def generate_conformations(molecule: oechem.OEGraphMol, max_conformations: int = 1000, dense: bool = False) -> oechem.OEMol: """ Generate conformations of a given molecule. Parameters ---------- molecule: oechem.OEGraphMol An OpenEye molecule. max_conformations: int Maximal number of conformations to generate. dense: bool If densely sampled conformers should be generated. Will overwrite max_conformations settings. Returns ------- conformations: oechem.OEMol An OpenEye multi-conformer molecule holding the generated conformations. """ from openeye import oechem, oeomega if dense: omega_options = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) else: omega_options = oeomega.OEOmegaOptions() omega_options.SetMaxSearchTime(60.0) # time out omega_options.SetMaxConfs(max_conformations) omega = oeomega.OEOmega(omega_options) omega.SetStrictStereo(False) conformations = oechem.OEMol(molecule) omega.Build(conformations) return conformations
def FromMol(mol, use_flipper=True, num_sterocenters=12, force_flipper=False): """ Generates a set of conformers as an OEMol object Inputs: mol is an OEMol isomers is a boolean controling whether or not the various diasteriomers of a molecule are created num_enantiomers is the allowable number of enantiomers. For all, set to -1 """ omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetMaxConfRange("200,800") omegaOpts.SetRangeIncrement(8) omegaOpts.SetMaxSearchTime(30) omega = oeomega.OEOmega(omegaOpts) out_conf = [] for enantiomer in oeomega.OEFlipper(mol.GetActive(), num_sterocenters, force_flipper): enantiomer = oechem.OEMol(enantiomer) ret_code = omega.Build(enantiomer) if ret_code == oeomega.OEOmegaReturnCode_Success: out_conf.append(enantiomer) else: oechem.OEThrow.Warning( "%s: %s" % (mol.GetTitle(), oeomega.OEGetOmegaError(ret_code))) return out_conf
def dock_molecules(receptor_filename, molecules, filename): """ Dock the specified molecules, writing out to specified file Parameters ---------- receptor_filename : str Receptor .oeb.gz filename molecules : list of openeye.oechem.OEMol The read molecules to dock filename : str The filename to stream docked molecules to """ # Read the receptor print('Loading receptor...') from openeye import oechem, oedocking receptor = oechem.OEGraphMol() if not oedocking.OEReadReceptorFile(receptor, 'receptor.oeb.gz'): oechem.OEThrow.Fatal("Unable to read receptor") if oedocking.OEReceptorHasBoundLigand(receptor): print("Receptor has a bound ligand") else: print("Receptor does not have bound ligand") print('Initializing receptor...') dockMethod = oedocking.OEDockMethod_Hybrid2 dockResolution = oedocking.OESearchResolution_High dock = oedocking.OEDock(dockMethod, dockResolution) success = dock.Initialize(receptor) # Set up Omega from openeye import oeomega omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) #omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) omega.SetStrictStereo(False) # Dock molecules with oechem.oemolostream(filename) as ofs: from tqdm import tqdm for mol in tqdm(molecules): dockedMol = oechem.OEGraphMol() # Expand conformers omega.Build(mol) # Dock molecule retCode = dock.DockMultiConformerMolecule(dockedMol, mol) if (retCode != oedocking.OEDockingReturnCode_Success): oechem.OEThrow.Fatal("Docking Failed with error code " + oedocking.OEDockingReturnCodeGetName(retCode)) # Store docking data sdtag = oedocking.OEDockMethodGetName(dockMethod) oedocking.OESetSDScore(dockedMol, dock, sdtag) dock.AnnotatePose(dockedMol) # Write molecule oechem.OEWriteMolecule(ofs, dockedMol)
def main(argv=[__name__]): if len(argv) != 3: oechem.OEThrow.Usage("%s <infile> <outfile>" % argv[0]) ifs = oechem.oemolistream() if not ifs.open(argv[1]): oechem.OEThrow.Fatal("Unable to open %s for reading" % argv[1]) ofs = oechem.oemolostream() if not ofs.open(argv[2]): oechem.OEThrow.Fatal("Unable to open %s for writing" % argv[2]) if not oechem.OEIs3DFormat(ofs.GetFormat()): oechem.OEThrow.Fatal("Invalid output file format for 3D coordinates!") omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) for mol in ifs.GetOEMols(): oechem.OEThrow.Info("Title: %s" % mol.GetTitle()) for enantiomer in oeomega.OEFlipper(mol.GetActive(), 12, True): enantiomer = oechem.OEMol(enantiomer) ret_code = omega.Build(enantiomer) if ret_code == oeomega.OEOmegaReturnCode_Success: oechem.OEWriteMolecule(ofs, enantiomer) else: oechem.OEThrow.Warning( "%s: %s" % (enantiomer.GetTitle(), oeomega.OEGetOmegaError(ret_code))) return 0
def dock_molecules_to_receptor(receptor_filename): """ Dock the specified molecules, writing out to specified file Parameters ---------- receptor_filename : str Receptor .oeb.gz filename fragment : str The fragment name to dock to """ import os # Read the receptor from openeye import oechem, oedocking receptor = oechem.OEGraphMol() if not oedocking.OEReadReceptorFile(receptor, receptor_filename): oechem.OEThrow.Fatal("Unable to read receptor") if not oedocking.OEReceptorHasBoundLigand(receptor): raise Exception("Receptor does not have bound ligand") #print('Initializing receptor...') dockMethod = oedocking.OEDockMethod_Hybrid2 dockResolution = oedocking.OESearchResolution_Default dock = oedocking.OEDock(dockMethod, dockResolution) success = dock.Initialize(receptor) # Set up Omega #print('Expanding conformers...') from openeye import oeomega #omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) omega.SetStrictStereo(False) # Dock molecules docked_molecules = list() for mol in molecules: dockedMol = oechem.OEGraphMol() # Expand conformers omega.Build(mol) # Dock molecule #print(f'Docking {mol.NumConfs()} conformers...') retCode = dock.DockMultiConformerMolecule(dockedMol, mol) if (retCode != oedocking.OEDockingReturnCode_Success): print("Docking Failed with error code " + oedocking.OEDockingReturnCodeGetName(retCode)) continue # Store docking data sdtag = oedocking.OEDockMethodGetName(dockMethod) oedocking.OESetSDScore(dockedMol, dock, sdtag) dock.AnnotatePose(dockedMol) docked_molecules.append( oechem.OEMol(dockedMol) ) return docked_molecules
def configure_omega(library, rotor_predicate, rms_cutoff, energy_window, num_conformers=MAX_CONFS): opts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) opts.SetEnumRing(False) opts.SetEnumNitrogen(oeomega.OENitrogenEnumeration_Off) opts.SetSampleHydrogens(True) opts.SetRotorPredicate(rotor_predicate) opts.SetIncludeInput(False) opts.SetEnergyWindow(energy_window) opts.SetMaxConfs(num_conformers) opts.SetRMSThreshold(rms_cutoff) conf_sampler = oeomega.OEOmega(opts) conf_sampler.SetCanonOrder(False) torlib = conf_sampler.GetTorLib() # torlib.ClearTorsionLibrary() for rule in library: if not torlib.AddTorsionRule(rule): oechem.OEThrow.Fatal('Failed to add torsion rule: {}'.format(rule)) conf_sampler.SetTorLib(torlib) return conf_sampler
def FromMol(mol, isomer=True, num_enantiomers=-1): """ Generates a set of conformers as an OEMol object Inputs: mol is an OEMol isomers is a boolean controling whether or not the various diasteriomers of a molecule are created num_enantiomers is the allowable number of enantiomers. For all, set to -1 """ omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetMaxConfs(199) omega = oeomega.OEOmega(omegaOpts) out_conf = [] ofs = oechem.oemolostream("test.sdf") if not isomer: ret_code = omega.Build(mol) if ret_code == oeomega.OEOmegaReturnCode_Success: out_conf.append(mol) else: oechem.OEThrow.Warning("%s: %s" % (mol.GetTitle(), oeomega.OEGetOmegaError(ret_code))) elif isomer: for enantiomer in oeomega.OEFlipper(mol.GetActive(), 12, True): enantiomer = oechem.OEMol(enantiomer) ret_code = omega.Build(enantiomer) if ret_code == oeomega.OEOmegaReturnCode_Success: out_conf.append(enantiomer) num_enantiomers -= 1 oechem.OEWriteMolecule(ofs, mol) if num_enantiomers == 0: break else: oechem.OEThrow.Warning("%s: %s" % (mol.GetTitle(), oeomega.OEGetOmegaError(ret_code))) return out_conf
def main(argv=[__name__]): ifs = oechem.oemolistream() if not ifs.open("lig.smi"): #input: ligand SMILES oechem.OEThrow.Fatal("Unable to open %s for reading" % argv[1]) ofs = oechem.oemolostream() if not ofs.open("lig.oeb.gz"): #output: OEBinary Format oechem.OEThrow.Fatal("Unable to open %s for writing" % argv[2]) omegaOpts = oeomega.OEOmegaOptions() #Parameters omegaOpts.SetMaxConfs(800) omegaOpts.SetCanonOrder(False) omegaOpts.SetSampleHydrogens(True) omegaOpts.SetEnergyWindow(15.0) omegaOpts.SetRMSThreshold(1.0) omegaOpts.SetStrictStereo(True) omegaOpts.SetRangeIncrement(8) omega = oeomega.OEOmega(omegaOpts) for mol in ifs.GetOEMols(): oechem.OEThrow.Info("Title: %s" % mol.GetTitle()) if omega(mol): oechem.OEWriteMolecule(ofs, mol) return 0
def __init__(self, prefix: str, ref_file: str, **kwargs): """ Shape alignment on generated molecules to a reference molecule :param prefix: Name (to help keep track metrics, if using a scoring function class more than once) :param ref_file: Path to reference file to overlay query to (.pdb) :param return_best_overlay: Whether to also return best overlay (for use with docking) :param kwargs: Ignored """ self.prefix = prefix.replace(" ", "_") self.rocs_metrics = [ 'GetColorScore', 'GetColorTanimoto', 'GetColorTversky', 'GetComboScore', 'GetFitColorTversky', 'GetFitSelfColor', 'GetFitSelfOverlap', 'GetFitTversky', 'GetFitTverskyCombo', 'GetOverlap', 'GetRefColorTversky', 'GetRefSelfColor', 'GetRefSelfOverlap', 'GetRefTversky', 'GetRefTverskyCombo', 'GetShapeTanimoto', 'GetTanimoto', 'GetTanimotoCombo', 'GetTversky', 'GetTverskyCombo' ] self.ref_file = ref_file self.refmol = oechem.OEMol() ifs = oechem.oemolistream(self.ref_file) # Set up input file stream oechem.OEReadMolecule(ifs, self.refmol) # Read ifs to empty mol object self.fitmol = None self.rocs_results = None self.best_overlay = None omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetStrictStereo(False) omegaOpts.SetMaxSearchTime(1.0) self.omega = oeomega.OEOmega(omegaOpts)
def enumerate_from_smiles(smiles, oe_options=None): oe_options = oe_options or OEOptions() omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Pose) omegaOpts.SetMaxSearchTime(60) omega = oeomega.OEOmega(omegaOpts) if oe_options.use_tautomer: tautomer_options = oequacpac.OETautomerOptions() pKa_norm = True taut_iter = lambda x: oequacpac.OEGetReasonableTautomers(x, tautomer_options, pKa_norm) else: taut_iter = lambda x: [x] if oe_options.use_flipper: flipper = lambda x: oeomega.OEFlipper(x.GetActive(), oe_options.num_sterocenters, oe_options.force_flipper) else: flipper = lambda x: [x] # get molecule try: molecule = mol_from_smiles(smiles) except ValueError: return [None] results = [] for enantiomer in flipper(molecule): for tautomer in taut_iter(enantiomer): tautomer = oechem.OEMol(tautomer) omega.Build(tautomer) tautomer2 = oechem.OEMol(tautomer) results.append(tautomer2) return results
def expand_stereochemistry(mols): """Expand stereochemistry when uncertain Parameters ---------- mols : openeye.oechem.OEGraphMol Molecules to be expanded Returns ------- expanded_mols : openeye.oechem.OEMol Expanded molecules """ expanded_mols = list() from openeye import oechem, oeomega omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) maxcenters = 12 forceFlip = False enumNitrogen = True warts = True # add suffix for stereoisomers for mol in mols: for enantiomer in oeomega.OEFlipper(mol, maxcenters, forceFlip, enumNitrogen, warts): enantiomer = oechem.OEMol(enantiomer) expanded_mols.append(enantiomer) return expanded_mols
def create_conformers(infile=None, outfile=None, resname=None, folder= None, name = None): """ This function takes a mol1 file and runs Openeye's omega to create conformers for the molecules The conformers are stored in separated files, adding the number of the conformer at the end of the filename :param infile: Path to input file :param outfile: Path to output file return :param folder: Name of the folder for the target. If not specified. {name}-liquid is used. :param resname: Abbreviation of the Residue. Specified in the mol2 :return: Number of conformers for this molecule """ if folder is None and name is None: log.error('Please specify keyword argument folder or name') sys.exit(1) elif folder is None: folder = name +'-liquid' infilepath = os.path.join(folder, infile) outfilepath = os.path.join(folder, outfile) ifs = oechem.oemolistream() if not ifs.open(infilepath): oechem.OEThrow.Fatal("Unable to open %s for reading" % infilepath) ofs = oechem.oemolostream() if not ofs.open(outfilepath): oechem.OEThrow.Fatal("Unable to open %s for writing" % outfilepath) if not oechem.OEIs2DFormat(ofs.GetFormat()): oechem.OEThrow.Fatal("Invalid output file format for 2D coordinates!") omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) omega.SetCommentEnergy(True) omega.SetEnumNitrogen(True) omega.SetSampleHydrogens(True) omega.SetEnergyWindow(9.0) omega.SetMaxConfs(5) omega.SetRangeIncrement(2) omega.SetRMSRange([0.5, 1.0, 1.5, 2.0, 2.5, 3.0, 3.5]) filename = '{}-conformers'.format(resname) for mol in ifs.GetOEMols(): ret_code = omega.Build(mol) if ret_code == oeomega.OEOmegaReturnCode_Success: oechem.OEWriteMolecule(ofs, mol) for k, conf in enumerate(mol.GetConfs()): ofs1 = oechem.oemolostream() if not ofs1.open(os.path.join(folder, filename + '_' + str(k + 1) + '.mol2')): oechem.OEThrow.Fatal("Unable to open %s for writing" % os.path.join(folder, filename + '_' + str(k + 1) + '.mol2')) oechem.OEWriteMolecule(ofs1, conf) nconf = k + 1 log.info('Created conformations for {} and saved them to {}'.format(infilepath, outfilepath)) else: oechem.OEThrow.Warning("%s: %s" % (mol.GetTitle(), oeomega.OEGetOmegaError(ret_code))) return nconf
def __init__(self, receptor: utils.FilePath): self.receptor_file = receptor omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetStrictStereo(False) self.omega = oeomega.OEOmega(omegaOpts) oechem.OEThrow.SetLevel(10000) oereceptor = oechem.OEGraphMol() oedocking.OEReadReceptorFile(oereceptor, self.receptor_file) self.dock = oedocking.OEDock() self.dock.Initialize(oereceptor)
def initialize_system(dt=0.001, temperature=100, forcefield_file='forcefield/smirnoff99Frosst.offxml', smiles="C1CCCCC1"): mol = OEMol() # OEParseSmiles(mol, 'CCOCCSCC') # OEParseSmiles(mol, 'c1ccccc1') OEParseSmiles(mol, smiles) # OEParseSmiles(mol, 'C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O') OEAddExplicitHydrogens(mol) masses = get_masses(mol) num_atoms = mol.NumAtoms() topology = generateTopologyFromOEMol(mol) ff = ForceField(get_data_filename(forcefield_file)) nrgs, total_params, offsets = system_builder.construct_energies( ff, mol, False) # dt = 0.0025 # friction = 10.0 # temperature = 300 # gradient descent dt = dt friction = 10.0 temperature = temperature a, b, c = get_abc_coefficents(masses, dt, friction, temperature) buf_size = estimate_buffer_size(1e-10, a) print("BUFFER SIZE", buf_size) omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetMaxConfs(1) omega = oeomega.OEOmega(omegaOpts) omega.SetStrictStereo(False) if not omega(mol): assert 0 x0 = mol_coords_to_numpy_array(mol) / 10 intg = custom_ops.Integrator_double(dt, buf_size, num_atoms, total_params, a, b, c) context = custom_ops.Context_double(nrgs, intg) x0 = minimizer.minimize_newton_cg(nrgs, x0, total_params) return nrgs, offsets, intg, context, x0, total_params
def _docking_internal(receptor: oechem.OEGraphMol, bound_ligand: oechem.OEGraphMol, ligand_string): """ Internal method for docking to a receptor given a bound ligand and ligand to dock to Parameters ---------- receptor: oechem.OEGraphMol, required An oechem receptor to dock to bound_ligand: oechem.OEGraphMol, required The ligand bound to the current receptor pocket docking_ligand: oechem.OEGraphMol, required The ligand to dock. Returns ------- An oechem molecule with coordinates of its docking """ # Create posit config oedocking.OEReceptorSetBoundLigand(receptor, bound_ligand) poser = oedocking.OEHybrid(oedocking.OEDockMethod_Hybrid2, oedocking.OESearchResolution_High) poser.Initialize(receptor) # Create multiple conformations omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetMaxConfs(1000) omega_driver = oeomega.OEOmega(omegaOpts) conformer_docking = oechem.OEMol() # type: OEMol oechem.OESmilesToMol(conformer_docking, ligand_string) oechem.OEAddExplicitHydrogens(conformer_docking) print(conformer_docking.NumAtoms()) if not omega_driver(conformer_docking): single_sdf = tempfile.NamedTemporaryFile(suffix=".sdf") double_sdf = tempfile.NamedTemporaryFile(suffix=".sdf") smiles = ligand_string subprocess.run( "obabel -:'%s' -O %s --gen3d; obabel %s -O %s --confab --conf = 100" % (smiles, single_sdf.name, single_sdf.name, double_sdf.name), shell=True) ins = oechem.oemolistream() ins.SetConfTest(oechem.OEOmegaConfTest()) ins.open(double_sdf.name) oechem.OEReadMolecule(ins, conformer_docking) # Dock and get top conformer posed_ligand = oechem.OEGraphMol() # type: OEGraphMol poser.DockMultiConformerMolecule(posed_ligand, conformer_docking) return posed_ligand
def from_oemol(self, from_oemol): with self.logger("from_oemol") as logger: tautomer_options = oequacpac.OETautomerOptions() tautomer_options.SetMaxTautomersGenerated(4096) tautomer_options.SetMaxTautomersToReturn(16) tautomer_options.SetCarbonHybridization(True) tautomer_options.SetMaxZoneSize(50) tautomer_options.SetApplyWarts(True) pKa_norm = True omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Pose) omegaOpts.SetStrictAtomTypes(False) omegaOpts.SetSampleHydrogens(True) omegaOpts.SetMaxSearchTime(30) omegaOpts.SetFixDeleteH(True) omega = oeomega.OEOmega(omegaOpts) options = oeshape.OEROCSOptions() overlayoptions = oeshape.OEOverlayOptions() overlayoptions.SetOverlapFunc( oeshape.OEOverlapFunc(oeshape.OEAnalyticShapeFunc())) options.SetOverlayOptions(overlayoptions) # options.SetNumBestHits(10) options.SetConfsPerHit(200) # options.SetMaxHits(10000) rocs = oeshape.OEROCS(options) for tautomer in oequacpac.OEGetReasonableTautomers( from_oemol, tautomer_options, pKa_norm): logger.log("got enantiomer") for enantiomer in oeomega.OEFlipper(tautomer, 4, False): logger.log("got tautomer ") enantiomer_ = oechem.OEMol(enantiomer) ret_code = omega.Build(enantiomer_) if ret_code != oeomega.OEOmegaReturnCode_Success: logger.error("got oemeg_failed", oeomega.OEGetOmegaError(ret_code)) else: rocs.AddMolecule(oechem.OEMol(enantiomer_)) for res in rocs.Overlay(self.refmol): outmol = oechem.OEMol(res.GetOverlayConfs()) good_mol = oechem.OEMol(outmol) oechem.OEAddExplicitHydrogens(good_mol) oechem.OEClearSDData(good_mol) oeshape.OEDeleteCompressedColorAtoms(good_mol) oeshape.OEClearCachedSelfColor(good_mol) oeshape.OEClearCachedSelfShape(good_mol) oeshape.OERemoveColorAtoms(good_mol) return good_mol logger.error("Returning None.") return None
def expand_stereochemistry(mols): """Expand stereochemistry when uncertain Parameters ---------- mols : openeye.oechem.OEGraphMol Molecules to be expanded Returns ------- expanded_mols : openeye.oechem.OEMol Expanded molecules """ expanded_mols = list() from openeye import oechem, oeomega omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) maxcenters = 12 forceFlip = False enumNitrogen = False warts = True # add suffix for stereoisomers for mol in mols: compound_title = mol.GetTitle() compound_smiles = oechem.OEMolToSmiles(mol) enantiomers = list() for enantiomer in oeomega.OEFlipper(mol, maxcenters, forceFlip, enumNitrogen, warts): enantiomer = oechem.OEMol(enantiomer) enantiomer_smiles = oechem.OEMolToSmiles(enantiomer) oechem.OESetSDData(enantiomer, 'compound', compound_title) oechem.OESetSDData(enantiomer, 'compound_smiles', compound_smiles) oechem.OESetSDData(enantiomer, 'enantiomer_smiles', enantiomer_smiles) enantiomers.append(enantiomer) expanded_mols += enantiomers # DEBUG if 'EDJ-MED-e4b030d8-2' in mol.GetTitle(): msg = 'Enumerated microstates for compound: ' msg += mol.GetTitle() + '\n' msg += f'{"":5s} ' + oechem.OEMolToSmiles(mol) + '\n' for index, m in enumerate(enantiomers): msg += f'{index:5d} : ' + oechem.OEMolToSmiles(m) + '\n' print(msg) return expanded_mols
def gen_conf(mol): oemols = [] omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_FastROCS) omega = oeomega.OEOmega(omegaOpts) for enantiomer in oeomega.OEFlipper(mol.GetActive(), 6, True): enantiomer = oechem.OEMol(enantiomer) ret_code = omega.Build(enantiomer) if ret_code == oeomega.OEOmegaReturnCode_Success: halfMol = oechem.OEMol(mol, oechem.OEMCMolType_HalfFloatCartesian) oemols.append(halfMol) else: oechem.OEThrow.Warning( "%s: %s" % (enantiomer.GetTitle(), oeomega.OEGetOmegaError(ret_code))) return oemols
def __init__(self, prefix: str, receptor_file: os.PathLike): """ :param prefix: Prefix to identify scoring function instance (e.g., Risperidone) :param receptor_file: Path to receptor file (.oeb). """ logger.warning("This code has not been tested (at all!)") self.prefix = prefix self.receptor_file = receptor_file omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetStrictStereo(False) self.omega = oeomega.OEOmega(omegaOpts) oechem.OEThrow.SetLevel(10000) oereceptor = oechem.OEGraphMol() oedocking.OEReadReceptorFile(oereceptor, self.receptor_file) self.oedock = oedocking.OEDock() self.oedock.Initialize(oereceptor)
def begin(self): omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) omega = oeomega.OEOmega() omega.SetIncludeInput(False) omega.SetCanonOrder(False) omega.SetSampleHydrogens(True) omega.SetStrictStereo(False) # JDC omega.SetMaxSearchTime( self.args.max_search_time) # maximum omega search time omega.SetEnergyWindow(self.args.energy_window) omega.SetMaxConfs(self.args.max_confs) omega.SetRMSThreshold(1.0) self.omega = omega
def __init__(self, prefix: str, receptor_file: str): """ Scoring function class to perform OpenEye docking (FRED) :param prefix: Name (to help keep track metrics, if using a scoring function class more than once) :param receptor_file: Path to oe receptor file. """ logger.warning("This code has not been tested (at all!)") self.prefix = prefix self.receptor_file = receptor_file omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetStrictStereo(False) self.omega = oeomega.OEOmega(omegaOpts) oechem.OEThrow.SetLevel(10000) oereceptor = oechem.OEGraphMol() oedocking.OEReadReceptorFile(oereceptor, self.receptor_file) self.oedock = oedocking.OEDock() self.oedock.Initialize(oereceptor)
def initialize(input_smiles, gp): train_reference_args = [] train_args = [] train_offset_idxs = [] train_charge_idxs = [] for smi_idx, smiles in enumerate(input_smiles): print("processing", smiles, smi_idx, "/", len(input_smiles)) mol = OEMol() OEParseSmiles(mol, smiles) OEAddExplicitHydrogens(mol) masses = get_masses(mol) num_atoms = mol.NumAtoms() omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetMaxConfs(1) omega = oeomega.OEOmega(omegaOpts) omega.SetStrictStereo(False) if not omega(mol): assert 0 topology = generateTopologyFromOEMol(mol) reference_forcefield_file = 'forcefield/smirnoff99Frosst_perturbed.offxml' ff = ForceField(get_data_filename(reference_forcefield_file)) params = system_builder.construct_energies(ff, mol, True) train_reference_args.append((params[0], params[1], masses, mol)) params = system_builder.construct_energies(ff, mol, False) # global_params = args[0] # nrg_params = args[1] # total_params = args[2] # masses = args[3] # mol = args[4] # charge_idxs = args[5] train_args.append((gp, params[0], params[1], masses, mol, params[3])) train_offset_idxs.append(params[2]) train_charge_idxs.append(params[3]) label_confs = [generate_conformations(a) for a in train_reference_args] return train_args, train_offset_idxs, train_charge_idxs, label_confs
def __init__(self, prefix: str, ref_file: os.PathLike, **kwargs): """ :param prefix: Prefix to identify scoring function instance (e.g., Risperidone) :param ref_file: Path to reference file to overlay query to (.pdb) :param kwargs: """ self.prefix = prefix.replace(" ", "_") self.rocs_metrics = ROCS.return_metrics self.ref_file = ref_file self.refmol = oechem.OEMol() ifs = oechem.oemolistream(self.ref_file) # Set up input file stream oechem.OEReadMolecule(ifs, self.refmol) # Read ifs to empty mol object self.fitmol = None self.rocs_results = None self.best_overlay = None omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetStrictStereo(False) omegaOpts.SetMaxSearchTime(1.0) self.omega = oeomega.OEOmega(omegaOpts)
def expand_stereochemistry(mols): """Expand stereochemistry when uncertain Parameters ---------- mols : openeye.oechem.OEGraphMol Molecules to be expanded Returns ------- expanded_mols : openeye.oechem.OEMol Expanded molecules """ expanded_mols = list() from openeye import oechem, oeomega omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) maxcenters = 12 forceFlip = False enumNitrogen = True warts = True # add suffix for stereoisomers for mol in mols: compound_title = mol.GetTitle() compound_smiles = oechem.OEMolToSmiles(mol) enantiomers = list() for enantiomer in oeomega.OEFlipper(mol, maxcenters, forceFlip, enumNitrogen, warts): enantiomer = oechem.OEMol(enantiomer) enantiomer_smiles = oechem.OEMolToSmiles(enantiomer) oechem.OESetSDData(enantiomer, 'compound', compound_title) oechem.OESetSDData(enantiomer, 'compound_smiles', compound_smiles) oechem.OESetSDData(enantiomer, 'enantiomer_smiles', enantiomer_smiles) enantiomers.append(enantiomer) expanded_mols += enantiomers return expanded_mols
def generate_restricted_conformers(receptor, refmol, mol, core_smarts=None): """ Generate and select a conformer of the specified molecule using the reference molecule Parameters ---------- receptor : openeye.oechem.OEGraphMol Receptor (already prepped for docking) for identifying optimal pose refmol : openeye.oechem.OEGraphMol Reference molecule which shares some part in common with the proposed molecule mol : openeye.oechem.OEGraphMol Molecule whose conformers are to be enumerated core_smarts : str, optional, default=None If core_smarts is specified, substructure will be extracted using SMARTS. """ from openeye import oechem, oeomega # DEBUG: For benzotriazoles, truncate refmol core_smarts = 'c1ccc(NC(=O)[C,N]n2nnc3ccccc32)cc1' # prospective core_smarts = 'NC(=O)[C,N]n2nnc3ccccc32' # retrospective # Get core fragment if core_smarts: # Truncate refmol to SMARTS if specified #print(f'Trunctating using SMARTS {refmol_smarts}') ss = oechem.OESubSearch(core_smarts) oechem.OEPrepareSearch(refmol, ss) for match in ss.Match(refmol): core_fragment = oechem.OEGraphMol() oechem.OESubsetMol(core_fragment, match) break #print(f'refmol has {refmol.NumAtoms()} atoms') else: core_fragment = GetCoreFragment(refmol, [mol]) oechem.OESuppressHydrogens(core_fragment) #print(f' Core fragment has {core_fragment.NumAtoms()} heavy atoms') MIN_CORE_ATOMS = 6 if core_fragment.NumAtoms() < MIN_CORE_ATOMS: return None # Create an Omega instance #omegaOpts = oeomega.OEOmegaOptions() omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) # Set the fixed reference molecule omegaFixOpts = oeomega.OEConfFixOptions() omegaFixOpts.SetFixMaxMatch(10) # allow multiple MCSS matches omegaFixOpts.SetFixDeleteH(True) # only use heavy atoms omegaFixOpts.SetFixMol(core_fragment) #omegaFixOpts.SetFixSmarts(smarts) omegaFixOpts.SetFixRMS(0.5) atomexpr = oechem.OEExprOpts_Aromaticity | oechem.OEExprOpts_Hybridization bondexpr = oechem.OEExprOpts_BondOrder | oechem.OEExprOpts_Aromaticity omegaFixOpts.SetAtomExpr(atomexpr) omegaFixOpts.SetBondExpr(bondexpr) omegaOpts.SetConfFixOptions(omegaFixOpts) molBuilderOpts = oeomega.OEMolBuilderOptions() molBuilderOpts.SetStrictAtomTypes(False) # don't give up if MMFF types are not found omegaOpts.SetMolBuilderOptions(molBuilderOpts) omegaOpts.SetWarts(False) # expand molecule title omegaOpts.SetStrictStereo(False) # set strict stereochemistry omegaOpts.SetIncludeInput(False) # don't include input omegaOpts.SetMaxConfs(1000) # generate lots of conformers #omegaOpts.SetEnergyWindow(10.0) # allow high energies omega = oeomega.OEOmega(omegaOpts) from openeye import oequacpac if not oequacpac.OEGetReasonableProtomer(mol): print('No reasonable protomer found') return None mol = oechem.OEMol(mol) # multi-conformer molecule ret_code = omega.Build(mol) if (mol.GetDimension() != 3) or (ret_code != oeomega.OEOmegaReturnCode_Success): print(f'Omega failure: {mol.GetDimension()} and {oeomega.OEGetOmegaError(ret_code)}') return None # Extract poses class Pose(object): def __init__(self, conformer): self.conformer = conformer self.clash_score = None self.docking_score = None self.overlap_score = None poses = [ Pose(conf) for conf in mol.GetConfs() ] # Score clashes bump_check = BumpCheck(receptor) for pose in poses: pose.clash_score = bump_check.count(pose.conformer) # Score docking poses from openeye import oedocking score = oedocking.OEScore(oedocking.OEScoreType_Chemgauss4) score.Initialize(receptor) for pose in poses: pose.docking_score = score.ScoreLigand(pose.conformer) # Compute overlap scores from openeye import oeshape overlap_prep = oeshape.OEOverlapPrep() overlap_prep.Prep(refmol) shapeFunc = oeshape.OEExactShapeFunc() shapeFunc.SetupRef(refmol) oeshape_result = oeshape.OEOverlapResults() for pose in poses: tmpmol = oechem.OEGraphMol(pose.conformer) overlap_prep.Prep(tmpmol) shapeFunc.Overlap(tmpmol, oeshape_result) pose.overlap_score = oeshape_result.GetRefTversky() # Filter poses based on top 10% of overlap poses = sorted(poses, key= lambda pose : pose.overlap_score) poses = poses[int(0.9*len(poses)):] # Select the best docking score import numpy as np poses = sorted(poses, key=lambda pose : pose.docking_score) pose = poses[0] mol.SetActive(pose.conformer) oechem.OESetSDData(mol, 'clash_score', str(pose.clash_score)) oechem.OESetSDData(mol, 'docking_score', str(pose.docking_score)) oechem.OESetSDData(mol, 'overlap_score', str(pose.overlap_score)) # Convert to single-conformer molecule mol = oechem.OEGraphMol(mol) return mol
def oesolvate(solute, density=1.0, padding_distance=10.0, distance_between_atoms=2.5, solvents='tip3p', molar_fractions='1.0', geometry='box', close_solvent=True, salt='[Na+], [Cl-]', salt_concentration=0.0, neutralize_solute=True, verbose=False, return_components=False, **kargs): """ This function solvates the passed solute in a cubic box or a sphere by using Packmol. Packmol creates an initial point for molecular dynamics simulations by packing molecule in defined regions of space. For additional info: http://www.ime.unicamp.br/~martinez/packmol/home.shtml The geometry volume is estimated by the using the padding parameter and the solute size. The number of solvent molecules is calculated by using the specified density and volume. Solvent molecules are specified as comma separated smiles strings. The molar fractions of each solvent molecule are specified in a similar fashion. By default if the solute is charged counter ions are added to neutralize it Parameters: ----------- solute: OEMol molecule The solute to solvate density: float The solution density in g/ml padding_distance: float The largest dimension of the solute (along the x, y, or z axis) is determined (in A), and a cubic box of size (largest dimension)+2*padding is used distance_between_atoms: float The minimum distance between atoms in A solvents: python string A comma separated smiles string or keywords for the solvent molecules. Special water models can be selected by using the keywords: tip3p for TIP3P water model geometry molar_fractions: python string A comma separated molar fraction string of the solvent molecules close_solvent: boolean If True solvent molecules will be placed very close to the solute salt: python string A comma separated string of the dissociated salt in solution salt_concentration: float Salt concentration in millimolar neutralize_solute: boolean If True counter-ions will be added to the solution to neutralize the solute verbose: Bool If True verbose mode is enabled return_components: Bool If True the added solvent molecules are also returned as OEMol Return: ------- oe_mol: OEMol The solvated system. If the selected geometry is a box a SD tag with name 'box_vector' is attached the output molecule containing the system box vectors. oe_mol_components: OEMol If the return_components flag is True the added solvent molecules are returned as an additional OEMol """ def BoundingBox(molecule): """ This function calculates the Bounding Box of the passed molecule molecule: OEMol return: bb (numpy array) the calculated bounding box is returned as numpy array: [(xmin,ymin,zmin), (xmax,ymax,zmax)] """ coords = [v for k, v in molecule.GetCoords().items()] np_coords = np.array(coords) min_coord = np_coords.min(axis=0) max_coord = np_coords.max(axis=0) bb = np.array([min_coord, max_coord]) return bb if shutil.which("packmol") is None: raise (IOError("Packmol executable not found")) # Extract solvent smiles strings and mole fractions solvents = [sm.strip() for sm in solvents.split(',')] fractions = [float(mf) for mf in molar_fractions.split(',')] # If the smiles string and mole fractions lists have different lengths raise an error if len(solvents) != len(fractions): raise ValueError( "Selected solvent number and selected molar fraction number mismatch: {} vs {}" .format(len(solvents), len(fractions))) # Remove smiles string with 0.0 mole fraction solvent_smiles = [ solvents[i] for i, v in enumerate(fractions) if fractions[i] ] mol_fractions = [mf for mf in fractions if mf] # Mole fractions are non-negative numbers if any([v < 0.0 for v in mol_fractions]): raise ValueError("Error: Mole fractions are non-negative real numbers") # Mole fractions must sum up to 1.0 if abs(sum(mol_fractions) - 1.0) > 0.001: oechem.OEThrow.Error("Error: Mole fractions do not sum up to 1.0") if geometry not in ['box', 'sphere']: raise ValueError( "Error geometry: the supported geometries are box and sphere not {}" .format(geometry)) # Set Units density = density * unit.grams / unit.milliliter padding_distance = padding_distance * unit.angstrom salt_concentration = salt_concentration * unit.millimolar # Calculate the Solute Bounding Box BB_solute = BoundingBox(solute) # Estimate of the box cube length box_edge = 2.0 * padding_distance + np.max(BB_solute[1] - BB_solute[0]) * unit.angstrom if geometry == 'box': # Box Volume Volume = box_edge**3 if geometry == 'sphere': Volume = (4.0 / 3.0) * 3.14159265 * (0.5 * box_edge)**3 # Omega engine is used to generate conformations omegaOpts = oeomega.OEOmegaOptions() omegaOpts.SetMaxConfs(1) omegaOpts.SetStrictStereo(False) omega = oeomega.OEOmega(omegaOpts) # Create a string code to identify the solute residues. The code ID used is based # on the residue number id, the residue name and the chain id: # id+resname+chainID hv_solute = oechem.OEHierView( solute, oechem.OEAssumption_BondedResidue + oechem.OEAssumption_ResPerceived) solute_resid_list = [] for chain in hv_solute.GetChains(): for frag in chain.GetFragments(): for hres in frag.GetResidues(): oe_res = hres.GetOEResidue() solute_resid_list.append( str(oe_res.GetResidueNumber()) + oe_res.GetName() + chain.GetChainID()) # Solvent component list_names solvent_resid_dic_names = dict() # Neutralize solute ion_sum_wgt_n_ions = 0.0 * unit.grams / unit.mole if neutralize_solute: # Container for the counter-ions oe_ions = [] # Container for the ion smiles strings ions_smiles = [] solute_formal_charge = 0 for at in solute.GetAtoms(): solute_formal_charge += at.GetFormalCharge() if solute_formal_charge > 0: ions_smiles.append("[Cl-]") elif solute_formal_charge < 0: ions_smiles.append("[Na+]") else: pass # Total number of counter-ions to neutralize the solute n_ions = abs(solute_formal_charge) # print("Counter ions to add = {} of {}".format(n_ions, ions_smiles[0])) # Ions if n_ions >= 1: for sm in ions_smiles: mol = oechem.OEMol() if not oechem.OESmilesToMol(mol, sm): raise ValueError( "Error counter ions: SMILES string parsing fails for the string: {}" .format(sm)) # Generate conformer if not omega(mol): raise ValueError( "Error counter ions: Conformer generation fails for the molecule with " "smiles string: {}".format(sm)) oe_ions.append(mol) if sm == '[Na+]': solvent_resid_dic_names[' NA'] = mol else: solvent_resid_dic_names[' CL'] = mol ion_sum_wgt = 0.0 * unit.grams / unit.mole for ion in oe_ions: # Molecular weight ion_sum_wgt += oechem.OECalculateMolecularWeight( ion) * unit.grams / unit.mole ion_sum_wgt_n_ions = ion_sum_wgt * n_ions # Create ions .pdb files ions_smiles_pdbs = [] for i in range(0, len(ions_smiles)): pdb_name = os.path.basename(tempfile.mktemp(suffix='.pdb')) pdb_name = ions_smiles[i] + '_' + pdb_name ions_smiles_pdbs.append(pdb_name) for i in range(0, len(ions_smiles)): ofs = oechem.oemolostream(ions_smiles_pdbs[i]) oechem.OEWriteConstMolecule(ofs, oe_ions[i]) # Add salts to the solution # Solvent smiles string parsing char_set = string.ascii_uppercase salt_sum_wgt_n_salt = 0.0 * unit.grams / unit.mole if salt_concentration > 0.0 * unit.millimolar: salt_smiles = [sm.strip() for sm in salt.split(',')] # Container list of oemol salt molecules generated by using smiles strings oe_salt = [] for sm in salt_smiles: mol_salt = oechem.OEMol() if not oechem.OESmilesToMol(mol_salt, sm): raise ValueError( "Error salt: SMILES string parsing fails for the string: {}" .format(sm)) # Generate conformer if not omega(mol_salt): raise ValueError( "Error salt: Conformer generation fails for the " "molecule with smiles string: {}".format(sm)) # Unique 3 code letter are set as solvent residue names solv_id = ''.join(random.sample(char_set * 3, 3)) # Try to recognize the residue name oechem.OEPerceiveResidues(mol_salt) for atmol in mol_salt.GetAtoms(): res = oechem.OEAtomGetResidue(atmol) if res.GetName() == 'UNL': res.SetName(solv_id) oechem.OEAtomSetResidue(atmol, res) if solv_id not in solvent_resid_dic_names: solvent_resid_dic_names[solv_id] = mol_salt else: if res.GetName() not in solvent_resid_dic_names: solvent_resid_dic_names[res.GetName()] = mol_salt break oe_salt.append(mol_salt) n_salt = int( round(unit.AVOGADRO_CONSTANT_NA * salt_concentration * Volume.in_units_of(unit.liter))) # for i in range(0, len(salt_smiles)): # print("Number of molecules for the salt component {} = {}".format(salt_smiles[i], n_salt)) salt_sum_wgt = 0.0 * unit.grams / unit.mole for salt in oe_salt: # Molecular weight salt_sum_wgt += oechem.OECalculateMolecularWeight( salt) * unit.grams / unit.mole salt_sum_wgt_n_salt = salt_sum_wgt * n_salt # Create salt .pdb files if n_salt >= 1: salt_pdbs = [] for i in range(0, len(salt_smiles)): pdb_name = os.path.basename(tempfile.mktemp(suffix='.pdb')) # pdb_name = salt_smiles[i] + '_' + pdb_name salt_pdbs.append(pdb_name) for i in range(0, len(salt_smiles)): ofs = oechem.oemolostream(salt_pdbs[i]) oechem.OEWriteConstMolecule(ofs, oe_salt[i]) # Container list of oemol solvent molecules generated by using smiles strings oe_solvents = [] for sm in solvent_smiles: if sm == 'tip3p': tip3p_fn = os.path.join(PACKAGE_DIR, 'oeommtools', 'data', 'tip3p.pdb') ifs = oechem.oemolistream(tip3p_fn) mol_sol = oechem.OEMol() if not oechem.OEReadMolecule(ifs, mol_sol): raise IOError( "It was not possible to read the tip3p molecule file") else: mol_sol = oechem.OEMol() if not oechem.OESmilesToMol(mol_sol, sm): raise ValueError( "Error solvent: SMILES string parsing fails for the string: {}" .format(sm)) # Generate conformer if not omega(mol_sol): raise ValueError( "Error solvent: Conformer generation fails for " "the molecule with smiles string: {}".format(sm)) # Unique 3 code letter are set as solvent residue names solv_id = ''.join(random.sample(char_set * 3, 3)) # Try to recognize the residue name oechem.OEPerceiveResidues(mol_sol) for atmol in mol_sol.GetAtoms(): res = oechem.OEAtomGetResidue(atmol) if res.GetName() == 'UNL': res.SetName(solv_id) oechem.OEAtomSetResidue(atmol, res) if solv_id not in solvent_resid_dic_names: solvent_resid_dic_names[solv_id] = mol_sol else: if res.GetName() not in solvent_resid_dic_names: solvent_resid_dic_names[res.GetName()] = mol_sol break oe_solvents.append(mol_sol) # Sum of the solvent molecular weights solvent_sum_wgt_frac = 0.0 * unit.grams / unit.mole for idx in range(0, len(oe_solvents)): # Molecular weight wgt = oechem.OECalculateMolecularWeight( oe_solvents[idx]) * unit.grams / unit.mole solvent_sum_wgt_frac += wgt * mol_fractions[idx] # Solute molecular weight solute_wgt = oechem.OECalculateMolecularWeight( solute) * unit.gram / unit.mole # Estimate of the number of each molecular species present in the solution accordingly # to their molar fraction fi: # # ni = fi*(density*volume*NA - wgt_solute - sum_k(wgt_salt_k*nk) - wgt_ion*n_ion)/sum_j(wgt_nj * fj) # # where ni is the number of molecule of specie i, density the mixture density, volume the # mixture volume, wgt_solute the molecular weight of the solute, wgt_salt_k the molecular # weight of the salt component k, nk the number of molecule of salt component k, wgt_ion # the counter ion molecular weight, n_ions the number of counter ions and wgt_nj the molecular # weight of the molecule specie j with molar fraction fj div = (unit.AVOGADRO_CONSTANT_NA * density * Volume - (solute_wgt + salt_sum_wgt_n_salt + ion_sum_wgt_n_ions)) / solvent_sum_wgt_frac # Solvent number of monomers n_monomers = [int(round(mf * div)) for mf in mol_fractions] if not all([nm > 0 for nm in n_monomers]): raise ValueError( "Error negative number of solvent components: the density could be too low" ) # for i in range(0, len(solvent_smiles)): # print("Number of molecules for the component {} = {}".format(solvent_smiles[i], n_monomers[i])) # Packmol Configuration file setting if close_solvent: header_template = """\n# Mixture\ntolerance {}\nfiletype pdb\noutput {}\nadd_amber_ter\navoid_overlap no""" else: header_template = """\n# Mixture\ntolerance {}\nfiletype pdb\noutput {}\nadd_amber_ter\navoid_overlap yes""" # Templates strings solute_template = """\n\n# Solute\nstructure {}\nnumber 1\nfixed 0. 0. 0. 0. 0. 0.\nresnumbers 1\nend structure""" if geometry == 'box': solvent_template = """\nstructure {}\nnumber {}\ninside box {:0.3f} {:0.3f} {:0.3f} {:0.3f} {:0.3f} {:0.3f}\ \nchain !\nresnumbers 3\nend structure""" if geometry == 'sphere': solvent_template = """\nstructure {}\nnumber {}\ninside sphere {:0.3f} {:0.3f} {:0.3f} {:0.3f}\ \nchain !\nresnumbers 3\nend structure""" # Create solvents .pdb files solvent_pdbs = [] for i in range(0, len(solvent_smiles)): pdb_name = os.path.basename(tempfile.mktemp(suffix='.pdb')) solvent_pdbs.append(pdb_name) for i in range(0, len(solvent_smiles)): ofs = oechem.oemolostream(solvent_pdbs[i]) oechem.OEWriteConstMolecule(ofs, oe_solvents[i]) solute_pdb = 'solute' + '_' + os.path.basename( tempfile.mktemp(suffix='.pdb')) ofs = oechem.oemolostream(solute_pdb) if solute.GetMaxConfIdx() > 1: raise ValueError("Solutes with multiple conformers are not supported") else: oechem.OEWriteConstMolecule(ofs, solute) # Write Packmol header section mixture_pdb = 'mixture' + '_' + os.path.basename( tempfile.mktemp(suffix='.pdb')) body = header_template.format(distance_between_atoms, mixture_pdb) # Write Packmol configuration file solute section body += solute_template.format(solute_pdb) # The solute is centered inside the box xc = (BB_solute[0][0] + BB_solute[1][0]) / 2. yc = (BB_solute[0][1] + BB_solute[1][1]) / 2. zc = (BB_solute[0][2] + BB_solute[1][2]) / 2. # Correct for periodic box conditions to avoid # steric clashes at the box edges pbc_correction = 1.0 * unit.angstrom xmin = xc - ((box_edge - pbc_correction) / 2.) / unit.angstrom xmax = xc + ((box_edge - pbc_correction) / 2.) / unit.angstrom ymin = yc - ((box_edge - pbc_correction) / 2.) / unit.angstrom ymax = yc + ((box_edge - pbc_correction) / 2.) / unit.angstrom zmin = zc - ((box_edge - pbc_correction) / 2.) / unit.angstrom zmax = zc + ((box_edge - pbc_correction) / 2.) / unit.angstrom # Packmol setting for the solvent section body += '\n\n# Solvent' for i in range(0, len(solvent_smiles)): if geometry == 'box': body += solvent_template.format(solvent_pdbs[i], n_monomers[i], xmin, ymin, zmin, xmax, ymax, zmax) if geometry == 'sphere': body += solvent_template.format(solvent_pdbs[i], n_monomers[i], xc, yc, zc, 0.5 * box_edge / unit.angstrom) # Packmol setting for the salt section if salt_concentration > 0.0 * unit.millimolar and n_salt >= 1: body += '\n\n# Salt' for i in range(0, len(salt_smiles)): if geometry == 'box': body += solvent_template.format(salt_pdbs[i], int(round(n_salt)), xmin, ymin, zmin, xmax, ymax, zmax) if geometry == 'sphere': body += solvent_template.format(salt_pdbs[i], int(round(n_salt)), xc, yc, zc, 0.5 * box_edge / unit.angstrom) # Packmol setting for the ions section if neutralize_solute and n_ions >= 1: body += '\n\n# Counter Ions' for i in range(0, len(ions_smiles)): if geometry == 'box': body += solvent_template.format(ions_smiles_pdbs[i], n_ions, xmin, ymin, zmin, xmax, ymax, zmax) if geometry == 'sphere': body += solvent_template.format(ions_smiles_pdbs[i], n_ions, xc, yc, zc, 0.5 * box_edge / unit.angstrom) # Packmol configuration file packmol_filename = os.path.basename(tempfile.mktemp(suffix='.inp')) with open(packmol_filename, 'w') as file_handle: file_handle.write(body) # Call Packmol if not verbose: mute_output = open(os.devnull, 'w') with open(packmol_filename, 'r') as file_handle: subprocess.check_call(['packmol'], stdin=file_handle, stdout=mute_output, stderr=mute_output) else: with open(packmol_filename, 'r') as file_handle: subprocess.check_call(['packmol'], stdin=file_handle) # Read in the Packmol solvated system solvated = oechem.OEMol() if os.path.exists(mixture_pdb + '_FORCED'): os.rename(mixture_pdb + '_FORCED', mixture_pdb) print("Warning: Packing solution is not optimal") ifs = oechem.oemolistream(mixture_pdb) oechem.OEReadMolecule(ifs, solvated) # To avoid to change the user oemol starting solute by reading in # the generated mixture pdb file and loosing molecule info, the # solvent molecules are extracted from the mixture system and # added back to the starting solute # Extract from the solution system the solvent molecules # by checking the previous solute generated ID: id+resname+chainID hv_solvated = oechem.OEHierView( solvated, oechem.OEAssumption_BondedResidue + oechem.OEAssumption_ResPerceived) # This molecule will hold the solvent molecules generated directly from # the omega conformers. This is useful to avoid problems related to read in # the solvent molecules from pdb files and triggering unwanted perceiving actions new_components = oechem.OEMol() bv = oechem.OEBitVector(solvated.GetMaxAtomIdx()) for chain in hv_solvated.GetChains(): for frag in chain.GetFragments(): for hres in frag.GetResidues(): oe_res = hres.GetOEResidue() if str(oe_res.GetResidueNumber()) + oe_res.GetName( ) + chain.GetChainID() not in solute_resid_list: oechem.OEAddMols(new_components, solvent_resid_dic_names[oe_res.GetName()]) atms = hres.GetAtoms() for at in atms: bv.SetBitOn(at.GetIdx()) pred = oechem.OEAtomIdxSelected(bv) components = oechem.OEMol() oechem.OESubsetMol(components, solvated, pred) new_components.SetCoords(components.GetCoords()) # This is necessary otherwise just one big residue is created oechem.OEPerceiveResidues(new_components) # Add the solvent molecules to the solute copy solvated_system = solute.CreateCopy() oechem.OEAddMols(solvated_system, new_components) # Set Title solvated_system.SetTitle(solute.GetTitle()) # Set ions resname to Na+ and Cl- for at in solvated_system.GetAtoms(): res = oechem.OEAtomGetResidue(at) if res.GetName() == ' NA': res.SetName("Na+") oechem.OEAtomSetResidue(atmol, res) elif res.GetName() == ' CL': res.SetName("Cl-") oechem.OEAtomSetResidue(atmol, res) else: pass # Cleaning to_delete = solvent_pdbs + [packmol_filename, solute_pdb, mixture_pdb] if salt_concentration > 0.0 * unit.millimolar and n_salt >= 1: to_delete += salt_pdbs if neutralize_solute and n_ions >= 1: to_delete += ions_smiles_pdbs for fn in to_delete: try: os.remove(fn) except: pass # Calculate the solution total density total_wgt = oechem.OECalculateMolecularWeight( solvated_system) * unit.gram / unit.mole density_mix = (1 / unit.AVOGADRO_CONSTANT_NA) * total_wgt / Volume print("Computed Solution Density = {}".format( density_mix.in_units_of(unit.gram / unit.milliliter))) # Threshold checking ths = 0.1 * unit.gram / unit.milliliter if not abs(density - density_mix.in_units_of(unit.gram / unit.milliliter)) < ths: raise ValueError( "Error: the computed density for the solute {} does not match the selected density {} vs {}" .format(solute.GetTitle(), density_mix, density)) if geometry == 'box': # Define the box vector and attached it as SD tag to the solvated system # with ID tag: 'box_vectors' box_vectors = (Vec3(box_edge / unit.angstrom, 0.0, 0.0), Vec3(0.0, box_edge / unit.angstrom, 0.0), Vec3(0.0, 0.0, box_edge / unit.angstrom)) * unit.angstrom box_vectors = data_utils.encodePyObj(box_vectors) solvated_system.SetData(oechem.OEGetTag('box_vectors'), box_vectors) if return_components: new_components.SetTitle(solute.GetTitle() + '_solvent_comp') return solvated_system, new_components else: return solvated_system
def generate_restricted_conformers(receptor, refmol, mol, core_smarts=None): """ Generate and select a conformer of the specified molecule using the reference molecule Parameters ---------- receptor : openeye.oechem.OEGraphMol Receptor (already prepped for docking) for identifying optimal pose refmol : openeye.oechem.OEGraphMol Reference molecule which shares some part in common with the proposed molecule mol : openeye.oechem.OEGraphMol Molecule whose conformers are to be enumerated core_smarts : str, optional, default=None If core_smarts is specified, substructure will be extracted using SMARTS. """ from openeye import oechem, oeomega logging.debug( f'mol: {oechem.OEMolToSmiles(mol)} | core_smarts: {core_smarts}') # Be quiet from openeye import oechem oechem.OEThrow.SetLevel(oechem.OEErrorLevel_Quiet) #oechem.OEThrow.SetLevel(oechem.OEErrorLevel_Error) # Get core fragment if core_smarts: # Truncate refmol to SMARTS if specified #print(f'Trunctating using SMARTS {refmol_smarts}') ss = oechem.OESubSearch(core_smarts) oechem.OEPrepareSearch(refmol, ss) for match in ss.Match(refmol): core_fragment = oechem.OEGraphMol() oechem.OESubsetMol(core_fragment, match) logging.debug( f'Truncated refmol to generate core_fragment: {oechem.OEMolToSmiles(core_fragment)}' ) break #print(f'refmol has {refmol.NumAtoms()} atoms') else: core_fragment = GetCoreFragment(refmol, [mol]) oechem.OESuppressHydrogens(core_fragment) #print(f' Core fragment has {core_fragment.NumAtoms()} heavy atoms') MIN_CORE_ATOMS = 6 if core_fragment.NumAtoms() < MIN_CORE_ATOMS: return None # Create an Omega instance #omegaOpts = oeomega.OEOmegaOptions() omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) # Set the fixed reference molecule omegaFixOpts = oeomega.OEConfFixOptions() omegaFixOpts.SetFixMaxMatch(10) # allow multiple MCSS matches omegaFixOpts.SetFixDeleteH(True) # only use heavy atoms omegaFixOpts.SetFixMol(core_fragment) #omegaFixOpts.SetFixSmarts(core_smarts) # DEBUG omegaFixOpts.SetFixRMS(0.5) # This causes a warning: #Warning: OESubSearch::Match() is unable to match unset hybridization in the target (EN300-221518_3_1) for patterns with set hybridization, call OEPrepareSearch on the target first #atomexpr = oechem.OEExprOpts_Aromaticity | oechem.OEExprOpts_Hybridization atomexpr = oechem.OEExprOpts_Aromaticity | oechem.OEExprOpts_AtomicNumber bondexpr = oechem.OEExprOpts_BondOrder | oechem.OEExprOpts_Aromaticity omegaFixOpts.SetAtomExpr(atomexpr) omegaFixOpts.SetBondExpr(bondexpr) omegaOpts.SetConfFixOptions(omegaFixOpts) molBuilderOpts = oeomega.OEMolBuilderOptions() molBuilderOpts.SetStrictAtomTypes( False) # don't give up if MMFF types are not found omegaOpts.SetMolBuilderOptions(molBuilderOpts) omegaOpts.SetWarts(False) # expand molecule title omegaOpts.SetStrictStereo(True) # set strict stereochemistry omegaOpts.SetIncludeInput(False) # don't include input omegaOpts.SetMaxConfs(1000) # generate lots of conformers omegaOpts.SetEnergyWindow(20.0) # allow high energies omega = oeomega.OEOmega(omegaOpts) # TODO: Expand protonation states and tautomers from openeye import oequacpac if not oequacpac.OEGetReasonableProtomer(mol): logging.warning('No reasonable protomer found') return None mol = oechem.OEMol(mol) # multi-conformer molecule ret_code = omega.Build(mol) if (mol.GetDimension() != 3) or (ret_code != oeomega.OEOmegaReturnCode_Success): msg = f'\nOmega failure for {mol.GetTitle()} : SMILES {oechem.OEMolToSmiles(mol)} : core_smarts {core_smarts} : {oeomega.OEGetOmegaError(ret_code)}\n' logging.warning(msg) return None # Return the molecule with an error code #oechem.OESetSDData(mol, 'error', '{oeomega.OEGetOmegaError(ret_code)}') #return mol # Extract poses class Pose(object): def __init__(self, conformer): self.conformer = conformer self.clash_score = None self.docking_score = None self.overlap_score = None poses = [Pose(conf) for conf in mol.GetConfs()] # Score clashes bump_check = BumpCheck(receptor) for pose in poses: pose.clash_score = bump_check.count(pose.conformer) # Score docking poses from openeye import oedocking score = oedocking.OEScore(oedocking.OEScoreType_Chemgauss4) score.Initialize(receptor) for pose in poses: pose.docking_score = score.ScoreLigand(pose.conformer) # Compute overlap scores from openeye import oeshape overlap_prep = oeshape.OEOverlapPrep() overlap_prep.Prep(refmol) shapeFunc = oeshape.OEExactShapeFunc() shapeFunc.SetupRef(refmol) oeshape_result = oeshape.OEOverlapResults() for pose in poses: tmpmol = oechem.OEGraphMol(pose.conformer) overlap_prep.Prep(tmpmol) shapeFunc.Overlap(tmpmol, oeshape_result) pose.overlap_score = oeshape_result.GetRefTversky() # Filter poses based on top 10% of overlap poses = sorted(poses, key=lambda pose: pose.overlap_score) poses = poses[int(0.9 * len(poses)):] # Select the best docking score import numpy as np poses = sorted(poses, key=lambda pose: pose.docking_score) pose = poses[0] mol.SetActive(pose.conformer) oechem.OESetSDData(mol, 'clash_score', str(pose.clash_score)) oechem.OESetSDData(mol, 'docking_score', str(pose.docking_score)) oechem.OESetSDData(mol, 'overlap_score', str(pose.overlap_score)) # Convert to single-conformer molecule mol = oechem.OEGraphMol(mol) # Compute MMFF energy energy = mmff_energy(mol) oechem.OESetSDData(mol, 'MMFF_internal_energy', str(energy)) # Store SMILES docked_smiles = oechem.OEMolToSmiles(mol) oechem.OESetSDData(mol, 'docked_smiles', docked_smiles) return mol
import sys from openeye import oechem from openeye import oeomega if len(sys.argv) != 2: oechem.OEThrow.Usage("%s <outfile>" % sys.argv[0]) mol = oechem.OEMol() oechem.OESmilesToMol(mol, "O=COC") ofs = oechem.oemolostream() if not ofs.open(sys.argv[1]): oechem.OEThrow.Fatal("Unable to open %s for writing" % sys.argv[1]) omegaOpts = oeomega.OEOmegaOptions() omega = oeomega.OEOmega(omegaOpts) torlib = oeomega.OETorLib() # @ <SNIPPET-AddTorsionRule-string> # Adding the torsion rule "[O:1]=[C:2]-[O:3][CH3:4] 90" as a string # This takes precedent over previous rule rule = "[O:1]=[C:2]-[O:3][CH3:4] 90" if not torlib.AddTorsionRule(rule): oechem.OEThrow.Fatal("Failed to add torsion rule: %s" % rule) omegaOpts.SetTorLib(torlib) omega.SetOptions(omegaOpts) if omega(mol): oechem.OEWriteMolecule(ofs, mol) # @ </SNIPPET-AddTorsionRule-string>
def compute_conformers(smiles=None, smiles_file=None, start_index=0, batch_size=0, out_file=None, bad_file=None, save_csv=False, overwrite=False, save_gzip=False, license=None, timeout=0, max_failures=2): import csv import os from openeye import oechem from openeye import oeomega from openeye import oemolprop import signal os.environ['OE_LICENSE'] = license if save_gzip or save_csv: raise Exception("GZip and CSV not supported") if not overwrite and os.path.exists(out_file): raise Exception("File exists: %s" % out_file) if smiles_file: with open(smiles_file) as current: current.seek(start_index) smiles = [current.readline() for i in range(batch_size)] if len(smiles) == 0: return "" # function to compute enantiomers # separated out so we can use an alarm to timeout def get_enan(omega, enan): enan = oechem.OEMol(enan) ret = omega.Build(enan) return enan, ret def alarm_handler(signum, frame): #print("ALARM signal received") raise Exception() #ofs = oechem.oemolostream() #ofs.SetFormat(oechem.OEFormat_OEB) #if not ofs.open(out_file): # oechem.OEThrow.Fatal("Unable to open %s for writing" % out_file) sep = "," bad = [] mols = [] for s in smiles: mol = s.split(sep) if len(mol) > 1: mols.append(mol[2].rstrip()) # put all mols in a string as we're told it is faster to process this way in_smiles = "\n".join(mols) ims = oechem.oemolistream() ims.SetFormat(oechem.OEFormat_SMI) ims.openstring(in_smiles) # Turn off logging except errors oechem.OEThrow.SetLevel(5) filt = oemolprop.OEFilter(oemolprop.OEFilterType_BlockBuster) #ofs.open(out_file) signal.signal(signal.SIGALRM, alarm_handler) oe_results = [] for mol in ims.GetOEMols(): if filt(mol): oemols = [] ret_code = None omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_FastROCS) omega = oeomega.OEOmega(omegaOpts) failures = 0 for enantiomer in oeomega.OEFlipper(mol.GetActive(), 6, True): if max_failures > 0 and failures >= max_failures: break if len(oemols) >= 10: break ret_code = None error = False signal.alarm(timeout) try: enantiomer, ret_code = get_enan(omega, enantiomer) except: print("Timeout %s" % out_file) failures += 1 error = True signal.alarm(0) if not error and ret_code == oeomega.OEOmegaReturnCode_Success: halfMol = oechem.OEMol(mol, oechem.OEMCMolType_HalfFloatCartesian) oemols.append(halfMol) #else: #oechem.OEThrow.Warning("%s: %s" % # (enantiomer.GetTitle(), oeomega.OEGetOmegaError(ret_code))) oe_results.append(oemols) ofs = oechem.oemolostream() ofs.SetFormat(oechem.OEFormat_OEB) ofs.open(out_file) for r in oe_results: for res in r: oechem.OEWriteMolecule(ofs, res) ofs.close() return out_file
def dock_molecule_to_receptor(molecule, receptor_filename, covalent=False): """ Dock the specified molecules, writing out to specified file Parameters ---------- molecule : oechem.OEMol The molecule to dock receptor_filename : str Receptor to dock to covalent : bool, optional, default=False If True, try to place covalent warheads in proximity to CYS145 Returns ------- docked_molecule : openeye.oechem.OEMol Returns the best tautomer/protomer in docked geometry, annotated with docking score None is returned if no viable docked pose found """ import os # Extract the fragment name for the receptor fragment = extract_fragment_from_filename(receptor_filename) # Read the receptor from openeye import oechem, oedocking receptor = oechem.OEGraphMol() if not oedocking.OEReadReceptorFile(receptor, receptor_filename): oechem.OEThrow.Fatal("Unable to read receptor") #print(f'Receptor has {receptor.NumAtoms()} atoms') if not oedocking.OEReceptorHasBoundLigand(receptor): raise Exception("Receptor does not have bound ligand") #print('Initializing receptor...') dockMethod = oedocking.OEDockMethod_Hybrid2 dockResolution = oedocking.OESearchResolution_High dock = oedocking.OEDock(dockMethod, dockResolution) success = dock.Initialize(receptor) # Add covalent restraint if specified warheads_found = find_warheads(molecule) if covalent and len(warheads_found) > 0: warheads_found = set(warheads_found.keys()) # Initialize covalent constraints customConstraints = oedocking.OEReceptorGetCustomConstraints(receptor) # Find CYS145 SG atom hv = oechem.OEHierView(receptor) hres = hv.GetResidue("A", "CYS", 145) proteinHeavyAtom = None for atom in hres.GetAtoms(): if atom.GetName().strip() == 'SG': proteinHeavyAtom = atom break if proteinHeavyAtom is None: raise Exception('Could not find CYS145 SG') # Add the constraint feature = customConstraints.AddFeature() feature.SetFeatureName("CYS145 proximity") for warhead_type in warheads_found: smarts = covalent_warhead_smarts[warhead_type] print(f'Adding constraint for SMARTS pattern {smarts}') feature.AddSmarts(smarts) sphereRadius = 4.0 # Angstroms sphereCenter = oechem.OEFloatArray(3) receptor.GetCoords(proteinHeavyAtom, sphereCenter) sphere = feature.AddSphere() sphere.SetRad(sphereRadius) sphere.SetCenter(sphereCenter[0], sphereCenter[1], sphereCenter[2]) oedocking.OEReceptorSetCustomConstraints(receptor, customConstraints) # Enumerate tautomers from openeye import oequacpac tautomer_options = oequacpac.OETautomerOptions() tautomer_options.SetMaxTautomersGenerated(4096) tautomer_options.SetMaxTautomersToReturn(16) tautomer_options.SetCarbonHybridization(True) tautomer_options.SetMaxZoneSize(50) tautomer_options.SetApplyWarts(True) pKa_norm = True tautomers = [ oechem.OEMol(tautomer) for tautomer in oequacpac.OEGetReasonableTautomers(molecule, tautomer_options, pKa_norm) ] # Set up Omega #print('Expanding conformers...') from openeye import oeomega #omegaOpts = oeomega.OEOmegaOptions(oeomega.OEOmegaSampling_Dense) omegaOpts = oeomega.OEOmegaOptions() #omegaOpts.SetMaxConfs(5000) omegaOpts.SetMaxSearchTime(60.0) # time out omega = oeomega.OEOmega(omegaOpts) omega.SetStrictStereo(False) # enumerate sterochemistry if uncertain # Dock tautomers docked_molecules = list() from tqdm import tqdm for mol in tautomers: dockedMol = oechem.OEGraphMol() # Expand conformers omega.Build(mol) # Dock molecule retCode = dock.DockMultiConformerMolecule(dockedMol, mol) if (retCode != oedocking.OEDockingReturnCode_Success): #print("Docking Failed with error code " + oedocking.OEDockingReturnCodeGetName(retCode)) continue # Store docking data sdtag = oedocking.OEDockMethodGetName(dockMethod) oedocking.OESetSDScore(dockedMol, dock, sdtag) oechem.OESetSDData(dockedMol, "docked_fragment", fragment) dock.AnnotatePose(dockedMol) docked_molecules.append( dockedMol.CreateCopy() ) if len(docked_molecules) == 0: return None # Select the best-ranked molecule and pose # Note that this ignores protonation state and tautomer penalties docked_molecules.sort(key=score) best_molecule = docked_molecules[0] return best_molecule