def main(wf): """Run workflow Script Filter. Args: wf (workflow.Workflow): Current Workflow object. """ global ureg ureg = UnitRegistry(wf.decode(DEFAULT_UNIT_DEFINITIONS)) ureg.default_format = 'P' wf.magic_arguments['appkey'] = open_currency_instructions if not len(wf.args): return query = wf.args[0] # .lower() log.debug('query : %s', query) handle_update(wf) # Create data files if necessary bootstrap(wf) # Add workflow and user units to unit registry register_units() # Notify of available update if wf.update_available: wf.add_item('A newer version is available', 'Action this item to download & install the new version', autocomplete='workflow:update', icon=ICON_UPDATE) # Load cached data exchange_rates = wf.cached_data(CURRENCY_CACHE_NAME, max_age=0) if exchange_rates: # Add exchange rates to conversion database register_exchange_rates(exchange_rates) if not wf.cached_data_fresh(CURRENCY_CACHE_NAME, CURRENCY_CACHE_AGE): # Update currency rates cmd = ['/usr/bin/python', wf.workflowfile('currency.py')] run_in_background('update', cmd) wf.rerun = 0.5 if is_running('update'): wf.rerun = 0.5 if exchange_rates is None: # No data cached yet wf.add_item(u'Fetching exchange rates…', 'Currency conversions will be momentarily possible', icon=ICON_INFO) else: wf.add_item(u'Updating exchange rates…', icon=ICON_INFO) return convert(query)
def main(wf): """Run workflow Script Filter. Args: wf (workflow.Workflow): Current Workflow object. """ global ureg ureg = UnitRegistry(wf.decode(DEFAULT_UNIT_DEFINITIONS)) ureg.default_format = 'P' wf.magic_arguments['appkey'] = open_currency_instructions if not len(wf.args): return query = wf.args[0] # .lower() log.debug('query : %s', query) handle_update(wf) # Create data files if necessary bootstrap(wf) # Add workflow and user units to unit registry register_units() # Notify of available update if wf.update_available: wf.add_item('A newer version is available', 'Action this item to download & install the new version', autocomplete='workflow:update', icon=ICON_UPDATE) # Load cached data exchange_rates = wf.cached_data(CURRENCY_CACHE_NAME, max_age=0) if exchange_rates: # Add exchange rates to conversion database register_exchange_rates(exchange_rates) if not wf.cached_data_fresh(CURRENCY_CACHE_NAME, CURRENCY_CACHE_AGE): # Update currency rates cmd = ['/usr/bin/python', wf.workflowfile('currency.py')] run_in_background('update', cmd) wf.rerun = 0.5 if is_running('update'): wf.rerun = 0.5 if exchange_rates is None: # No data cached yet wf.add_item(u'Fetching exchange rates…', 'Currency conversions will be momentarily possible', icon=ICON_INFO) else: wf.add_item(u'Updating exchange rates…', icon=ICON_INFO) return convert(query)
def init_unit_reg(): ureg = UnitRegistry(on_redefinition="ignore") ureg.define("hash = [hash] = H") ureg.define("solution = [solution] = Sol") ureg.define("bitcoin = [currency] = BTC") ureg.default_format = '~' Benchmarker.ureg = ureg
def convertTemp(T,top1,top2): #The 3 lines here for ureg are just setting the baseline for our temperature units ureg = UnitRegistry(autoconvert_offset_to_baseunit = True) ureg.default_format = '.3f' Q_ = ureg.Quantity if top1 == 0: home = Q_(T, ureg.degC) elif top1 == 1: home = Q_(T, ureg.degF) elif top1 == 2: home = Q_(T, ureg.degK) return home.to(tTypes[top2])
def test_default_formatting(self): ureg = UnitRegistry() x = ureg.Quantity(4.12345678, UnitsContainer(meter=2, kilogram=1, second=-1)) for spec, result in (('L', r'4.12345678 \frac{kilogram \cdot meter^{2}}{second}'), ('P', '4.12345678 kilogram·meter²/second'), ('H', '4.12345678 kilogram meter<sup>2</sup>/second'), ('~', '4.12345678 kg * m ** 2 / s'), ('L~', r'4.12345678 \frac{kg \cdot m^{2}}{s}'), ('P~', '4.12345678 kg·m²/s'), ('H~', '4.12345678 kg m<sup>2</sup>/s'), ): ureg.default_format = spec self.assertEqual('{0}'.format(x), result)
def test_default_formatting(self): ureg = UnitRegistry() x = ureg.Quantity(4.12345678, UnitsContainer(meter=2, kilogram=1, second=-1)) for spec, result in (('L', r'4.12345678 \frac{kilogram \cdot meter^{2}}{second}'), ('P', '4.12345678 kilogram·meter²/second'), ('H', '4.12345678 kilogram meter<sup>2</sup>/second'), ('C', '4.12345678 kilogram*meter**2/second'), ('~', '4.12345678 kg * m ** 2 / s'), ('L~', r'4.12345678 \frac{kg \cdot m^{2}}{s}'), ('P~', '4.12345678 kg·m²/s'), ('H~', '4.12345678 kg m<sup>2</sup>/s'), ('C~', '4.12345678 kg*m**2/s'), ): ureg.default_format = spec self.assertEqual('{0}'.format(x), result)
def unit_conversion(result): data = _get_entities(result) response = { "tts": "", "file": "", "save": True, } if data: units = UnitRegistry() units.default_format = '.2f' base = data["base"] conversion = data["conversion"] try: amount = data["amount"] * units(input_string=base) except UndefinedUnitError as e: response[ "tts"] = "The base unit does not appear to be in the unit registry." response["file"] = "base_unit_undefined.mp3" else: try: result = amount.to(conversion) except DimensionalityError as e: response[ "tts"] = f"I can't conver the base unit to the conversion unit." response["file"] = "conversion_dimensionality.mp3" except UndefinedUnitError as e: response[ "tts"] = "The conversion unit does not appear to be in the unit registry." response["file"] = "conversion_unit_undefined.mp3" else: response["tts"] = f"{amount} is {result}" response["save"] = False return response response["tts"] = "I wasn't able to convert those units." response["file"] = "conversion_failure.mp3" return response
from pint import UnitRegistry u = UnitRegistry() u.default_format = '~P' Q_ = u.Quantity from .atoms import Atom, AtomMixed from .unitCell import UnitCell from .structure import Structure from .simulation import Simulation from .xray import Xray from .xrayKin import XrayKin from .xrayDyn import XrayDyn __all__ = [ 'Atom', 'AtomMixed', 'UnitCell', 'Structure', 'Simulation', 'Xray', 'XrayKin', 'XrayDyn', 'u', 'Q_' ]
# http://taurus-scada.org ## # Copyright 2011 CELLS / ALBA Synchrotron, Bellaterra, Spain ## # Taurus is free software: you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. ## # Taurus is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. ## # You should have received a copy of the GNU Lesser General Public License # along with Taurus. If not, see <http://www.gnu.org/licenses/>. ## ############################################################################# """ This module provides a pint unit registry instance (`UR`) to be used by all taurus objects. It also provides the `Quantity` factory from that registry (also aliased as `Q_`). """ from pint import UnitRegistry # Ininitialize the unit registry for taurus UR = UnitRegistry() UR.default_format = '~' # use abbreviated units Q_ = Quantity = UR.Quantity
# Units handling # here we assign the identifier 'unit' to the UnitRegistry unit = UnitRegistry() # use this to enable legacy handling of offset units # TODO fix this to handle offsets the way pint wants us to since 0.7 unit.autoconvert_offset_to_baseunit = True # append custom unit definitions and contexts directory = os.path.dirname(__file__) unit.load_definitions(directory + "/pint_custom_units.txt") # activate the "chemistry" context globally unit.enable_contexts("chem") # set the default string formatting for pint quantities unit.default_format = "P~" def testfunc(val): list = [] try: list.append(float(val) * unit("")) return list except ValueError: print("Value Error") return None class Parameter: """ Class for storing and retrieving measured parameter values together with their
CUSTOM_DEFINITIONS_FILENAME, DECIMAL_PLACES, DECIMAL_SEPARATOR, DEFAULT_SETTINGS, HELP_URL, ICON_UPDATE, THOUSANDS_SEPARATOR, UPDATE_SETTINGS, ) from defaults import Defaults log = None # Pint objects ureg = UnitRegistry() ureg.default_format = 'P' # Q = ureg.Quantity class NoToUnits(Exception): """Raised if there are no to units (or defaults).""" class Input(object): """Parsed user query.""" def __init__(self, number, dimensionality, from_unit, to_unit=None): self.number = number self.dimensionality = dimensionality self.from_unit = from_unit self.to_unit = to_unit
def test_issue_1300(self): ureg = UnitRegistry() ureg.default_format = "~P" m = ureg.Measurement(1, 0.1, "meter") assert m.default_format == "~P"
Author: Matthew C. Jones Email: [email protected] :copyright: 2020 Matthew C. Jones :license: MIT License, see LICENSE for more details. """ from inspect import currentframe from numpy import sqrt from ambiance import Atmosphere from pint import UnitRegistry unit = UnitRegistry(system='mks') unit.default_format = '~P' dimless = unit('dimensionless') def name_of_var(var): """Find name of variables using local items. :var: dimensioned variable :returns: user-coded name of variable """ try: local_vars = currentframe().f_back.f_back.f_locals.items() match = [name for name, val in local_vars if val is var] except AttributeError: local_vars = currentframe().f_back.f_locals.items()
import numpy as np import six from IPython.display import Latex import matplotlib.pyplot as plt import pytablewriter from enum import Enum from collections import UserList from pint import UnitRegistry, set_application_registry from pint import __version__ as pint_version u = UnitRegistry(autoconvert_offset_to_baseunit=True) if int(pint_version.split('.')[0]) * 10 + int(pint_version.split('.')[1]) > 8: u.setup_matplotlib(True) u.default_format = '.4f~L' set_application_registry(u) np.set_printoptions(precision=3) __all__ = [ 'density', 'specific_volume', 'u', 'np', 'latex', 'V_flux', 'delta_u', 'speed', 'Delta_speed', 'isentropisch_work', 'isentropische_dT', 'isentropische_dV', 'isentropische_dv', 'isentropische_dP', 'isobaar_heat', 'isobaar_work', 'isobaar_dv', 'isobaar_dT', 'technical_work', 'delta_e_kin', 'delta_h', 'ProcessType', 'TransitionState', 'Transition', 'Cycle', 'States', 'mass_flux' ] class ProcessType(Enum): POLYTROPIC = -1
from flasgger.base import Swagger from mongoengine import ValidationError from mongoengine.base.datastructures import BaseDict from itsdangerous import URLSafeTimedSerializer from pint import UnitRegistry from pint.unit import UnitDefinition from pint.converters import ScaleConverter from string import punctuation from boltons.iterutils import remap, default_enter ureg = UnitRegistry(preprocessors=[ lambda s: s.replace("%%", " permille "), lambda s: s.replace("%", " percent "), ]) ureg.default_format = "P~" ureg.define(UnitDefinition("percent", "%", (), ScaleConverter(0.01))) ureg.define(UnitDefinition("permille", "%%", (), ScaleConverter(0.001))) ureg.define(UnitDefinition("ppm", "ppm", (), ScaleConverter(1e-6))) ureg.define(UnitDefinition("ppb", "ppb", (), ScaleConverter(1e-9))) ureg.define("atom = 1") ureg.define("bohr_magneton = e * hbar / (2 * m_e) = µᵇ = µ_B = mu_B") ureg.define("electron_mass = 9.1093837015e-31 kg = mₑ = m_e") Q_ = ureg.Quantity delimiter, max_depth = ".", 3 max_dgts = 6 invalidChars = set(punctuation.replace("*", "")) invalidChars.add(" ") quantity_keys = {"display", "value", "unit"}
U_.define("__wrapped__ = 1" ) # <- hack to avoid an error with pytest (doctest activated) U_.define("@alias point = count") U_.define("transmittance = 1. / 100.") U_.define("absolute_transmittance = 1.") U_.define("absorbance = 1. = a.u.") U_.define("Kubelka_Munk = 1. = K.M.") U_.define("ppm = 1. = ppm") U_.define(UnitDefinition("percent", "pct", (), ScaleConverter(1 / 100.0))) U_.define( UnitDefinition("weight_percent", "wt_pct", (), ScaleConverter(1 / 100.0))) U_.default_format = "~P" Q_ = U_.Quantity Q_.default_format = "~P" set_application_registry(U_) del UnitRegistry # to avoid importing it else: warn("Unit registry was already set up. Bypassed the new loading") U_.enable_contexts("spectroscopy", "boltzmann", "chemistry") # Context for NMR # ------------------------------------------------------------------ def set_nmr_context(larmor):
# filename = resource_filename(PKG, 'spectrochempy.txt') U_ = UnitRegistry(on_redefinition='ignore') # filename) U_.define('__wrapped__ = 1') # <- hack to avoid an error with pytest (doctest activated) U_.define('@alias point = count') U_.define('transmittance = 1. / 100.') U_.define('absolute_transmittance = 1.') U_.define('absorbance = 1. = a.u.') U_.define('Kubelka_Munk = 1. = K.M.') U_.define('ppm = 1. = ppm') U_.define(UnitDefinition('percent', 'pct', (), ScaleConverter(1 / 100.0))) U_.define(UnitDefinition('weight_percent', 'wt_pct', (), ScaleConverter(1 / 100.0))) U_.default_format = '' # .2fK' Q_ = U_.Quantity Q_.default_format = '' # .2fK' set_application_registry(U_) del UnitRegistry # to avoid importing it else: warn('Unit registry was already set up. Bypassed the new loading') U_.enable_contexts('spectroscopy', 'boltzmann', 'chemistry') # Context for NMR # ---------------------------------------------------------------------------------------------------------------------- def set_nmr_context(larmor):
import numbers import numpy as np import uncertainties from interval import imath, inf, interval from IPython.display import Latex, display from pint import DimensionalityError, UnitRegistry from typeguard import typechecked from uncertainties import ufloat ureg = UnitRegistry() ureg.default_format = "~P" ureg.define("GRAPI = 1.0") # added base unit for gamma ray log Q_ = ureg.Quantity esc = lambda s: s.replace('"\"', '"\\"') @typechecked class Limits: def __init__(self, limits: (tuple, list)): assert len(limits) == 2 lower, upper = limits try: assert lower.dimensionality == upper.dimensionality except DimensionalityError as exc: raise exc try: assert isinstance(lower.m, numbers.Number) assert isinstance(upper.m, numbers.Number) except AssertionError as e:
from pint import UnitRegistry # here we assign the identifier 'unit' to the UnitRegistry unit = UnitRegistry() #use this to enable legacy handling of offset units # TODO fix this to handle offsets the way pint wants us to since 0.7 unit.autoconvert_offset_to_baseunit = True # append custom unit definitions and contexts import os directory = os.path.dirname(__file__) unit.load_definitions(directory + '/pint_custom_units.txt') # activate the "chemistry" context globally unit.enable_contexts('chem') # set the default string formatting for pint quantities unit.default_format = 'P~' def testfunc(val): list = [] try: list.append(float(val) * unit('')) return list except ValueError: print('Value Error') return None class Parameter: ''' Class for storing and retrieving measured parameter values together with their
from pint import UnitRegistry units = UnitRegistry() units.default_format = ".5~P" units.default_LaTeX_format = ":~L" Quantity = units.Quantity # define custom units for dealing with humid air # lbmol units.define("pound_mole = 453.59237*mol = lbmol") # mass of dry air units.define("gram_dry_air = [mass_dry_air] = g_a = g_dry_air = ga ") units.define( "pound_dry_air = 453.59237 * gram_dry_air = lb_dry_air = lba = lb_a = lbm_a = lbma = lb_dry_air = lbm_dry_air" ) # mass of humid air units.define("gram_humid_air = [mass_humid_air] = gha = g_ha = g_humid_air") units.define( "pound_humid_air = 453.59237 * gram_humid_air = lb_humid_air = lbha = lbmha = lbm_humid_air" ) # mass of water units.define("gram_water = [mass_water] = g_water = gw = g_w") units.define( "pound_water = 453.59237 * gram_water = lb_water = lb_w = lbw = lbmw = lbm_w = lbm_water" ) # molecules of dry air units.define( "mole_dry_air = [substance_dry_air] = mol_dry_air = mol_a = mola = mol_da = molda" ) units.define( "pound_mole_dry_air = 453.59237 * mol_dry_air = lbmol_dry_air = lbmol_a = lbmola = lbmol_da = lbmolda"
from pint import UnitRegistry ureg = UnitRegistry() Q = ureg.Quantity ureg.default_format = '.2f~P'
import numpy as np import pandas as pd import matplotlib as mpl import matplotlib.pyplot as plt from pint import UnitRegistry ureg = UnitRegistry() ureg.default_format = "Lx" mpl.rcParams["text.latex.preamble"] = r"\usepackage{xfrac}\usepackage{siunitx}" def plot_halftime_sequence(): halftime = pd.read_csv("data/scope_4_1.csv", header=[0, 1]) fig = plt.figure() ax = fig.add_subplot(211) ax.plot(halftime["x-axis"], halftime["1"], label="Burst Sequenz") ax.legend() ax.set_xlabel(r"$t \:\:/\:\: \si{\second}$") ax.set_ylabel(r"$U \:\:/\:\: \si{\volt}$") peak = halftime[25000:29500] peak["1"] -= peak["1"].values[0] mask = peak["1"] <= peak["1"].min() / 2 halftimes_x = peak["x-axis"].values[mask][[0, -1]]
'reaction' ]) #: Chemical engineering plant cost index (defaults to 567.5 at 2017) CE = 567.5 # %% Import base utils import pandas as pd import numpy as np from pint import UnitRegistry import os # Set pint Unit Registry _ureg = UnitRegistry() _ureg.default_format = '~P' _ureg.load_definitions( os.path.dirname(os.path.realpath(__file__)) + '/my_units_defs.txt') _Q = _ureg.Quantity _Q._repr_latex_ = _Q._repr_html_ = _Q.__str__ = _Q.__repr__ = lambda self: self.__format__( '') # Set number of digits displayed np.set_printoptions(suppress=False) np.set_printoptions(precision=3) pd.options.display.float_format = '{:.3g}'.format pd.set_option('display.max_rows', 35) pd.set_option('display.max_columns', 10) pd.set_option('max_colwidth', 35) del np, pd, os, UnitRegistry
from pint import UnitRegistry # here we assign the identifier 'unit' to the UnitRegistry unit = UnitRegistry() #use this to enable legacy handling of offset units # TODO fix this to handle offsets the way pint wants us to since 0.7 unit.autoconvert_offset_to_baseunit = True # append custom unit definitions and contexts import os directory = os.path.dirname(__file__) unit.load_definitions(directory+'/pint_custom_units.txt') # activate the "chemistry" context globally unit.enable_contexts('chem') # set the default string formatting for pint quantities unit.default_format = 'P~' def testfunc(val): list = [] try: list.append(float(val) * unit('')) return list except ValueError: print('Value Error') return None class Parameter: ''' Class for storing and retrieving measured parameter values together with their units, context, and reference information.
import sqlite3 as sql import pandas as pd import random import math import os from pint import UnitRegistry, UndefinedUnitError dbConn = sql.connect(":memory:", check_same_thread=False) dbConn.row_factory = sql.Row u_reg = UnitRegistry() u_reg.default_format = "H" def setup(): cur = dbConn.cursor() for root, dirs, files in os.walk("data"): for file in files: if file.endswith(".csv"): readFile = pd.read_csv(os.path.join(root, file)) readFile.to_sql(file.split(".")[0], dbConn, index=False) cur.execute("SELECT * FROM " + file.split(".")[0] + ";") def get_random_record(record_type: str): if record_type not in ["volumes", "times", "mass", "lengths"]: return None cur = dbConn.cursor() cur.execute("SELECT * FROM " + record_type + " WHERE rowid = abs(random()) % (SELECT max(rowid) FROM " + record_type + ") + 1;")
# ***************************************************************** # IonControl: Copyright 2016 Sandia Corporation # This Software is released under the GPL license detailed # in the file "license.txt" in the top-level IonControl directory # ***************************************************************** from pint import UnitRegistry, set_application_registry from functools import lru_cache from pint.util import UnitsContainer, infer_base_unit ureg = UnitRegistry() ureg.default_format = "~" ureg.define('samples = count / second') ureg.define('sample = count / second') set_application_registry(ureg) Q = ureg.Quantity # define a hash function for quantity def quantityHash(self): return hash(self.to_tuple()) Q.__hash__ = quantityHash def is_Q(q): return isinstance(q, Q) def value(q, unit=None): if is_Q(q): return q.m_as(unit)