class Hwindow(): """Creates host/join menu.""" def __init__(self): self.h = Gui() # make h window self.h.title('Othello!') self.h.la(text='Game Name (no spaces)') self.entryField = self.h.en() self.h.gr(cols=2) hostButton = self.h.bu(text='Host Game', command=self.host) joinButton = self.h.bu(text='Join Game',command=self.join) self.h.mainloop() def host(self): """Creates a game w/ 2 players and 2 computers.""" name = self.entryField.get() data = { 'gameName': name } req = urllib2.Request('http://othello.herokuapp.com/createGame') req.add_header('Content-Type', 'application/json') response = urllib2.urlopen(req, json.dumps(data)) self.h.destroy() # close h window os.system('python board_piece_final_tweaked1.py ' + name + ' black') def join(self): """Joins an existing game w/ 2 players and 2 computers.""" name = self.entryField.get() self.h.destroy() # close h window os.system('python board_piece_final_tweaked1.py ' + name + ' white')
def make_gui(): global g g = Gui() g.title('Chapter 19 Section 2 Excercise 1')
def make_gui(): global g g = Gui() g.title('Chapter 19 Section 5 Excercise 3') global canvas canvas = g.ca(width=500, height=500) canvas.config(bg='black')
def final_res(ipusn): view=Gui() view.title('view results') fin=open('RES.txt') usn_gpa={} #an dictionary with usn as key and gpa as items name_usn={} gpa_usn={} #an dictionary with gpa as key and usn as items linesplit=[] #an empty list gpaacc=[] #a list to store all the gpas usnacc=[] #a list to store all the usn usn_name={} #a dictionary to map usn to names for line in fin: linesplit=line.split(' ') #reads the line and splits it into list of strings gpa=gpa_calc(linesplit) #sends the whole list to the function usn_gpa[linesplit[1]]=gpa #stores the gpa in a dictionary database usnacc.append(linesplit[1]) #stores the usn into a usn accumilator dell=' ' usn_name[linesplit[1]]=dell.join(linesplit[2:-18]) #extracts the name from the line if gpa in gpa_usn: #store all the usns with same GPAs under the GPA key gpa_usn[gpa].append(linesplit[1]) else: gpa_usn[gpa]=[linesplit[1]] if gpa not in gpaacc: #store gpa into gpaacc if it is not in the list gpaacc.append(gpa) gpaacc.sort(reverse=True) #sort the gpa acc for finding the rank if ipusn not in usnacc: view.la(text='Invalid USN\n Make sure you have entered the USN correctly') gpa2=usn_gpa[ipusn] #get the gpa of the student whose usn is taken as input for i in range(len(gpaacc)): #find the rank if gpaacc[i]==gpa2: rank=i+1 view.row() view.col() view.la(text='Hello %s' %usn_name[ipusn]) view.la(text='Your SGPA is %s' %gpa2) view.la(text='Your SGPA position is %i: ' %rank) view.endcol() gpa_usn[gpa2].remove(ipusn) view.col(padx=50) view.la(text='Your SGPA is tied with %s students' %len(gpa_usn[gpa2])) view.col(pady=50) view.col(padx=5) for u in gpa_usn[gpa2]: var='%s (%s)' %(usn_name[u], u) view.la(text=var) view.col(pady=5)
class Gwindow(): """Creates local/internet menu.""" def __init__(self): self.g = Gui() # make g window self.g.title('Othello!') self.g.gr(cols=2) localButton = self.g.bu(text='Local Game', command=self.local) internetButton = self.g.bu(text='Internet Game', command=self.internet) self.g.mainloop() def local(self): """Creates a game w/ 2 players on 1 computer.""" self.g.destroy() # close g window os.system('python board_piece_final_tweaked.py') # start local game def internet(self): """Leads to next menu.""" self.g.destroy() # close g window Hwindow()
'''import urllib conn = urllib.urlopen('http://thinkpython.com/secret.html') for line in conn: print line.strip()''' from swampy.Gui import * g = Gui() g.title('Web Browser') canvas = g.ca(width = 400, height = 400) b1 = g.bu(text = "Click to browse", command = make_change)
from swampy.Gui import * g = Gui() g.title = "Gui" def make_circle(): canvas.circle([0, 0], 55, fill="orange", outline="white", width=3) canvas = g.ca(500, 500, bg="black") g.bu(text="make me a circle", command=make_circle) g.mainloop()
view.col(pady=5) def res(): u=entry.get() #get the entry from the txt field(input USN) final_res(u.upper()) #pass the usn into the function win = Gui() #initialise a win object win.title('GPA Analysis') win.row() logo1=PIL.open('logo.png') logo=ImageTk.PhotoImage(logo1) win.la(image=logo) win.row([0,0], padx=50) win.la(text='Analysing 4th sem, ECE results \n of the year 2014') win.col() win.bu(text='About the app', command=ab_app) win.bu(text='About the Developer', command=ab_dev) win.la(text='Kindly mail your feedback to \n [email protected]') win.endcol() win.col([0,3],pady=70,padx=50) win.la(text='Enter your USN') entry=win.en(text='1BM12EC129') win.bu(text='View result analysis', command=res) #function res is invoked when the bu is clicked
"""This module contains code from Think Python by Allen B. Downey http://thinkpython.com Copyright 2012 Allen B. Downey License: GNU GPLv3 http://www.gnu.org/licenses/gpl.html """ from swampy.Gui import * g = Gui() g.title("circle demo") canvas = g.ca(width=500, height=500, bg="white") circle = None def callback1(): """called when the user presses 'Create circle' """ global circle circle = canvas.circle([0, 0], 100) def callback2(): """called when the user presses 'Change color' """ # if the circle hasn't been created yet, do nothing if circle == None: return # get the text from the entry and try to change the circle's color
from swampy.Gui import * g = Gui() g.title("Gui") text = g.te(width=100, height=5) canvas = g.ca(width=300, height=300) canvas.config(bg='grey') circle = None def change_color(): global circle color = entry.get() print color if circle == None: return circle.config(fill=color) def draw_circle(): global circle circle = canvas.circle([0, 0], 100, fill='red') g.bu(text='create circle', command=draw_circle) entry = g.en() g.bu(text='change color', command=change_color) g.mainloop()
self.move(dx, dy) def drop(self, event): self.config(fill=self.fill) def make_circle(event): pos = ca.canvas_coords([event.x, event.y]) item = ca.circle(pos, 5, fill='white') Draggable(item) def make_text(event=None): text = en.get() item = ca.text([0, 0], text) Draggable(item) g = Gui() g.title('Draggable Demo') ca = g.ca(width=500, height=500, bg='black') ca.bind('<ButtonPress-3>', make_circle) g.row([1, 0]) en = g.en() bu = g.bu('Make text item:', make_text) en.bind('<Return>', make_text) g.mainloop()
"""This module contains code from Think Python by Allen B. Downey http://thinkpython.com Copyright 2012 Allen B. Downey License: GNU GPLv3 http://www.gnu.org/licenses/gpl.html """ from swampy.Gui import * g = Gui() g.title('circle demo') canvas = g.ca(width=500, height=500, bg='white') circle = None def callback1(): """called when the user presses 'Create circle' """ global circle circle = canvas.circle([0, 0], 100) def callback2(): """called when the user presses 'Change color' """ # if the circle hasn't been created yet, do nothing if circle is None: return # get the text from the entry and try to change the circle's color
import os from swampy.Gui import * import Tkinter import Image as PIL import ImageTk g = Gui() g.title("Image Viewer") canvas = g.ca(width=500, height=500, bg="white") def walk(dirname): for name in os.listdir(dirname): path = os.path.join(dirname, name) if os.path.isfile(path): try: show_image(name) print name g.mainloop() except: pass else: walk(path) def show_image(fp): image = PIL.open(fp) tkpi = ImageTk.PhotoImage(image) canvas(image=tkpi)
from swampy.Gui import * g = Gui() g.title('19-2.py') def make_create(): item = canvas.circle([0,0], 100, fill = 'green') def make_change(): i = item.config(fill = 'red', outline = 'orange', width = 10) canvas = g.ca(width = 500, height = 600) b1 = g.bu(text = 'Press Button', command = make_create) b2 = g.bu(text = 'Press To change', comman = make_change) g.mainloop()
allows us to double click on a link and show it, as well as remove it from the list of need to view links """ for thing in point_total.find(): existing = thing['points'] point_total.update({'points': existing}, {'$set': {'points':existing+1}}) points.config(text = str(existing + 1)) index = event.widget.find_closest(event.x, event.y) i = shared_viewer.find() access = i[index[0] - 1] link = access['link'] url_display(link) shared_viewer.remove(access) shared_source.remove(access) #General set-up g.title('Minumum Deliverable URLSender') g.row() g.col() g.la(text = 'Welcome to musicswAPPer') g.bu(text = 'Update Data', command = MediaShare.update()) g.row([0,1], pady = 10) g.endrow() g.la(text = 'Share a link!') friend = g.en(text = 'Who do you want to share with?') en = g.en(text = 'Insert URL here') g.bu(text = 'Share', command = MediaShare.print_entry()) label = g.la()
from swampy.Gui import * g = Gui() g.title('19-3.py') canvas = g.ca(width=500, height=600, bg='white') circle = None def make_circle(): circle = canvas.circle([0, 0], 100) def make_change(): if circle == None: return color = entry.get() try: circle.config(fill=color) except TclError, message: print message b1 = g.bu(text='Create Circle', command=make_circle) entry = g.en() b2 = g.bu(text='Press to Config', command=make_change) g.mainloop()
from swampy.Gui import * g = Gui() g.title('Event') def make_circle(event): pos = canvas.canvas_coords([event.x, event.y]) item = canvas.circle(pos, 5, fill='red') canvas = g.ca(width=400, height=400, bg='white') canvas.bind('<ButtonPress-1>', make_circle) g.mainloop()
from swampy.Gui import * g = Gui() g.title('Event') def make_circle(event): pos = canvas.canvas_coords([event.x, event.y]) item = canvas.circle(pos, 5, fill = 'red') canvas = g.ca(width = 400, height = 400, bg = 'white') canvas.bind('<ButtonPress-1>', make_circle) g.mainloop()
"""Exercise 2 Write a program that creates a Canvas and a Button. When the user presses the Button, it should draw a circle on the canvas.""" from swampy.Gui import * g = Gui() g.title = "Gui" def make_circle(): canvas.circle([0, 0], 55, fill="orange", outline="white", width=3) canvas = g.ca(500, 500, bg="black") g.bu(text="make me a circle", command=make_circle) g.mainloop()
self.dragy = event.y self.move(dx, dy) def drop(self, event): self.config(fill=self.fill) def make_circle(event): pos = ca.canvas_coords([event.x, event.y]) item = ca.circle(pos, 5, fill='white') Draggable(item) def make_text(event=None): text = en.get() item = ca.text([0,0], text) Draggable(item) g = Gui() g.title('Draggable Demo') ca = g.ca(width=500, height=500, bg='black') ca.bind('<ButtonPress-3>', make_circle) g.row([1,0]) en = g.en() bu = g.bu('Make text item:', make_text) en.bind('<Return>', make_text) g.mainloop()
from swampy.Gui import * import Tkinter import Image as PIL import ImageTk g = Gui() g.title('Image Viewer') canvas = g.ca(width = 400, height = 400) photo = Tkinter.PhotoImage(file = 'danger.gif') ''' PhotoImage reads a file and returns a PhotoImage object that Tkinter can display ''' canvas.image([0,0], image = photo) g.la(image = photo) g.bu(image = photo) g.mainloop()
from swampy.Gui import * g = Gui() g.title('') def callback1(): g.bu(text='Now press me.', command=callback2) def callback2(): g.la(text='Nice job.') g.bu(text='Press me.', command=callback1) g.mainloop()
""" Write a program that creates a Canvas and a Button. When the user presses the Button, it should draw a circle on the canvas """ from swampy.Gui import * #g=Gui() #g.title('Gui') #g.mainloop() #button=g.bu(text='Press me') g = Gui() g.title('Test') def callback1(): g.bu(text='Now press me.', command=callback2) def callback2(): g.la(text='Nice job.') g.bu(text='Press me.', command=callback1) g.mainloop()
from swampy.Gui import * g = Gui() g.title('Exercise 1') def cb1(): g.bu(text="Second Button", command=cb2) def cb2(): g.la(text="Nice Job") button = g.bu(text='First Button', command=cb1) g.mainloop()
from swampy.Gui import * def set_color(color): mb.config(text=color) print color g = Gui() g.title('Menubutton Demo') g.la('Select a color:') colors = ['red', 'green', 'blue'] mb = g.mb(text='color') for color in colors: g.mi(mb, text=color, command=Callable(set_color, color)) g.mainloop()
def launch(): """ launches the 'real' gui system, the one we interact with """ #names new databases that we will use now that the application is launched share_hist = db.share_hist display = db.display point_total = db.point_total shared_source = db.shared_source shared_viewer = db.shared_viewer #clears the databases upon running script #IMPORTANT: leave the shared_viewer.remove() shared_viewer.remove() def initialize(): """ upon running the script, gets data from the database and updates the gui displays """ global count global share_count global username try: for thing in point_total.distinct(username): amount = thing points.config(text = str(amount)) except: point_total.insert({username:10}) for thing in point_total.distinct(username): amount = thing points.config(text = str(amount)) for thing in display.distinct(username): share_history.canvas.text([0,count], text = thing['friend'] + ' ' + thing['share'] + ' ' + str(thing['date'])) count -= 12 for thing in shared_viewer.distinct(username): link = new_shared_list.canvas.text([0,share_count], text = str(thing[username]['link']), activefill = 'blue') link.bind('<Double-1>', onObjectClick) share_count -= 12 def update(): """ when the update button is pushed, this looks at the database, and will print things not already in the display, as well as log displayed data (meaning that if the gui closes before update is pressed, the data is still saved, and will be displayed the next time update will be pressed) """ global count global username for log in share_hist.find(): if log not in display.find(): display.insert(log) share_history.canvas.text([0,count], text = log[username]['friend'] + ' ' + log[username]['share'] + ' ' + str(log[username]['date'])) count -= 12 get_new_shares() def print_entry(): """ Allows shares to be made, will check to make sure nothing is a repeat, will log the data. Interactive with the user. """ global count global username res = [] text = en.get() connection = friend.get() for user in users.find(): res.append(user['user']) if connection not in res: label.config(text = 'Sorry, user not in our records') return follower = ' was shared with ' message = text + follower + connection + '!' for thing in point_total.distinct(username): existing = thing point_total.update({username: existing}, {'$inc': {username:(-1)}}) points.config(text = str(existing-1)) if count == 1: t = datetime.datetime.now() if t.minute < 10: minute = '0'+str(t.minute) else: minute = str(t.minute) timestamp = str(t.month) + '/' + str(t.day) +'/' + str(t.year) + ',' +str(t.hour) + ':' + minute share_hist.insert({username:{'friend':connection,'share':text, 'date': timestamp}}) shared_source.insert({connection:{'link': text, 'friend':username}}) label.config(text = message) count -= 12 else: instance_count = 0 for instance in share_hist.distinct(username): if text == instance['share'] and connection == instance['friend']: label.config(text = 'That is a repeat!') return instance_count += 1 if instance_count == len(share_hist.distinct(username)): t = datetime.datetime.now() if t.minute < 10: minute = '0'+str(t.minute) else: minute = str(t.minute) timestamp = str(t.month) + '/' + str(t.day) +'/' + str(t.year) + ',' +str(t.hour) + ':' + minute share_hist.insert({username:{'friend':connection,'share':text, 'date': timestamp}}) shared_source.insert({connection:{'link': text, 'friend':username}}) label.config(text = message) def url_display(url): """ downloads a youtube video into a file, then plays that file within the gui space url - raw string url from gui input """ myfile="playingvid.mp4" try: os.remove(myfile) except OSError: k=2 os.system('youtube-dl -o playingvid.mp4 %s'%url) gobject.threads_init() window_id = canvas.winfo_id() player = gst.element_factory_make('playbin2', 'player') player.set_property('video-sink', None) x=os.path.dirname(os.path.realpath(__file__)) player.set_property('uri', 'file://%s/playingvid.mp4'%(x)) player.set_state(gst.STATE_PLAYING) bus = player.get_bus() bus.add_signal_watch() bus.enable_sync_message_emission() bus.connect('sync-message::element', on_sync_message, window_id) def on_sync_message(bus, message, window_id): if not message.structure is None: if message.structure.get_name() == 'prepare-xwindow-id': image_sink = message.src image_sink.set_property('force-aspect-ratio', True) image_sink.set_xwindow_id(window_id) def add_link(new_link): """ adds a link to the shared_viewer display """ return shared_viewer.insert(new_link) def get_new_shares(): """ will update the recieved, or shared_viewer display """ global share_count global username for i in shared_source.distinct(username): if i['link'] not in shared_viewer.distinct('link'): add_link(i) link = new_shared_list.canvas.text([0,share_count], text = str(i['link']), activefill = 'blue') link.bind('<Double-1>', onObjectClick) share_count -= 12 def onObjectClick(event): """ allows us to double click on a link and show it, as well as remove it from the list of need to view links """ global username for thing in point_total.find(): for key in thing: if key == username: existing = thing[username] point_total.update({username: existing}, {'$inc': {username:1}}) points.config(text = str(existing + 1)) index = event.widget.find_closest(event.x, event.y) i = shared_viewer.find() access = i[index[0] - 1] link = access['link'] url_display(link) shared_source.remove({username: {'link':access['link'], 'friend':access['friend']}}) #General set-up pretty = 'light cyan' gui = Gui() gui.title('MusicswAPPer') gui.row() gui.la(text = 'Welcome to the swAPP', bg = 'black', fg='cyan', justify = 'left', font = ('Times', 20, 'bold italic'), height = 2, relief = 'groove') gui.endrow() gui.row(bg=pretty) gui.col(bg=pretty) gui.bu(text = 'Refresh', fg = 'forest green', font = ('Times', 15, 'bold'), bg=pretty, activeforeground='forest green', activebackground='powder blue', command = update) gui.row([0,1], pady = 10, bg=pretty) gui.endrow() gui.la(text = 'Share a link', bg = pretty, font = ('Times', 13, 'italic'), anchor = 'left', justify='left') friend = gui.en(text = 'Who do you want to share with?', disabledforeground = 'light gray', fg = 'black', font = ('Times', 12)) en = gui.en(text = 'Insert URL here', font = ('Times', 12)) gui.bu(text = 'Share', font = ('Times', 15, 'bold'), bg = pretty, fg = 'forest green', activebackground = 'powder blue', activeforeground = 'forest green', command = print_entry) label = gui.la(bg=pretty, font=('Times', 11)) gui.row([0,1], pady = 10, bg=pretty) gui.endrow() gui.la(text = 'Share history', bg=pretty, font=('Times',13, 'italic')) share_history = gui.sc(width = 500, height = 300) share_history.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty, bd=0) gui.endcol() gui.col(bg=pretty) gui.ca(height = 10, width = 5, bg=pretty, bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty) gui.endcol() gui.col(bg=pretty) gui.la(text = 'New Shares from Friends', bg = pretty, font=('Times', 13, 'italic')) new_shared_list = gui.sc(width = 500, height = 100) new_shared_list.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) gui.row([0,1], pady = 30, bg=pretty) gui.endrow() gui.la(text = 'Viewer', bg=pretty, font = ('Times', 13, 'italic')) canvas = gui.ca(width = 500, height = 300, bg='black') canvas.configure(confine = False, scrollregion = (0,0,2000, 2000)) points = gui.la(bg=pretty) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty) gui.endcol() gui.endrow() initialize() gui.mainloop()
import os from swampy.Gui import * import Tkinter import Image as PIL import ImageTk g = Gui() g.title('Image Viewer') canvas = g.ca(width=500, height=500, bg='white') def walk(dirname): for name in os.listdir(dirname): path = os.path.join(dirname, name) if os.path.isfile(path): try: show_image(name) print name g.mainloop() except: pass else: walk(path) def show_image(fp): image = PIL.open(fp) tkpi = ImageTk.PhotoImage(image) canvas(image=tkpi)
def main(): """ Launches login system everytime the script is run, users have the option of signing in, or signing up if they have not already established an account and accout information. Upon login/signup, the main application is launched """ def newusergui(): """ for anyone who needs to register, this adds them to the database system """ def newuser(): global username for user in users.find(): for info in user: if user[info]==newusername.get(): label.config(text="That username is already in use.") return if newpassword.get()==repeatnewpassword.get(): users.insert({'user':newusername.get(), 'password': newpassword.get()}) db.add_user(newusername.get(), newpassword.get()) label.config(text="Thank you for signing up!") username = newusername.get() launch() else: label.config(text="Your passwords don't match! Please try again") usernamelabel=g.la(text='Username:'******'Password:'******'*') repeatpasswordlabel=g.la(text='Re-enter Password') repeatnewpassword=g.en(show='*') button=g.bu(text="Let's get started!",command=newuser) label=g.la() def logingui(): """ this launches the general sign-in gui for those who have registered """ def close(): global username for user in users.find(): if password.get()==user['password'] and usernameentry.get() == user['user']: label.config(text= "You are now logged in!") username = usernameentry.get() g.quit() launch() return True else: label.config(text= "We do not recognize your username or password, please try again.") usernamelabel=g.la(text = "MusicSwAPPer Username: "******"MusicSwAPPer Password: "******"Let's get started!",command=close) label=g.la() g=Gui() g.title('Launch MusicSwAPPer') signuporlogin = g.la(text = 'Please Sign-In or Sign-Up!') g.row() login = g.bu(text = 'Sign in', command=logingui) sign = g.bu(text = 'Sign up', command=newusergui) g.endrow() g.mainloop()
from swampy.Gui import * g = Gui() g.title('') g.la('Select a color:') colors = ['red', 'green', 'blue'] mb = g.mb(text=colors[0]) def set_color(color): print color mb.config(text=color) for color in colors: g.mi(mb, text=color, command=Callable(set_color, color)) g.mainloop()
#coding:utf-8 from swampy.Gui import * g = Gui() g.title('GUI') canvas = g.ca(width=500, height=500) canvas.config(bg='blue') def draw_circle(): canvas.circle([0, 0], 100, fill='red', outline='green') g.bu(text='Create a circle', command=draw_circle) g.mainloop()
circle = canvas.circle([0,0], 100, fill='white') def change_color(): if circle == None: return 'Create a circle before press button.' color = entry.get() try: circle.config(fill=color) except: message = 'probaly an unknown color name' print message g = Gui() g.title('Gui') button = g.bu(text='Press it', command=callback1) canvas = g.ca(width=500, height=500) circle = None #canvas.config(bg='black') #item = canvas.rectangle([[0, 0], [200, 200]], #fill='white', outline='orange',width=10) #item = canvas.oval([[0, 0], [200, 100]], #fill='white', outline='orange',width=10) #item = canvas.line([[0, 100], [100, 200], [200, 100]], width=10, fill='white') #item = canvas.polygon([[0, 100], [100, 200], [200, 100]], width=10, fill='white', outline='orange') #entry = g.en(text='Default text.') #print entry.get() #text = g.te(width=100, height=5) #text.insert(2.3, 'nother')
from swampy.Gui import * colors=['white', 'red', 'green', 'blue', 'cyan', 'yellow', 'magenta'] cir=None g = Gui() g.title('Exercise 3') def cb1(): cir = canvas.circle([0,0], 100, fill='black', outline='white') global cir def cb2(): if cir == None: return color = entry.get() if color in colors: cir.config(outline=color) else: raise ValueError button = g.bu(text='Draw Circle', command=cb1) entry = g.en(text='white') button_change_color = g.bu(text='Change', command=cb2) canvas = g.ca(width=500, height=500) canvas.config(bg='black') g.mainloop()
#! /usr/bin/python from swampy.Gui import * def testBit(int_type, offset): mask = 1 << offset return(int_type & mask) def toggleBit(int_type, offset): mask = 1 << offset return(int_type ^ mask) model = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0] g = Gui() g.title('Font creator') canvas = g.ca(200, 300, bg='orange') def redrawCanvas(): canvas.clear() for line in range(0, 16): canvas.text([70, 140-18*line], '['+str(line)+']='+str(model[line])) for pos in range(0, 8): x = 40 - pos * 10 y = 80 - line * 10 item = canvas.rectangle([[x, y], [x+10, y+10]], fill='white', outline='black', width=1) if testBit(model[line], pos) > 0: item.config(fill='black') def mouseClicked(event): cc = canvas.canvas_coords([event.x, event.y])
from swampy.Gui import * g = Gui() def draw_circle(fill_color='black'): canvas = g.ca(width=300, height=300, bg='white') c = canvas.circle([0, 0], 100, outline='black') c.config(fill=fill_color) def read(): color = ent.get() print color colors = [ 'white', 'black', 'red', 'green', 'blue', 'cyan', 'yellow', 'magenta' ] for c in colors: print c if color == c: draw_circle(color) return print "no color match" g.bu(text='Draw circle', command=draw_circle) g.title('draw cicle') ent = g.en() g.bu(text='second button', command=read) g.mainloop()
return(int_type & mask) models = [] models.append([0, 60, 66, 129, 129, 129, 129, 129, 129, 129, 129, 129, 129, 66, 60, 0]) #0 models.append([0, 4, 12, 20, 36, 4, 4, 4, 4, 4, 4, 4, 4, 4, 4, 0]) #1 models.append([0, 60, 66, 129, 129, 1, 1, 2, 4, 8, 16, 32, 64, 128, 255, 0]) #2 models.append([0, 60, 66, 129, 1, 1, 2, 12, 2, 1, 1, 1, 129, 66, 60, 0]) #3 models.append([0, 6, 10, 10, 18, 18, 34, 34, 66, 66, 130, 255, 2, 2, 2, 0]) #4 models.append([0, 254, 128, 128, 128, 128, 188, 194, 1, 1, 1, 129, 129, 66, 60, 0]) #5 models.append([0, 60, 66, 129, 128, 128, 188, 194, 129, 129, 129, 129, 129, 66, 60, 0]) #6 models.append([0, 255, 1, 2, 2, 4, 4, 8, 8, 16, 16, 32, 32, 64, 64, 0]) #7 models.append([0, 60, 66, 129, 129, 129, 66, 60, 66, 129, 129, 129, 129, 66, 60, 0]) #8 models.append([0, 60, 66, 129, 129, 129, 129, 129, 67, 61, 1, 1, 129, 66, 60, 0]) #9 g = Gui() g.title('Font testing') canvas = g.ca(1020, 360, bg='orange') def drawLineOfModels(y_offset, x_delta, e_size): for digit in range(0, 10): for line in range(0, 16): for pos in range(0, 8): x = -380 + digit * x_delta - pos * e_size y = y_offset - line * e_size item = canvas.rectangle([[x, y], [x+e_size, y+e_size]], fill='orange', outline='black', width=0) if testBit(models[digit][line], pos) > 0: item.config(fill='black') drawLineOfModels(80, 90, 10) drawLineOfModels(-100, 30, 3)
from swampy.Gui import * g = Gui() g.title('circle demo') canvas = g.ca(width=500, height=500, bg='white') circle = None def callback1(): """called when the user presses 'Create circle' """ global circle circle = canvas.circle([0,0], 100) def callback2(): """called when the user presses 'Change color' """ # if the circle hasn't been created yet, do nothing if circle == None: return # get the text from the entry and try to change the circle's color color = entry.get() try: circle.config(fill=color) except TclError, message: # probably an unknown color name print message # create the widgets g.bu(text='Create circle', command=callback1) entry = g.en()
from swampy.Gui import * g = Gui() g.title('19-3.py') canvas = g.ca(width = 500, height = 600, bg = 'white') circle = None def make_circle(): circle = canvas.circle([0,0], 100) def make_change(): if circle == None: return color = entry.get() try: circle.config(fill = color) except TclError, message: print message b1 = g.bu(text = 'Create Circle', command = make_circle) entry = g.en() b2 = g.bu(text = 'Press to Config', command= make_change) g.mainloop()
""" Write a program that creates a Canvas and a Button. When the user presses the Button, it should draw a circle on the canvas. """ from swampy.Gui import * g = Gui() g.title('Canvas') canvas = g.ca(width=500, height=500) canvas.config(bg='blue') def draw_circle(): global canvas canvas.circle([0, 0], 100, fill='red') g.bu(text='Press me', command=draw_circle) g.mainloop()
from swampy.Gui import * g = Gui() g.title("Gui") g.mainloop()
def main(): client = MongoClient() db = client.test_database users = db.users users.remove() print users users.insert({'user':'******', 'password':'******'}) for thing in users.find(): print thing def newusergui(): def close(): signupgui.quit() def newuser(): for user in users.find(): for info in user: print info print user[info] if user[info]==newusername.get(): print 'already in use' label.config(text="That username is already in use.") return if newpassword.get()==repeatnewpassword.get(): print 'running this loop' users.insert({'user':newusername.get(), 'password': newpassword.get()}) print users label.config(text="Thank you for signing up!") close() launch() return True else: label.config(text="Your passwords don't match! Please try again") usernamelabel=signupgui.la(text='Username:'******'Password:'******'*') repeatpasswordlabel=signupgui.la(text='Re-enter Password') repeatnewpassword=signupgui.en(show='*') button=signupgui.bu(text="Let's get started!",command=newuser) label=signupgui.la() def logingui(): def close(): for user in users.find(): for info in user: if password.get()==user[info]: label.config(text= "You are now logged in!") signupgui.quit() launch() return True else: label.config(text= "We do not recognize your username or password, please try again.") usernamelabel=signupgui.la(text = "MusicSwAPPer Username: "******"MusicSwAPPer Password: "******"Let's get started!",command=close) label=signupgui.la() signupgui=Gui() signupgui.title('MusicSwAPPer Sign Up') signuporlogin = signupgui.la(text = 'Please Sign-In or Sign-Up!') signupgui.row() login = signupgui.bu(text = 'Sign in', command=logingui) sign = signupgui.bu(text = 'Sign up', command=newusergui) signupgui.endrow() signupgui.mainloop()
from swampy.Gui import * g = Gui() g.title('Button demo gui') #tao ra 1 canvas canvas = g.ca(width=250, height=250) canvas.config(bg='white') def draw_circle_in_canvas(): #cai tien ve hong tam item = canvas.circle([0, 0], 100, fill='red') item.config(fill='yellow', outline='red', width=15) item1 = canvas.circle([0, 0], 70, fill='red') item1.config(fill='yellow', outline='red', width=15) item2 = canvas.circle([0, 0], 40, fill='red') item2.config(fill='yellow', outline='red', width=15) item3 = canvas.circle([0, 0], 10, fill='red') item3.config(fill='yellow', outline='red', width=15) button = g.bu(text='First button', command=draw_circle_in_canvas) g.mainloop()
def make_gui(): global g g = Gui() g.title('Chapter 19 Excercise 2')
'''import urllib conn = urllib.urlopen('http://thinkpython.com/secret.html') for line in conn: print line.strip()''' from swampy.Gui import * g = Gui() g.title('Web Browser') canvas = g.ca(width=400, height=400) b1 = g.bu(text="Click to browse", command=make_change)
''' Exercise 2 Write a program that creates a Canvas and a Button. When the user presses the Button, it should draw a circle on the canvas. ''' from swampy.Gui import * g = Gui() g.title('Exercise 2') def cb1(): item = canvas.circle([0, 0], 100, fill='black', outline='white') button = g.bu(text='Draw Circle', command=cb1) canvas = g.ca(width=500, height=500) canvas.config(bg='black') g.mainloop()
from swampy.Gui import * g = Gui() g.title = ('Gui')
list2=[1,2,3,4,5,6,7,8,9,0] global presuf presuf=sample(list2, 4)[:] r=randint(1,2) if r==1: ques_pos() elif r==2: ques_neg() def close(event=NONE): if tkMessageBox.askyesno("Quit","Do You Want To Quit???"): p.destroy() p=Gui() p.title('Sentiment Analysis') p.geometry(newGeometry='700x500') fr=p.fr() canint=p.ca(bg='green') imag=Image.open('pic1.jpg') imag2=ImageTk.PhotoImage(imag) canint.image([300,-200],image=imag2) canint.image=imag2 var=IntVar(0) var2=IntVar(0) but1=p.bu('YES',command=start,font=('bold',15), bg='red', fg='white', activebackground='white',activeforeground='red',bd=8).place(x=175,y=370, height=50, width=80) p.bind('y',start) but2=p.bu('NO',command=close,font=('bold',15), bg='red', fg='white', activebackground='white',activeforeground='red',bd=8).place(x=450,y=370, height=50, width=80) item1=canint.create_text(350,140,text="\nWelcome!!!\n Hope You Had A Great Day Till Now.\nIf Not, We Are Gonna Make It Great With This Program!!!\n\n\nSo Shall We Begin???",font=('BOOKMAN OLD STYLE',17,'bold'),justify=CENTER,fill='white') p.bind('n',close)
from swampy.Gui import * from Tkinter import * g = Gui() g.title('Gui') class Canvas(): """ """ def __init__(self): canvas = g.ca(width=500, height=500) class MakeWindow(): """ """ def setup(self): self.canvas = g.ca(width=500, height=500, bg='white') def add_button(self, text, the_command=None): g.bu(text, command=the_command) #b.pack() def test_it(): print "yeah" # def set_option(self, color): # mb.config(text = option) # print color
from swampy.Gui import * a = Gui() a.title('Alberto') def boton1(): a.bu(text='Presioname otra vez.', command=boton2) def boton2(): a.la(text='Buen trabajo.') a.bu(text='Presioname.', command=boton1) a.mainloop()