class Hwindow(): """Creates host/join menu.""" def __init__(self): self.h = Gui() # make h window self.h.title('Othello!') self.h.la(text='Game Name (no spaces)') self.entryField = self.h.en() self.h.gr(cols=2) hostButton = self.h.bu(text='Host Game', command=self.host) joinButton = self.h.bu(text='Join Game',command=self.join) self.h.mainloop() def host(self): """Creates a game w/ 2 players and 2 computers.""" name = self.entryField.get() data = { 'gameName': name } req = urllib2.Request('http://othello.herokuapp.com/createGame') req.add_header('Content-Type', 'application/json') response = urllib2.urlopen(req, json.dumps(data)) self.h.destroy() # close h window os.system('python board_piece_final_tweaked1.py ' + name + ' black') def join(self): """Joins an existing game w/ 2 players and 2 computers.""" name = self.entryField.get() self.h.destroy() # close h window os.system('python board_piece_final_tweaked1.py ' + name + ' white')
def callback1(): """called when the user presses 'Create circle' """ global circle circle = canvas.circle([0, 0], 100) def callback2(): """called when the user presses 'Change color' """ # if the circle hasn't been created yet, do nothing if circle is None: return # get the text from the entry and try to change the circle's color color = entry.get() try: circle.config(fill=color) except TclError as message: # probably an unknown color name print message # create the widgets g.bu(text='Create circle', command=callback1) entry = g.en() g.bu(text='Change color', command=callback2) g.mainloop()
from swampy.Gui import * g = Gui() g.title('19-3.py') canvas = g.ca(width = 500, height = 600, bg = 'white') circle = None def make_circle(): circle = canvas.circle([0,0], 100) def make_change(): if circle == None: return color = entry.get() try: circle.config(fill = color) except TclError, message: print message b1 = g.bu(text = 'Create Circle', command = make_circle) entry = g.en() b2 = g.bu(text = 'Press to Config', command= make_change) g.mainloop()
vec = Vector(item) ca.bind("<ButtonPress-1>", vec.select) def make_circle(event): """Makes a circle item at the location of a button press.""" dx = event.x dy = event.y pos = ca.canvas_coords([[event.x, event.y], [event.x + 10, event.y + 10]]) print pos item = ca.rectangle(pos, fill="red") item = Vector(item) ca.bind("<ButtonPress-3>", make_circle) def make_text(event=None): """Pressing Return in the Entry makes a text item.""" text = en.get() item = ca.text([0, 0], text) item = Vector(item) g.row([0, 1]) bu = g.bu("Make text item:", make_text) en = g.en() en.bind("<Return>", make_text) g.mainloop()
win = Gui() #initialise a win object win.title('GPA Analysis') win.row() logo1=PIL.open('logo.png') logo=ImageTk.PhotoImage(logo1) win.la(image=logo) win.row([0,0], padx=50) win.la(text='Analysing 4th sem, ECE results \n of the year 2014') win.col() win.bu(text='About the app', command=ab_app) win.bu(text='About the Developer', command=ab_dev) win.la(text='Kindly mail your feedback to \n [email protected]') win.endcol() win.col([0,3],pady=70,padx=50) win.la(text='Enter your USN') entry=win.en(text='1BM12EC129') win.bu(text='View result analysis', command=res) #function res is invoked when the bu is clicked win.endcol() win.row([0,4], padx=1) win.col() bms=PIL.open('bmslogo.png') bms=ImageTk.PhotoImage(bms) win.la(image=bms) win.mainloop()
circle.config(fill=color) except: message = 'probaly an unknown color name' print message g = Gui() g.title('Gui') button = g.bu(text='Press it', command=callback1) canvas = g.ca(width=500, height=500) circle = None #canvas.config(bg='black') #item = canvas.rectangle([[0, 0], [200, 200]], #fill='white', outline='orange',width=10) #item = canvas.oval([[0, 0], [200, 100]], #fill='white', outline='orange',width=10) #item = canvas.line([[0, 100], [100, 200], [200, 100]], width=10, fill='white') #item = canvas.polygon([[0, 100], [100, 200], [200, 100]], width=10, fill='white', outline='orange') #entry = g.en(text='Default text.') #print entry.get() #text = g.te(width=100, height=5) #text.insert(2.3, 'nother') #text.delete(0.2, END) #print text.get(0.0, END) entry = g.en(text='Type a color') button_color = g.bu(text='Change color', command=change_color) g.mainloop()
# create the Gui: the debug flag makes the frames visible g = Gui(debug=False) # the topmost structure is a row of widgets g.row() # FRAME 1 # the first frame is a column of widgets g.col() # la is for label la1 = g.la(text='This is a label.') # en is for entry en = g.en() en.insert(END, 'This is an entry widget.') la2 = g.la(text='') def press_me(): """this callback gets invoked when the user presses the button""" text = en.get() la2.configure(text=text) # bu is for button bu = g.bu(text='Press me', command=press_me) # end of the first frame
from swampy.Gui import * def make_label(): g.la(text='Thank you.') g = Gui() g.title('Gui') button = g.bu(text='Press me.') button2 = g.bu(text='No, press me!', command=make_label) label = g.la(text='Press the buttom.') canvas = g.ca(width=500, height=500) canvas.config(bg='white') item = canvas.circle([0,0], 100, fill='red') item.config(fill='yellow', outline='orange', width=10) canvas.rectangle([[0,0], [200,200]], fill='blue',outline='orange',width=10) canvas.oval([[0,0], [200,100]], outline='orange', width=10) canvas.line([[0,100], [100,200], [200,100]], width=10) canvas.polygon([[0,100], [100,200], [200,100]], fill='red', outline='orange', width=10) entry = g.en(text='Default text.') text = g.te(width=100, height=5) text.insert(END, 'A line of text.') text.insert(1.1, 'nother') text.delete(1.2, END) g.mainloop()
g = Gui() g.title = "Gui" circle1 = False def make_circle(): global circle1 circle1 = canvas.circle([random.randint(-200, 200), random.randint(-200, 200)], 55, fill="orange", outline="white", width=3) def change_circle_color(): if circle1 == False: g.la(text="You must make the circle first") return try: color = entry.get() circle1.config(fill=str(color)) except: g.la(text="Please enter a valid color") return canvas = g.ca(500, 500, bg="black") g.bu(text="make me a circle", command=make_circle) entry = g.en(text="name a color") g.bu(text="change circle color to entry", command=change_circle_color) g.mainloop()
from swampy.Gui import * g = Gui() def draw_circle(fill_color='black'): canvas = g.ca(width=300, height=300, bg='white') c = canvas.circle([0, 0], 100, outline='black') c.config(fill=fill_color) def read(): color = ent.get() print color colors = [ 'white', 'black', 'red', 'green', 'blue', 'cyan', 'yellow', 'magenta' ] for c in colors: print c if color == c: draw_circle(color) return print "no color match" g.bu(text='Draw circle', command=draw_circle) g.title('draw cicle') ent = g.en() g.bu(text='second button', command=read) g.mainloop()
from swampy.Gui import * colors=['white', 'red', 'green', 'blue', 'cyan', 'yellow', 'magenta'] cir=None g = Gui() g.title('Exercise 3') def cb1(): cir = canvas.circle([0,0], 100, fill='black', outline='white') global cir def cb2(): if cir == None: return color = entry.get() if color in colors: cir.config(outline=color) else: raise ValueError button = g.bu(text='Draw Circle', command=cb1) entry = g.en(text='white') button_change_color = g.bu(text='Change', command=cb2) canvas = g.ca(width=500, height=500) canvas.config(bg='black') g.mainloop()
# first arg is a coordinate pair, that specifices the center of the circle # 2nd arg is radius item.config(fill='yellow', outline='orange', width=10) # coordinate sequences canvas.rectangle([0, 0], [200, 200], fill='blue', outline='orange', width=10) # oval takes a bounding box and draws an oval within rectangle canvas.oval([[0, 0], [200, 100]], outline='orange', width=10) canvas.line([[0, 100], [100, 200], [200, 100]], width=10) # polygon takes same args, but draws the last leg of polygon and fills canvas.polygon([[0, 100], [100, 200], [200, 100]], fill='red', outline='orange', width=10) # widgets # en creates new entry entry = g.en(text='default text') # te grecreates text widget text = g.te(width=100, height=5) text.insert(END, 'A line of text') text.insert(1.1, 'nother') # packing widgets class SimpleTurtleWorld(TurtleWorld): def setup(self): """create the GUI""" self.row() self.canvas = self.ca(width=400, height=400, bg='white')
def launch(): """ launches the 'real' gui system, the one we interact with """ #names new databases that we will use now that the application is launched share_hist = db.share_hist display = db.display point_total = db.point_total shared_source = db.shared_source shared_viewer = db.shared_viewer #clears the databases upon running script #IMPORTANT: leave the shared_viewer.remove() shared_viewer.remove() def initialize(): """ upon running the script, gets data from the database and updates the gui displays """ global count global share_count global username try: for thing in point_total.distinct(username): amount = thing points.config(text = str(amount)) except: point_total.insert({username:10}) for thing in point_total.distinct(username): amount = thing points.config(text = str(amount)) for thing in display.distinct(username): share_history.canvas.text([0,count], text = thing['friend'] + ' ' + thing['share'] + ' ' + str(thing['date'])) count -= 12 for thing in shared_viewer.distinct(username): link = new_shared_list.canvas.text([0,share_count], text = str(thing[username]['link']), activefill = 'blue') link.bind('<Double-1>', onObjectClick) share_count -= 12 def update(): """ when the update button is pushed, this looks at the database, and will print things not already in the display, as well as log displayed data (meaning that if the gui closes before update is pressed, the data is still saved, and will be displayed the next time update will be pressed) """ global count global username for log in share_hist.find(): if log not in display.find(): display.insert(log) share_history.canvas.text([0,count], text = log[username]['friend'] + ' ' + log[username]['share'] + ' ' + str(log[username]['date'])) count -= 12 get_new_shares() def print_entry(): """ Allows shares to be made, will check to make sure nothing is a repeat, will log the data. Interactive with the user. """ global count global username res = [] text = en.get() connection = friend.get() for user in users.find(): res.append(user['user']) if connection not in res: label.config(text = 'Sorry, user not in our records') return follower = ' was shared with ' message = text + follower + connection + '!' for thing in point_total.distinct(username): existing = thing point_total.update({username: existing}, {'$inc': {username:(-1)}}) points.config(text = str(existing-1)) if count == 1: t = datetime.datetime.now() if t.minute < 10: minute = '0'+str(t.minute) else: minute = str(t.minute) timestamp = str(t.month) + '/' + str(t.day) +'/' + str(t.year) + ',' +str(t.hour) + ':' + minute share_hist.insert({username:{'friend':connection,'share':text, 'date': timestamp}}) shared_source.insert({connection:{'link': text, 'friend':username}}) label.config(text = message) count -= 12 else: instance_count = 0 for instance in share_hist.distinct(username): if text == instance['share'] and connection == instance['friend']: label.config(text = 'That is a repeat!') return instance_count += 1 if instance_count == len(share_hist.distinct(username)): t = datetime.datetime.now() if t.minute < 10: minute = '0'+str(t.minute) else: minute = str(t.minute) timestamp = str(t.month) + '/' + str(t.day) +'/' + str(t.year) + ',' +str(t.hour) + ':' + minute share_hist.insert({username:{'friend':connection,'share':text, 'date': timestamp}}) shared_source.insert({connection:{'link': text, 'friend':username}}) label.config(text = message) def url_display(url): """ downloads a youtube video into a file, then plays that file within the gui space url - raw string url from gui input """ myfile="playingvid.mp4" try: os.remove(myfile) except OSError: k=2 os.system('youtube-dl -o playingvid.mp4 %s'%url) gobject.threads_init() window_id = canvas.winfo_id() player = gst.element_factory_make('playbin2', 'player') player.set_property('video-sink', None) x=os.path.dirname(os.path.realpath(__file__)) player.set_property('uri', 'file://%s/playingvid.mp4'%(x)) player.set_state(gst.STATE_PLAYING) bus = player.get_bus() bus.add_signal_watch() bus.enable_sync_message_emission() bus.connect('sync-message::element', on_sync_message, window_id) def on_sync_message(bus, message, window_id): if not message.structure is None: if message.structure.get_name() == 'prepare-xwindow-id': image_sink = message.src image_sink.set_property('force-aspect-ratio', True) image_sink.set_xwindow_id(window_id) def add_link(new_link): """ adds a link to the shared_viewer display """ return shared_viewer.insert(new_link) def get_new_shares(): """ will update the recieved, or shared_viewer display """ global share_count global username for i in shared_source.distinct(username): if i['link'] not in shared_viewer.distinct('link'): add_link(i) link = new_shared_list.canvas.text([0,share_count], text = str(i['link']), activefill = 'blue') link.bind('<Double-1>', onObjectClick) share_count -= 12 def onObjectClick(event): """ allows us to double click on a link and show it, as well as remove it from the list of need to view links """ global username for thing in point_total.find(): for key in thing: if key == username: existing = thing[username] point_total.update({username: existing}, {'$inc': {username:1}}) points.config(text = str(existing + 1)) index = event.widget.find_closest(event.x, event.y) i = shared_viewer.find() access = i[index[0] - 1] link = access['link'] url_display(link) shared_source.remove({username: {'link':access['link'], 'friend':access['friend']}}) #General set-up pretty = 'light cyan' gui = Gui() gui.title('MusicswAPPer') gui.row() gui.la(text = 'Welcome to the swAPP', bg = 'black', fg='cyan', justify = 'left', font = ('Times', 20, 'bold italic'), height = 2, relief = 'groove') gui.endrow() gui.row(bg=pretty) gui.col(bg=pretty) gui.bu(text = 'Refresh', fg = 'forest green', font = ('Times', 15, 'bold'), bg=pretty, activeforeground='forest green', activebackground='powder blue', command = update) gui.row([0,1], pady = 10, bg=pretty) gui.endrow() gui.la(text = 'Share a link', bg = pretty, font = ('Times', 13, 'italic'), anchor = 'left', justify='left') friend = gui.en(text = 'Who do you want to share with?', disabledforeground = 'light gray', fg = 'black', font = ('Times', 12)) en = gui.en(text = 'Insert URL here', font = ('Times', 12)) gui.bu(text = 'Share', font = ('Times', 15, 'bold'), bg = pretty, fg = 'forest green', activebackground = 'powder blue', activeforeground = 'forest green', command = print_entry) label = gui.la(bg=pretty, font=('Times', 11)) gui.row([0,1], pady = 10, bg=pretty) gui.endrow() gui.la(text = 'Share history', bg=pretty, font=('Times',13, 'italic')) share_history = gui.sc(width = 500, height = 300) share_history.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty, bd=0) gui.endcol() gui.col(bg=pretty) gui.ca(height = 10, width = 5, bg=pretty, bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty) gui.endcol() gui.col(bg=pretty) gui.la(text = 'New Shares from Friends', bg = pretty, font=('Times', 13, 'italic')) new_shared_list = gui.sc(width = 500, height = 100) new_shared_list.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) gui.row([0,1], pady = 30, bg=pretty) gui.endrow() gui.la(text = 'Viewer', bg=pretty, font = ('Times', 13, 'italic')) canvas = gui.ca(width = 500, height = 300, bg='black') canvas.configure(confine = False, scrollregion = (0,0,2000, 2000)) points = gui.la(bg=pretty) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty) gui.endcol() gui.endrow() initialize() gui.mainloop()
shared_viewer.remove(access) shared_source.remove(access) #General set-up g.title('Minumum Deliverable URLSender') g.row() g.col() g.la(text = 'Welcome to musicswAPPer') g.bu(text = 'Update Data', command = MediaShare.update()) g.row([0,1], pady = 10) g.endrow() g.la(text = 'Share a link!') friend = g.en(text = 'Who do you want to share with?') en = g.en(text = 'Insert URL here') g.bu(text = 'Share', command = MediaShare.print_entry()) label = g.la() g.row([0,1], pady = 10) g.endrow() g.la(text = 'Share History') share_history = g.sc(width = 500, height = 300) share_history.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) g.endcol() g.col() g.ca(height = 100, width = 50)
circle.config(fill=color) except: message = 'probaly an unknown color name' print message g = Gui() g.title('Gui') button = g.bu(text='Press it', command=callback1) canvas = g.ca(width=500, height=500) circle = None #canvas.config(bg='black') #item = canvas.rectangle([[0, 0], [200, 200]], #fill='white', outline='orange',width=10) #item = canvas.oval([[0, 0], [200, 100]], #fill='white', outline='orange',width=10) #item = canvas.line([[0, 100], [100, 200], [200, 100]], width=10, fill='white') #item = canvas.polygon([[0, 100], [100, 200], [200, 100]], width=10, fill='white', outline='orange') #entry = g.en(text='Default text.') #print entry.get() #text = g.te(width=100, height=5) #text.insert(2.3, 'nother') #text.delete(0.2, END) #print text.get(0.0, END) entry = g.en(text='Type a color') button_color = g.bu(text='Change color', command=change_color) g.mainloop()