grafico) etiqueta = Label() etiqueta.setOrigin(0, alto) etiqueta.fontSize = FONTSIZE etiqueta.fontName = "Helvetica" etiqueta.setText("(%)") retorno.add(etiqueta) return retorno
def addAxis(drawing, xmap, y, fontSize=8, tickLen=4, minorTickLen=2, nTicks=20, strokeWidth=1, minorStrokeWidth=0.5): line = Line(xmap.x0, y, xmap.x1, y, strokeWidth=strokeWidth) drawing.add(line) ticks = tick_generator(xmap.start, xmap.end, n=nTicks, convert=int) for p in ticks: x = xmap(p) line = Line(x, y, x, y-tickLen, strokeWidth=strokeWidth) drawing.add(line) s = Label() s.setOrigin(x, y-tickLen) s.setText(str(p)) s.fontName = 'Helvetica' s.fontSize = fontSize s.textAnchor = 'middle' s.boxAnchor = 'n' drawing.add(s) minorticks = tick_generator(xmap.start, xmap.end, n=50, convert=int) for p in minorticks: x = xmap(p) line = Line(x, y, x, y-minorTickLen, strokeWidth=minorStrokeWidth) drawing.add(line)
def genLayers(l0=["substrate", 30], l1=["p++", 20], l2=["p--", 50]): c = ['#ffeea0', '#ff88ff', '#bbd5e8'] length = 4 * cm d = Drawing(4 * cm, 100) xpos = 0 #*(width-length-4*cm)/2 # layer0 = 40 # l1[1] = 40 # l2[1]= 100-layer0-l1[1] l0[1], l1[1], l2[1] = layersize(l0[1], l1[1], l2[1]) d.add(Rect(xpos, 0, length, l0[1], fillColor=colors.HexColor(c[0]))) lab = Label() lab.textAnchor = 'middle' lab.setText(l0[0]) lab.setOrigin(xpos + 2 * cm, l0[1] / 2) d.add(lab) d.add(Rect(xpos, l0[1], length, l1[1], fillColor=colors.HexColor(c[1]))) lab = Label() lab.textAnchor = 'middle' lab.setText(l1[0]) lab.setOrigin(xpos + 2 * cm, l0[1] + l1[1] / 2) d.add(lab) d.add( Rect(xpos, l0[1] + l1[1], length, l2[1], fillColor=colors.HexColor(c[2]))) lab = Label() lab.textAnchor = 'middle' lab.setText(l2[0]) lab.setOrigin(xpos + 2 * cm, l0[1] + l1[1] + l2[1] / 2) d.add(lab) return d
lab.setText('Some\nMulti-Line\nLabel') d.add(lab) """) from reportlab.graphics import shapes from reportlab.graphics.charts.textlabels import Label d = Drawing(200, 100) # mark the origin of the label d.add(Circle(100,90, 5, fillColor=colors.green)) lab = Label() lab.setOrigin(100,90) lab.boxAnchor = 'ne' lab.angle = 45 lab.dx = 0 lab.dy = -20 lab.boxStrokeColor = colors.green lab.setText('Some\nMulti-Line\nLabel') d.add(lab) draw(d, 'Label example') disc(""" In the drawing above, the label is defined relative to the green blob.
print lp.data lp.joinedLines = 1 lp.lines.symbol = makeMarker('Circle') lp.lineLabelFormat = '%2.2f' lp.strokeColor = colors.black lp.xValueAxis.valueMin = 0 lp.xValueAxis.valueMax = 2100 lp.xValueAxis.labelTextFormat = '%2.0f' lp.yValueAxis.valueMin = 0 lp.yValueAxis.valueMax = 100 lp.yValueAxis.valueStep = 10 xlbl = Label() xlbl.setText("No. of Genes") xlbl.setOrigin(310, 72) ylbl = Label() ylbl.setText("Percentage\n (%)") ylbl.setOrigin(28, 260) lp.lines[0].strokeColor = colors.darkgreen lp.lineLabels[0].strokeColor = colors.darkgreen lp.lines[1].strokeColor = colors.tomato lp.lineLabels[1].strokeColor = colors.tomato lp.lines[2].strokeColor = colors.aquamarine lp.lineLabels[2].strokeColor = colors.aquamarine lp.lines[3].strokeColor = colors.purple lp.lineLabels[3].strokeColor = colors.purple lgnd = Legend()
class BaseHorizontalBarChart(object): pdfmetrics.registerFont(TTFont('simsun', 'simsun.ttc')) def __init__( self, width=A4[0], height=A4[1] * 0.25, leftMargin=inch, rightMargin=inch, axis_font_size=10, axis_font_name='simsun', ): self.axis_font_name = axis_font_name self.axis_font_size = axis_font_size self.width = width self.height = height self.chart_width = self.width - leftMargin - rightMargin self.chart_height = self.height self.chart = HorizontalBarChart() self.chart.x = 0 self.chart.y = 0 self.chart.width = self.chart_width self.chart.height = self.chart_height self.chart.bars.strokeColor = None # 设置柱状图的柱子颜色 self.chart.bars[0].fillColor = deepskyblue # 设置在柱状图后增加该坐标的值 self.chart.barLabelFormat = '%0.2f' self.chart.barLabels.boxAnchor = 'w' # 锚点,用不好.. self.chart.barLabels.dx = 0.1 * cm # 柱状图的值向右偏移0.1CM # 设置柱状图的柱宽 self.chart.barWidth = height * 0.05 self.title = Label() self.x_unit = Label() self.y_unit = Label() self.title.setText('') self.x_unit.setText('') self.y_unit.setText('') self.x_unit.fontName = self.axis_font_name self.y_unit.fontName = self.axis_font_name def add_title(self, title='', title_font_size=18, title_font_name='simsun'): if title: self.title.setText(title) self.title.setOrigin(0, 0) self.title.dx = 0.5 * self.chart_width self.title.dy = self.chart.height + title_font_size self.title.fontName = title_font_name self.title.fontSize = title_font_size else: self.title.fontSize = 0 def add_category_axis(self, category_names=None, axis_unit=None): # 设置纵坐标轴 self.chart.categoryAxis.labels.fontName = self.axis_font_name self.chart.categoryAxis.labels.fontSize = self.axis_font_size self.chart.categoryAxis.categoryNames = category_names if category_names: self.chart.height = len(category_names) * self.axis_font_size * 2 self.chart_height = self.chart.height # print(self.chart_height) self.height = self.chart.height + getattr(self.title, 'fontSize') if axis_unit: # 纵坐标轴单位 self.y_unit.setText(axis_unit) self.y_unit.setOrigin(0, 0) self.y_unit.dy = self.chart.height + self.axis_font_size self.y_unit.dx = -1 * self.axis_font_size * math.floor( len(axis_unit) / 2) def add_values(self, values, axis_unit=None): min_value = 0 max_value = max(values) if max_value >= 50: step = 10 else: step = 5 # 设置横坐标轴 self.chart.valueAxis.labels.fontName = self.axis_font_name self.chart.valueAxis.labels.fontSize = self.axis_font_size self.chart.valueAxis.valueMin = min_value self.chart.valueAxis.valueMax = min( divmod(max_value, step)[0] * step + step, 100) self.chart.valueAxis.valueStep = step if values: self.chart.data = [values] else: self.data = [ 0 for _ in range(len(self.chart.categoryAxis.categoryNames)) ] # self.chart.data = values if axis_unit: self.x_unit.setText(axis_unit) self.x_unit.setOrigin(0, 0) if len(axis_unit) == 1: self.x_unit.dx = self.chart_width + self.axis_font_size else: self.x_unit.dx = self.chart_width + self.axis_font_size * math.floor( len(axis_unit) / 2) def show(self): ret = list() print(self.width, self.height) print(self.chart_width, self.chart_height) print(self.chart.width, self.chart.height) draw = Drawing(self.width, self.height) draw.add(self.title) draw.add(self.chart) draw.add(self.x_unit) draw.add(self.y_unit) spacer = Spacer( self.chart_width, getattr(self.title, 'fontSize') * 2 + self.axis_font_size) ret.append(spacer) ret.append(draw) # Spacer(chart_width, title_font_size * 2 + axis_font_size), d) return self.ret
def addCompoundFeature(drawing, xmap, y, gene, strokeColor=None, fillColor=colors.blue, intronColor=colors.blue, intronWidth=0.5, glyph=Block, height=12, utrHeight=6, labeldy=10, fontSize=10, textAnchor='middle', boxAnchor='s'): """Adds a compund feature to the drawing. A compound feature is typically several exons joined by zig-zag lines.""" rise = height + utrHeight intronStarts = [None] intronEnds = [] heights = [] for exon in gene: x1,x2 = xmap(exon.start), xmap(exon.end) kind = exon.kind.lower() if kind in ['exon', 'utr']: intronStarts.append(exon.end) intronEnds.append(exon.start) g = glyph() g.x = x1 g.y = y+height/2 if exon.kind.lower()=='exon': g.height = height heights.append(height) else: g.height = utrHeight heights.append(utrHeight) g.length = x2-x1 g.fillColor = fillColor if strokeColor: g.strokeColor = strokeColor else: g.strokeColor = fillColor g.fontSize = fontSize drawing.add(g) for i,(intronStart,intronEnd) in enumerate(zip(intronStarts[1:], intronEnds[1:])): x1 = xmap(intronStart) x2 = xmap(0.5*(intronStart+intronEnd)) x3 = xmap(intronEnd) # if abs(x3-x1)<3: continue # print intronStart,intronEnd,heights[i],heights[i+1] y1 = y+heights[i]/2+height/2 y2 = y+rise y3 = y+heights[i+1]/2+height/2 line1 = Line(x1,y1,x2,y2,strokeColor=intronColor,strokeWidth=intronWidth) line2 = Line(x2,y2,x3,y3,strokeColor=intronColor,strokeWidth=intronWidth) drawing.add(line1) drawing.add(line2) # Draw arrows if xmap.flipped: signum = -1 else: signum = 1 if gene.strand=='+': x1 = xmap(gene.end) x2 = x1 + signum*15 x3 = x1 + signum*10 y1 = y + 0.5*height y2 = y + 0.75*height y3 = y + 0.25*height line1 = Line(x1,y1,x2,y1,strokeColor=intronColor,strokeWidth=intronWidth) line2 = Line(x2,y1,x3,y2,strokeColor=intronColor,strokeWidth=intronWidth) line3 = Line(x2,y1,x3,y3,strokeColor=intronColor,strokeWidth=intronWidth) drawing.add(line1) drawing.add(line2) drawing.add(line3) else: x1 = xmap(gene.start) x2 = x1 - signum*15 x3 = x1 - signum*10 y1 = y + 0.5*height y2 = y + 0.75*height y3 = y + 0.25*height line1 = Line(x1,y1,x2,y1,strokeColor=intronColor,strokeWidth=intronWidth) line2 = Line(x2,y1,x3,y2,strokeColor=intronColor,strokeWidth=intronWidth) line3 = Line(x2,y1,x3,y3,strokeColor=intronColor,strokeWidth=intronWidth) drawing.add(line1) drawing.add(line2) drawing.add(line3) # if gene has attribute name... label = Label() label.setText(gene.name) pos = 0.5*(gene.start+gene.end) x = xmap(pos) label.setOrigin(x,y) label.dy = labeldy label.textAnchor = textAnchor label.boxAnchor = boxAnchor drawing.add(label)
class BasePie(object): pdfmetrics.registerFont(TTFont('simsun', 'simsun.ttc')) def __init__(self, width=A4[0], height=A4[0] / 2, left_margin=0, right_margin=0, top_margin=0, bottom_margin=0, label_font_size=10, label_font_name='simsun'): self.label_font_size = label_font_size self.label_font_name = label_font_name self.width = width self.height = height # self.chart_width = self.width # self.chart_height = self.height self.chart_width = self.chart_height = min( self.width - left_margin - right_margin, self.height - top_margin - bottom_margin) self.chart = Pie() # self.chart.x = 0 # self.chart.y = 0 self.chart.x = (self.width - self.chart_width) / 2 self.chart.y = (self.height - self.chart_height) / 2 self.chart.width = self.chart_width self.chart.height = self.chart_height self.title = Label() def add_values(self, values): self.chart.data = values def add_labels(self, labels, unit=None): self.chart.labels = labels def add_title(self, title='', title_font_name='simsun', title_font_size=18): if title: self.title.setText(title) self.title.setOrigin(0, 0) self.title.dx = self.width / 2 # self.title.dy = self.height - (self.height - self.chart_height)/2 self.title.dy = self.height + title_font_size * 2 self.title.fontName = title_font_name self.title.fontSize = title_font_size else: self.title.fontSize = 0 def show(self): ret = list() draw = Drawing(self.width, self.height) draw.add(self.title) draw.add(self.chart) # spacer = Spacer(self.chart_width, getattr(self.title, 'fontSize') * 2 + self.label_font_size) spacer = Spacer(self.chart_width, getattr(self.title, 'fontSize') * 4) ret.append(spacer) ret.append(draw) return ret
print lp.data lp.joinedLines = 1 lp.lines.symbol = makeMarker('Circle') lp.lineLabelFormat = '%2.2f' lp.strokeColor = colors.black lp.xValueAxis.valueMin = 0 lp.xValueAxis.valueMax = 5 lp.xValueAxis.labelTextFormat = '%2.0f' lp.yValueAxis.valueMin = 0 lp.yValueAxis.valueMax = 104 lp.yValueAxis.valueStep = 10 xlbl = Label() xlbl.setText("No. of Clusters") xlbl.setOrigin(310, 53) xlbl1 = Label() xlbl1.setText("No. Of Clusters Vs Accuracy") xlbl1.setOrigin(310, 25) ylbl = Label() ylbl.setText("Accuracy\n (%)") ylbl.setOrigin(28, 260) lp.lines[0].strokeColor = colors.purple lp.lineLabels[0].strokeColor = colors.purple d.add(lp) d.add(xlbl) d.add(xlbl1)
def makeSummary(self, stype): logger.debug('StartQT4::makeSummary(%s)' % stype) pinfo = self.imageViews[-1].getSummaryDemographics() if pinfo is None: return reportname = self.imageViews[-1].getReportName() + '.pdf' filename = QtGui.QFileDialog.getSaveFileName( self, directory=reportname, filter='PDF Files *.pdf(*.pdf);;All Files *(*)') #filename = QtGui.QFileDialog.getSaveFileName(self, filter='PDF Files *.pdf(*.pdf);;All Files *(*)') if len(filename) == 0: return doc = SimpleDocTemplate(str(filename), pagesize=A4, rightMargin=1.5 * cm, leftMargin=2 * cm, topMargin=2 * cm, bottomMargin=3 * cm) elements = [] #data = pinfo.items() for iv in self.imageViews: vt = iv.getVelocityText() if stype == 'BOTH' or stype == iv.getViewShortName(): pinfo.append(vt) t = Table(pinfo, rowHeights=12) t.setStyle( TableStyle([('BACKGROUND', (1, 1), (-2, -2), colors.green), ('TEXTCOLOR', (0, 0), (1, -1), colors.black), ('ALIGNMENT', (0, 0), (0, -1), 'RIGHT')])) elements.append(t) for iv in self.imageViews: if stype == 'BOTH' or stype == iv.getViewShortName(): drawing = Drawing(400, 280) cd = iv.getDataPointer() vt = iv.getVelocityText() pinfo.append(vt) #ydata = cd.getCOMYScaled(False, 'mm').tolist() ydata = cd.getCOMYScaled(True, 'mm').tolist() xPlaneFit = cd.getYPlaneFit(units='mm', bothAxes=True).tolist() vdata = cd.getVelocitySlopeScaled(units='mm', bothAxes=True) gdata = [ydata, xPlaneFit] if vdata is not None: gdata.append(vdata.tolist()) title = Label() title.setOrigin(150, 240) title.setText(iv.getViewName()) ylabel = Label() ylabel.setOrigin(0, 100) ylabel.angle = 90 ylabel.setText("Millimeters") xlabel = Label() xlabel.setOrigin(70, 0) xlabel.setText("Seconds") lp = LinePlot() lp.height = 230 lp.width = 400 lp.data = gdata lp.lines[0].strokeColor = colors.blue lp.lines[1].strokeColor = colors.red lp.lines[2].strokeColor = colors.green #lp.xValueAxis.xLabel = "Seconds" drawing.add(title) drawing.add(ylabel) drawing.add(xlabel) drawing.add(lp) elements.append(drawing) doc.build(elements, onFirstPage=self.pdfHeaderFooter, onLaterPages=self.pdfHeaderFooter)
def results_chart(self, control_mean, match_mean, treated_mean, att): """ Specify layout of the results chart and generate flowable object that can be added to the pdf """ drawing = Drawing() vbc = VerticalBarChart() # Offset chart from border and text vbc.x = self.chart_offset_x vbc.y = self.chart_offset_y # Set figure size vbc.height = self.chart_height vbc.width = self.chart_width # Specify chart -- list of lists -- list of series with enteries vbc.data = [[control_mean, match_mean, treated_mean, att]] #Set Y-Axis ranges #axis_range = self._calculate_y_axis(vbc.data) #vbc.valueAxis.valueMin = axis_range['min'] #vbc.valueAxis.valueMax = axis_range['max'] #vbc.valueAxis.valueStep = axis_range['step'] #Grid formatting vbc.valueAxis.visibleGrid = 1 vbc.valueAxis.gridStrokeColor = colors.lightgrey # Set bar characteristics vbc.bars[(0, 0)].fillColor = colors.blue vbc.bars[(0, 1)].fillColor = colors.yellow vbc.bars[(0, 2)].fillColor = colors.red vbc.bars[(0, 3)].fillColor = colors.green vbc.bars.strokeColor = None vbc.barSpacing = 2 # Create callout labels #vbc.barLabels.fontName = "Helvetica" vbc.barLabels.fontSize = 8 vbc.barLabels.fillColor = colors.black vbc.barLabelFormat = '%.2f' vbc.barLabels.nudge = 5 # X-axis labels #vbc.categoryAxis.labels.dy = -60 #vbc.valueAxis.labels.fontName = 'Helvetica' vbc.categoryAxis.categoryNames = [ 'Control Mean', 'Matched Control Mean', 'Treatment mean', 'ATT' ] lab = Label() lab.setOrigin(10, 155) lab.boxAnchor = 'ne' lab.angle = 90 lab.dx = 0 lab.dy = -15 #lab.boxStrokeColor = colors.green lab.setText('Result Values') drawing.add(lab) drawing.add(vbc) self.elements.append(drawing)
def get_pdf_results(task_id): # Flask response response = Response() response.status_code = 200 task = data.get_task_result(task_id) #Saving file to a in-memory file output_file = StringIO.StringIO() def header_footer(canvas, doc): canvas.saveState() background = 'static/img/pdf_bg.png' canvas.drawImage(background, 1 * inch, 5.75 * inch, width=8 * inch, height=6 * inch, mask='auto') # Header logo = Image('static/img/logo/logo.png') logo.drawHeight = 0.5 * inch logo.drawWidth = 1.75 * inch date = datetime.now().strftime("%y-%m-%d %H:%M") headerData = [[logo, '', date]] headerTable = Table(headerData, colWidths=[2 * inch, 3.58 * inch, 1.2 * inch], style=[('LINEBELOW', (0, 0), (2, 0), 1, colors.HexColor(0xcccccc)), ('TEXTCOLOR', (0, 0), (2, 0), colors.HexColor(0x807F83)), ('VALIGN', (1, 0), (1, 0), 'MIDDLE'), ('VALIGN', (2, 0), (2, 0), 'MIDDLE')]) headerTable.wrapOn(canvas, doc.width, doc.topMargin) headerTable.drawOn(canvas, doc.leftMargin, doc.height + doc.topMargin) pageNum = "Page %d" % doc.page footerData = [[ 'KAPSARC Building Energy Assessment Tool (BEAT)', pageNum ]] footerTable = Table(footerData, colWidths=[5.76 * inch, 1 * inch], style=[('LINEABOVE', (0, 0), (1, 0), 2, colors.HexColor(0xcccccc)), ('TEXTCOLOR', (0, 0), (1, 0), colors.HexColor(0x807F83)), ('ALIGN', (1, 0), (1, 0), 'RIGHT')]) footerTable.wrapOn(canvas, doc.width, doc.bottomMargin) footerTable.drawOn(canvas, doc.leftMargin, 0.5 * inch) canvas.restoreState() pdfmetrics.registerFont(TTFont('Vera', 'Vera.ttf')) pdfmetrics.registerFont(TTFont('VeraBd', 'VeraBd.ttf')) pdfmetrics.registerFont(TTFont('VeraIt', 'VeraIt.ttf')) pdfmetrics.registerFont(TTFont('VeraBI', 'VeraBI.ttf')) styles = getSampleStyleSheet() # Title styles.add( ParagraphStyle(name='styleTitle', alignment=TA_CENTER, fontSize=16, fontName='Vera', textColor=colors.HexColor(0x61a659), leading=30, spaceBefore=35, spaceAfter=10)) # Headings styles.add( ParagraphStyle(name='styleHeading', parent=styles['Heading2'], fontSize=14, textColor=colors.HexColor(0x807F83), leading=20, spaceBefore=10, underlineProportion=1.1, spaceAfter=10)) styles.add( ParagraphStyle(name='styleHeading2', parent=styles['Heading2'], fontSize=14, textColor=colors.HexColor(0x61a659), leading=20, spaceBefore=20, underlineProportion=1.1, spaceAfter=20)) styles.add( ParagraphStyle( name='styleHeading3', #alignment= TA_CENTER, fontSize=12, fontName='Vera', textColor=colors.HexColor(0x61a659), leading=20, spaceBefore=10, spaceAfter=5)) # Body text styles.add( ParagraphStyle(name='styleBodyText', parent=styles['Normal'], fontSize=9, textColor=colors.HexColor(0x666666), spaceBefore=5, spaceAfter=15)) styleTitle = styles['styleTitle'] styleHeading = styles['styleHeading'] styleHeading2 = styles['styleHeading2'] styleHeading3 = styles['styleHeading3'] styleBodyText = styles['styleBodyText'] pdf_chart_colors = [ "#3D6531", "#61a24f", "#89B97B", "#B0D1A7", "#cde5c7", "#7e7f82", "#9E9FA1", "#BFBFC1", "#DFDFE0", "#ffd200", "#FFE360", "#FFEE9F", ] Elements = [] doc = BaseDocTemplate(output_file, showBoundary=0, pagesize=A4, title='KASPSARC BEAT Report', author="KAPSARC", leftMargin=0.75 * inch, rightMargin=0.75 * inch, topMargin=inch, bottomMargin=inch) frame = Frame(doc.leftMargin, doc.topMargin, doc.width, doc.height, topPadding=0.3 * inch, showBoundary=0) template = PageTemplate(id='template', frames=[frame], onPage=header_footer) doc.addPageTemplates([template]) ## PAGE 1 #add some flowables Elements.append( Paragraph("KAPSARC Building Energy Assessment Tool (BEAT)", styleTitle)) Elements.append(Paragraph("Your Building Description", styleHeading)) rowHeights = 0.3 * inch calibrationData = task['calibrationData'] Elements.append(Paragraph("General Information:", styleHeading3)) infoTableData = [ [ Paragraph('<b>- Name: </b>' + calibrationData['txtBldgName'], styleBodyText), Paragraph('<b>- Address: </b>' + calibrationData['txtBldgAddress'], styleBodyText), Paragraph('<b>- Type: </b>' + calibrationData['cmbBldgType'], styleBodyText) ], [ Paragraph( '<b>- Location: </b>' + calibrationData['cmbBldgLocation'], styleBodyText), Paragraph('<b>- Shape: </b>' + calibrationData['cmbBldgShape'], styleBodyText), Paragraph( '<b>- Floor Area (m' + u"\u00b2" + '): </b>' + str(calibrationData['txtFloorArea']), styleBodyText) ] ] infoTable = Table(infoTableData, colWidths=[160, 165, 150], rowHeights=rowHeights) Elements.append(infoTable) Elements.append(Paragraph('<br />', styleBodyText)) Elements.append(Paragraph("Envelope Construction Details:", styleHeading3)) envTableData = [ [ Paragraph( '<b>- South Wall: </b>' + calibrationData['cmbSouthWall'], styleBodyText), Paragraph('<b>- West Wall: </b>' + calibrationData['cmbWestWall'], styleBodyText) ], [ Paragraph( '<b>- North Wall: </b>' + calibrationData['cmbNorthWall'], styleBodyText), Paragraph('<b>- East Wall: </b>' + calibrationData['cmbEastWall'], styleBodyText) ], [ Paragraph('<b>- Roof: </b>' + calibrationData['cmbRoof'], styleBodyText), Paragraph( '<b>- Floor: </b>' + calibrationData['cmbFirstFloorContact'], styleBodyText) ], [ Paragraph('<b>- Windows Type: </b>' + calibrationData['glasstype'], styleBodyText), Paragraph( '<b>- Overhang Depth (m): </b>' + str(calibrationData['txtWinSouthOverhang']), styleBodyText) ] ] envTable = Table(envTableData, colWidths=[240, 235], rowHeights=rowHeights) Elements.append(envTable) Elements.append(Paragraph('<br />', styleBodyText)) Elements.append(Paragraph("Air Conditioning Systems", styleHeading3)) hvacTableData = [[ Paragraph( '<b>- HVAC System Type: </b>' + calibrationData['cmbBldgSystem'], styleBodyText), Paragraph( '<b>- Cooling Temperature Setting (' + u"\u00b0" + 'C): </b>' + str(calibrationData['txtCoolSetTemp']), styleBodyText) ], [ Paragraph( '<b>- Energy Efficiency Ratio (EER): </b>' + str(calibrationData['eir']), styleBodyText), Paragraph( '<b>- Heating Temperature Setting (' + u"\u00b0" + 'C): </b>' + str(calibrationData['txtHeatSetTemp']), styleBodyText) ]] hvacTable = Table(hvacTableData, colWidths=[240, 235], rowHeights=rowHeights) Elements.append(hvacTable) Elements.append(Paragraph('<br />', styleBodyText)) Elements.append(Paragraph("Overall Assessment", styleHeading)) Elements.append( Paragraph( "Based on your description and current SASO requirements, the tool provides the following assessments:", styleBodyText)) if task['compliant']: compliant = "<strong><font color=green>meets</font></strong>" else: compliant = "<strong><font color=red>does not meet</font></strong>" if (task['ngEnergyDiff'] < 0): energyDiff = "<strong><font color=green>" + str( task['energyDiff']) + " kWh/year, less</font></strong>" else: energyDiff = "<strong><font color=red>" + str( task['energyDiff']) + " kWh/year, more</font></strong>" Elements.append( Paragraph( "- Your building " + compliant + " SASO requirements for all building envelope", styleBodyText)) Elements.append( Paragraph( "- Your building consumed " + energyDiff + " than the SASO Baseline", styleBodyText)) if task['compliant']: Elements.append( Paragraph( "- You may reduce even more your energy consumption in your building by using LED lamps and high efficient appliances and air conditioning system", styleBodyText)) else: Elements.append( Paragraph( " - You need to add more insulation to the walls and/or roof, or use more efficient window glazing to comply with SASO requirements", styleBodyText)) if not task['compliant'] and (task['ngEnergyDiff'] >= 0): Elements.append( Paragraph( " - You may also consider using LED lamps and energy efficient appliances and air conditioning system", styleBodyText)) Elements.append(PageBreak()) Elements.append( Paragraph("How electricity is used in your building?", styleHeading3)) Elements.append( Paragraph( "Your building needs electricity to operate several types of equipment including: air-conditioning, lighting, appliances and domestic hot water.", styleBodyText)) #add image Elements.append( Image('static/img/results-intro.png', width=4 * inch, height=1.2 * inch)) #add text Elements.append( Paragraph( "Based on the description you provided as well as typical lighting and appliances used in households, here how your building consumes electricity on annual basis:", styleBodyText)) bepuPieData = task['bepuPieData'] bepuTableData = [[0 for i in xrange(len(bepuPieData[0]))] for i in xrange(len(bepuPieData) + 1)] bepuChartLabel = [0 for i in xrange(len(bepuPieData))] bepuChartData = [0 for i in xrange(len(bepuPieData))] bepuTableData[0][0] = 'End-Use' bepuTableData[0][1] = 'Annual Electricity Use' for i, result in enumerate(bepuPieData): # write body cells bepuTableData[i + 1][0] = str(result['label']) bepuTableData[i + 1][1] = int(result['value']) bepuChartLabel[i] = str(result['label']) bepuChartData[i] = result['value'] #add chart bepuChart = Drawing(400, 200) pc = Pie() pc.data = bepuChartData labelc = [0 for i in xrange(len(bepuChartData))] for i, r in enumerate(bepuChartData): labelc[i] = str(round(r / sum(bepuChartData) * 100, 1)) + "%" pc.labels = labelc pc._seriesCount = len(bepuChartLabel) pc.slices.strokeColor = colors.HexColor(0xffffff) pc.slices.strokeWidth = 0.5 bepu_chart_colors = ['#FFC43E', '#A4A4A4', '#F67A40', '#5894D0', '#98cd99'] for i, r in enumerate(bepuChartLabel): pc.slices[i].fillColor = colors.HexColor(bepu_chart_colors[i]) pc.width = pc.height = 120 pc.x = 40 pc.y = 30 # add_legend(d, pc) legend = Legend() legend.alignment = 'right' legend.x = pc.width + pc.x + 80 legend.y = pc.height - 10 legend.dx = 8 legend.dy = 8 legend.fontName = 'Helvetica' legend.fillColor = colors.HexColor(0x807F83) legend.fontSize = 10 legend.boxAnchor = 'nw' legend.columnMaximum = 8 legend.strokeWidth = 0.5 legend.strokeColor = colors.HexColor(0xffffff) legend.deltax = 75 legend.deltay = 10 legend.autoXPadding = 10 legend.yGap = 0 legend.dxTextSpace = 5 legend.dividerLines = 1 | 2 | 4 legend.dividerOffsY = 6 legend.subCols.rpad = 70 legend.dividerColor = colors.HexColor(0xdedede) legend.colorNamePairs = [(pc.slices[i].fillColor, (bepuChartLabel[i][0:20], ' %s ' % "{:,}".format(int(pc.data[i])))) for i in xrange(len(pc.data))] legendHeader = Legend() legendHeader.colorNamePairs = [ ('', ('End-Use', 'Annual Electricity Use\n(kWh/year)')) ] legendHeader.alignment = 'right' legendHeader.x = legend.x - 20 legendHeader.y = legend.y + 30 legendHeader.fontName = 'Helvetica' legendHeader.fillColor = colors.HexColor(0x807F83) legendHeader.fontSize = 10 legendHeader.boxAnchor = 'nw' legendHeader.subCols.rpad = 80 legendFooter = Legend() legendFooter.colorNamePairs = [ ('', ('Total', str("{:,}".format(int(sum(bepuChartData)))) + '')) ] legendFooter.alignment = 'right' legendFooter.x = legendHeader.x + 5 legendFooter.y = legend.y - (len(bepuChartLabel) + 1) * 10 legendFooter.fontName = 'Helvetica-Bold' legendFooter.fillColor = colors.HexColor(0x807F83) legendFooter.fontSize = 10 legendFooter.boxAnchor = 'nw' legendFooter.subCols.rpad = 145 bepuChart.add(legend) bepuChart.add(legendHeader) bepuChart.add(legendFooter) pc.slices.fontColor = colors.HexColor(0x807F83) n = len(pc.data) bepuChart.add(pc, '') Elements.append(bepuChart) ## PAGE 2 Elements.append( Paragraph("When electricity is consumed in your building?", styleHeading3)) Elements.append( Paragraph( "Based on the weather of your location as well as typical lighting and appliances used in households, your building consumes electricity as noted in the following monthly profile:", styleBodyText)) #add chart pseBarData = task['pseBarData'] pseTableData = [[0 for i in xrange(len(pseBarData[0]['values']) + 1)] for i in xrange(len(pseBarData) + 1)] pseChartData = [[0 for i in xrange(len(pseBarData[0]['values']))] for i in xrange(len(pseBarData))] pseChartLegend = [0 for i in xrange(len(pseBarData))] pseTableData[0][0] = 'Key' month = [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ] for i, m in enumerate(month): pseTableData[0][i + 1] = str(month[i]) for i, result in enumerate(pseBarData): # write body cells pseTableData[i + 1][0] = str(result['key']) pseChartLegend[i] = str(result['key']) for j, value in enumerate(result['values']): pseTableData[i + 1][j + 1] = int(result['values'][j]['y']) pseChartData[i][j] = int(result['values'][j]['y']) pseChart = Drawing(400, 200) bc = VerticalBarChart() bc.x = 70 bc.y = 0 bc.height = 200 bc.width = 300 bc.data = pseChartData bc.strokeColor = colors.black bc.valueAxis.valueMin = 0 bc.strokeWidth = 0 bc.valueAxis.valueMin = 0 bc.categoryAxis.style = 'stacked' bc.categoryAxis.labels.boxAnchor = 'ne' bc.categoryAxis.labels.dx = 10 bc.categoryAxis.labels.dy = -2 bc.valueAxis.labels.fontName = 'Helvetica' bc.valueAxis.labels.fontSize = 10 bc.valueAxis.strokeWidth = 0.5 bc.valueAxis.strokeColor = colors.HexColor(0x807F83) bc.categoryAxis.strokeWidth = 0.5 bc.categoryAxis.strokeColor = colors.HexColor(0x807F83) bc.valueAxis.labels.fillColor = colors.HexColor(0x807F83) bc.categoryAxis.labels.fontName = 'Helvetica' bc.categoryAxis.labels.fontSize = 10 bc.categoryAxis.labels.fillColor = colors.HexColor(0x807F83) bc.categoryAxis.categoryNames = month # create a list and add the elements of our document (image, paragraphs, table, chart) to it #add our barchart and legend bc.barWidth = .3 * inch bc.groupSpacing = .2 * inch bc.bars.strokeColor = colors.HexColor(0xffffff) bc.bars.strokeWidth = 0. pse_chart_colors = ['#FFC43E', '#A4A4A4', '#F67A40', '#5894D0'] for i, r in enumerate(pseChartLegend): bc.bars[i].fillColor = colors.HexColor(pse_chart_colors[i]) # = colors.blue legend = Legend() legend.alignment = 'right' legend.x = bc.width + bc.x + 5 legend.y = bc.height + bc.y legend.deltax = 40 legend.dxTextSpace = 5 legend.dx = 8 legend.dy = 8 legend.fontName = 'Helvetica' legend.fillColor = colors.HexColor(0x807F83) legend.fontSize = 10 legend.boxAnchor = 'nw' legend.columnMaximum = (len(bc.data) + 1) / 2 legend.strokeWidth = 0.5 legend.strokeColor = colors.HexColor(0xffffff) legend.deltax = 75 legend.deltay = 12 legend.dividerColor = colors.HexColor(0xdedede) legend.columnMaximum = len(pseChartLegend) legend.colorNamePairs = [(bc.bars[i].fillColor, pseChartLegend[i]) for i in xrange(len(bc.data))] #pseChart.hAlign = 'RIGHT' label = Label() label.setOrigin(10, bc.height / 2) #label.boxAnchor = 'sw' label.angle = 90 label.fillColor = colors.HexColor(0x807F83) label.setText('Electricity Consumption (kWh)') label.fontName = 'Helvetica' pseChart.add(legend, 'legend') pseChart.add(bc) pseChart.add(label) Elements.append(pseChart) Elements.append(PageBreak()) ## PAGE 3 Elements.append( Paragraph( "Does your building meet SASO Thermal Performance Requirements?", styleHeading3)) Elements.append( Paragraph( "Based on your description, the thermal transmittance properties of the walls, roof and glazing are calculated, and compared with SASO thermal building performance requirements:", styleBodyText)) #add chart lvdData = task['lvdData'] lvdChartData = [[0 for i in xrange(len(lvdData[0]['values']))] for i in xrange(len(lvdData))] lvdChartCategoryNames = [0 for i in xrange(len(lvdData[0]['values']))] lvdComparedObjKey = [0 for i in xrange(len(lvdData))] for i, result in enumerate(lvdData): # write body cells lvdComparedObjKey[i] = str(lvdData[i]['key']) for j, value in enumerate(result['values']): lvdChartCategoryNames[j] = value['label'] lvdChartData[i][j] = value['value'] lvdChart = Drawing(400, 200) bc = VerticalBarChart() bc.x = 70 bc.y = 0 bc.height = 200 bc.width = 300 bc.data = lvdChartData bc.strokeColor = colors.black # bc.fillColor=colors.blue bc.valueAxis.valueMin = 0 bc.strokeWidth = 0 bc.valueAxis.valueMin = 0 bc.categoryAxis.labels.boxAnchor = 'n' bc.categoryAxis.labels.dx = 0 bc.categoryAxis.labels.dy = -2 # bc.categoryAxis.labels.angle = 20 bc.valueAxis.labels.fontName = 'Helvetica' bc.valueAxis.labels.fontSize = 10 bc.valueAxis.strokeWidth = 0.5 bc.valueAxis.strokeColor = colors.HexColor(0x807F83) bc.categoryAxis.strokeWidth = 0.5 bc.categoryAxis.strokeColor = colors.HexColor(0x807F83) bc.valueAxis.labels.fillColor = colors.HexColor(0x807F83) bc.categoryAxis.labels.fontName = 'Helvetica' bc.categoryAxis.labels.fontSize = 8 bc.categoryAxis.labels.fillColor = colors.HexColor(0x807F83) bc.categoryAxis.categoryNames = lvdChartCategoryNames bc.categoryAxis.labels.angle = 0 # create a list and add the elements of our document (image, paragraphs, table, chart) to it #add our barchart and legend bc.barWidth = .3 * inch bc.groupSpacing = .2 * inch bc.bars.strokeColor = colors.HexColor(0xffffff) bc.bars.strokeWidth = 0.5 lvd_chart_colors = ['#5894D0', '#F67A40'] for i, r in enumerate(lvdComparedObjKey): bc.bars[i].fillColor = colors.HexColor(lvd_chart_colors[i]) # = colors.blue legend = Legend() legend.alignment = 'right' legend.x = bc.width + bc.x + 5 legend.y = bc.height + bc.y legend.deltax = 40 legend.dxTextSpace = 5 legend.dx = 8 legend.dy = 8 legend.fontName = 'Helvetica' legend.fillColor = colors.HexColor(0x807F83) legend.fontSize = 10 legend.boxAnchor = 'nw' legend.columnMaximum = (len(bc.data) + 1) / 2 legend.strokeWidth = 0.5 legend.strokeColor = colors.HexColor(0xffffff) legend.deltax = 75 legend.deltay = 12 legend.dividerColor = colors.HexColor(0xdedede) legend.columnMaximum = len(lvdComparedObjKey) legend.colorNamePairs = [(bc.bars[i].fillColor, lvdComparedObjKey[i]) for i in xrange(len(bc.data))] #pseChart.hAlign = 'RIGHT' label = Label() label.setOrigin(10, bc.height / 2) #label.boxAnchor = 'sw' label.angle = 90 label.fillColor = colors.HexColor(0x807F83) label.setText('Envelope U-value (W/m' + u'\u00b2' + '.k)') label.fontName = 'Helvetica' lvdChart.add(label) lvdChart.add(legend, 'legend') lvdChart.add(bc) Elements.append(lvdChart) #Elements.append(PageBreak()) Elements.append(Paragraph('<br /><br />', styleBodyText)) ## PAGE 4 Elements.append( Paragraph("How energy efficient is your building?", styleHeading3)) Elements.append( Paragraph( "Using your input specifications, the annual electricity consumption is calculated and compared with a similar building that meets SASO requirements:", styleBodyText)) #add chart bepuComparisonData = task['bepuComparisonData'] bepuComparisonChartData = [[ 0 for i in xrange(len(bepuComparisonData[0]['values'])) ] for i in xrange(len(bepuComparisonData))] bepuChartCategoryNames = [ 0 for i in xrange(len(bepuComparisonData[0]['values'])) ] bepuComparedObjKey = [0 for i in xrange(len(bepuComparisonData))] for i, result in enumerate(bepuComparisonData): # write body cells bepuComparedObjKey[i] = str(bepuComparisonData[i]['key']) for j, value in enumerate(result['values']): bepuChartCategoryNames[j] = value['label'] bepuComparisonChartData[i][j] = value['value'] bepuComparisonChart = Drawing(400, 200) bc = VerticalBarChart() bc.x = 70 bc.y = 0 bc.height = 200 bc.width = 300 bc.data = bepuComparisonChartData bc.strokeColor = colors.black # bc.fillColor=colors.blue bc.valueAxis.valueMin = 0 bc.strokeWidth = 0 bc.valueAxis.valueMin = 0 bc.categoryAxis.labels.boxAnchor = 'ne' bc.categoryAxis.labels.dx = 10 bc.categoryAxis.labels.dy = -2 # bc.categoryAxis.labels.angle = 20 bc.valueAxis.labels.fontName = 'Helvetica' bc.valueAxis.labels.fontSize = 10 bc.valueAxis.strokeWidth = 0.5 bc.valueAxis.strokeColor = colors.HexColor(0x807F83) bc.categoryAxis.strokeWidth = 0.5 bc.categoryAxis.strokeColor = colors.HexColor(0x807F83) bc.valueAxis.labels.fillColor = colors.HexColor(0x807F83) bc.categoryAxis.labels.fontName = 'Helvetica' bc.categoryAxis.labels.fontSize = 10 bc.categoryAxis.labels.fillColor = colors.HexColor(0x807F83) bc.categoryAxis.categoryNames = bepuChartCategoryNames bc.categoryAxis.labels.angle = 30 # create a list and add the elements of our document (image, paragraphs, table, chart) to it #add our barchart and legend bc.barWidth = .3 * inch bc.groupSpacing = .2 * inch bc.bars.strokeColor = colors.HexColor(0xffffff) bc.bars.strokeWidth = 0.5 bepu_chart_colors = ['#5894D0', '#F67A40'] for i, r in enumerate(bepuComparedObjKey): bc.bars[i].fillColor = colors.HexColor(bepu_chart_colors[i]) # = colors.blue # bc.bars[1].fillColor = colors.lightblue legend = Legend() legend.alignment = 'right' legend.x = bc.width + bc.x + 5 legend.y = bc.height + bc.y legend.deltax = 40 legend.dxTextSpace = 5 legend.dx = 8 legend.dy = 8 legend.fontName = 'Helvetica' legend.fillColor = colors.HexColor(0x807F83) legend.fontSize = 10 legend.boxAnchor = 'nw' legend.columnMaximum = (len(bc.data) + 1) / 2 legend.strokeWidth = 0.5 legend.strokeColor = colors.HexColor(0xffffff) legend.deltax = 75 legend.deltay = 12 legend.dividerColor = colors.HexColor(0xdedede) legend.columnMaximum = len(bepuComparedObjKey) legend.colorNamePairs = [(bc.bars[i].fillColor, bepuComparedObjKey[i]) for i in xrange(len(bc.data))] #pseChart.hAlign = 'RIGHT' label = Label() label.setOrigin(10, bc.height / 2) #label.boxAnchor = 'sw' label.angle = 90 label.fillColor = colors.HexColor(0x807F83) label.setText('Annual Energy Use (kWh/year)') label.fontName = 'Helvetica' bepuComparisonChart.add(label) bepuComparisonChart.add(legend, 'legend') bepuComparisonChart.add(bc) Elements.append(bepuComparisonChart) Elements.append(PageBreak()) doc.build(Elements) output_file.seek(0) # Set filname and mimetype file_name = 'K-BEAT_export_{}.pdf'.format( datetime.now().strftime("%Y-%m-%d %H:%M:%S")) #Returning the file from memory return send_file(output_file, attachment_filename=file_name, as_attachment=True)
def getPlot(): drawing = Drawing(400, 200) #temps = [((0.5,7), (1.5,1), (2.5,2), (3.5,1), (4.5,3), (5.5,5), (6.5, 10), (7.5,6))] temps = [getTemps()] bc = LinePlot() bc.x = 50 bc.y = 50 bc.height = 125 bc.width = 300 bc.data = temps #labels yilabel = Label() yilabel.setText("Temperatura (°C)") yilabel.angle = 90 yilabel.setOrigin(20,120) xlabel = Label() xlabel.setText("Días") xlabel.setOrigin(200,20) labelT = Label() labelT.setText("Temperatura") labelT.setOrigin(210,185) labelH = Label() labelH.setText("Humedad") labelH.setOrigin(285,185) bc.xValueAxis.valueMin = 0 bc.xValueAxis.valueMax = 20 bc.xValueAxis.valueSteps = [x for x in range(1,bc.xValueAxis.valueMax)] #bc.xValueAxis.labelTextFormat = '%2.1f' bc.yValueAxis.valueMin = 0 bc.yValueAxis.valueMax = 60 bc.yValueAxis.valueSteps = [0, 10, 20, 30, 40, 50, 60] drawing.add(bc) drawing.add(yilabel) drawing.add(xlabel) drawing.add(Line(170,185,185,185, strokeColor=colors.red)) drawing.add(Line(250,185,265,185, strokeColor=colors.blue)) drawing.add(labelT) drawing.add(labelH) #humedad=[[(0.5, 4), (1.5, 3), (2.5, 4), (3.5, 6), (4.5, 4), (5.5, 2), (6.5, 5), (7.5, 6)]] humedad = [getHumedad()] lp = LinePlot() lp.x = bc.x lp.y = bc.y lp.height = bc.height lp.width = bc.width lp.data = humedad ydlabel = Label() ydlabel.setText("Humedad (%)") ydlabel.angle = -90 ydlabel.setOrigin(lp.x+lp.width+30,lp.y+70) lp.joinedLines = 1 lp.lines[0].symbol = makeMarker('Circle') lp.lines[0].strokeColor=colors.blue lp.lineLabelFormat = '%2.0f' lp.xValueAxis.valueMin = 0 lp.xValueAxis.valueMax = bc.xValueAxis.valueMax lp.yValueAxis.valueMin = 0 lp.yValueAxis.valueMax = 100 lp.xValueAxis.visible=False lp.yValueAxis.visible=False #Hide 2nd plot its Yaxis drawing.add(lp) drawing.add(ydlabel) y2Axis = YValueAxis()#Replicate 2nd plot Yaxis in the right y2Axis.setProperties(lp.yValueAxis.getProperties()) y2Axis.setPosition(lp.x+lp.width,lp.y,lp.height) y2Axis.tickRight=5 y2Axis.tickLeft=0 y2Axis.labels.dx = 20 y2Axis.configure(humedad) y2Axis.visible=True drawing.add(y2Axis) return drawing
def scatter_plot_2(final_dis_clock, xname, yname): drawing = Drawing(400, 300) chart = ScatterPlot() chart.width = 450 chart.height = 350 chart.x = 32 chart.y = 26 chart.data = [final_dis_clock] chart.joinedLines = 0 chart.fillColor = color03 chart.lineLabelFormat = None chart.lineLabels.fontName = 'Helvetica' lab = Label() lab.setOrigin(130, 260) chart.xValueAxis.avoidBoundFrac = 1 chart.xValueAxis.visibleGrid = 1 chart.xValueAxis.tickDown = 2 chart.xValueAxis.labels.fontName = 'Helvetica' chart.xValueAxis.labels.fontSize = 10 chart.xValueAxis.labelTextFormat = '%d' chart.leftPadding = -32 chart.xLabel = xname chart.xValueAxis.forceZero = 1 chart.yValueAxis.avoidBoundFrac = 1 chart.yValueAxis.visibleGrid = 1 chart.yValueAxis.tickLeft = 2 chart.yValueAxis.labels.fontName = 'Helvetica' chart.yValueAxis.labels.fontSize = 10 chart.yValueAxis.labelTextFormat = '%s' chart.yValueAxis.valueMin = 0.0 chart.yValueAxis.valueStep = 3.0 chart.yValueAxis.valueMax = 9.0 chart.yLabel = yname chart.yLabel.center(10) chart.yValueAxis.forceZero = 0 # Title = Label() # Title.fontName = 'Helvetica-Bold' # Title.fontSize = 10 # Title.x = 100 # Title.y = 550 # Title._text = 'This is just a test chart' # Title.maxWidth = 20 # Title.height = 100 # Title.textAnchor = 'middle' # legend = Legend() # legend.colorNamePairs = [(color01, 'Widgets'), (color02, 'Sprockets')] # legend.fontName = 'Helvetica' # legend.fontSize = 8 # legend.x = 470 # legend.y = 470 # legend.dxTextSpace = 4 # legend.dy = 7 # legend.dx = 7 # legend.deltay = 4 # legend.alignment = 'right' drawing.add(chart) return drawing
def makeSummary(self, stype): logger.debug('StartQT4::makeSummary(%s)' % stype) pinfo = self.imageViews[-1].getSummaryDemographics() if pinfo is None: return reportname = self.imageViews[-1].getReportName()+'.pdf' filename = QtGui.QFileDialog.getSaveFileName(self, directory=reportname, filter='PDF Files *.pdf(*.pdf);;All Files *(*)') #filename = QtGui.QFileDialog.getSaveFileName(self, filter='PDF Files *.pdf(*.pdf);;All Files *(*)') if len(filename) == 0: return doc = SimpleDocTemplate(str(filename), pagesize=A4, rightMargin=1.5*cm, leftMargin=2*cm, topMargin=2*cm, bottomMargin=3*cm) elements = [] #data = pinfo.items() for iv in self.imageViews: vt = iv.getVelocityText() if stype == 'BOTH' or stype == iv.getViewShortName(): pinfo.append(vt) t=Table(pinfo, rowHeights=12) t.setStyle(TableStyle([('BACKGROUND',(1,1),(-2,-2),colors.green), ('TEXTCOLOR',(0,0),(1,-1),colors.black), ('ALIGNMENT', (0,0),(0,-1), 'RIGHT')])) elements.append(t) for iv in self.imageViews: if stype == 'BOTH' or stype == iv.getViewShortName(): drawing = Drawing(400, 280) cd = iv.getDataPointer() vt = iv.getVelocityText() pinfo.append(vt) #ydata = cd.getCOMYScaled(False, 'mm').tolist() ydata = cd.getCOMYScaled(True, 'mm').tolist() xPlaneFit = cd.getYPlaneFit(units='mm', bothAxes=True).tolist() vdata = cd.getVelocitySlopeScaled(units='mm', bothAxes=True) gdata = [ydata, xPlaneFit] if vdata is not None: gdata.append(vdata.tolist()) title = Label() title.setOrigin(150, 240) title.setText(iv.getViewName()) ylabel = Label() ylabel.setOrigin(0, 100) ylabel.angle = 90 ylabel.setText("Millimeters") xlabel = Label() xlabel.setOrigin(70, 0) xlabel.setText("Seconds") lp = LinePlot() lp.height = 230 lp.width = 400 lp.data = gdata lp.lines[0].strokeColor = colors.blue lp.lines[1].strokeColor = colors.red lp.lines[2].strokeColor = colors.green #lp.xValueAxis.xLabel = "Seconds" drawing.add(title) drawing.add(ylabel) drawing.add(xlabel) drawing.add(lp) elements.append(drawing) doc.build(elements, onFirstPage=self.pdfHeaderFooter, onLaterPages=self.pdfHeaderFooter)
def half_year(title,city, year, startmon): '''startmon is the 1-indexed month to start the page on''' reqd, mons = get_months(year, startmon) LEFTMARGIN = 5 DAYCOLWIDTH = 50 CELLWIDTH = 80 CELLHEIGHT = 19 TOPROWHEIGHT = 18 WIDTH = LEFTMARGIN + DAYCOLWIDTH + CELLWIDTH*6 HEIGHT = reqd * CELLHEIGHT + TOPROWHEIGHT d = shapes.Drawing(WIDTH, HEIGHT) lab = Label() lab.setOrigin(LEFTMARGIN,HEIGHT) lab.boxAnchor = 'nw' lab.setText(title) lab.fontName = 'Times-Bold' d.add(lab) # Month headings for i in range(6): x = LEFTMARGIN + i*CELLWIDTH + DAYCOLWIDTH + CELLWIDTH/2 month_name = calendar.month_abbr[i + startmon] d.add(shapes.String(x, HEIGHT-14, month_name, fontSize=14, fontName='Times-Bold', textAnchor='middle')) # Day row headings for i in range(reqd): y = HEIGHT - i*CELLHEIGHT - TOPROWHEIGHT weekday_name = calendar.day_abbr[i%7] d.add(shapes.String(LEFTMARGIN + 10, y-14, weekday_name, fontSize=14)) # Draw the day cells, for each month for j in range(6): x = LEFTMARGIN + j*CELLWIDTH + DAYCOLWIDTH # for each day for i in range(reqd): if i >= len(mons[j]) or not mons[j][i]: continue y = HEIGHT - i*CELLHEIGHT - TOPROWHEIGHT # cells for each day, light grey background if weekend weekend = i%7 > 4 lightgrey = colors.HexColor(0xD0B090) color = weekend and lightgrey or colors.white # Now we have (x, y, color) for (year, month=j+startmon, day=mons[j][i]) # Get the ephemerides for the date date = datetime.datetime(year, j+startmon, mons[j][i]) (sunrise, sunset, moon_phase, moon_fm) = ephem3.ephem_one_day(city, date) # Insert the date cell at x, y d.add(shapes.Rect(x, y, CELLWIDTH, -CELLHEIGHT, fillColor=color)) d.add(shapes.String(x+1, y-10, str(mons[j][i]), fontSize=10)) green = colors.HexColor(0x207020) # Insert the moon phase if moon_fm: d.add(shapes.String(x+15, y-10, moon_fm, fontSize=8, fillColor=green)) # for each day # for each month return d
def balance_statistics_chart(self, control_vars, match_vars, var_names): """ Specify layout of the balance statistics chart and generate flowable object that can be added to the pdf """ drawing = Drawing() vbc = VerticalBarChart() # Chart position in document vbc.x = self.chart_offset_x vbc.y = self.chart_offset_y vbc.height = self.chart_height vbc.width = self.chart_width # Specify data # [[control_var1, control_var2], [match_var1, match_var2]] vbc.data = [control_vars, match_vars] #Set Y-Axis ranges #axis_range = self._calculate_y_axis(vbc.data) #vbc.valueAxis.valueMin = axis_range['min'] #vbc.valueAxis.valueMax = axis_range['max'] #vbc.valueAxis.valueStep = axis_range['step'] #Grid formatting vbc.valueAxis.visibleGrid = 1 vbc.valueAxis.gridStrokeColor = colors.lightgrey #Bar formatting vbc.bars[0].fillColor = colors.blue vbc.bars[1].fillColor = colors.yellow vbc.bars.strokeColor = None vbc.groupSpacing = 1 vbc.barWidth = 5 # Callout label formatting (numbers above bar) #vbc.barLabels.fontName = "Arial" vbc.barLabels.fontSize = 8 vbc.barLabels.fillColor = colors.black vbc.barLabelFormat = '%.2f' vbc.barLabels.nudge = 5 # Central axis vbc.categoryAxis.visibleTicks = 1 # X-axis labels #vbc.categoryAxis.labels.dy = -60 vbc.valueAxis.labels.fontName = 'Helvetica' vbc.categoryAxis.categoryNames = var_names lab = Label() lab.setOrigin(10, 155) lab.boxAnchor = 'ne' lab.angle = 90 lab.dx = 0 lab.dy = -15 #lab.boxStrokeColor = colors.green lab.setText('Percent Bias') drawing.add(lab) drawing.add(vbc) self.elements.append(drawing)
def getTempPlot(): drawing = Drawing(400, 200) temps = [getTemps()] bc = LinePlot() bc.x = 50 bc.y = 50 bc.height = 125 bc.width = 300 bc.data = temps bc.lines[0].symbol = makeMarker('Circle') #labels yilabel = Label() yilabel.setText("Temperatura (°C)") yilabel.angle = 90 yilabel.setOrigin(20, 120) xlabel = Label() xlabel.setText("Días") xlabel.setOrigin(200, 20) #labelT = Label() #labelT.setText("Temperatura") #labelT.setOrigin(210,185) #labelH = Label() #labelH.setText("Humedad") #labelH.setOrigin(285,185) label55 = Label() label55.setText("55°") label55.setOrigin(325, 185) bc.xValueAxis.valueMin = 0 bc.xValueAxis.valueMax = 30 bc.xValueAxis.valueSteps = [x for x in range(0, bc.xValueAxis.valueMax, 5)] #bc.xValueAxis.labelTextFormat = '%2.1f' bc.yValueAxis.valueMin = 0 bc.yValueAxis.valueMax = 80 bc.yValueAxis.valueSteps = [0, 10, 20, 30, 40, 50, 60, 70, 80] drawing.add(bc) drawing.add(yilabel) drawing.add(xlabel) #drawing.add(Line(170,185,185,185, strokeColor=colors.red)) #drawing.add(Line(250,185,265,185, strokeColor=colors.blue)) drawing.add( Line(300, 185, 315, 185, strokeColor=colors.black, strokeDashArray=[2, 2])) drawing.add( Line(50, 135, 350, 135, strokeColor=colors.black, strokeDashArray=[2, 2])) #drawing.add(labelT) #drawing.add(labelH) drawing.add(label55) #drawing.add(Grid()) drawing.add(String(130, 200, "Gráfico de temperaturas", fontSize=16)) return drawing
if not line.isspace() and line[0] not in COMMENT_CHARS: data.append([float(n) for n in line.split()]) print(data) pred = [row[2] for row in data] high = [row[3] for row in data] low = [row[4] for row in data] times = [row[0] + row[1] / 12.0 for row in data] lp = LinePlot() lp.x = 50 lp.y = 50 lp.height = 125 lp.width = 300 lp.data = [ list(zip(times, pred)), list(zip(times, high)), list(zip(times, low)) ] lp.lines[0].strokeColor = colors.blue lp.lines[1].strokeColor = colors.red lp.lines[2].strokeColor = colors.green lab = Label() lab.setOrigin(350, 180) lab.setText('blue line:pred\nred line:high\ngreen line:low') lab.boxStrokeColor = colors.green drawing.add(lab) drawing.add(lp) drawing.add(String(250, 150, 'Sunspots', fontSize=14, fillColor=colors.red)) renderPDF.drawToFile(drawing, 'report2.pdf', 'Sunspots')
def exportMonthlyReport(self, file, month, year): """Outputs the monthly report to the specified file location Parameters: self: the class instance file: str - file location and name ending in .pdf month: str - required month year: int - required year """ # For conversion of month to three letter abbreviation months = [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ] # Creating a title title = Label() title.setOrigin(300, 20) title.boxAnchor = 'ne' title.dx = 0 title.dy = -5 title.fontSize = 30 title.setText("Monthly Report") # Adding title to a drawing draw_title = Drawing(0, 40) draw_title.add(title) # Creating a subtitle subtitle = Label() subtitle.setOrigin(320, 20) subtitle.boxAnchor = 'ne' subtitle.dx = 0 subtitle.dy = -10 subtitle.fontSize = 14 # Converts month to three letter abbreviation str_month = months[int(month) - 1] # Setting the subtitle's text subtitle.setText("Australia Zoo Wildlife Hospital, " + str_month + " " + str(year)) # Adding subtitle to a drawing draw_subtitle = Drawing(0, 30) draw_subtitle.add(subtitle) # Creating a label for the first chart label_lga = Label() label_lga.setOrigin(180, 20) label_lga.boxAnchor = 'ne' label_lga.dx = 0 label_lga.dy = -20 label_lga.setText("Local Government Area Totals") # Adding label to a drawing draw_label_lga = Drawing(0, 40) draw_label_lga.add(label_lga) # Creating drawing for the lga chart draw_lga = Drawing(0, 270) draw_lga.add(self.getSpecificBarChart("LGA", month, year)) # Creating a label for the second chart label_taxons = Label() label_taxons.setOrigin(180, 20) label_taxons.boxAnchor = 'ne' label_taxons.dx = 0 label_taxons.dy = -20 label_taxons.setText("Taxon Grouping Totals") # Adding label to a drawing draw_label_taxons = Drawing(0, 40) draw_label_taxons.add(label_taxons) # Creating drawing for the taxons chart draw_taxons = Drawing(0, 270) draw_taxons.add(self.getSpecificBarChart("Taxons", month, year)) # List of drawings in order of how to place them in the canvas drawlist = [ draw_title, draw_subtitle, draw_label_lga, draw_lga, draw_label_taxons, draw_taxons ] # Creating a canvas (pdf file) and saving it to a location canvas = Canvas(file) # Creating a frame to add flowables (drawings) to frame = Frame(inch, 0, 15.92 * cm, 29.7 * cm) # Adding flowables frame.addFromList(drawlist, canvas) # Saving the pdf canvas.save()
def draw_hex(self): print 'Reporting Hex' story = [] for p in self.world.packets: pl,t = p.build_ps() XSTART = 0 XDSTART = 210 y = 0.0 XMUL= 100.0 YMUL = 10.0 larg = 16 YDUMP = PAGE_HEIGHT*0.80/YMUL - 10 YDUMP = 0 canvas = shapes.Drawing(500, 100) # canvas.add(shapes.Rect(0,0, 500, PAGE_HEIGHT, fillColor=colors.yellow)) backcolor=colgen(0.6, 0.8, 1.0) forecolor=colgen(0.2, 0.5, 0.8) def hexstr(x): s = [] for c in x: s.append("%02x" % ord(c)) return " ".join(s) my_y = 0 shift = 0 last_x = 0 while t: bkcol = backcolor.next() proto,fields = t.pop() l = Label() l.setText(proto.name) l.boxAnchor = 'w' l.boxStrokeColor = colors.gray bc = colors.Color(bkcol[0], bkcol[1], bkcol[2] ) l.boxFillColor = bc l.setOrigin(XSTART, (YDUMP-y)*YMUL) canvas.add(l) my_y = y for fname, fval, fdump in fields: y += 1.5 col = forecolor.next() l = Label() l.boxAnchor = 'w' l.setText(fname.name) l.setOrigin(XSTART + (0.1 * XMUL), (YDUMP-y)*YMUL) canvas.add(l) if fval is not None: if len(fval) > 24: fval = fval[:21]+"..." else: fval="" l = Label() l.setText(fval) xlabel, ylabel = XSTART+(1.5*XMUL), (YDUMP-y)*YMUL l.setOrigin(xlabel, ylabel) l.boxStrokeWidth = 2 l.boxAnchor = 'e' canvas.add(l) first = True while fdump: dmp, fdump = fdump[:larg-shift],fdump[larg-shift:] l = Label() l.boxAnchor = 'w' l.fontName = 'Courier' l.boxFillColor = colors.Color(bkcol[0], bkcol[1], bkcol[2]) l.boxStrokeColor = colors.Color(col[0], col[1], col[2]) l.boxStrokeWidth = 2 xdump, ydump = XDSTART+ last_x * 0.06*XMUL, (YDUMP-my_y)*YMUL l.setOrigin(xdump, ydump) h = hexstr(dmp) l.setText(h) canvas.add(l) if first: link = shapes.Line(xdump, ydump, xlabel, ylabel, strokeColor=colors.Color(col[0], col[1], col[2]), strokeWidth=1) canvas.add(link) first = False shift += len(dmp) last_x += len(h) +1 if shift >= larg: shift = 0 last_x = 0 my_y += 2 y += 2 scale = 0.7 canvas.shift(0, y * YMUL*scale) canvas.height = min(y * YMUL *scale , PAGE_HEIGHT*0.80) canvas.scale(scale, scale) # para = Paragraph('<a name="hex%d"/>'%p.number + \ # '<a href="#summary%d">(%d) %s</a>' % (p.number, p.number, p.description), styles['Normal']) # story.append([[para, Spacer(1,10), canvas]]) para = Paragraph('<a href="#summary%d">(%d) %s</a>' % (p.number, p.number, p.description), styles['Normal']) story.append([[para, Spacer(1,10), canvas]]) t = Table(story) t.setStyle(TableStyle([ ('INNERGRID', (0,0), (-1,-1), 0.1, colors.black), ('BOX', (0,0), (-1,-1), 0.1, colors.black), ])) return [t]