def create_fit(self,log=False,debug=False): self.validate() # create ctlike instance with given parameters self.info("Fitting Data using ctlike") if self.m_obs: self.like = ct.ctlike(self.m_obs) else: self.like = ct.ctlike() if self.m_binned: self.like["infile"] = self.m_cntfile else: self.like["infile"] = self.m_evtfile self.like["stat"].string(self.m_stat) self.like["caldb"].string(self.m_caldb) self.like["irf"].string(self.m_irf) self.like["srcmdl"] = self.m_xml self.like["edisp"].boolean(self.m_edisp) self.like["outmdl"] = self.m_xml_out # Optionally open the log file if log: self.like.logFileOpen() # Optionally switch-on debugging model if debug: self.like["debug"].boolean(True)
def fit(obs, log=False, debug=False): """ Perform maximum likelihood fitting of observations in the container. Parameters: obs - Observation container Keywords: log - Create log file(s) debug - Create screen dump """ # Allocate ctlike application like = ctools.ctlike(obs) # Optionally open the log file if log: like.logFileOpen() # Optionally switch-on debugging model if debug: like["debug"].boolean(True) # Run ctlike application. like.run() # Return observations return like
def fit(obs, log=False, debug=False, chatter=2, edisp=False): """ Perform maximum likelihood fitting of observations in the container. Parameters: obs - Observation container Keywords: log - Create log file(s) debug - Create screen dump chatter - Chatter level edisp - Apply energy dispersion? """ # Allocate ctlike application like = ctools.ctlike(obs) # Optionally open the log file if log: like.logFileOpen() # Optionally switch-on debugging model if debug: like["debug"] = True # Set chatter level like["chatter"] = chatter # Optionally apply energy dispersion like["edisp"] = edisp # Run ctlike application. like.run() # Return observations return like
def test_functional(self): """ Test ctlike functionnality. """ # Set-up ctlike like = ctools.ctlike() like["inobs"] = self.events_name like["inmodel"] = self.model_name like["caldb"] = self.caldb like["irf"] = self.irf like["outmodel"] = "result.xml" # Run tool self.test_try("Run ctlike") try: like.run() self.test_try_success() except: self.test_try_failure("Exception occured in ctlike.") # Save results self.test_try("Save results") try: like.save() self.test_try_success() except: self.test_try_failure("Exception occured in saving results.") # Return return
def ctlike_binned(events_name, cntmap_name, emin, emax, enumbins, nxpix, nypix, binsz, ra, dec, IRF, CALDB, outfile): """ Copied and modified from ctools/examples/make_binned_analysis.py """ # Bin the events first bin = ctools.ctbin() # We need this to explicitely open the log file in Python mode bin.logFileOpen() bin["evfile"].filename(events_name) bin["outfile"].filename(cntmap_name) bin["emin"].real(emin) bin["emax"].real(emax) bin["enumbins"].integer(enumbins) bin["nxpix"].integer(nxpix) bin["nypix"].integer(nypix) bin["binsz"].real(binsz) bin["coordsys"].string('GAL') bin["xref"].real(ra) bin["yref"].real(dec) bin["proj"].string('CAR') bin.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like.logFileOpen() like["infile"].filename(cntmap_name) like["srcmdl"].filename('$CTOOLS/share/models/crab.xml') like["outmdl"].filename(outfile) like["caldb"].string(CALDB) like["irf"].string(IRF) like.execute()
def ctlike_binned(events_name, cntmap_name, emin, emax, enumbins, nxpix, nypix, binsz, ra, dec, IRF, CALDB, outfile): """ Copied and modified from ctools/examples/make_binned_analysis.py """ # Bin the events first bin = ctools.ctbin() # We need this to explicitely open the log file in Python mode bin.logFileOpen() bin["evfile"].filename(events_name) bin["outfile"].filename(cntmap_name) bin["emin"].real(emin) bin["emax"].real(emax) bin["enumbins"].integer(enumbins) bin["nxpix"].integer(nxpix) bin["nypix"].integer(nypix) bin["binsz"].real(binsz) bin["coordsys"].string('GAL') bin["xref"].real(ra) bin["yref"].real(dec) bin["proj"].string('CAR') bin.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like.logFileOpen() like["infile"].filename(cntmap_name) like["srcmdl"].filename('$CTOOLS/share/models/crab.xml') like["outmdl"].filename(outfile) like["caldb"].string(CALDB) like["irf"].string(IRF) like.execute()
def _test_python(self): """ Test ctlike from Python """ # Set-up ctlike like = ctools.ctlike() like['inobs'] = self._events like['inmodel'] = self._model like['caldb'] = self._caldb like['irf'] = self._irf like['outmodel'] = 'ctlike_py1.xml' like['logfile'] = 'ctlike_py1.log' like['chatter'] = 2 # Run ctlike tool like.logFileOpen() # Make sure we get a log file like.run() like.save() # Check result file self._check_result_file('ctlike_py1.xml') # Retrieve observation container, save and check model file obs = like.obs() obs.models().save('ctlike_py2.xml') self._check_result_file('ctlike_py2.xml') # Retrieve optimizer opt = like.opt() # Return return
def fit(obs, log=False, debug=False, chatter=2, edisp=False): """ Perform maximum likelihood fitting of observations in the container. Parameters: obs - Observation container Keywords: log - Create log file(s) debug - Create screen dump chatter - Chatter level edisp - Apply energy dispersion? """ # Allocate ctlike application like = ctools.ctlike(obs) # Optionally open the log file if log: like.logFileOpen() # Optionally switch-on debugging model if debug: like["debug"] = True # Set chatter level like["chatter"] = chatter # Optionally apply energy dispersion like["edisp"] = edisp # Run ctlike application. like.run() # Return observations return like
def ctlike_run(self, input_obs_list, input_models=None, output_models='ml_result.xml', log_file='ctlike.log', force=False, save=False): like = ctools.ctlike() if isinstance(input_obs_list, gammalib.GObservations): like.obs(input_obs_list) if input_models is not None: like.obs().models(input_models) elif os.path.isfile(input_obs_list) and os.path.isfile(input_models): # observations list from file like["inobs"] = input_obs_list like["inmodel"] = input_models else: raise Exception('Cannot understand input obs list for ctlike') like["outmodel"] = output_models like["logfile"] = log_file like["nthreads"] = self.nthreads if force or not os.path.isfile(output_models): like.logFileOpen() like.run() elif os.path.isfile(output_models): ml_models = gammalib.GModels(output_models) like.obs().models(ml_models) else: raise Exception("Cannot proceed with ctlike") saved = False if (save and force) or (save and not os.path.isfile(output_models)): like.save() saved = True logger.info("File {} created.".format(output_models)) return like
def test_unbinned_mem(self): """ Test unbinned in-memory pipeline. """ # Set script parameters model_name = "data/crab.xml" caldb = "irf" irf = "cta_dummy_irf" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = 1800.0 emin = 0.1 emax = 100.0 rad_select = 3.0 # Simulate events sim = ctools.ctobssim() sim["inmodel"].filename(model_name) sim["caldb"].string(caldb) sim["irf"].string(irf) sim["ra"].real(ra) sim["dec"].real(dec) sim["rad"].real(rad_sim) sim["tmin"].real(tstart) sim["tmax"].real(tstop) sim["emin"].real(emin) sim["emax"].real(emax) self.test_try("Run ctobssim") try: sim.run() self.test_try_success() except: self.test_try_failure("Exception occured in ctobssim.") # Select events select = ctools.ctselect(sim.obs()) select["ra"].real(ra) select["dec"].real(dec) select["rad"].real(rad_select) select["tmin"].real(tstart) select["tmax"].real(tstop) select["emin"].real(emin) select["emax"].real(emax) self.test_try("Run ctselect") try: select.run() self.test_try_success() except: self.test_try_failure("Exception occured in ctselect.") # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) self.test_try("Run ctlike") try: like.run() self.test_try_success() except: self.test_try_failure("Exception occured in ctlike.")
def unbinned_pipeline(duration): """ Unbinned analysis pipeline. """ # Set script parameters model_name = "${CTOOLS}/share/models/crab.xml" caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 rad_select = 3.0 # Get start CPU time tstart = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"].filename(model_name) sim["caldb"].string(caldb) sim["irf"].string(irf) sim["ra"].real(ra) sim["dec"].real(dec) sim["rad"].real(rad_sim) sim["tmin"].real(tstart) sim["tmax"].real(tstop) sim["emin"].real(emin) sim["emax"].real(emax) sim.run() # Select events select = ctools.ctselect(sim.obs()) select["ra"].real(ra) select["dec"].real(dec) select["rad"].real(rad_select) select["tmin"].real(tstart) select["tmax"].real(tstop) select["emin"].real(emin) select["emax"].real(emax) select.run() # Get ctlike start CPU time tctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like.run() # Get stop CPU time tstop = time.clock() telapsed = tstop - tstart tctlike = tstop - tctlike # Return return telapsed, tctlike
def unbinned_pipeline(model_name, duration): """ Unbinned analysis pipeline. """ # Set script parameters caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 rad_select = 3.0 # Get start CPU time cpu_start = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"] = model_name sim["caldb"] = caldb sim["irf"] = irf sim["ra"] = ra sim["dec"] = dec sim["rad"] = rad_sim sim["tmin"] = tstart sim["tmax"] = tstop sim["emin"] = emin sim["emax"] = emax sim.run() # Select events select = ctools.ctselect(sim.obs()) select["ra"] = ra select["dec"] = dec select["rad"] = rad_select select["tmin"] = tstart select["tmax"] = tstop select["emin"] = emin select["emax"] = emax select.run() # Get ctlike start CPU time cpu_ctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like.run() # Get stop CPU time and compute elapsed times cpu_stop = time.clock() cpu_elapsed = cpu_stop - cpu_start cpu_ctlike = cpu_stop - cpu_ctlike # Return return cpu_elapsed, cpu_ctlike
def unbinned_pipeline(model_name, duration): """ Unbinned analysis pipeline. """ # Set script parameters caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 rad_select = 3.0 # Get start CPU time cpu_start = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"] = model_name sim["caldb"] = caldb sim["irf"] = irf sim["ra"] = ra sim["dec"] = dec sim["rad"] = rad_sim sim["tmin"] = tstart sim["tmax"] = tstop sim["emin"] = emin sim["emax"] = emax sim.run() # Select events select = ctools.ctselect(sim.obs()) select["ra"] = ra select["dec"] = dec select["rad"] = rad_select select["tmin"] = tstart select["tmax"] = tstop select["emin"] = emin select["emax"] = emax select.run() # Get ctlike start CPU time cpu_ctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like.run() # Get stop CPU time and compute elapsed times cpu_stop = time.clock() cpu_elapsed = cpu_stop - cpu_start cpu_ctlike = cpu_stop - cpu_ctlike # Return return cpu_elapsed, cpu_ctlike
def run_pipeline(obs, ra=83.63, dec=22.01, rad=3.0, emin=0.1, emax=100.0, tmin=0.0, tmax=0.0, debug=False): """ Simulation and binned analysis pipeline Parameters ---------- obs : `~gammalib.GObservations` Observation container ra : float, optional Right Ascension of Region of Interest centre (deg) dec : float, optional Declination of Region of Interest centre (deg) rad : float, optional Radius of Region of Interest (deg) emin : float, optional Minimum energy (TeV) emax : float, optional Maximum energy (TeV) tmin : float, optional Start time (s) tmax : float, optional Stop time (s) debug : bool, optional Debug function """ # Simulate events sim = ctools.ctobssim(obs) sim['debug'] = debug sim.run() # Select events select = ctools.ctselect(sim.obs()) select['ra'] = ra select['dec'] = dec select['rad'] = rad select['emin'] = emin select['emax'] = emax select['tmin'] = tmin select['tmax'] = tmax select['debug'] = debug select.run() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like['debug'] = True # Switch this always on for results in console like.run() # Return return
def test_unbinned_fits(self): """ Test unbinned pipeline with FITS file saving """ # Set script parameters events_name = 'events.fits' selected_events_name = 'selected_events.fits' result_name = 'results.xml' ra = 83.63 dec = 22.01 rad_sim = 10.0 rad_select = 3.0 tstart = 0.0 tstop = 300.0 emin = 0.1 emax = 100.0 # Simulate events sim = ctools.ctobssim() sim['inmodel'] = self._model sim['outevents'] = events_name sim['caldb'] = self._caldb sim['irf'] = self._irf sim['ra'] = ra sim['dec'] = dec sim['rad'] = rad_sim sim['tmin'] = tstart sim['tmax'] = tstop sim['emin'] = emin sim['emax'] = emax sim.execute() # Select events select = ctools.ctselect() select['inobs'] = events_name select['outobs'] = selected_events_name select['ra'] = ra select['dec'] = dec select['rad'] = rad_select select['tmin'] = tstart select['tmax'] = tstop select['emin'] = emin select['emax'] = emax select.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like['inobs'] = selected_events_name like['inmodel'] = self._model like['outmodel'] = result_name like['caldb'] = self._caldb like['irf'] = self._irf like.execute() # Return return
def run_pipeline(obs, ra=83.63, dec=22.01, rad=3.0, emin=0.1, emax=100.0, tmin=0.0, tmax=0.0, model="${CTOOLS}/share/models/crab.xml", caldb="prod2", irf="South_50h", debug=False): """ Simulation and unbinned analysis pipeline. Keywords: ra - RA of cube centre [deg] (default: 83.63) dec - DEC of cube centre [deg] (default: 22.01) rad - Selection radius [deg] (default: 3.0) emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) tmin - Start time [MET] (default: 0.0) tmax - Stop time [MET] (default: 0.0) model - Model Xml file caldb - Calibration database path (default: "dummy") irf - Instrument response function (default: cta_dummy_irf) debug - Enable debugging (default: False) """ # Get model # Simulate events sim = ctools.ctobssim(obs) sim["debug"] = debug sim["outevents"] = "obs.xml" sim.execute() # Select events select = ctools.ctselect() select["inobs"] = "obs.xml" select["outobs"] = "obs_selected.xml" select["ra"] = ra select["dec"] = dec select["rad"] = rad select["emin"] = emin select["emax"] = emax select["tmin"] = tmin select["tmax"] = tmax select["debug"] = debug select.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like["inobs"] = "obs_selected.xml" like["inmodel"] = model like["outmodel"] = "fit_results.xml" like["caldb"] = caldb like["irf"] = irf like["debug"] = True # Switch this always on for results in console like.execute() # Return return
def test_unbinned_fits(self): """ Test unbinned pipeline with FITS file saving """ # Set script parameters events_name = 'events.fits' selected_events_name = 'selected_events.fits' result_name = 'results.xml' ra = 83.63 dec = 22.01 rad_sim = 3.0 rad_select = 2.0 tstart = 0.0 tstop = 300.0 emin = 1.0 emax = 100.0 # Simulate events sim = ctools.ctobssim() sim['inmodel'] = self._model sim['outevents'] = events_name sim['caldb'] = self._caldb sim['irf'] = self._irf sim['ra'] = ra sim['dec'] = dec sim['rad'] = rad_sim sim['tmin'] = tstart sim['tmax'] = tstop sim['emin'] = emin sim['emax'] = emax sim.execute() # Select events select = ctools.ctselect() select['inobs'] = events_name select['outobs'] = selected_events_name select['ra'] = ra select['dec'] = dec select['rad'] = rad_select select['tmin'] = tstart select['tmax'] = tstop select['emin'] = emin select['emax'] = emax select.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like['inobs'] = selected_events_name like['inmodel'] = self._model like['outmodel'] = result_name like['caldb'] = self._caldb like['irf'] = self._irf like.execute() # Return return
def ctlike(inobs, inmodel, outmodel, caldb='prod2', irf='South_0.5h'): """""" ctl = ctools.ctlike() ctl['inobs'] = inobs ctl['caldb'] = caldb ctl['irf'] = irf ctl['inmodel'] = inmodel ctl['outmodel'] = outmodel ctl.execute() print("Generated " + outmodel)
def run_pipeline(obs, emin=0.1, emax=100.0, enumbins=20, nxpix=200, nypix=200, binsz=0.02, coordsys="CEL", proj="CAR", debug=False): """ Simulation and binned analysis pipeline. Keywords: emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) enumbins - Number of energy bins in cube (default: 20) nxpix - Number of RA pixels in cube (default: 200) nypix - Number of DEC pixels in cube (default: 200) binsz - Spatial cube bin size [deg] (default: 0.02) coordsys - Cube coordinate system (CEL or GAL) proj - Cube World Coordinate System (WCS) projection debug - Enable debugging (default: False) """ # Simulate events sim = ctools.ctobssim(obs) sim["debug"] = debug sim.run() # Bin events by looping over all observations in the container obs = gammalib.GObservations() obs.models(sim.obs().models()) for run in sim.obs(): # Create container with a single observation container = gammalib.GObservations() container.append(run) # Bin events for that observation bin = ctools.ctbin(container) bin["ebinalg"] = "LOG" bin["emin"] = emin bin["emax"] = emax bin["enumbins"] = enumbins bin["nxpix"] = nxpix bin["nypix"] = nypix bin["binsz"] = binsz bin["coordsys"] = coordsys bin["usepnt"] = True bin["proj"] = proj bin.run() # Append result to observations obs.extend(bin.obs()) # Perform maximum likelihood fitting like = ctools.ctlike(obs) like["debug"] = True # Switch this always on for results in console like.run() # Return return
def fit(obs, srcmodel, spec, bkgname, analysis, pars, alpha=1.0): """ Analyse one observation and determine the background model Parameters ---------- obs : `~gammalib.GObservations()` Observation container srcmodel : str Source model spec : str Spectral model bkgname : str Background model definition XML file analysis : str Analyse name pars : dict Dictionary of analysis parameters alpha : float, optional Map scaling factor """ # Set file names outmodel = 'rx_results_%s.xml' % analysis logfile = 'rx_results_%s.log' % analysis # Continue only if result file does not exist if not os.path.isfile(outmodel): # Set models models = set_model(srcmodel, spec, bkgname, alpha=alpha) # Attach models obs.models(models) # Perform maximum likelihood fitting with initial models like = ctools.ctlike(obs) like['edisp'] = pars['edisp'] like['outmodel'] = outmodel like['max_iter'] = 500 like['logfile'] = logfile like['debug'] = True like.logFileOpen() # Use wstat if no background model is provided if bkgname == '': like['statistic'] = 'WSTAT' # Execute ctlike like.execute() # Return return
def ctlike_unbinned(selected_events_name, IRF, CALDB, outfile): """ Copied and modified from ctools/test/test_python.py """ # Perform maximum likelihood fitting like = ctools.ctlike() like.logFileOpen() like["infile"].filename(selected_events_name) like["srcmdl"].filename('$CTOOLS/share/models/crab.xml') like["outmdl"].filename(outfile) like["caldb"].string(CALDB) like["irf"].string(IRF) like.execute()
def ctlike_unbinned(selected_events_name, IRF, CALDB, outfile): """ Copied and modified from ctools/test/test_python.py """ # Perform maximum likelihood fitting like = ctools.ctlike() like.logFileOpen() like["infile"].filename(selected_events_name) like["srcmdl"].filename('$CTOOLS/share/models/crab.xml') like["outmdl"].filename(outfile) like["caldb"].string(CALDB) like["irf"].string(IRF) like.execute()
def create_fit(self, log=False, debug=False): ''' Create ctlike instance with given parameters Parameters --------- log : save or not the log file debug : debug mode or not. This will print a lot of information ''' self.info("Fitting Data using ctlike") if self.m_obs: self.like = ct.ctlike(self.m_obs) else: self.like = ct.ctlike() for k in self.config.keys(): try: for kk in self.config[k].keys(): if self.like._has_par(kk): self.like[kk] = self.config[k][kk] except: if self.like._has_par(k): self.like[k] = self.config[k] if self.config["analysis"]["likelihood"] == "binned": self.like["inobs"] = join(self.workdir, self.config['file']["cube"]) self.like["outmodel"] = self.config['out'] + "/" + self.config[ 'target']["name"] + "_results.xml" # Optionally open the log file if log: self.like.logFileOpen() # Optionally switch-on debugging model if debug: self.like["debug"].boolean(True) if self.verbose: print self.like
def create_fit(self,log=False,debug=False, **kwargs): ''' Create ctlike instance with given parameters Parameters --------- log : save or not the log file debug : debug mode or not. This will print a lot of information ''' self.info("Fitting Data using ctlike") if self.m_obs: self.like = ct.ctlike(self.m_obs) else: self.like = ct.ctlike() self._fill_app(self.like,log=log,debug=debug, **kwargs) if self.config["analysis"]["likelihood"] == "binned": self.like["inobs"] = join(self.outdir,self.config['file']["cntcube"]) self.like["outmodel"] = self.config['out']+"/"+self.config['file']["tag"]+"_results.xml" self.like["edisp"] = self.config['analysis']["edisp"] if self.verbose: print self.like
def npred(obs, analysis, pars): """ Determine Npred of source Parameters ---------- obs : `~gammalib.GObservations()` Observation container analysis : str Analyse name pars : dict Dictionary of analysis parameters """ # Set file names inmodel = 'rx_results_%s.xml' % analysis outmodel = 'rx_npred_%s.xml' % analysis logfile = 'rx_npred_%s.log' % analysis # Continue only if result file does not exist if not os.path.isfile(outmodel) and os.path.isfile(inmodel): # Set models models = gammalib.GModels(inmodel) model = models['RX J1713.7-3946'] for par in model: par.fix() model.tscalc(False) # Otherwise leads to an error npred_models = gammalib.GModels() npred_models.append(model) # Attach models obs.models(npred_models) # If statistic is wstat then switch to cstat (since wstat does not # correctly compute Npred) for o in obs: if o.statistic() == 'wstat': o.statistic('cstat') # Perform maximum likelihood fitting like = ctools.ctlike(obs) like['edisp'] = pars['edisp'] like['outmodel'] = outmodel like['logfile'] = logfile like['debug'] = True like.logFileOpen() like.execute() # Return return
def __init__(self,analyser,srcname,parname = "Prefactor"): super(UpperLimitComputer,self).__init__() self.info("Creating "+self.classname+" object") # self.like = analyser.like.copy() obs = analyser.like.obs().copy() self.like = ct.ctlike(obs) self.succes = False # get spectral model self.model = self.like.obs().models()[srcname] self.spec = self.model.spectral() self.parname = parname self.bestloglike = analyser.like.opt().value() self.dloglike = 3.84/2.0 #95% CL now
def _fit_energy_bins(self): """ Fit model to energy bins Returns ------- results : list of dict List of dictionaries with fit results """ # Write header self._log_header1(gammalib.TERSE, 'Generate spectrum') self._log_string(gammalib.TERSE, str(self._ebounds)) like = ctools.ctlike(self.obs()) like['edisp'] = self['edisp'].boolean() like.run() logL = like.obs().logL() # print( 'Total LogLikelihood {:.7e}'.format( logL ) ) # Initialise results results = [] # If more than a single thread is requested then use multiprocessing if self._nthreads > 1: # Compute energy bins args = [(self, '_fit_energy_bin', i) for i in range(self._ebounds.size())] poolresults = mputils.process(self._nthreads, mputils.mpfunc, args) # Construct results for i in range(self._ebounds.size()): results.append(poolresults[i][0]) self._log_string(gammalib.TERSE, poolresults[i][1]['log'], False) # Otherwise, loop over energy bins else: for i in range(self._ebounds.size()): # Fit energy bin result = self._fit_energy_bin( i ) # Append results results.append(result) # Return results return results
def npred(obs, analysis, pars, fitname='pks_results', npredname='pks_npred'): """ Determine Npred of source Parameters ---------- obs : `~gammalib.GObservations()` Observation container analysis : str Analyse name pars : dict Dictionary of analysis parameters fitname : str, optional Fit result prefix npredname : str, optional Npred result prefix """ # Set file names inmodel = '%s_%s.xml' % (fitname, analysis) outmodel = '%s_%s.xml' % (npredname, analysis) logfile = '%s_%s.log' % (npredname, analysis) # Continue only if result file does not exist if not os.path.isfile(outmodel) and os.path.isfile(inmodel): # Set models models = gammalib.GModels(inmodel) model = models['PKS 2155-304'] for par in model: par.fix() model.tscalc(False) # Otherwise leads to an error npred_models = gammalib.GModels() npred_models.append(model) # Attach models obs.models(npred_models) # Perform maximum likelihood fitting like = ctools.ctlike(obs) like['edisp'] = pars['edisp'] like['outmodel'] = outmodel like['logfile'] = logfile like['debug'] = True like.logFileOpen() like.execute() # Return return
def ctlike_run(observation_file, input_model, force=0): working_dir = os.path.dirname(observation_file) result_file = os.path.join(working_dir, "ml_result.xml") log_file = os.path.join(working_dir, "ctlike.log") if not os.path.isfile(result_file) or force == 1: like = ctools.ctlike() like.clear() like["inobs"] = observation_file like["inmodel"] = input_model like["outmodel"] = result_file like["logfile"] = log_file like.logFileOpen() like.run() like.save() sys.stderr.write("File '%s' created.\n" % result_file) return result_file
def test_unbinned_mem(self): """ Test unbinned in-memory pipeline """ # Set script parameters ra = 83.63 dec = 22.01 rad_sim = 10.0 rad_select = 3.0 tstart = 0.0 tstop = 300.0 emin = 0.1 emax = 100.0 # Simulate events sim = ctools.ctobssim() sim['inmodel'] = self._model sim['caldb'] = self._caldb sim['irf'] = self._irf sim['ra'] = ra sim['dec'] = dec sim['rad'] = rad_sim sim['tmin'] = tstart sim['tmax'] = tstop sim['emin'] = emin sim['emax'] = emax sim.run() # Select events select = ctools.ctselect(sim.obs()) select['ra'] = ra select['dec'] = dec select['rad'] = rad_select select['tmin'] = tstart select['tmax'] = tstop select['emin'] = emin select['emax'] = emax select.run() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like.run() # Return return
def test_unbinned_mem(self): """ Test unbinned in-memory pipeline """ # Set script parameters ra = 83.63 dec = 22.01 rad_sim = 3.0 rad_select = 2.0 tstart = 0.0 tstop = 300.0 emin = 1.0 emax = 100.0 # Simulate events sim = ctools.ctobssim() sim['inmodel'] = self._model sim['caldb'] = self._caldb sim['irf'] = self._irf sim['ra'] = ra sim['dec'] = dec sim['rad'] = rad_sim sim['tmin'] = tstart sim['tmax'] = tstop sim['emin'] = emin sim['emax'] = emax sim.run() # Select events select = ctools.ctselect(sim.obs()) select['ra'] = ra select['dec'] = dec select['rad'] = rad_select select['tmin'] = tstart select['tmax'] = tstop select['emin'] = emin select['emax'] = emax select.run() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like.run() # Return return
def run_pipeline(obs, ra=83.63, dec=22.01, rad=3.0, \ emin=0.1, emax=100.0, \ tmin=0.0, tmax=0.0, \ debug=False): """ Simulation and unbinned analysis pipeline. Keywords: ra - RA of cube centre [deg] (default: 83.63) dec - DEC of cube centre [deg] (default: 22.01) rad - Selection radius [deg] (default: 3.0) emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) tmin - Start time [MET] (default: 0.0) tmax - Stop time [MET] (default: 0.0) debug - Enable debugging (default: False) """ # Simulate events sim = ctools.ctobssim(obs) sim["debug"].boolean(debug) sim.run() # Select events select = ctools.ctselect(sim.obs()) select["ra"].real(ra) select["dec"].real(dec) select["rad"].real(rad) select["emin"].real(emin) select["emax"].real(emax) select["tmin"].real(tmin) select["tmax"].real(tmax) select["debug"].boolean(debug) select.run() # Perform maximum likelihood fitting like = ctools.ctlike(select.obs()) like["debug"].boolean(True) # Switch this always on for results in console like.run() # Return return
def makeFit(cfg): """ makes fit with ctlike """ # Perform maximum likelihood fitting outputdir = cfg.getValue('general', 'outputdir') like = ctools.ctlike() if cfg.getValue('general', 'anatype') == 'unbinned': like["inobs"] = outputdir + '/' + cfg.getValue('ctselect', 'output') like["inmodel"] = outputdir + '/' + \ cfg.getValue('csiactobs', 'model_output') elif cfg.getValue('general', 'anatype') == 'binned': like["inobs"] = outputdir + '/' + cfg.getValue('ctbin', 'output') like["inmodel"] = outputdir + '/' + \ cfg.getValue('ctbkgcube', 'output_model') like["expcube"] = outputdir + '/' + cfg.getValue('ctexpcube', 'output') like["psfcube"] = outputdir + '/' + cfg.getValue('ctpsfcube', 'output') like["bkgcube"] = outputdir + '/' + \ cfg.getValue('ctbkgcube', 'output_cube') else: Utilities.warning('Unlnown type: {}'.format( cfg.getValue('general', 'anatype'))) sys.exit() if cfg.getValue('general', 'edisp'): like["edisp"] = True else: like["edisp"] = False like["outmodel"] = outputdir + '/' + cfg.getValue('ctlike', 'output') like["chatter"] = 1 if cfg.getValue('general', 'debug') is True: like["debug"] = True like.run() like.save()
def run(self): """ Run the script. """ # Switch screen logging on in debug mode if self.logDebug(): self.log.cout(True) # Get parameters self.get_parameters() # Write input parameters into logger if self.logTerse(): self.log_parameters() self.log("\n") # Write observation into logger if self.logTerse(): self.log("\n") self.log.header1("Observation") self.log(str(self.obs)) self.log("\n") # Write header if self.logTerse(): self.log("\n") self.log.header1("Adjust model parameters") # Adjust model parameters dependent on input user parameters for model in self.obs.models(): # Set TS flag for all models to false. # Source of interest will be set to true later model.tscalc(False) # Log model name if self.logExplicit(): self.log.header3(model.name()) # Deal with the source of interest if model.name() == self.m_srcname: if self.m_calc_ts: model.tscalc(True) elif self.m_fix_bkg and not model.classname() == "GModelSky": for par in model: if par.is_free() and self.logExplicit(): self.log(" Fixing \""+par.name()+"\"\n") par.fix() elif self.m_fix_srcs and model.classname() == "GModelSky": for par in model: if par.is_free() and self.logExplicit(): self.log(" Fixing \""+par.name()+"\"\n") par.fix() # Write header if self.logTerse(): self.log("\n") self.log.header1("Generate lightcurve") # Initialise FITS Table with extension "LIGHTCURVE" table = gammalib.GFitsBinTable(self.m_tbins.size()) table.extname("LIGHTCURVE") # Add Header for compatibility with gammalib.GMWLSpectrum table.card("INSTRUME", "CTA", "Name of Instrument") table.card("TELESCOP", "CTA", "Name of Telescope") # Create FITS table columns MJD = gammalib.GFitsTableDoubleCol("MJD", self.m_tbins.size()) MJD.unit("days") e_MJD = gammalib.GFitsTableDoubleCol("e_MJD", self.m_tbins.size()) e_MJD.unit("days") # Create a FITS column for every free parameter columns = [] for par in self.obs.models()[self.m_srcname]: if par.is_free(): col = gammalib.GFitsTableDoubleCol(par.name(), self.m_tbins.size()) col.unit(par.unit()) columns.append(col) e_col = gammalib.GFitsTableDoubleCol("e_"+par.name(), self.m_tbins.size()) e_col.unit(par.unit()) columns.append(e_col) # Create TS and upper limit columns TSvalues = gammalib.GFitsTableDoubleCol("TS", self.m_tbins.size()) ulim_values = gammalib.GFitsTableDoubleCol("UpperLimit", self.m_tbins.size()) ulim_values.unit("ph/cm2/s") # Loop over energy bins for i in range(self.m_tbins.size()): # Log information if self.logTerse(): self.log("\n") self.log.header2("Time bin "+str(i)) # Get time boundaries tmin = self.m_tbins.tstart(i) tmax = self.m_tbins.tstop(i) # Compute time bin center and time width tmean = (tmin + tmax) tmean *= 0.5 twidth = (tmax - tmin) twidth *= 0.5 # Store time as MJD MJD[i] = tmean.mjd() e_MJD[i] = twidth.days() # Log information if self.logExplicit(): self.log.header3("Selecting events") # Select events select = ctools.ctselect(self.obs) select["emin"].real(self.m_emin) select["emax"].real(self.m_emax) select["tmin"].real(tmin.convert(select.time_reference())) select["tmax"].real(tmax.convert(select.time_reference())) select["rad"].value("UNDEFINED") select["ra"].value("UNDEFINED") select["dec"].value("UNDEFINED") select.run() # Retrieve observation obs = select.obs() # Binned analysis if self.m_binned: # Header if self.logTerse(): self.log.header3("Binning events") # Bin events bin = ctools.ctbin(select.obs()) bin["usepnt"].boolean(False) bin["ebinalg"].string("LOG") bin["xref"].real(self.m_xref) bin["yref"].real(self.m_yref) bin["binsz"].real(self.m_binsz) bin["nxpix"].integer(self.m_nxpix) bin["nypix"].integer(self.m_nypix) bin["enumbins"].integer(self.m_ebins) bin["emin"].real(self.m_emin) bin["emax"].real(self.m_emax) bin["coordsys"].string(self.m_coordsys) bin["proj"].string(self.m_proj) bin.run() # Header if self.logTerse(): self.log.header3("Creating exposure cube") # Create exposure cube expcube = ctools.ctexpcube(select.obs()) expcube["incube"].filename("NONE") expcube["usepnt"].boolean(False) expcube["ebinalg"].string("LOG") expcube["xref"].real(self.m_xref) expcube["yref"].real(self.m_yref) expcube["binsz"].real(self.m_binsz) expcube["nxpix"].integer(self.m_nxpix) expcube["nypix"].integer(self.m_nypix) expcube["enumbins"].integer(self.m_ebins) expcube["emin"].real(self.m_emin) expcube["emax"].real(self.m_emax) expcube["coordsys"].string(self.m_coordsys) expcube["proj"].string(self.m_proj) expcube.run() # Header if self.logTerse(): self.log.header3("Creating PSF cube") # Create psf cube psfcube = ctools.ctpsfcube(select.obs()) psfcube["incube"].filename("NONE") psfcube["usepnt"].boolean(False) psfcube["ebinalg"].string("LOG") psfcube["xref"].real(self.m_xref) psfcube["yref"].real(self.m_yref) psfcube["binsz"].real(self.m_binsz) psfcube["nxpix"].integer(self.m_nxpix) psfcube["nypix"].integer(self.m_nypix) psfcube["enumbins"].integer(self.m_ebins) psfcube["emin"].real(self.m_emin) psfcube["emax"].real(self.m_emax) psfcube["coordsys"].string(self.m_coordsys) psfcube["proj"].string(self.m_proj) psfcube.run() # Header if self.logTerse(): self.log.header3("Creating background cube") # Create background cube bkgcube = ctools.ctbkgcube(select.obs()) bkgcube["incube"].filename("NONE") bkgcube["usepnt"].boolean(False) bkgcube["ebinalg"].string("LOG") bkgcube["xref"].real(self.m_xref) bkgcube["yref"].real(self.m_yref) bkgcube["binsz"].real(self.m_binsz) bkgcube["nxpix"].integer(self.m_nxpix) bkgcube["nypix"].integer(self.m_nypix) bkgcube["enumbins"].integer(self.m_ebins) bkgcube["emin"].real(self.m_emin) bkgcube["emax"].real(self.m_emax) bkgcube["coordsys"].string(self.m_coordsys) bkgcube["proj"].string(self.m_proj) bkgcube.run() # Set new binned observation obs = bin.obs() # Set precomputed binned response obs[0].response(expcube.expcube(), psfcube.psfcube(), bkgcube.bkgcube()) # Get new models models = bkgcube.models() # Fix background models if required if self.m_fix_bkg: for model in models: if not model.classname() == "GModelSky": for par in model: par.fix() # Set new models to binned observation obs.models(models) # Header if self.logTerse(): self.log.header3("Performing fit") # Likelihood like = ctools.ctlike(obs) like.run() # Skip bin if no event was present if like.obs().logL() == 0.0: # Log information if self.logTerse(): self.log("No event in this time bin. Bin is skipped\n") # Set all values to 0 for col in columns: col[i] = 0.0 TSvalues[i] = 0.0 ulim_values[i] = 0.0 continue # Get results fitted_models = like.obs().models() source = fitted_models[self.m_srcname] # Calculate Upper Limit ulimit_value = -1.0 if self.m_calc_ulimit: # Logging information if self.logTerse(): self.log.header3("Computing upper limit") # Create upper limit object ulimit = ctools.ctulimit(like.obs()) ulimit["srcname"].string(self.m_srcname) ulimit["eref"].real(1.0) # Try to run upper limit and catch exceptions try: ulimit.run() ulimit_value = ulimit.flux_ulimit() except: if self.logTerse(): self.log("Upper limit calculation failed\n") ulimit_value = -1.0 # Get TS value TS = -1.0 if self.m_calc_ts: TS = source.ts() # Set values for storage TSvalues[i] = TS # Set FITS column values for col in columns: if "e_" == col.name()[:2]: col[i] = source.spectral()[col.name()[2:]].error() else: col[i] = source.spectral()[col.name()].value() # Store upper limit value if available if ulimit_value > 0.0: ulim_values[i] = ulimit_value # Log information if self.logExplicit(): self.log.header3("Results of bin "+str(i)+": MJD "+str(tmin.mjd())+"-"+str(tmax.mjd())) for col in columns: if "e_" == col.name()[:2]: continue value = source.spectral()[col.name()].value() error = source.spectral()[col.name()].error() unit = source.spectral()[col.name()].unit() self.log(" > "+col.name()+": "+str(value)+" +- "+str(error)+" "+unit+"\n") if self.m_calc_ts and TSvalues[i] > 0.0: self.log(" > TS = "+str(TS)+" \n") if self.m_calc_ulimit and ulim_values[i] > 0.0: self.log(" > UL = "+str(ulim_values[i])+" [ph/cm2/s]") self.log("\n") # Append filles columns to fits table table.append(MJD) table.append(e_MJD) for col in columns: table.append(col) table.append(TSvalues) table.append(ulim_values) # Create the FITS file now self.fits = gammalib.GFits() self.fits.append(table) # Return return
def fit(obs, srcmodel, spec, bkgname, analysis, pars, fitname='pks_results'): """ Analyse one observation and determine the background model Parameters ---------- obs : `~gammalib.GObservations()` Observation container srcmodel : str Source model spec : str Spectral model bkgname : str Background model definition XML file analysis : str Analyse name pars : dict Dictionary of analysis parameters fitname : str, optional Fit result prefix """ # Set file names outmodel = '%s_%s.xml' % (fitname, analysis) logfile = '%s_%s.log' % (fitname, analysis) # Continue only if result file does not exist if not os.path.isfile(outmodel): # Set models models = set_model(srcmodel, spec, bkgname) # Attach models obs.models(models) # Perform maximum likelihood fitting with initial models like = ctools.ctlike(obs) like['edisp'] = pars['edisp'] like['outmodel'] = outmodel like['logfile'] = logfile like['max_iter'] = 200 like['debug'] = True like.logFileOpen() # Use wstat if no background model is provided if bkgname == '': like['statistic'] = 'WSTAT' # Execute ctlike like.execute() # Compute energy flux and add it to log file if os.path.isfile(outmodel): # Load result file and compute energy flux emin = gammalib.GEnergy(0.3, 'TeV') emax = gammalib.GEnergy(3.0, 'TeV') models = gammalib.GModels(outmodel) eflux = models['PKS 2155-304'].spectral().eflux(emin, emax) # Append result to output file with open(logfile, "a") as myfile: myfile.write('\n') myfile.write('Energy flux (0.3-3 TeV): %e' % eflux) # Return return
def run_pipeline(obs, emin=0.1, emax=100.0, \ enumbins=20, nxpix=200, nypix=200, binsz=0.02, \ coordsys="CEL", proj="CAR", \ model="${CTOOLS}/share/models/crab.xml", \ caldb="prod2", irf="South_50h", \ debug=False): """ Simulation and binned analysis pipeline. Keywords: emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) enumbins - Number of energy bins in cube (default: 20) nxpix - Number of RA pixels in cube (default: 200) nypix - Number of DEC pixels in cube (default: 200) binsz - Spatial cube bin size [deg] (default: 0.02) coordsys - Cube coordinate system (CEL or GAL) proj - Cube World Coordinate System (WCS) projection model - Model Xml file caldb - Calibration database path (default: "dummy") irf - Instrument response function (default: cta_dummy_irf) debug - Enable debugging (default: False) """ # Simulate events sim = ctools.ctobssim(obs) sim["debug"].boolean(debug) sim["outevents"].filename("obs.xml") sim.execute() # Bin events by looping over all observations in the container sim_obs = gammalib.GObservations("obs.xml") obs = gammalib.GObservations() for run in sim_obs: # Get event filename and set counts cube filename eventfile = run.eventfile() cubefile = "cube_"+eventfile # Bin events for that observation bin = ctools.ctbin() bin["inobs"].filename(eventfile) bin["outcube"].filename(cubefile) bin["ebinalg"].string("LOG") bin["emin"].real(emin) bin["emax"].real(emax) bin["enumbins"].integer(enumbins) bin["nxpix"].integer(nxpix) bin["nypix"].integer(nypix) bin["binsz"].real(binsz) bin["coordsys"].string(coordsys) bin["usepnt"].boolean(True) bin["proj"].string(proj) bin.execute() # Set observation ID bin.obs()[0].id(cubefile) bin.obs()[0].eventfile(cubefile) # Append result to observations obs.extend(bin.obs()) # Save XML file xml = gammalib.GXml() obs.write(xml) xml.save("obs_cube.xml") # Perform maximum likelihood fitting like = ctools.ctlike() like["inobs"].filename("obs_cube.xml") like["inmodel"].filename(model) like["outmodel"].filename("fit_results.xml") like["expcube"].filename("NONE") like["psfcube"].filename("NONE") like["bkgcube"].filename("NONE") like["caldb"].string(caldb) like["irf"].string(irf) like["debug"].boolean(True) # Switch this always on for results in console like.execute() # Return return
def _generate_bkg(self, obs): """ Generate background models Parameters ---------- obs : `~gammalib.GObservations()` Observations container Returns ------- model : `~gammalib.GModelData()` Background model component """ # Write header for event selection self._log_header3(gammalib.EXPLICIT, 'Select events from observation') # Select events obs = self._select_events(obs) # Write header for initial background model generation self._log_header3(gammalib.EXPLICIT, 'Generate initial background model') # Generate initial background model model = self._generate_initial_model() # Attach initial background model models = gammalib.GModels() models.append(model) obs.models(models) # Write header for initial model fitting self._log_header3(gammalib.EXPLICIT, 'Fit initial background model') # Perform maximum likelihood fitting with initial model like = ctools.ctlike(obs) like.run() # Extract optimiser opt = like.opt() # Extract fitted model model = like.obs().models()[0].copy() # If a NODES model is requested then refit a node spectrum if self['spectral'].string() == 'NODES': # Create nodes spectrum from fitted initial model model = self._create_nodes(model) # Attach node spectrum models = gammalib.GModels() models.append(model) obs.models(models) # Write header for node model fitting self._log_header3(gammalib.EXPLICIT, 'Fit nodes background model') # Perform maximum likelihood fitting with node model like = ctools.ctlike(obs) like.run() # Extract optimiser opt = like.opt() # Extract fitted model model = like.obs().models()[0].copy() # Remove nodes with zero errors as they are not constrained # by the data and may lead to fitting problems later spectral = model.spectral() nodes = spectral.nodes() for i in range(nodes): iint = 2 * (nodes - i) - 1 if spectral[iint].error() == 0.0: spectral.remove(nodes - i - 1) # Write optimizer self._log_string(gammalib.EXPLICIT, str(opt)) # Return model return model
def test_unbinned_fits(self): """ Test unbinned pipeline with FITS file saving. """ # Set script parameters model_name = "data/crab.xml" events_name = "events.fits" selected_events_name = "selected_events.fits" result_name = "results.xml" caldb = "irf" irf = "cta_dummy_irf" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = 1800.0 emin = 0.1 emax = 100.0 rad_select = 3.0 # Simulate events sim = ctools.ctobssim() sim["inmodel"].filename(model_name) sim["outevents"].filename(events_name) sim["caldb"].string(caldb) sim["irf"].string(irf) sim["ra"].real(ra) sim["dec"].real(dec) sim["rad"].real(rad_sim) sim["tmin"].real(tstart) sim["tmax"].real(tstop) sim["emin"].real(emin) sim["emax"].real(emax) self.test_try("Execute ctobssim") try: sim.execute() self.test_try_success() except: self.test_try_failure("Exception occured in ctobssim.") # Select events select = ctools.ctselect() select["inobs"].filename(events_name) select["outobs"].filename(selected_events_name) select["ra"].real(ra) select["dec"].real(dec) select["rad"].real(rad_select) select["tmin"].real(tstart) select["tmax"].real(tstop) select["emin"].real(emin) select["emax"].real(emax) self.test_try("Execute ctselect") try: select.execute() self.test_try_success() except: self.test_try_failure("Exception occured in ctselect.") # Perform maximum likelihood fitting like = ctools.ctlike() like["inobs"].filename(selected_events_name) like["inmodel"].filename(model_name) like["outmodel"].filename(result_name) like["caldb"].string(caldb) like["irf"].string(irf) self.test_try("Execute ctlike") try: like.execute() self.test_try_success() except: self.test_try_failure("Exception occured in ctlike.")
def gw_simulation(sim_in, config_in, model_xml, fits_model, counter): """ :param sim_in: :param config_in: :param model_xml: :param fits_model: :param counter: :return: """ src_name = fits_model.split("/")[-1][:-5] run_id, merger_id = src_name.split('_') fits_header_0 = fits.open(fits_model)[0].header ra_src = fits_header_0['RA'] dec_src = fits_header_0['DEC'] coordinate_source = SkyCoord(ra=ra_src * u.deg, dec=dec_src * u.deg, frame="icrs") src_yaml = sim_in['source'] point_path = create_path(src_yaml['pointings_path']) opt_point_path = f"{point_path}/optimized_pointings" ctools_pipe_path = create_path(config_in['exe']['software_path']) ctobss_params = sim_in['ctobssim'] seed = int(counter)*10 # # PARAMETERS FROM THE CTOBSSIM sim_e_min = u.Quantity(ctobss_params['energy']['e_min']).to_value(u.TeV) sim_e_max = u.Quantity(ctobss_params['energy']['e_max']).to_value(u.TeV) sim_rad = ctobss_params['radius'] output_path = create_path(sim_in['output']['path'] + f"/{src_name}/seed-{seed:03}") irf_dict = sim_in['IRF'] site = irf_dict['site'] detection = sim_in['detection'] significance_map = detection['skymap_significance'] srcdetect_ctlike = detection['srcdetect_likelihood'] save_simulation = ctobss_params['save_simulation'] try: mergers_data = pd.read_csv( f"{point_path}/BNS-GW-Time_onAxis5deg.txt", sep=" ") except FileNotFoundError: print("merger data not present. check that the text file with the correct pointings is in the 'pointings' folder!") sys.exit() filter_mask = (mergers_data["run"] == run_id) & (mergers_data["MergerID"] == f"Merger{merger_id}") merger_onset_data = mergers_data[filter_mask] time_onset_merger = merger_onset_data['Time'].values[0] with open(f"{output_path}/GW-{src_name}_seed-{seed:03}_site-{site}.txt", "w") as f: f.write(f"GW_name\tRA_src\tDEC_src\tseed\tpointing_id\tsrc_to_point\tsrc_in_point\tra_point\tdec_point\tradius\ttime_start\ttime_end\tsignificanceskymap\tsigmasrcdetectctlike\n") try: file_name = f"{opt_point_path}/{run_id}_Merger{merger_id}_GWOptimisation_v3.txt" pointing_data = pd.read_csv( file_name, header=0, sep=",") except FileNotFoundError: print("File not found\n") sys.exit() RA_data = pointing_data['RA(deg)'] DEC_data = pointing_data['DEC(deg)'] times = pointing_data['Observation Time UTC'] durations = pointing_data['Duration'] # LOOP OVER POINTINGS for index in range(0, len(pointing_data)): RA_point = RA_data[index] DEC_point = DEC_data[index] coordinate_pointing = SkyCoord( ra=RA_point * u.degree, dec=DEC_point * u.degree, frame="icrs" ) src_from_pointing = coordinate_pointing.separation(coordinate_source) t_in_point = Time(times[index]) obs_condition = Observability(site=site) obs_condition.set_irf(irf_dict) obs_condition.Proposal_obTime = 10 obs_condition.TimeOffset = 0 obs_condition.Steps_observability = 10 condition_check = obs_condition.check(RA=RA_point, DEC=DEC_point, t_start=t_in_point) # once the IRF has been chosen, the times are shifted # this is a quick and dirty solution to handle the times in ctools...not elegant for sure t_in_point = (Time(times[index]) - Time(time_onset_merger)).to(u.s) t_end_point = t_in_point + durations[index] * u.s if len(condition_check) == 0: print(f"Source Not Visible in pointing {index}") f.write( f"{src_name}\t{ra_src}\t{dec_src}\t{seed}\t{index}\t{src_from_pointing.value:.2f}\t{src_from_pointing.value < sim_rad}\t{RA_point}\t{DEC_point}\t{sim_rad}\t{t_in_point.value:.2f}\t{t_end_point.value:.2f}\t -1 \t -1\n") continue name_irf = condition_check['IRF_name'][0] irf = condition_check['IRF'][0] # model loading if irf.prod_number == "3b" and irf.prod_version == 0: caldb = "prod3b" else: caldb = f'prod{irf.prod_number}-v{irf.prod_version}' # simulation sim = ctools.ctobssim() sim['inmodel'] = model_xml sim['caldb'] = caldb sim['irf'] = name_irf sim['ra'] = RA_point sim['dec'] = DEC_point sim['rad'] = sim_rad sim['tmin'] = t_in_point.value sim['tmax'] = t_end_point.value sim['emin'] = sim_e_min sim['emax'] = sim_e_max sim['seed'] = seed if save_simulation: event_list_path = create_path(f"{ctobss_params['output_path']}/{src_name}/seed-{seed:03}/") sim['outevents'] = f"{event_list_path}/event_list_source-{src_name}_seed-{seed:03}_pointingID-{index}.fits" sim.execute() f.write( f"{src_name}\t{ra_src}\t{dec_src}\t{seed}\t{index}\t{src_from_pointing.value:.2f}\t{src_from_pointing.value < sim_rad}\t{RA_point}\t{DEC_point}\t{sim_rad}\t{t_in_point.value:.2f}\t{t_end_point.value:.2f}\t -1 \t -1\n" ) continue else: sim.run() obs = sim.obs() obs.models(gammalib.GModels()) # ctskymap sigma_onoff = -1 sqrt_ts_like = -1 if significance_map: pars_skymap = detection['parameters_skymap'] scale = float(pars_skymap['scale']) npix = 2 * int(sim_rad / scale) fits_temp_title = f"{output_path}/GW-skymap_point-{index}_{seed}.fits" skymap = ctools.ctskymap(obs.copy()) skymap['proj'] = 'CAR' skymap['coordsys'] = 'CEL' skymap['xref'] = RA_point skymap['yref'] = DEC_point skymap['binsz'] = scale skymap['nxpix'] = npix skymap['nypix'] = npix skymap['emin'] = sim_e_min skymap['emax'] = sim_e_max skymap['bkgsubtract'] = 'RING' skymap['roiradius'] = pars_skymap['roiradius'] skymap['inradius'] = pars_skymap['inradius'] skymap['outradius'] = pars_skymap['outradius'] skymap['iterations'] = pars_skymap['iterations'] skymap['threshold'] = pars_skymap['threshold'] skymap['outmap'] = fits_temp_title skymap.execute() input_fits = fits.open(fits_temp_title) datain = input_fits['SIGNIFICANCE'].data datain[np.isnan(datain)] = 0.0 datain[np.isinf(datain)] = 0.0 sigma_onoff = np.max(datain) if pars_skymap['remove_fits']: os.remove(fits_temp_title) if srcdetect_ctlike: pars_detect = detection['parameters_detect'] scale = float(pars_detect['scale']) npix = 2 * int(sim_rad / scale) skymap = ctools.ctskymap(obs.copy()) skymap['proj'] = 'TAN' skymap['coordsys'] = 'CEL' skymap['xref'] = RA_point skymap['yref'] = DEC_point skymap['binsz'] = scale skymap['nxpix'] = npix skymap['nypix'] = npix skymap['emin'] = sim_e_min skymap['emax'] = sim_e_max skymap['bkgsubtract'] = 'NONE' skymap.run() # cssrcdetect srcdetect = cscripts.cssrcdetect(skymap.skymap().copy()) srcdetect['srcmodel'] = 'POINT' srcdetect['bkgmodel'] = 'NONE' srcdetect['corr_kern'] = 'GAUSSIAN' srcdetect['threshold'] = pars_detect['threshold'] srcdetect['corr_rad'] = pars_detect['correlation'] srcdetect.run() models = srcdetect.models() # if there's some detection we can do the likelihood. # Spectral model is a PL and the spatial model is the one from cssrcdetect if len(models) > 0: hotspot = models['Src001'] ra_hotspot = hotspot['RA'].value() dec_hotspot = hotspot['DEC'].value() models_ctlike = gammalib.GModels() src_dir = gammalib.GSkyDir() src_dir.radec_deg(ra_hotspot, dec_hotspot) spatial = gammalib.GModelSpatialPointSource(src_dir) spectral = gammalib.GModelSpectralPlaw() spectral['Prefactor'].value(5.5e-16) spectral['Prefactor'].scale(1e-16) spectral['Index'].value(-2.6) spectral['Index'].scale(-1.0) spectral['PivotEnergy'].value(50000) spectral['PivotEnergy'].scale(1e3) model_src = gammalib.GModelSky(spatial, spectral) model_src.name('PL_fit_GW') model_src.tscalc(True) models_ctlike.append(model_src) spectral_back = gammalib.GModelSpectralPlaw() spectral_back['Prefactor'].value(1.0) spectral_back['Prefactor'].scale(1.0) spectral_back['Index'].value(0) spectral_back['PivotEnergy'].value(300000) spectral_back['PivotEnergy'].scale(1e6) back_model = gammalib.GCTAModelIrfBackground() back_model.instruments('CTA') back_model.name('Background') back_model.spectral(spectral_back.copy()) models_ctlike.append(back_model) xmlmodel_PL_ctlike_std = f"{output_path}/model_PL_ctlike_std_seed-{seed}_pointing-{index}.xml" models_ctlike.save(xmlmodel_PL_ctlike_std) like_pl = ctools.ctlike(obs.copy()) like_pl['inmodel'] = xmlmodel_PL_ctlike_std like_pl['caldb'] = caldb like_pl['irf'] = name_irf like_pl.run() ts = -like_pl.obs().models()[0].ts() if ts > 0: sqrt_ts_like = np.sqrt(ts) else: sqrt_ts_like = 0 if pars_detect['remove_xml']: os.remove(xmlmodel_PL_ctlike_std) f.write( f"{src_name}\t{ra_src}\t{dec_src}\t{seed}\t{index}\t{src_from_pointing.value:.2f}\t{src_from_pointing.value < sim_rad}\t{RA_point:.2f}\t{DEC_point:.2f}\t{sim_rad}\t{t_in_point:.2f}\t{t_end_point:.2f}\t{sigma_onoff:.2f}\t{sqrt_ts_like}\n")
sim['inmodel'] = 'nu_sources_' + str(i + 1) + '.xml' sim['caldb'] = caldb sim['irf'] = irf sim['ra'] = ra sim['dec'] = dec sim['rad'] = 5.0 sim['tmin'] = '2020-05-31T12:00:00' sim['tmax'] = '2020-05-31T12:10:00' sim['emin'] = 0.02 sim['emax'] = 199.0 sim['maxrate'] = 1.0e9 sim['debug'] = debug sim['edisp'] = edisp sim.run() like = ctools.ctlike(sim.obs()) like['debug'] = debug like['edisp'] = edisp like.run() nuts = like.obs().models()[sourcename].ts() nunormsp = like.obs().models()[sourcename].spectral( )['Normalization'].value() nunormsp_error = like.obs().models()[sourcename].spectral( )['Normalization'].error() if nuts >= 25.: if nunormsp > 2. or nunormsp < 0.5: fake = str(i + 1) + ' ' + str(nuts) + ' ' + str( nunormsp) + ' ' + str(nunormsp_error) + ' ' + str( ra) + ' ' + str(dec) + ' ' + str(tsig) + '\n'
def _trial(self, seed): """ Compute the pull for a single trial Parameters ---------- seed : int Random number generator seed Returns ------- result : dict Dictionary of results """ # Write header self._log_header2(gammalib.NORMAL, 'Trial %d' % (seed-self['seed'].integer()+1)) # Get number of energy bins and On source name and initialise # some parameters nbins = self['enumbins'].integer() onsrc = self['onsrc'].string() edisp = self['edisp'].boolean() statistic = self['statistic'].string() emin = None emax = None binsz = 0.0 npix = 0 proj = 'TAN' coordsys = 'CEL' # If we have a On source name then set On region radius if gammalib.toupper(onsrc) != 'NONE': onrad = self['onrad'].real() emin = self['emin'].real() emax = self['emax'].real() edisp = True # Use always energy dispersion for On/Off else: # Reset On region source name and radius onrad = 0.0 onsrc = None # If we have a binned obeservation then specify the lower and # upper energy limit in TeV if nbins > 0: emin = self['emin'].real() emax = self['emax'].real() binsz = self['binsz'].real() npix = self['npix'].integer() proj = self['proj'].string() coordsys = self['coordsys'].string() # Simulate events obs = obsutils.sim(self.obs(), emin=emin, emax=emax, nbins=nbins, onsrc=onsrc, onrad=onrad, addbounds=True, seed=seed, binsz=binsz, npix=npix, proj=proj, coord=coordsys, edisp=edisp, log=False, debug=self._logDebug(), chatter=self['chatter'].integer()) # Determine number of events in simulation nevents = 0.0 for run in obs: nevents += run.nobserved() # Write simulation results self._log_header3(gammalib.NORMAL, 'Simulation') for run in self.obs(): self._log_value(gammalib.NORMAL, 'Input observation %s' % run.id(), self._obs_string(run)) for run in obs: self._log_value(gammalib.NORMAL, 'Output observation %s' % run.id(), self._obs_string(run)) self._log_value(gammalib.NORMAL, 'Number of simulated events', nevents) # Fit model if self['profile'].boolean(): models = self.obs().models() for model in models: like = ctools.cterror(obs) like['srcname'] = model.name() like['edisp'] = edisp like['statistic'] = statistic like['debug'] = self._logDebug() like['chatter'] = self['chatter'].integer() like.run() else: like = ctools.ctlike(obs) like['edisp'] = edisp like['statistic'] = statistic like['debug'] = self._logDebug() like['chatter'] = self['chatter'].integer() like.run() # Store results logL = like.opt().value() npred = like.obs().npred() models = like.obs().models() # Write result header self._log_header3(gammalib.NORMAL, 'Pulls') # Gather results in form of a list of result columns and a # dictionary containing the results. The result contains the # log-likelihood, the number of simulated events, the number of # predicted events and for each fitted parameter the fitted value, # the pull and the fit error. # # Note that we do not use the model and parameter iterators # because we need the indices to get the true (or real) parameter # values from the input models. colnames = ['LogL', 'Sim_Events', 'Npred_Events'] values = {'LogL': logL, 'Sim_Events': nevents, 'Npred_Events': npred} for i in range(models.size()): model = models[i] for k in range(model.size()): par = model[k] if par.is_free(): # Set name as a combination of model name and parameter # name separated by an underscore. In that way each # parameter has a unique name. name = model.name()+'_'+par.name() # Append parameter, Pull_parameter and e_parameter column # names colnames.append(name) colnames.append('Pull_'+name) colnames.append('e_'+name) # Compute pull for this parameter as the difference # (fitted - true) / error # In case that the error is 0 the pull is set to 99 fitted_value = par.value() real_value = self.obs().models()[i][k].value() error = par.error() if error != 0.0: pull = (fitted_value - real_value) / error else: pull = 99.0 # Store results in dictionary values[name] = fitted_value values['Pull_'+name] = pull values['e_'+name] = error # Write results into logger value = '%.4f (%e +/- %e)' % (pull, fitted_value, error) self._log_value(gammalib.NORMAL, name, value) # Bundle together results in a dictionary result = {'colnames': colnames, 'values': values} # Return return result
def run(self): """ Run the script. """ # Switch screen logging on in debug mode if self.logDebug(): self.log.cout(True) # Get parameters self.get_parameters() # Write input parameters into logger if self.logTerse(): self.log_parameters() self.log("\n") # Write spectral binning into header if self.logTerse(): self.log("\n") self.log.header1("Spectral binning") if self.m_binned_mode: cube_ebounds = self.obs[0].events().ebounds() self.log.parformat("Counts cube energy range") self.log(str(cube_ebounds.emin())) self.log(" - ") self.log(str(cube_ebounds.emax())) self.log("\n") for i in range(self.m_ebounds.size()): self.log.parformat("Bin "+str(i+1)) self.log(str(self.m_ebounds.emin(i))) self.log(" - ") self.log(str(self.m_ebounds.emax(i))) self.log("\n") # Write observation into logger if self.logTerse(): self.log("\n") self.log.header1("Observation") self.log(str(self.obs)) self.log("\n") # Write header if self.logTerse(): self.log("\n") self.log.header1("Adjust model parameters") # Adjust model parameters dependent on input user parameters for model in self.obs.models(): # Set TS flag for all models to false. # Source of interest will be set to true later model.tscalc(False) # Log model name if self.logExplicit(): self.log.header3(model.name()) # Deal with the source of interest if model.name() == self.m_srcname: for par in model: if par.is_free() and self.logExplicit(): self.log(" Fixing \""+par.name()+"\"\n") par.fix() normpar = model.spectral()[0] if normpar.is_fixed() and self.logExplicit(): self.log(" Freeing \""+normpar.name()+"\"\n") normpar.free() if self.m_calc_ts: model.tscalc(True) elif self.m_fix_bkg and not model.classname() == "GModelSky": for par in model: if par.is_free() and self.logExplicit(): self.log(" Fixing \""+par.name()+"\"\n") par.fix() elif self.m_fix_srcs and model.classname() == "GModelSky": for par in model: if par.is_free() and self.logExplicit(): self.log(" Fixing \""+par.name()+"\"\n") par.fix() # Write header if self.logTerse(): self.log("\n") self.log.header1("Generate spectrum") self.log(str(self.m_ebounds)) # Initialise FITS Table with extension "SPECTRUM" table = gammalib.GFitsBinTable(self.m_ebounds.size()) table.extname("SPECTRUM") # Add Header for compatibility with gammalib.GMWLSpectrum table.card("INSTRUME", "CTA", "Name of Instrument") table.card("TELESCOP", "CTA", "Name of Telescope") # Create FITS table columns energy = gammalib.GFitsTableDoubleCol("Energy", self.m_ebounds.size()) energy_low = gammalib.GFitsTableDoubleCol("ed_Energy", self.m_ebounds.size()) energy_high = gammalib.GFitsTableDoubleCol("eu_Energy", self.m_ebounds.size()) flux = gammalib.GFitsTableDoubleCol("Flux", self.m_ebounds.size()) flux_err = gammalib.GFitsTableDoubleCol("e_Flux", self.m_ebounds.size()) TSvalues = gammalib.GFitsTableDoubleCol("TS", self.m_ebounds.size()) ulim_values = gammalib.GFitsTableDoubleCol("UpperLimit", self.m_ebounds.size()) Npred_values = gammalib.GFitsTableDoubleCol("Npred", self.m_ebounds.size()) energy.unit("TeV") energy_low.unit("TeV") energy_high.unit("TeV") flux.unit("erg/cm2/s") flux_err.unit("erg/cm2/s") ulim_values.unit("erg/cm2/s") # Loop over energy bins for i in range(self.m_ebounds.size()): # Log information if self.logExplicit(): self.log("\n") self.log.header2("Energy bin "+str(i+1)) # Get energy boundaries emin = self.m_ebounds.emin(i) emax = self.m_ebounds.emax(i) elogmean = self.m_ebounds.elogmean(i) elogmean2 = elogmean.MeV() * elogmean.MeV() # Store energy as TeV energy[i] = elogmean.TeV() # Store energy errors energy_low[i] = (elogmean - emin).TeV() energy_high[i] = (emax - elogmean).TeV() # use ctselect for unbinned analysis if not self.m_binned_mode: # Log information if self.logExplicit(): self.log.header3("Selecting events") # Select events select = ctools.ctselect(self.obs) select["emin"] = emin.TeV() select["emax"] = emax.TeV() select["tmin"] = "UNDEFINED" select["tmax"] = "UNDEFINED" select["rad"] = "UNDEFINED" select["ra"] = "UNDEFINED" select["dec"] = "UNDEFINED" select.run() # Retrieve observation obs = select.obs() # use ctcubemask for binned analysis else: # Header if self.logExplicit(): self.log.header3("Filtering cube") # Select layers cubemask = ctools.ctcubemask(self.obs) cubemask["regfile"] = "NONE" cubemask["ra"] = "UNDEFINED" cubemask["dec"] = "UNDEFINED" cubemask["rad"] = "UNDEFINED" cubemask["emin"] = emin.TeV() cubemask["emax"] = emax.TeV() cubemask.run() # Set new binned observation obs = cubemask.obs() # Header if self.logExplicit(): self.log.header3("Performing fit") # Likelihood like = ctools.ctlike(obs) like["edisp"] = self.m_edisp like.run() # Skip bin if no event was present if like.obs().logL() == 0.0: # Log information if self.logExplicit(): self.log("No event in this bin. ") self.log("Likelihood is zero. ") self.log("Bin is skipped.") # Set all values to 0 flux[i] = 0.0 flux_err[i] = 0.0 TSvalues[i] = 0.0 ulim_values[i] = 0.0 Npred_values[i] = 0.0 continue # Get results fitted_models = like.obs().models() source = fitted_models[self.m_srcname] # Calculate Upper Limit ulimit_value = -1.0 if self.m_calc_ulimit: # Logging information if self.logExplicit(): self.log.header3("Computing upper limit") # Create upper limit object ulimit = ctools.ctulimit(like.obs()) ulimit["srcname"] = self.m_srcname ulimit["eref"] = elogmean.TeV() # Try to run upper limit and catch exceptions try: ulimit.run() ulimit_value = ulimit.diff_ulimit() except: if self.logExplicit(): self.log("Upper limit calculation failed.") ulimit_value = -1.0 # Get TS value TS = -1.0 if self.m_calc_ts: TS = source.ts() # Compute Npred value (only works for unbinned analysis) Npred = 0.0 if not self.m_binned_mode: for observation in like.obs(): Npred += observation.npred(source) # Get differential flux fitted_flux = source.spectral().eval(elogmean,gammalib.GTime()) # Compute flux error parvalue = source.spectral()[0].value() rel_error = source.spectral()[0].error() / parvalue e_flux = fitted_flux * rel_error # Set values for storage TSvalues[i] = TS # Set npred values Npred_values[i] = Npred # Convert fluxes to nuFnu flux[i] = fitted_flux * elogmean2 * gammalib.MeV2erg flux_err[i] = e_flux * elogmean2 * gammalib.MeV2erg if ulimit_value > 0.0: ulim_values[i] = ulimit_value * elogmean2 * gammalib.MeV2erg # Log information if self.logTerse(): self.log("\n") self.log.parformat("Bin "+str(i+1)) self.log(str(flux[i])) self.log(" +/- ") self.log(str(flux_err[i])) if self.m_calc_ulimit and ulim_values[i] > 0.0: self.log(" [< "+str(ulim_values[i])+"]") self.log(" erg/cm2/s") if self.m_calc_ts and TSvalues[i] > 0.0: self.log(" (TS = "+str(TS)+")") # Append filled columns to fits table table.append(energy) table.append(energy_low) table.append(energy_high) table.append(flux) table.append(flux_err) table.append(TSvalues) table.append(ulim_values) table.append(Npred_values) # Create the FITS file now self.fits = gammalib.GFits() self.fits.append(table) # Return return
def run_pipeline(obs, ra=83.63, dec=22.01, emin=0.1, emax=100.0, \ enumbins=20, nxpix=200, nypix=200, binsz=0.02, \ coordsys="CEL", proj="CAR", \ model="${CTOOLS}/share/models/crab.xml", \ caldb="prod2", irf="South_50h", \ debug=False): """ Simulation and stacked analysis pipeline. Keywords: ra - RA of cube centre [deg] (default: 83.6331) dec - DEC of cube centre [deg] (default: 22.0145) emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) enumbins - Number of energy bins in cube (default: 20) nxpix - Number of RA pixels in cube (default: 200) nypix - Number of DEC pixels in cube (default: 200) binsz - Spatial cube bin size [deg] (default: 0.02) coordsys - Cube coordinate system (CEL or GAL) proj - Cube World Coordinate System (WCS) projection debug - Enable debugging (default: False) """ # Simulate events sim = ctools.ctobssim(obs) sim["debug"].boolean(debug) sim["outevents"].filename("obs.xml") sim.execute() # Bin events into counts map bin = ctools.ctbin() bin["inobs"].filename("obs.xml") bin["outcube"].filename("cntcube.fits") bin["ebinalg"].string("LOG") bin["emin"].real(emin) bin["emax"].real(emax) bin["enumbins"].integer(enumbins) bin["nxpix"].integer(nxpix) bin["nypix"].integer(nypix) bin["binsz"].real(binsz) bin["coordsys"].string(coordsys) bin["proj"].string(proj) bin["xref"].real(ra) bin["yref"].real(dec) bin["debug"].boolean(debug) bin.execute() # Create exposure cube expcube = ctools.ctexpcube() expcube["inobs"].filename("obs.xml") expcube["incube"].filename("cntcube.fits") expcube["outcube"].filename("expcube.fits") expcube["caldb"].string(caldb) expcube["irf"].string(irf) expcube["ebinalg"].string("LOG") expcube["emin"].real(emin) expcube["emax"].real(emax) expcube["enumbins"].integer(enumbins) expcube["nxpix"].integer(nxpix) expcube["nypix"].integer(nypix) expcube["binsz"].real(binsz) expcube["coordsys"].string(coordsys) expcube["proj"].string(proj) expcube["xref"].real(ra) expcube["yref"].real(dec) expcube["debug"].boolean(debug) expcube.execute() # Create PSF cube psfcube = ctools.ctpsfcube() psfcube["inobs"].filename("obs.xml") psfcube["incube"].filename("NONE") psfcube["outcube"].filename("psfcube.fits") psfcube["caldb"].string(caldb) psfcube["irf"].string(irf) psfcube["ebinalg"].string("LOG") psfcube["emin"].real(emin) psfcube["emax"].real(emax) psfcube["enumbins"].integer(enumbins) psfcube["nxpix"].integer(10) psfcube["nypix"].integer(10) psfcube["binsz"].real(1.0) psfcube["coordsys"].string(coordsys) psfcube["proj"].string(proj) psfcube["xref"].real(ra) psfcube["yref"].real(dec) psfcube["debug"].boolean(debug) psfcube.execute() # Create background cube bkgcube = ctools.ctbkgcube() bkgcube["inobs"].filename("obs.xml") bkgcube["inmodel"].filename(model) bkgcube["incube"].filename("cntcube.fits") bkgcube["outcube"].filename("bkgcube.fits") bkgcube["outmodel"].filename("model_bkg.xml") bkgcube["caldb"].string(caldb) bkgcube["irf"].string(irf) bkgcube["ebinalg"].string("LOG") bkgcube["emin"].real(emin) bkgcube["emax"].real(emax) bkgcube["enumbins"].integer(enumbins) bkgcube["nxpix"].integer(10) bkgcube["nypix"].integer(10) bkgcube["binsz"].real(1.0) bkgcube["coordsys"].string(coordsys) bkgcube["proj"].string(proj) bkgcube["xref"].real(ra) bkgcube["yref"].real(dec) bkgcube["debug"].boolean(debug) bkgcube.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like["inobs"].filename("cntcube.fits") like["inmodel"].filename("model_bkg.xml") like["outmodel"].filename("fit_results.xml") like["expcube"].filename("expcube.fits") like["psfcube"].filename("psfcube.fits") like["bkgcube"].filename("bkgcube.fits") like["caldb"].string(caldb) like["irf"].string(irf) like["debug"].boolean(True) # Switch this always on for results in console like.execute() # Return return
def _get_sensitivity(self, emin, emax, test_model): """ Determine sensitivity for given observations Parameters ---------- emin : `~gammalib.GEnergy` Minimum energy for fitting and flux computation emax : `~gammalib.GEnergy` Maximum energy for fitting and flux computation test_model : `~gammalib.GModels` Test source model Returns ------- result : dict Result dictionary """ # Set TeV->erg conversion factor tev2erg = 1.6021764 # Set parameters ts_thres = self['sigma'].real() * self['sigma'].real() max_iter = self['max_iter'].integer() enumbins = self['enumbins'].integer() if not enumbins == 0: npix = self['npix'].integer() binsz = self['binsz'].real() else: npix = 200 binsz = 0.05 # Set flux ratio precision required for convergence to 5% ratio_precision = 0.05 # Set energy boundaries self._set_obs_ebounds(emin, emax) # Determine mean energy for energy boundary e_mean = math.sqrt(emin.TeV()*emax.TeV()) loge = math.log10(e_mean) erg_mean = e_mean * tev2erg # Compute Crab unit. This is the factor with which the Prefactor needs # to be multiplied to get 1 Crab. crab_flux = self._get_crab_flux(emin, emax) src_flux = test_model[self._srcname].spectral().flux(emin, emax) crab_unit = crab_flux/src_flux # Initialise regression coefficient regcoeff = 0.0 # Write header for energy bin self._log_string(gammalib.TERSE, '') self._log_header2(gammalib.TERSE, 'Energies: '+str(emin)+' - '+str(emax)) # Write initial parameters self._log_header3(gammalib.TERSE, 'Initial parameters') self._log_value(gammalib.TERSE, 'Crab flux', str(crab_flux)+' ph/cm2/s') self._log_value(gammalib.TERSE, 'Source model flux', str(src_flux)+' ph/cm2/s') self._log_value(gammalib.TERSE, 'Crab unit factor', crab_unit) # Initialise loop results = [] iterations = 0 test_crab_flux = 0.1 # Initial test flux in Crab units (100 mCrab) # Write header for iterations for terse chatter level if self._logTerse(): self._log_header3(gammalib.TERSE, 'Iterations') # Loop until we break while True: # Update iteration counter iterations += 1 # Write header for iteration into logger self._log_header2(gammalib.EXPLICIT, 'Iteration '+str(iterations)) # Create a copy of the test models, set the prefactor of the test # source in the models, and append the models to the observation. # "crab_prefactor" is the Prefactor that corresponds to a flux of # 1 Crab. models = test_model.copy() crab_prefactor = models[self._srcname]['Prefactor'].value() * crab_unit models[self._srcname]['Prefactor'].value(crab_prefactor * test_crab_flux) self.obs().models(models) # Simulate events for the models. "sim" holds an observation # container with observations containing the simulated events. sim = obsutils.sim(self.obs(), nbins=enumbins, seed=iterations, binsz=binsz, npix=npix, log=self._log_clients, debug=self['debug'].boolean(), edisp=self['edisp'].boolean()) # Determine number of events in simulation by summing the events # over all observations in the observation container nevents = 0.0 for run in sim: nevents += run.events().number() # Write simulation results into logger self._log_header3(gammalib.EXPLICIT, 'Simulation') self._log_value(gammalib.EXPLICIT, 'Number of simulated events', nevents) # Fit test source to the simulated events in the observation # container fit = ctools.ctlike(sim) fit['edisp'] = self['edisp'].boolean() fit['debug'] = self['debug'].boolean() fit['chatter'] = self['chatter'].integer() fit.run() # Get model fitting results logL = fit.opt().value() npred = fit.obs().npred() models = fit.obs().models() source = models[self._srcname] ts = source.ts() # Get fitted Crab, photon and energy fluxes crab_flux = source['Prefactor'].value() / crab_prefactor photon_flux = source.spectral().flux(emin, emax) energy_flux = source.spectral().eflux(emin, emax) # Compute differential sensitivity in unit erg/cm2/s by evaluating # the spectral model at the "e_mean" energy and by multipling the # result with the energy squared. Since the "eval()" method returns # an intensity in units of ph/cm2/s/MeV we multiply by 1.0e6 to # convert into ph/cm2/s/TeV, by "e_mean" to convert into ph/cm2/s, # and finally by "erg_mean" to convert to erg/cm2/s. energy = gammalib.GEnergy(e_mean, 'TeV') sensitivity = source.spectral().eval(energy) * e_mean*erg_mean*1.0e6 # Write fit results into logger name = 'Iteration %d' % iterations value = ('TS=%10.4f Sim=%9.4f mCrab Fit=%9.4f mCrab ' 'Sens=%e erg/cm2/s' % (ts, test_crab_flux*1000.0, crab_flux*1000.0, sensitivity)) self._log_value(gammalib.TERSE, name, value) # If TS was non-positive then increase the test flux and start over if ts <= 0.0: # If the number of iterations was exceeded then stop if (iterations >= max_iter): self._log_string(gammalib.TERSE, ' Test ended after %d iterations.' % max_iter) break # Increase test flux test_crab_flux *= 3.0 # Signal start we start over self._log_string(gammalib.EXPLICIT, 'Non positive TS, increase test flux and start over.') # ... and start over continue # Append result entry to result list result = {'ts': ts, 'crab_flux': crab_flux, 'photon_flux': photon_flux, 'energy_flux': energy_flux} results.append(result) # Predict Crab flux at threshold TS using a linear regression of # the log(TS) and log(crab_flux) values that have so far been # computed. If not enough results are available than use a simple # TS scaling relation. if len(results) > 1: pred_crab_flux, regcoeff = self._predict_flux(results, ts_thres) correct = pred_crab_flux / crab_flux else: correct = math.sqrt(ts_thres/ts) # Compute extrapolated fluxes based on the flux correction factor crab_flux = correct * crab_flux photon_flux = correct * photon_flux energy_flux = correct * energy_flux sensitivity = correct * sensitivity # If we have at least 3 results then check if the flux determination # at the TS threshold has converged if len(results) > 3: if test_crab_flux > 0: # Compute fractional change in the Crab flux between two # iterations ratio = crab_flux/test_crab_flux # If fractional change is smaller than the required position # the iterations are stopped if ratio > 1.0-ratio_precision and \ ratio < 1.0+ratio_precision: value = ('TS=%10.4f Sim=%9.4f mCrab ' ' Sens=%e erg/cm2/s' % (ts, crab_flux*1000.0, sensitivity)) self._log_value(gammalib.TERSE, 'Converged result', value) self._log_value(gammalib.TERSE, 'Converged flux ratio', ratio) self._log_value(gammalib.TERSE, 'Regression coefficient', regcoeff) break else: self._log_value(gammalib.TERSE, 'Not converged', 'Flux is zero') break # Set test flux for next iteration test_crab_flux = crab_flux # Exit loop if number of trials exhausted if (iterations >= max_iter): self._log_string(gammalib.TERSE, ' Test ended after %d iterations.' % max_iter) break # Write fit results into logger self._log_header3(gammalib.TERSE, 'Fit results') self._log_value(gammalib.TERSE, 'Photon flux', str(photon_flux)+' ph/cm2/s') self._log_value(gammalib.TERSE, 'Energy flux', str(energy_flux)+' erg/cm2/s') self._log_value(gammalib.TERSE, 'Crab flux', str(crab_flux*1000.0)+' mCrab') self._log_value(gammalib.TERSE, 'Differential sensitivity', str(sensitivity)+' erg/cm2/s') self._log_value(gammalib.TERSE, 'Number of simulated events', nevents) self._log_header3(gammalib.TERSE, 'Test source model fitting') self._log_value(gammalib.TERSE, 'log likelihood', logL) self._log_value(gammalib.TERSE, 'Number of predicted events', npred) for model in models: self._log_value(gammalib.TERSE, 'Model', model.name()) for par in model: self._log_string(gammalib.TERSE, str(par)) # Restore energy boundaries of observation container for i, obs in enumerate(self.obs()): obs.events().ebounds(self._obs_ebounds[i]) # Store result result = {'loge': loge, 'emin': emin.TeV(), 'emax': emax.TeV(), \ 'crab_flux': crab_flux, 'photon_flux': photon_flux, \ 'energy_flux': energy_flux, \ 'sensitivity': sensitivity, 'regcoeff': regcoeff, \ 'nevents': nevents, 'npred': npred} # Return result return result
def _fit_energy_bin(self, i): """ Fit data for one energy bin Parameters ---------- i : int Energy bin index Returns ------- result : dict Dictionary with fit results """ # Get energy boundaries emin = self._ebounds.emin(i) emax = self._ebounds.emax(i) elogmean = self._ebounds.elogmean(i) # Select observations for energy bin obs = self._select_obs(emin, emax) # Initialise dictionary result = {'energy': elogmean.TeV(), 'energy_low': (elogmean - emin).TeV(), 'energy_high': (emax - elogmean).TeV(), 'flux': 0.0, 'flux_err': 0.0, 'TS': 0.0, 'ulimit': 0.0, 'Npred': 0.0} # Write header for fitting self._log_header3(gammalib.EXPLICIT, 'Performing fit') # Perform maximum likelihood fit like = ctools.ctlike(obs) like['edisp'] = self['edisp'].boolean() like.run() # Continue only if log-likelihood is non-zero if like.obs().logL() != 0.0: # Get results fitted_models = like.obs().models() source = fitted_models[self['srcname'].string()] # Extract Test Statistic value if self['calc_ts'].boolean(): result['TS'] = source.ts() # Compute Npred value (only works for unbinned analysis) if not self._binned_mode and not self._onoff_mode: for observation in like.obs(): result['Npred'] += observation.npred(source) # Compute upper flux limit ulimit_value = -1.0 if self['calc_ulim'].boolean(): # Logging information self._log_header3(gammalib.EXPLICIT, 'Computing upper limit') # Create upper limit object ulimit = ctools.ctulimit(like.obs()) ulimit['srcname'] = self['srcname'].string() ulimit['eref'] = elogmean.TeV() # Try to run upper limit and catch exceptions try: ulimit.run() ulimit_value = ulimit.diff_ulimit() except: self._log_string(gammalib.EXPLICIT, 'Upper limit ' 'calculation failed.') ulimit_value = -1.0 # Compute upper limit if ulimit_value > 0.0: result['ulimit'] = ulimit_value * elogmean.MeV() * \ elogmean.MeV() * gammalib.MeV2erg # Compute differential flux and flux error fitted_flux = source.spectral().eval(elogmean) parvalue = source.spectral()[0].value() if parvalue != 0.0: rel_error = source.spectral()[0].error() / parvalue e_flux = fitted_flux * rel_error else: e_flux = 0.0 # Convert differential flux and flux error to nuFnu elogmean2 = elogmean.MeV() * elogmean.MeV() result['flux'] = fitted_flux * elogmean2 * gammalib.MeV2erg result['flux_err'] = e_flux * elogmean2 * gammalib.MeV2erg # Log information value = '%e +/- %e' % (result['flux'], result['flux_err']) if self['calc_ulim'].boolean() and result['ulimit'] > 0.0: value += ' [< %e]' % (result['ulimit']) value += ' erg/cm2/s' if self['calc_ts'].boolean() and result['TS'] > 0.0: value += ' (TS = %.3f)' % (result['TS']) self._log_value(gammalib.TERSE, 'Bin '+str(i+1), value) # ... otherwise if logL is zero then signal that bin is # skipped else: value = 'No event in this bin. Likelihood is zero. Bin is skipped.' self._log_value(gammalib.TERSE, 'Bin '+str(i+1), value) # Return result return result
def _fit_energy_bin(self, i): """ Fit data for one energy bin Parameters ---------- i : int Energy bin index Returns ------- result : dict Dictionary with fit results """ # Write header for energy bin self._log_header2(gammalib.EXPLICIT, 'Energy bin ' + str(i + 1)) # Get energy boundaries emin = self._ebounds.emin(i) emax = self._ebounds.emax(i) elogmean = self._ebounds.elogmean(i) # Select observations for energy bin obs = self._select_obs(emin, emax) # Initialise dictionary result = { 'energy': elogmean.TeV(), 'energy_low': (elogmean - emin).TeV(), 'energy_high': (emax - elogmean).TeV(), 'flux': 0.0, 'flux_err': 0.0, 'TS': 0.0, 'ulimit': 0.0, 'Npred': 0.0 } # Write header for fitting self._log_header3(gammalib.EXPLICIT, 'Performing fit in energy bin') # Setup maximum likelihood fit like = ctools.ctlike(obs) like['edisp'] = self['edisp'].boolean() like['nthreads'] = 1 # Avoids OpenMP conflict # If chatter level is verbose and debugging is requested then # switch also on the debug model in ctlike if self._logVerbose() and self._logDebug(): like['debug'] = True # Perform maximum likelihood fit like.run() # Write model results for explicit chatter level self._log_string(gammalib.EXPLICIT, str(like.obs().models())) # Continue only if log-likelihood is non-zero if like.obs().logL() != 0.0: # Get results fitted_models = like.obs().models() source = fitted_models[self['srcname'].string()] # Extract Test Statistic value if self['calc_ts'].boolean(): result['TS'] = source.ts() # Compute Npred value (only works for unbinned analysis) if not self._binned_mode and not self._onoff_mode: for observation in like.obs(): result['Npred'] += observation.npred(source) # Compute upper flux limit ulimit_value = -1.0 if self['calc_ulim'].boolean(): # Logging information self._log_header3(gammalib.EXPLICIT, 'Computing upper limit for energy bin') # Create upper limit object ulimit = ctools.ctulimit(like.obs()) ulimit['srcname'] = self['srcname'].string() ulimit['eref'] = elogmean.TeV() # If chatter level is verbose and debugging is requested # then switch also on the debug model in ctulimit if self._logVerbose() and self._logDebug(): ulimit['debug'] = True # Try to run upper limit and catch exceptions try: ulimit.run() ulimit_value = ulimit.diff_ulimit() except: self._log_string(gammalib.EXPLICIT, 'Upper limit ' 'calculation failed.') ulimit_value = -1.0 # Compute upper limit if ulimit_value > 0.0: result['ulimit'] = ulimit_value * elogmean.MeV() * \ elogmean.MeV() * gammalib.MeV2erg # Compute differential flux and flux error fitted_flux = source.spectral().eval(elogmean) parvalue = source.spectral()[0].value() if parvalue != 0.0: rel_error = source.spectral()[0].error() / parvalue e_flux = fitted_flux * rel_error else: e_flux = 0.0 # If the source model is a cube then multiply-in the cube # spectrum if source.spatial().classname() == 'GModelSpatialDiffuseCube': dir = gammalib.GSkyDir() source.spatial().set_mc_cone(dir, 180.0) norm = source.spatial().spectrum().eval(elogmean) fitted_flux *= norm e_flux *= norm # Convert differential flux and flux error to nuFnu elogmean2 = elogmean.MeV() * elogmean.MeV() result['flux'] = fitted_flux * elogmean2 * gammalib.MeV2erg result['flux_err'] = e_flux * elogmean2 * gammalib.MeV2erg # Log information value = '%e +/- %e' % (result['flux'], result['flux_err']) if self['calc_ulim'].boolean() and result['ulimit'] > 0.0: value += ' [< %e]' % (result['ulimit']) value += ' erg/cm2/s' if self['calc_ts'].boolean() and result['TS'] > 0.0: value += ' (TS = %.3f)' % (result['TS']) self._log_value(gammalib.TERSE, 'Bin ' + str(i + 1), value) # ... otherwise if logL is zero then signal that bin is # skipped else: value = 'Likelihood is zero. Bin is skipped.' self._log_value(gammalib.TERSE, 'Bin ' + str(i + 1), value) # Return result return result
def _fit_model(self): """ Fit model to observations Returns ------- results : list of dict List of dictionaries with fit results """ # Write header self._log_header1(gammalib.TERSE, 'Generate spectrum') # Write header for fitting self._log_header3(gammalib.EXPLICIT, 'Performing model fit') # Perform maximum likelihood fit like = ctools.ctlike(self.obs()) like['edisp'] = self['edisp'].boolean() like.run() # Initialise fit results results = [] # Extract fit results model = like.obs().models()[self['srcname'].string()] spectrum = model.spectral() logL0 = like.obs().logL() # Write model results for explicit chatter level self._log_string(gammalib.EXPLICIT, str(like.obs().models())) # Loop over all nodes for i in range(spectrum.nodes()): # Get energy boundaries emin = self._ebounds.emin(i) emax = self._ebounds.emax(i) elogmean = self._ebounds.elogmean(i) # Initialise dictionary result = { 'energy': elogmean.TeV(), 'energy_low': (elogmean - emin).TeV(), 'energy_high': (emax - elogmean).TeV(), 'flux': 0.0, 'flux_err': 0.0, 'TS': 0.0, 'ulimit': 0.0, 'Npred': 0.0 } # Convert differential flux and flux error to nuFnu norm = elogmean.MeV() * elogmean.MeV() * gammalib.MeV2erg result['flux'] = spectrum[i * 2 + 1].value() * norm result['flux_err'] = spectrum[i * 2 + 1].error() * norm # Compute upper flux limit ulimit_value = -1.0 if self['calc_ulim'].boolean(): # Logging information self._log_header3( gammalib.EXPLICIT, 'Computing upper limit for node energy %f TeV' % result['energy']) # Copy observation container obs = like.obs().copy() # Fix intensities of all nodes spectral = obs.models()[self['srcname'].string()].spectral() for par in spectral: par.fix() # Create upper limit object ulimit = ctools.ctulimit(obs) ulimit['srcname'] = self['srcname'].string() ulimit['parname'] = 'Intensity%d' % i ulimit['eref'] = elogmean.TeV() ulimit['tol'] = 1.0e-3 # Try to run upper limit and catch exceptions try: ulimit.run() ulimit_value = ulimit.diff_ulimit() except: self._log_string(gammalib.EXPLICIT, 'Upper limit ' 'calculation failed.') ulimit_value = -1.0 # Compute upper limit if ulimit_value > 0.0: result['ulimit'] = ulimit_value * elogmean.MeV() * \ elogmean.MeV() * gammalib.MeV2erg # Compute TS if self['calc_ts'].boolean(): # Copy observation container obs = like.obs().copy() # Set intensity of node to tiny value by scaling the value # by a factor 1e-8. par = obs.models()[self['srcname'].string()].spectral()[i * 2 + 1] par.autoscale() par.factor_min(1.0e-8) par.factor_value(1.0e-8) par.autoscale() par.fix() # Perform maximum likelihood fit tslike = ctools.ctlike(obs) tslike['edisp'] = self['edisp'].boolean() tslike.run() # Store Test Statistic model = tslike.obs().models()[self['srcname'].string()] logL1 = tslike.obs().logL() result['TS'] = 2.0 * (logL1 - logL0) # Log information value = '%e +/- %e' % (result['flux'], result['flux_err']) if self['calc_ulim'].boolean() and result['ulimit'] > 0.0: value += ' [< %e]' % (result['ulimit']) value += ' erg/cm2/s' if self['calc_ts'].boolean() and result['TS'] > 0.0: value += ' (TS = %.3f)' % (result['TS']) self._log_value(gammalib.TERSE, 'Bin ' + str(i + 1), value) # Append results results.append(result) # Return results return results
def binned_pipeline(model_name, duration): """ Binned analysis pipeline. """ # Set script parameters caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 enumbins = 40 nxpix = 200 nypix = 200 binsz = 0.02 coordsys = "CEL" proj = "CAR" # Get start CPU time cpu_start = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"] = model_name sim["caldb"] = caldb sim["irf"] = irf sim["ra"] = ra sim["dec"] = dec sim["rad"] = rad_sim sim["tmin"] = tstart sim["tmax"] = tstop sim["emin"] = emin sim["emax"] = emax sim.run() # Bin events into counts map bin = ctools.ctbin(sim.obs()) bin["ebinalg"] = "LOG" bin["emin"] = emin bin["emax"] = emax bin["enumbins"] = enumbins bin["nxpix"] = nxpix bin["nypix"] = nypix bin["binsz"] = binsz bin["coordsys"] = coordsys bin["xref"] = ra bin["yref"] = dec bin["proj"] = proj bin.run() # Get ctlike start CPU time cpu_ctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(bin.obs()) like.run() # Get stop CPU time and compute elapsed times cpu_stop = time.clock() cpu_elapsed = cpu_stop - cpu_start cpu_ctlike = cpu_stop - cpu_ctlike # Return return cpu_elapsed, cpu_ctlike
def grb_simulation(sim_in, config_in, model_xml, fits_header_0, counter): """ Function to handle the GRB simulation. :param sim_in: the yaml file for the simulation (unpacked as a dict of dicts) :param config_in: the yaml file for the job handling (unpacked as a dict of dicts) :param model_xml: the XML model name for the source under analysis :param fits_header_0: header for the fits file of the GRB model to use. Used in the visibility calculation :param counter: integer number. counts the id of the source realization :return: significance obtained with the activated detection methods """ src_name = model_xml.split('/')[-1].split('model_')[1][:-4] print(src_name, counter) ctools_pipe_path = create_path(config_in['exe']['software_path']) ctobss_params = sim_in['ctobssim'] seed = int(counter)*10 # PARAMETERS FROM THE CTOBSSIM sim_t_min = u.Quantity(ctobss_params['time']['t_min']).to_value(u.s) sim_t_max = u.Quantity(ctobss_params['time']['t_max']).to_value(u.s) sim_e_min = u.Quantity(ctobss_params['energy']['e_min']).to_value(u.TeV) sim_e_max = u.Quantity(ctobss_params['energy']['e_max']).to_value(u.TeV) sim_rad = ctobss_params['radius'] models = sim_in['source'] source_type = models['type'] if source_type == "GRB": phase_path = "/" + models['phase'] elif source_type == "GW": phase_path = "" output_path = create_path(sim_in['output']['path'] + phase_path + '/' + src_name) save_simulation = ctobss_params['save_simulation'] with open(f"{output_path}/GRB-{src_name}_seed-{seed}.txt", "w") as f: f.write(f"GRB,seed,time_start,time_end,sigma_lima,sqrt_TS_onoff,sqrt_TS_std\n") # VISIBILITY PART # choose between AUTO mode (use visibility) and MANUAL mode (manually insert IRF) simulation_mode = sim_in['IRF']['mode'] if simulation_mode == "auto": print("using visibility to get IRFs") # GRB information from the fits header ra = fits_header_0['RA'] dec = fits_header_0['DEC'] t0 = Time(fits_header_0['GRBJD']) irf_dict = sim_in['IRF'] site = irf_dict['site'] obs_condition = Observability(site=site) obs_condition.set_irf(irf_dict) t_zero_mode = ctobss_params['time']['t_zero'].lower() if t_zero_mode == "VIS": # check if the source is visible one day after the onset of the source print("time starts when source becomes visible") obs_condition.Proposal_obTime = 86400 condition_check = obs_condition.check(RA=ra, DEC=dec, t_start=t0) elif t_zero_mode == "ONSET": print("time starts from the onset of the GRB") condition_check = obs_condition.check(RA=ra, DEC=dec, t_start=t0, t_min=sim_t_min, t_max=sim_t_max) else: print(f"Choose some proper mode between 'VIS' and 'ONSET'. {t_zero_mode} is not a valid one.") sys.exit() # NO IRF in AUTO mode ==> No simulation! == EXIT! if len(condition_check) == 0: f.write(f"{src_name},{seed}, -1, -1, -1, -1, -1\n") sys.exit() elif simulation_mode == "manual": print("manual picking IRF") # find proper IRF name irf = IRFPicker(sim_in, ctools_pipe_path) name_irf = irf.irf_pick() backgrounds_path = create_path(ctobss_params['bckgrnd_path']) fits_background_list = glob.glob( f"{backgrounds_path}/{irf.prod_number}_{irf.prod_version}_{name_irf}/background*.fits") if len(fits_background_list) == 0: print(f"No background for IRF {name_irf}") sys.exit() fits_background_list = sorted(fits_background_list, key=sort_background) background_fits = fits_background_list[int(counter) - 1] obs_back = gammalib.GCTAObservation(background_fits) else: print(f"wrong input for IRF - mode. Input is {simulation_mode}. Use 'auto' or 'manual' instead") sys.exit() if irf.prod_number == "3b" and irf.prod_version == 0: caldb = "prod3b" else: caldb = f'prod{irf.prod_number}-v{irf.prod_version}' # source simulation sim = ctools.ctobssim() sim['inmodel'] = model_xml sim['caldb'] = caldb sim['irf'] = name_irf sim['ra'] = 0.0 sim['dec'] = 0.0 sim['rad'] = sim_rad sim['tmin'] = sim_t_min sim['tmax'] = sim_t_max sim['emin'] = sim_e_min sim['emax'] = sim_e_max sim['seed'] = seed sim.run() obs = sim.obs() # # move the source photons from closer to (RA,DEC)=(0,0), where the background is located # for event in obs[0].events(): # # ra_evt = event.dir().dir().ra() # dec_evt = event.dir().dir().dec() # ra_evt_deg = event.dir().dir().ra_deg() # dec_evt_deg = event.dir().dir().dec_deg() # # ra_corrected = (ra_evt_deg - ra_pointing)*np.cos(dec_evt) # dec_corrected = dec_evt_deg - dec_pointing # event.dir().dir().radec_deg(ra_corrected, dec_corrected) # append all background events to GRB ones ==> there's just one observation and not two for event in obs_back.events(): obs[0].events().append(event) # ctselect to save data on disk if save_simulation: event_list_path = create_path(f"{ctobss_params['output_path']}/{src_name}/") #obs.save(f"{event_list_path}/event_list_source-{src_name}_seed-{seed:03}.fits") select_time = ctools.ctselect(obs) select_time['rad'] = sim_rad select_time['tmin'] = sim_t_min select_time['tmax'] = sim_t_max select_time['emin'] = sim_e_min select_time['emax'] = sim_e_max select_time['outobs'] = f"{event_list_path}/event_list_source-{src_name}_{seed:03}.fits" select_time.run() sys.exit() # delete all 70+ models from the obs def file...not needed any more obs.models(gammalib.GModels()) # CTSELECT select_time = sim_in['ctselect']['time_cut'] slices = int(select_time['t_slices']) if slices == 0: times = [sim_t_min, sim_t_max] times_start = times[:-1] times_end = times[1:] elif slices > 0: time_mode = select_time['mode'] if time_mode == "log": times = np.logspace(np.log10(sim_t_min), np.log10(sim_t_max), slices + 1, endpoint=True) elif time_mode == "lin": times = np.linspace(sim_t_min, sim_t_max, slices + 1, endpoint=True) else: print(f"{time_mode} not valid. Use 'log' or 'lin' ") sys.exit() if select_time['obs_mode'] == "iter": times_start = times[:-1] times_end = times[1:] elif select_time['obs_mode'] == "cumul": times_start = np.repeat(times[0], slices) # this is to use the same array structure for the loop times_end = times[1:] elif select_time['obs_mode'] == "all": begins, ends = np.meshgrid(times[:-1], times[1:]) mask_times = begins < ends times_start = begins[mask_times].ravel() times_end = ends[mask_times].ravel() else: print(f"obs_mode: {select_time['obs_mode']} not supported") sys.exit() else: print(f"value {slices} not supported...check yaml file") sys.exit() # ------------------------------------ # ----- TIME LOOP STARTS HERE -------- # ------------------------------------ ctlike_mode = sim_in['detection'] mode_1 = ctlike_mode['counts'] mode_2 = ctlike_mode['ctlike-onoff'] mode_3 = ctlike_mode['ctlike-std'] for t_in, t_end in zip(times_start, times_end): sigma_onoff = 0 sqrt_ts_like_onoff = 0 sqrt_ts_like_std = 0 print("-----------------------------") print(f"t_in: {t_in:.2f}, t_end: {t_end:.2f}") # different ctlikes (onoff or std) need different files. # will be appended here and used later on for the final likelihood dict_obs_select_time = {} # perform time selection for this specific time bin select_time = ctools.ctselect(obs) select_time['rad'] = sim_rad select_time['tmin'] = t_in select_time['tmax'] = t_end select_time['emin'] = sim_e_min select_time['emax'] = sim_e_max select_time.run() if mode_1: fits_temp_title = f"skymap_{seed}_{t_in:.2f}_{t_end:.2f}.fits" pars_counts = ctlike_mode['pars_counts'] scale = float(pars_counts['scale']) npix = 2*int(sim_rad/scale) skymap = ctools.ctskymap(select_time.obs().copy()) skymap['emin'] = sim_e_min skymap['emax'] = sim_e_max skymap['nxpix'] = npix skymap['nypix'] = npix skymap['binsz'] = scale skymap['proj'] = 'TAN' skymap['coordsys'] = 'CEL' skymap['xref'] = 0 skymap['yref'] = 0 skymap['bkgsubtract'] = 'RING' skymap['roiradius'] = pars_counts['roiradius'] skymap['inradius'] = pars_counts['inradius'] skymap['outradius'] = pars_counts['outradius'] skymap['iterations'] = pars_counts['iterations'] skymap['threshold'] = pars_counts['threshold'] skymap['outmap'] = fits_temp_title skymap.execute() input_fits = fits.open(fits_temp_title) datain = input_fits[2].data datain[np.isnan(datain)] = 0.0 datain[np.isinf(datain)] = 0.0 sigma_onoff = np.max(datain) os.remove(fits_temp_title) if mode_3: dict_obs_select_time['std'] = select_time.obs().copy() if mode_2: onoff_time_sel = cscripts.csphagen(select_time.obs().copy()) onoff_time_sel['inmodel'] = 'NONE' onoff_time_sel['ebinalg'] = 'LOG' onoff_time_sel['emin'] = sim_e_min onoff_time_sel['emax'] = sim_e_max onoff_time_sel['enumbins'] = 30 onoff_time_sel['coordsys'] = 'CEL' onoff_time_sel['ra'] = 0.0 onoff_time_sel['dec'] = 0.5 onoff_time_sel['rad'] = 0.2 onoff_time_sel['bkgmethod'] = 'REFLECTED' onoff_time_sel['use_model_bkg'] = False onoff_time_sel['stack'] = False onoff_time_sel.run() dict_obs_select_time['onoff'] = onoff_time_sel.obs().copy() del onoff_time_sel # print(f"sigma ON/OFF: {sigma_onoff:.2f}") if mode_2 or mode_3: # Low Energy PL fitting # to be saved in this dict dict_pl_ctlike_out = {} e_min_pl_ctlike = 0.030 e_max_pl_ctlike = 0.080 # simple ctobssim copy and select for ctlike-std select_pl_ctlike = ctools.ctselect(select_time.obs().copy()) select_pl_ctlike['rad'] = 3 select_pl_ctlike['tmin'] = t_in select_pl_ctlike['tmax'] = t_end select_pl_ctlike['emin'] = e_min_pl_ctlike select_pl_ctlike['emax'] = e_max_pl_ctlike select_pl_ctlike.run() # create test source src_dir = gammalib.GSkyDir() src_dir.radec_deg(0, 0.5) spatial = gammalib.GModelSpatialPointSource(src_dir) # create and append source spectral model spectral = gammalib.GModelSpectralPlaw() spectral['Prefactor'].value(5.5e-16) spectral['Prefactor'].scale(1e-16) spectral['Index'].value(-2.6) spectral['Index'].scale(-1.0) spectral['PivotEnergy'].value(50000) spectral['PivotEnergy'].scale(1e3) model_src = gammalib.GModelSky(spatial, spectral) model_src.name('PL_fit_temp') model_src.tscalc(True) spectral_back = gammalib.GModelSpectralPlaw() spectral_back['Prefactor'].value(1.0) spectral_back['Prefactor'].scale(1.0) spectral_back['Index'].value(0) spectral_back['PivotEnergy'].value(300000) spectral_back['PivotEnergy'].scale(1e6) if mode_2: back_model = gammalib.GCTAModelIrfBackground() back_model.instruments('CTAOnOff') back_model.name('Background') back_model.spectral(spectral_back.copy()) onoff_pl_ctlike_lima = cscripts.csphagen(select_pl_ctlike.obs().copy()) onoff_pl_ctlike_lima['inmodel'] = 'NONE' onoff_pl_ctlike_lima['ebinalg'] = 'LOG' onoff_pl_ctlike_lima['emin'] = e_min_pl_ctlike onoff_pl_ctlike_lima['emax'] = e_max_pl_ctlike onoff_pl_ctlike_lima['enumbins'] = 30 onoff_pl_ctlike_lima['coordsys'] = 'CEL' onoff_pl_ctlike_lima['ra'] = 0.0 onoff_pl_ctlike_lima['dec'] = 0.5 onoff_pl_ctlike_lima['rad'] = 0.2 onoff_pl_ctlike_lima['bkgmethod'] = 'REFLECTED' onoff_pl_ctlike_lima['use_model_bkg'] = False onoff_pl_ctlike_lima['stack'] = False onoff_pl_ctlike_lima.run() onoff_pl_ctlike_lima.obs().models(gammalib.GModels()) onoff_pl_ctlike_lima.obs().models().append(model_src.copy()) onoff_pl_ctlike_lima.obs().models().append(back_model.copy()) like_pl = ctools.ctlike(onoff_pl_ctlike_lima.obs()) like_pl['refit'] = True like_pl.run() dict_pl_ctlike_out['onoff'] = like_pl.obs().copy() del onoff_pl_ctlike_lima del like_pl if mode_3: models_ctlike_std = gammalib.GModels() models_ctlike_std.append(model_src.copy()) back_model = gammalib.GCTAModelIrfBackground() back_model.instruments('CTA') back_model.name('Background') back_model.spectral(spectral_back.copy()) models_ctlike_std.append(back_model) # save models xmlmodel_PL_ctlike_std = 'test_model_PL_ctlike_std.xml' models_ctlike_std.save(xmlmodel_PL_ctlike_std) del models_ctlike_std like_pl = ctools.ctlike(select_pl_ctlike.obs().copy()) like_pl['inmodel'] = xmlmodel_PL_ctlike_std like_pl['refit'] = True like_pl.run() dict_pl_ctlike_out['std'] = like_pl.obs().copy() del like_pl del spatial del spectral del model_src del select_pl_ctlike # EXTENDED CTLIKE for key in dict_obs_select_time.keys(): likelihood_pl_out = dict_pl_ctlike_out[key] selected_data = dict_obs_select_time[key] pref_out_pl = likelihood_pl_out.models()[0]['Prefactor'].value() index_out_pl = likelihood_pl_out.models()[0]['Index'].value() pivot_out_pl = likelihood_pl_out.models()[0]['PivotEnergy'].value() expplaw = gammalib.GModelSpectralExpPlaw() expplaw['Prefactor'].value(pref_out_pl) expplaw['Index'].value(index_out_pl) expplaw['PivotEnergy'].value(pivot_out_pl) expplaw['CutoffEnergy'].value(80e3) if key == "onoff": selected_data.models()[0].name(src_name) selected_data.models()[0].tscalc(True) selected_data.models()[0].spectral(expplaw.copy()) like = ctools.ctlike(selected_data) like['refit'] = True like.run() ts = like.obs().models()[0].ts() if ts > 0: sqrt_ts_like_onoff = np.sqrt(like.obs().models()[0].ts()) else: sqrt_ts_like_onoff = 0 del like if key == "std": models_fit_ctlike = gammalib.GModels() # create test source src_dir = gammalib.GSkyDir() src_dir.radec_deg(0, 0.5) spatial = gammalib.GModelSpatialPointSource(src_dir) # append spatial and spectral models model_src = gammalib.GModelSky(spatial, expplaw.copy()) model_src.name('Source_fit') model_src.tscalc(True) models_fit_ctlike.append(model_src) # create and append background back_model = gammalib.GCTAModelIrfBackground() back_model.instruments('CTA') back_model.name('Background') spectral_back = gammalib.GModelSpectralPlaw() spectral_back['Prefactor'].value(1.0) spectral_back['Prefactor'].scale(1.0) spectral_back['Index'].value(0) spectral_back['PivotEnergy'].value(300000) spectral_back['PivotEnergy'].scale(1e6) back_model.spectral(spectral_back) models_fit_ctlike.append(back_model) # save models input_ctlike_xml = "model_GRB_fit_ctlike_in.xml" models_fit_ctlike.save(input_ctlike_xml) del models_fit_ctlike like = ctools.ctlike(selected_data) like['inmodel'] = input_ctlike_xml like['refit'] = True like.run() ts = like.obs().models()[0].ts() if ts > 0: sqrt_ts_like_std = np.sqrt(like.obs().models()[0].ts()) else: sqrt_ts_like_std = 0 del like # E_cut_off = like.obs().models()[0]['CutoffEnergy'].value() # E_cut_off_error = like.obs().models()[0]['CutoffEnergy'].error() # print(f"sqrt(TS) {key}: {np.sqrt(ts_like):.2f}") # print(f"E_cut_off {key}: {E_cut_off:.2f} +- {E_cut_off_error:.2f}") del dict_pl_ctlike_out f.write(f"{src_name},{seed},{t_in:.2f},{t_end:.2f},{sigma_onoff:.2f},{sqrt_ts_like_onoff:.2f},{sqrt_ts_like_std:.2f}\n") del dict_obs_select_time del select_time
def run_pipeline(obs, ra=83.63, dec=22.01, emin=0.1, emax=100.0, enumbins=20, nxpix=200, nypix=200, binsz=0.02, coordsys="CEL", proj="CAR", model="${CTOOLS}/share/models/crab.xml", caldb="prod2", irf="South_50h", debug=False): """ Simulation and stacked analysis pipeline. Keywords: ra - RA of cube centre [deg] (default: 83.6331) dec - DEC of cube centre [deg] (default: 22.0145) emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) enumbins - Number of energy bins in cube (default: 20) nxpix - Number of RA pixels in cube (default: 200) nypix - Number of DEC pixels in cube (default: 200) binsz - Spatial cube bin size [deg] (default: 0.02) coordsys - Cube coordinate system (CEL or GAL) proj - Cube World Coordinate System (WCS) projection debug - Enable debugging (default: False) """ # Simulate events sim = ctools.ctobssim(obs) sim["debug"] = debug sim["outevents"] = "obs.xml" sim.execute() # Bin events into counts map bin = ctools.ctbin() bin["inobs"] = "obs.xml" bin["outcube"] = "cntcube.fits" bin["ebinalg"] = "LOG" bin["emin"] = emin bin["emax"] = emax bin["enumbins"] = enumbins bin["nxpix"] = nxpix bin["nypix"] = nypix bin["binsz"] = binsz bin["coordsys"] = coordsys bin["proj"] = proj bin["xref"] = ra bin["yref"] = dec bin["debug"] = debug bin.execute() # Create exposure cube expcube = ctools.ctexpcube() expcube["inobs"] = "obs.xml" expcube["incube"] = "cntcube.fits" expcube["outcube"] = "expcube.fits" expcube["caldb"] = caldb expcube["irf"] = irf expcube["ebinalg"] = "LOG" expcube["emin"] = emin expcube["emax"] = emax expcube["enumbins"] = enumbins expcube["nxpix"] = nxpix expcube["nypix"] = nypix expcube["binsz"] = binsz expcube["coordsys"] = coordsys expcube["proj"] = proj expcube["xref"] = ra expcube["yref"] = dec expcube["debug"] = debug expcube.execute() # Create PSF cube psfcube = ctools.ctpsfcube() psfcube["inobs"] = "obs.xml" psfcube["incube"] = "NONE" psfcube["outcube"] = "psfcube.fits" psfcube["caldb"] = caldb psfcube["irf"] = irf psfcube["ebinalg"] = "LOG" psfcube["emin"] = emin psfcube["emax"] = emax psfcube["enumbins"] = enumbins psfcube["nxpix"] = 10 psfcube["nypix"] = 10 psfcube["binsz"] = 1.0 psfcube["coordsys"] = coordsys psfcube["proj"] = proj psfcube["xref"] = ra psfcube["yref"] = dec psfcube["debug"] = debug psfcube.execute() # Create background cube bkgcube = ctools.ctbkgcube() bkgcube["inobs"] = "obs.xml" bkgcube["inmodel"] = model bkgcube["incube"] = "cntcube.fits" bkgcube["outcube"] = "bkgcube.fits" bkgcube["outmodel"] = "model_bkg.xml" bkgcube["caldb"] = caldb bkgcube["irf"] = irf bkgcube["ebinalg"] = "LOG" bkgcube["emin"] = emin bkgcube["emax"] = emax bkgcube["enumbins"] = enumbins bkgcube["nxpix"] = 10 bkgcube["nypix"] = 10 bkgcube["binsz"] = 1.0 bkgcube["coordsys"] = coordsys bkgcube["proj"] = proj bkgcube["xref"] = ra bkgcube["yref"] = dec bkgcube["debug"] = debug bkgcube.execute() # Perform maximum likelihood fitting like = ctools.ctlike() like["inobs"] = "cntcube.fits" like["inmodel"] = "model_bkg.xml" like["outmodel"] = "fit_results.xml" like["expcube"] = "expcube.fits" like["psfcube"] = "psfcube.fits" like["bkgcube"] = "bkgcube.fits" like["caldb"] = caldb like["irf"] = irf like["debug"] = True # Switch this always on for results in console like.execute() # Return return
def stacked_pipeline(duration): """ Cube-style analysis pipeline. """ # Set script parameters model_name = "${CTOOLS}/share/models/crab.xml" caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 enumbins = 20 nxpix = 200 nypix = 200 binsz = 0.02 coordsys = "CEL" proj = "CAR" # Get start CPU time tstart = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"].filename(model_name) sim["caldb"].string(caldb) sim["irf"].string(irf) sim["ra"].real(ra) sim["dec"].real(dec) sim["rad"].real(rad_sim) sim["tmin"].real(tstart) sim["tmax"].real(tstop) sim["emin"].real(emin) sim["emax"].real(emax) sim.run() # Bin events into counts map bin = ctools.ctbin(sim.obs()) bin["ebinalg"].string("LOG") bin["emin"].real(emin) bin["emax"].real(emax) bin["enumbins"].integer(enumbins) bin["nxpix"].integer(nxpix) bin["nypix"].integer(nypix) bin["binsz"].real(binsz) bin["coordsys"].string(coordsys) bin["proj"].string(proj) bin["xref"].real(ra) bin["yref"].real(dec) bin.run() # Create exposure cube expcube = ctools.ctexpcube(sim.obs()) expcube["incube"].filename("NONE") expcube["caldb"].string(caldb) expcube["irf"].string(irf) expcube["ebinalg"].string("LOG") expcube["emin"].real(emin) expcube["emax"].real(emax) expcube["enumbins"].integer(enumbins) expcube["nxpix"].integer(nxpix) expcube["nypix"].integer(nypix) expcube["binsz"].real(binsz) expcube["coordsys"].string(coordsys) expcube["proj"].string(proj) expcube["xref"].real(ra) expcube["yref"].real(dec) expcube.run() # Create PSF cube psfcube = ctools.ctpsfcube(sim.obs()) psfcube["incube"].filename("NONE") psfcube["caldb"].string(caldb) psfcube["irf"].string(irf) psfcube["ebinalg"].string("LOG") psfcube["emin"].real(emin) psfcube["emax"].real(emax) psfcube["enumbins"].integer(enumbins) psfcube["nxpix"].integer(10) psfcube["nypix"].integer(10) psfcube["binsz"].real(1.0) psfcube["coordsys"].string(coordsys) psfcube["proj"].string(proj) psfcube["xref"].real(ra) psfcube["yref"].real(dec) psfcube.run() # Create background cube bkgcube = ctools.ctbkgcube(sim.obs()) bkgcube["incube"].filename("NONE") bkgcube["ebinalg"].string("LOG") bkgcube["emin"].real(emin) bkgcube["emax"].real(emax) bkgcube["enumbins"].integer(enumbins) bkgcube["nxpix"].integer(10) bkgcube["nypix"].integer(10) bkgcube["binsz"].real(1.0) bkgcube["coordsys"].string(coordsys) bkgcube["proj"].string(proj) bkgcube["xref"].real(ra) bkgcube["yref"].real(dec) bkgcube.run() # Attach background model to observation container bin.obs().models(bkgcube.models()) # Set Exposure and Psf cube for first CTA observation # (ctbin will create an observation with a single container) bin.obs()[0].response(expcube.expcube(), psfcube.psfcube(), bkgcube.bkgcube()) # Get ctlike start CPU time tctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(bin.obs()) like.run() # Get stop CPU time tstop = time.clock() telapsed = tstop - tstart tctlike = tstop - tctlike # Return return telapsed, tctlike
def _fit_model(self): """ Fit model to observations Returns ------- results : list of dict List of dictionaries with fit results """ # Write header self._log_header1(gammalib.TERSE, 'Generate spectrum') # Write header for fitting self._log_header3(gammalib.EXPLICIT, 'Performing fit') # Perform maximum likelihood fit like = ctools.ctlike(self.obs()) like['edisp'] = self['edisp'].boolean() like.run() # Initialise fit results results = [] # Extract fit results model = like.obs().models()[self['srcname'].string()] spectrum = model.spectral() ts = model.ts() # Loop over all nodes for i in range(spectrum.nodes()): # Get energy boundaries emin = self._ebounds.emin(i) emax = self._ebounds.emax(i) elogmean = self._ebounds.elogmean(i) # Initialise dictionary result = {'energy': elogmean.TeV(), 'energy_low': (elogmean - emin).TeV(), 'energy_high': (emax - elogmean).TeV(), 'flux': 0.0, 'flux_err': 0.0, 'TS': 0.0, 'ulimit': 0.0, 'Npred': 0.0} # Convert differential flux and flux error to nuFnu norm = elogmean.MeV() * elogmean.MeV() * gammalib.MeV2erg result['flux'] = spectrum[i*2+1].value() * norm result['flux_err'] = spectrum[i*2+1].error() * norm # Compute TS if self['calc_ts'].boolean(): # Copy observation container obs = like.obs().copy() # Set intensity of node to tiny value par = obs.models()[self['srcname'].string()].spectral()[i*2+1] value = 1.0e-30 * par.value() if par.min() > value: par.min(value) par.value(value) par.fix() # Perform maximum likelihood fit tslike = ctools.ctlike(obs) tslike['edisp'] = self['edisp'].boolean() tslike.run() # Store Test Statistic model = tslike.obs().models()[self['srcname'].string()] result['TS'] = ts - model.ts() # Log information value = '%e +/- %e' % (result['flux'], result['flux_err']) if self['calc_ulim'].boolean() and result['ulimit'] > 0.0: value += ' [< %e]' % (result['ulimit']) value += ' erg/cm2/s' if self['calc_ts'].boolean() and result['TS'] > 0.0: value += ' (TS = %.3f)' % (result['TS']) self._log_value(gammalib.TERSE, 'Bin '+str(i+1), value) # Append results results.append(result) # Return results return results
def stackedPipeline( name="Crab", obsfile="index.xml", l=0.01, b=0.01, emin=0.1, emax=100.0, enumbins=20, nxpix=200, nypix=200, binsz=0.02, coordsys="CEL", proj="CAR", caldb="prod2", irf="acdc1a", debug=False, inmodel="Crab", outmodel="results", ): """ Simulation and stacked analysis pipeline Parameters ---------- obs : `~gammalib.GObservations` Observation container ra : float, optional Right Ascension of counts cube centre (deg) dec : float, optional Declination of Region of counts cube centre (deg) emin : float, optional Minimum energy (TeV) emax : float, optional Maximum energy (TeV) enumbins : int, optional Number of energy bins nxpix : int, optional Number of pixels in X axis nypix : int, optional Number of pixels in Y axis binsz : float, optional Pixel size (deg) coordsys : str, optional Coordinate system proj : str, optional Coordinate projection debug : bool, optional Debug function """ # Bin events into counts map bin = ctools.ctbin() bin["inobs"] = obsfile bin["ebinalg"] = "LOG" bin["emin"] = emin bin["emax"] = emax bin["enumbins"] = enumbins bin["nxpix"] = nxpix bin["nypix"] = nypix bin["binsz"] = binsz bin["coordsys"] = coordsys bin["proj"] = proj bin["xref"] = l bin["yref"] = b bin["debug"] = debug bin["outobs"] = "cntcube.fits" bin.execute() print("Datacube : done!") # Create exposure cube expcube = ctools.ctexpcube() # expcube['incube']=bin.obs() expcube["inobs"] = obsfile expcube["incube"] = "NONE" expcube["ebinalg"] = "LOG" expcube["caldb"] = caldb expcube["irf"] = irf expcube["emin"] = emin expcube["emax"] = emax expcube["enumbins"] = enumbins expcube["nxpix"] = nxpix expcube["nypix"] = nypix expcube["binsz"] = binsz expcube["coordsys"] = coordsys expcube["proj"] = proj expcube["xref"] = l expcube["yref"] = b expcube["debug"] = debug expcube["outcube"] = "cube_exp.fits" expcube.execute() print("Expcube : done!") # Create PSF cube psfcube = ctools.ctpsfcube() psfcube["inobs"] = obsfile psfcube["incube"] = "NONE" psfcube["ebinalg"] = "LOG" psfcube["caldb"] = caldb psfcube["irf"] = irf psfcube["emin"] = emin psfcube["emax"] = emax psfcube["enumbins"] = enumbins psfcube["nxpix"] = 10 psfcube["nypix"] = 10 psfcube["binsz"] = 1.0 psfcube["coordsys"] = coordsys psfcube["proj"] = proj psfcube["xref"] = l psfcube["yref"] = b psfcube["debug"] = debug psfcube["outcube"] = "psf_cube.fits" psfcube.execute() print("Psfcube : done!") edispcube = ctools.ctedispcube() edispcube["inobs"] = obsfile edispcube["ebinalg"] = "LOG" edispcube["incube"] = "NONE" edispcube["caldb"] = caldb edispcube["irf"] = irf edispcube["xref"] = l edispcube["yref"] = b edispcube["proj"] = proj edispcube["coordsys"] = coordsys edispcube["binsz"] = 1.0 edispcube["nxpix"] = 10 edispcube["nypix"] = 10 edispcube["emin"] = emin edispcube["emax"] = emax edispcube["enumbins"] = enumbins edispcube["outcube"] = "edisp_cube.fits" edispcube["debug"] = debug edispcube.execute() print("Edispcube : done!") # Create background cube bkgcube = ctools.ctbkgcube() bkgcube["inobs"] = obsfile bkgcube["incube"] = "cntcube.fits" bkgcube["caldb"] = caldb bkgcube["irf"] = irf bkgcube["debug"] = debug bkgcube["inmodel"] = str(inmodel) bkgcube["outcube"] = "bkg_cube.fits" bkgcube["outmodel"] = "bkg_cube.xml" bkgcube.execute() print("Bkgcube : done!") # Fix the instrumental background parameters bkgcube.models()["BackgroundModel"]["Prefactor"].fix() bkgcube.models()["BackgroundModel"]["Index"].fix() # # # Attach background model to observation container bin.obs().models(bkgcube.models()) # # # # Set Exposure and Psf cube for first CTA observation # # (ctbin will create an observation with a single container) bin.obs()[0].response(expcube.expcube(), psfcube.psfcube(), edispcube.edispcube(), bkgcube.bkgcube()) # Perform maximum likelihood fitting like = ctools.ctlike(bin.obs()) # like['inmodel']='bkg_cube.xml' like["edisp"] = True # like['edispcube'] = 'edisp_cube.fits' # like['expcube'] = 'cube_exp.fits' # like['psfcube'] = 'psf_cube.fits' # like['bkgcube'] = 'bkg_cube.fits' like["outmodel"] = str(outmodel) # like['outcovmat']=inmodel+'_covmat.txt' like["debug"] = debug # Switch this always on for results in console # like['statistic']='CSTAT' like.execute() print("Likelihood : done!") # Set the best-fit models (from ctlike) for the counts cube bin.obs().models(like.obs().models()) # Obtain the best-fit butterfly try: butterfly = ctools.ctbutterfly(bin.obs()) butterfly["srcname"] = name butterfly["inmodel"] = str(outmodel) butterfly["edisp"] = True butterfly["emin"] = emin butterfly["emax"] = emax butterfly["outfile"] = str(outmodel.parent) + "/" + str( outmodel.stem) + ".txt" butterfly[ "debug"] = debug # Switch this always on for results in console # like['statistic']='CSTAT' butterfly.execute() print("Butterfly : done!") except: print("I COULDN'T CALCULATE THE BUTTERFLY....") # Extract the spectrum try: csspec = cscripts.csspec(bin.obs()) csspec["srcname"] = name csspec["inmodel"] = str(outmodel) csspec["method"] = "AUTO" csspec["ebinalg"] = "LOG" csspec["emin"] = emin csspec["emax"] = emax csspec["enumbins"] = 10 csspec["edisp"] = True csspec["outfile"] = str(outmodel.parent) + "/" + str( outmodel.stem) + ".fits" csspec["debug"] = debug # Switch this always on for results in console csspec.execute() print("Csspec : done!") except: print("I COULDN'T CALCULATE THE SPECTRUM....") # Return return
def binned_pipeline(duration): """ Binned analysis pipeline. """ # Set script parameters model_name = "${CTOOLS}/share/models/crab.xml" caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 enumbins = 20 nxpix = 200 nypix = 200 binsz = 0.02 coordsys = "CEL" proj = "CAR" # Get start CPU time tstart = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"].filename(model_name) sim["caldb"].string(caldb) sim["irf"].string(irf) sim["ra"].real(ra) sim["dec"].real(dec) sim["rad"].real(rad_sim) sim["tmin"].real(tstart) sim["tmax"].real(tstop) sim["emin"].real(emin) sim["emax"].real(emax) sim.run() # Bin events into counts map bin = ctools.ctbin(sim.obs()) bin["ebinalg"].string("LOG") bin["emin"].real(emin) bin["emax"].real(emax) bin["enumbins"].integer(enumbins) bin["nxpix"].integer(nxpix) bin["nypix"].integer(nypix) bin["binsz"].real(binsz) bin["coordsys"].string(coordsys) bin["xref"].real(ra) bin["yref"].real(dec) bin["proj"].string(proj) bin.run() # Get ctlike start CPU time tctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(bin.obs()) like.run() # Get stop CPU time tstop = time.clock() telapsed = tstop - tstart tctlike = tstop - tctlike # Return return telapsed, tctlike
import gammalib import ctools import cscripts debug = True like = ctools.ctlike() like['inobs'] = 'cntcube.fits' like['expcube'] = 'expcube.fits' like['psfcube'] = 'psfcube.fits' like['bkgcube'] = 'bkgcube.fits' like['inmodel'] = 'models_cat_iem+fb+ts.xml' like['outmodel'] = 'results_cat_iem+fb+ts.xml' like["debug"] = debug like.execute() resmap = cscripts.csresmap() resmap['inobs'] = 'cntcube.fits' resmap['expcube'] = 'expcube.fits' resmap['psfcube'] = 'psfcube.fits' resmap['bkgcube'] = 'bkgcube.fits' resmap['inmodel'] = 'results_cat_iem+fb+ts.xml' resmap['modcube'] = 'NONE' resmap['outmap'] = 'resmap_cat_iem+fb+ts.fits' resmap['algorithm'] = 'SIGNIFICANCE' resmap["debug"] = debug resmap.execute()
def _test_python(self): """ Test ctulimit from Python """ # Allocate ctulimit ulimit = ctools.ctulimit() # Check that empty ctulimit tool holds zero upper limits self.test_value(ulimit.diff_ulimit(), 0.0, 1.0e-21, 'Check differential upper limit') self.test_value(ulimit.flux_ulimit(), 0.0, 1.0e-16, 'Check upper limit on photon flux') self.test_value(ulimit.eflux_ulimit(), 0.0, 1.0e-16, 'Check upper limit on energy flux') # Check that saving does not nothing ulimit['logfile'] = 'ctulimit_py0.log' ulimit.logFileOpen() ulimit.save() # Check that clearing does not lead to an exception or segfault ulimit.clear() # Now set ctulimit parameters ulimit['inobs'] = self._events ulimit['inmodel'] = self._model ulimit['srcname'] = 'Crab' ulimit['caldb'] = self._caldb ulimit['irf'] = self._irf ulimit['tol'] = 0.1 ulimit['logfile'] = 'ctulimit_py1.log' ulimit['chatter'] = 2 # Run ctulimit tool ulimit.logFileOpen() # Make sure we get a log file ulimit.run() ulimit.save() # Set reference value ref_diff = 2.75359655874408e-17 ref_flux = 1.66942609234064e-11 ref_eflux = 6.4588860064421e-11 # Check results self.test_value(ulimit.diff_ulimit(), ref_diff, 1.0e-21, 'Check differential upper limit') self.test_value(ulimit.flux_ulimit(), ref_flux, 1.0e-16, 'Check upper limit on photon flux') self.test_value(ulimit.eflux_ulimit(), ref_eflux, 1.0e-16, 'Check upper limit on energy flux') # Check obs() method self.test_value(ulimit.obs().size(), 1, 'Check number of observations in container') # Check opt() method self.test_value(ulimit.opt().status(), 0, 'Check optimizer status') # Copy ctulimit tool cpy_ulimit = ulimit.copy() # Check results of copy self.test_value(cpy_ulimit.diff_ulimit(), ref_diff, 1.0e-21, 'Check differential upper limit') self.test_value(cpy_ulimit.flux_ulimit(), ref_flux, 1.0e-16, 'Check upper limit on photon flux') self.test_value(cpy_ulimit.eflux_ulimit(), ref_eflux, 1.0e-16, 'Check upper limit on energy flux') # Check results self.test_value(cpy_ulimit.diff_ulimit(), ref_diff, 1.0e-21, 'Check differential upper limit') self.test_value(cpy_ulimit.flux_ulimit(), ref_flux, 1.0e-16, 'Check upper limit on photon flux') self.test_value(cpy_ulimit.eflux_ulimit(), ref_eflux, 1.0e-16, 'Check upper limit on energy flux') # Now clear copy of ctulimit tool cpy_ulimit.clear() # Check that empty ctulimit tool holds zero upper limits self.test_value(cpy_ulimit.diff_ulimit(), 0.0, 1.0e-21, 'Check differential upper limit') self.test_value(cpy_ulimit.flux_ulimit(), 0.0, 1.0e-16, 'Check upper limit on photon flux') self.test_value(cpy_ulimit.eflux_ulimit(), 0.0, 1.0e-16, 'Check upper limit on energy flux') # Run ctlike to get an initial log-likelihood solution like = ctools.ctlike() like['inobs'] = self._events like['inmodel'] = self._model like['caldb'] = self._caldb like['irf'] = self._irf like.run() # Now set ctulimit tool using the observation container from the # previous run. This should avoid the necessity to recompute the # maximum likelihood ulimit = ctools.ctulimit(like.obs()) ulimit['srcname'] = 'Crab' ulimit['tol'] = 0.1 ulimit['logfile'] = 'ctulimit_py2.log' ulimit['chatter'] = 3 # Execute ctulimit tool ulimit.logFileOpen() # Needed to get a new log file ulimit.execute() # Check results self.test_value(ulimit.diff_ulimit(), ref_diff, 1.0e-21, 'Check differential upper limit') self.test_value(ulimit.flux_ulimit(), ref_flux, 1.0e-16, 'Check upper limit on photon flux') self.test_value(ulimit.eflux_ulimit(), ref_eflux, 1.0e-16, 'Check upper limit on energy flux') # Test invalid model name ulimit['srcname'] = 'Weihnachtsstern' ulimit['logfile'] = 'ctulimit_py3.log' ulimit.logFileOpen() self.test_try('Test invalid model name') try: ulimit.execute() self.test_try_failure('Exception not thrown') except ValueError: self.test_try_success() # Test specification of background model ulimit['srcname'] = 'Background' ulimit['logfile'] = 'ctulimit_py4.log' ulimit.logFileOpen() self.test_try('Test invalid model name') try: ulimit.execute() self.test_try_failure('Exception not thrown') except ValueError: self.test_try_success() # Test run with too few iterations ulimit['srcname'] = 'Crab' ulimit['max_iter'] = 1 ulimit['logfile'] = 'ctulimit_py5.log' ulimit.logFileOpen() self.test_try('Test ctulimit with too few iterations') try: ulimit.execute() self.test_try_failure('Exception not thrown') except ValueError: self.test_try_success() # Return return
def stacked_pipeline(model_name, duration): """ Stacked analysis pipeline. """ # Set script parameters caldb = "prod2" irf = "South_50h" ra = 83.63 dec = 22.01 rad_sim = 10.0 tstart = 0.0 tstop = duration emin = 0.1 emax = 100.0 enumbins = 40 nxpix = 200 nypix = 200 binsz = 0.02 coordsys = "CEL" proj = "CAR" # Get start CPU time cpu_start = time.clock() # Simulate events sim = ctools.ctobssim() sim["inmodel"] = model_name sim["caldb"] = caldb sim["irf"] = irf sim["ra"] = ra sim["dec"] = dec sim["rad"] = rad_sim sim["tmin"] = tstart sim["tmax"] = tstop sim["emin"] = emin sim["emax"] = emax sim.run() # Bin events into counts map bin = ctools.ctbin(sim.obs()) bin["ebinalg"] = "LOG" bin["emin"] = emin bin["emax"] = emax bin["enumbins"] = enumbins bin["nxpix"] = nxpix bin["nypix"] = nypix bin["binsz"] = binsz bin["coordsys"] = coordsys bin["proj"] = proj bin["xref"] = ra bin["yref"] = dec bin.run() # Create exposure cube expcube = ctools.ctexpcube(sim.obs()) expcube["incube"] = "NONE" expcube["caldb"] = caldb expcube["irf"] = irf expcube["ebinalg"] = "LOG" expcube["emin"] = emin expcube["emax"] = emax expcube["enumbins"] = enumbins expcube["nxpix"] = nxpix expcube["nypix"] = nypix expcube["binsz"] = binsz expcube["coordsys"] = coordsys expcube["proj"] = proj expcube["xref"] = ra expcube["yref"] = dec expcube.run() # Create PSF cube psfcube = ctools.ctpsfcube(sim.obs()) psfcube["incube"] = "NONE" psfcube["caldb"] = caldb psfcube["irf"] = irf psfcube["ebinalg"] = "LOG" psfcube["emin"] = emin psfcube["emax"] = emax psfcube["enumbins"] = enumbins psfcube["nxpix"] = 10 psfcube["nypix"] = 10 psfcube["binsz"] = 1.0 psfcube["coordsys"] = coordsys psfcube["proj"] = proj psfcube["xref"] = ra psfcube["yref"] = dec psfcube.run() # Create background cube bkgcube = ctools.ctbkgcube(sim.obs()) bkgcube["incube"] = "NONE" bkgcube["ebinalg"] = "LOG" bkgcube["emin"] = emin bkgcube["emax"] = emax bkgcube["enumbins"] = enumbins bkgcube["nxpix"] = 10 bkgcube["nypix"] = 10 bkgcube["binsz"] = 1.0 bkgcube["coordsys"] = coordsys bkgcube["proj"] = proj bkgcube["xref"] = ra bkgcube["yref"] = dec bkgcube.run() # Attach background model to observation container bin.obs().models(bkgcube.models()) # Set Exposure and Psf cube for first CTA observation # (ctbin will create an observation with a single container) bin.obs()[0].response(expcube.expcube(), psfcube.psfcube(), bkgcube.bkgcube()) # Get ctlike start CPU time cpu_ctlike = time.clock() # Perform maximum likelihood fitting like = ctools.ctlike(bin.obs()) like.run() # Get stop CPU time and compute elapsed times cpu_stop = time.clock() cpu_elapsed = cpu_stop - cpu_start cpu_ctlike = cpu_stop - cpu_ctlike # Return return cpu_elapsed, cpu_ctlike
def _phase_bin(self, phbin): # Write time bin into header self._log_header2(gammalib.TERSE, 'PHASE %f - %f' % (phbin[0], phbin[1])) # Select events select = ctools.ctselect(self.obs().copy()) select['emin'] = self['emin'].real() select['emax'] = self['emax'].real() select['tmin'] = 'UNDEFINED' select['tmax'] = 'UNDEFINED' select['rad'] = 'UNDEFINED' select['ra'] = 'UNDEFINED' select['dec'] = 'UNDEFINED' select['expr'] = 'PHASE>' + str(phbin[0]) + ' && PHASE<' + str( phbin[1]) select.run() # Set phase string phstr = str(phbin[0]) + '-' + str(phbin[1]) # Add phase to observation id for i in range(0, select.obs().size()): oldid = select.obs()[i].id() select.obs()[i].id(oldid + '_' + phstr) obs = select.obs() # If an On/Off analysis is requested generate the On/Off observations if self._onoff: obs = obsutils.get_onoff_obs(self, select.obs(), nthreads=1) # ... otherwise, if stacked analysis is requested then bin the # events and compute the stacked response functions and setup # an observation container with a single stacked observation. elif self._stacked: obs = obsutils.get_stacked_obs(self, select.obs()) # Header self._log_header3(gammalib.EXPLICIT, 'Fitting the data') # The On/Off analysis can produce empty observation containers, # e.g., when on-axis observations are used. To avoid ctlike asking # for a new observation container (or hang, if in interactive mode) # we'll run ctlike only if the size is >0 if obs.size() > 0: # Do maximum likelihood model fitting like = ctools.ctlike(obs) like['edisp'] = self['edisp'].boolean() like['nthreads'] = 1 # Avoids OpenMP conflict like.run() # Renormalize models to phase selection # TODO move the scaling from the temporal to the spectral component for model in like.obs().models(): scaled_norm = model['Normalization'].value() / (phbin[1] - phbin[0]) model['Normalization'].value(scaled_norm) # Store fit model fitmodels = like.obs().models().copy() # ... otherwise we set an empty model container else: self._log_string( gammalib.TERSE, 'PHASE %f - %f: no observations available' ' for fitting' % (phbin[0], phbin[1])) # Set empty models container fitmodels = gammalib.GModels() # Set results result = {'phstr': phstr, 'fitmodels': fitmodels} # Return results return result
def run_pipeline(obs, emin=0.1, emax=100.0, enumbins=20, nxpix=200, nypix=200, binsz=0.02, coordsys='CEL', proj='CAR', model='data/crab.xml', caldb='prod2', irf='South_0.5h', debug=False): """ Simulation and binned analysis pipeline Parameters ---------- obs : `~gammalib.GObservations` Observation container emin : float, optional Minimum energy (TeV) emax : float, optional Maximum energy (TeV) enumbins : int, optional Number of energy bins nxpix : int, optional Number of pixels in X axis nypix : int, optional Number of pixels in Y axis binsz : float, optional Pixel size (deg) coordsys : str, optional Coordinate system proj : str, optional Coordinate projection model : str, optional Model definition XML file caldb : str, optional Calibration database path irf : str, optional Instrument response function debug : bool, optional Debug function """ # Simulate events sim = ctools.ctobssim(obs) sim['debug'] = debug sim['outevents'] = 'obs.xml' sim.execute() # Bin events by looping over all observations in the container sim_obs = gammalib.GObservations('obs.xml') obs = gammalib.GObservations() for run in sim_obs: # Get event filename and set counts cube filename eventfile = run.eventfile().url() cubefile = 'cube_'+eventfile # Bin events for that observation bin = ctools.ctbin() bin['inobs'] = eventfile bin['outcube'] = cubefile bin['ebinalg'] = 'LOG' bin['emin'] = emin bin['emax'] = emax bin['enumbins'] = enumbins bin['nxpix'] = nxpix bin['nypix'] = nypix bin['binsz'] = binsz bin['coordsys'] = coordsys bin['usepnt'] = True bin['proj'] = proj bin.execute() # Set observation ID bin.obs()[0].id(cubefile) bin.obs()[0].eventfile(cubefile) # Append result to observations obs.extend(bin.obs()) # Save XML file xml = gammalib.GXml() obs.write(xml) xml.save('obs_cube.xml') # Perform maximum likelihood fitting like = ctools.ctlike() like['inobs'] = 'obs_cube.xml' like['inmodel'] = model like['outmodel'] = 'fit_results.xml' like['expcube'] = 'NONE' like['psfcube'] = 'NONE' like['bkgcube'] = 'NONE' like['caldb'] = caldb like['irf'] = irf like['debug'] = True # Switch this always on for results in console like.execute() # Return return
def run_pipeline(obs, ra=83.63, dec=22.01, emin=0.1, emax=100.0, enumbins=20, nxpix=200, nypix=200, binsz=0.02, coordsys="CEL", proj="CAR", debug=False): """ Simulation and stacked analysis pipeline. Keywords: ra - RA of cube centre [deg] (default: 83.6331) dec - DEC of cube centre [deg] (default: 22.0145) emin - Minimum energy of cube [TeV] (default: 0.1) emax - Maximum energy of cube [TeV] (default: 100.0) enumbins - Number of energy bins in cube (default: 20) nxpix - Number of RA pixels in cube (default: 200) nypix - Number of DEC pixels in cube (default: 200) binsz - Spatial cube bin size [deg] (default: 0.02) coordsys - Cube coordinate system (CEL or GAL) proj - Cube World Coordinate System (WCS) projection debug - Enable debugging (default: False) """ # Simulate events sim = ctools.ctobssim(obs) sim["debug"] = debug sim.run() # Bin events into counts map bin = ctools.ctbin(sim.obs()) bin["ebinalg"] = "LOG" bin["emin"] = emin bin["emax"] = emax bin["enumbins"] = enumbins bin["nxpix"] = nxpix bin["nypix"] = nypix bin["binsz"] = binsz bin["coordsys"] = coordsys bin["proj"] = proj bin["xref"] = ra bin["yref"] = dec bin["debug"] = debug bin.run() # Create exposure cube expcube = ctools.ctexpcube(sim.obs()) expcube["incube"] = "NONE" expcube["ebinalg"] = "LOG" expcube["emin"] = emin expcube["emax"] = emax expcube["enumbins"] = enumbins expcube["nxpix"] = nxpix expcube["nypix"] = nypix expcube["binsz"] = binsz expcube["coordsys"] = coordsys expcube["proj"] = proj expcube["xref"] = ra expcube["yref"] = dec expcube["debug"] = debug expcube.run() # Create PSF cube psfcube = ctools.ctpsfcube(sim.obs()) psfcube["incube"] = "NONE" psfcube["ebinalg"] = "LOG" psfcube["emin"] = emin psfcube["emax"] = emax psfcube["enumbins"] = enumbins psfcube["nxpix"] = 10 psfcube["nypix"] = 10 psfcube["binsz"] = 1.0 psfcube["coordsys"] = coordsys psfcube["proj"] = proj psfcube["xref"] = ra psfcube["yref"] = dec psfcube["debug"] = debug psfcube.run() # Create background cube bkgcube = ctools.ctbkgcube(sim.obs()) bkgcube["incube"] = "NONE" bkgcube["ebinalg"] = "LOG" bkgcube["emin"] = emin bkgcube["emax"] = emax bkgcube["enumbins"] = enumbins bkgcube["nxpix"] = 10 bkgcube["nypix"] = 10 bkgcube["binsz"] = 1.0 bkgcube["coordsys"] = coordsys bkgcube["proj"] = proj bkgcube["xref"] = ra bkgcube["yref"] = dec bkgcube["debug"] = debug bkgcube.run() # Attach background model to observation container bin.obs().models(bkgcube.models()) # Set Exposure and Psf cube for first CTA observation # (ctbin will create an observation with a single container) bin.obs()[0].response(expcube.expcube(), psfcube.psfcube(), bkgcube.bkgcube()) # Perform maximum likelihood fitting like = ctools.ctlike(bin.obs()) like["debug"] = True # Switch this always on for results in console like.run() # Return return