def wetbulb(T, p, q=None, Td=None, w=None, cpd=None, Rd=None, Rv=None, Lv=None): ''' Return wet-bulb temperature T_w [K] given temperature T [K], pressure p [mb] and exactly one of the following: - Specific humidity q [g/kg] - Dew-point temperature Td [K] - Mass-mixing ratio w [g/kg] Specific humidity q can be given as a positional argument while Td and w must be named explicitly. Uses Bohren & Albrecht p 283 eq 6.70. ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] if cpd is None: cpd = Parameters()['Cpd'] if Lv is None: Lv = Parameters()['Lv'] if not q is None: return squeeze(_thermodyn.wetbulb_from_q(cpd, Lv, Rd, Rv, T, p, q)) elif not Td is None: return squeeze(_thermodyn.wetbulb_from_tdew(cpd, Lv, Rd, Rv, T, p, Td)) elif not w is None: return squeeze(_thermodyn.wetbulb_from_w(cpd, Lv, Rd, Rv, T, p, w)) else: print "CliMT error: Function thermodyn.wetbulb requires one of q, Td, or \
def wetbulb(T, p, q=None, Td=None, w=None, cpd=None, Rd=None, Rv=None, Lv=None): """ Return wet-bulb temperature T_w [K] given temperature T [K], pressure p [mb] and exactly one of the following: - Specific humidity q [g/kg] - Dew-point temperature Td [K] - Mass-mixing ratio w [g/kg] Specific humidity q can be given as a positional argument while Td and w must be named explicitly. Uses Bohren & Albrecht p 283 eq 6.70. """ if Rd is None: Rd = Parameters()["Rd"] if Rv is None: Rv = Parameters()["Rv"] if cpd is None: cpd = Parameters()["Cpd"] if Lv is None: Lv = Parameters()["Lv"] if not q is None: return squeeze(_thermodyn.wetbulb_from_q(cpd, Lv, Rd, Rv, T, p, q)) elif not Td is None: return squeeze(_thermodyn.wetbulb_from_tdew(cpd, Lv, Rd, Rv, T, p, Td)) elif not w is None: return squeeze(_thermodyn.wetbulb_from_w(cpd, Lv, Rd, Rv, T, p, w)) else: print "CliMT error: Function thermodyn.wetbulb requires one of q, Td, or \
def sanitize_item(cls, key, val): key = squeeze(key) val = squeeze(val) if val: func_name = cls.item_lookup.get(key, key) if func_name.startswith('sanitize'): func_name = 'default' val = getattr(cls, func_name, cls.default)(val) return key, val
def __call__(self, videos): """Support joint transform :param videos: np.ndarray or a list of np.ndarray :return: """ videos = utils.unsqueeze(videos) h_orig, w_orig = videos[0].shape[-3:-1] for attempt in range(10): ret = [] area = h_orig * w_orig target_area = random.uniform(0.4, 1.0) * area aspect_ratio = random.uniform(3. / 4, 4. / 3) w = int(round(math.sqrt(target_area * aspect_ratio))) h = int(round(math.sqrt(target_area / aspect_ratio))) if random.random() < 0.5: w, h = h, w if w <= w_orig and h <= h_orig: x1 = random.randint(0, w_orig - w) y1 = random.randint(0, h_orig - h) for tp, video in zip(self.transform_pixel, videos): video = video[..., y1:y1 + h, x1:x1 + w, :] video = imgproc.resize(video, (self.size, self.size), 'bilinear') if tp: video[ ..., 0] = (video[..., 0] - 128) * (self.size / w) + 128 video[ ..., 1] = (video[..., 1] - 128) * (self.size / h) + 128 ret.append(video) return utils.squeeze(ret) # Fallback ret = [] scales = [ Scale(self.size, tp, 'bilinear') for tp in self.transform_pixel ] crop = CenterCrop(self.size) for scale, video in zip(scales, videos): video = crop(scale(video)) ret.append(video) return utils.squeeze(ret)
def calculate_user_preferences(user_id_list: str=None, start: str=Config.train_start, end:str=Config.train_end, save_path: str='./dev_recommendation_sources/'): if user_id_list == 'dev': user_id_list = load_pickle(Config.dev_user_list) elif user_id_list == 'test': user_id_list = load_pickle(Config.test_user_list) elif isinstance(user_id_list, str): # 파일 경로를 입력할 경우 user_id_list = load_pickle(user_id_list) print('Load calculating tools...', end='\t') try: user_time_read = load_user_time_read(Config.user_time_read) post_id_encoder = PostIdEncoder(Config.encodings_root) tfidf_generator = TFIDFGenerator(Config.tfidf_root) except: # When import in Jupyter Notebook user_time_read = load_user_time_read("../preprocessed/user_time_read.json") post_id_encoder = PostIdEncoder("../encodings/") tfidf_generator = TFIDFGenerator("../tfidf") print('loaded!') post_meta_id = [] # user_id_list의 유저들이 조회한 모든 글 posts_raw = [] # 유저들의 로그에서 등장한 모든 글을 담을 리스트 user_preferences_raw = [] # 유저들의 feature 벡터를 담을 리스트 for user_id in tqdm(user_id_list, desc=f'User Preference Extraction ({start}-{end})'): # 설정한 구간에 대한 해당 유저의 로그 history = filter_read_by_time(user_time_read[user_id], start, end) history = squeeze(list(map(lambda x: x[-1], history))) # 유저 로그로부터 TF-IDF 행렬 생성 user_tfidf = tfidf_generator.generate(post_id_encoder.transform(history), drop_id=False) # # TF-IDF 행렬로부터 유저 feature 벡터를 생성 preference = sparse.csr_matrix(user_tfidf.iloc[:, 1:].values.sum(axis=0)[:, np.newaxis]) # post_meta_id 컬럼을 제외한 뒤 summation user_tfidf = user_tfidf.groupby('post_meta_id').first().reset_index() # faster than drop_duplicates() user_tfidf = user_tfidf.loc[~user_tfidf['post_meta_id'].isin(post_meta_id), :] if len(user_tfidf) > 0: post_meta_id.extend(user_tfidf['post_meta_id'].tolist()) posts_raw.append(sparse.csr_matrix(user_tfidf.iloc[:, 1:])) # post_meta_id 컬럼을 제외하고 append -> post_meta_id 리스트를 개별적으로 생성하므로 불필요 user_preferences_raw.append(preference) print('Postprocessing...', end='\t') posts = sparse.vstack(posts_raw) user_preferences = sparse.hstack(user_preferences_raw) idf = np.array(np.log(tfidf_generator.DF.values.squeeze()) - np.log((posts != 0).sum(axis=0) + 1e-4)) # 1e-4: to prevent ZeroDivisionError recommend_output = (posts.multiply(idf)).dot(user_preferences) print('finished!') if save_path: interval = f'{start}-{end}' if interval not in os.listdir(save_path): os.mkdir(os.path.join(save_path, interval)) save_path = os.path.join(save_path, interval) sparse.save_npz(os.path.join(save_path, f'recommend_output.npz'), recommend_output) sparse.save_npz(os.path.join(save_path, f'user_preferences.npz'), user_preferences) np.save(os.path.join(save_path, f'idf.npy'), idf) sparse.save_npz(os.path.join(save_path, f'posts.npz'), posts) save_as_pickle(os.path.join(save_path, f'post_meta_id.pkl'), post_meta_id) print(f'Saved successfully in {save_path}😎') else: return recommend_output, user_preferences, idf, posts, post_meta_id
def __getitem__(self, key): for obj in [self.Params, self.Grid, self.State]: if key in obj: if type(obj[key]) is type('string'): return obj[key] else: return squeeze(obj[key]) raise IndexError, '\n\n CliMT.State: %s not in Params, Grid or State' % str( key)
def thetae_old(T, p, q): """ Return equivalent potential temperature thetae [K] given temperature T [K], pressure p [mb], specific humidity q [g/kg]. Use Eq. (38) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 """ return squeeze(_thermodyn.thetae_old(T, p, q))
def CAPE(p, T, q, Virtual=True, MixedLayerDepth=100.0, Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None): """ Returns convective available potential energy [J/kg] given pressure p [mb], temperature T [K], spec. humidity q [g/kg]. Use average parcel properties over layer of depth MixedLayerDepth [mb] above ground. If Virtual=True, apply virtual temp correction. """ if Rd is None: Rd = Parameters()["Rd"] if Rv is None: Rv = Parameters()["Rv"] if lv0 is None: lv0 = Parameters()["Lv"] if cpd is None: cpd = Parameters()["Cpd"] if cpv is None: cpv = Parameters()["Cpv"] if cl is None: cl = Parameters()["Cl"] if alltrue(p[0] > p[-1]): p = p[::-1] T = T[::-1] q = q[::-1] if Virtual: ivirt = 1 else: ivirt = 0 return squeeze(_thermodyn.cape(Rd, Rv, lv0, cpd, cpv, cl, ivirt, MixedLayerDepth, p, T, q))
def _get_idf(batch: pd.DataFrame, vocab: list, num_docs: int) -> pd.DataFrame: """batch 데이터의 IDF 리턴 - IDF 방식: logarithmic - Reference: https://ko.wikipedia.org/wiki/Tf-idf Args: batch (pd.DataFrame): metadata의 일부 vocab (list): IDF에 활용할 키워드 리스트 num_docs (int): metadata(모집단)의 모든 문서, 즉 행의 개수 Returns: pd.DataFrame: (1, vocab 수) 크기의 IDF 행렬 """ vocab_size = len(vocab) idf = pd.DataFrame(np.zeros((1, vocab_size)), columns=vocab) kwd_list = set(squeeze(batch["keyword_list"].tolist())) kwd_list_filtered = list(filter(lambda x: x in vocab, kwd_list)) pbar = tqdm(kwd_list_filtered) pbar.set_description("Getting IDF") for tag in pbar: if tag in vocab: idf[tag] = np.log(num_docs) - np.log( sum(batch["keyword_list"].apply(lambda x: tag in x))) return idf
def theta_old(T,p,q): ''' Return potential temperature theta [K] given temperature T [K], pressure p [mb], specific humidity q [g/kg]. Use Eq. (7) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.theta_old(T,p,q))
def thetae(T, p, wt=None, Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None, p0=None): """ Return equivalent potential temperature thetae [K] given temperature T [K], pressure p [mb], and total water mass mixing ratio wt [g/kg]. If wt is not specified, parcel is assumed to be just saturated (no condensate). If wt is specified and is less that saturation mixing ratio, thetae is computed at the lifting condensation level. Uses Eq. (6.119) in Bohren+Albrecht, p.293. """ if Rd is None: Rd = Parameters()["Rd"] if Rv is None: Rv = Parameters()["Rv"] if lv0 is None: lv0 = Parameters()["Lv"] if cpd is None: cpd = Parameters()["Cpd"] if cpv is None: cpv = Parameters()["Cpv"] if cl is None: cl = Parameters()["Cl"] if p0 is None: p0 = 1000.0 if wt is None: wt = -1.0 * ones(shape(T)) return squeeze(_thermodyn.thetae(Rd, Rv, lv0, cpd, cpv, cl, p0, p, T, wt))
def es(T): ''' Return saturation partial pressure of water vapour es [mb] at temperature T [K] Use Boren and Albrecht "Atmospheric Thermodynamics", p 198 ''' return squeeze(_thermodyn.es(T))
def theta_old(T,p,q): ''' Return potential temperature theta [K] given temperature T [K], pressure p [mb], specific humidity q [g/kg]. Use Eq. (7) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.theta_old(T,p,q))
def tdew(p,q): ''' Return dew point temperature tdew [K] at pressure p [mb] and specific humidity q [g/kg] Use Eq. (11) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tdew(p,q))
def pseudoadiab(p, p0, T0, thetae=None, \ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None): ''' Returns the temperature [K] at the pressure levels p [mb] along the psudoadiabat identified by pressure p0 [mb] and temperature T0 [K]. If equivalent potential temp thetae is input, then it identifies the adiabat overriding p0,T0. ''' if Rd is None: Rd=Parameters()['Rd'] if Rv is None: Rv=Parameters()['Rv'] if lv0 is None: lv0=Parameters()['Lv'] if cpd is None: cpd=Parameters()['Cpd'] if cpv is None: cpv=Parameters()['Cpv'] if cl is None: cl=Parameters()['Cl'] if thetae is not None: p0 = zeros(shape(thetae)) + 1. T0 = thetae*(p0/1000.)**(Rd/cpd) flip=False if alltrue(p[0]>p[-1]): p=p[::-1] flip=True T=squeeze(_thermodyn.pseudoadiab(Rd,Rv,lv0,cpd,cpv,cl,p,p0,T0)) if flip: T = T[::-1] return T
def tdew(p,q): ''' Return dew point temperature tdew [K] at pressure p [mb] and specific humidity q [g/kg] Use Eq. (11) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tdew(p,q))
def recommend(recommend_src: str = Config.recommend_src, output_root: str = Config.output_root): print('Loading recommendation tools...', end='\t') user_time_read = load_user_time_read(Config.user_time_read) user_id_list = load_pickle(Config.test_user_list) recommend_meta = sparse.load_npz( os.path.join(recommend_src, 'recommend_output.npz')) post_meta_id = load_pickle(os.path.join(recommend_src, 'post_meta_id.pkl')) encoder = PostIdEncoder(Config.encodings_root) print('loaded!') with open(os.path.join(output_root, 'recommend.txt'), 'w') as file: for idx in tqdm(range(len(user_id_list)), desc='Generate Recommendations'): user_id = user_id_list[idx] seens = filter_read_by_time(user_time_read[user_id], start=Config.train_start, end=Config.train_end) seens = squeeze(list(map(lambda x: x[-1], seens))) recommend_raw = recommend_meta[:, idx] recommend_raw = pd.Series( recommend_raw.toarray().flatten(), index=post_meta_id).sort_values(ascending=False) recommend_raw = recommend_raw[ ~recommend_raw.index.isin(seens)].head(100).index.tolist() recommend = list( map(lambda x: encoder.inverse_transform(x), recommend_raw)) file.write(f'{user_id} ') file.write(f"{' '.join(recommend)}\n") print(f"Saved 'recommend.txt' in {output_root}")
def pseudoadiab(p, p0, T0, thetae=None, \ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None): ''' Returns the temperature [K] at the pressure levels p [mb] along the psudoadiabat identified by pressure p0 [mb] and temperature T0 [K]. If equivalent potential temp thetae is input, then it identifies the adiabat overriding p0,T0. ''' if Rd is None: Rd=Parameters()['Rd'] if Rv is None: Rv=Parameters()['Rv'] if lv0 is None: lv0=Parameters()['Lv'] if cpd is None: cpd=Parameters()['Cpd'] if cpv is None: cpv=Parameters()['Cpv'] if cl is None: cl=Parameters()['Cl'] if thetae is not None: p0 = zeros(shape(thetae)) + 1. T0 = thetae*(p0/1000.)**(Rd/cpd) flip=False if alltrue(p[0]>p[-1]): p=p[::-1] flip=True T=squeeze(_thermodyn.pseudoadiab(Rd,Rv,lv0,cpd,cpv,cl,p,p0,T0)) if flip: T = T[::-1] return T
def CINE(p, T, q, Virtual=True, MixedLayerDepth=100.,\ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None): ''' Returns convective inhibition energy [J/kg] given pressure p [mb], temperature T [K], spec. humidity q [g/kg] Use average parcel properties over layer of depth MixedLayerDepth [mb] above ground. If Virtual=True, apply virtual temp correction. ''' if Rd is None: Rd=Parameters()['Rd'] if Rv is None: Rv=Parameters()['Rv'] if lv0 is None: lv0=Parameters()['Lv'] if cpd is None: cpd=Parameters()['Cpd'] if cpv is None: cpv=Parameters()['Cpv'] if cl is None: cl=Parameters()['Cl'] if p[0]>p[-1]: p=p[::-1] T=T[::-1] q=q[::-1] if Virtual: ivirt = 1 else: ivirt = 0 return squeeze(_thermodyn.cine(Rd,Rv,lv0,cpd,cpv,cl,ivirt,MixedLayerDepth,p,T,q))
def CINE(p, T, q, Virtual=True, MixedLayerDepth=100.,\ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None): ''' Returns convective inhibition energy [J/kg] given pressure p [mb], temperature T [K], spec. humidity q [g/kg] Use average parcel properties over layer of depth MixedLayerDepth [mb] above ground. If Virtual=True, apply virtual temp correction. ''' if Rd is None: Rd=Parameters()['Rd'] if Rv is None: Rv=Parameters()['Rv'] if lv0 is None: lv0=Parameters()['Lv'] if cpd is None: cpd=Parameters()['Cpd'] if cpv is None: cpv=Parameters()['Cpv'] if cl is None: cl=Parameters()['Cl'] if p[0]>p[-1]: p=p[::-1] T=T[::-1] q=q[::-1] if Virtual: ivirt = 1 else: ivirt = 0 return squeeze(_thermodyn.cine(Rd,Rv,lv0,cpd,cpv,cl,ivirt,MixedLayerDepth,p,T,q))
def es(T): ''' Return saturation partial pressure of water vapour es [mb] at temperature T [K] Use Boren and Albrecht "Atmospheric Thermodynamics", p 198 ''' return squeeze(_thermodyn.es(T))
def squeeze(self, dimension=None): """Return a new Variable object with squeezed data. Parameters ---------- dimensions : None or str or tuple of str, optional Selects a subset of the length one dimensions. If a dimension is selected with length greater than one, an error is raised. If None, all length one dimensions are squeezed. Returns ------- squeezed : Variable This array, but with with all or a subset of the dimensions of length 1 removed. Notes ----- Although this operation returns a view of this variable's data, it is not lazy -- the data will be fully loaded. See Also -------- numpy.squeeze """ dimensions = dict(zip(self.dimensions, self.shape)) return utils.squeeze(self, dimensions, dimension)
def pdryadiab(T,theta,q): ''' Return pressure level pdryadiab [mb] at which temperature is T [K] on the dry (i.e. unsaturated) adiabat identified by potential temperature theta [K] and specific humidity q [g/kg]. Use Eq. (7) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.pdryadiab(T,theta,q))
def tdryadiab(theta,p,q): ''' Return temperature tdryadiab [K] at level p [mb] on the dry (i.e. unsaturated) adiabat identified by potential temperature theta [K] and specific humidity q [g/kg]. Use Eq. (7) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tdryadiab(theta,p,q))
def tstar(T,p,q): ''' Return saturation point temperature tstar [K] (i.e. temperature at lifting condensation level) given temperature T [K], pressure p [mb], specific humidity q [g/kg]. Use Eq. (12) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tstar(T,p,q))
def tdryadiab(theta,p,q): ''' Return temperature tdryadiab [K] at level p [mb] on the dry (i.e. unsaturated) adiabat identified by potential temperature theta [K] and specific humidity q [g/kg]. Use Eq. (7) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tdryadiab(theta,p,q))
def pdryadiab(T,theta,q): ''' Return pressure level pdryadiab [mb] at which temperature is T [K] on the dry (i.e. unsaturated) adiabat identified by potential temperature theta [K] and specific humidity q [g/kg]. Use Eq. (7) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.pdryadiab(T,theta,q))
def tstar(T,p,q): ''' Return saturation point temperature tstar [K] (i.e. temperature at lifting condensation level) given temperature T [K], pressure p [mb], specific humidity q [g/kg]. Use Eq. (12) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tstar(T,p,q))
def qs(T, p, Rd=None, Rv=None): ''' Return saturation specific humidity qs [g/kg] at temperature T [K] and pressure p [mb] Use Boren and Albrecht "Atmospheric Thermodynamics", p 186 ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] return squeeze(_thermodyn.qs(Rd,Rv,T,p))
def ws(T, p, Rd=None, Rv=None): ''' Return saturation mass mixing ration of water vapour ws [g/kg] at temperature T [K] and pressure p [mb] Use Boren and Albrecht "Atmospheric Thermodynamics", p 186 ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] return squeeze(_thermodyn.ws(Rd,Rv,T,p))
def qs(T, p, Rd=None, Rv=None): ''' Return saturation specific humidity qs [g/kg] at temperature T [K] and pressure p [mb] Use Boren and Albrecht "Atmospheric Thermodynamics", p 186 ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] return squeeze(_thermodyn.qs(Rd,Rv,T,p))
def ws(T, p, Rd=None, Rv=None): ''' Return saturation mass mixing ration of water vapour ws [g/kg] at temperature T [K] and pressure p [mb] Use Boren and Albrecht "Atmospheric Thermodynamics", p 186 ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] return squeeze(_thermodyn.ws(Rd,Rv,T,p))
def esflatau(T,i): ''' Return saturation partial pressure of water vapor es [mb] at temperature T [K]. Use 8th order polynomial fit of Flatau et al (1992),J. App. Met . 31, 1507-1513, Table 4 i = 1 => return vapour pressure over water (valid -85C < t < 70C) i = 2 => return vapour pressure over ice (valid -90C < t < 0C) ''' return squeeze(_thermodyn.esflatau(T,i))
def tmoistadiab(thetaes,p): ''' Return temperature [K] at level p [mb] on the moist (i.e. saturated) pseudo-adiabat identified by saturation equivalent potential temperature thetaes [K]. Do it by varying t until delthetae := thetaes - thetae(T,p,qs(T,p)) = 0 Use Eq. (43) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tmoistadiab(thetaes,p))
def esflatau(T,i): ''' Return saturation partial pressure of water vapor es [mb] at temperature T [K]. Use 8th order polynomial fit of Flatau et al (1992),J. App. Met . 31, 1507-1513, Table 4 i = 1 => return vapour pressure over water (valid -85C < t < 70C) i = 2 => return vapour pressure over ice (valid -90C < t < 0C) ''' return squeeze(_thermodyn.esflatau(T,i))
def tmoistadiab(thetaes,p): ''' Return temperature [K] at level p [mb] on the moist (i.e. saturated) pseudo-adiabat identified by saturation equivalent potential temperature thetaes [K]. Do it by varying t until delthetae := thetaes - thetae(T,p,qs(T,p)) = 0 Use Eq. (43) in Bolton (1980), Mon. Wea. Rev. 108, 1046-1053 ''' return squeeze(_thermodyn.tmoistadiab(thetaes,p))
def theta(T, p, q=None, Rd=None, Rv=None, cpd=None, cpv=None, p0=None): ''' Return potential temperature theta [K] given temperature T [K], pressure p [mb], specific humidity q [g/kg]. ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] if cpd is None: cpd = Parameters()['Cpd'] if cpv is None: cpv = Parameters()['Cpv'] if p0 is None: p0 = 1000. if q is None: q = zeros(shape(T))*0. return squeeze(_thermodyn.theta(Rd, Rv, cpd, cpv, p0, p, T, q))
def theta(T, p, q=None, Rd=None, Rv=None, cpd=None, cpv=None, p0=None): ''' Return potential temperature theta [K] given temperature T [K], pressure p [mb], specific humidity q [g/kg]. ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] if cpd is None: cpd = Parameters()['Cpd'] if cpv is None: cpv = Parameters()['Cpv'] if p0 is None: p0 = 1000. if q is None: q = zeros(shape(T))*0. return squeeze(_thermodyn.theta(Rd, Rv, cpd, cpv, p0, p, T, q))
def get_df(batch: pd.DataFrame, vocab: list) -> pd.DataFrame: vocab_size = len(vocab) df = pd.DataFrame(np.zeros((1, vocab_size)), columns=vocab) kwd_list = set(squeeze(batch["keyword_list"].tolist())) kwd_list_filtered = list(filter(lambda x: x in vocab, kwd_list)) pbar = tqdm(kwd_list_filtered) pbar.set_description("Getting DF") for tag in pbar: if tag in vocab: df[tag] = sum(batch["keyword_list"].apply(lambda x: tag in x)) return df
def wsflatau(T,p,i=None,Rd=None,Rv=None): ''' Return saturation mass mixing ratio of water vapor ws [g/kg] at temperature T [K] and pressure p [mb] Use 8th order polynomial fit of Flatau et al (1992), J. App. Met . 31, 1507-1513, Table 4 i = 1 => return sat. mix. ratio over water (valid -85C < t < 70C) i = 2 => return sat. mix. ratio over ice (valid -90C < t < 0C) ''' if i is None: i = 1 if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] return squeeze(_thermodyn.wsflatau(T,p,i))
def wsflatau(T,p,i=None,Rd=None,Rv=None): ''' Return saturation mass mixing ratio of water vapor ws [g/kg] at temperature T [K] and pressure p [mb] Use 8th order polynomial fit of Flatau et al (1992), J. App. Met . 31, 1507-1513, Table 4 i = 1 => return sat. mix. ratio over water (valid -85C < t < 70C) i = 2 => return sat. mix. ratio over ice (valid -90C < t < 0C) ''' if i is None: i = 1 if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] return squeeze(_thermodyn.wsflatau(T,p,i))
def thetaes(T, p, \ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None, p0=None): ''' Return saturation equivalent potential temperature thetae [K] given temperature T [K] and pressure p [mb] Uses Eq. (6.123) in Bohren+Albrecht, p.293. ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] if lv0 is None: lv0 = Parameters()['Lv'] if cpd is None: cpd = Parameters()['Cpd'] if cpv is None: cpv = Parameters()['Cpv'] if cl is None: cl = Parameters()['Cl'] if p0 is None: p0 = 1000. return squeeze(_thermodyn.thetaes(Rd, Rv, lv0, cpd, cpv, cl, p0, p, T))
def thetaes(T, p, \ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None, p0=None): ''' Return saturation equivalent potential temperature thetae [K] given temperature T [K] and pressure p [mb] Uses Eq. (6.123) in Bohren+Albrecht, p.293. ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] if lv0 is None: lv0 = Parameters()['Lv'] if cpd is None: cpd = Parameters()['Cpd'] if cpv is None: cpv = Parameters()['Cpv'] if cl is None: cl = Parameters()['Cl'] if p0 is None: p0 = 1000. return squeeze(_thermodyn.thetaes(Rd, Rv, lv0, cpd, cpv, cl, p0, p, T))
def refresh(self, Component): """ Update monitor display. """ if not gotMatplotlib or not self.Monitoring: return for key in self.Figure.keys(): Field = Component[key] Panel = self.Figure[key] grid = Component.Grid # If Field is 3D, show zonal average if Field.ndim == 3: Field = average(Field, axis=grid.grid_layout.index('lon')) Field = squeeze(Field) # Reset data if Field.ndim == 1: if min(Field) == max(Field) == 0.: Field = Field + 1.e-7 MinVal = min(Field) - 0.01 * abs(min(Field)) MaxVal = max(Field) + 0.01 * abs(max(Field)) if Panel.orientation == 0: Panel.handle.set_xdata(Field) Panel.axes.set_xlim([MinVal, MaxVal]) Panel.axes.get_xaxis().get_major_formatter( ).set_powerlimits((-2, 3)) else: Panel.handle.set_ydata(Field) Panel.axes.set_ylim([MinVal, MaxVal]) if Field.ndim == 2: if Panel.orientation == 0: Panel.handle.set_data(Field.transpose()[::-1]) if Panel.orientation == 1: Panel.handle.set_data(Field.transpose()) # update normalization Panel.handle.set_norm(None) # Reset title day = Component.State.ElapsedTime / 86400. try: TitleText = Panel.TitleTemplate % day except: TitleText = Panel.TitleTemplate % (day, min( ravel(Field)), max(ravel(Field))) Panel.title.set_text(TitleText) # Redraw figure self.manager.canvas.draw()
def __call__(self, videos): """Support joint transform :param videos: np.ndarray or a list of np.ndarray :return: """ if random.random() < 0.5: videos = utils.unsqueeze(videos) ret = [] for tp, video in zip(self.transform_pixel, videos): video = video[..., ::-1, :] if tp: video[..., 0] = 255 - video[..., 0] ret.append(video.copy()) return utils.squeeze(ret) else: return videos
def qsflatau(T, p, i=None, Rd=None, Rv=None): """ Return saturation specific humidity qs [g/kg] at temperature T [K] and pressure p [mb] Use 8th order polynomial fit of Flatau et al (1992), J. App. Met . 31, 1507-1513, Table 4 i = 1 => return sat. mix. ratio over water (valid -85C < t < 70C) i = 2 => return sat. mix. ratio over ice (valid -90C < t < 0C) """ if i is None: i = 1 if Rd is None: Rd = Parameters()["Rd"] if Rv is None: Rv = Parameters()["Rv"] return squeeze(_thermodyn.qsflatau(Rd, Rv, T, p, i))
def z(p, T, p0=None, R=None, g=None): ''' Returns height z given temperature T [K] and pressure p. If gas constant R is not specified, then dry air value is used. If grav. accn. g is not specified, then earth value is used. If surface pressure p0 is not specified, then p0=p[-1]. ''' flip=False if alltrue(p[0]>p[-1]): p=p[::-1] flip=True if R is None: R=Parameters()['Rd'] if g is None: g=Parameters()['g'] if p0 is None: p0=p[-1] z=squeeze(_thermodyn.z(R,g,p0,p,T)) if flip: z=z[::-1] return z
def z(p, T, p0=None, R=None, g=None): ''' Returns height z given temperature T [K] and pressure p. If gas constant R is not specified, then dry air value is used. If grav. accn. g is not specified, then earth value is used. If surface pressure p0 is not specified, then p0=p[-1]. ''' flip=False if alltrue(p[0]>p[-1]): p=p[::-1] flip=True if R is None: R=Parameters()['Rd'] if g is None: g=Parameters()['g'] if p0 is None: p0=p[-1] z=squeeze(_thermodyn.z(R,g,p0,p,T)) if flip: z=z[::-1] return z
def numbers(cls, number): number = number.lstrip(';., ') if '+' in number: number = '+' + number.split('+', 1)[1] elif not number.startswith(tuple('+(0123456789'.split())): number = number.lstrip((string.ascii_letters + ' :/')) if number: if not number.startswith('('): # Remove (0) things including the 0 inside strings number = re.sub(r'\(\s*0\s*\)', ' ', number) number = re.sub(r'[()/.\\-]', ' ', number) number = squeeze(number) # Avoid single leading zeros if number[0] == '0' and number[1] == ' ': number = '0' + number[2:] number = number.replace("'", '') return number
def refresh(self, Component): """ Update monitor display. """ if not gotMatplotlib or not self.Monitoring: return for key in self.Figure.keys(): Field = Component[key] Panel = self.Figure[key] # If Field is 3D, show zonal average if ndim(Field) == 3: Field = average(Field, axis=2) Field = squeeze(Field) # Reset data if ndim(Field) == 1: if min(Field) == max(Field) == 0.0: Field = Field + 1.0e-7 MinVal = min(Field) - 0.01 * abs(min(Field)) MaxVal = max(Field) + 0.01 * abs(max(Field)) if Panel.orientation == 0: Panel.handle.set_xdata(Field) Panel.axes.set_xlim([MinVal, MaxVal]) else: Panel.handle.set_ydata(Field) Panel.axes.set_ylim([MinVal, MaxVal]) if ndim(Field) == 2: if Panel.orientation == 0: Panel.handle.set_data(Field[::-1]) if Panel.orientation == 1: Panel.handle.set_data(Field) # update normalization Panel.handle.set_norm(None) # Reset title day = Component.State.ElapsedTime / 86400.0 try: TitleText = Panel.TitleTemplate % day except: TitleText = Panel.TitleTemplate % (day, min(ravel(Field)), max(ravel(Field))) Panel.title.set_text(TitleText) # Redraw figure self.manager.canvas.draw()
def thetae(T, p, wt=None, \ Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None, p0=None): ''' Return equivalent potential temperature thetae [K] given temperature T [K], pressure p [mb], and total water mass mixing ratio wt [g/kg]. If wt is not specified, parcel is assumed to be just saturated (no condensate). If wt is specified and is less that saturation mixing ratio, thetae is computed at the lifting condensation level. Uses Eq. (6.119) in Bohren+Albrecht, p.293. ''' if Rd is None: Rd = Parameters()['Rd'] if Rv is None: Rv = Parameters()['Rv'] if lv0 is None: lv0 = Parameters()['Lv'] if cpd is None: cpd = Parameters()['Cpd'] if cpv is None: cpv = Parameters()['Cpv'] if cl is None: cl = Parameters()['Cl'] if p0 is None: p0 = 1000. if wt is None: wt = -1.*ones(shape(T)) return squeeze(_thermodyn.thetae(Rd, Rv, lv0, cpd, cpv, cl, p0, p, T, wt))
def thetaes(T, p, Rd=None, Rv=None, lv0=None, cpd=None, cpv=None, cl=None, p0=None): """ Return saturation equivalent potential temperature thetae [K] given temperature T [K] and pressure p [mb] Uses Eq. (6.123) in Bohren+Albrecht, p.293. """ if Rd is None: Rd = Parameters()["Rd"] if Rv is None: Rv = Parameters()["Rv"] if lv0 is None: lv0 = Parameters()["Lv"] if cpd is None: cpd = Parameters()["Cpd"] if cpv is None: cpv = Parameters()["Cpv"] if cl is None: cl = Parameters()["Cl"] if p0 is None: p0 = 1000.0 return squeeze(_thermodyn.thetaes(Rd, Rv, lv0, cpd, cpv, cl, p0, p, T))
def __getitem__(self, idx): vid_name, target = self.dataset[idx] length = len( glob.glob( os.path.join(self.root, rgb_folder_name, vid_name, '*.' + rgb_pattern.split('.')[1]))) - 1 if self.train: samples = np.random.randint(0, length - self.n_frames + 1, self.n_samples) # randint: exclusive else: if length > self.n_samples: samples = np.round( np.linspace(0, length - self.n_frames, self.n_samples)).astype( int) # linspace: inclusive else: samples = np.arange(0, length - self.n_frames + 1) # arange: exclusive # load raw data inputs = [] for loader in self.loaders: vid = [] for s in samples: clip = [] for t in range(self.n_frames): frame_id = s + t + 1 image = loader(self.root, vid_name, frame_id) clip.append(image) vid.append(clip) inputs.append(np.array(vid)) # transform if self.transforms is not None: for i, transform in enumerate(self.transforms): if self.transforms[i] is not None: inputs[i] = transform(inputs[i]) return utils.squeeze(inputs), target
def getOligos(rID, seq, vectorID, userID): content = "\nSequencing Primers for " + vectorID + "\n\nVector length: " + `len(seq.strip())` + " nt\n" protocolPropID = propHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["protocol"], prop_Category_Name_ID_Map["Classifiers"]) seqPropID = propHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["sequence"], prop_Category_Name_ID_Map["DNA Sequence"]) cdnaPropID = propHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["cdna insert"], prop_Category_Name_ID_Map["DNA Sequence Features"]) projectPropID = propHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["packet id"], prop_Category_Name_ID_Map["General Properties"]) namePropID = propHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["name"], prop_Category_Name_ID_Map["General Properties"]) statusPropID = propHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["status"], prop_Category_Name_ID_Map["General Properties"]) cdnaStart = rHandler.findReagentFeatureStart(rID, cdnaPropID) cdnaEnd = rHandler.findReagentFeatureEnd(rID, cdnaPropID) if cdnaStart > 0: content += "\ncDNA: " + `cdnaStart` + "-" + `cdnaEnd` + "\n" # find all Oligos whose protocol is 'sequencing' cursor.execute("SELECT r.reagentID, r.groupID, s.sequence FROM Sequences_tbl s, ReagentPropList_tbl p1, ReagentPropList_tbl p2, Reagents_tbl r WHERE p1.propertyID=" + `protocolPropID` + " AND p1.propertyValue='sequencing' AND p1.reagentID=r.reagentID AND r.reagentTypeID='3' AND p1.reagentID=p2.reagentID AND p2.propertyID=" + `seqPropID` + " AND p2.propertyValue=s.seqID AND p1.status='ACTIVE' AND p2.status='ACTIVE' AND r.status='ACTIVE' AND s.status='ACTIVE'") results = cursor.fetchall() seq = utils.squeeze(seq).lower() uPackets = getCurrentUserProjects(userID) #print "Content-type:text/html" #print #print reagentID uPackets.sort() #print `uPackets` features = rHandler.findAllReagentFeatures(Vector(rID), rID) overlapping_features = [] tmp_features = {} # linear list of oligos, regular array for result in results: overlapping_features = [] if result: #print "Content-type:text/html" #print #print len(result) oligoID = int(result[0]) groupID = int(result[1]) oligo_lims_id = "O" + `groupID` #print oligo_lims_id # April 26, 2010, Karen's request: Ignore Oligos whose status is 'Failed' or 'Do Not Use' oligoStatus = rHandler.findSimplePropertyValue(oligoID, statusPropID) if oligoStatus: #print oligoStatus if oligoStatus.lower() == 'failed' or oligoStatus.lower() == 'do not use': continue oligoPacket = int(rHandler.findSimplePropertyValue(oligoID, projectPropID)) #print oligoPacket if oligoPacket: if oligoPacket not in uPackets: #print oligoPacket continue oligoName = rHandler.findSimplePropertyValue(oligoID, namePropID) #if oligoName: #oligoNamesDict[oligoID] = oligoName #else: #oligoNamesDict[oligoID] = "" #print `features` if len(result) == 3: oligoSeq = utils.squeeze(result[2].strip()).lower() #print oligoSeq tm = dnaHandler.calculateTm(oligoSeq) if seq.find(oligoSeq) >= 0: fStart = seq.find(oligoSeq) + 1 fEnd = fStart + len(oligoSeq) - 1 direction = "forward" for f_tmp in features: tmp_f_Start = f_tmp.getFeatureStartPos() tmp_f_End = f_tmp.getFeatureEndPos() # 4 cases: # Feature contained within ORF (tmp_fStart >= fStart and tmp_fEnd <= fEnd) # Feature starts inside ORF (tmp_fStart >= fStart and tmp_fStart <= fEnd) # Feature ends inside ORF (tmp_fEnd >= fStart and tmp_fEnd <= fEnd) # ORF contained within feature (tmp_fStart <= fStart and tmp_fEnd >= fEnd) if (tmp_f_Start >= fStart and tmp_f_End <= fEnd) or (tmp_f_End >= fStart and tmp_f_End <= fEnd) or (tmp_f_Start >= fStart and tmp_f_Start <= fEnd) or (tmp_f_Start <= fStart and tmp_f_End >= fEnd): overlapping_features.append(f_tmp) else: revSeq = dnaHandler.reverse_complement(oligoSeq) direction = "reverse" if seq.find(revSeq) < 0: continue fStart = seq.find(revSeq) + 1 fEnd = fStart + len(revSeq) # Note: start pos > end pos, as we're talking about reverse Oligo sequence revStart = fEnd - 1 revEnd = fStart for f_tmp in features: tmp_f_Start = f_tmp.getFeatureStartPos() tmp_f_End = f_tmp.getFeatureEndPos() # 4 cases: (remember, revStart > revEnd, e.g. O1100 for V2559 - start 2583, end 2559) # Feature contained within ORF (tmp_f_Start <= revStart and tmp_f_End >= revEnd) # Feature starts inside ORF (tmp_f_Start >= revStart and tmp_f_Start <= revEnd) # Feature ends inside ORF (tmp_f_End >= revStart and tmp_f_End <= revEnd) # ORF contained within feature (tmp_f_Start >= revStart and tmp_f_End <= revEnd) if (tmp_f_Start >= revStart and tmp_f_End <= revEnd) or (tmp_f_End >= revStart and tmp_f_End <= revEnd) or (tmp_f_Start >= revStart and tmp_f_Start <= revEnd) or (tmp_f_Start <= revStart and tmp_f_End >= revEnd): overlapping_features.append(f_tmp) fStart = revEnd fEnd = revStart oFeature = SequenceFeature(oligoName, oligo_lims_id, fStart, fEnd, direction, oligoSeq, tm) tmp_features[oFeature] = overlapping_features tmp_oligos = {} for tmpFeature in tmp_features.keys(): oligoStart = tmpFeature.getFeatureStartPos() if tmp_oligos.has_key(oligoStart): tmp_o_list = tmp_oligos[oligoStart] else: tmp_o_list = [] tmp_oligos[oligoStart] = tmpFeature tmp_o_list.append(tmpFeature) tmp_oligos[oligoStart] = tmp_o_list for oligoStart in sorted(tmp_oligos.keys()): oFeatures = tmp_oligos[oligoStart] for tmpFeature in oFeatures: overlapping_features = tmp_features[tmpFeature] oligoName = tmpFeature.getFeatureType() oligo_lims_id = tmpFeature.getFeatureName() oligoSeq = tmpFeature.getFeatureDescrType() tm = tmpFeature.getFeatureDescrName() fStart = tmpFeature.getFeatureStartPos() fEnd = tmpFeature.getFeatureEndPos() direction = tmpFeature.getFeatureDirection() if oligoName: content += '\n--------------------------------------------------\n' + oligo_lims_id + " " + oligoName + ": " + oligoSeq + ", " + direction + "\n\n" else: content += '\n--------------------------------------------------\n' + oligo_lims_id + ": " + oligoSeq + ", " + direction + "\n\n" content += "Start position = " + `fStart` + "\n" content += "Stop position = " + `fEnd` + "\n" content += "\nTm: " + tm + "ºC\n" if len(overlapping_features) > 0: content += "\nOverlapping features:\n" for tmp_f in overlapping_features: tmp_fStart = tmp_f.getFeatureStartPos() tmp_fEnd = tmp_f.getFeatureEndPos() if tmp_f.getFeatureType().lower() == 'cdna insert': content += "cDNA" #elif tmp_f.getFeatureType().lower() == 'intron': #content += tmp_f.getFeatureName().title() + " intron" elif tmp_f.getFeatureType().lower() == 'promoter': content += tmp_f.getFeatureName().title() + " promoter" elif tmp_f.getFeatureType().lower() == "5' cloning site" or tmp_f.getFeatureType().lower() == "3' cloning site": content += tmp_f.getFeatureName().title() + " cloning site" elif tmp_f.getFeatureType().lower() == 'restriction site': content += tmp_f.getFeatureName().title() + " restriction site" elif tmp_f.getFeatureType().lower() == 'intron': content += tmp_f.getFeatureName().title() + " intron" elif tmp_f.getFeatureType().lower() == 'polya': content += tmp_f.getFeatureName().title() + " polyA" elif tmp_f.getFeatureType().lower() == 'origin': content += tmp_f.getFeatureName().title() + " ori." elif tmp_f.getFeatureType().lower() == 'tag type': content += tmp_f.getFeatureName().title() + " tag" elif tmp_f.getFeatureType().lower() == 'transcription terminator': content += tmp_f.getFeatureName().title() + " tscn. ter." else: content += tmp_f.getFeatureName().title() content += ": " + `tmp_fStart` + "-" + `tmp_fEnd` + '\n' content +="\n--------------------------------------------------\n\nNOTE: Only Oligos in OpenFreezer whose protocol is 'sequencing' and whose sequence is an exact match to the vector are reported.\n" return content
def drawMap(): dbConn = DatabaseConn() db = dbConn.databaseConnect() cursor = db.cursor() hostname = dbConn.getHostname() root_path = dbConn.getRootDir() form = cgi.FieldStorage(keep_blank_values="True") #print "Content-type:text/html" #print #print `form` if form.has_key("rID"): rID = form.getvalue("rID") else: # script executed from command line # Worst-case scenarios #rID = 260 # V260 #rID = 230 # V260 #rID = 80 # V80 - ok #rID = 69661 # V2412 - not bad at all, just one of the oligos overlaps exactly with promoter (1 nt difference) #rID = 23999 # V59541 rID = 97918 #print rID if form.has_key("user_id_hidden"): userID = form.getvalue("user_id_hidden") else: # command-line execution userID = 1 # debug reagentID = rHandler.convertDatabaseToReagentID(rID) uPackets = getCurrentUserProjects(userID) #print "Content-type:text/html" #print #print reagentID uPackets.sort() #print `uPackets` namePropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["name"], prop_Category_Name_ID_Map["General Properties"]) statusPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["status"], prop_Category_Name_ID_Map["General Properties"]) projectPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["packet id"], prop_Category_Name_ID_Map["General Properties"]) rName = rHandler.findSimplePropertyValue(rID, namePropID) rTypeID = rHandler.findReagentTypeID(rID) try: os.remove(root_path + "Reagent/vector_maps/" + reagentID + "_Oligo_map.pdf") except OSError: pass #print root_path c = Canvas(root_path + "Reagent/vector_maps/" + reagentID + "_Oligo_map.pdf") c.setPageSize((1500,1500)) c.setStrokeColorRGB(0,0,0) c.saveState() # Draw circle origin = 0 origin_x = 750 origin_y = 750 radius = 200 c.circle(origin_x, origin_y, radius) c.restoreState() # Divide circle into 100-unit sectors rSeqID = rHandler.findDNASequenceKey(rID) rSeq = sHandler.findSequenceByID(rSeqID) seqLen = len(rSeq) #print "Content-type:text/html" #print #print `rID` unit_angle_measure = float(360) / float(seqLen) #print unit_angle_measure # Mark 1 on the circle - KEEP, Karen said! c.setLineWidth(1) c.setStrokeColor(black) c.setFillColor(black) c.saveState() path = c.beginPath() # Draw a triangle pointing down above the circle #path.moveTo(origin_x, origin_y+radius+7) #path.lineTo(origin_x-5, origin_y+radius+14) #path.lineTo(origin_x+5, origin_y+radius+14) #path.lineTo(origin_x, origin_y+radius+7) # Draw a triangle pointing up inside the circle #path.moveTo(origin_x, origin_y+radius-10) #path.lineTo(origin_x-5, origin_y+radius-14) #path.lineTo(origin_x+5, origin_y+radius-14) #path.lineTo(origin_x, origin_y+radius-10) # Draw a triangle pointing right inside the circle path.moveTo(origin_x, origin_y+radius-14) path.lineTo(origin_x, origin_y+radius-28) path.lineTo(origin_x+8, origin_y+radius-21) path.lineTo(origin_x, origin_y+radius-14) c.drawPath(path, True, True) # label 1 t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 16) #t.setTextOrigin(origin_x-5, origin_y+radius+19) # above circle t.setTextOrigin(origin_x-3, origin_y+radius-50) # above circle t.textOut("1") c.drawText(t) c.restoreState() # Calculate feature segment sizes sequenceFeatures = rHandler.findReagentSequenceFeatures(rID) #print `sequenceFeatures` # Draw legend ox_legend = 1280 oy_legend = 1465 prev_legend = oy_legend # draw frame c.setStrokeColor(darkgray) c.setFillColor(white) c.saveState() featureNames = rtPropHandler.findReagentTypeAttributeNamesByCategory(rTypeID, prop_Category_Name_ID_Map["DNA Sequence Features"]) featureNames.sort() if len(featureNames) > 15: origin_spacer = -19 coeff = 12 else: origin_spacer = 65 coeff = 15 origin_legend = prev_legend+origin_spacer-len(featureNames)*coeff x = (990 - origin_legend) / len(featureNames) #print x if x < 12: x = 12 # WHEN WANT TO ADJUST LEGEND GREY BOX HEIGHT: UPDATE THE VALUE ADDED TO legend_height AND THE VALUE SUBTRACTED FROM origin_legend legend_height = len(featureNames)*x + 55 c.rect(ox_legend-25, origin_legend-35, 215, legend_height, 1, 1) # good for specific rtype attributes c.restoreState() protocolPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["protocol"], prop_Category_Name_ID_Map["Classifiers"]) seqPropID = pHandler.findReagentPropertyInCategoryID(prop_Name_ID_Map["sequence"], prop_Category_Name_ID_Map["DNA Sequence"]) sequenceFeatures = rHandler.findAllReagentFeatures(Vector(rID), rID) # Print reagent ID and size at the centre of the circle and print name at the top of the page c.setFont("Helvetica-Bold", 32) c.setFillColor(black) c.saveState() c.drawCentredString(origin_x, origin_y+35, reagentID) c.drawCentredString(origin_x, origin_y+10, "nt 1 - " + `seqLen`) if rName: c.setFillColor(blue) c.drawCentredString(origin_x, 1415, rName) c.restoreState() # find all Oligos whose protocol is 'sequencing' # April 26, 2010: Do not include status in this query, as it might just not be recorded for the oligo at all (early entries) cursor.execute("SELECT r.reagentID, r.groupID, s.sequence FROM Sequences_tbl s, ReagentPropList_tbl p1, ReagentPropList_tbl p2, Reagents_tbl r WHERE p1.propertyID=" + `protocolPropID` + " AND p1.propertyValue='sequencing' AND p1.reagentID=r.reagentID AND r.reagentTypeID='3' AND p1.reagentID=p2.reagentID AND p2.propertyID=" + `seqPropID` + " AND p2.propertyValue=s.seqID AND p1.status='ACTIVE' AND p2.status='ACTIVE' AND r.status='ACTIVE' AND s.status='ACTIVE'") #print "SELECT r.reagentID, r.groupID, s.sequence FROM Sequences_tbl s, ReagentPropList_tbl p1, ReagentPropList_tbl p2, Reagents_tbl r WHERE p1.propertyID=" + `protocolPropID` + " AND p1.propertyValue='sequencing' AND p1.reagentID=r.reagentID AND r.reagentTypeID='3' AND p1.reagentID=p2.reagentID AND p2.propertyID=" + `seqPropID` + " AND p2.propertyValue=s.seqID AND p1.status='ACTIVE' AND p2.status='ACTIVE' AND r.status='ACTIVE' AND s.status='ACTIVE'" results = cursor.fetchall() rSeq = utils.squeeze(rSeq).lower() #print rSeq oligoFeatures = [] oligoIDsDict = {} # O123 => 123 oligoNamesDict = {} # 123 => "O123 Name" oligoProjectDict = {} # 123 => 7 for result in results: if result: oligoID = int(result[0]) groupID = int(result[1]) oligo_lims_id = "O" + `groupID` oligoIDsDict[oligo_lims_id] = oligoID #print oligo_lims_id oligoName = rHandler.findSimplePropertyValue(oligoID, namePropID) # April 26, 2010, Karen's request: Ignore Oligos whose status is 'Failed' or 'Do Not Use' oligoStatus = rHandler.findSimplePropertyValue(oligoID, statusPropID) if oligoStatus: #print oligoStatus if oligoStatus.lower() == 'failed' or oligoStatus.lower() == 'do not use': continue if oligoName: oligoNamesDict[oligoID] = oligoName else: oligoNamesDict[oligoID] = "" #cursor.execute("SELECT propertyValue FROM ReagentPropList_tbl WHERE reagentID=" + `oligoID` + " AND propertyID=" + `namePropID` + " AND status='ACTIVE'") #result2 = cursor.fetchone() #if result2: #oligoName = result2[0] #oligoNamesDict[oligoID] = oligoName #else: #oligoNamesDict[oligoID] = "" # PROJECT - MUST CAST TO INT oligoPacket = int(rHandler.findSimplePropertyValue(oligoID, projectPropID)) #print oligoPacket if oligoPacket: if oligoPacket not in uPackets: #print oligoPacket continue #cursor.execute("SELECT propertyValue FROM ReagentPropList_tbl WHERE reagentID=" + `oligoID` + " AND propertyID=" + `projectPropID` + " AND status='ACTIVE'") #result3 = cursor.fetchone() #if result3: #oligoPacket = int(result3[0]) ##print oligoPacket #if oligoPacket not in uPackets: ##print oligoPacket #continue #oligoProjectDict[oligoID] = oligoPacket #else: #oligoProjectDict[oligoID] = 0 if len(result) == 3: oligoSeq = result[2].strip().lower() #print oligoSeq tm = sHandler.calculateTm(oligoSeq) # Changes made April 26, 2010: Karen caught that the sense/antisense check does not work for T3 and T7 vectors and said to check oligo sequence both ways #if rSeq.find(oligoSeq) < 0: #continue if rSeq.find(oligoSeq) >= 0: fStart = rSeq.find(oligoSeq) + 1 fEnd = fStart + len(oligoSeq) - 1 #if oHandler.isSenseOligo(oligoID): oFeature = SequenceFeature("sequencing primer", oligo_lims_id, fStart, fEnd, 'forward', oligoSeq, tm) #else: #oFeature = SequenceFeature("sequencing primer", oligo_lims_id, fStart, fEnd, 'reverse', oligoSeq, tm) else: revSeq = sHandler.reverse_complement(oligoSeq) if rSeq.find(revSeq) < 0: continue fStart = rSeq.find(revSeq) + 1 fEnd = fStart + len(revSeq) # Note: start pos > end pos, as we're talking about reverse Oligo sequence revStart = fEnd - 1 revEnd = fStart # Still, record sense/antisense for displaying on the map ('forward' and 'reverse' here are just static values in Feature class, it doesn't reflect sequence orientation in our case - just use as a temporary placeholder) #if oHandler.isSenseOligo(oligoID): #oligoFeatures.append(oFeature) #oFeature = SequenceFeature("sequencing primer", oligo_lims_id, revStart, revEnd, 'forward', oligoSeq, tm) #else: oFeature = SequenceFeature("sequencing primer", oligo_lims_id, revStart, revEnd, 'reverse', oligoSeq, tm) oligoFeatures.append(oFeature) sequenceFeatures.append(oFeature) # SORT features by size, so that short features are not hidden behind the long ones fSizes = [] sortedFeatures = [] fSortedPos = {} fStartPos = [] fEndPos = [] for feature in sequenceFeatures: fSize = int(feature.getFeatureSize()) if fSize > 0: fSizes.append(fSize) #if fSize > 150: f_start_tmp = int(feature.getFeatureStartPos()) fStartPos.append(f_start_tmp) fSortedPos[f_start_tmp] = feature f_end_tmp = int(feature.getFeatureEndPos()) fEndPos.append(f_end_tmp) fEndPos.sort() fStartPos.sort() #print `fStartPos` #print `fEndPos` fSizes.sort(reverse=True) #print `fSizes` for fs in fSizes: for feature in sequenceFeatures: fSize = feature.getFeatureSize() # added existence check July 17/08 - different features may have same sizes so end up with duplicate features in list (e.g. cloning sizes appeared twice on the map) if fs == fSize and feature not in sortedFeatures: sortedFeatures.append(feature) # Order: 5' site, 3' site, 5' linker, 3' linker, then the rest sites_color = featureNameColorMap["5' cloning site"] # same for 3' site # 5' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(sites_color) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "5' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # 3' site c.setStrokeColor(sites_color) c.setFillColor(sites_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(sites_color) t.setFillColor(sites_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "3' CLONING SITE") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Show legend for linkers linkers_color = featureNameColorMap["5' linker"] # 5' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "5' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # 3' linker c.setStrokeColor(linkers_color) c.setFillColor(linkers_color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(linkers_color) t.setFillColor(linkers_color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "3' LINKER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Output the rest of the features in alphabetical order featureNames = featureNameColorMap.keys() featureNames.sort() #print `featureNames` for featureName in featureNames: #print featureName if featureNameColorMap.has_key(featureName): color = featureNameColorMap[featureName] if featureName != "5' cloning site" and featureName != "3' cloning site" and featureName != "5' linker" and featureName != "3' linker" and color != None: #print featureName c.setStrokeColor(color) c.setFillColor(color) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(color) t.setFillColor(color) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + featureName.upper()) c.drawText(t) c.restoreState prev_legend = prev_legend-15 # Sequencing Primer oligoColor = "#7cfc00" c.setStrokeColor(oligoColor) c.setFillColor(oligoColor) c.saveState() c.rect(ox_legend-15, prev_legend-20, 25,8, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(oligoColor) t.setFillColor(oligoColor) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_legend+12, prev_legend-20) t.textOut(" - " + "SEQUENCING PRIMER") c.drawText(t) c.restoreState prev_legend = prev_legend-15 ox_labels = 40 oy_labels = 40 #prev_legend = oy_labels for feature in sortedFeatures: fType = feature.getFeatureType() fValue = feature.getFeatureName() fSize = feature.getFeatureSize() #print fType #print fValue #print fSize # color if featureNameColorMap.has_key(fType): fColor = featureNameColorMap[fType] textColor = fColor elif fType == 'sequencing primer': fColor = "#7cfc00" textColor = "black" o_id = oligoIDsDict[fValue] oligoName = oligoNamesDict[o_id] if len(oligoName) > 0: fValue += " " + oligoName # property name if fType == 'cdna insert': fValue = "cDNA Insert" elif fType == 'promoter': fValue = fValue + " " + fType fStart = feature.getFeatureStartPos() fEnd = feature.getFeatureEndPos() fDir = feature.getFeatureDirection() # value #if fType == 'sequencing primer': #oligoDir = feature.getFeatureDirection() #if oligoDir == 'forward': #oligoType = 'Sense' #else: #oligoType = 'Antisense' #fTxt = fValue + " (" + `fStart` + "-" + `fEnd` + "), " + oligoDir #else: fTxt = fValue + " (" + `fStart` + "-" + `fEnd` + ")" if fSize > 0: f_start = fStart * unit_angle_measure #print "Start " + `fStart` #print "End " + `fEnd` startAngle = 90 - f_start #print "Start angle " + `startAngle` f_end = fEnd * unit_angle_measure endAngle = 90 - f_end #print "End angle " + `endAngle` extAngle = -1*(f_end - f_start) #print "Ext angle " + `extAngle` x1 = origin_x - radius y1 = origin_y - radius x2 = origin_x + radius y2 = origin_y + radius p = c.beginPath() c.setLineWidth(10) c.setLineJoin(1) c.setStrokeColor(fColor) c.saveState() p.arc(x1, y1, x2, y2, startAngle, extAngle) c.drawPath(p) c.restoreState() # common to all startAngle_rad = (startAngle * math.pi) / 180.0 endAngle_rad = (endAngle * math.pi) / 180.0 c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 9) c.saveState() arc_x_start = origin_x + (radius+5)*math.cos(startAngle_rad) arc_y_start = origin_y + (radius+5)*math.sin(startAngle_rad) arc_x_end = origin_x+(radius+5)*math.cos(endAngle_rad) arc_y_end = origin_y+(radius+5)*math.sin(endAngle_rad) # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(fColor) c.setFillColor(fColor) c.setFont("Helvetica-Bold", 12) c.saveState() # draw line delta = 45 if fStart < seqLen/2: if arc_y_start > origin_y: # THIS WORKS!!!! c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.line(arc_x_start, arc_y_start, arc_x_start+math.fabs(math.sin(delta))*(fInd*10), arc_y_start+math.fabs(math.cos(delta))*(fY*10)) #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fInd*10)+2, arc_y_start+math.fabs(math.cos(delta))*(fY*10)-math.cos(delta)*0.9, fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fInd*10)+2, arc_y_start+math.fabs(math.cos(delta))*(fY*10)-math.cos(delta)*0.9, fTxt) c.restoreState() else: fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() c.line(arc_x_start, arc_y_start, arc_x_start+math.fabs(math.sin(delta))*(fY*10), arc_y_start-math.fabs(math.cos(delta))*(fInd*10)) c.restoreState() #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fY*10)+2, arc_y_start-math.fabs(math.cos(delta))*(fInd*10)-math.cos(delta)*13, fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawString(arc_x_start+math.fabs(math.sin(delta))*(fY*10)+2, arc_y_start-math.fabs(math.cos(delta))*(fInd*10)-math.cos(delta)*13, fTxt) c.restoreState() else: if arc_y_start > origin_y: fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() c.line(arc_x_start, arc_y_start, arc_x_start-math.fabs(math.sin(delta)*(fY*10)), arc_y_start+math.fabs(math.cos(delta)*(fInd*10))) c.restoreState() # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fY*10))+2, arc_y_start+math.fabs(math.cos(delta)*(fInd*10)), fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fY*10))+2, arc_y_start+math.fabs(math.cos(delta)*(fInd*10)), fTxt) c.restoreState() else: fInd = fStartPos.index(fStart) fY = len(fStartPos) - fInd c.setStrokeColor(fColor) c.setFillColor(fColor) c.setLineWidth(1) c.saveState() c.line(arc_x_start, arc_y_start, arc_x_start-math.fabs(math.sin(delta)*(fInd*10)), arc_y_start-math.fabs(math.cos(delta)*(fY*10))) c.restoreState() # draw label #c.setStrokeColorRGB(0,0,1) #c.setFillColorRGB(0,0,1) c.setStrokeColor(textColor) c.setFillColor(textColor) c.setFont("Helvetica-Bold", 8) c.saveState() #c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fInd*10))-2, arc_y_start-math.fabs(math.cos(delta)*(fY*10))-math.cos(delta)*12, fValue + " (" + `fStart` + "-" + `fEnd` + ")") c.drawRightString(arc_x_start-math.fabs(math.sin(delta)*(fInd*10))-2, arc_y_start-math.fabs(math.cos(delta)*(fY*10))-math.cos(delta)*12, fTxt) c.restoreState() # print Oligo info #prev_legend = prev_legend-10 prev_legend = 1365 t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels, prev_legend-15) t.textOut("Sequencing primers for " + reagentID + ":") c.drawText(t) c.restoreState prev_legend = prev_legend-18 fColor = "#7cfc00" # sort oligos tmp_oligos = {} #print `oligoFeatures` for oFeature in oligoFeatures: oligoID = oFeature.getFeatureName() #print oligoID oligoStart = oFeature.getFeatureStartPos() #print oligoStart if tmp_oligos.has_key(oligoStart): tmp_o_list = tmp_oligos[oligoStart] else: tmp_o_list = [] tmp_oligos[oligoStart] = oFeature tmp_o_list.append(oFeature) tmp_oligos[oligoStart] = tmp_o_list oligoSeq = oFeature.getFeatureDescrType() #print oligoSeq #print `tmp_oligos` for oligoStart in sorted(tmp_oligos.keys()): oFeatures = tmp_oligos[oligoStart] for oFeature in oFeatures: oligoID = oFeature.getFeatureName() #oligoSeq = oFeature.getFeatureDescrType() oligoTm = oFeature.getFeatureDescrName() oligoEnd = oFeature.getFeatureEndPos() oligoDir = oFeature.getFeatureDirection() o_rID = oligoIDsDict[oligoID] oligoName = oligoNamesDict[o_rID] #if oligoDir == 'forward': #oligoType = 'Sense' #else: #oligoType = 'Antisense' c.setStrokeColor(fColor) c.setFillColor(fColor) c.saveState() c.rect(ox_labels+5, prev_legend-15, 15,6, 1, 1) c.restoreState t = c.beginText() t.setStrokeColor(black) t.setFillColor(black) t.setFont("Helvetica-Bold", 10) t.setTextOrigin(ox_labels+25, prev_legend-15) if len(oligoName) > 0: #t.textOut(oligoID + ": " + oligoName + " (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoType) t.textOut(oligoID + ": " + oligoName + " (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoDir) else: #t.textOut(oligoID + ": (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoType) t.textOut(oligoID + ": (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoDir) #print oligoID + ": (" + `oligoStart` + "-" + `oligoEnd` + ")" ", " + oligoType c.drawText(t) c.restoreState prev_legend = prev_legend-15 c.restoreState() c.showPage() c.save()
def __init__(self, Component, FieldKey, Subplot): # get Field value Field = Component.State[FieldKey] Dims = KnownFields[FieldKey][2] # Figure out axes AxisKey = [] if Dims == "2D": for i in range(2): if shape(Field)[i] > 1: AxisKey.append(["lat", "lon"][i]) if Dims == "3D": for i in range(3): if shape(Field)[i] > 1: AxisKey.append(["lev", "lat", "lon"][i]) # If Field is 3D, show zonal average Field = squeeze(Field) if ndim(Field) == 3: Field = average(Field, axis=2) Field = squeeze(Field) AxisKey.pop(2) # Axes names and values AxisName = [] AxisVal = [] for key in AxisKey: AxisName.append(Component.Grid.long_name[key]) AxisVal.append(Component.Grid[key]) # Get handles to figure and properties if len(AxisName) == 1: if min(Field) == max(Field) == 0.0: Field = Field + 1.0e-7 MinVal = min(Field) - 0.01 * abs(min(Field)) MaxVal = max(Field) + 0.01 * abs(max(Field)) if AxisKey[0] == "lev": pylab.ylabel(AxisName[0]) self.orientation = 0 self.handle = pylab.plot(Field, AxisVal[0], "bo-").pop(0) self.axes = pylab.gca() pylab.xlim(MinVal, MaxVal) pylab.ylim(AxisVal[0][-1], AxisVal[0][0]) else: if Subplot in ["111", "212", "223", "224"]: pylab.xlabel(AxisName[0]) self.orientation = 1 self.handle = pylab.plot(AxisVal[0], Field, "bo-").pop(0) self.axes = pylab.gca() pylab.ylim([MinVal, MaxVal]) pylab.xlim([AxisVal[0][0], AxisVal[0][-1]]) elif len(AxisName) == 2: xmin = AxisVal[1][0] xmax = AxisVal[1][-1] ymin = AxisVal[0][0] ymax = AxisVal[0][-1] if AxisKey[0] == "lev": self.orientation = 0 self.handle = pylab.imshow(Field[::-1], extent=(xmin, xmax, ymin, ymax), interpolation="bilinear") pylab.setp(pylab.gca(), "xlim", [xmin, xmax], "ylim", [ymax, ymin]) else: self.orientation = 1 self.handle = pylab.imshow(Field, extent=(xmin, xmax, ymin, ymax), interpolation="bilinear") pylab.setp(pylab.gca(), "xlim", [xmin, xmax], "ylim", [ymin, ymax]) # write x label only if subplot does not have other subplot underneath if Subplot in ["111", "212", "223", "224"]: pylab.xlabel(AxisName[1]) pylab.ylabel(AxisName[0]) self.handle.set_norm(None) # Title self.TitleTemplate = "%s [%s]" % (FieldKey, KnownFields[FieldKey][1]) + " %6.2f days" if len(AxisName) == 2: self.TitleTemplate = self.TitleTemplate + "\n min=%g max=%g" day = Component.State.ElapsedTime / 86400.0 try: TitleText = self.TitleTemplate % day except: TitleText = self.TitleTemplate % (day, min(ravel(Field)), max(ravel(Field))) self.title = pylab.title(TitleText) self.title.set_fontsize(12)
def __getitem__(self, key): for obj in [self.Params, self.Grid, self.State]: if key in obj: if type(obj[key]) is type('string'): return obj[key] else: return squeeze(obj[key]) raise IndexError,'\n\n CliMT.State: %s not in Params, Grid or State' % str(key)
def __init__(self, Component, FieldKey, Subplot): # get Field value Field = Component.State[FieldKey] Dims = KnownFields[FieldKey][2] # Figure out axes AxisKey = [] if Dims == '2D': for i in range(2): if shape(Field)[i] > 1: AxisKey.append(['lat','lon'][i]) if Dims == '3D': for i in range(3): if shape(Field)[i] > 1: AxisKey.append(['lev','lat','lon'][i]) # If Field is 3D, show zonal average Field = squeeze(Field) if rank(Field) == 3: Field = average(Field,axis=2) Field = squeeze(Field) AxisKey.pop(2) # Axes names and values AxisName = [] AxisVal = [] for key in AxisKey: AxisName.append(Component.Grid.long_name[key]) AxisVal.append(Component.Grid[key]) # Get handles to figure and properties if len(AxisName) == 1: if min(Field) == max(Field) == 0.: Field=Field+1.e-7 MinVal = min(Field) - 0.01*abs(min(Field)) MaxVal = max(Field) + 0.01*abs(max(Field)) if AxisKey[0] == 'lev': pylab.ylabel(AxisName[0]) self.orientation = 0 self.handle = pylab.plot(Field, AxisVal[0], 'bo-').pop(0) self.axes = pylab.gca() pylab.xlim(MinVal, MaxVal) pylab.ylim(AxisVal[0][-1], AxisVal[0][0] ) else: if Subplot in ['111','212','223','224']: pylab.xlabel(AxisName[0]) self.orientation = 1 self.handle = pylab.plot(AxisVal[0], Field, 'bo-').pop(0) self.axes = pylab.gca() pylab.ylim([MinVal, MaxVal]) pylab.xlim([ AxisVal[0][0], AxisVal[0][-1] ]) elif len(AxisName) == 2: xmin = AxisVal[1][0] xmax = AxisVal[1][-1] ymin = AxisVal[0][0] ymax = AxisVal[0][-1] if AxisKey[0] == 'lev': self.orientation = 0 self.handle = pylab.imshow(\ Field[::-1],\ extent=(xmin, xmax, ymin, ymax),\ interpolation='bilinear') pylab.setp(pylab.gca(), 'xlim',[xmin,xmax], 'ylim',[ymax,ymin]) else: self.orientation = 1 self.handle = pylab.imshow( \ Field, \ extent=(xmin, xmax, ymin, ymax),\ interpolation='bilinear') pylab.setp(pylab.gca(), 'xlim',[xmin,xmax], 'ylim',[ymin,ymax]) # write x label only if subplot does not have other subplot underneath if Subplot in ['111','212','223','224']: pylab.xlabel(AxisName[1]) pylab.ylabel(AxisName[0]) self.handle.set_norm(None) # Title self.TitleTemplate = '%s [%s]' % (FieldKey,KnownFields[FieldKey][1]) + ' %6.2f days' if len(AxisName) == 2: self.TitleTemplate = self.TitleTemplate + '\n min=%g max=%g' day = Component.State.ElapsedTime/86400. try: TitleText = self.TitleTemplate % day except: TitleText = self.TitleTemplate % (day, min(ravel(Field)), max(ravel(Field))) self.title = pylab.title(TitleText) self.title.set_fontsize(12)