def testGetRingGroupsFromComments(self): """ Test that getRingGroupsFromComments method works for fused polycyclics. """ from rmgpy.thermo.thermoengine import generateThermoData # set-up RMG object rmg = RMG() # load kinetic database and forbidden structures rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadThermo(os.path.join(path, 'thermo')) smi = 'C12C(C3CCC2C3)C4CCC1C4'#two norbornane rings fused together spc = Species().fromSMILES(smi) spc.thermo = generateThermoData(spc) thermodb = rmg.database.thermo thermodb.getRingGroupsFromComments(spc.thermo) import rmgpy.data.rmg rmgpy.data.rmg.database = None
class TestExecutionStatsWriter(unittest.TestCase): """ Contains unit tests of the ExecutionStatsWriter. """ def setUp(self): """ Set up an RMG object """ folder = os.path.join(os.getcwd(),'rmgpy/output') if not os.path.isdir(folder): os.mkdir(folder) self.rmg = RMG(outputDirectory=folder) self.rmg.reactionModel = CoreEdgeReactionModel() self.rmg.saveEverything() def test_save(self): """ Tests if the statistics output file can be found. """ folder = self.rmg.outputDirectory writer = ExecutionStatsWriter(folder) writer.update(self.rmg) statsfile = os.path.join(folder,'statistics.xls') self.assertTrue(os.path.isfile(statsfile)) def tearDown(self): shutil.rmtree(self.rmg.outputDirectory)
def testInitialSpecies(self): " Test we can check whether the solvent is listed as one of the initial species in various scenarios " # Case 1. when SMILES for solvent is available, the molecular structures of the initial species and the solvent # are compared to check whether the solvent is in the initial species list # Case 1-1: the solvent water is not in the initialSpecies list, so it raises Exception rmg=RMG() rmg.initialSpecies = [] solute = Species(label='n-octane', molecule=[Molecule().fromSMILES('C(CCCCC)CC')]) rmg.initialSpecies.append(solute) rmg.solvent = 'water' solventStructure = Species().fromSMILES('O') self.assertRaises(Exception, self.database.checkSolventinInitialSpecies, rmg, solventStructure) # Case 1-2: the solvent is now octane and it is listed as the initialSpecies. Although the string # names of the solute and the solvent are different, because the solvent SMILES is provided, # it can identify the 'n-octane' as the solvent rmg.solvent = 'octane' solventStructure = Species().fromSMILES('CCCCCCCC') self.database.checkSolventinInitialSpecies(rmg, solventStructure) self.assertTrue(rmg.initialSpecies[0].isSolvent) # Case 2: the solvent SMILES is not provided. In this case, it can identify the species as the # solvent by looking at the string name. # Case 2-1: Since 'n-octane and 'octane' are not equal, it raises Exception solventStructure = None self.assertRaises(Exception, self.database.checkSolventinInitialSpecies, rmg, solventStructure) # Case 2-2: The label 'n-ocatne' is corrected to 'octane', so it is identified as the solvent rmg.initialSpecies[0].label = 'octane' self.database.checkSolventinInitialSpecies(rmg, solventStructure) self.assertTrue(rmg.initialSpecies[0].isSolvent)
def runThermoEstimator(inputFile): """ Estimate thermo for a list of species using RMG and the settings chosen inside a thermo input file. """ rmg = RMG() rmg.loadThermoInput(inputFile) # initialize and load the database as well as any QM settings rmg.loadDatabase() if rmg.quantumMechanics: rmg.quantumMechanics.initialize() # Generate the thermo for all the species and write them to chemkin format as well as # ThermoLibrary format with values for H, S, and Cp's. output = open(os.path.join(rmg.outputDirectory, 'output.txt'),'wb') library = ThermoLibrary(name='Thermo Estimation Library') for species in rmg.initialSpecies: species.generateThermoData(rmg.database, quantumMechanics=rmg.reactionModel.quantumMechanics) library.loadEntry( index = len(library.entries) + 1, label = species.label, molecule = species.molecule[0].toAdjacencyList(), thermo = species.thermo.toThermoData(), shortDesc = species.thermo.comment, ) output.write(writeThermoEntry(species)) output.write('\n') output.close() library.save(os.path.join(rmg.outputDirectory,'ThermoLibrary.py'))
def __init__(self, *args, **kwargs): super(Input, self).__init__(*args, **kwargs) self.rmg = RMG() self.folder = os.path.join('rmg', 'tools', 'input') self.path = os.path.join(settings.MEDIA_ROOT, self.folder) self.loadpath = os.path.join(self.path, 'input_upload.py') self.savepath = os.path.join(self.path, 'input.py')
class TestExecutionStatsWriter(unittest.TestCase): """ Contains unit tests of the ExecutionStatsWriter. """ def setUp(self): """ Set up an RMG object """ folder = os.path.join(os.getcwd(), 'rmgpy/output') if not os.path.isdir(folder): os.mkdir(folder) self.rmg = RMG(outputDirectory=folder) self.rmg.reactionModel = CoreEdgeReactionModel() self.rmg.saveEverything() def test_save(self): """ Tests if the statistics output file can be found. """ folder = self.rmg.outputDirectory writer = ExecutionStatsWriter(folder) writer.update(self.rmg) statsfile = os.path.join(folder, 'statistics.xls') self.assertTrue(os.path.isfile(statsfile)) def tearDown(self): shutil.rmtree(self.rmg.outputDirectory)
def testGetRingGroupsFromComments(self): """ Test that getRingGroupsFromComments method works for fused polycyclics. """ from rmgpy.thermo.thermoengine import generateThermoData # set-up RMG object rmg = RMG() # load kinetic database and forbidden structures rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadThermo(os.path.join(path, 'thermo')) smi = 'C12C(C3CCC2C3)C4CCC1C4' #two norbornane rings fused together spc = Species().fromSMILES(smi) spc.thermo = generateThermoData(spc) thermodb = rmg.database.thermo thermodb.getRingGroupsFromComments(spc.thermo) import rmgpy.data.rmg rmgpy.data.rmg.database = None
def testInitialSpecies(self): " Test we can check whether the solvent is listed as one of the initial species in various scenarios " # Case 1. when SMILES for solvent is available, the molecular structures of the initial species and the solvent # are compared to check whether the solvent is in the initial species list # Case 1-1: the solvent water is not in the initialSpecies list, so it raises Exception rmg=RMG() rmg.initialSpecies = [] solute = Species(label='n-octane', molecule=[Molecule().fromSMILES('C(CCCCC)CC')]) rmg.initialSpecies.append(solute) rmg.solvent = 'water' solventStructure = Species().fromSMILES('O') self.assertRaises(Exception, self.database.checkSolventinInitialSpecies, rmg, solventStructure) # Case 1-2: the solvent is now octane and it is listed as the initialSpecies. Although the string # names of the solute and the solvent are different, because the solvent SMILES is provided, # it can identify the 'n-octane' as the solvent rmg.solvent = 'octane' solventStructure = Species().fromSMILES('CCCCCCCC') self.database.checkSolventinInitialSpecies(rmg, solventStructure) self.assertTrue(rmg.initialSpecies[0].isSolvent) # Case 2: the solvent SMILES is not provided. In this case, it can identify the species as the # solvent by looking at the string name. # Case 2-1: Since 'n-octane and 'octane' are not equal, it raises Exception solventStructure = None self.assertRaises(Exception, self.database.checkSolventinInitialSpecies, rmg, solventStructure) # Case 2-2: The label 'n-ocatne' is corrected to 'octane', so it is identified as the solvent rmg.initialSpecies[0].label = 'octane' self.database.checkSolventinInitialSpecies(rmg, solventStructure) self.assertTrue(rmg.initialSpecies[0].isSolvent)
def main(): """ Driver function that parses command line arguments and passes them to the execute function. """ # Parse the command-line arguments (requires the argparse module) args = parse_command_line_arguments() # Initialize the logging system (resets the RMG.log file) level = logging.INFO if args.debug: level = 0 elif args.verbose: level = logging.DEBUG elif args.quiet: level = logging.WARNING kwargs = { 'restart': args.restart, 'walltime': args.walltime, 'log': level, 'kineticsdatastore': args.kineticsdatastore } initializeLog(level, os.path.join(args.output_directory, 'RMG.log')) rmg = RMG(inputFile=args.file, outputDirectory=args.output_directory) # Add output listeners: rmg.attach(ChemkinWriter(args.output_directory)) rmg.attach(OutputHTMLWriter(args.output_directory)) execute(rmg, **kwargs)
def test_liquid_input_reading(self): """ Check if constant concentration condition is well handled. From input file reading to information storage in liquid reactor object. """ rmg = RMG() rmg.input_file = os.path.join(os.path.dirname(rmgpy.__file__), 'solver', 'files', 'liquid_phase_constSPC', 'input.py') rmg.initialize() for index, reactionSystem in enumerate(rmg.reaction_systems): self.assertIsNotNone( reactionSystem.const_spc_names, 'Reactor should contain constant species name and indices after few steps' ) self.assertIsNotNone( reactionSystem.const_spc_indices, 'Reactor should contain constant species indices in the core species array' ) self.assertIs( reactionSystem.const_spc_names[0], rmg.reaction_model.core.species[ reactionSystem.const_spc_indices[0]].label, 'The constant species name from the reaction model and constantSPCnames should be equal' )
def main(): # Parse the command-line arguments (requires the argparse module) # args = parse_command_line_arguments() # AJ: change path to intended input file # args = parse_command_line_arguments(["/Users/agnes/Documents/Software/RMG/RMG-Py/examples/rmg/superminimal/input.py"]) args = parse_command_line_arguments( ["./examples/rmg/superminimal/input.py"]) if args.postprocess: print "Postprocessing the profiler statistics (will be appended to RMG.log)" else: # Initialize the logging system (resets the RMG.log file) level = logging.INFO if args.debug: level = 0 elif args.verbose: level = logging.DEBUG elif args.quiet: level = logging.WARNING initializeLog(level, os.path.join(args.output_directory, 'RMG.log')) logging.info(rmgpy.settings.report()) kwargs = { 'restart': args.restart, 'walltime': args.walltime, 'kineticsdatastore': args.kineticsdatastore } if args.profile: import cProfile global_vars = {} local_vars = { 'inputFile': args.file, 'output_dir': args.output_directory, 'kwargs': kwargs, 'RMG': RMG } command = """rmg = RMG(inputFile=inputFile, outputDirectory=output_dir); rmg.execute(**kwargs)""" stats_file = os.path.join(args.output_directory, 'RMG.profile') print("Running under cProfile") if not args.postprocess: # actually run the program! cProfile.runctx(command, global_vars, local_vars, stats_file) # postprocess the stats log_file = os.path.join(args.output_directory, 'RMG.log') processProfileStats(stats_file, log_file) makeProfileGraph(stats_file) else: rmg = RMG(inputFile=args.file, outputDirectory=args.output_directory) rmg.execute(**kwargs)
def saveRestartFile(path, rmg, delay=0): """ Save a restart file to `path` on disk containing the contents of the provided `reactionModel`. The `delay` parameter is a time in seconds; if the restart file is not at least that old, the save is aborted. (Use the default value of 0 to force the restart file to be saved.) """ # Saving of a restart file is very slow (likely due to all the Quantity objects) # Therefore, to save it less frequently, don't bother if the restart file is less than an hour old if os.path.exists(path) and time.time() - os.path.getmtime(path) < delay: logging.info('Not saving restart file in this iteration.') return # Pickle the reaction model to the specified file # We also compress the restart file to save space (and lower the disk read/write time) logging.info('Saving restart file...') from rmgpy.rmg.main import RMG rmg_restart = RMG() rmg_restart.reactionModel = rmg.reactionModel rmg_restart.unimolecularReact = rmg.unimolecularReact rmg_restart.bimolecularReact = rmg.bimolecularReact rmg_restart.trimolecularReact = rmg.trimolecularReact if rmg.filterReactions: rmg_restart.unimolecularThreshold = rmg.unimolecularThreshold rmg_restart.bimolecularThreshold = rmg.bimolecularThreshold rmg_restart.trimolecularThreshold = rmg.trimolecularThreshold f = open(path, 'wb') cPickle.dump(rmg_restart, f, cPickle.HIGHEST_PROTOCOL) f.close()
def loadRMGPyJob(inputFile, chemkinFile=None, speciesDict=None, generateImages=True): """ Load the results of an RMG-Py job generated from the given `inputFile`. """ from rmgpy.rmg.main import RMG # Load the specified RMG input file rmg = RMG() rmg.loadInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG if not chemkinFile: chemkinFile = os.path.join(os.path.dirname(inputFile), 'chemkin', 'chem.inp') if not speciesDict: speciesDict = os.path.join(os.path.dirname(inputFile), 'chemkin', 'species_dictionary.txt') speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict) # Map species in input file to corresponding species in Chemkin file speciesDict = {} for spec0 in rmg.initialSpecies: for species in speciesList: if species.isIsomorphic(spec0): speciesDict[spec0] = species break # Generate flux pairs for each reaction if needed for reaction in reactionList: if not reaction.pairs: reaction.generatePairs() # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([(speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems()]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): t.species = speciesDict[t.species] reactionSystem.sensitiveSpecies = [speciesDict[spec] for spec in reactionSystem.sensitiveSpecies] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList # Generate species images if generateImages: speciesPath = os.path.join(os.path.dirname(inputFile), 'species') try: os.mkdir(speciesPath) except OSError: pass for species in speciesList: path = os.path.join(speciesPath, '{0!s}.png'.format(species)) if not os.path.exists(path): species.molecule[0].draw(str(path)) return rmg
def test_check_for_existing_species_for_bi_aromatics(self): """ Test RMG check_for_existing_species can correctly check isomorphism for biaromatics. In this test, DPP is a species already stored in rmg species_dict, mol_test is a newly created molecule which has one kekulized benzene ring and one double_bond-single_bond benzene ring. """ rmg_test = RMG() rmg_test.reaction_model = CoreEdgeReactionModel() DPP = Species().from_smiles('C1=CC=C(C=C1)CCCC1C=CC=CC=1') DPP.generate_resonance_structures() formula = DPP.molecule[0].get_formula() if formula in rmg_test.reaction_model.species_dict: rmg_test.reaction_model.species_dict[formula].append(DPP) else: rmg_test.reaction_model.species_dict[formula] = [DPP] mol_test = Molecule().from_adjacency_list( """ 1 C u0 p0 c0 {2,S} {3,S} {16,S} {17,S} 2 C u0 p0 c0 {1,S} {4,S} {18,S} {19,S} 3 C u0 p0 c0 {1,S} {5,S} {20,S} {21,S} 4 C u0 p0 c0 {2,S} {6,B} {7,B} 5 C u0 p0 c0 {3,S} {8,D} {9,S} 6 C u0 p0 c0 {4,B} {10,B} {22,S} 7 C u0 p0 c0 {4,B} {12,B} {24,S} 8 C u0 p0 c0 {5,D} {14,S} {27,S} 9 C u0 p0 c0 {5,S} {15,D} {28,S} 10 C u0 p0 c0 {6,B} {11,B} {23,S} 11 C u0 p0 c0 {10,B} {12,B} {25,S} 12 C u0 p0 c0 {7,B} {11,B} {26,S} 13 C u0 p0 c0 {14,D} {15,S} {29,S} 14 C u0 p0 c0 {8,S} {13,D} {30,S} 15 C u0 p0 c0 {9,D} {13,S} {31,S} 16 H u0 p0 c0 {1,S} 17 H u0 p0 c0 {1,S} 18 H u0 p0 c0 {2,S} 19 H u0 p0 c0 {2,S} 20 H u0 p0 c0 {3,S} 21 H u0 p0 c0 {3,S} 22 H u0 p0 c0 {6,S} 23 H u0 p0 c0 {10,S} 24 H u0 p0 c0 {7,S} 25 H u0 p0 c0 {11,S} 26 H u0 p0 c0 {12,S} 27 H u0 p0 c0 {8,S} 28 H u0 p0 c0 {9,S} 29 H u0 p0 c0 {13,S} 30 H u0 p0 c0 {14,S} 31 H u0 p0 c0 {15,S} """) spec = rmg_test.reaction_model.check_for_existing_species(mol_test) self.assertIsNotNone(spec)
def main(): # Parse the command-line arguments (requires the argparse module) args = parse_command_line_arguments() if args.postprocess: logging.info( "Postprocessing the profiler statistics (will be appended to RMG.log)" ) else: # Initialize the logging system (resets the RMG.log file) level = logging.INFO if args.debug: level = 0 elif args.verbose: level = logging.DEBUG elif args.quiet: level = logging.WARNING initialize_log(level, os.path.join(args.output_directory, 'RMG.log')) logging.info(rmgpy.settings.report()) kwargs = { 'restart': args.restart, 'walltime': args.walltime, 'maxproc': args.maxproc, 'kineticsdatastore': args.kineticsdatastore } if args.profile: import cProfile global_vars = {} local_vars = { 'inputFile': args.file, 'output_dir': args.output_directory, 'kwargs': kwargs, 'RMG': RMG } command = """rmg = RMG(input_file=inputFile, output_directory=output_dir); rmg.execute(**kwargs)""" stats_file = os.path.join(args.output_directory, 'RMG.profile') print("Running under cProfile") if not args.postprocess: # actually run the program! cProfile.runctx(command, global_vars, local_vars, stats_file) # postprocess the stats log_file = os.path.join(args.output_directory, 'RMG.log') process_profile_stats(stats_file, log_file) make_profile_graph(stats_file) else: rmg = RMG(input_file=args.file, output_directory=args.output_directory) rmg.execute(**kwargs)
def generate_RMG_model(inputFile, outputDirectory): """ Generate the RMG-Py model NOT containing any non-normal isotopomers. Returns created RMG object. """ initializeLog(logging.INFO, os.path.join(outputDirectory, 'RMG.log')) # generate mechanism: rmg = RMG(inputFile = os.path.abspath(inputFile), outputDirectory = os.path.abspath(outputDirectory)) rmg.execute() return rmg
def setUp(self): """ Set up an RMG object """ folder = os.path.join(os.getcwd(), 'rmgpy/output') if not os.path.isdir(folder): os.mkdir(folder) self.rmg = RMG(outputDirectory=folder) self.rmg.reactionModel = CoreEdgeReactionModel() self.rmg.saveEverything()
def generate_rmg_model(input_file, output_directory): """ Generate the RMG-Py model NOT containing any non-normal isotopomers. Returns created RMG object. """ initialize_log(logging.INFO, os.path.join(output_directory, 'RMG.log')) # generate mechanism: rmg = RMG(input_file=os.path.abspath(input_file), output_directory=os.path.abspath(output_directory)) rmg.execute() return rmg
def main(): # Parse the command-line arguments (requires the argparse module) args = parse_command_line_arguments() if args.postprocess: print "Postprocessing the profiler statistics (will be appended to RMG.log)" else: # Initialize the logging system (resets the RMG.log file) level = logging.INFO if args.debug: level = 0 elif args.verbose: level = logging.DEBUG elif args.quiet: level = logging.WARNING initializeLog(level, os.path.join(args.output_directory, 'RMG.log')) logging.info(rmgpy.settings.report()) kwargs = { 'restart': args.restart, 'walltime': args.walltime, 'kineticsdatastore': args.kineticsdatastore } if args.profile: import cProfile global_vars = {} local_vars = { 'inputFile': args.file, 'output_dir': args.output_directory, 'kwargs': kwargs, 'RMG': RMG } command = """rmg = RMG(inputFile=inputFile, outputDirectory=output_dir); rmg.execute(**kwargs)""" stats_file = os.path.join(args.output_directory, 'RMG.profile') print("Running under cProfile") if not args.postprocess: # actually run the program! cProfile.runctx(command, global_vars, local_vars, stats_file) # postprocess the stats log_file = os.path.join(args.output_directory, 'RMG.log') processProfileStats(stats_file, log_file) makeProfileGraph(stats_file) else: rmg = RMG(inputFile=args.file, outputDirectory=args.output_directory) rmg.execute(**kwargs)
def loadRMGPyJob(inputFile, chemkinFile, speciesDict=None): """ Load the results of an RMG-Py job generated from the given `inputFile`. """ # Load the specified RMG input file rmg = RMG() rmg.loadInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict, readComments=False) assert speciesList, reactionList # print 'labels from species in the chemkin file:' # for spc in speciesList: # print spc.label # Map species in input file to corresponding species in Chemkin file speciesDict = {} assert rmg.initialSpecies # print 'initial species: ', rmg.initialSpecies #label of initial species must correspond to the label in the chemkin file WITHOUT parentheses. #E.g.: "JP10" not "JP10(1)" for spec0 in rmg.initialSpecies: for species in speciesList: if species.label == spec0.label: speciesDict[spec0] = species break assert speciesDict # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([ (speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems() ]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): t.species = speciesDict[t.species] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList # print 'core: ', speciesList return rmg
def saveRestartFile(path, rmg, delay=0): """ Save a restart file to `path` on disk containing the contents of the provided `reactionModel`. The `delay` parameter is a time in seconds; if the restart file is not at least that old, the save is aborted. (Use the default value of 0 to force the restart file to be saved.) """ warnings.warn("The saveRestartFile is no longer supported and may be" " removed in version 2.3.", DeprecationWarning) # Saving of a restart file is very slow (likely due to all the Quantity objects) # Therefore, to save it less frequently, don't bother if the restart file is less than an hour old if os.path.exists(path) and time.time() - os.path.getmtime(path) < delay: logging.info('Not saving restart file in this iteration.') return # Pickle the reaction model to the specified file # We also compress the restart file to save space (and lower the disk read/write time) logging.info('Saving restart file...') from rmgpy.rmg.main import RMG rmg_restart = RMG() rmg_restart.reactionModel = rmg.reactionModel rmg_restart.unimolecularReact = rmg.unimolecularReact rmg_restart.bimolecularReact = rmg.bimolecularReact rmg_restart.trimolecularReact = rmg.trimolecularReact if rmg.filterReactions: rmg_restart.unimolecularThreshold = rmg.unimolecularThreshold rmg_restart.bimolecularThreshold = rmg.bimolecularThreshold rmg_restart.trimolecularThreshold = rmg.trimolecularThreshold f = open(path, 'wb') cPickle.dump(rmg_restart, f, cPickle.HIGHEST_PROTOCOL) f.close()
def __init__(self, *args, **kwargs): super(Input, self).__init__(*args, **kwargs) self.rmg = RMG() self.folder = os.path.join('rmg', 'tools', 'input') self.path = os.path.join(settings.MEDIA_ROOT, self.folder) self.loadpath = os.path.join(self.path, 'input_upload.py') self.savepath = os.path.join(self.path, 'input.py')
def testDuplicateReaction(self): """ Test that the radical addition reaction HCJ=O + CH2O = [CH2]OC=O present in the reaction library "Methylformate", only appears once in the model. """ from rmgpy.reaction import Reaction from rmgpy.molecule import Molecule folder = os.path.join(os.path.dirname(rmgpy.__file__),'tools/data/generate/duplicates') inputFile = os.path.join(folder,'input.py') rmg = RMG() rmg = execute(rmg, inputFile, folder) self.assertIsNotNone(rmg) rxnFlagged = Reaction(reactants=[Molecule(SMILES='[CH]=O'),Molecule(SMILES='C=O')], products=[Molecule(SMILES='[CH2]OC=O')]) count = 0 for reaction in rmg.reactionModel.core.reactions: if reaction.isIsomorphic(rxnFlagged): count += 1 self.assertEquals(count, 1) shutil.rmtree(os.path.join(folder,'pdep'))
def load(): tearDown() rmg = RMG()#for solvent database = RMGDatabase() database.loadThermo(os.path.join(settings['database.directory'], 'thermo')) database.loadTransport(os.path.join(settings['database.directory'], 'transport')) database.loadSolvation(os.path.join(settings['database.directory'], 'solvation'))
def test_liquidInputReading(self): """ Check if constant concentration condition is well handled. From input file reading to information storage in liquid reactor object. """ rmg = RMG() rmg.inputFile = os.path.join('rmgpy', 'solver', 'files', 'liquid_phase_constSPC', 'input.py') rmg.initialize() for index, reactionSystem in enumerate(rmg.reactionSystems): self.assertIsNotNone(reactionSystem.constSPCNames, 'Reactor should contain constant species name and indices after few steps') self.assertIsNotNone(reactionSystem.constSPCIndices, 'Reactor should contain constant species indices in the core species array') self.assertIs(reactionSystem.constSPCNames[0], rmg.reactionModel.core.species[reactionSystem.constSPCIndices[0]].label, 'The constant species name from the reaction model and constantSPCnames should be equal')
def loadRMGPyJob(inputFile, chemkinFile, speciesDict=None): """ Load the results of an RMG-Py job generated from the given `inputFile`. """ # Load the specified RMG input file rmg = RMG() rmg.loadInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict, readComments=False) assert speciesList, reactionList # print 'labels from species in the chemkin file:' # for spc in speciesList: # print spc.label # Map species in input file to corresponding species in Chemkin file speciesDict = {} assert rmg.initialSpecies # print 'initial species: ', rmg.initialSpecies #label of initial species must correspond to the label in the chemkin file WITHOUT parentheses. #E.g.: "JP10" not "JP10(1)" for spec0 in rmg.initialSpecies: for species in speciesList: if species.label == spec0.label: speciesDict[spec0] = species break assert speciesDict # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([(speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems()]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): t.species = speciesDict[t.species] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList # print 'core: ', speciesList return rmg
def setUpModule(): """ A method that is run before the class. """ # set-up RMG object and get global rmg object in input.py file # so methods can be tested global rmg rmg = RMG() inp.set_global_rmg(rmg)
def loadRMGPyJob(inputFile, chemkinFile, speciesDict): """ Load the results of an RMG-Py job generated from the given `inputFile`. """ import os.path from rmgpy.chemkin import getSpeciesIdentifier, loadChemkinFile from rmgpy.rmg.main import RMG from rmgpy.solver.base import TerminationTime, TerminationConversion # Load the specified RMG input file rmg = RMG() rmg.loadInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict, readComments=False) # Map species in input file to corresponding species in Chemkin file speciesDict = {} #label of initial species must correspond to the label in the chemkin file WITHOUT parentheses. for spec0 in rmg.initialSpecies: for species in speciesList: if species.label == spec0.label: speciesDict[spec0] = species break # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([ (speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems() ]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): t.species = speciesDict[t.species] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList return rmg
def run_thermo_estimator(input_file, library_flag): """ Estimate thermo for a list of species using RMG and the settings chosen inside a thermo input file. """ rmg = RMG() rmg.load_thermo_input(input_file) rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.load_thermo(os.path.join(path, 'thermo'), rmg.thermo_libraries, depository=False) if rmg.solvent: rmg.database.load_solvation(os.path.join(path, 'solvation')) Species.solvent_data = rmg.database.solvation.get_solvent_data( rmg.solvent) Species.solvent_name = rmg.solvent for species in rmg.initial_species: submit(species) if library_flag: library = ThermoLibrary(name='Thermo Estimation Library') for species in rmg.initial_species: library.load_entry( index=len(library.entries) + 1, label=species.label, molecule=species.molecule[0].to_adjacency_list(), thermo=species.get_thermo_data().to_thermo_data(), shortDesc=species.get_thermo_data().comment, ) library.save(os.path.join(rmg.output_directory, 'ThermoLibrary.py')) # Save the thermo data to chemkin format output files and dictionary, with no reactions save_chemkin_file(os.path.join(rmg.output_directory, 'chem_annotated.inp'), species=rmg.initial_species, reactions=[]) save_species_dictionary(os.path.join(rmg.output_directory, 'species_dictionary.txt'), species=rmg.initial_species)
def load(): """ A method that is run before each unit test in this class. """ tearDown() # set-up RMG object rmg = RMG() # load kinetic database and forbidden structures rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadForbiddenStructures(os.path.join(path, 'forbiddenStructures.py')) # kinetics family loading rmg.database.loadKinetics(os.path.join(path, 'kinetics'), kineticsFamilies=[TESTFAMILY], reactionLibraries=[] )
def createOutput(self): """ Generate output html file from the path containing chemkin and dictionary files. """ import rmgpy.tools.generate_reactions as generate_reactions from rmgpy.rmg.main import initializeLog, RMG from rmgpy.chemkin import ChemkinWriter from rmgpy.rmg.output import OutputHTMLWriter inputFile = self.input output_directory = self.getDirname() rmg = RMG() # Add output listeners: rmg.attach(ChemkinWriter(output_directory)) rmg.attach(OutputHTMLWriter(output_directory)) generate_reactions.execute(rmg, inputFile, output_directory)
def main(): """ Driver function that parses command line arguments and passes them to the execute function. """ # Parse the command-line arguments (requires the argparse module) args = parseCommandLineArguments() # For output and scratch directories, if they are empty strings, set them # to match the input file location inputFile = args.file[0] inputDirectory = os.path.abspath(os.path.dirname(inputFile)) if args.output_directory == "": args.output_directory = inputDirectory if args.scratch_directory == "": args.scratch_directory = inputDirectory # Initialize the logging system (resets the RMG.log file) level = logging.INFO if args.debug: level = 0 elif args.verbose: level = logging.DEBUG elif args.quiet: level = logging.WARNING kwargs = { "scratch_directory": args.scratch_directory, "restart": args.restart, "walltime": args.walltime, "log": level, } initializeLog(level, os.path.join(args.output_directory, "RMG.log")) rmg = RMG(inputFile=inputFile, outputDirectory=args.output_directory) # Add output listeners: rmg.attach(ChemkinWriter(args.output_directory)) rmg.attach(OutputHTMLWriter(args.output_directory)) execute(rmg, **kwargs)
def load(): """ A method that is run before each unit test in this class. """ tearDown() # set-up RMG object rmg = RMG() # load kinetic database and forbidden structures rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadForbiddenStructures(os.path.join(path, 'forbiddenStructures.py')) # kinetics family loading rmg.database.loadKinetics(os.path.join(path, 'kinetics'), kineticsFamilies=[TESTFAMILY], reactionLibraries=[] )
def runThermoEstimator(inputFile): """ Estimate thermo for a list of species using RMG and the settings chosen inside a thermo input file. """ rmg = RMG() rmg.loadThermoInput(inputFile) rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadThermo(os.path.join(path, 'thermo'), rmg.thermoLibraries, depository=False) if rmg.solvent: rmg.database.loadSolvation(os.path.join(path, 'solvation')) Species.solventData = rmg.database.solvation.getSolventData( rmg.solvent) Species.solventName = rmg.solvent for species in rmg.initialSpecies: submit(species) # library = ThermoLibrary(name='Thermo Estimation Library') # for spc in rmg.initialSpecies: # library.loadEntry( # index = len(library.entries) + 1, # label = species.label, # molecule = species.molecule[0].toAdjacencyList(), # thermo = species.getThermoData().toThermoData(), # shortDesc = species.getThermoData().comment, # ) # library.save(os.path.join(rmg.outputDirectory,'ThermoLibrary.py')) # Save the thermo data to chemkin format output files and dictionary, with no reactions saveChemkinFile(os.path.join(rmg.outputDirectory, 'chem_annotated.inp'), species=rmg.initialSpecies, reactions=[]) saveSpeciesDictionary(os.path.join(rmg.outputDirectory, 'species_dictionary.txt'), species=rmg.initialSpecies)
def runThermoEstimator(inputFile): """ Estimate thermo for a list of species using RMG and the settings chosen inside a thermo input file. """ rmg = RMG() rmg.loadThermoInput(inputFile) # initialize and load the database as well as any QM settings rmg.loadDatabase() if rmg.quantumMechanics: rmg.quantumMechanics.initialize() # Generate the thermo for all the species and write them to chemkin format as well as # ThermoLibrary format with values for H, S, and Cp's. output = open(os.path.join(rmg.outputDirectory, 'output.txt'), 'wb') library = ThermoLibrary(name='Thermo Estimation Library') for species in rmg.initialSpecies: species.generateThermoData( rmg.database, quantumMechanics=rmg.reactionModel.quantumMechanics) library.loadEntry( index=len(library.entries) + 1, label=species.label, molecule=species.molecule[0].toAdjacencyList(), thermo=species.thermo.toThermoData(), shortDesc=species.thermo.comment, ) output.write(writeThermoEntry(species)) output.write('\n') output.close() library.save(os.path.join(rmg.outputDirectory, 'ThermoLibrary.py'))
def main(): """ Driver function that parses command line arguments and passes them to the execute function. """ # Parse the command-line arguments (requires the argparse module) args = parse_command_line_arguments() # Initialize the logging system (resets the RMG.log file) level = logging.INFO if args.debug: level = 0 elif args.verbose: level = logging.DEBUG elif args.quiet: level = logging.WARNING kwargs = { 'restart': args.restart, 'walltime': args.walltime, 'log': level, 'kineticsdatastore': args.kineticsdatastore } initializeLog(level, os.path.join(args.output_directory, 'RMG.log')) rmg = RMG(inputFile=args.file, outputDirectory=args.output_directory) # Add output listeners: rmg.attach(ChemkinWriter(args.output_directory)) rmg.attach(OutputHTMLWriter(args.output_directory)) execute(rmg, **kwargs)
def loadRMGPyJob(inputFile, chemkinFile, speciesDict): """ Load the results of an RMG-Py job generated from the given `inputFile`. """ import os.path from rmgpy.chemkin import getSpeciesIdentifier, loadChemkinFile from rmgpy.rmg.main import RMG from rmgpy.solver.base import TerminationTime, TerminationConversion # Load the specified RMG input file rmg = RMG() rmg.loadInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict, readComments=False) # Map species in input file to corresponding species in Chemkin file speciesDict = {} #label of initial species must correspond to the label in the chemkin file WITHOUT parentheses. for spec0 in rmg.initialSpecies: for species in speciesList: if species.label == spec0.label: speciesDict[spec0] = species break # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([(speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems()]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): t.species = speciesDict[t.species] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList return rmg
def setUp(self): """ Set up an RMG object """ folder = os.path.join(os.getcwd(),'rmgpy/output') if not os.path.isdir(folder): os.mkdir(folder) self.rmg = RMG(outputDirectory=folder) self.rmg.reactionModel = CoreEdgeReactionModel() self.rmg.saveEverything()
def setUpClass(cls): """ A method that is run before each unit test in this class. """ # set-up RMG object cls.rmg = RMG() # load kinetic database and forbidden structures cls.rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading cls.rmg.database.load_thermo(os.path.join(path, 'thermo'))
def test(self): folder = os.path.join(os.path.dirname(rmgpy.__file__), 'tools/data/generate') input_file = os.path.join(folder, 'input.py') rmg = RMG(input_file=input_file, output_directory=folder) rmg = execute(rmg) self.assertIsNotNone(rmg) self.assertIsNotNone(rmg.reaction_model.output_species_list) self.assertIsNotNone(rmg.reaction_model.output_reaction_list) shutil.rmtree(os.path.join(folder, 'pdep'))
def setUpClass(cls): """A function that is run ONCE before all unit tests in this class.""" cls.testDir = os.path.join(originalPath, 'rmg', 'test_data', 'restartTest') cls.outputDir = os.path.join(cls.testDir, 'output_no_filters') cls.databaseDirectory = settings['database.directory'] os.mkdir(cls.outputDir) initialize_log(logging.INFO, os.path.join(cls.outputDir, 'RMG.log')) cls.rmg = RMG(input_file=os.path.join(cls.testDir, 'restart_no_filters.py'), output_directory=os.path.join(cls.outputDir))
def loadRMGPyJob(inputFile): """ Load the results of an RMG-Py job generated from the given `inputFile`. """ # Load the specified RMG input file rmg = RMG() rmg.loadInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG chemkinFile = os.path.join(os.path.dirname(inputFile), 'chemkin', 'chem.inp') speciesDict = os.path.join(os.path.dirname(inputFile), 'chemkin', 'species_dictionary.txt') speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict) # Map species in input file to corresponding species in Chemkin file speciesDict = {} for spec0 in rmg.initialSpecies: for species in speciesList: if species.isIsomorphic(spec0): speciesDict[spec0] = species break # Generate flux pairs for each reaction if needed for reaction in reactionList: if not reaction.pairs: reaction.generatePairs() # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([(speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems()]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): t.species = speciesDict[t.species] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList return rmg
def runThermoEstimator(inputFile): """ Estimate thermo for a list of species using RMG and the settings chosen inside a thermo input file. """ rmg = RMG() rmg.loadThermoInput(inputFile) rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadThermo(os.path.join(path, 'thermo'), rmg.thermoLibraries, depository=False) if rmg.solvent: rmg.database.loadSolvation(os.path.join(path, 'solvation')) Species.solventData = rmg.database.solvation.getSolventData(rmg.solvent) Species.solventName = rmg.solvent # Generate the thermo for all the species and write them to chemkin format as well as # ThermoLibrary format with values for H, S, and Cp's. output = open(os.path.join(rmg.outputDirectory, 'output.txt'),'wb') library = ThermoLibrary(name='Thermo Estimation Library') for species in rmg.initialSpecies: species.getThermoData(rmg.database) library.loadEntry( index = len(library.entries) + 1, label = species.label, molecule = species.molecule[0].toAdjacencyList(), thermo = species.thermo.toThermoData(), shortDesc = species.thermo.comment, ) output.write(writeThermoEntry(species)) output.write('\n') output.close() library.save(os.path.join(rmg.outputDirectory,'ThermoLibrary.py'))
def setUpClass(cls): """ A method that is run before each unit test in this class. """ test_family = 'H_Abstraction' # set-up RMG object rmg = RMG() # load kinetic database and forbidden structures rmg.database = RMGDatabase() path = os.path.join(settings['test_data.directory'], 'testing_database') # kinetics family loading rmg.database.load_kinetics(os.path.join(path, 'kinetics'), kinetics_families=[test_family], reaction_libraries=[]) # load empty forbidden structures to avoid any dependence on forbidden structures # for these tests for family in rmg.database.kinetics.families.values(): family.forbidden = ForbiddenStructures() rmg.database.forbidden_structures = ForbiddenStructures()
def test(self): folder = os.path.join(os.path.dirname(rmgpy.__file__),'tools/data/generate') inputFile = os.path.join(folder,'input.py') rmg = RMG() rmg = execute(rmg, inputFile, folder) self.assertIsNotNone(rmg) self.assertIsNotNone(rmg.reactionModel.outputSpeciesList) self.assertIsNotNone(rmg.reactionModel.outputReactionList) shutil.rmtree(os.path.join(folder,'pdep'))
def test_liquidInputReading(self): """ Check if constant concentration condition is well handled. From input file reading to information storage in liquid reactor object. """ rmg = RMG() ##use the liquid phase example to load every input parameters inp = os.path.join("examples","rmg","liquid_phase_constSPC","input.py") #In order to work on every system, use of os.path rmg.inputFile = inp rmg.initialize() if rmg.solvent is not None: ##call the function to identify indices in the solver for index, reactionSystem in enumerate(rmg.reactionSystems): if reactionSystem.constSPCNames is not None: #if no constant species provided do nothing reactionSystem.get_constSPCIndices(rmg.reactionModel.core.species) for index, reactionSystem in enumerate(rmg.reactionSystems): self.assertIsNotNone(reactionSystem.constSPCNames,"""this input \"{0} \" contain constant SPC, reactor should contain its name and its indices after few steps""") self.assertIsNotNone(reactionSystem.constSPCIndices,"""this input \"{0} \" contain constant SPC, reactor should contain its corresponding indices in the core species array""") self.assertIs(reactionSystem.constSPCNames[0],rmg.reactionModel.core.species[reactionSystem.constSPCIndices[0]].label,"The constant species name from reaction model and constantSPCnames has to be equals")
def runThermoEstimator(inputFile): """ Estimate thermo for a list of species using RMG and the settings chosen inside a thermo input file. """ rmg = RMG() rmg.loadThermoInput(inputFile) rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading rmg.database.loadThermo(os.path.join(path, 'thermo'), rmg.thermoLibraries, depository=False) if rmg.solvent: rmg.database.loadSolvation(os.path.join(path, 'solvation')) Species.solventData = rmg.database.solvation.getSolventData(rmg.solvent) Species.solventName = rmg.solvent for species in rmg.initialSpecies: submit(species) # library = ThermoLibrary(name='Thermo Estimation Library') # for spc in rmg.initialSpecies: # library.loadEntry( # index = len(library.entries) + 1, # label = species.label, # molecule = species.molecule[0].toAdjacencyList(), # thermo = species.getThermoData().toThermoData(), # shortDesc = species.getThermoData().comment, # ) # library.save(os.path.join(rmg.outputDirectory,'ThermoLibrary.py')) # Save the thermo data to chemkin format output files and dictionary, with no reactions saveChemkinFile(os.path.join(rmg.outputDirectory, 'chem_annotated.inp'), species=rmg.initialSpecies, reactions=[]) saveSpeciesDictionary(os.path.join(rmg.outputDirectory, 'species_dictionary.txt'), species=rmg.initialSpecies)
def setUpClass(cls): """ A method that is run before each unit test in this class. """ TESTFAMILY = 'H_Abstraction' # set-up RMG object rmg = RMG() # load kinetic database and forbidden structures rmg.database = RMGDatabase() path=os.path.join(settings['test_data.directory'], 'testing_database') # kinetics family loading rmg.database.loadKinetics(os.path.join(path, 'kinetics'), kineticsFamilies=[TESTFAMILY], reactionLibraries=[] ) #load empty forbidden structures to avoid any dependence on forbidden structures #for these tests for family in rmg.database.kinetics.families.values(): family.forbidden = ForbiddenStructures() rmg.database.forbiddenStructures = ForbiddenStructures()
def setUpClass(cls): """A function that is run ONCE before all unit tests in this class.""" cls.testDir = os.path.join(originalPath, 'rmg', 'test_data', 'mainTest') cls.outputDir = os.path.join(cls.testDir, 'output') cls.databaseDirectory = settings['database.directory'] os.mkdir(os.path.join(cls.testDir, cls.outputDir)) cls.max_iter = 10 cls.rmg = RMG(input_file=os.path.join(cls.testDir, 'superminimal_input.py'), output_directory=cls.outputDir) cls.rmg.execute(max_iterations=cls.max_iter)
def setUpClass(cls): """ A function run ONCE before all unit tests in this class. """ cls.rmg = RMG() rmgpy.rmg.input.rmg = cls.rmg rmgpy.rmg.input.generatedSpeciesConstraints( maximumCarbonAtoms=2, maximumOxygenAtoms=1, maximumNitrogenAtoms=1, maximumSiliconAtoms=1, maximumSulfurAtoms=1, maximumHeavyAtoms=3, maximumRadicalElectrons=2, maximumSingletCarbenes=1, maximumCarbeneRadicals=0, )
def setUp(self): """ A method that is run before each unit test in this class. """ # set-up RMG object self.rmg = RMG() # load kinetic database and forbidden structures self.rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) # forbidden structure loading self.rmg.database.load_forbidden_structures( os.path.join(path, 'forbiddenStructures.py')) # kinetics family loading self.rmg.database.load_kinetics(os.path.join(path, 'kinetics'), kinetics_families=TESTFAMILIES, reaction_libraries=[])
def saveForm(self, posted, form): """ Save form data into input.py file specified by the path. """ # Clean past history self.rmg = RMG() # Databases # self.rmg.databaseDirectory = settings['database.directory'] self.rmg.thermoLibraries = [] if posted.thermo_libraries.all(): self.rmg.thermoLibraries = [item.thermolib.encode() for item in posted.thermo_libraries.all()] self.rmg.reactionLibraries = [] self.rmg.seedMechanisms = [] if posted.reaction_libraries.all(): for item in posted.reaction_libraries.all(): if not item.seedmech and not item.edge: self.rmg.reactionLibraries.append((item.reactionlib.encode(), False)) elif not item.seedmech: self.rmg.reactionLibraries.append((item.reactionlib.encode(), True)) else: self.rmg.seedMechanisms.append(item.reactionlib.encode()) self.rmg.statmechLibraries = [] self.rmg.kineticsDepositories = "default" self.rmg.kineticsFamilies = "default" self.rmg.kineticsEstimator = "rate rules" # Species self.rmg.initialSpecies = [] speciesDict = {} initialMoleFractions = {} self.rmg.reactionModel = CoreEdgeReactionModel() for item in posted.reactor_species.all(): structure = Molecule().fromAdjacencyList(item.adjlist.encode()) spec, isNew = self.rmg.reactionModel.makeNewSpecies( structure, label=item.name.encode(), reactive=False if item.inert else True ) self.rmg.initialSpecies.append(spec) speciesDict[item.name.encode()] = spec initialMoleFractions[spec] = item.molefrac # Reactor systems self.rmg.reactionSystems = [] for item in posted.reactor_systems.all(): T = Quantity(item.temperature, item.temperature_units.encode()) P = Quantity(item.pressure, item.pressure_units.encode()) termination = [] if item.conversion: termination.append(TerminationConversion(speciesDict[item.species.encode()], item.conversion)) termination.append(TerminationTime(Quantity(item.terminationtime, item.time_units.encode()))) # Sensitivity Analysis sensitiveSpecies = [] if item.sensitivity: if isinstance(item.sensitivity.encode(), str): sensitivity = item.sensitivity.encode().split(",").strip() for spec in sensitivity: sensitiveSpecies.append(speciesDict[spec]) system = SimpleReactor(T, P, initialMoleFractions, termination, sensitiveSpecies, item.sensitivityThreshold) self.rmg.reactionSystems.append(system) # Simulator tolerances self.rmg.absoluteTolerance = form.cleaned_data["simulator_atol"] self.rmg.relativeTolerance = form.cleaned_data["simulator_rtol"] self.rmg.sensitivityAbsoluteTolerance = form.cleaned_data["simulator_sens_atol"] self.rmg.sensitivityRelativeTolerance = form.cleaned_data["simulator_sens_rtol"] self.rmg.fluxToleranceKeepInEdge = form.cleaned_data["toleranceKeepInEdge"] self.rmg.fluxToleranceMoveToCore = form.cleaned_data["toleranceMoveToCore"] self.rmg.fluxToleranceInterrupt = form.cleaned_data["toleranceInterruptSimulation"] self.rmg.maximumEdgeSpecies = form.cleaned_data["maximumEdgeSpecies"] # Pressure Dependence pdep = form.cleaned_data["pdep"].encode() if pdep != "off": self.rmg.pressureDependence = PressureDependenceJob(network=None) self.rmg.pressureDependence.method = pdep # Process interpolation model if form.cleaned_data["interpolation"].encode() == "chebyshev": self.rmg.pressureDependence.interpolationModel = ( form.cleaned_data["interpolation"].encode(), form.cleaned_data["temp_basis"], form.cleaned_data["p_basis"], ) else: self.rmg.pressureDependence.interpolationModel = (form.cleaned_data["interpolation"].encode(),) # Temperature and pressure range self.rmg.pressureDependence.Tmin = Quantity( form.cleaned_data["temp_low"], form.cleaned_data["temprange_units"].encode() ) self.rmg.pressureDependence.Tmax = Quantity( form.cleaned_data["temp_high"], form.cleaned_data["temprange_units"].encode() ) self.rmg.pressureDependence.Tcount = form.cleaned_data["temp_interp"] self.rmg.pressureDependence.generateTemperatureList() self.rmg.pressureDependence.Pmin = Quantity( form.cleaned_data["p_low"], form.cleaned_data["prange_units"].encode() ) self.rmg.pressureDependence.Pmax = Quantity( form.cleaned_data["p_high"], form.cleaned_data["prange_units"].encode() ) self.rmg.pressureDependence.Pcount = form.cleaned_data["p_interp"] self.rmg.pressureDependence.generatePressureList() # Process grain size and count self.rmg.pressureDependence.grainSize = Quantity( form.cleaned_data["maximumGrainSize"], form.cleaned_data["grainsize_units"].encode() ) self.rmg.pressureDependence.grainCount = form.cleaned_data["minimumNumberOfGrains"] self.rmg.pressureDependence.maximumAtoms = form.cleaned_data["maximumAtoms"] # Additional Options self.rmg.units = "si" self.rmg.saveRestartPeriod = ( Quantity(form.cleaned_data["saveRestartPeriod"], form.cleaned_data["saveRestartPeriodUnits"].encode()) if form.cleaned_data["saveRestartPeriod"] else None ) self.rmg.generateOutputHTML = form.cleaned_data["generateOutputHTML"] self.rmg.generatePlots = form.cleaned_data["generatePlots"] self.rmg.saveSimulationProfiles = form.cleaned_data["saveSimulationProfiles"] self.rmg.saveEdgeSpecies = form.cleaned_data["saveEdgeSpecies"] self.rmg.verboseComments = form.cleaned_data["verboseComments"] # Species Constraints speciesConstraints = form.cleaned_data["speciesConstraints"] if speciesConstraints == "on": allowed = [] if form.cleaned_data["allowed_inputSpecies"]: allowed.append("input species") if form.cleaned_data["allowed_seedMechanisms"]: allowed.append("seed mechanisms") if form.cleaned_data["allowed_reactionLibraries"]: allowed.append("reaction libraries") self.rmg.speciesConstraints["allowed"] = allowed self.rmg.speciesConstraints["maximumCarbonAtoms"] = form.cleaned_data["maximumCarbonAtoms"] self.rmg.speciesConstraints["maximumHydrogenAtoms"] = form.cleaned_data["maximumHydrogenAtoms"] self.rmg.speciesConstraints["maximumOxygenAtoms"] = form.cleaned_data["maximumOxygenAtoms"] self.rmg.speciesConstraints["maximumNitrogenAtoms"] = form.cleaned_data["maximumNitrogenAtoms"] self.rmg.speciesConstraints["maximumSiliconAtoms"] = form.cleaned_data["maximumSiliconAtoms"] self.rmg.speciesConstraints["maximumSulfurAtoms"] = form.cleaned_data["maximumSulfurAtoms"] self.rmg.speciesConstraints["maximumHeavyAtoms"] = form.cleaned_data["maximumHeavyAtoms"] self.rmg.speciesConstraints["maximumRadicalElectrons"] = form.cleaned_data["maximumRadicalElectrons"] self.rmg.speciesConstraints["allowSingletO2"] = form.cleaned_data["allowSingletO2"] # Quantum Calculations quantumCalc = form.cleaned_data["quantumCalc"] if quantumCalc == "on": from rmgpy.qm.main import QMCalculator self.rmg.quantumMechanics = QMCalculator( software=form.cleaned_data["software"].encode(), method=form.cleaned_data["method"].encode(), fileStore=form.cleaned_data["fileStore"].encode(), scratchDirectory=form.cleaned_data["scratchDirectory"].encode(), onlyCyclics=form.cleaned_data["onlyCyclics"], maxRadicalNumber=form.cleaned_data["maxRadicalNumber"], ) # Save the input.py file self.rmg.saveInput(self.savepath)
'restart': args.restart, 'walltime': args.walltime, } if args.profile: import cProfile, sys, pstats, os global_vars = {} local_vars = { 'inputFile': inputFile, 'output_dir': output_dir, 'kwargs': kwargs, 'RMG': RMG } command = """rmg = RMG(inputFile=inputFile, outputDirectory=output_dir); rmg.execute(**kwargs)""" stats_file = os.path.join(args.output_directory,'RMG.profile') print("Running under cProfile") if not args.postprocess: # actually run the program! cProfile.runctx(command, global_vars, local_vars, stats_file) # postprocess the stats log_file = os.path.join(args.output_directory,'RMG.log') processProfileStats(stats_file, log_file) makeProfileGraph(stats_file) else: rmg = RMG(inputFile=inputFile, outputDirectory=output_dir) rmg.execute(**kwargs)
def saveForm(self, posted, form): """ Save form data into input.py file specified by the path. """ # Clean past history self.rmg = RMG() # Databases #self.rmg.databaseDirectory = settings['database.directory'] self.rmg.thermoLibraries = [] if posted.thermo_libraries.all(): self.rmg.thermoLibraries = [item.thermolib.encode() for item in posted.thermo_libraries.all()] self.rmg.reactionLibraries = [] self.rmg.seedMechanisms = [] if posted.reaction_libraries.all(): for item in posted.reaction_libraries.all(): if not item.seedmech and not item.edge: self.rmg.reactionLibraries.append((item.reactionlib.encode(), False)) elif not item.seedmech: self.rmg.reactionLibraries.append((item.reactionlib.encode(), True)) else: self.rmg.seedMechanisms.append(item.reactionlib.encode()) self.rmg.statmechLibraries = [] self.rmg.kineticsDepositories = ['training'] self.rmg.kineticsFamilies = ['!Intra_Disproportionation'] self.rmg.kineticsEstimator = 'rate rules' # Species self.rmg.initialSpecies = [] speciesDict = {} initialMoleFractions = {} self.rmg.reactionModel = CoreEdgeReactionModel() for item in posted.reactor_species.all(): structure = Molecule().fromAdjacencyList(item.adjlist.encode()) spec, isNew = self.rmg.reactionModel.makeNewSpecies(structure, label = item.name.encode(), reactive = False if item.inert else True) self.rmg.initialSpecies.append(spec) speciesDict[item.name.encode()] = spec initialMoleFractions[spec] = item.molefrac # Reactor systems self.rmg.reactionSystems = [] for item in posted.reactor_systems.all(): T = Quantity(item.temperature, item.temperature_units.encode()) P = Quantity(item.pressure, item.pressure_units.encode()) termination = [] if item.conversion: termination.append(TerminationConversion(speciesDict[item.species.encode()], item.conversion)) termination.append(TerminationTime(Quantity(item.terminationtime, item.time_units.encode()))) system = SimpleReactor(T, P, initialMoleFractions, termination) self.rmg.reactionSystems.append(system) # Simulator tolerances self.rmg.absoluteTolerance = form.cleaned_data['simulator_atol'] self.rmg.relativeTolerance = form.cleaned_data['simulator_rtol'] self.rmg.fluxToleranceKeepInEdge = form.cleaned_data['toleranceKeepInEdge'] self.rmg.fluxToleranceMoveToCore = form.cleaned_data['toleranceMoveToCore'] self.rmg.fluxToleranceInterrupt = form.cleaned_data['toleranceInterruptSimulation'] self.rmg.maximumEdgeSpecies = form.cleaned_data['maximumEdgeSpecies'] # Pressure Dependence pdep = form.cleaned_data['pdep'].encode() if pdep != 'off': self.rmg.pressureDependence = PressureDependenceJob(network=None) self.rmg.pressureDependence.method = pdep # Temperature and pressure range self.rmg.pressureDependence.interpolationModel = (form.cleaned_data['interpolation'].encode(), form.cleaned_data['temp_basis'], form.cleaned_data['p_basis']) self.rmg.pressureDependence.Tmin = Quantity(form.cleaned_data['temp_low'], form.cleaned_data['temprange_units'].encode()) self.rmg.pressureDependence.Tmax = Quantity(form.cleaned_data['temp_high'], form.cleaned_data['temprange_units'].encode()) self.rmg.pressureDependence.Tcount = form.cleaned_data['temp_interp'] self.rmg.pressureDependence.generateTemperatureList() self.rmg.pressureDependence.Tlist = Quantity(Tlist,"K") self.rmg.pressureDependence.Pmin = Quantity(form.cleaned_data['p_low'], form.cleaned_data['prange_units'].encode()) self.rmg.pressureDependence.Pmax = Quantity(form.cleaned_data['p_high'], form.cleaned_data['prange_units'].encode()) self.rmg.pressureDependence.Pcount = form.cleaned_data['p_interp'] self.rmg.pressureDependence.generatePressureList() self.rmg.pressureDependence.Plist = Quantity(Plist,"Pa") # Process grain size and count self.rmg.pressureDependence.grainSize = Quantity(form.cleaned_data['maximumGrainSize'], form.cleaned_data['grainsize_units'].encode()) self.rmg.pressureDependence.grainCount = form.cleaned_data['minimumNumberOfGrains'] # Process interpolation model self.rmg.pressureDependence.model = interpolation # Additional Options self.rmg.units = 'si' self.rmg.saveRestartPeriod = Quantity(form.cleaned_data['saveRestartPeriod'], form.cleaned_data['saveRestartPeriodUnits'].encode()) if form.cleaned_data['saveRestartPeriod'] else None self.rmg.drawMolecules = form.cleaned_data['drawMolecules'] self.rmg.generatePlots = form.cleaned_data['generatePlots'] self.rmg.saveSimulationProfiles = form.cleaned_data['saveSimulationProfiles'] # Save the input.py file self.rmg.saveInput(self.savepath)
def __init__(self, *args, **kwargs): super(Input, self).__init__(*args, **kwargs) self.rmg = RMG() self.path = self.getDirname() self.loadpath = self.path + '/input_upload.py' self.savepath = self.path + '/input.py'
import os from rmgpy.molecule.molecule import Molecule from rmgpy.rmg.model import Species from rmgpy.rmg.model import CoreEdgeReactionModel from rmgpy.rmg.main import RMG from rmgpy import settings from rmgpy.data.rmg import RMGDatabase rmg = RMG() rmg.database = RMGDatabase() path = os.path.join(settings['database.directory']) rmg.database.loadThermo(os.path.join(path,'thermo')) mol = Molecule().fromSMILES('C1=CC=CC=C1') tdt = rmg.database.thermo.estimateThermoViaGroupAdditivity(mol) print tdt.comment print mol.isAromatic() spc = Species().fromSMILES('C1=CC=CC=C1') tdt = rmg.database.thermo.getThermoDataFromGroups(spc) print tdt.comment print '\n' rmg.reactionModel = CoreEdgeReactionModel() spc, isNew = rmg.reactionModel.makeNewSpecies(mol) rmg.reactionModel.addSpeciesToEdge(spc) rmg.initialSpecies = [] rmg.initialSpecies.append(spc) for species in rmg.initialSpecies: #species.generateThermoData(rmg.database, quantumMechanics=rmg.reactionModel.quantumMechanics) #print species.thermo.comment tdt = rmg.database.thermo.getThermoDataFromGroups(spc)
class Input(models.Model): """ Model for RMG Input Conditions """ def __init__(self, *args, **kwargs): super(Input, self).__init__(*args, **kwargs) self.rmg = RMG() self.path = self.getDirname() self.loadpath = self.path + '/input_upload.py' self.savepath = self.path + '/input.py' def upload_input_to(instance, filename): return instance.path + '/input_upload.py' input_upload = models.FileField(upload_to=upload_input_to, verbose_name='Input File', blank = True) # Pressure Dependence p_methods=(('off','off',),('modified strong collision','Modified Strong Collision',),('reservoir state','Reservoir State',)) pdep = models.CharField(max_length = 50, default = 'off', choices = p_methods) # Advanced Options for PDep # Grain Size maximumGrainSize = models.FloatField(blank = True, default = 2, null = True) grain_units = (('kcal/mol','kcal/mol',),('kJ/mol','kJ/mol',)) grainsize_units = models.CharField(max_length = 50, default = 'kcal/mol', choices = grain_units) minimumNumberOfGrains = models.PositiveIntegerField(blank = True, default = 200, null = True) # P and T Range p_low = models.FloatField(blank = True, null = True) p_high = models.FloatField(blank = True, null = True) prange_units = models.CharField(max_length = 50, default = 'bar', choices=p_units) p_interp = models.PositiveIntegerField(blank = True, null = True, default = 5) temp_low = models.FloatField(blank = True, null = True) temp_high = models.FloatField(blank = True, null = True) temprange_units = models.CharField(max_length = 50, default = 'K', choices = temp_units) temp_interp = models.PositiveIntegerField(blank = True, null=True, default = 8) # Interpolation interpolation_choices = (('chebyshev','Chebyshev',),('pdeparrhenius','Pressure Dependent Arrhenius',)) interpolation = models.CharField(max_length = 50, default = 'chebyshev', choices = interpolation_choices) temp_basis = models.PositiveIntegerField(blank = True, default = 6, null = True) p_basis = models.PositiveIntegerField(blank = True, default = 4, null = True) # Tolerance toleranceMoveToCore = models.FloatField(blank=True, null=True) toleranceKeepInEdge= models.FloatField(default = 0.0) # Tolerance Advanced Options toleranceInterruptSimulation = models.FloatField(default = 1.0) maximumEdgeSpecies = models.PositiveIntegerField(default = 100000) simulator_atol = models.FloatField(default = 1e-16) simulator_rtol = models.FloatField(default = 1e-8) # Additional Options saveRestartPeriod=models.FloatField(blank = True, null=True) restartunits = (('second','seconds'),('hour','hours'),('day','days'),('week','weeks')) saveRestartPeriodUnits = models.CharField(max_length = 50, default = 'hour', choices = restartunits) drawMolecules=models.BooleanField() generatePlots=models.BooleanField() saveSimulationProfiles = models.BooleanField() def getDirname(self): """ Return the absolute path of the directory that the object uses to store files. """ return os.path.join(settings.MEDIA_ROOT, 'rmg','tools','input/') def createDir(self): """ Create the directory (and any other needed parent directories) that the Network uses for storing files. """ try: os.makedirs(self.getDirname()) except OSError: # Fail silently on any OS errors pass def deleteDir(self): """ Clean up everything by deleting the directory """ import shutil try: shutil.rmtree(self.getDirname()) except OSError: pass def loadForm(self, path): """ Load input.py file onto form initial data. """ readInputFile(path, self.rmg) # Databases initial_thermo_libraries = [] if self.rmg.thermoLibraries: for item in self.rmg.thermoLibraries: initial_thermo_libraries.append({'thermolib': item}) initial_reaction_libraries = [] if self.rmg.seedMechanisms: for item in self.rmg.seedMechanism: initial_reaction_libraries.append({'reactionlib': item, 'seedmech': True, 'edge': False}) if self.rmg.reactionLibraries: for item, edge in self.rmg.reactionLibraries: initial_reaction_libraries.append({'reactionlib': item, 'seedmech': False, 'edge': edge}) # Reactor systems initial_reactor_systems = [] for system in self.rmg.reactionSystems: temperature = system.T.getValue() temperature_units = system.T.units pressure = system.P.getValue() pressure_units = system.P.units initialMoleFractions = system.initialMoleFractions for item in system.termination: if isinstance(item, TerminationTime): terminationtime = item.time.getValue() time_units = item.time.units else: species = item.species.label conversion = item.conversion initial_reactor_systems.append({'temperature': temperature, 'temperature_units': temperature_units, 'pressure': pressure, 'pressure_units': pressure_units, 'terminationtime': terminationtime, 'time_units': time_units, 'species': species, 'conversion': conversion}) # Species initial_species = [] for item in self.rmg.initialSpecies: name = item.label adjlist = item.molecule[0].toAdjacencyList() inert = False if item.reactive else True spec, isNew = self.rmg.reactionModel.makeNewSpecies(item.molecule[0], label = item.label, reactive = item.reactive) molefrac = initialMoleFractions[spec] initial_species.append({'name': name, 'adjlist': adjlist, 'inert': inert, 'molefrac': molefrac}) # Tolerances initial = {} initial['simulator_atol'] = self.rmg.absoluteTolerance initial['simulator_rtol'] = self.rmg.relativeTolerance initial['toleranceKeepInEdge'] = self.rmg.fluxToleranceKeepInEdge initial['toleranceMoveToCore']= self.rmg.fluxToleranceMoveToCore initial['toleranceInterruptSimulation'] = self.rmg.fluxToleranceInterrupt initial['maximumEdgeSpecies'] = self.rmg.maximumEdgeSpecies # Pressure Dependence if self.rmg.pressureDependence: initial['interpolation'] = self.rmg.pressureDependence.model[0] initial['temp_basis'] = self.rmg.pressureDependence.model[1] initial['p_basis'] = self.rmg.pressureDependence.model[2] initial['temp_low'] = self.rmg.pressureDependence.Tmin.getValue() initial['temp_high'] = self.rmg.pressureDependence.Tmax.getValue() initial['temprange_units'] = self.rmg.pressureDependence.Tmax.units initial['temp_interp'] = self.rmg.pressureDependence.Tcount initial['p_low'] = self.rmg.pressureDependence.Pmin.getValue() initial['p_high'] = self.rmg.pressureDependence.Pmax.getValue() initial['prange_units'] = self.rmg.pressureDependence.Pmax.units initial['p_interp'] = self.rmg.pressureDepence.Pcount initial['maximumGrainSize'] = self.rmg.pressureDependence.grainSize.getValue() initial['grainsize_units'] = self.rmg.pressureDependence.grainSize.units initial['minimumNumberOfGrains'] = self.rmg.pressureDependence.grainCount else: initial['pdep'] = 'off' # Additional Options if self.rmg.saveRestartPeriod: initial['saveRestartPeriod'] = self.rmg.saveRestartPeriod.getValue() initial['saveRestartPeriodUnits'] = self.rmg.saveRestartPeriod.units if self.rmg.drawMolecules: initial['drawMolecules'] = True if self.rmg.generatePlots: initial['generatePlots'] = True if self.rmg.saveSimulationProfiles: initial['saveSimulationProfiles'] = True return initial_thermo_libraries, initial_reaction_libraries, initial_reactor_systems, initial_species, initial def saveForm(self, posted, form): """ Save form data into input.py file specified by the path. """ # Clean past history self.rmg = RMG() # Databases #self.rmg.databaseDirectory = settings['database.directory'] self.rmg.thermoLibraries = [] if posted.thermo_libraries.all(): self.rmg.thermoLibraries = [item.thermolib.encode() for item in posted.thermo_libraries.all()] self.rmg.reactionLibraries = [] self.rmg.seedMechanisms = [] if posted.reaction_libraries.all(): for item in posted.reaction_libraries.all(): if not item.seedmech and not item.edge: self.rmg.reactionLibraries.append((item.reactionlib.encode(), False)) elif not item.seedmech: self.rmg.reactionLibraries.append((item.reactionlib.encode(), True)) else: self.rmg.seedMechanisms.append(item.reactionlib.encode()) self.rmg.statmechLibraries = [] self.rmg.kineticsDepositories = ['training'] self.rmg.kineticsFamilies = ['!Intra_Disproportionation'] self.rmg.kineticsEstimator = 'rate rules' # Species self.rmg.initialSpecies = [] speciesDict = {} initialMoleFractions = {} self.rmg.reactionModel = CoreEdgeReactionModel() for item in posted.reactor_species.all(): structure = Molecule().fromAdjacencyList(item.adjlist.encode()) spec, isNew = self.rmg.reactionModel.makeNewSpecies(structure, label = item.name.encode(), reactive = False if item.inert else True) self.rmg.initialSpecies.append(spec) speciesDict[item.name.encode()] = spec initialMoleFractions[spec] = item.molefrac # Reactor systems self.rmg.reactionSystems = [] for item in posted.reactor_systems.all(): T = Quantity(item.temperature, item.temperature_units.encode()) P = Quantity(item.pressure, item.pressure_units.encode()) termination = [] if item.conversion: termination.append(TerminationConversion(speciesDict[item.species.encode()], item.conversion)) termination.append(TerminationTime(Quantity(item.terminationtime, item.time_units.encode()))) system = SimpleReactor(T, P, initialMoleFractions, termination) self.rmg.reactionSystems.append(system) # Simulator tolerances self.rmg.absoluteTolerance = form.cleaned_data['simulator_atol'] self.rmg.relativeTolerance = form.cleaned_data['simulator_rtol'] self.rmg.fluxToleranceKeepInEdge = form.cleaned_data['toleranceKeepInEdge'] self.rmg.fluxToleranceMoveToCore = form.cleaned_data['toleranceMoveToCore'] self.rmg.fluxToleranceInterrupt = form.cleaned_data['toleranceInterruptSimulation'] self.rmg.maximumEdgeSpecies = form.cleaned_data['maximumEdgeSpecies'] # Pressure Dependence pdep = form.cleaned_data['pdep'].encode() if pdep != 'off': self.rmg.pressureDependence = PressureDependenceJob(network=None) self.rmg.pressureDependence.method = pdep # Temperature and pressure range self.rmg.pressureDependence.interpolationModel = (form.cleaned_data['interpolation'].encode(), form.cleaned_data['temp_basis'], form.cleaned_data['p_basis']) self.rmg.pressureDependence.Tmin = Quantity(form.cleaned_data['temp_low'], form.cleaned_data['temprange_units'].encode()) self.rmg.pressureDependence.Tmax = Quantity(form.cleaned_data['temp_high'], form.cleaned_data['temprange_units'].encode()) self.rmg.pressureDependence.Tcount = form.cleaned_data['temp_interp'] self.rmg.pressureDependence.generateTemperatureList() self.rmg.pressureDependence.Tlist = Quantity(Tlist,"K") self.rmg.pressureDependence.Pmin = Quantity(form.cleaned_data['p_low'], form.cleaned_data['prange_units'].encode()) self.rmg.pressureDependence.Pmax = Quantity(form.cleaned_data['p_high'], form.cleaned_data['prange_units'].encode()) self.rmg.pressureDependence.Pcount = form.cleaned_data['p_interp'] self.rmg.pressureDependence.generatePressureList() self.rmg.pressureDependence.Plist = Quantity(Plist,"Pa") # Process grain size and count self.rmg.pressureDependence.grainSize = Quantity(form.cleaned_data['maximumGrainSize'], form.cleaned_data['grainsize_units'].encode()) self.rmg.pressureDependence.grainCount = form.cleaned_data['minimumNumberOfGrains'] # Process interpolation model self.rmg.pressureDependence.model = interpolation # Additional Options self.rmg.units = 'si' self.rmg.saveRestartPeriod = Quantity(form.cleaned_data['saveRestartPeriod'], form.cleaned_data['saveRestartPeriodUnits'].encode()) if form.cleaned_data['saveRestartPeriod'] else None self.rmg.drawMolecules = form.cleaned_data['drawMolecules'] self.rmg.generatePlots = form.cleaned_data['generatePlots'] self.rmg.saveSimulationProfiles = form.cleaned_data['saveSimulationProfiles'] # Save the input.py file self.rmg.saveInput(self.savepath)
def loadRMGJavaJob(inputFile, chemkinFile=None, speciesDict=None): """ Load the results of an RMG-Java job generated from the given `inputFile`. """ from rmgpy.molecule import Molecule # Load the specified RMG-Java input file # This implementation only gets the information needed to generate flux diagrams rmg = RMG() rmg.loadRMGJavaInput(inputFile) rmg.outputDirectory = os.path.abspath(os.path.dirname(inputFile)) # Load the final Chemkin model generated by RMG-Java if not chemkinFile: chemkinFile = os.path.join(os.path.dirname(inputFile), 'chemkin', 'chem.inp') if not speciesDict: speciesDict = os.path.join(os.path.dirname(inputFile), 'RMG_Dictionary.txt') speciesList, reactionList = loadChemkinFile(chemkinFile, speciesDict) # Bath gas species don't appear in RMG-Java species dictionary, so handle # those as a special case for species in speciesList: if species.label == 'Ar': species.molecule = [Molecule().fromSMILES('[Ar]')] elif species.label == 'Ne': species.molecule = [Molecule().fromSMILES('[Ne]')] elif species.label == 'He': species.molecule = [Molecule().fromSMILES('[He]')] elif species.label == 'N2': species.molecule = [Molecule().fromSMILES('N#N')] # Map species in input file to corresponding species in Chemkin file speciesDict = {} for spec0 in rmg.initialSpecies: for species in speciesList: if species.isIsomorphic(spec0): speciesDict[spec0] = species break # Generate flux pairs for each reaction if needed for reaction in reactionList: if not reaction.pairs: reaction.generatePairs() # Replace species in input file with those in Chemkin file for reactionSystem in rmg.reactionSystems: reactionSystem.initialMoleFractions = dict([(speciesDict[spec], frac) for spec, frac in reactionSystem.initialMoleFractions.iteritems()]) for t in reactionSystem.termination: if isinstance(t, TerminationConversion): if t.species not in speciesDict.values(): t.species = speciesDict[t.species] # Set reaction model to match model loaded from Chemkin file rmg.reactionModel.core.species = speciesList rmg.reactionModel.core.reactions = reactionList # RMG-Java doesn't generate species images, so draw them ourselves now speciesPath = os.path.join(os.path.dirname(inputFile), 'species') try: os.mkdir(speciesPath) except OSError: pass for species in speciesList: path = os.path.join(speciesPath + '/{0!s}.png'.format(species)) species.molecule[0].draw(str(path)) return rmg
def generate_isotope_model(outputDirectory, rmg0, isotopes, useOriginalReactions = False, kineticIsotopeEffect = None): """ Replace the core species of the rmg model with the parameter list of species. Generate all reactions between new list of core species. Returns created RMG object. """ logging.debug("isotope: called generateIsotopeModel") rmg = RMG(inputFile=rmg0.inputFile, outputDirectory=outputDirectory) rmg.attach(ChemkinWriter(outputDirectory)) logging.info("isotope: making the isotope model for with all species") initialize_isotope_model(rmg, isotopes) if useOriginalReactions: logging.info("isotope: finding reactions from the original reactions") rxns = generate_isotope_reactions(rmg0.reactionModel.core.reactions, isotopes) rmg.reactionModel.processNewReactions(rxns,newSpecies=[]) else: logging.info("isotope: enlarging the isotope model") rmg.reactionModel.enlarge(reactEdge=True, unimolecularReact=rmg.unimolecularReact, bimolecularReact=rmg.bimolecularReact) logging.info("isotope: clustering reactions") clusters = cluster(rmg.reactionModel.core.reactions) logging.info('isotope: fixing the directions of every reaction to a standard') for isotopomerRxnList in clusters: ensure_reaction_direction(isotopomerRxnList) consistent = True logging.info("isotope: checking symmetry is consistent among isotopomers") for species_list in cluster(rmg.reactionModel.core.species): if not ensure_correct_symmetry(species_list): logging.info("isotopomers of {} with index {} may have wrong symmetry".format(species_list[0], species_list[0].index)) consistent = False logging.info("isotope: checking that reaction degeneracy is consistent among isotopomers") for rxn_list in clusters: if not ensure_correct_degeneracies(rxn_list): logging.info("isotopomers of {} with index {} may have incorrect degeneracy.".format(rxn_list[0], rxn_list[0].index)) consistent = False if not consistent: logging.warning("isotope: non-consistent degeneracy and/or symmetry was detected. This may lead to unrealistic deviations in enrichment. check log for more details") if kineticIsotopeEffect: logging.info('isotope: modifying reaction rates using kinetic isotope effect method "{0}"'.format(kineticIsotopeEffect)) if kineticIsotopeEffect == 'simple': apply_kinetic_isotope_effect_simple(clusters,rmg.database.kinetics) else: logging.warning('isotope: kinetic isotope effect {0} is not supported. skipping adding kinetic isotope effects.') else: logging.info('isotope: not adding kinetic isotope effects since no method was supplied.') logging.info("isotope: saving files") rmg.saveEverything() rmg.finish() return rmg