def _samples(self, kappa, beta=1, return_full=False, print_progress=False): r""" Draws samples from the surrogate model (optionally the acquisition function). Calls `dynesty.NestedSampler`. Runs on a single thread even if `self.nthreads > 1`. Parameters ---------- kappa : int Acquisition function parameter. See class documentation for more information. beta : float, optional Parallel tempering parameter :math:`L^{\beta}`, where :math:`L` is the target function. By default 1. return_full : bool, optional Whether to also return the sampled log-target values and the target evidence. print_progress : bool, optional Whether to print the sampler's progress bar. Returns ------- samples : np.ndarray Sampled points from the surrogate model. logtarget : np.ndarray Optionally returned if `return_full=True`, the surrogate model target values. logz : int Optionally returned if `return_full=True`, the surrogate model evidence. """ sampler = NestedSampler(self.surrogate_predict, self._prior_transform, ndim=len(self.params), logl_kwargs={ 'kappa': kappa, 'beta': beta }, rstate=self.generator, **self._sampler_kwargs) sampler.run_nested(print_progress=print_progress) results = sampler.results logz = results.logz[-1] weights = numpy.exp(results.logwt - logz) # Resample from the posterior samples = dyfunc.resample_equal(results.samples, weights) if return_full: logtarget = self.surrogate_predict(samples) # We're only interested in the contribution to the evidence the # likelihood (our target function). The uniform prior is used only # to provide samples, hence undo its contribution. logprior = -numpy.log(self._prior_max - self._prior_min).sum() logz -= logprior return samples, logtarget, logz return samples
def construct_analytical_functions(self): """Construct invertible functions based on interpolations.""" import warnings # from dynesty import DynamicNestedSampler from dynesty import NestedSampler from collections import OrderedDict import numpy as np warnings.filterwarnings("ignore") self._free_vars = OrderedDict( (('r0', (0.25, 1.5)), ('mpow', (0, 5)), ('mtrunning', (-5, 5)), ('mrunning', (-5, 5)), ('tpow', (-5, 5)), ('trunning', (-5, 5)), ('tmrunning', (-5, 5)), ('zpow', (-5, 5)))) self._min_ilms, self._max_ilms = np.log10(np.min(self._ims)), np.log10( np.max(self._ims)) self._min_ilzs, self._max_ilzs = np.min(self._ilzs), np.max(self._ilzs) self._mlzs, self._mms, self._mts = np.meshgrid(self._ilzs, self._ims, self._its, indexing='ij') self._ndim = len(list(self._free_vars.keys())) dsampler = NestedSampler(self.rad_log_like, self.ptform, self._ndim, sample='rwalk') # dsampler.run_nested(dlogz_init=0.01) dsampler.run_nested(dlogz=1000) res = dsampler.results bbest = res['samples'][-1] prt_ts = np.linspace(0, 1, 5) test_masses = 10.0**np.linspace(self._min_ilms, self._max_ilms, 3) test_lzs = np.linspace(self._min_ilzs, self._max_ilzs, 3) for tlz in test_lzs: for tm in test_masses: print('Radii for logz = {} and m = {}'.format(tlz, tm)) print(self._radius_rgi([[tlz, tm, x] for x in prt_ts])) print(self.rad_func(bbest, tlz, tm, prt_ts)) max_frac_err = np.max( np.abs( self.rad_func(bbest, self._mlzs, self._mms, self._mts) - self._irs) / self._irs) print('Maximum fractional error: {:.1%}'.format(max_frac_err))
def nestle_multi_cos(): with closing(Pool(processes=24)) as pool: # Run nestedsampling sampler = NestedSampler(log_likelihood_cosine, prior_transform_cos, 17, bound='balls', nlive=1024,sample='rwalk',pool=pool,queue_size=24) # t0 = time.time() sampler.run_nested(dlogz=tol, print_progress=False) # don't output progress bar # t1 = time.time() pool.terminate res=sampler.results print (res.summary()) print(res.logz) return res.logz[-1],res.logzerr[-1]
def execute(self): from dynesty import NestedSampler, DynamicNestedSampler ndim = self.pipeline.nvaried sampling_method = None if self.sample == "auto" else self.sample if self.mode == "static": sampler = NestedSampler(log_probability_function, prior_transform, ndim, nlive=self.nlive, bound=self.bound, sample=sampling_method, update_interval=self.update_interval, first_update={ 'min_ncall': self.min_ncall, 'min_eff': self.min_eff }, queue_size=self.queue_size, pool=self.pool) sampler.run_nested(dlogz=self.dlogz) else: sampler = DynamicNestedSampler( log_probability_function, prior_transform, ndim, bound=self.bound, sample=sampling_method, # update_interval = self.update_interval, queue_size=self.queue_size, pool=self.pool) sampler.run_nested(dlogz_init=self.dlogz) results = sampler.results results.summary() for sample, logwt, logl in zip(results['samples'], results['logwt'], results['logl']): self.output.parameters(sample, logwt, logl) self.output.final("ncall", results['ncall']) self.output.final("efficiency", results['eff']) self.output.final("log_z", results['logz']) self.output.final("log_z_err", results['logzerr']) self.converged = True
def sampler_setup(self): # see jupyter notebook memopy_testing_evidence_analytical (env_working) # for background, reference and visualisations of this test sigma = 0.001 def loglikelihood(theta): r2 = np.sum(theta**2) logl = - r2 / (2 * sigma**2) return logl def logprior_transform_2_sphere(hypercube): # transforms a 2-dimenional vector of uniform[0, 1] random variables # into a two-dimensional uniform vector of the 2-sphere interior u = hypercube[0] v = hypercube[1] r = u**0.5 # sqrt function theta = 2* np.pi * v x = r*np.cos(theta) y = r*np.sin(theta) return np.array([x, y]) # theoretical results # logevid_analytical = -13.122363377404328 # logl_max_analytical = 0.0 # theta means = 0.0, 0.0 nlive = 1000 # number of live points bound = 'multi' # use MutliNest algorithm for bounds ndims = 2 # two parameters sample = 'unif' # unif or random walk sampling or ... tol = 0.01 # the stopping criterion sampler = NestedSampler(loglikelihood, logprior_transform_2_sphere, ndims, bound=bound, sample=sample, nlive=nlive) sampler.run_nested(dlogz=tol, print_progress=False) # don't output progress bar return sampler
def run_inference(beta, age, S, nlive=1500, lamscale=1.0, muscale=0.05, gammascale=0.05, verbose=False): # set the std of the halfnormal priors on lam, mu, gamma scales = np.array([lamscale, muscale, gammascale]) ndims = 7 + 2 * S + 1 # create dummy functions which takes only the params as an argument to pass # to dynesty prior_function = lambda flat_prior: prior_transform(flat_prior, scales) loglikelihood_function = lambda params: loglikelihood(params, beta, S, age) t0 = time() print('Performing Dynesty sampling') sampler = NestedSampler(loglikelihood_function, prior_function, ndims, bound='multi', sample='rwalk', nlive=nlive) sampler.run_nested(print_progress=verbose) res = sampler.results t1 = time() timesampler = int(t1 - t0) print("\nTime taken to run Dynesty is {} seconds".format(timesampler)) print(res.summary()) return res
def run(self, nlive=1000, cores=None, filename=None, **kwargs): merge = "no" if filename is not None and os.path.isfile(filename): doit = input(f"There seems to be a file named {filename}. " f"Would you like to run anyway? [y/n] ").lower() if doit in ["no", "n"]: with open(filename, "br") as file: self.results = pickle.load(file) return if cores is None or cores > MAX_CORES: cores = MAX_CORES try: with Pool(cores) as pool: sampler = NestedSampler( self.loglike, self.sample, self.N, npdim=self.ndim, nlive=nlive, pool=pool, queue_size=cores, **kwargs, ) sampler.run_nested() except KeyboardInterrupt: pass if filename is not None and os.path.isfile(filename): merge = input("Merge new run with previous data? [y/n] ").lower() if merge in ["no", "n"]: self.results = sampler.results else: with open(filename, "br") as file: res = pickle.load(file) self.results = merge_runs([sampler.results, res]) if filename is not None: with open(filename, "bw") as file: pickle.dump(self.results, file)
def run_multinest(self, transit_bins, transit_depths, transit_errors, eclipse_bins, eclipse_depths, eclipse_errors, fit_info, include_condensation=True, rad_method="xsec", maxiter=None, maxcall=None, nlive=100, num_final_samples=100, **dynesty_kwargs): '''Runs nested sampling to retrieve atmospheric parameters. Parameters ---------- transit_bins : array_like, shape (N,2) Wavelength bins, where wavelength_bins[i][0] is the start wavelength and wavelength_bins[i][1] is the end wavelength for bin i. transit_depths : array_like, length N Measured transit depths for the specified wavelength bins transit_errors : array_like, length N Errors on the aforementioned transit depths eclipse_bins : array_like, shape (N,2) Wavelength bins, where wavelength_bins[i][0] is the start wavelength and wavelength_bins[i][1] is the end wavelength for bin i. eclipse_depths : array_like, length N Measured eclipse depths for the specified wavelength bins eclipse_errors : array_like, length N Errors on the aforementioned eclipse depths fit_info : :class:`.FitInfo` object Tells us what parameters to freely vary, and in what range those parameters can vary. Also sets default values for the fixed parameters. include_condensation : bool, optional When determining atmospheric abundances, whether to include condensation. rad_method : string, optional "xsec" for opacity sampling, "ktables" for correlated k nlive : int Number of live points to use for nested sampling **dynesty_kwargs : keyword arguments to pass to dynesty's NestedSampler Returns ------- result : RetrievalResult object ''' transit_calc = None eclipse_calc = None if transit_bins is not None: transit_calc = TransitDepthCalculator( include_condensation=include_condensation, method=rad_method) transit_calc.change_wavelength_bins(transit_bins) self._validate_params(fit_info, transit_calc) if eclipse_bins is not None: eclipse_calc = EclipseDepthCalculator( include_condensation=include_condensation, method=rad_method) eclipse_calc.change_wavelength_bins(eclipse_bins) def transform_prior(cube): new_cube = np.zeros(len(cube)) for i in range(len(cube)): new_cube[i] = fit_info._from_unit_interval(i, cube[i]) return new_cube def multinest_ln_like(cube): ln_like = self._ln_like(cube, transit_calc, eclipse_calc, fit_info, transit_depths, transit_errors, eclipse_depths, eclipse_errors) if np.random.randint(100) == 0: print("\nEvaluated params: {}".format(self.pretty_print(fit_info))) return ln_like num_dim = fit_info._get_num_fit_params() sampler = NestedSampler(multinest_ln_like, transform_prior, num_dim, bound='multi', update_interval=float(num_dim), nlive=nlive, **dynesty_kwargs) sampler.run_nested(maxiter=maxiter, maxcall=maxcall) result = sampler.results result.logp = result.logl + np.array([fit_info._ln_prior(params) for params in result.samples]) best_params_arr = result.samples[np.argmax(result.logp)] normalized_weights = np.exp(result.logwt - np.max(result.logwt)) normalized_weights /= np.sum(normalized_weights) result.weights = normalized_weights equal_samples = dynesty.utils.resample_equal(result.samples, result.weights) np.random.shuffle(equal_samples) write_param_estimates_file( equal_samples, best_params_arr, np.max(result.logp), fit_info.fit_param_names) best_fit_transit_depths, best_fit_transit_info, best_fit_eclipse_depths, best_fit_eclipse_info = self._ln_like( best_params_arr, transit_calc, eclipse_calc, fit_info, transit_depths, transit_errors, eclipse_depths, eclipse_errors, ret_best_fit=True) retrieval_result = RetrievalResult( result, "dynesty", transit_bins, transit_depths, transit_errors, eclipse_bins, eclipse_depths, eclipse_errors, best_fit_transit_depths, best_fit_transit_info, best_fit_eclipse_depths, best_fit_eclipse_info, fit_info) retrieval_result.random_transit_depths = [] retrieval_result.random_eclipse_depths = [] for params in equal_samples[0:num_final_samples]: _, transit_info, _, eclipse_info = self._ln_like( params, transit_calc, eclipse_calc, fit_info, transit_depths, transit_errors, eclipse_depths, eclipse_errors, ret_best_fit=True) if transit_depths is not None: retrieval_result.random_transit_depths.append(transit_info["unbinned_depths"]) if eclipse_depths is not None: retrieval_result.random_eclipse_depths.append(eclipse_info["unbinned_eclipse_depths"]) with open("retrieval_result.pkl", "wb") as f: pickle.dump(retrieval_result, f) return retrieval_result
def sample(self, quiet=False): """ sample using the UltraNest numerical integration method :rtype: :returns: """ if not self._is_setup: log.info("You forgot to setup the sampler!") return loud = not quiet self._update_free_parameters() param_names = list(self._free_parameters.keys()) ndim = len(param_names) self._kwargs["ndim"] = ndim loglike, dynesty_prior = self._construct_unitcube_posterior(return_copy=True) # check if we are doing to do things in parallel if threeML_config["parallel"]["use_parallel"]: c = ParallelClient() view = c[:] self._kwargs["pool"] = view self._kwargs["queue_size"] = len(view) sampler = NestedSampler(loglike, dynesty_prior, **self._kwargs) self._sampler_kwargs["print_progress"] = loud with use_astromodels_memoization(False): log.debug("Start dynesty run") sampler.run_nested(**self._sampler_kwargs) log.debug("Dynesty run done") self._sampler = sampler results = self._sampler.results # draw posterior samples weights = np.exp(results["logwt"] - results["logz"][-1]) SQRTEPS = math.sqrt(float(np.finfo(np.float64).eps)) rstate = np.random if abs(np.sum(weights) - 1.0) > SQRTEPS: # same tol as in np.random.choice. raise ValueError("Weights do not sum to 1.") # Make N subdivisions and choose positions with a consistent random offset. nsamples = len(weights) positions = (rstate.random() + np.arange(nsamples)) / nsamples # Resample the data. idx = np.zeros(nsamples, dtype=np.int) cumulative_sum = np.cumsum(weights) i, j = 0, 0 while i < nsamples: if positions[i] < cumulative_sum[j]: idx[i] = j i += 1 else: j += 1 samples_dynesty = results["samples"][idx] self._raw_samples = samples_dynesty # now do the same for the log likes logl_dynesty = results["logl"][idx] self._log_like_values = logl_dynesty self._log_probability_values = self._log_like_values + np.array( [self._log_prior(samples) for samples in self._raw_samples] ) self._marginal_likelihood = self._sampler.results["logz"][-1] / np.log(10.0) self._build_results() # Display results if loud: self._results.display() # now get the marginal likelihood return self.samples
model_transformation = model_transformation_4 ndim = 12 + ic_cantons + 1 + 1 print("+++++++++++++++++++++++++++++") print("+++ Nested Sampling +++") print(" Case : ", args.case) print(" nlive: ", args.nlive) print(" dlogz: ", args.dlogz) print(" cores: ", args.cores) print("+++++++++++++++++++++++++++++") t = -time.time() from pathlib import Path Path("case" + str(args.case)).mkdir(parents=True, exist_ok=True) fname = 'case' + str(args.case) + '/samples_' + str( args.case) + '.pickle' pool = MyPool(args.cores) sampler = NestedSampler(model, model_transformation, ndim, nlive=args.nlive, bound='multi', pool=pool) sampler.run_nested(maxiter=1e8, dlogz=args.dlogz, add_live=True) res = sampler.results res.summary() with open(fname, 'wb') as f: pickle.dump(res, f) t += time.time() print("Total time=", t)
def dynestyfitter(lc, model, meta, log, **kwargs): """Perform sampling using dynesty. Parameters ---------- lc: eureka.S5_lightcurve_fitting.lightcurve.LightCurve The lightcurve data object model: eureka.S5_lightcurve_fitting.models.CompositeModel The composite model to fit meta: MetaClass The metadata object log: logedit.Logedit The open log in which notes from this step can be added. **kwargs: Arbitrary keyword arguments. Returns ------- best_model: eureka.S5_lightcurve_fitting.models.CompositeModel The composite model after fitting Notes ----- History: - December 29, 2021 Taylor Bell Updated documentation. Reduced repeated code. - January 7-22, 2022 Megan Mansfield Adding ability to do a single shared fit across all channels - February 23-25, 2022 Megan Mansfield Added log-uniform and Gaussian priors. - February 28-March 1, 2022 Caroline Piaulet Adding scatter_ppm parameter. """ # Group the different variable types freenames, freepars, prior1, prior2, priortype, indep_vars = group_variables( model) if hasattr(meta, 'old_fitparams') and meta.old_fitparams is not None: freepars = load_old_fitparams(meta, log, lc.channel, freenames) # DYNESTY nlive = meta.run_nlive # number of live points bound = meta.run_bound # use MutliNest algorithm for bounds ndims = len(freepars) # two parameters sample = meta.run_sample # uniform sampling tol = meta.run_tol # the stopping criterion start_lnprob = lnprob(freepars, lc, model, prior1, prior2, priortype, freenames) log.writelog(f'Starting lnprob: {start_lnprob}', mute=(not meta.verbose)) # START DYNESTY l_args = [lc, model, freenames] log.writelog('Running dynesty...') min_nlive = int(np.ceil(ndims * (ndims + 1) // 2)) if nlive < min_nlive: log.writelog( f'**** WARNING: You should set run_nlive to at least {min_nlive} ****' ) if hasattr(meta, 'ncpu') and meta.ncpu > 1: pool = Pool(meta.ncpu) queue_size = meta.ncpu else: meta.ncpu = 1 pool = None queue_size = None sampler = NestedSampler(ln_like, ptform, ndims, pool=pool, queue_size=queue_size, bound=bound, sample=sample, nlive=nlive, logl_args=l_args, ptform_args=[prior1, prior2, priortype]) sampler.run_nested(dlogz=tol, print_progress=True) # output progress bar res = sampler.results # get results dictionary from sampler if meta.ncpu > 1: pool.close() pool.join() logZdynesty = res.logz[-1] # value of logZ logZerrdynesty = res.logzerr[ -1] # estimate of the statistcal uncertainty on logZ log.writelog('', mute=(not meta.verbose)) # Need to temporarily redirect output since res.summar() prints rather than returns a string old_stdout = sys.stdout sys.stdout = mystdout = StringIO() res.summary() sys.stdout = old_stdout log.writelog(mystdout.getvalue(), mute=(not meta.verbose)) # get function that resamples from the nested samples to give sampler with equal weight # draw posterior samples weights = np.exp(res['logwt'] - res['logz'][-1]) samples = resample_equal(res.samples, weights) log.writelog('Number of posterior samples is {}'.format(len(samples)), mute=(not meta.verbose)) # Compute the medians and uncertainties fit_params = [] upper_errs = [] lower_errs = [] for i in range(ndims): q = np.percentile(samples[:, i], [16, 50, 84]) lower_errs.append(q[0]) fit_params.append(q[1]) upper_errs.append(q[2]) fit_params = np.array(fit_params) upper_errs = np.array(upper_errs) - fit_params lower_errs = fit_params - np.array(lower_errs) model.update(fit_params, freenames) if "scatter_ppm" in freenames: ind = [ i for i in np.arange(len(freenames)) if freenames[i][0:11] == "scatter_ppm" ] for chan in range(len(ind)): lc.unc_fit[chan * lc.time.size:(chan + 1) * lc.time.size] = fit_params[ind[chan]] * 1e-6 elif "scatter_mult" in freenames: ind = [ i for i in np.arange(len(freenames)) if freenames[i][0:12] == "scatter_mult" ] for chan in range(len(ind)): lc.unc_fit[chan * lc.time.size:(chan + 1) * lc.time.size] = fit_params[ ind[chan]] * lc.unc[chan * lc.time.size:(chan + 1) * lc.time.size] else: lc.unc_fit = lc.unc # Save the fit ASAP so plotting errors don't make you lose everything save_fit(meta, lc, model, 'dynesty', fit_params, freenames, samples, upper_errs=upper_errs, lower_errs=lower_errs) end_lnprob = lnprob(fit_params, lc, model, prior1, prior2, priortype, freenames) log.writelog(f'Ending lnprob: {end_lnprob}', mute=(not meta.verbose)) # plot using corner.py if meta.isplots_S5 >= 5: plots.plot_corner(samples, lc, meta, freenames, fitter='dynesty') # Make a new model instance best_model = copy.copy(model) best_model.components[0].update(fit_params, freenames) #Plot GP fit + components if model.GP: plots.plot_GP_components(lc, model, meta, fitter='dynesty') # Plot fit if meta.isplots_S5 >= 1: plots.plot_fit(lc, model, meta, fitter='dynesty') # Compute reduced chi-squared chi2red = computeRedChiSq(lc, log, model, meta, freenames) log.writelog('\nDYNESTY RESULTS:') for i in range(ndims): if 'scatter_mult' in freenames[i]: chan = freenames[i].split('_')[-1] if chan.isnumeric(): chan = int(chan) else: chan = 0 scatter_ppm = fit_params[i] * np.ma.median( lc.unc[chan * lc.time.size:(chan + 1) * lc.time.size]) * 1e6 scatter_ppm_upper = upper_errs[i] * np.ma.median( lc.unc[chan * lc.time.size:(chan + 1) * lc.time.size]) * 1e6 scatter_ppm_lower = lower_errs[i] * np.ma.median( lc.unc[chan * lc.time.size:(chan + 1) * lc.time.size]) * 1e6 log.writelog('{0}: {1} (+{2}, -{3}); {4} (+{5}, -{6}) ppm'.format( freenames[i], fit_params[i], upper_errs[i], lower_errs[i], scatter_ppm, scatter_ppm_upper, scatter_ppm_lower)) else: log.writelog('{0}: {1} (+{2}, -{3})'.format( freenames[i], fit_params[i], upper_errs[i], lower_errs[i])) log.writelog('') # Plot Allan plot if meta.isplots_S5 >= 3: plots.plot_rms(lc, model, meta, fitter='dynesty') # Plot residuals distribution if meta.isplots_S5 >= 3: plots.plot_res_distr(lc, model, meta, fitter='dynesty') best_model.__setattr__('chi2red', chi2red) best_model.__setattr__('fit_params', fit_params) return best_model
def MCMC_diagnostic(path, ndim, p, loglike, ptform, galname, nlive, **pdict): pdict = pdict['pdict'] start = time.time() pdict['start'] = start if ndim == 10: nparams = '_10P' sampler = NestedSampler(loglike, ptform, ndim=ndim, nlive=nlive, sample='unif', bound='multi', logl_kwargs=pdict, update_interval=.8, dlogz=0.5, first_update={ 'min_ncall': nlive, 'min_eff': 50. }, pool=p) sampler.run_nested(maxiter=15000, maxcall=50000) res1 = sampler.results # Save nested data # obtain KL divergence klds = [] for i in range(500): kld = dyfunc.kld_error(res1, error='simulate') klds.append(kld[-1]) print(np.mean(klds)) res1['KLval'] = np.mean(klds) with open(path + '/result_nested_P' + '{}'.format(nlive) + '.json', 'w') as ff: ff.write(json.dumps(res1, cls=NumpyEncoder)) lnz_truth = 10 * -np.log(2 * 30.) fig, axes = dyplot.runplot(res1, lnz_truth=lnz_truth) plt.savefig(path + '/runplot_' + galname + nparams + '.png') plt.close() fig, axes = dyplot.traceplot( res1, truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'], pdict['phi'] ]), truth_color='black', show_titles=True, trace_cmap='viridis', connect=True, smooth=0.02, connect_highlight=range(8), labels=[ r'$v_{rot,225}$', r'$v_{rot,450}$', r'$v_{rot,675}$', r'$v_{rot,900}$', r'$\sigma_{225}$', r'$\sigma_{450}$', r'$\sigma_{675}$', r'$\sigma_{900}$', r'$i$', r'$\phi$' ]) plt.savefig(path + '/traceplot_' + galname + nparams + '.png') plt.close() # initialize figure fig, axes = plt.subplots(2, 3, figsize=(15, 10)) # plot 6 snapshots over the course of the run for i, a in enumerate(axes.flatten()): it = int((i + 1) * res1.niter / 8.) # overplot the result onto each subplot temp = dyplot.boundplot(res1, dims=(0, 1), it=it, prior_transform=ptform, max_n_ticks=3, show_live=True, span=[(70, 150), (70, 150)], fig=(fig, a)) a.set_title('Iteration {0}'.format(it), fontsize=26) fig.tight_layout() plt.savefig(path + '/boundplot_' + galname + nparams + '.png') plt.close() fg, ax = dyplot.cornerplot( res1, color='blue', truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'], pdict['phi'] ]), # 91.8,98.3,8.88,6.5,60,60 truth_color='black', show_titles=True, smooth=0.02, max_n_ticks=5, quantiles=None, labels=[ r'$v_{rot,225}$', r'$v_{rot,450}$', r'$v_{rot,675}$', r'$v_{rot,900}$', r'$\sigma_{225}$', r'$\sigma_{450}$', r'$\sigma_{675}$', r'$\sigma_{900}$', r'$i$', r'$\phi$' ]) plt.savefig(path + '/cornerplot_' + galname + nparams + '.png') plt.close() with open(path + '/' + galname + '.txt', 'w+') as f: f.write('Running took: {} hours'.format( (time.time() - start) / 3600)) # Save the model data samples, weights = res1.samples, np.exp(res1.logwt - res1.logz[-1]) mean, cov = dyfunc.mean_and_cov(samples, weights) MaP = res1['samples'][res1['logl'].tolist().index( max(res1['logl'].tolist()))] quantiles = [ dyfunc.quantile(samps, [0.025, 0.5, 0.975], weights=weights) for samps in samples.T ] print(quantiles) # vrotsigma sigmavrot1_l = [i for i in samples[:, 0] if (i - MaP[0]) < 0] sigmavrot1_r = [i for i in samples[:, 0] if (i - MaP[0]) > 0] sigmavrot2_l = [i for i in samples[:, 1] if (i - MaP[1]) < 0] sigmavrot2_r = [i for i in samples[:, 1] if (i - MaP[1]) > 0] sigmavrot3_l = [i for i in samples[:, 2] if (i - MaP[2]) < 0] sigmavrot3_r = [i for i in samples[:, 2] if (i - MaP[2]) > 0] sigmavrot4_l = [i for i in samples[:, 3] if (i - MaP[3]) < 0] sigmavrot4_r = [i for i in samples[:, 3] if (i - MaP[3]) > 0] if len(sigmavrot1_l) == 0: sigmavrot1_l.append(0) if len(sigmavrot1_r) == 0: sigmavrot1_r.append(0) if len(sigmavrot2_l) == 0: sigmavrot2_l.append(0) if len(sigmavrot2_r) == 0: sigmavrot2_r.append(0) if len(sigmavrot3_l) == 0: sigmavrot3_l.append(0) if len(sigmavrot3_r) == 0: sigmavrot3_r.append(0) if len(sigmavrot4_l) == 0: sigmavrot4_l.append(0) if len(sigmavrot4_r) == 0: sigmavrot4_r.append(0) # vdispsigma sigmavdisp1_l = [i for i in samples[:, 4] if (i - MaP[4]) < 0] sigmavdisp1_r = [i for i in samples[:, 4] if (i - MaP[4]) > 0] sigmavdisp2_l = [i for i in samples[:, 5] if (i - MaP[5]) < 0] sigmavdisp2_r = [i for i in samples[:, 5] if (i - MaP[5]) > 0] sigmavdisp3_l = [i for i in samples[:, 6] if (i - MaP[6]) < 0] sigmavdisp3_r = [i for i in samples[:, 6] if (i - MaP[6]) > 0] sigmavdisp4_l = [i for i in samples[:, 7] if (i - MaP[7]) < 0] sigmavdisp4_r = [i for i in samples[:, 7] if (i - MaP[7]) > 0] if len(sigmavdisp1_l) == 0: sigmavdisp1_l.append(0) if len(sigmavdisp1_r) == 0: sigmavdisp1_r.append(0) if len(sigmavdisp2_l) == 0: sigmavdisp2_l.append(0) if len(sigmavdisp2_r) == 0: sigmavdisp2_r.append(0) if len(sigmavdisp3_l) == 0: sigmavdisp3_l.append(0) if len(sigmavdisp3_r) == 0: sigmavdisp3_r.append(0) if len(sigmavdisp4_l) == 0: sigmavdisp4_l.append(0) if len(sigmavdisp4_r) == 0: sigmavdisp4_r.append(0) pdict['sigmavrot'] = [(np.std(sigmavrot1_l), np.std(sigmavrot1_r)), (np.std(sigmavrot2_l), np.std(sigmavrot2_r)), (np.std(sigmavrot3_l), np.std(sigmavrot3_r)), (np.std(sigmavrot4_l), np.std(sigmavrot4_r))] pdict['sigmavdisp'] = [(np.std(sigmavdisp1_l), np.std(sigmavdisp1_r)), (np.std(sigmavdisp2_l), np.std(sigmavdisp2_r)), (np.std(sigmavdisp3_l), np.std(sigmavdisp3_r)), (np.std(sigmavdisp4_l), np.std(sigmavdisp4_r))] if len(MaP) == 8: pdict['vrot'] = MaP[0:4] pdict['vdisp'] = MaP[4:8] if len(MaP) == 9: pdict['vrot'] = MaP[0:4] pdict['vdisp'] = MaP[4:8] pdict['inc'] = MaP[8] # inc sigmainc_l = [i for i in samples[:, 8] if (i - MaP[8]) < 0] sigmainc_r = [i for i in samples[:, 8] if (i - MaP[8]) > 0] if len(sigmainc_l) == 0: sigmainc_l.append(0) if len(sigmainc_r) == 0: sigmainc_r.append(0) pdict['sigmainc'] = [(np.std(sigmainc_l), np.std(sigmainc_r))] if len(MaP) == 10: pdict['vrot'] = MaP[0:4] pdict['vdisp'] = MaP[4:8] pdict['inc'] = MaP[8] pdict['phi'] = MaP[9] # inc sigmainc_l = [i for i in samples[:, 8] if (i - MaP[8]) < 0] sigmainc_r = [i for i in samples[:, 8] if (i - MaP[8]) > 0] if len(sigmainc_l) == 0: sigmainc_l.append(0) if len(sigmainc_r) == 0: sigmainc_r.append(0) pdict['sigmainc'] = [(np.std(sigmainc_l), np.std(sigmainc_r))] # phi sigmaphi_l = [i for i in samples[:, 9] if (i - MaP[9]) < 0] sigmaphi_r = [i for i in samples[:, 9] if (i - MaP[9]) > 0] if len(sigmaphi_l) == 0: sigmaphi_l.append(0) if len(sigmaphi_r) == 0: sigmaphi_r.append(0) pdict['sigmaphi'] = [(np.std(sigmaphi_l), np.std(sigmaphi_r))] # We don't need data entry pdict['Data'] = None with open(path + '/params_model.json', 'w') as f: f.write(json.dumps(pdict, cls=NumpyEncoder))
def runMCMC(path, ndim, p, loglike, ptform, galname, **pdict): pdict = pdict['pdict'] start = time.time() pdict['start'] = start if ndim == 8: nparams = '_8P' sampler = NestedSampler(loglike, ptform, ndim=ndim, nlive=250, sample='unif', bound='multi', logl_kwargs=pdict, update_interval=0.8, dlogz=0.5, first_update={ 'min_ncall': 300, 'min_eff': 50. }, pool=p) sampler.run_nested(maxiter=15000, maxcall=50000) res1 = sampler.results with open(path + '/result_nested_P' + '{}'.format(ndim) + '.json', 'w') as ff: ff.write(json.dumps(res1, cls=NumpyEncoder)) lnz_truth = 10 * -np.log(2 * 30.) fig, axes = dyplot.runplot(res1, lnz_truth=lnz_truth) plt.savefig(path + '/runplot_' + galname + nparams + '.png') plt.close() fig, axes = dyplot.traceplot(res1, truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3] ]), truth_color='black', show_titles=True, trace_cmap='viridis', connect=True, smooth=0.02, connect_highlight=range(8), labels=[ r'$v_{rot,225}$', r'$v_{rot,450}$', r'$v_{rot,675}$', r'$v_{rot,900}$', r'$\sigma_{225}$', r'$\sigma_{450}$', r'$\sigma_{675}$', r'$\sigma_{900}$' ]) plt.savefig(path + '/traceplot_' + galname + nparams + '.png') plt.close() # plot 6 snapshots over the course of the run for i, a in enumerate(axes.flatten()): it = int((i + 1) * res1.niter / 8.) # overplot the result onto each subplot temp = dyplot.boundplot(res1, dims=(0, 1), it=it, prior_transform=ptform, max_n_ticks=5, show_live=True, span=[(70, 150), (70, 150)], fig=(fig, a)) a.set_title('Iteration {0}'.format(it), fontsize=26) fig.tight_layout() plt.savefig(path + '/boundplot_' + galname + nparams + '.png') plt.close() matplotlib.rcParams.update({'font.size': 16}) fig, axes = dyplot.cornerplot( res1, color='blue', truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'], pdict['phi'] ]), truth_color='black', show_titles=True, smooth=0.02, max_n_ticks=5, quantiles=[0.16, 0.5, 0.84], labels=[ r'$V_{225}[km/s]$', r'$V_{450}[km/s]$', r'$V_{675}[km/s]$', r'$V_{900}[km/s]$', r'$\sigma_{gas,225}[km/s]$', r'$\sigma_{gas,450}[km/s]$', r'$\sigma_{gas,675}[km/s]$', r'$\sigma_{gas,900}[km/s]$', r'$i[deg]$', r'$\phi[deg]$' ]) # Save the model data samples, weights = res1.samples, np.exp(res1.logwt - res1.logz[-1]) mean, cov = dyfunc.mean_and_cov(samples, weights) MaP = res1['samples'][res1['logl'].tolist().index( max(res1['logl'].tolist()))] quantiles = [ dyfunc.quantile(samps, [0.16, 0.5, 0.84], weights=weights) for samps in samples.T ] labels = [ r'$V_{225}$', r'$V_{450}$', r'$V_{675}$', r'$V_{900}$', r'$\sigma_{gas,225}$', r'$\sigma_{gas,450}$', r'$\sigma_{gas,675}$', r'$\sigma_{gas,900}$', r'$i$', r'$\phi$' ] units = [ ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [deg]', ' [deg]' ] for i in range(ndim): ax = axes[i, i] q5 = np.round(quantiles[i][1], 2) q14 = np.round(quantiles[i][0], 2) q84 = np.round(quantiles[i][2], 2) ax.set_title(r"$%.2f_{%.2f}^{+%.2f}$" % (q5, -1 * abs(q5 - q14), abs(q5 - q84)) + units[i]) # Loop over the histograms for yi in range(ndim): axes[yi, 0].set_ylabel(labels[yi] + units[yi], labelpad=30, fontsize=20) axes[-1, yi].set_xlabel(labels[yi] + units[yi], labelpad=30, fontsize=20) axes[yi, 0].tick_params(axis='y', which='major', labelsize=14) axes[-1, yi].tick_params(axis='x', which='major', labelsize=14) fig.tight_layout() plt.savefig(path + '/cornerplot_' + galname + nparams + '.pdf') plt.close() with open(path + '/' + galname + '.txt', 'w+') as f: f.write('Running took: {} hours'.format( (time.time() - start) / 3600)) elif ndim == 9: nparams = '_9P' sampler = NestedSampler(loglike, ptform, ndim=ndim, nlive=250, sample='unif', bound='multi', logl_kwargs=pdict, update_interval=0.8, dlogz=0.5, first_update={ 'min_ncall': 300, 'min_eff': 50. }, pool=p) sampler.run_nested(maxiter=15000, maxcall=50000) res1 = sampler.results with open(path + '/result_nested_P' + '{}'.format(ndim) + '.json', 'w') as ff: ff.write(json.dumps(res1, cls=NumpyEncoder)) lnz_truth = 10 * -np.log(2 * 30.) fig, axes = dyplot.runplot(res1, lnz_truth=lnz_truth) plt.savefig(path + '/runplot_' + galname + nparams + '.png') plt.close() fig, axes = dyplot.traceplot( res1, truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'] ]), truth_color='black', show_titles=True, trace_cmap='viridis', connect=True, smooth=0.02, connect_highlight=range(8), labels=[ r'$v_{rot,225}$', r'$v_{rot,450}$', r'$v_{rot,675}$', r'$v_{rot,900}$', r'$\sigma_{225}$', r'$\sigma_{450}$', r'$\sigma_{675}$', r'$\sigma_{900}$', r'$i$' ]) plt.savefig(path + '/traceplot_' + galname + nparams + '.png') plt.close() # initialize figure fig, axes = plt.subplots(2, 3, figsize=(15, 10)) # plot 6 snapshots over the course of the run for i, a in enumerate(axes.flatten()): it = int((i + 1) * res1.niter / 8.) # overplot the result onto each subplot temp = dyplot.boundplot(res1, dims=(0, 1), it=it, prior_transform=ptform, max_n_ticks=3, show_live=True, span=[(70, 150), (70, 150)], fig=(fig, a)) a.set_title('Iteration {0}'.format(it), fontsize=26) fig.tight_layout() plt.savefig(path + '/boundplot_' + galname + nparams + '.png') plt.close() matplotlib.rcParams.update({'font.size': 16}) fig, axes = dyplot.cornerplot( res1, color='blue', truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'] ]), truth_color='black', show_titles=True, smooth=0.02, max_n_ticks=5, quantiles=[0.16, 0.5, 0.84], labels=[ r'$V_{225}[km/s]$', r'$V_{450}[km/s]$', r'$V_{675}[km/s]$', r'$V_{900}[km/s]$', r'$\sigma_{gas,225}[km/s]$', r'$\sigma_{gas,450}[km/s]$', r'$\sigma_{gas,675}[km/s]$', r'$\sigma_{gas,900}[km/s]$', r'$i[deg]$' ]) # Save the model data samples, weights = res1.samples, np.exp(res1.logwt - res1.logz[-1]) mean, cov = dyfunc.mean_and_cov(samples, weights) MaP = res1['samples'][res1['logl'].tolist().index( max(res1['logl'].tolist()))] quantiles = [ dyfunc.quantile(samps, [0.16, 0.5, 0.84], weights=weights) for samps in samples.T ] labels = [ r'$V_{225}$', r'$V_{450}$', r'$V_{675}$', r'$V_{900}$', r'$\sigma_{gas,225}$', r'$\sigma_{gas,450}$', r'$\sigma_{gas,675}$', r'$\sigma_{gas,900}$', r'$i$', r'$\phi$' ] units = [ ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [deg]', ' [deg]' ] for i in range(ndim): ax = axes[i, i] q5 = np.round(quantiles[i][1], 2) q14 = np.round(quantiles[i][0], 2) q84 = np.round(quantiles[i][2], 2) ax.set_title(r"$%.2f_{%.2f}^{+%.2f}$" % (q5, -1 * abs(q5 - q14), abs(q5 - q84)) + units[i]) # Loop over the histograms for yi in range(ndim): axes[yi, 0].set_ylabel(labels[yi] + units[yi], labelpad=30, fontsize=20) axes[-1, yi].set_xlabel(labels[yi] + units[yi], labelpad=30, fontsize=20) axes[yi, 0].tick_params(axis='y', which='major', labelsize=14) axes[-1, yi].tick_params(axis='x', which='major', labelsize=14) fig.tight_layout() plt.savefig(path + '/cornerplot_' + galname + nparams + '.pdf') plt.close() with open(path + '/' + galname + '.txt', 'w+') as f: f.write('Running took: {} hours'.format( (time.time() - start) / 3600)) elif ndim == 10: nparams = '_10P' sampler = NestedSampler(loglike, ptform, ndim=ndim, nlive=250, sample='unif', bound='multi', logl_kwargs=pdict, update_interval=.8, dlogz=0.5, first_update={ 'min_ncall': 300, 'min_eff': 50. }, pool=p) sampler.run_nested(maxiter=15000, maxcall=50000) res1 = sampler.results with open(path + '/result_nested_P' + '{}'.format(ndim) + '.json', 'w') as ff: ff.write(json.dumps(res1, cls=NumpyEncoder)) lnz_truth = 10 * -np.log(2 * 30.) fig, axes = dyplot.runplot(res1, lnz_truth=lnz_truth) plt.savefig(path + '/runplot_' + galname + nparams + '.png') plt.close() fig, axes = dyplot.traceplot( res1, truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'], pdict['phi'] ]), truth_color='black', show_titles=True, trace_cmap='viridis', connect=True, smooth=0.02, connect_highlight=range(8), labels=[ r'$v_{rot,225}$', r'$v_{rot,450}$', r'$v_{rot,675}$', r'$v_{rot,900}$', r'$\sigma_{225}$', r'$\sigma_{450}$', r'$\sigma_{675}$', r'$\sigma_{900}$', r'$i$', r'$\phi$' ]) plt.savefig(path + '/traceplot_' + galname + nparams + '.png') plt.close() # initialize figure fig, axes = plt.subplots(2, 3, figsize=(15, 10)) # plot 6 snapshots over the course of the run for i, a in enumerate(axes.flatten()): it = int((i + 1) * res1.niter / 8.) # overplot the result onto each subplot temp = dyplot.boundplot(res1, dims=(0, 1), it=it, prior_transform=ptform, max_n_ticks=3, show_live=True, span=[(70, 150), (70, 150)], fig=(fig, a)) a.set_title('Iteration {0}'.format(it), fontsize=26) fig.tight_layout() plt.savefig(path + '/boundplot_' + galname + nparams + '.png') plt.close() matplotlib.rcParams.update({'font.size': 16}) fig, axes = dyplot.cornerplot( res1, color='blue', truths=np.array([ pdict['vrot'][0], pdict['vrot'][1], pdict['vrot'][2], pdict['vrot'][3], pdict['vdisp'][0], pdict['vdisp'][1], pdict['vdisp'][2], pdict['vdisp'][3], pdict['inc'], pdict['phi'] ]), truth_color='black', show_titles=True, smooth=0.02, max_n_ticks=5, quantiles=[0.16, 0.5, 0.84], labels=[ r'$V_{225}[km/s]$', r'$V_{450}[km/s]$', r'$V_{675}[km/s]$', r'$V_{900}[km/s]$', r'$\sigma_{gas,225}[km/s]$', r'$\sigma_{gas,450}[km/s]$', r'$\sigma_{gas,675}[km/s]$', r'$\sigma_{gas,900}[km/s]$', r'$i[deg]$', r'$\phi[deg]$' ]) # Save the model data samples, weights = res1.samples, np.exp(res1.logwt - res1.logz[-1]) mean, cov = dyfunc.mean_and_cov(samples, weights) MaP = res1['samples'][res1['logl'].tolist().index( max(res1['logl'].tolist()))] quantiles = [ dyfunc.quantile(samps, [0.16, 0.5, 0.84], weights=weights) for samps in samples.T ] labels = [ r'$V_{225}$', r'$V_{450}$', r'$V_{675}$', r'$V_{900}$', r'$\sigma_{gas,225}$', r'$\sigma_{gas,450}$', r'$\sigma_{gas,675}$', r'$\sigma_{gas,900}$', r'$i$', r'$\phi$' ] units = [ ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [km/s]', ' [deg]', ' [deg]' ] for i in range(ndim): ax = axes[i, i] q5 = np.round(quantiles[i][1], 2) q14 = np.round(quantiles[i][0], 2) q84 = np.round(quantiles[i][2], 2) ax.set_title(r"$%.2f_{%.2f}^{+%.2f}$" % (q5, -1 * abs(q5 - q14), abs(q5 - q84)) + units[i]) # Loop over the histograms for yi in range(ndim): axes[yi, 0].set_ylabel(labels[yi] + units[yi], labelpad=30, fontsize=20) axes[-1, yi].set_xlabel(labels[yi] + units[yi], labelpad=30, fontsize=20) axes[yi, 0].tick_params(axis='y', which='major', labelsize=14) axes[-1, yi].tick_params(axis='x', which='major', labelsize=14) fig.tight_layout() plt.savefig(path + '/cornerplot_' + galname + nparams + '.pdf') plt.close() with open(path + '/' + galname + '.txt', 'w+') as f: f.write('Running took: {} hours'.format( (time.time() - start) / 3600)) # Save the model data samples, weights = res1.samples, np.exp(res1.logwt - res1.logz[-1]) mean, cov = dyfunc.mean_and_cov(samples, weights) MaP = res1['samples'][res1['logl'].tolist().index( max(res1['logl'].tolist()))] quantiles = [ dyfunc.quantile(samps, [0.16, 0.5, 0.84], weights=weights) for samps in samples.T ] pdict['sigmavrot'] = [(quantiles[0][0], quantiles[0][2]), (quantiles[1][0], quantiles[1][2]), (quantiles[2][0], quantiles[2][2]), (quantiles[3][0], quantiles[3][2])] pdict['sigmavdisp'] = [(quantiles[4][0], quantiles[4][2]), (quantiles[5][0], quantiles[5][2]), (quantiles[6][0], quantiles[6][2]), (quantiles[7][0], quantiles[7][2])] pdict['vrot'] = [ quantiles[0][1], quantiles[1][1], quantiles[2][1], quantiles[3][1] ] pdict['vdisp'] = [ quantiles[4][1], quantiles[5][1], quantiles[6][1], quantiles[7][1] ] if len(quantiles) == 9: pdict['inc'] = quantiles[8][1] pdict['sigmainc'] = [(quantiles[8][0], quantiles[8][2])] if len(quantiles) == 10: pdict['inc'] = quantiles[8][1] pdict['sigmainc'] = [(quantiles[8][0], quantiles[8][2])] pdict['phi'] = quantiles[9][1] pdict['sigmaphi'] = [(quantiles[9][0], quantiles[9][2])] # We don't need data entry, waste of space pdict['Data'] = None with open(path + '/params_model.json', 'w') as f: f.write(json.dumps(pdict, cls=NumpyEncoder))
dlogZdynesty = dres.logz[-1] # value of logZ dlogZerrdynesty = dres.logzerr[-1] # estimate of the statistcal uncertainty on logZ # output marginal likelihood print('Marginalised evidence (using dynamic sampler) is {} ± {}'.format(dlogZdynesty, dlogZerrdynesty)) # get the posterior samples dweights = np.exp(dres['logwt'] - dres['logz'][-1]) dpostsamples = resample_equal(dres.samples, dweights) print('Number of posterior samples (using dynamic sampler) is {}'.format(dpostsamples.shape[0])) # Now run with the static sampler sampler = NestedSampler(loglikelihood_dynesty, prior_transform, ndims, bound=bound, sample=sample, nlive=nlive) sampler.run_nested(dlogz=0.1) res = sampler.results logZdynesty = res.logz[-1] # value of logZ logZerrdynesty = res.logzerr[-1] # estimate of the statistcal uncertainty on logZ # output marginal likelihood print('Marginalised evidence (using static sampler) is {} ± {}'.format(logZdynesty, logZerrdynesty)) # get the posterior samples weights = np.exp(res['logwt'] - res['logz'][-1]) postsamples = resample_equal(res.samples, weights) print('Number of posterior samples (using static sampler) is {}'.format(postsamples.shape[0]))
# get the posterior samples dweights = np.exp(dres['logwt'] - dres['logz'][-1]) dpostsamples = resample_equal(dres.samples, dweights) print('Number of posterior samples (using dynamic sampler) is {}'.format( dpostsamples.shape[0])) # Now run with the static sampler sampler = NestedSampler(loglikelihood_dynesty, prior_transform, ndims, bound=bound, sample=sample, nlive=nlive) sampler.run_nested(dlogz=0.1) res = sampler.results logZdynesty = res.logz[-1] # value of logZ logZerrdynesty = res.logzerr[ -1] # estimate of the statistcal uncertainty on logZ # output marginal likelihood print('Marginalised evidence (using static sampler) is {} ± {}'.format( logZdynesty, logZerrdynesty)) # get the posterior samples weights = np.exp(res['logwt'] - res['logz'][-1]) postsamples = resample_equal(res.samples, weights)
obs_times, obs_wavs, obs_excess, obs_excess_error = get_obs_data( config["spectrum"], config["error"], config["min_wav"], config["max_wav"]) def multinest_ln_like(cube): return get_ln_like(cube, config, obs_times, obs_wavs, obs_excess, obs_excess_error) sampler = NestedSampler(multinest_ln_like, transform_prior, 3, bound='multi', nlive=100) sampler.run_nested() result = sampler.results normalized_weights = np.exp(result.logwt - np.max(result.logwt)) normalized_weights /= np.sum(normalized_weights) result.weights = normalized_weights with open("dynesty_result.pkl", "wb") as f: pickle.dump(result, f) best_params = result.samples[np.argmax(result.logl)] get_ln_like(best_params, config, obs_times, obs_wavs, obs_excess, obs_excess_error, plot=True)
def rebuild_current_distribution( fields: np.ndarray, ics: np.ndarray, jj_size: float, current_pattern: List[Union[Literal["f"], str]], sweep_invariants: List[Union[Literal["offset"], Literal["field_to_k"]]] = [ "offset", "field_to_k", ], precision: float = 100, n_points: int = 2 ** 10 + 1, ) -> dict: """Rebuild a current distribution from a Fraunhofer pattern. This assumes a uniform field focusing since allowing a non uniform focusing would lead to a much larger space to explore. Parameters ---------- fields : np.ndarray Out of plane field for which the critical current was measured. ics : np.ndarray Critical current of the junction. jj_size : float Size of the junction. current_pattern : List[Union[Literal["f"], str]] Describe in how many pieces to use to represent the junction. If the input arrays are more than 1D, "f" means that value is the same across all outer dimension, "v" means that the slice takes different value for all outer dimension (ie. one value per sweep). sweep_invariants : Tuple[Union[Literal["offset", "field_to_k"]]] Indicate what quantities are invariants across sweep for more the 1D inputs. precision : float, optional pass n_points : int, optional Returns ------- dict """ # Get the offset and estimated amplitude used in the prior # We do not use the estimated current and phase distribution to give the # more space to the algorithm. offsets, first_node_locs, _, _, _ = guess_current_distribution( field, fraunhofer, site_number, jj_size ) # Gives a Fraunhofer pattern at the first node for v[1] = 1 field_to_ks = 2 * np.pi / jj_size / np.abs(first_node_locs - offsets) # Determine the dimensionality of the problem based on the invariants and # the shape of the inputs. if len(sweep_invariants) > 2: raise ValueError("There are at most 2 invariants.") if any(k for k in sweep_invariants if k not in ("offset", "field_to_k")): raise ValueError( f"Invalid invariant specified {sweep_invariants}, " "valid values are 'offset', 'field_to_k'." ) shape = fields.shape[:-1] shape_product = prod(shape) if shape else 0 if shape_product == 0 and any(p.startswith("v") for p in current_pattern): raise ValueError( "Found variable current in the distribution but the measurements are 1D." ) dim = len(sweep_invariants) + current_pattern.count("f") dim += shape_product * (current_pattern.count("v") + 2 - len(sweep_invariants)) # Pre-compute slices to access elements in the prior and log-like offset_access = slice( 0, 1 if "offset" in sweep_invariants else (shape_product or 1) ) field_to_k_access = slice( offset_access.stop, offset_access.stop + 1 if "field_to_k" in sweep_invariants else (shape_product or 1), ) stop = field_to_k_access.stop current_density_accesses = [] for p in current_pattern: if p == "f": current_density_accesses.append(slice(stop, stop + 1)) stop += 1 elif p == "v": current_density_accesses.append(slice(stop, stop + (shape_product or 1))) stop += current_density_accesses[-1].stop else: raise ValueError( f"Valid values in current_pattern are 'f' and 'v', found '{p}'" ) def prior(u): """Map the sampled in 0-1 to the relevant values range. For all values we consider the values in the prior to be the log of the values we are looking for. """ v = np.empty_like(u) v[offset_access] = 4 * u[offset_access] - 2 v[field_to_k_access] = 4 * u[field_to_k_access] - 2 stop += step # For all the amplitude we map the value between 0 and -X since the # amplitude of a single segment cannot be larger than the total current # X is determined based on the number of segments ampl = -np.log10(len(current_pattern)) for sl in current_density_accesses: v[sl] = u[sl] * ampl return v def loglike(v): """Compute the distance to the data""" # We turn invariant input into their variant form (from 1 occurence in v # to n repetition in w) to ease a systematic writing of the loglike. stop = step = shape_product or 1 w = np.empty((2 + len(current_pattern)) * (shape_product or 1)) stop = step = shape_product or 1 w[0:stop] = w_offset = v[offset_access] w[stop : stop + step] = w_f2k = v[field_to_k_access] stop += step for sl in current_density_accesses: w[stop : stop + step] = v[sl] # Pack the current distribution so that each line corresponds to different # conditions c_density = w[stop + step :].reshape((len(current_pattern), -1)).T err = np.empty_like(ics) it = np.nditer((offsets, first_node_locs, field_to_ks), ["multi_index"]) for i, (off, fnloc, f2k) in enumerate(it): # Compute the offset f_off = off + np.sign(w_off[i]) * 10 ** -abs(w_off[i]) * fnloc # Compute the Fraunhofer pattern f = produce_fraunhofer_fast( (fields[it.multi_index] - f_off[i]), f2k * 10 ** w_f2k[i], jj_size, c_density[i], 2 ** 10 + 1, ) # Compute and store the error err[it.multi_index] = np.sum( (100 * (ics[it.multi_index] - f) / amplitude) ** 2 ) return -np.ravel(err) # XXX do that nasty part later sampler = NestedSampler(loglike, prior, dim) sampler.run_nested(dlogz=precision) res = sampler.results weights = np.exp(res.logwt - res.logz[-1]) mu, cov = utils.mean_and_cov(res["samples"], weights) res["fraunhofer_params"] = { "offset": offset + np.sign(mu[0]) * 10 ** -abs(mu[0]) * first_node_loc, "field_to_k": 2 * np.pi / jj_size / abs(first_node_loc - offset) * 10 ** mu[1], "amplitude": amplitude * 10 ** mu[2], "current_distribution": np.array( [1 - np.sum(mu[3 : 3 + site_number - 1])] + list(mu[3 : 3 + site_number - 1]) ), "phase_distribution": np.array( [0] + list(mu[3 + site_number - 1 : 3 + 2 * site_number - 2]) ), } return res
def main(path2config): # load the yaml parameters config = yaml.load(open(path2config)) sim_params = config['sim_params'] HOD_params = config['HOD_params'] clustering_params = config['clustering_params'] data_params = config['data_params'] dynesty_config_params = config['dynesty_config_params'] fit_params = config['dynesty_fit_params'] # create a new abacushod object and load the subsamples newBall = AbacusHOD(sim_params, HOD_params, clustering_params) # read data parameters newData = wp_Data(data_params, HOD_params) # parameters to fit nparams = len(fit_params.keys()) param_mapping = {} param_tracer = {} params = np.zeros((nparams, 2)) for key in fit_params.keys(): mapping_idx = fit_params[key][0] tracer_type = fit_params[key][-1] param_mapping[key] = mapping_idx param_tracer[key] = tracer_type params[mapping_idx, :] = fit_params[key][1:-1] # Make path to output if not os.path.isdir( os.path.expanduser(dynesty_config_params['path2output'])): try: os.makedirs( os.path.expanduser(dynesty_config_params['path2output'])) except: pass # dynesty parameters nlive = dynesty_config_params['nlive'] maxcall = dynesty_config_params['maxcall'] method = dynesty_config_params['method'] bound = dynesty_config_params['bound'] # where to record prefix_chain = os.path.join( os.path.expanduser(dynesty_config_params['path2output']), dynesty_config_params['chainsPrefix']) # initiate sampler found_file = os.path.isfile(prefix_chain + '.dill') if (not found_file) or (not dynesty_config_params['rerun']): # initialize our nested sampler sampler = NestedSampler( lnprob, prior_transform, nparams, logl_args=[param_mapping, param_tracer, newData, newBall], ptform_args=[params[:, 0], params[:, 1]], nlive=nlive, sample=method, rstate=np.random.RandomState(dynesty_config_params['rseed'])) # first_update = {'min_eff': 20}) else: # load sampler to continue the run with open(prefix_chain + '.dill', "rb") as f: sampler = dill.load(f) sampler.rstate = np.load(prefix_chain + '_results.npz')['rstate'] print("run sampler") sampler.run_nested(maxcall=maxcall) # save sampler itself with open(prefix_chain + '.dill', "wb") as f: dill.dump(sampler, f) res1 = sampler.results np.savez(prefix_chain + '_results.npz', res=res1, rstate=np.random.get_state())
def run_multinest(self, transit_bins, transit_depths, transit_errors, eclipse_bins, eclipse_depths, eclipse_errors, fit_info, include_condensation=True, plot_best=False, maxiter=None, maxcall=None, nlive=100, **dynesty_kwargs): '''Runs nested sampling to retrieve atmospheric parameters. Parameters ---------- transit_bins : array_like, shape (N,2) Wavelength bins, where wavelength_bins[i][0] is the start wavelength and wavelength_bins[i][1] is the end wavelength for bin i. transit_depths : array_like, length N Measured transit depths for the specified wavelength bins transit_errors : array_like, length N Errors on the aforementioned transit depths eclipse_bins : array_like, shape (N,2) Wavelength bins, where wavelength_bins[i][0] is the start wavelength and wavelength_bins[i][1] is the end wavelength for bin i. eclipse_depths : array_like, length N Measured eclipse depths for the specified wavelength bins eclipse_errors : array_like, length N Errors on the aforementioned eclipse depths fit_info : :class:`.FitInfo` object Tells us what parameters to freely vary, and in what range those parameters can vary. Also sets default values for the fixed parameters. include_condensation : bool, optional When determining atmospheric abundances, whether to include condensation. plot_best : bool, optional If True, plots the best fit model with the data nlive : int Number of live points to use for nested sampling **dynesty_kwargs : keyword arguments to pass to dynesty's NestedSampler Returns ------- result : Result object This returns dynesty's NestedSampler 'results' field, slightly modified. The object is dictionary-like and has many useful items. For example, result.samples (or alternatively, result["samples"]) are the parameter values of each sample, result.logwt contains the log(weights), result.weights contains the normalized weights (this is added by PLATON), result.logl contains the ln likelihoods, and result.logp contains the ln posteriors (this is added by PLATON). result.logz is the natural logarithm of the evidence. ''' transit_calc = TransitDepthCalculator( include_condensation=include_condensation) transit_calc.change_wavelength_bins(transit_bins) eclipse_calc = EclipseDepthCalculator() eclipse_calc.change_wavelength_bins(eclipse_bins) self._validate_params(fit_info, transit_calc) def transform_prior(cube): new_cube = np.zeros(len(cube)) for i in range(len(cube)): new_cube[i] = fit_info._from_unit_interval(i, cube[i]) return new_cube def multinest_ln_like(cube): ln_like = self._ln_like(cube, transit_calc, eclipse_calc, fit_info, transit_depths, transit_errors, eclipse_depths, eclipse_errors) if np.random.randint(100) == 0: print("\nEvaluated params: {}".format( self.pretty_print(fit_info))) return ln_like num_dim = fit_info._get_num_fit_params() sampler = NestedSampler(multinest_ln_like, transform_prior, num_dim, bound='multi', sample='rwalk', update_interval=float(num_dim), nlive=nlive, **dynesty_kwargs) sampler.run_nested(maxiter=maxiter, maxcall=maxcall) result = sampler.results result.logp = result.logl + np.array( [fit_info._ln_prior(params) for params in result.samples]) best_params_arr = result.samples[np.argmax(result.logp)] normalized_weights = np.exp(result.logwt) / np.sum(np.exp( result.logwt)) result.weights = normalized_weights write_param_estimates_file( dynesty.utils.resample_equal(result.samples, normalized_weights), best_params_arr, np.max(result.logp), fit_info.fit_param_names) if plot_best: self._ln_prob(best_params_arr, transit_calc, eclipse_calc, fit_info, transit_depths, transit_errors, eclipse_depths, eclipse_errors, plot=True) plt.figure(3) dyplot.runplot(result) plt.savefig("dyplot_runplot.png") plt.figure(4) dyplot.traceplot(result) plt.savefig("dyplot_traceplot.png") return result