Exemplo n.º 1
0
from objc_util import ObjCClass
UIDevice = ObjCClass('UIDevice')
NSProcessInfo = ObjCClass('NSProcessInfo')
device = UIDevice.currentDevice()
process = NSProcessInfo.processInfo()
_fsizes = {'B': 1.0, 'KB': 1024.0, 'MB':  float(pow(1024,2)), 'GB': float(pow(1024,3))}

def lowPowerModeStatus():
    return process.isLowPowerModeEnabled()
    

def hostName():
    return str(process.hostName())
    

def osVersion():
    major = process.operatingSystemVersion().a
    minor = process.operatingSystemVersion().b
    patch = process.operatingSystemVersion().c
    return (major, minor, patch)


def osVersionString():
    return str(process.operatingSystemVersionString())


def deviceName():
    return str(device.name())


def deviceType():
Exemplo n.º 2
0
    def get_available_memory(self):
        """found in github
            what is the original source of this peace of magic?
            https://gist.github.com/lukaskollmer/a09c0278d2d224b9f4839a895ebb9988
            https://forum.omz-software.com/topic/3146/share-code-get-available-memory
		"""

        NSProcessInfo = ObjCClass('NSProcessInfo')
        NSByteCountFormatter = ObjCClass('NSByteCountFormatter')

        class c_vm_statistics(Structure):
            _fields_ = [('free_count', c_uint), ('active_count', c_uint),
                        ('inactive_count', c_uint), ('wire_count', c_uint),
                        ('zero_fill_count', c_uint), ('reactivations', c_uint),
                        ('pageins', c_uint), ('pageouts', c_uint),
                        ('faults', c_uint), ('cow_faults', c_uint),
                        ('lookups', c_uint), ('hits', c_uint),
                        ('purgeable_count', c_uint), ('purges', c_uint),
                        ('speculative_count', c_uint)]

        c = cdll.LoadLibrary(None)

        mach_host_self = c.mach_host_self
        mach_host_self.restype = c_uint
        mach_host_self.argtypes = [c_void_p]

        host_page_size = c.host_page_size
        host_page_size.restype = c_int
        host_page_size.argtypes = [c_uint, POINTER(c_uint)]

        host_statistics = c.host_statistics
        host_statistics.restype = c_int
        host_statistics.argtypes = [
            c_uint, c_int, POINTER(c_int),
            POINTER(c_uint)
        ]

        host_port = c_uint()
        host_size = c_uint()
        page_size = c_uint()

        host_port = mach_host_self(None)
        host_size = c_uint(int(sizeof(c_vm_statistics) / sizeof(c_int)))
        host_page_size(host_port, byref(page_size))
        vm_stat = c_vm_statistics()

        HOST_VM_INFO = c_int(2)  # This is a c macro
        KERN_SUCCESS = 0  # Another c macro (No c_int initializer used because we don't pass it to a c function)

        get_host_statistics = host_statistics(
            host_port, HOST_VM_INFO, cast(byref(vm_stat), POINTER(c_int)),
            byref(host_size))

        if not get_host_statistics == int(KERN_SUCCESS):
            print("Failed to fetch vm statistics")

        mem_used = (vm_stat.active_count + vm_stat.inactive_count +
                    vm_stat.wire_count) * int(page_size.value)
        mem_free = vm_stat.free_count * int(page_size.value)
        mem_total = mem_used + mem_free

        physical_memory = NSProcessInfo.processInfo().physicalMemory()

        byteCountFormtter = NSByteCountFormatter.new()
        mem_used = byteCountFormtter.stringFromByteCount_(mem_used)
        mem_free = byteCountFormtter.stringFromByteCount_(mem_free)
        mem_total = byteCountFormtter.stringFromByteCount_(mem_total)
        physical_memory = byteCountFormtter.stringFromByteCount_(
            physical_memory)

        self.LogMessage(f"used {mem_used} free {mem_free} total {mem_total}")
Exemplo n.º 3
0
HOST_VM_INFO = c_int(2)  # This is a c macro
KERN_SUCCESS = 0  # Another c macro (No c_int initializer used because we don't pass it to a c function)

get_host_statistics = host_statistics(host_port, HOST_VM_INFO,
                                      cast(byref(vm_stat), POINTER(c_int)),
                                      byref(host_size))

if not get_host_statistics == int(KERN_SUCCESS):
    print("Failed to fetch vm statistics")

mem_used = (vm_stat.active_count + vm_stat.inactive_count +
            vm_stat.wire_count) * int(page_size.value)
mem_free = vm_stat.free_count * int(page_size.value)
mem_total = mem_used + mem_free

physical_memory = NSProcessInfo.processInfo().physicalMemory()

byteCountFormtter = NSByteCountFormatter.new()
mem_used = byteCountFormtter.stringFromByteCount_(mem_used)
mem_free = byteCountFormtter.stringFromByteCount_(mem_free)
mem_total = byteCountFormtter.stringFromByteCount_(mem_total)
physical_memory = byteCountFormtter.stringFromByteCount_(physical_memory)

print('used:  ', mem_used)
print('free:  ', mem_free)
print('total: ', mem_total)
print('total (according to Cocoa): ', physical_memory)

# NSProcessInfo.processInfo().activeProcessorCount()
Exemplo n.º 4
0
from objc_util import ObjCClass
UIDevice = ObjCClass('UIDevice')
NSProcessInfo = ObjCClass('NSProcessInfo')
device = UIDevice.currentDevice()
process = NSProcessInfo.processInfo()
_fsizes = {'B': 1.0, 'KB': 1024.0, 'MB':  float(pow(1024,2)), 'GB': float(pow(1024,3))}


class Process (object):
    def __init__(self):
        self._objc = NSProcessInfo.processInfo()
        self._fsizes = {'B': 1.0, 'KB': 1024.0, 'MB':  float(pow(1024,2)), 'GB': float(pow(1024,3))}
    @property
    def lowPowerModeStatus(self):
        return self._objc.isLowPowerModeEnabled()
        
    @property
    def hostName(self):
        return str(self._objc.hostName())
        
    @property
    def osVersion(self):
        major = self._objc.operatingSystemVersion().a
        minor = self._objc.operatingSystemVersion().b
        patch = self._objc.operatingSystemVersion().c
        return (major, minor, patch)
    
    @property
    def osVersionString(self):
        return str(self._objc.operatingSystemVersionString())