def get_ro3_from_mol(mol): """ Get rule of three criteria for a fragment, i.e. molecular weight, logP, number of hydrogen bond acceptors/donors, number of rotatable bonds, and PSA. Parameters ---------- mol : rdkit.Chem.rdchem.Mol Fragment. Returns ------- pd.Series Rule of three criteria for input fragment. Notes ----- Taken from: https://europepmc.org/article/med/14554012 """ properties = QED.properties(mol) mw = 1 if properties.MW < 300 else 0 logp = 1 if properties.ALOGP <= 3 else 0 hbd = 1 if properties.HBD <= 3 else 0 hba = 1 if properties.HBA <= 3 else 0 nrot = 1 if properties.ROTB <= 3 else 0 psa = 1 if properties.PSA <= 60 else 0 return pd.Series([mw, logp, hbd, hba, nrot, psa], index="mw logp hbd hba nrot psa".split())
def compute_druglikeness(mol: Chem.rdchem.Mol): """Call RDKit to compute the drug likeness properties.""" try: data = QED.properties(mol) results = [getattr(data, key) for key in KEYS_DRUGS_LIKENESS] except RuntimeError: results = [None] * len(KEYS_DRUGS_LIKENESS) return results
def getMoleculeProperties(m: Chem.rdchem.Mol, index: int): qed = QED.properties(m) return [ #index, Descriptors.ExactMolWt(m), qed[1], qed[4], qed[3] ]
def test_properties(self): m = Chem.MolFromSmiles('N=C(CCSCc1csc(N=C(N)N)n1)NS(N)(=O)=O') p = QED.properties(m) self.assertAlmostEqual(p.MW, 337.456) self.assertAlmostEqual(p.ALOGP, -0.55833) self.assertAlmostEqual(p.HBA, 6) self.assertAlmostEqual(p.HBD, 5) self.assertAlmostEqual(p.PSA, 173.33) self.assertAlmostEqual(p.ROTB, 7) self.assertAlmostEqual(p.AROM, 1) self.assertAlmostEqual(p.ALERTS, 3) p = QED.properties(Chem.AddHs(m)) self.assertAlmostEqual(p.MW, 337.456) self.assertAlmostEqual(p.ALOGP, -0.55833) self.assertAlmostEqual(p.HBA, 6) self.assertAlmostEqual(p.HBD, 5) self.assertAlmostEqual(p.PSA, 173.33) self.assertAlmostEqual(p.ROTB, 7) self.assertAlmostEqual(p.AROM, 1) self.assertAlmostEqual(p.ALERTS, 3)
def test_properties(self): m = Chem.MolFromSmiles('N=C(CCSCc1csc(N=C(N)N)n1)NS(N)(=O)=O') p = QED.properties(m) self.assertAlmostEqual(p.MW, 337.456) self.assertAlmostEqual(p.ALOGP, -0.55833) self.assertAlmostEqual(p.HBA, 6) self.assertAlmostEqual(p.HBD, 5) self.assertAlmostEqual(p.PSA, 173.33) self.assertAlmostEqual(p.ROTB, 7) self.assertAlmostEqual(p.AROM, 1) self.assertAlmostEqual(p.ALERTS, 3) p = QED.properties(Chem.AddHs(m)) self.assertAlmostEqual(p.MW, 337.456) self.assertAlmostEqual(p.ALOGP, -0.55833) self.assertAlmostEqual(p.HBA, 6) self.assertAlmostEqual(p.HBD, 5) self.assertAlmostEqual(p.PSA, 173.33) self.assertAlmostEqual(p.ROTB, 7) self.assertAlmostEqual(p.AROM, 1) self.assertAlmostEqual(p.ALERTS, 3)
def QSArproperties_test(array,forest, num, namefile): ##Bickerton, G.R.; Paolini, G.V.; Besnard, J.; Muresan, S.; Hopkins, A.L. (2012) ##Quantifying the chemical beauty of drugs, ##Nature Chemistry, 4, 90-98 ##[https://doi.org/10.1038/nchem.1243] # ##Wildman, S.A.; Crippen, G.M. (1999) ##Prediction of Physicochemical Parameters by Atomic Contributions, ##Journal of Chemical Information and Computer Sciences, 39, 868-873 ##[https://doi.org/10.1021/ci990307l] # fw = open( 'QSAR-2D' + str(num) + str(namefile) + '.csv', 'w') # for line in array: parameter= line.split(sep="\t",maxsplit=9) peptide_seq = parameter[0] peptide = parameter[1] # molpeptideLi = Chem.MolFromSmiles(peptide) # subprocess scoreSA_Li = calculateScore(molpeptideLi) # # Make Prediction Random-Forest fp_vect_Li = genFP(molpeptideLi) # Get probabilities predictionsLi = forest.predict_proba(fp_vect_Li.reshape(1,-1)) #print ("Probability %s mutagenic %0.6f " % (sequence,predictionsLi[0][1])) # See http://cdb.ics.uci.edu/cgibin/Smi2DepictWeb.py propQSAR = QED.properties(molpeptideLi) MolWeight = propQSAR.MW MolLogP = propQSAR.ALOGP HbondA = propQSAR.HBA HbondD = propQSAR.HBD PolarSA = propQSAR.PSA Rbonds = propQSAR.ROTB Aromatic = propQSAR.AROM # MolarRefractivity = Crippen.MolMR(molpeptideLi) nAtoms = molpeptideLi.GetNumAtoms() # SynthAcces = scoreSA_Li AmesMutagenic = predictionsLi[0][1] # result = ( str(MolWeight) + "\t" + str(MolLogP) + "\t" + str(HbondA) + "\t" + str(HbondD) + "\t" + str(PolarSA) + "\t" + str(Rbonds) + "\t" + str(MolarRefractivity) + "\t" + str(nAtoms) + "\t" + str(SynthAcces) + "\t" + str(AmesMutagenic) + "\t" + str (peptide_seq) + "\t" + str(peptide) + "\n") #print (result) fw.write(result) fw.close()
def __init__(self, mol=None, mw=None, logP=None, hba=None, hbd=None, psa=None, rotb=None, arom=None): self.molecule = mol if mol else None self.molecule_name = mol.GetProp('_Name') if mol else None self._qed = QED.properties(self.molecule) if mol else None self.mw = mw if not mol else self._qed.MW self.logP = logP if not mol else self._qed.ALOGP self.hba = hba if not mol else self._qed.HBA self.hbd = hbd if not mol else self._qed.HBD self.psa = psa if not mol else self._qed.PSA self.rotb = rotb if not mol else self._qed.ROTB self.arom = arom if not mol else self._qed.AROM
def QSArproperties(mol, sa, seq, Ames): propQSAR = QED.properties(mol) """Bickerton, G.R.; Paolini, G.V.; Besnard, J.; Muresan, S.; Hopkins, A.L. (2012) Quantifying the chemical beauty of drugs, Nature Chemistry, 4, 90-98 [https://doi.org/10.1038/nchem.1243]""" # """Wildman, S.A.; Crippen, G.M. (1999) Prediction of Physicochemical Parameters by Atomic Contributions, Journal of Chemical Information and Computer Sciences, 39, 868-873 [https://doi.org/10.1021/ci990307l]""" # MolWeight = propQSAR.MW MolLogP = propQSAR.ALOGP HbondA = propQSAR.HBA HbondD = propQSAR.HBD PolarSA = propQSAR.PSA Rbonds = propQSAR.ROTB Aromatic = propQSAR.AROM MolarRefractivity = Crippen.MolMR(mol) SynthAcces = sa nAtoms = mol.GetNumAtoms() AmesMutagenic = Ames
def filter_mols(mols: List[Chem.Mol], names: Optional[List[str]] = None, max_atoms: int = 1000, max_weight: float = 10000., max_logP: float = 10., **kwargs) -> Tuple[List[str], Optional[List[str]]]: """Filter a list of molecules according to input critera Parameters ---------- mols : List[Chem.Mol] the molecules to filter names : Optional[List[str]] (Default = None) a parallel list of names corresponding to each molecule max_atoms : int (Default = 1000) max_weight : float (Default = 10000) max_logP : float (Default = 10) Returns ------- smis_filtered : List[str] the SMILES strings corresponding to the filtered molecules names_filtered : Optional[List[str]] the names corresponding to the filtered molecules. None, if no names were originally supplied """ names = names or [] smis_filtered = [] names_filtered = [] if names: for mol, name in tqdm(zip(mols, names), total=len(mols), desc='Filtering mols', unit='mol'): if mol.GetNumHeavyAtoms() > max_atoms: continue props = QED.properties(mol) if props.MW > max_weight: continue if props.ALOGP > max_logP: continue smis_filtered.append(mol_to_smi(mol)) names_filtered.append(name) else: names_filtered = None for mol in tqdm(mols, total=len(mols), desc='Filtering mols', unit='mol'): if mol.GetNumHeavyAtoms() > max_atoms: continue props = QED.properties(mol) if props.MW > max_weight: continue if props.ALOGP > max_logP: continue smis_filtered.append(mol_to_smi(mol)) return smis_filtered, names_filtered