def example_filterbank(): from pylab import plt import numpy as np x = _create_impulse(2000) gfb = GammatoneFilterbank(density=1) analyse = gfb.analyze(x) imax, slopes = gfb.estimate_max_indices_and_slopes() fig, axs = plt.subplots(len(gfb.centerfrequencies), 1) for (band, state), imx, ax in zip(analyse, imax, axs): ax.plot(np.real(band)) ax.plot(np.imag(band)) ax.plot(np.abs(band)) ax.plot(imx, 0, 'o') ax.set_yticklabels([]) [ax.set_xticklabels([]) for ax in axs[:-1]] axs[0].set_title('Impulse responses of gammatone bands') fig, ax = plt.subplots() def plotfun(x, y): ax.semilogx(x, 20*np.log10(np.abs(y)**2)) gfb.freqz(nfft=2*4096, plotfun=plotfun) plt.grid(True) plt.title('Absolute spectra of gammatone bands.') plt.xlabel('Normalized Frequency (log)') plt.ylabel('Attenuation /dB(FS)') plt.axis('Tight') plt.ylim([-90, 1]) plt.show() return gfb
def example_filterbank(): from pylab import plt import numpy as np x = _create_impulse(2000) gfb = GammatoneFilterbank(density=1) analyse = gfb.analyze(x) imax, slopes = gfb.estimate_max_indices_and_slopes() fig, axs = plt.subplots(len(gfb.centerfrequencies), 1) for (band, state), imx, ax in zip(analyse, imax, axs): ax.plot(np.real(band)) ax.plot(np.imag(band)) ax.plot(np.abs(band)) ax.plot(imx, 0, 'o') ax.set_yticklabels([]) [ax.set_xticklabels([]) for ax in axs[:-1]] axs[0].set_title('Impulse responses of gammatone bands') fig, ax = plt.subplots() def plotfun(x, y): ax.semilogx(x, 20 * np.log10(np.abs(y)**2)) gfb.freqz(nfft=2 * 4096, plotfun=plotfun) plt.grid(True) plt.title('Absolute spectra of gammatone bands.') plt.xlabel('Normalized Frequency (log)') plt.ylabel('Attenuation /dB(FS)') plt.axis('Tight') plt.ylim([-90, 1]) plt.show() return gfb
def stochastic_volatility(): S0 = 100. r = 0.05 v0 = 0.1 kappa = 3.0 theta = 0.25 sigma = 0.1 rho = 0.6 T = 1.0 corr_mat = np.zeros((2, 2)) corr_mat[0, :] = [1.0, rho] corr_mat[1, :] = [rho, 1.0] cho_mat = np.linalg.cholesky(corr_mat) M = 50 I = 10000 dt = T / M ran_num = npr.standard_normal((2, M + 1, I)) v = np.zeros_like(ran_num[0]) vh = np.zeros_like(v) v[0] = v0 vh[0] = v0 for t in range(1, M + 1): ran = np.dot(cho_mat, ran_num[:, t, :]) vh[t] = ( vh[t - 1] + kappa * (theta - np.maximum(vh[t - 1], 0)) * dt + sigma * np.sqrt(np.maximum(vh[t - 1], 0)) * math.sqrt(dt) * ran[1]) v = np.maximum(vh, 0) S = np.zeros_like(ran_num[0]) S[0] = S0 for t in range(1, M + 1): ran = np.dot(cho_mat, ran_num[:, t, :]) S[t] = S[t - 1] * np.exp((r - 0.5 * v[t]) * dt + np.sqrt(v[t]) * ran[0] * np.sqrt(dt)) ig, (ax1, ax2) = plt.subplots(1, 2, figsize=(10, 6)) ax1.hist(S[-1], bins=50) ax1.set_xlabel('index level') ax1.set_ylabel('frequency') ax2.hist(v[-1], bins=50) ax2.set_xlabel('volatility') plt.show() fig, (ax1, ax2) = plt.subplots(2, 1, sharex=True, figsize=(10, 6)) ax1.plot(S[:, :100], lw=1) ax1.set_ylabel('index level') ax2.plot(v[:, :100], lw=1) ax2.set_xlabel('time') ax2.set_ylabel('volatility') plt.show()
def main(data_folder="../data", figure_folder="../figures"): deviation_from_equilibrium = dict() for i in [(1, 0), (2, 0), (2, 1)]: deviation_from_equilibrium[i] = \ json.load(open("{}/deviation_from_equilibrium_{}.json".format(data_folder, i), mode="r")) x = np.arange(len(list(deviation_from_equilibrium.values())[0])) fig, ax = plt.subplots() for i in deviation_from_equilibrium.keys(): ax.plot(x, deviation_from_equilibrium[i], label='{} against {}'.format(i[0], i[1])) ax.legend(fontsize=12) # loc='upper center ax.set_xlabel("generation") ax.set_ylabel("actual price / equilibrium price") ax.set_title( "Price Dynamics in Scarf Three-good Economy \n(relative deviation from equilibrium prices)" ) if not path.exists(figure_folder): mkdir(figure_folder) plt.savefig("{}/figure.pdf".format(figure_folder)) plt.show()
def main(): msft = yf.Ticker("MSFT") euro_security_process, euro_trials, euro_price_mean = european_monte_carlo_valuation( trials=10000, partitions=50, time=1.0, S0=msft.info.get("previousClose"), r=0.05, sigma=0.64, strike=210, option='call') simulated_returns_data = pd.DataFrame(euro_security_process[:, :200]) simulated_returns = np.log( 1 + simulated_returns_data.astype(float).pct_change()) actual_returns_data = msft.history(period="1y")['Close'] actual_returns_data = np.log( 1 + actual_returns_data.astype(float).pct_change()) fig, (ax1, ax2) = plt.subplots(1, 2, figsize=(20, 12)) ax1.hist(simulated_returns.values.flatten(), bins=50) ax1.set_xlabel('Theoretical Returns') ax1.set_ylabel('Frequency') ax2.hist(actual_returns_data, bins=50) ax2.set_xlabel('Observed Returns') ax2.set_ylabel('Frequency') plt.show()
def remove_extreme_value(self, df_input): if self.is_plot: del df_input["date"] del df_input["flag"] fig, (ax0, ax1) = plt.subplots(2, 1, sharey="all") ax0.set_title('BEFORE /20130201/non_ts.csv remove extreme value') df_input.plot(ax=ax0) desc = df_input.describe() mean_add_3std = desc.loc['mean'] + desc.loc['std'] * 3 mean_minus_3std = desc.loc['mean'] - desc.loc['std'] * 3 df_input = df_input.where(df_input < mean_add_3std, mean_add_3std, axis=1) df_input = df_input.where(df_input > mean_minus_3std, mean_minus_3std, axis=1) ax1.set_title('AFTER /20130201/non_ts.csv remove extreme value') df_input.plot(ax=ax1) plt.show() else: desc = df_input.describe() mean_add_3std = desc.loc['mean'] + desc.loc['std'] * 3 mean_minus_3std = desc.loc['mean'] - desc.loc['std'] * 3 df_input = df_input.where(df_input < mean_add_3std, mean_add_3std, axis=1) df_input = df_input.where(df_input > mean_minus_3std, mean_minus_3std, axis=1) return df_input
def plot(cls, data, figure_folder, msg="", suffix=""): fig, ax = plt.subplots() plt.subplots_adjust(left=0.1, right=0.9, top=0.9, bottom=0.2) x = np.arange(len(data[:])) ax.plot(x, data[:, 0], c="red", linewidth=2, label="agent 01") ax.plot(x, data[:, 1], c="blue", linewidth=2, label="agent 12") ax.plot(x, data[:, 2], c="green", linewidth=2, label="agent 20") plt.ylim([-0.01, 1.01]) plt.text(0, -0.23, "PARAMETERS. {}".format(msg)) ax.legend(fontsize=12, bbox_to_anchor=(1.1, 1.05)) # loc='upper center' ax.set_xlabel("$t$") ax.set_ylabel("Proportion of agents proceeding to indirect exchange") ax.set_title("Money emergence with a basal ganglia model") # Save fig if not exists(figure_folder): mkdir(figure_folder) fig_name = "{}/figure_{}.pdf".format(figure_folder, suffix.split(".p")[0]) plt.savefig(fig_name) plt.close()
def plot_weightings(): """Plots all weighting functions defined in :module: splweighting.""" from scipy.signal import freqz from pylab import plt, np sample_rate = 48000 num_samples = 2 * 4096 fig, ax = plt.subplots() for name, weight_design in sorted(_weighting_coeff_design_funsd.items()): b, a = weight_design(sample_rate) w, H = freqz(b, a, worN=num_samples) freq = w * sample_rate / (2 * np.pi) ax.semilogx(freq, 20 * np.log10(np.abs(H) + 1e-20), label='{}-Weighting'.format(name)) plt.legend(loc='lower right') plt.xlabel('Frequency / Hz') plt.ylabel('Damping / dB') plt.grid(True) plt.axis([10, 20000, -80, 5]) return fig, ax
def draw_plot(company_name, hyper_parameter, plot_data): point_list = ['C0o-', 'C1o-', 'C2o-', 'C3o-', 'C4o-', 'C5o-'] x = np.arange(len(plot_data[0][1])) x_label = np.zeros(len(plot_data[0][1])) for i, val in enumerate(plot_data[0][1]): x_label[i] = val[0] fig, ax = plt.subplots(1, 1) for j, model in enumerate(plot_data): model_name = model[0] y = np.zeros(len(model[1])) for i, val in enumerate(model[1]): y[i] = val[1] ax.plot(x, y, point_list[j], label=model_name) ax.set_title(company_name + "'s MSE results w/ " + hyper_parameter, fontdict={ 'fontsize': 18, 'weight': 'bold' }) ax.set_ylabel('MSE', fontdict={'fontsize': 15, 'weight': 'bold'}) ax.set_xlabel(hyper_parameter, fontdict={'fontsize': 15, 'weight': 'bold'}) ax.set_xticks(x) ax.set_xticklabels(x_label) ax.legend() dir_path = 'MSE_figures\\' + company_name os.system('mkdir ' + dir_path) plt.savefig(dir_path + '\\' + company_name + '_' + hyper_parameter + '.png')
def plot(cls, data, figure_folder, msg="", suffix=""): fig, ax = plt.subplots() plt.subplots_adjust(left=0.1, right=0.9, top=0.9, bottom=0.2) x = np.arange(len(data[:])) ax.plot(x, data[:, 0], c="red", linewidth=2, label="agent 01") ax.plot(x, data[:, 1], c="blue", linewidth=2, label="agent 12") ax.plot(x, data[:, 2], c="green", linewidth=2, label="agent 20") plt.ylim([-0.01, 1.01]) plt.text(0, -0.23, "PARAMETERS. {}".format(msg)) ax.legend(fontsize=12, bbox_to_anchor=(1.1, 1.05)) # loc='upper center' ax.set_xlabel("$t$") ax.set_ylabel("Proportion of agents proceeding to indirect exchange") ax.set_title("Money emergence with a basal ganglia model") # Save fig if not exists(figure_folder): mkdir(figure_folder) fig_name = "{}/figure_{}.pdf".format(figure_folder, suffix.split(".p")[0]) plt.savefig(fig_name) plt.close()
def ramd(): sample_size = 500 rn1 = npr.rand(sample_size, 3) rn2 = npr.randint(0, 10, sample_size) rn3 = npr.sample(size=sample_size) a = [0, 25, 50, 75, 100] rn4 = npr.choice(a, size=sample_size) fig, ((ax1, ax2), (ax3, ax4)) = plt.subplots(nrows=2, ncols=2, figsize=(10, 8)) ax1.hist(rn1, bins=25, stacked=True) ax1.set_title('rand') ax1.set_ylabel('frequency') ax2.hist(rn2, bins=25) ax2.set_title('randint') ax3.hist(rn3, bins=25) ax3.set_title('samople') ax3.set_ylabel("frequency") ax4.hist(rn4, bins=25) ax4.set_title('choice') plt.show()
def plot_weightings(): """Plots all weighting functions defined in :module: splweighting.""" from scipy.signal import freqz from pylab import plt, np sample_rate = 48000 num_samples = 2*4096 fig, ax = plt.subplots() for name, weight_design in sorted( _weighting_coeff_design_funsd.items()): b, a = weight_design(sample_rate) w, H = freqz(b, a, worN=num_samples) freq = w*sample_rate / (2*np.pi) ax.semilogx(freq, 20*np.log10(np.abs(H)+1e-20), label='{}-Weighting'.format(name)) plt.legend(loc='lower right') plt.xlabel('Frequency / Hz') plt.ylabel('Damping / dB') plt.grid(True) plt.axis([10, 20000, -80, 5]) return fig, ax
def plot_Mos_Mws(days, Mos=None, Mws=None, ylim = None, yticks=None): if Mos is None and Mws is None: raise ValueError('Set Mos or Mws.') if Mos is not None and Mws is not None: raise ValueError("Don't set both.") if Mws is not None: Mos = mw_to_mo(Mws) fig, ax1 = plt.subplots() ax1.plot(days, Mos,'-o') ax1.set_yscale('log') if yticks is not None: ax1.set_yticks(yticks) ax1.get_yaxis().set_major_formatter(matplotlib.ticker.ScalarFormatter()) if ylim is not None: ax1.set_ylim(ylim) lim1 = ax1.get_ylim() ax1.set_xlabel('days after the mainshock') ax1.set_ylabel('Moment(Nm)') ax1.grid('on') ax2 = ax1.twinx() ax2.set_ylabel('Mw') ax2.set_ylim(mo_to_mw(lim1))
def distribution(): sample_size = 500 rn1 = npr.standard_normal(sample_size) rn2 = npr.normal(100, 20, sample_size) rn3 = npr.chisquare(df=0.5, size=sample_size) rn4 = npr.poisson(lam=1.0, size=sample_size) fig, ((ax1, ax2), (ax3, ax4)) = plt.subplots(nrows=2, ncols=2, figsize=(10, 8)) ax1.hist(rn1, bins=25, stacked=True) ax1.set_title('Standard normal') ax1.set_ylabel('frequency') ax2.hist(rn2, bins=25) ax2.set_title('Normal 100,20') ax3.hist(rn3, bins=25) ax3.set_title('Chi squared') ax3.set_ylabel("frequency") ax4.hist(rn4, bins=25) ax4.set_title('Poisson') plt.show()
def plot_example_graphs(graphs, rows=4, cols=4, figsize=(10, 10)): import matplotlib as mplt norm = mplt.colors.Normalize(0, 20) fig, axes = plt.subplots(rows, cols, squeeze=False, figsize=figsize) def flatten(x): arr = [] for a in x: for b in a: arr.append(b) return arr axes = flatten(axes) for g, ax in zip(graphs, axes): if not g.number_of_nodes(): continue ylabels = {n: ndata for n, ndata in g.nodes(data="y")} nodelist, nodedata = zip(*g.nodes(data=True)) ylabels = { n: round(ndata["y"].flatten().item(), 2) for n, ndata in zip(nodelist, nodedata) } y = [round(ndata["y"].flatten().item(), 2) for ndata in nodedata] pos = GraphPlotter._topological_sort(g) nx.draw_networkx_labels(g, pos, labels=ylabels, ax=ax) nx.draw_networkx_nodes(g, pos, ax=ax, node_color=mplt.cm.coolwarm(norm(y))) nx.draw_networkx_edges(g, pos, ax=ax) return fig, axes
def phase_diagram(data, labels, n_good, title=None, ax=None, letter=None, n_ticks=3, fig_name=None): if ax is None: print('No ax given, I will create a fig.') fig, ax = plt.subplots() im = ax.imshow(data, cmap="binary", origin="lower", vmin=0.2, vmax=0.8) # , vmin=0.5) # Create colorbar cbar = ax.figure.colorbar(im, ax=ax) step = int(len(labels) / n_ticks) lab_to_display = labels[::step] ax.set_xticklabels(lab_to_display) ax.set_yticklabels(lab_to_display) ticks = list(range(len(labels)))[::step] ax.set_xticks(ticks) ax.set_yticks(ticks) ax.tick_params(labelsize=8) ax.set_xlabel(f'$x_{n_good-2}$') ax.set_ylabel(f'$x_{n_good-1}$') ax.set_aspect(1) if title is not None: ax.set_title(title) if letter: ax.text(s=letter, x=-0.1, y=-0.2, horizontalalignment='center', verticalalignment='center', transform=ax.transAxes, fontsize=20) if 'fig' in locals(): print('Saving fig.') # noinspection PyUnboundLocalVariable fig.tight_layout() if fig_name is None: fig_name = f'fig/phase_{n_good}.pdf' os.makedirs(os.path.dirname(fig_name), exist_ok=True) plt.savefig(fig_name)
def get_axis(cNr): # fig, axes = plt.subplots(ncols=cNr[0], nrows=cNr[1], dpi=150, sharex=True); fig, axes = plt.subplots(ncols=cNr[0], nrows=cNr[1], sharex=True, figsize=(16*0.8, 9*0.8), dpi=80, facecolor='w', edgecolor='k'); fig.subplots_adjust(right=0.95, bottom=0.1, top=0.95, hspace=0.2, wspace=0.02) # fig.subplots_adjust(right=0.85, bottom=0.1, top=0.95, hspace=0.25) if sum(cNr)<=2: return axes else: return axes.ravel()
def __init__(self, kernel, xmin, xmax, ymin, ymax, base_accuracy, max_iter, interpolation='none', splits=None, *args): fig, ax = plt.subplots() self.base_accuracy = base_accuracy self.height = base_accuracy self.width = base_accuracy self.max_iter = max_iter self.kernel = kernel self.x = np.linspace(xmin, xmax, self.width) self.y = np.linspace(ymin, ymax, self.height) self.splits = splits self.args = args self.ax = ax self.fig = fig self.interpolation = interpolation self.image_array = None class ImageSaver(ToolBase): image_array = None description = 'Save the image only' def trigger(self, *args, **kwargs): path = filedialog.asksaveasfilename(initialfile='Fractal_1', defaultextension='png', filetypes=[('PNG', ".png") ]) if path: image = Image.fromarray(self.image_array, mode='RGB') image.save(path, "PNG", quality=95, optimize=False) tm = fig.canvas.manager.toolmanager self.image_saver = tm.add_tool("Save Image", ImageSaver) fig.canvas.manager.toolbar.add_tool(tm.get_tool("Save Image"), "toolgroup") self.slider_box = plt.axes([0.12, 0.02, 0.7, 0.03]) self.slider = Slider(self.slider_box, 'Max iter:', 100, 50000, valinit=max_iter, valstep=10) self.slider.set_val(max_iter) self.slider.on_changed(self.on_slider_change) plt.subplots_adjust(bottom=0.1, top=0.95)
def plotSigmoidTanh(fname=None): fig, ax = plt.subplots() xs = np.linspace(-10.0, 10.0, num = 50, endpoint=True) ys = [sigmoidTanh(x, 0.9) for x in xs] ax.plot(xs, ys, 'black') plt.title("y=sigmoid(s)") plt.grid(True) if fname: plt.savefig(fname) plt.show()
def my_plot(fits, vectors, ndf): plt.rcParams['mathtext.fontset'] = 'stix' # 'cm' plt.rcParams["font.family"] = "Times New Roman" if True: # for fit in fits: # print(fit) # ax = pg.plot_non_dominated_fronts(fits) # ax = my_plot_non_dominated_fronts(fits, comp=[0,1], marker='o', up_to_rank_no=3) # ax = my_plot_non_dominated_fronts(fits, comp=[0,2], marker='o', up_to_rank_no=3) # ax = my_plot_non_dominated_fronts(fits, comp=[1,2], marker='o', up_to_rank_no=3) pass my_2p5d_plot_non_dominated_fronts(fits, comp=[0,1], marker='o', up_to_rank_no=1) # # for studying LSA population (whether or not the optimal is on Rank 1 Pareto Front) # x = fits[0][0]/1e3 # y = fits[0][1] # z = fits[0][2] # ax.plot(x, y, color='k', marker='s') # ax.annotate(r'$x_{\rm optm}$', xy=(x, y), xytext=(x+1, y+0.0005), arrowprops=dict(facecolor='black', shrink=0.05),) # my_2p5d_plot_non_dominated_fronts(fits, comp=[0,2], marker='o', up_to_rank_no=1) # my_2p5d_plot_non_dominated_fronts(fits, comp=[1,2], marker='o', up_to_rank_no=1) else: # Obselete. Use ax.step instead to plot print('Valid for 2D objective function space only for now.') fig, axes = plt.subplots(ncols=2, nrows=1, dpi=150, facecolor='w', edgecolor='k'); ax = axes[0] for index, xy in enumerate(vectors): ax.plot(*xy, 's', color='0') ax.text(*xy, '#%d'%(index), color='0') ax.title.set_text("Decision Vector Space") ax = axes[1] for index, front in enumerate(ndf): print('Rank/Tier', index, front) the_color = '%g'%(index/len(ndf)) for individual in front: # individual is integer here ax.plot(*fits[individual], 'o', color=the_color) ax.text(*fits[individual], '#%d'%(individual), color=the_color) front = front.tolist() front.sort(key = lambda individual: fits[individual][1]) # sort by y-axis value # individual is integer here for individual_A, individual_B in zip(front[:-1], front[1:]): # front is already sorted fits_A = fits[individual_A] fits_B = fits[individual_B] ax.plot([fits_A[0], fits_B[0]], [fits_B[1], fits_B[1]], color=the_color, lw=0.25) # 取高的点的Y ax.plot([fits_A[0], fits_A[0]], [fits_A[1], fits_B[1]], color=the_color, lw=0.25) # 取低的点的X ax.title.set_text("Pareto Front | Objective Function Space")
def show_fashion_mnist(images, labels): # plt.set_matplotlib_formats('svg') # 这里的_表示我们忽略(不使用)的变量 _, figs = plt.subplots(1, len(images), figsize=(12, 12)) for f, img, lbl in zip(figs, images, labels): f.imshow(img.reshape((28, 28)).asnumpy()) f.set_title(lbl) f.axes.get_xaxis().set_visible(False) f.axes.get_yaxis().set_visible(False) plt.show()
def show_images(imgs, num_rows, num_cols, scale=2): ''' 画出多张图片 ''' figsize = (num_cols * scale, num_rows * scale) _, axes = plt.subplots(num_rows, num_cols, figsize=figsize) for i in range(num_rows): for j in range(num_cols): axes[i][j].imshow(imgs[i * num_cols + j]) axes[i][j].axes.get_xaxis().set_visible(False) axes[i][j].axes.get_yaxis().set_visible(False) return axes
def subplots(self, figNum, numRows, figTitle='', sharex=True, numCols=1): # if not figNum in self.sharex.keys(): # self.sharex[figNum] = plt.subplot(numRows,1,plotNum) # # plt.plot(time, data, options) if not figNum in self.f.keys(): self.f[figNum] = cObj() self.f[figNum].fig, self.f[figNum].ax = plt.subplots(numRows, numCols, sharex=sharex) self.f[figNum].fig.canvas.set_window_title("%s__%s" % (self.preTitle, figTitle)) return self.f[figNum].fig, self.f[figNum].ax
def plotBeforeAfterFilter(originalS, myFilter, myFilter_time, filteredS, genere, filter_idx): fig, (ax_orig, ax_win, ax_winT, ax_filt) = plt.subplots(4, 1, sharex=True) ax_orig.plot(originalS) ax_orig.set_title('Original pulse') ax_orig.margins(0, 0.1) ax_win.plot(myFilter) ax_win.set_title('str(filter_idx)'+' Filter impulse response--FrequencyDomain') ax_win.margins(0, 0.1) ax_winT.plot(myFilter_time) ax_winT.set_title('str(filter_idx)'+' Filter impulse response--TimeDomain') ax_winT.margins(0, 0.1) ax_filt.plot(filteredS) ax_filt.set_title('Filtered signal') ax_filt.margins(0, 0.1) fig.tight_layout()
def plotSigmoidBias(fname=None): fig, ax = plt.subplots() xs = np.linspace(-10.0, 10.0, num = 50, endpoint=True) ys = [sigmoid(1.0 * x - 5.0) for x in xs] ax.plot(xs, ys, 'black', linestyle='-', label='sig(1.0 * x - 1.0 * 5)') ys = [sigmoid(1.0 * x) for x in xs] ax.plot(xs, ys, 'black', linestyle='--', label='sig(1.0 * x + 1.0 * 0)') ys = [sigmoid(1.0 * x + 5.0) for x in xs] ax.plot(xs, ys, 'black', linestyle='-.', label='sig(1.0 * x + 1.0 * 5)') legend = ax.legend(loc='best', framealpha=0.5) plt.title("y=sig(s * w1 + 1.0 * w2)") plt.grid(True) if fname: plt.savefig(fname) plt.show()
def my_plot_non_dominated_fronts(points, marker='o', comp=[0, 1], up_to_rank_no=None): # We plot fronts, _, _, _ = pg.fast_non_dominated_sorting(points) # We define the colors of the fronts (grayscale from black to white) if up_to_rank_no is None: cl = list( zip(np.linspace(0.1, 0.9, len(fronts)), np.linspace(0.1, 0.9, len(fronts)), np.linspace(0.1, 0.9, len(fronts)))) else: cl = list( zip(np.linspace(0.1, 0.9, up_to_rank_no), np.linspace(0.1, 0.9, up_to_rank_no), np.linspace(0.1, 0.9, up_to_rank_no))) fig, ax = plt.subplots() count = 0 for ndr, front in enumerate(fronts): count += 1 # We plot the points for idx in front: ax.plot(points[idx][comp[0]], points[idx][comp[1]], marker=marker, color=cl[ndr]) # We plot the fronts # Frist compute the points coordinates x = [points[idx][comp[0]] for idx in front] y = [points[idx][comp[1]] for idx in front] # Then sort them by the first objective tmp = [(a, b) for a, b in zip(x, y)] tmp = sorted(tmp, key=lambda k: k[0]) # Now plot using step ax.step([c[0] for c in tmp], [c[1] for c in tmp], color=cl[ndr], where='post') if up_to_rank_no is None: pass else: if count >= up_to_rank_no: break return ax
def plot_mat(data): # Three subplots sharing both x/y axes f, axarray = plt.subplots(16, sharex=True, sharey=True) for i, row in enumerate(data): axarray[i].plot(range(len(row)), row, 'g') # Fine-tune figure; make subplots close to each other and hide x ticks for # all but bottom plot. f.subplots_adjust(hspace=0) plt.setp([a.get_xticklabels() for a in f.axes], visible=False) plt.setp([a.get_yticklabels() for a in f.axes], visible=False) axarray[0].set_title('10 minute EEG Reading for Patient') axarray[int(len(axarray) / 2)].set_ylabel('Magnitude') axarray[-1].set_xlabel('Time') font = {'family': 'normal', 'weight': 'bold', 'size': 48} plt.rc('font', **font) plt.show()
def plotMap(self, fname=None): fig, ax = plt.subplots() ax.plot([self.o1[0], self.a[0], self.o2[0]], [self.o1[1], self.a[1], self.o2[1]], 'r', label='Trajectory 0') ax.plot([self.o1[0], self.b[0], self.o2[0]], [self.o1[1], self.b[1], self.o2[1]], 'b--', label='Trajectory 1') legend = ax.legend(loc='best', framealpha=0.5) plt.title("Map") plt.grid(True) if fname: plt.savefig(fname) plt.show()
def plot_baseline(data, plate_name, save_folder = r'Figures/'): """ """ colors = ((0.2, 0.2, 0.2), (0.5, 0.5, 0.5), (0.7, 0.7, 0.7), (0.3, 0.3, 0.3)) names = data.keys() names.sort() fig, axs = plt.subplots(figsize=(8,3)) for index, name in enumerate(names): for value in data[name]['original_data']: plot_color = colors[index % len(colors)] if abs(value - data[name]['mean'][0]) > data[name]['std'][0] * 2.0: axs.plot([value], [index], 'ko', markerfacecolor = [1,1,1]) else: axs.plot([value], [index], 'ko', color = plot_color) axs.plot([data[name]['mean'][0] for _ in xrange(2)], [index-0.25, index+0.25], 'k-') axs.plot([data[name]['mean'][0] - data[name]['std'][0] for _ in xrange(2)], [index-0.25, index+0.25], 'k--') axs.plot([data[name]['mean'][0] + data[name]['std'][0] for _ in xrange(2)], [index-0.25, index+0.25], 'k--') plt.yticks([i for i in xrange(len(names))], names, size = 10) plt.title(plate_name) plt.ylim(-0.5,len(names)-0.5) plt.xlabel('Fluorescent intensity') plt.tight_layout() save_filename = save_folder + 'baseline_average' pdf = PdfPages(save_filename.split('.')[0] + '.pdf') pdf.savefig(fig) pdf.close() plt.savefig(save_filename) # return None
def plot_mat(data): # Three subplots sharing both x/y axes f, axarray = plt.subplots(16, sharex=True, sharey=True) for i, row in enumerate(data): axarray[i].plot(range(len(row)), row, 'g') # Fine-tune figure; make subplots close to each other and hide x ticks for # all but bottom plot. f.subplots_adjust(hspace=0) plt.setp([a.get_xticklabels() for a in f.axes], visible=False) plt.setp([a.get_yticklabels() for a in f.axes], visible=False) axarray[0].set_title('10 minute EEG Reading for Patient') axarray[int(len(axarray) / 2)].set_ylabel('Magnitude') axarray[-1].set_xlabel('Time') font = {'family': 'normal', 'weight': 'bold', 'size': 48} plt.rc('font', **font) plt.show()
def convolve(arrays, melBank, genere, filter_idx): x = [] melBank_time = np.fft.ifft(melBank) #need to transform melBank to time domain for eachClip in arrays: result = np.convolve(eachClip, melBank_time) x.append(result) plotBeforeAfterFilter(eachClip, melBank, melBank_time, result, genere, filter_idx) m = np.asmatrix(np.array(x)) fig, ax = plt.subplots() ax.matshow(m.real) #each element has imaginary part. So just plot real part plt.axis('equal') plt.axis('tight') plt.title(genere) plt.tight_layout() # filename = "./figures/convolution/Convolution_"+"Filter"+str(filter_idx)+genere+".png" # plt.savefig(filename) plt.show()
def animate(S0, u, d, p, T, N, P=10): ''' S: data NumSims: simulation size numPaths: no. of simulated paths shown ''' S = simulate(S0, u, d, p, T, N) fig, mainplot = plt.subplots(figsize=(10, 5)) mainplot.plot(S[:, :P]) plt.grid(True) plt.xlabel('time step') plt.ylabel('price') divider = make_axes_locatable(mainplot) axHist = divider.append_axes("right", 2.5, pad=0.1, sharey=mainplot) axHist.hist(S[-1, :N], bins=15, orientation='horizontal', normed=True) axHist.yaxis.set_ticks_position("right") axHist.xaxis.set_major_formatter(FuncFormatter('{0:.1%}'.format)) plt.grid(True) plt.xlabel('probability') plt.show()
def money_bar_plots(means, errors, labels, ax=None, letter=None): if ax is None: print('No ax given, I will create a fig.') fig, ax = plt.subplots() if letter: ax.text(s=letter, x=-0.1, y=-0.68, horizontalalignment='center', verticalalignment='center', transform=ax.transAxes, fontsize=20) # Hide spines ax.spines['top'].set_visible(False) ax.spines['right'].set_visible(False) ax.tick_params(axis='y', labelsize=8) ax.tick_params(axis='x', length=0) # print(labels) # Set x labels labels_pos = np.arange(len(labels)) ax.set_xticklabels(labels, rotation='vertical') ax.set_xticks(labels_pos) ax.set_ylim(0, 1) ax.set_yticks((0, 0.5, 1)) ax.set_ylabel("Monetary behavior") # create ax.bar(labels_pos, means, errors=errors, edgecolor="white", align="center", color="black")
def plot(self, good, bad, dataset0, dataset1, fname=None): fig, ax = plt.subplots() ax.plot([self.o1[0], self.a[0], self.o2[0]], [self.o1[1], self.a[1], self.o2[1]], 'r', label='Trajectory 0') ax.plot([self.o1[0], self.b[0], self.o2[0]], [self.o1[1], self.b[1], self.o2[1]], 'b--', label='Trajectory 1') if dataset0.any(): ax.plot(dataset0[:, 0], dataset0[:, 1], 'ro', label='Train Dataset 0') if dataset1.any(): ax.plot(dataset1[:, 0], dataset1[:, 1], 'b*', label='Train Dataset 1') if good.any(): ax.plot(good[:, 0], good[:, 1], 'go', markersize=10, label='Correct prediction') if bad.any(): ax.plot(bad[:, 0], bad[:, 1], 'black', linestyle='none', marker='D', markersize=10, label='Incorrect prediction') legend = ax.legend(loc='best', framealpha=0.5) plt.title("Map") plt.grid(True) if fname: plt.savefig(fname) plt.show()
def get_axis(): fig, axes = plt.subplots(ncols=1, nrows=1, sharex=True, figsize=(7, 4.7), dpi=80, facecolor='w', edgecolor='k') # 1 inch = 2.5cm fig.subplots_adjust(right=0.90, bottom=0.15, top=0.85, hspace=0.2, wspace=0.1) # gcf() means get the current fig, so plt.gcf().axes() means create axes in current fig # grid on # plt.grid(color='r', linestyle='--', linewidth=1,alpha=0.3) plt.grid(color='lightgray', linestyle='-', linewidth=0.5, alpha=0.3) #figure ax size setting return axes
def plot_slip_and_rate_at_subflt(slip, nth_dip, nth_stk): epochs = slip.get_epochs() ts_slip = slip.get_cumu_slip_at_subfault(nth_dip, nth_stk) ts_rate = slip.get_slip_rate_at_subfault(nth_dip, nth_stk) fig, ax1 = plt.subplots() ln1 = ax1.plot(epochs, ts_slip, 'r^-', label='Slip') ax1.grid('on') ax1.set_ylabel('Slip/m') ax1.set_xlabel('Days after the mainshock') ax2 = ax1.twinx() ln2 = ax2.plot(epochs[1:], ts_rate, 'bo-', label='Rate') ax2.set_ylabel('Rate/(m/day)') fontP = FontProperties() fontP.set_size('small') lns = ln1 + ln2 labs = [l.get_label() for l in lns] ax2.legend(lns, labs, loc=1, prop=fontP, bbox_to_anchor=(1.1, 1.05))
def generate_random_samples(): sample_size = 100 rn1 = npr.rand(sample_size, 3) rn2 = npr.randint(1, 10, sample_size) rn3 = npr.sample(size=sample_size) a = list(range(0, 101, 25)) rn4 = npr.choice(a, sample_size) fig, ((ax1, ax2), (ax3, ax4)) = plt.subplots(nrows=2, ncols=2, figsize=(10, 8)) ax1.hist(rn1, bins=25, stacked=True) ax1.set_title('rand') ax1.set_ylabel('frequency') ax2.hist(rn2, bins=25) ax2.set_title('randint') ax3.hist(rn3, bins=25) ax3.set_title('sample') ax3.set_ylabel('frequency') ax4.hist(rn4, bins=25) ax4.set_title('choice') plt.show()
def plot_slip_and_rate_at_subflt(slip, nth_dip, nth_stk): epochs = slip.get_epochs() ts_slip = slip.get_cumu_slip_at_subfault(nth_dip, nth_stk) ts_rate = slip.get_slip_rate_at_subfault(nth_dip, nth_stk) fig, ax1 = plt.subplots() ln1 = ax1.plot(epochs, ts_slip, 'r^-', label='Slip') ax1.grid('on') ax1.set_ylabel('Slip/m') ax1.set_xlabel('Days after the mainshock') ax2 = ax1. twinx() ln2 = ax2.plot(epochs[1:], ts_rate, 'bo-', label='Rate') ax2.set_ylabel('Rate/(m/day)') fontP = FontProperties() fontP.set_size('small') lns = ln1 + ln2 labs = [l.get_label() for l in lns] ax2.legend(lns, labs, loc=1, prop = fontP, bbox_to_anchor=(1.1, 1.05))
_, y2 = ax2.transData.transform((0, v2)) inv = ax2.transData.inverted() _, dy = inv.transform((0, 0)) - inv.transform((0, y1-y2)) miny, maxy = ax2.get_ylim() ax2.set_ylim(miny+dy, maxy+dy) site = 'J543' cmpt = 'u' epochs, ys = get_ts(site, cmpt) vel = np.diff(ys)/np.diff(epochs) from pylab import plt fig, ax1 = plt.subplots() pos1 = ax1.get_position() # get the original position pos2 = [pos1.x0, pos1.y0, pos1.width/1.1 , pos1.height] ax1.set_position(pos2) ax1.plot(np.asarray(epochs)/365., ys,'bx-', label='disp.') ax1.legend(loc=0) #ax1.set_ylim([-1e-6,2e-6]) # ####################### ax2 = ax1.twinx() ax2.plot(np.asarray(epochs[1:])/365., vel*365,'r', label=r'vel ($yr^{-1}$)')
step = int((Ns-window)/Nwindow) time_bins = range(0, Ns-window, step) pv = [] Fv = [] # For each frequency bin, estimate the stats t_init = time() for t in time_bins: covmats = covest.fit_transform(epochs_data[:, ::1, t:(t+window)]) p_test = PermutationDistance(1000, metric='riemann', mode='pairwise') p, F = p_test.test(covmats, labels, verbose=False) pv.append(p) Fv.append(F[0]) duration = time() - t_init # plot result fig, axes = plt.subplots(1, 1, figsize=[6, 3], sharey=True) sig = 0.05 times = np.array(time_bins)/float(Fs) + tmin axes.plot(times, Fv, lw=2, c='k') plt.xlabel('Time (sec)') plt.ylabel('Score') a = np.where(np.diff(np.array(pv) < sig))[0] a = a.reshape(int(len(a)/2), 2) st = (times[1] - times[0])/2.0 for p in a: axes.axvspan(times[p[0]]-st, times[p[1]]+st, facecolor='g', alpha=0.5) axes.legend(['Score', 'p<%.2f' % sig]) axes.set_title('Pairwise distance - %.1f sec.' % duration)
def createPdfPage( self ): print "Creating a new subplot grid" self.fig, self.axarr = plt.subplots(figsize=(8, 8), nrows=self.rows, ncols=self.columns )
def runAnalysis( caseDirs , resultsDir , noReweight = False): # Do a reference for each one for refDir in caseDirs: # ID of reference case refID = refDir.split("/")[-1] # User info print "Doing PCA analysis with "+refDir+" as reference" # Get the PCA limits of component 1-2 plot limit = 10 with open(refDir+"/analysis/data/pca_limits_1", "r") as fi: limit = int(float(fi.read())) limit += 0.01 # Go through the case dirs to plot for caseDir in caseDirs: print "Using "+caseDir+" as case" # ID of case caseID = caseDir.split("/")[-1] ## PCA PLOTTING ON REF DIR PCA COMPONENTS ######################################### # Create & run cpptraj for plotting all cases on the axes of the first eigenvector # Good URLs for PCA in CPPTRAJ: # http://archive.ambermd.org/201404/0243.html # PCA plotter pcaHandler = pcaFuncs.PCA( resultsDir+"/plots/pcaComparison/PCA_"+caseID+"_on_"+refID+".pdf" ) # Create new submission file TEMPLATE = open( caseDir+"/ccptraj_analysis_pca.ptraj", 'r') TEMP = TEMPLATE.read().replace("[PCAREFERENCE]", refDir ) TEMPLATE.close() # Write the submission file FILE = open(caseDir+"/ccptraj_analysis_pca.ptraj","w"); FILE.write( TEMP ); FILE.close(); # Run the cpptraj utility os.system( "$AMBERHOME/bin/cpptraj -p "+caseDir+"/md-files/peptide_nowat.prmtop -i "+caseDir+"/ccptraj_analysis_pca.ptraj" ) # Do the plots of energy landscapes & distributions pcaHandler.plotPCA( "Case: "+caseID+". Ref case: "+refID, # Plot Title caseDir+"/analysis/data/" , # Data Dir "global_pca", # Eigenvector file eigenVectorCount = 2, # Only plot two plotDistibution = False, # Do not plot the distribution limits = limit ) # Save the plot pcaHandler.savePlot() ## REWEIGHTING OF PCA PLOTS ON RED DIR PCA COMPONENTS ##################################################### # Check if we should do a reweighted version if noReweight == False: if os.path.isfile( caseDir+"/md-logs/weights.dat" ): # User info print "aMD weights found. Now attempting 2D reweighting" # Prepare input file numLines = 0 with open(caseDir+"/analysis/data/global_pca", "r") as fi: with open(caseDir+"/analysis/data/global_pca_singleColumn", "w") as fo: next(fi) for line in fi: numLines += 1 fo.write( line.split()[1]+"\t"+line.split()[2]+"\n" ) # Set the discretization reqBins = 100 discretization = (2*limit) / reqBins # Get the max value of normal plot maxValue = math.ceil(pcaHandler.getLatestMax()) # Run the reweighting procedure command = "python $PLMDHOME/src/PyReweighting/PyReweighting-2D.py \ -input "+caseDir+"/analysis/data/global_pca_singleColumn \ -name "+caseDir+"/analysis/data/global_pca_singleColumn_reweighted \ -Xdim -"+str(limit)+" "+str(limit)+" \ -Ydim -"+str(limit)+" "+str(limit)+" \ -discX "+str(discretization)+" \ -discY "+str(discretization)+" \ -cutoff 10 \ -Emax "+str(maxValue)+" \ -job amdweight_CE \ -weight "+refDir+"/md-logs/weights.dat | tee -a reweight_variable.log" print "Running command:", command os.system( command ) # Create long file for PCA module with open(caseDir+"/analysis/data/global_pca_reweightedDone", "w") as fo: with open(caseDir+"/analysis/data/global_pca_singleColumn_reweighted-pmf-c2.dat", "r") as fi: frame = 0 for line in fi: temp = line.split() entries = int(float(temp[2])*10) for i in range(0,entries): fo.write( str(frame) + "\t" + temp[0] + "\t" + temp[1] +"\n" ) frame += 1 # Print block analysis 'family' : 'Arial', fig, ax = plt.subplots(figsize=(8, 8), nrows=1, ncols=1 ) font = {'weight' : 'normal','size' : 10} plt.rc('font', **font) # Now plot the 2d histogram hist = np.load(caseDir+"/analysis/data/global_pca_singleColumn_reweighted_c2EnergyHist.npy") xedges = np.load(caseDir+"/analysis/data/global_pca_singleColumn_reweighted_c2edgesX.npy") yedges = np.load(caseDir+"/analysis/data/global_pca_singleColumn_reweighted_c2edgesY.npy") # Remove points above limit for jy in range(len(hist[0,:])): for jx in range(len(hist[:,0])): if hist[jx,jy] >= maxValue: hist[jx,jy] = float("inf") # Do plot img = plt.imshow(hist.transpose(), interpolation='nearest', origin='lower',extent=[yedges[0], yedges[-1],xedges[0], xedges[-1]] , rasterized=True ) # create an axes on the right side of ax. The width of cax will be 5% # of ax and the padding between cax and ax will be fixed at 0.05 inch. divider = make_axes_locatable(ax) cax = divider.append_axes("right", size="5%", pad=0.05) # Create colorbar colorbar = plt.colorbar(img, ax=ax, cax = cax) colorbar.set_label("Kcal / mol") # Set title, labels etc plt.legend() ax.set_xlabel("PC1", fontsize=12) ax.set_ylabel("PC2", fontsize=12) ax.set_title( "PCA. Case: "+caseID+" Reweighted. Ref case: "+refID ) plt.rc('font', **font) # Save figure fig.savefig(resultsDir+"/plots/pcaComparison/PCA_"+caseID+"_on_"+refID+"_reweighted.pdf") ## CLUSTER PLOTS ON PCA COMPONENTS ################################## # Do both hier and dbscan for clusterType in ["dbscan","hier"]: # Instantiate the class if os.path.isfile(caseDir+"/analysis/data/cluster_"+clusterType+"_out"): print "Doing the "+clusterType+" cluster equivalent of the PCA plot" # Start the cluster handler. Load the file declaring cluster for each frame clusterHandler = cluster.clusterBase( caseDir+"/analysis/data/cluster_"+clusterType+"_out" ) # Separate the dataset. # global_pca is the projection file for this case on the ref modes numPCAdataSets = clusterHandler.separateDataSet( caseDir+"/analysis/data/global_pca", # Input file caseDir+"/analysis/data/cluster_"+clusterType+"_pca_", # Output files xColumn = 1 ) # Create lists of labels and files for plotting clusterLabels = [] clusterFiles = [] offset = 1 if clusterType == "hier" else 0 for i in range( 0+offset, numPCAdataSets+offset): clusterLabels.append( "Cluster "+str(i) ) clusterFiles.append( caseDir+"/analysis/data/cluster_"+clusterType+"_pca_d2_c"+str(i) ) # First one is noise if offset == 0: clusterLabels[0] = "Noise" myPlot.plotData( resultsDir+"/plots/pcaComparison/" , clusterType+"_"+caseID+"_on_"+refID, clusterLabels, clusterFiles , "PC2", xUnit = "PC1", scatter = True, legendLoc = 4, figWidth = 8, figHeight = 8, tightXlimits = False, legendFrame = 1, legendAlpha = 1, xLimits = [-limit,limit], yLimits = [-limit,limit] )
def plot_slip_overview(slip, output_file, if_x_log=False, xlim=[0, 1344], ylim = [0,100], yticks = [20, 40, 60], xticks = [1, 10, 100, 1000], xticklabels = [r'$10^0$', r'$10^1$', r'$10^2$', r'$10^3$'], rotation = 45, fontsize = 10, ): num_subflts_strike = slip.num_subflt_along_strike num_subflts_dip = slip.num_subflt_along_dip epochs = slip.get_epochs() fig, axes = plt.subplots(num_subflts_dip, num_subflts_strike, sharex=True, sharey=True) for ii in range(num_subflts_dip): for jj in range(num_subflts_strike): ax = axes[ii][jj] slip_subflt = slip.get_cumu_slip_at_subfault(ii,jj) plt.sca(ax) plt.fill_between(x=epochs, y1=slip_subflt, y2=0, color='r') if if_x_log: ax.set_xscale('log') plt.xlim(xlim) plt.ylim(ylim) plt.grid('on') plt.box('on') plt.tick_params(axis='both',which='both', bottom='off', top='off', left='off', right='off', labelbottom='off', labeltop='off', labelleft='off', labelright='off') fig.subplots_adjust(hspace=0, wspace=0) for ax in axes[-1,::2]: plt.sca(ax) plt.tick_params(axis='x',which='major', bottom='on', top='off', left='off', right='off', labelbottom='on', labeltop='off', labelleft='off', labelright='off') ax.set_xticks(xticks) ax.set_xticklabels(xticklabels, rotation=rotation, fontsize=fontsize) plt.xlabel('day') for ax in axes[0,1::2]: plt.sca(ax) plt.tick_params(axis='x',which='major', bottom='off', top='on', left='off', right='off', labelbottom='off', labeltop='on', labelleft='off', labelright='off') ax.set_xticks(xticks) ax.set_xticklabels(xticklabels, rotation=rotation, fontsize=fontsize) plt.xlabel('day') for ax in axes[::2,0]: plt.sca(ax) plt.tick_params(axis='y',which='major', bottom='off', top='off', left='on', right='off', labelbottom='off', labeltop='off', labelleft='on', labelright='off') ax.set_yticks(yticks) #ax.set_yticklabels(range(0,100,20)) for tick in ax.yaxis.get_major_ticks(): tick.label.set_fontsize(10) tick.label.set_rotation('horizontal') plt.ylabel('slip/m') for ax in axes[::2,-1]: plt.sca(ax) plt.tick_params(axis='y',which='major', bottom='off', top='off', left='off', right='on', labelbottom='off', labeltop='off', labelleft='off', labelright='on') ax.set_yticks(yticks) #ax.set_yticklabels(range(0,100,20)) for tick in ax.yaxis.get_major_ticks(): tick.label.set_fontsize(10) tick.label.set_rotation('horizontal') plt.ylabel('slip/m') ax.yaxis.set_label_position("right") fig.set_size_inches(33,10) plt.savefig(output_file) plt.close()
def plot_mean_curve(time_data, data, additions, plate_name, save_folder = r'Figures/'): """ """ if not os.path.isdir(save_folder): os.makedirs(save_folder) for block in data: # group = group_similar(data[block].keys()) names = data[block].keys() names.sort() # ----------------- # Plot each group individualy # ----------------- data_per_inch = 5.0 y_len = int(math.sqrt(len(names))) x_len = int(np.ceil(len(names) / float(y_len))) fig, axs = plt.subplots(y_len, x_len, sharex=True, sharey=True, figsize=(x_len*data_per_inch,y_len*data_per_inch), dpi=300) y_min = data[block][names[0]]['original_data'].min() y_max = data[block][names[0]]['original_data'].max() for i, name in enumerate(names): if data[block][name]['original_data'].min() < y_min: y_min = data[block][name]['original_data'].min() if data[block][name]['original_data'].max() > y_max: y_max = data[block][name]['original_data'].max() y_range = y_max - y_min for i, name in enumerate(names): px = i / x_len py = i % x_len if y_len > 1: position = (px, py) else: position = py time = time_data[block][name] mean = np.array(data[block][name]['mean']) std = np.array(data[block][name]['std']) all_curve = data[block][name]['original_data'] axs[position].plot(time, [1.0 for _ in time], 'k-') for curve in all_curve: axs[position].plot(time, curve, color = [0.7 for _ in xrange(3)]) axs[position].plot(time, mean, color = [0.2 for _ in xrange(3)], linewidth = 2.5, label = name) axs[position].plot(time, mean+std, 'k--', color = [0.2 for _ in xrange(3)], linewidth = 2.5) axs[position].plot(time, mean-std, 'k--', color = [0.2 for _ in xrange(3)], linewidth = 2.5) for addition in additions[:block+1]: axs[position].plot([addition[0] for _ in xrange(2)], [0.0,3.0], 'k-') axs[position].text(addition[0], 0.98, addition[1], rotation=270) if i % x_len == 0: axs[position].set_ylabel('Normalized fluorescence', size = 14) if i / x_len == y_len - 1: axs[position].set_xlabel('Time / sec', size = 14) axs[position].set_xlim(0, time[-1]) for j, text in enumerate(name.split(';')): axs[position].text(10, y_max - y_range*j*0.1, text, size = 14) axs[position].set_ylim(y_min-y_range*0.1, y_max+y_range*0.1) # plt.suptitle(plate_name) plt.subplots_adjust(wspace = 0.01, hspace = 0.01) plt.tight_layout() plt.savefig(save_folder + 'block_' + str(block + 1)) # return None