示例#1
0
    def test_chemical_environments_matches_OE(self):
        """Test Topology.chemical_environment_matches"""
        from simtk.openmm import app

        toolkit_wrapper = OpenEyeToolkitWrapper()
        pdbfile = app.PDBFile(
            get_data_file_path(
                "systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb"))
        # toolkit_wrapper = RDKitToolkitWrapper()
        molecules = [
            Molecule.from_file(get_data_file_path(name))
            for name in ("molecules/ethanol.mol2",
                         "molecules/cyclohexane.mol2")
        ]
        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        # Test for substructure match
        matches = topology.chemical_environment_matches(
            "[C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 143
        assert matches[0].topology_atom_indices == (1728, 1729, 1730)
        # Test for whole-molecule match
        matches = topology.chemical_environment_matches(
            "[H][C:1]([H])([H])-[C:2]([H])([H])-[O:3][H]",
            toolkit_registry=toolkit_wrapper,
        )
        assert (len(matches) == 1716
                )  # 143 * 12 (there are 12 possible hydrogen mappings)
        assert matches[0].topology_atom_indices == (1728, 1729, 1730)
        # Search for a substructure that isn't there
        matches = topology.chemical_environment_matches(
            "[C][C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 0
示例#2
0
    def setUp(self):
        self.empty_molecule = Molecule()
        self.ethane_from_smiles = Molecule.from_smiles("CC")
        self.ethene_from_smiles = Molecule.from_smiles("C=C")
        self.propane_from_smiles = Molecule.from_smiles("CCC")

        filename = get_data_file_path("molecules/toluene.sdf")
        self.toluene_from_sdf = Molecule.from_file(filename)
        if OpenEyeToolkitWrapper.is_available():
            filename = get_data_file_path("molecules/toluene_charged.mol2")
            # TODO: This will require openeye to load
            self.toluene_from_charged_mol2 = Molecule.from_file(filename)
        self.charged_methylamine_from_smiles = Molecule.from_smiles(
            "[H]C([H])([H])[N+]([H])([H])[H]")

        molecule = Molecule.from_smiles("CC")
        carbons = [atom for atom in molecule.atoms if atom.atomic_number == 6]
        c0_hydrogens = [
            atom for atom in carbons[0].bonded_atoms if atom.atomic_number == 1
        ]
        molecule.add_bond_charge_virtual_site(
            (carbons[0], carbons[1]),
            0.1 * unit.angstrom,
            charge_increments=[0.1, 0.05] * unit.elementary_charge,
        )
        molecule.add_monovalent_lone_pair_virtual_site(
            (c0_hydrogens[0], carbons[0], carbons[1]),
            0.2 * unit.angstrom,
            20 * unit.degree,
            25 * unit.degree,
            charge_increments=[0.01, 0.02, 0.03] * unit.elementary_charge,
        )
        self.ethane_from_smiles_w_vsites = Molecule(molecule)

        # Make a propane with virtual sites
        molecule = Molecule.from_smiles("CCC")
        carbons = [atom for atom in molecule.atoms if atom.atomic_number == 6]
        c0_hydrogens = [
            atom for atom in carbons[0].bonded_atoms if atom.atomic_number == 1
        ]
        molecule.add_bond_charge_virtual_site(
            (carbons[0], carbons[1]),
            0.1 * unit.angstrom,
            charge_increments=[0.1, 0.05] * unit.elementary_charge,
        )
        molecule.add_monovalent_lone_pair_virtual_site(
            (c0_hydrogens[0], carbons[0], carbons[1]),
            0.2 * unit.angstrom,
            20 * unit.degree,
            25 * unit.degree,
            charge_increments=[0.01, 0.02, 0.03] * unit.elementary_charge,
        )
        self.propane_from_smiles_w_vsites = Molecule(molecule)
示例#3
0
class TestTopology(TestCase):
    def setUp(self):
        self.empty_molecule = Molecule()
        self.ethane_from_smiles = Molecule.from_smiles('CC')
        self.ethene_from_smiles = Molecule.from_smiles('C=C')
        self.propane_from_smiles = Molecule.from_smiles('CCC')

        filename = get_data_file_path('molecules/toluene.sdf')
        self.toluene_from_sdf = Molecule.from_file(filename)
        if OpenEyeToolkitWrapper.is_available():
            filename = get_data_file_path('molecules/toluene_charged.mol2')
            # TODO: This will require openeye to load
            self.toluene_from_charged_mol2 = Molecule.from_file(filename)
        self.charged_methylamine_from_smiles = Molecule.from_smiles(
            '[H]C([H])([H])[N+]([H])([H])[H]')

        molecule = Molecule.from_smiles('CC')
        carbons = [atom for atom in molecule.atoms if atom.atomic_number == 6]
        c0_hydrogens = [
            atom for atom in carbons[0].bonded_atoms if atom.atomic_number == 1
        ]
        molecule.add_bond_charge_virtual_site(
            (carbons[0], carbons[1]),
            0.1 * unit.angstrom,
            charge_increments=[0.1, 0.05] * unit.elementary_charge)
        molecule.add_monovalent_lone_pair_virtual_site(
            (c0_hydrogens[0], carbons[0], carbons[1]),
            0.2 * unit.angstrom,
            20 * unit.degree,
            25 * unit.degree,
            charge_increments=[0.01, 0.02, 0.03] * unit.elementary_charge)
        self.ethane_from_smiles_w_vsites = Molecule(molecule)

        # Make a propane with virtual sites
        molecule = Molecule.from_smiles('CCC')
        carbons = [atom for atom in molecule.atoms if atom.atomic_number == 6]
        c0_hydrogens = [
            atom for atom in carbons[0].bonded_atoms if atom.atomic_number == 1
        ]
        molecule.add_bond_charge_virtual_site(
            (carbons[0], carbons[1]),
            0.1 * unit.angstrom,
            charge_increments=[0.1, 0.05] * unit.elementary_charge)
        molecule.add_monovalent_lone_pair_virtual_site(
            (c0_hydrogens[0], carbons[0], carbons[1]),
            0.2 * unit.angstrom,
            20 * unit.degree,
            25 * unit.degree,
            charge_increments=[0.01, 0.02, 0.03] * unit.elementary_charge)
        self.propane_from_smiles_w_vsites = Molecule(molecule)

    def test_empty(self):
        """Test creation of empty topology"""
        topology = Topology()
        assert topology.n_reference_molecules == 0
        assert topology.n_topology_molecules == 0
        assert topology.n_topology_atoms == 0
        assert topology.n_topology_bonds == 0
        assert topology.n_topology_particles == 0
        assert topology.n_topology_virtual_sites == 0
        assert topology.box_vectors is None
        assert len(topology.constrained_atom_pairs.items()) == 0

    def test_box_vectors(self):
        """Test the getter and setter for box_vectors"""
        topology = Topology()
        good_box_vectors = unit.Quantity(np.array([10, 20, 30]), unit.angstrom)
        bad_box_vectors = np.array([10, 20, 30
                                    ])  # They're bad because they're unitless
        assert topology.box_vectors is None

        with self.assertRaises(ValueError) as context:
            topology.box_vectors = bad_box_vectors
        assert topology.box_vectors is None

        topology.box_vectors = good_box_vectors
        assert (topology.box_vectors == good_box_vectors).all()

    def test_from_smiles(self):
        """Test creation of a openforcefield Topology object from a SMILES string"""
        topology = Topology.from_molecules(self.ethane_from_smiles)

        assert topology.n_reference_molecules == 1
        assert topology.n_topology_molecules == 1
        assert topology.n_topology_atoms == 8
        assert topology.n_topology_bonds == 7
        assert topology.n_topology_particles == 8
        assert topology.n_topology_virtual_sites == 0
        assert topology.box_vectors is None
        assert len(topology.constrained_atom_pairs.items()) == 0

        topology.add_molecule(self.ethane_from_smiles)

        assert topology.n_reference_molecules == 1
        assert topology.n_topology_molecules == 2
        assert topology.n_topology_atoms == 16
        assert topology.n_topology_bonds == 14
        assert topology.n_topology_particles == 16
        assert topology.n_topology_virtual_sites == 0
        assert topology.box_vectors is None
        assert len(topology.constrained_atom_pairs.items()) == 0

    def test_from_smiles_unique_mols(self):
        """Test the addition of two different molecules to a topology"""
        topology = Topology.from_molecules(
            [self.ethane_from_smiles, self.propane_from_smiles])
        assert topology.n_topology_molecules == 2
        assert topology.n_reference_molecules == 2

    def test_n_topology_atoms(self):
        """Test n_atoms function"""
        topology = Topology()
        assert topology.n_topology_atoms == 0
        assert topology.n_topology_bonds == 0
        topology.add_molecule(self.ethane_from_smiles)
        assert topology.n_topology_atoms == 8
        assert topology.n_topology_bonds == 7

    def test_get_atom(self):
        """Test Topology.atom function (atom lookup from index)"""
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles)
        with self.assertRaises(Exception) as context:
            topology_atom = topology.atom(-1)

        # Make sure we get 2 carbons and 8 hydrogens
        n_carbons = 0
        n_hydrogens = 0
        for index in range(8):
            if topology.atom(index).atomic_number == 6:
                n_carbons += 1
            if topology.atom(index).atomic_number == 1:
                n_hydrogens += 1
        assert n_carbons == 2
        assert n_hydrogens == 6

        with self.assertRaises(Exception) as context:
            topology_atom = topology.atom(8)

    def test_get_bond(self):
        """Test Topology.bond function (bond lookup from index)"""
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles)
        topology.add_molecule(self.ethene_from_smiles)
        with self.assertRaises(Exception) as context:
            topology_atom = topology.bond(-1)

        n_single_bonds = 0
        n_double_bonds = 0
        n_ch_bonds = 0
        n_cc_bonds = 0
        for index in range(12):  # 7 from ethane, 5 from ethene
            topology_bond = topology.bond(index)
            if topology_bond.bond_order == 1:
                n_single_bonds += 1
            if topology_bond.bond_order == 2:
                n_double_bonds += 1
            n_bond_carbons = 0
            n_bond_hydrogens = 0
            for atom in topology_bond.atoms:
                if atom.atomic_number == 6:
                    n_bond_carbons += 1
                if atom.atomic_number == 1:
                    n_bond_hydrogens += 1
            if n_bond_carbons == 2:
                n_cc_bonds += 1
            if n_bond_carbons == 1 and n_bond_hydrogens == 1:
                n_ch_bonds += 1

        assert n_single_bonds == 11
        assert n_double_bonds == 1
        assert n_cc_bonds == 2
        assert n_ch_bonds == 10

        with self.assertRaises(Exception) as context:
            topology_bond = topology.bond(12)

    def test_get_virtual_site(self):
        """Test Topology.virtual_site function (get virtual site from index)
        """
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles_w_vsites)
        assert topology.n_topology_virtual_sites == 2
        topology.add_molecule(self.propane_from_smiles_w_vsites)
        assert topology.n_topology_virtual_sites == 4
        with self.assertRaises(Exception) as context:
            topology_vsite = topology.virtual_site(-1)
        with self.assertRaises(Exception) as context:
            topology_vsite = topology.virtual_site(4)
        topology_vsite1 = topology.virtual_site(0)
        topology_vsite2 = topology.virtual_site(1)
        topology_vsite3 = topology.virtual_site(2)
        topology_vsite4 = topology.virtual_site(3)
        assert topology_vsite1.type == "BondChargeVirtualSite"
        assert topology_vsite2.type == "MonovalentLonePairVirtualSite"
        assert topology_vsite3.type == "BondChargeVirtualSite"
        assert topology_vsite4.type == "MonovalentLonePairVirtualSite"

        n_equal_atoms = 0
        for topology_atom in topology.topology_atoms:
            for vsite in topology.topology_virtual_sites:
                for vsite_atom in vsite.atoms:
                    if topology_atom == vsite_atom:
                        n_equal_atoms += 1

        # There are four virtual sites -- Two BondCharges with 2 atoms, and two MonovalentLonePairs with 3 atoms
        assert n_equal_atoms == 10

    def test_topology_particles_virtualsites_indexed_last(self):
        """
        Test to ensure that virtualsites are strictly indexed after all atoms
        in topology.particles
        """
        from openforcefield.topology import TopologyAtom, TopologyVirtualSite
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles_w_vsites)
        topology.add_molecule(self.propane_from_smiles_w_vsites)

        # Iterate through all TopologyParticles, ensuring that all atoms appear
        # before all virtualsides
        reading_atoms = True
        for particle in topology.topology_particles:
            if reading_atoms:
                if isinstance(particle, TopologyAtom):
                    pass
                else:
                    reading_atoms = False
            elif not (reading_atoms):
                assert isinstance(particle, TopologyVirtualSite)

    def test_topology_virtualsites_atom_indexing(self):
        """
        Add multiple instances of the same molecule, but in a different
        order, and ensure that virtualsite atoms are indexed correctly
        """
        topology = Topology()

        topology.add_molecule(create_ethanol())
        topology.add_molecule(create_ethanol())
        topology.add_molecule(create_reversed_ethanol())

        # Add a virtualsite to the reference ethanol
        for ref_mol in topology.reference_molecules:
            ref_mol._add_bond_charge_virtual_site(
                [0, 1],
                0.5 * unit.angstrom,
            )

        virtual_site_topology_atom_indices = [(0, 1), (9, 10), (26, 25)]
        for top_vs, expected_indices in zip(
                topology.topology_virtual_sites,
                virtual_site_topology_atom_indices):
            assert tuple([at.topology_particle_index
                          for at in top_vs.atoms]) == expected_indices
            assert top_vs.atom(
                0).topology_particle_index == expected_indices[0]
            assert top_vs.atom(
                1).topology_particle_index == expected_indices[1]

    def test_is_bonded(self):
        """Test Topology.virtual_site function (get virtual site from index)
        """
        topology = Topology()
        topology.add_molecule(self.propane_from_smiles_w_vsites)
        topology.assert_bonded(0, 1)
        topology.assert_bonded(1, 0)
        topology.assert_bonded(1, 2)
        # C-H bond
        topology.assert_bonded(0, 4)
        with self.assertRaises(Exception) as context:
            topology.assert_bonded(0, 2)

    def test_angles(self):
        """Topology.angles should return image angles of all topology molecules."""
        molecule1 = self.ethane_from_smiles
        molecule2 = self.propane_from_smiles

        # Create topology.
        topology = Topology()
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule2)

        # The topology should have the correct number of angles.
        topology_angles = list(topology.angles)
        assert len(topology_angles) == topology.n_angles
        assert topology.n_angles == 2 * molecule1.n_angles + molecule2.n_angles

        # Check that the topology angles are the correct ones.
        mol_angle_atoms1 = list(molecule1.angles)
        mol_angle_atoms2 = list(molecule2.angles)
        top_angle_atoms1 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_angles[:molecule1.n_angles]
        ]
        top_angle_atoms2 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_angles[molecule1.n_angles:2 *
                                         molecule1.n_angles]
        ]
        top_angle_atoms3 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_angles[2 * molecule1.n_angles:]
        ]

        assert_tuple_of_atoms_equal(top_angle_atoms1, mol_angle_atoms1)
        assert_tuple_of_atoms_equal(top_angle_atoms2, mol_angle_atoms1)
        assert_tuple_of_atoms_equal(top_angle_atoms3, mol_angle_atoms2)

    def test_propers(self):
        """Topology.propers should return image propers torsions of all topology molecules."""
        molecule1 = self.ethane_from_smiles
        molecule2 = self.propane_from_smiles

        # Create topology.
        topology = Topology()
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule2)

        # The topology should have the correct number of propers.
        topology_propers = list(topology.propers)
        assert len(topology_propers) == topology.n_propers
        assert topology.n_propers == 2 * molecule1.n_propers + molecule2.n_propers

        # Check that the topology propers are the correct ones.
        mol_proper_atoms1 = list(molecule1.propers)
        mol_proper_atoms2 = list(molecule2.propers)
        top_proper_atoms1 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_propers[:molecule1.n_propers]
        ]
        top_proper_atoms2 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_propers[molecule1.n_propers:2 *
                                          molecule1.n_propers]
        ]
        top_proper_atoms3 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_propers[2 * molecule1.n_propers:]
        ]

        assert_tuple_of_atoms_equal(top_proper_atoms1, mol_proper_atoms1)
        assert_tuple_of_atoms_equal(top_proper_atoms2, mol_proper_atoms1)
        assert_tuple_of_atoms_equal(top_proper_atoms3, mol_proper_atoms2)

    def test_impropers(self):
        """Topology.impropers should return image impropers torsions of all topology molecules."""
        molecule1 = self.ethane_from_smiles
        molecule2 = self.propane_from_smiles

        # Create topology.
        topology = Topology()
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule2)

        # The topology should have the correct number of impropers.
        topology_impropers = list(topology.impropers)
        assert len(topology_impropers) == topology.n_impropers
        assert topology.n_impropers == 2 * molecule1.n_impropers + molecule2.n_impropers

        # Check that the topology impropers are the correct ones.
        mol_improper_atoms1 = list(molecule1.impropers)
        mol_improper_atoms2 = list(molecule2.impropers)
        top_improper_atoms1 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_impropers[:molecule1.n_impropers]
        ]
        top_improper_atoms2 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_impropers[molecule1.n_impropers:2 *
                                            molecule1.n_impropers]
        ]
        top_improper_atoms3 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_impropers[2 * molecule1.n_impropers:]
        ]

        assert_tuple_of_atoms_equal(top_improper_atoms1, mol_improper_atoms1)
        assert_tuple_of_atoms_equal(top_improper_atoms2, mol_improper_atoms1)
        assert_tuple_of_atoms_equal(top_improper_atoms3, mol_improper_atoms2)

    # test_get_fractional_bond_order
    # test_two_of_same_molecule
    # test_two_different_molecules
    # test_to_from_dict
    # test_get_molecule
    # test_get_topology_atom
    # test_get_topology_bond
    # test_get_topology_virtual_site
    # test_get_topology_molecule
    # test_is_bonded
    # TODO: Test serialization

    def test_from_openmm(self):
        """Test creation of an openforcefield Topology object from an OpenMM Topology and component molecules"""
        from simtk.openmm import app
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))

        molecules = [create_ethanol(), create_cyclohexane()]

        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        assert topology.n_reference_molecules == 2
        assert topology.n_topology_molecules == 239

    def test_from_openmm_missing_reference(self):
        """Test creation of an openforcefield Topology object from an OpenMM Topology when missing a unique molecule"""
        from simtk.openmm import app
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))

        molecules = [create_ethanol()]
        with pytest.raises(
                ValueError,
                match='No match found for molecule C6H12') as excinfo:
            topology = Topology.from_openmm(pdbfile.topology,
                                            unique_molecules=molecules)

    def test_from_openmm_missing_conect(self):
        """
        Test creation of an openforcefield Topology object from an OpenMM Topology
        when the origin PDB lacks CONECT records
        """
        from simtk.openmm import app
        pdbfile = app.PDBFile(
            get_data_file_path('systems/test_systems/1_ethanol_no_conect.pdb'))

        molecules = []
        molecules.append(Molecule.from_smiles('CCO'))
        with pytest.raises(
                ValueError,
                match='No match found for molecule C. This would be a '
                'very unusual molecule to try and parameterize, '
                'and it is likely that the data source it was '
                'read from does not contain connectivity '
                'information. If this molecule is coming from '
                'PDB, please ensure that the file contains CONECT '
                'records.') as excinfo:
            topology = Topology.from_openmm(pdbfile.topology,
                                            unique_molecules=molecules)

    def test_to_from_openmm(self):
        """Test a round-trip OpenFF -> OpenMM -> OpenFF Topology."""
        from simtk.openmm.app import Aromatic

        # Create OpenFF topology with 1 ethanol and 2 benzenes.
        ethanol = Molecule.from_smiles('CCO')
        benzene = Molecule.from_smiles('c1ccccc1')
        off_topology = Topology.from_molecules(
            molecules=[ethanol, benzene, benzene])

        # Convert to OpenMM Topology.
        omm_topology = off_topology.to_openmm()

        # Check that bond orders are preserved.
        n_double_bonds = sum([b.order == 2 for b in omm_topology.bonds()])
        n_aromatic_bonds = sum(
            [b.type is Aromatic for b in omm_topology.bonds()])
        assert n_double_bonds == 6
        assert n_aromatic_bonds == 12

        # Check that there is one residue for each molecule.
        assert omm_topology.getNumResidues() == 3
        assert omm_topology.getNumChains() == 3

        # Convert back to OpenFF Topology.
        off_topology_copy = Topology.from_openmm(
            omm_topology, unique_molecules=[ethanol, benzene])

        # The round-trip OpenFF Topology is identical to the original.
        # The reference molecules are the same.
        assert off_topology.n_reference_molecules == off_topology_copy.n_reference_molecules
        reference_molecules_copy = list(off_topology_copy.reference_molecules)
        for ref_mol_idx, ref_mol in enumerate(
                off_topology.reference_molecules):
            assert ref_mol == reference_molecules_copy[ref_mol_idx]

        # The number of topology molecules is the same.
        assert off_topology.n_topology_molecules == off_topology_copy.n_topology_molecules

        # Check atoms.
        assert off_topology.n_topology_atoms == off_topology_copy.n_topology_atoms
        for atom_idx, atom in enumerate(off_topology.topology_atoms):
            atom_copy = off_topology_copy.atom(atom_idx)
            assert atom.atomic_number == atom_copy.atomic_number

        # Check bonds.
        for bond_idx, bond in enumerate(off_topology.topology_bonds):
            bond_copy = off_topology_copy.bond(bond_idx)
            bond_atoms = [a.atomic_number for a in bond.atoms]
            bond_atoms_copy = [a.atomic_number for a in bond_copy.atoms]
            assert bond_atoms == bond_atoms_copy
            assert bond.bond_order == bond_copy.bond_order
            assert bond.bond.is_aromatic == bond_copy.bond.is_aromatic

    @pytest.mark.skipif(not (OpenEyeToolkitWrapper.is_available()),
                        reason='Test requires OE toolkit')
    def test_from_openmm_duplicate_unique_mol(self):
        """Check that a DuplicateUniqueMoleculeError is raised if we try to pass in two indistinguishably unique mols"""
        from simtk.openmm import app
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))
        molecules = [
            Molecule.from_file(get_data_file_path(name))
            for name in ('molecules/ethanol.mol2',
                         'molecules/ethanol_reordered.mol2',
                         'molecules/cyclohexane.mol2')
        ]
        with self.assertRaises(DuplicateUniqueMoleculeError) as context:
            topology = Topology.from_openmm(pdbfile.topology,
                                            unique_molecules=molecules)

    @pytest.mark.skip
    def test_from_openmm_distinguish_using_stereochemistry(self):
        """Test creation of an openforcefield Topology object from an OpenMM topology with stereoisomers"""
        # From Jeff: The graph representation created from OMM molecules during the matching
        # process doesn't encode stereochemistry.
        raise NotImplementedError

    def test_to_openmm_assign_unique_atom_names(self):
        """
        Ensure that OFF topologies with no pre-existing atom names have unique
        atom names applied when being converted to openmm
        """
        # Create OpenFF topology with 1 ethanol and 2 benzenes.
        ethanol = Molecule.from_smiles('CCO')
        benzene = Molecule.from_smiles('c1ccccc1')
        off_topology = Topology.from_molecules(
            molecules=[ethanol, benzene, benzene])
        omm_topology = off_topology.to_openmm()
        atom_names = set()
        for atom in omm_topology.atoms():
            atom_names.add(atom.name)
        # There should be 6 unique Cs, 6 unique Hs, and 1 unique O, for a total of 13 unique atom names
        assert len(atom_names) == 13

    def test_to_openmm_assign_some_unique_atom_names(self):
        """
        Ensure that OFF topologies with some pre-existing atom names have unique
        atom names applied to the other atoms when being converted to openmm
        """
        # Create OpenFF topology with 1 ethanol and 2 benzenes.
        ethanol = Molecule.from_smiles('CCO')
        for atom in ethanol.atoms:
            atom.name = f'AT{atom.molecule_atom_index}'
        benzene = Molecule.from_smiles('c1ccccc1')
        off_topology = Topology.from_molecules(
            molecules=[ethanol, benzene, benzene])
        omm_topology = off_topology.to_openmm()
        atom_names = set()
        for atom in omm_topology.atoms():
            atom_names.add(atom.name)
        # There should be 9 "ATOM#"-labeled atoms, 6 unique Cs, and 6 unique Hs,
        # for a total of 21 unique atom names
        assert len(atom_names) == 21

    def test_to_openmm_assign_unique_atom_names_some_duplicates(self):
        """
        Ensure that OFF topologies where some molecules have invalid/duplicate
        atom names have unique atom names applied while the other molecules are unaffected.
        """
        # Create OpenFF topology with 1 ethanol and 2 benzenes.
        ethanol = Molecule.from_smiles('CCO')

        # Assign duplicate atom names in ethanol (two AT0s)
        ethanol_atom_names_with_duplicates = [
            f'AT{i}' for i in range(ethanol.n_atoms)
        ]
        ethanol_atom_names_with_duplicates[1] = 'AT0'
        for atom, atom_name in zip(ethanol.atoms,
                                   ethanol_atom_names_with_duplicates):
            atom.name = atom_name

        # Assign unique atom names in benzene
        benzene = Molecule.from_smiles('c1ccccc1')
        benzene_atom_names = [f'AT{i}' for i in range(benzene.n_atoms)]
        for atom, atom_name in zip(benzene.atoms, benzene_atom_names):
            atom.name = atom_name

        off_topology = Topology.from_molecules(
            molecules=[ethanol, benzene, benzene])
        omm_topology = off_topology.to_openmm()
        atom_names = set()
        for atom in omm_topology.atoms():
            atom_names.add(atom.name)

        # There should be  12 "AT#"-labeled atoms (from benzene), 2 unique Cs,
        # 1 unique O, and 6 unique Hs, for a total of 21 unique atom names
        assert len(atom_names) == 21

    def test_to_openmm_do_not_assign_unique_atom_names(self):
        """
        Test disabling unique atom name assignment in Topology.to_openmm
        """
        # Create OpenFF topology with 1 ethanol and 2 benzenes.
        ethanol = Molecule.from_smiles('CCO')
        for atom in ethanol.atoms:
            atom.name = 'eth_test'
        benzene = Molecule.from_smiles('c1ccccc1')
        benzene.atoms[0].name = 'bzn_test'
        off_topology = Topology.from_molecules(
            molecules=[ethanol, benzene, benzene])
        omm_topology = off_topology.to_openmm(ensure_unique_atom_names=False)
        atom_names = set()
        for atom in omm_topology.atoms():
            atom_names.add(atom.name)
        # There should be 9 atom named "eth_test", 1 atom named "bzn_test",
        # and 12 atoms named "", for a total of 3 unique atom names
        assert len(atom_names) == 3

    @pytest.mark.skipif(not (OpenEyeToolkitWrapper.is_available()),
                        reason='Test requires OE toolkit')
    def test_chemical_environments_matches_OE(self):
        """Test Topology.chemical_environment_matches"""
        from simtk.openmm import app
        toolkit_wrapper = OpenEyeToolkitWrapper()
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))
        # toolkit_wrapper = RDKitToolkitWrapper()
        molecules = [
            Molecule.from_file(get_data_file_path(name))
            for name in ('molecules/ethanol.mol2',
                         'molecules/cyclohexane.mol2')
        ]
        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        # Test for substructure match
        matches = topology.chemical_environment_matches(
            "[C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 143
        assert matches[0].topology_atom_indices == (1728, 1729, 1730)
        # Test for whole-molecule match
        matches = topology.chemical_environment_matches(
            "[H][C:1]([H])([H])-[C:2]([H])([H])-[O:3][H]",
            toolkit_registry=toolkit_wrapper)
        assert len(
            matches
        ) == 1716  # 143 * 12 (there are 12 possible hydrogen mappings)
        assert matches[0].topology_atom_indices == (1728, 1729, 1730)
        # Search for a substructure that isn't there
        matches = topology.chemical_environment_matches(
            "[C][C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 0

    @pytest.mark.skipif(not (RDKitToolkitWrapper.is_available()),
                        reason='Test requires RDKit')
    def test_chemical_environments_matches_RDK(self):
        """Test Topology.chemical_environment_matches"""
        from simtk.openmm import app
        toolkit_wrapper = RDKitToolkitWrapper()
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))
        # toolkit_wrapper = RDKitToolkitWrapper()
        #molecules = [Molecule.from_file(get_data_file_path(name)) for name in ('molecules/ethanol.mol2',
        #                                                                      'molecules/cyclohexane.mol2')]
        molecules = []
        molecules.append(Molecule.from_smiles('CCO'))
        molecules.append(Molecule.from_smiles('C1CCCCC1'))
        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        # Count CCO matches
        matches = topology.chemical_environment_matches(
            "[C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 143
        assert matches[0].topology_atom_indices == (1728, 1729, 1730)
        matches = topology.chemical_environment_matches(
            "[H][C:1]([H])([H])-[C:2]([H])([H])-[O:3][H]",
            toolkit_registry=toolkit_wrapper)
        assert len(
            matches
        ) == 1716  # 143 * 12 (there are 12 possible hydrogen mappings)
        assert matches[0].topology_atom_indices == (1728, 1729, 1730)
        # Search for a substructure that isn't there
        matches = topology.chemical_environment_matches(
            "[C][C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 0
示例#4
0
class TestTopology(TestCase):
    def setUp(self):
        self.empty_molecule = Molecule()
        self.ethane_from_smiles = Molecule.from_smiles('CC')
        self.ethene_from_smiles = Molecule.from_smiles('C=C')
        self.propane_from_smiles = Molecule.from_smiles('CCC')

        filename = get_data_file_path('molecules/toluene.sdf')
        self.toluene_from_sdf = Molecule.from_file(filename)
        if OpenEyeToolkitWrapper.is_available():
            filename = get_data_file_path('molecules/toluene_charged.mol2')
            # TODO: This will require openeye to load
            self.toluene_from_charged_mol2 = Molecule.from_file(filename)
        self.charged_methylamine_from_smiles = Molecule.from_smiles(
            '[H]C([H])([H])[N+]([H])([H])[H]')

        molecule = Molecule.from_smiles('CC')
        carbons = [atom for atom in molecule.atoms if atom.atomic_number == 6]
        c0_hydrogens = [
            atom for atom in carbons[0].bonded_atoms if atom.atomic_number == 1
        ]
        molecule.add_bond_charge_virtual_site(
            (carbons[0], carbons[1]),
            0.1 * unit.angstrom,
            charge_increments=[0.1, 0.05] * unit.elementary_charge)
        molecule.add_monovalent_lone_pair_virtual_site(
            (c0_hydrogens[0], carbons[0], carbons[1]),
            0.2 * unit.angstrom,
            20 * unit.degree,
            25 * unit.degree,
            charge_increments=[0.01, 0.02, 0.03] * unit.elementary_charge)
        self.ethane_from_smiles_w_vsites = Molecule(molecule)

        # Make a propane with virtual sites
        molecule = Molecule.from_smiles('CCC')
        carbons = [atom for atom in molecule.atoms if atom.atomic_number == 6]
        c0_hydrogens = [
            atom for atom in carbons[0].bonded_atoms if atom.atomic_number == 1
        ]
        molecule.add_bond_charge_virtual_site(
            (carbons[0], carbons[1]),
            0.1 * unit.angstrom,
            charge_increments=[0.1, 0.05] * unit.elementary_charge)
        molecule.add_monovalent_lone_pair_virtual_site(
            (c0_hydrogens[0], carbons[0], carbons[1]),
            0.2 * unit.angstrom,
            20 * unit.degree,
            25 * unit.degree,
            charge_increments=[0.01, 0.02, 0.03] * unit.elementary_charge)
        self.propane_from_smiles_w_vsites = Molecule(molecule)

    def test_empty(self):
        """Test creation of empty topology"""
        topology = Topology()
        assert topology.n_reference_molecules == 0
        assert topology.n_topology_molecules == 0
        assert topology.n_topology_atoms == 0
        assert topology.n_topology_bonds == 0
        assert topology.n_topology_particles == 0
        assert topology.n_topology_virtual_sites == 0
        assert topology.box_vectors is None
        assert len(topology.constrained_atom_pairs.items()) == 0

    def test_box_vectors(self):
        """Test the getter and setter for box_vectors"""
        topology = Topology()
        good_box_vectors = unit.Quantity(np.array([10, 20, 30]), unit.angstrom)
        bad_box_vectors = np.array([10, 20, 30
                                    ])  # They're bad because they're unitless
        assert topology.box_vectors is None

        with self.assertRaises(ValueError) as context:
            topology.box_vectors = bad_box_vectors
        assert topology.box_vectors is None

        topology.box_vectors = good_box_vectors
        assert (topology.box_vectors == good_box_vectors).all()

    def test_from_smiles(self):
        """Test creation of a openforcefield Topology object from a SMILES string"""
        topology = Topology.from_molecules(self.ethane_from_smiles)

        assert topology.n_reference_molecules == 1
        assert topology.n_topology_molecules == 1
        assert topology.n_topology_atoms == 8
        assert topology.n_topology_bonds == 7
        assert topology.n_topology_particles == 8
        assert topology.n_topology_virtual_sites == 0
        assert topology.box_vectors is None
        assert len(topology.constrained_atom_pairs.items()) == 0

        topology.add_molecule(self.ethane_from_smiles)

        assert topology.n_reference_molecules == 1
        assert topology.n_topology_molecules == 2
        assert topology.n_topology_atoms == 16
        assert topology.n_topology_bonds == 14
        assert topology.n_topology_particles == 16
        assert topology.n_topology_virtual_sites == 0
        assert topology.box_vectors is None
        assert len(topology.constrained_atom_pairs.items()) == 0

    def test_from_smiles_unique_mols(self):
        """Test the addition of two different molecules to a topology"""
        topology = Topology.from_molecules(
            [self.ethane_from_smiles, self.propane_from_smiles])
        assert topology.n_topology_molecules == 2
        assert topology.n_reference_molecules == 2

    def test_n_topology_atoms(self):
        """Test n_atoms function"""
        topology = Topology()
        assert topology.n_topology_atoms == 0
        assert topology.n_topology_bonds == 0
        topology.add_molecule(self.ethane_from_smiles)
        assert topology.n_topology_atoms == 8
        assert topology.n_topology_bonds == 7

    def test_get_atom(self):
        """Test Topology.atom function (atom lookup from index)"""
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles)
        with self.assertRaises(Exception) as context:
            topology_atom = topology.atom(-1)

        # Make sure we get 2 carbons and 8 hydrogens
        n_carbons = 0
        n_hydrogens = 0
        for index in range(8):
            if topology.atom(index).atomic_number == 6:
                n_carbons += 1
            if topology.atom(index).atomic_number == 1:
                n_hydrogens += 1
        assert n_carbons == 2
        assert n_hydrogens == 6

        with self.assertRaises(Exception) as context:
            topology_atom = topology.atom(8)

    def test_get_bond(self):
        """Test Topology.bond function (bond lookup from index)"""
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles)
        topology.add_molecule(self.ethene_from_smiles)
        with self.assertRaises(Exception) as context:
            topology_atom = topology.bond(-1)

        n_single_bonds = 0
        n_double_bonds = 0
        n_ch_bonds = 0
        n_cc_bonds = 0
        for index in range(12):  # 7 from ethane, 5 from ethene
            topology_bond = topology.bond(index)
            if topology_bond.bond_order == 1:
                n_single_bonds += 1
            if topology_bond.bond_order == 2:
                n_double_bonds += 1
            n_bond_carbons = 0
            n_bond_hydrogens = 0
            for atom in topology_bond.atoms:
                if atom.atomic_number == 6:
                    n_bond_carbons += 1
                if atom.atomic_number == 1:
                    n_bond_hydrogens += 1
            if n_bond_carbons == 2:
                n_cc_bonds += 1
            if n_bond_carbons == 1 and n_bond_hydrogens == 1:
                n_ch_bonds += 1

        assert n_single_bonds == 11
        assert n_double_bonds == 1
        assert n_cc_bonds == 2
        assert n_ch_bonds == 10

        with self.assertRaises(Exception) as context:
            topology_bond = topology.bond(12)

    def test_get_virtual_site(self):
        """Test Topology.virtual_site function (get virtual site from index)
        """
        topology = Topology()
        topology.add_molecule(self.ethane_from_smiles_w_vsites)
        assert topology.n_topology_virtual_sites == 2
        topology.add_molecule(self.propane_from_smiles_w_vsites)
        assert topology.n_topology_virtual_sites == 4
        with self.assertRaises(Exception) as context:
            topology_vsite = topology.virtual_site(-1)
        with self.assertRaises(Exception) as context:
            topology_vsite = topology.virtual_site(4)
        topology_vsite1 = topology.virtual_site(0)
        topology_vsite2 = topology.virtual_site(1)
        topology_vsite3 = topology.virtual_site(2)
        topology_vsite4 = topology.virtual_site(3)
        assert topology_vsite1.type == "BondChargeVirtualSite"
        assert topology_vsite2.type == "MonovalentLonePairVirtualSite"
        assert topology_vsite3.type == "BondChargeVirtualSite"
        assert topology_vsite4.type == "MonovalentLonePairVirtualSite"

        n_equal_atoms = 0
        for topology_atom in topology.topology_atoms:
            for vsite in topology.topology_virtual_sites:
                for vsite_atom in vsite.atoms:
                    if topology_atom == vsite_atom:
                        n_equal_atoms += 1

        # There are four virtual sites -- Two BondCharges with 2 atoms, and two MonovalentLonePairs with 3 atoms
        assert n_equal_atoms == 10

    def test_is_bonded(self):
        """Test Topology.virtual_site function (get virtual site from index)
        """
        topology = Topology()
        topology.add_molecule(self.propane_from_smiles_w_vsites)
        #raise Exception([str(topology.atom(i).atom) for i in range(6)])
        topology.assert_bonded(0, 1)
        topology.assert_bonded(1, 0)
        topology.assert_bonded(1, 2)
        # C-H bond
        topology.assert_bonded(0, 4)
        with self.assertRaises(Exception) as context:
            topology.assert_bonded(0, 2)

    def test_angles(self):
        """Topology.angles should return image angles of all topology molecules."""
        molecule1 = self.ethane_from_smiles
        molecule2 = self.propane_from_smiles

        # Create topology.
        topology = Topology()
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule2)

        # The topology should have the correct number of angles.
        topology_angles = list(topology.angles)
        assert len(topology_angles) == topology.n_angles
        assert topology.n_angles == 2 * molecule1.n_angles + molecule2.n_angles

        # Check that the topology angles are the correct ones.
        mol_angle_atoms1 = list(molecule1.angles)
        mol_angle_atoms2 = list(molecule2.angles)
        top_angle_atoms1 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_angles[:molecule1.n_angles]
        ]
        top_angle_atoms2 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_angles[molecule1.n_angles:2 *
                                         molecule1.n_angles]
        ]
        top_angle_atoms3 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_angles[2 * molecule1.n_angles:]
        ]

        assert_tuple_of_atoms_equal(top_angle_atoms1, mol_angle_atoms1)
        assert_tuple_of_atoms_equal(top_angle_atoms2, mol_angle_atoms1)
        assert_tuple_of_atoms_equal(top_angle_atoms3, mol_angle_atoms2)

    def test_propers(self):
        """Topology.propers should return image propers torsions of all topology molecules."""
        molecule1 = self.ethane_from_smiles
        molecule2 = self.propane_from_smiles

        # Create topology.
        topology = Topology()
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule2)

        # The topology should have the correct number of propers.
        topology_propers = list(topology.propers)
        assert len(topology_propers) == topology.n_propers
        assert topology.n_propers == 2 * molecule1.n_propers + molecule2.n_propers

        # Check that the topology propers are the correct ones.
        mol_proper_atoms1 = list(molecule1.propers)
        mol_proper_atoms2 = list(molecule2.propers)
        top_proper_atoms1 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_propers[:molecule1.n_propers]
        ]
        top_proper_atoms2 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_propers[molecule1.n_propers:2 *
                                          molecule1.n_propers]
        ]
        top_proper_atoms3 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_propers[2 * molecule1.n_propers:]
        ]

        assert_tuple_of_atoms_equal(top_proper_atoms1, mol_proper_atoms1)
        assert_tuple_of_atoms_equal(top_proper_atoms2, mol_proper_atoms1)
        assert_tuple_of_atoms_equal(top_proper_atoms3, mol_proper_atoms2)

    def test_impropers(self):
        """Topology.impropers should return image impropers torsions of all topology molecules."""
        molecule1 = self.ethane_from_smiles
        molecule2 = self.propane_from_smiles

        # Create topology.
        topology = Topology()
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule1)
        topology.add_molecule(molecule2)

        # The topology should have the correct number of impropers.
        topology_impropers = list(topology.impropers)
        assert len(topology_impropers) == topology.n_impropers
        assert topology.n_impropers == 2 * molecule1.n_impropers + molecule2.n_impropers

        # Check that the topology impropers are the correct ones.
        mol_improper_atoms1 = list(molecule1.impropers)
        mol_improper_atoms2 = list(molecule2.impropers)
        top_improper_atoms1 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_impropers[:molecule1.n_impropers]
        ]
        top_improper_atoms2 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_impropers[molecule1.n_impropers:2 *
                                            molecule1.n_impropers]
        ]
        top_improper_atoms3 = [
            tuple(a._atom for a in atoms)
            for atoms in topology_impropers[2 * molecule1.n_impropers:]
        ]

        assert_tuple_of_atoms_equal(top_improper_atoms1, mol_improper_atoms1)
        assert_tuple_of_atoms_equal(top_improper_atoms2, mol_improper_atoms1)
        assert_tuple_of_atoms_equal(top_improper_atoms3, mol_improper_atoms2)

    # test_get_fractional_bond_order
    # test_two_of_same_molecule
    # test_two_different_molecules
    # test_to_from_dict
    # test_get_molecule
    # test_get_topology_atom
    # test_get_topology_bond
    # test_get_topology_virtual_site
    # test_get_topology_molecule
    # test_is_bonded
    # TODO: Test serialization

    def test_from_openmm(self):
        """Test creation of an openforcefield Topology object from an OpenMM Topology and component molecules"""
        from simtk.openmm import app
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))

        molecules = []
        molecules.append(Molecule.from_smiles('CCO'))
        molecules.append(Molecule.from_smiles('C1CCCCC1'))

        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        assert topology.n_reference_molecules == 2
        assert topology.n_topology_molecules == 239

    def test_to_from_openmm(self):
        """Test a round-trip OpenFF -> OpenMM -> OpenFF Topology."""
        from simtk.openmm.app import Aromatic

        # Create OpenFF topology with 1 ethanol and 2 benzenes.
        ethanol = Molecule.from_smiles('CCO')
        benzene = Molecule.from_smiles('c1ccccc1')
        off_topology = Topology.from_molecules(
            molecules=[ethanol, benzene, benzene])

        # Convert to OpenMM Topology.
        omm_topology = off_topology.to_openmm()

        # Check that bond orders are preserved.
        n_double_bonds = sum([b.order == 2 for b in omm_topology.bonds()])
        n_aromatic_bonds = sum(
            [b.type is Aromatic for b in omm_topology.bonds()])
        assert n_double_bonds == 6
        assert n_aromatic_bonds == 12

        # Check that there is one residue for each molecule.
        assert omm_topology.getNumResidues() == 3
        assert omm_topology.getNumChains() == 3

        # Convert back to OpenFF Topology.
        off_topology_copy = Topology.from_openmm(
            omm_topology, unique_molecules=[ethanol, benzene])

        # The round-trip OpenFF Topology is identical to the original.
        # The reference molecules are the same.
        assert off_topology.n_reference_molecules == off_topology_copy.n_reference_molecules
        reference_molecules_copy = list(off_topology_copy.reference_molecules)
        for ref_mol_idx, ref_mol in enumerate(
                off_topology.reference_molecules):
            assert ref_mol == reference_molecules_copy[ref_mol_idx]

        # The number of topology molecules is the same.
        assert off_topology.n_topology_molecules == off_topology_copy.n_topology_molecules

        # Check atoms.
        assert off_topology.n_topology_atoms == off_topology_copy.n_topology_atoms
        for atom_idx, atom in enumerate(off_topology.topology_atoms):
            atom_copy = off_topology_copy.atom(atom_idx)
            assert atom.atomic_number == atom_copy.atomic_number

        # Check bonds.
        for bond_idx, bond in enumerate(off_topology.topology_bonds):
            bond_copy = off_topology_copy.bond(bond_idx)
            bond_atoms = [a.atomic_number for a in bond.atoms]
            bond_atoms_copy = [a.atomic_number for a in bond_copy.atoms]
            assert bond_atoms == bond_atoms_copy
            assert bond.bond_order == bond_copy.bond_order
            assert bond.bond.is_aromatic == bond_copy.bond.is_aromatic

    @pytest.mark.skipif(not (OpenEyeToolkitWrapper.is_available()),
                        reason='Test requires OE toolkit')
    def test_from_openmm_duplicate_unique_mol(self):
        """Check that a DuplicateUniqueMoleculeError is raised if we try to pass in two indistinguishably unique mols"""
        from simtk.openmm import app
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))
        #toolkit_wrapper = RDKitToolkitWrapper()
        molecules = [
            Molecule.from_file(get_data_file_path(name))
            for name in ('molecules/ethanol.mol2',
                         'molecules/ethanol_reordered.mol2',
                         'molecules/cyclohexane.mol2')
        ]
        with self.assertRaises(DuplicateUniqueMoleculeError) as context:
            topology = Topology.from_openmm(pdbfile.topology,
                                            unique_molecules=molecules)

    @pytest.mark.skip
    def test_from_openmm_distinguish_using_stereochemistry(self):
        """Test creation of an openforcefield Topology object from an OpenMM topology with stereoisomers"""
        # From Jeff: The graph representation created from OMM molecules during the matching
        # process doesn't encode stereochemistry.
        raise NotImplementedError

    @pytest.mark.skipif(not (OpenEyeToolkitWrapper.is_available()),
                        reason='Test requires OE toolkit')
    def test_chemical_environments_matches_OE(self):
        """Test Topology.chemical_environment_matches"""
        from simtk.openmm import app
        toolkit_wrapper = OpenEyeToolkitWrapper()
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))
        # toolkit_wrapper = RDKitToolkitWrapper()
        molecules = [
            Molecule.from_file(get_data_file_path(name))
            for name in ('molecules/ethanol.mol2',
                         'molecules/cyclohexane.mol2')
        ]
        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        # Test for substructure match
        matches = topology.chemical_environment_matches(
            "[C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 143
        assert tuple(i.topology_atom_index
                     for i in matches[0]) == (1728, 1729, 1730)
        # Test for whole-molecule match
        matches = topology.chemical_environment_matches(
            "[H][C:1]([H])([H])-[C:2]([H])([H])-[O:3][H]",
            toolkit_registry=toolkit_wrapper)
        assert len(
            matches
        ) == 1716  # 143 * 12 (there are 12 possible hydrogen mappings)
        assert tuple(i.topology_atom_index
                     for i in matches[0]) == (1728, 1729, 1730)
        # Search for a substructure that isn't there
        matches = topology.chemical_environment_matches(
            "[C][C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 0

    @pytest.mark.skipif(not (RDKitToolkitWrapper.is_available()),
                        reason='Test requires RDKit')
    def test_chemical_environments_matches_RDK(self):
        """Test Topology.chemical_environment_matches"""
        from simtk.openmm import app
        toolkit_wrapper = RDKitToolkitWrapper()
        pdbfile = app.PDBFile(
            get_data_file_path(
                'systems/packmol_boxes/cyclohexane_ethanol_0.4_0.6.pdb'))
        # toolkit_wrapper = RDKitToolkitWrapper()
        #molecules = [Molecule.from_file(get_data_file_path(name)) for name in ('molecules/ethanol.mol2',
        #                                                                      'molecules/cyclohexane.mol2')]
        molecules = []
        molecules.append(Molecule.from_smiles('CCO'))
        molecules.append(Molecule.from_smiles('C1CCCCC1'))
        topology = Topology.from_openmm(pdbfile.topology,
                                        unique_molecules=molecules)
        # Count CCO matches
        matches = topology.chemical_environment_matches(
            "[C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 143
        assert tuple(i.topology_atom_index
                     for i in matches[0]) == (1728, 1729, 1730)
        matches = topology.chemical_environment_matches(
            "[H][C:1]([H])([H])-[C:2]([H])([H])-[O:3][H]",
            toolkit_registry=toolkit_wrapper)
        assert len(
            matches
        ) == 1716  # 143 * 12 (there are 12 possible hydrogen mappings)
        assert tuple(i.topology_atom_index
                     for i in matches[0]) == (1728, 1729, 1730)
        # Search for a substructure that isn't there
        matches = topology.chemical_environment_matches(
            "[C][C:1]-[C:2]-[O:3]", toolkit_registry=toolkit_wrapper)
        assert len(matches) == 0