text = en.get() la2.configure(text=text) # bu is for button bu = g.bu(text='Press me', command=press_me) # end of the first frame g.endcol() # FRAME 2 g.col() # ca is for canvas ca = g.ca(width=200, height=200) item1 = ca.circle([0, 0], 70, 'red') item2 = ca.rectangle([[0, 0], [60, 60]], 'blue') item3 = ca.text([0, 0], 'This is a canvas.', 'white') # mb is for menubutton mb = g.mb(text='Choose a color') def set_color(color): ca.itemconfig(item2, fill=color) # mi is for menuitem for color in ['red', 'green', 'blue']:
#!/usr/bin/env python from swampy.Gui import * def make_circle(): circle = canvas.circle([0,0], 100, fill='red') entry = g.en(text='Enter Color') button2 = g.bu(text='Enter', command=change_color) global circle, entry # handle the exception of changing color on a circle not created by # the order of operations, i.e. does not get to the color change until circle is created. def change_color(): color = entry.get() colorList = ['white', 'black', 'red', 'green', 'blue', 'cyan', 'yellow', 'magenta'] if color not in colorList: print "The color you specified is not valid. Available colors are: " for i in colorList: print i else: circle.config(fill=color) g = Gui() g.title('Gui') canvas = g.ca(width=500, height=500) canvas.config(bg='white') button1 = g.bu(text="Make Circle", command=make_circle) g.mainloop()
from swampy.Gui import * g = Gui() g.title("Gui") text = g.te(width=100, height=5) canvas = g.ca(width=300, height=300) canvas.config(bg='grey') circle = None def change_color(): global circle color = entry.get() print color if circle == None: return circle.config(fill=color) def draw_circle(): global circle circle = canvas.circle([0, 0], 100, fill='red') g.bu(text='create circle', command=draw_circle) entry = g.en() g.bu(text='change color', command=change_color) g.mainloop()
self.move(dx, dy) def drop(self, event): self.config(fill=self.fill) def make_circle(event): pos = ca.canvas_coords([event.x, event.y]) item = ca.circle(pos, 5, fill='white') Draggable(item) def make_text(event=None): text = en.get() item = ca.text([0, 0], text) Draggable(item) g = Gui() g.title('Draggable Demo') ca = g.ca(width=500, height=500, bg='black') ca.bind('<ButtonPress-3>', make_circle) g.row([1, 0]) en = g.en() bu = g.bu('Make text item:', make_text) en.bind('<Return>', make_text) g.mainloop()
import os from swampy.Gui import * import Tkinter import Image as PIL import ImageTk g = Gui() g.title('Image Viewer') canvas = g.ca(width=500, height=500, bg='white') def walk(dirname): for name in os.listdir(dirname): path = os.path.join(dirname, name) if os.path.isfile(path): try: show_image(name) print name g.mainloop() except: pass else: walk(path) def show_image(fp): image = PIL.open(fp) tkpi = ImageTk.PhotoImage(image) canvas(image=tkpi)
# dx = event.x - self.dragx # dy = event.y - self.dragy pos = ca.canvas_coords([[self.dragx, self.dragy], [event.x, event.y]]) print pos item = ca.rectangle(pos, fill="red") # move the item # self.move(dx, dy) def drop(self, event): """Drops this item.""" self.config(fill=self.fill) g = Gui() ca = g.ca(width=500, height=500, bg="white") item = ca.rectangle([[-250, -250], [100, 100]], fill="red") vec = Vector(item) ca.bind("<ButtonPress-1>", vec.select) def make_circle(event): """Makes a circle item at the location of a button press.""" dx = event.x dy = event.y pos = ca.canvas_coords([[event.x, event.y], [event.x + 10, event.y + 10]]) print pos item = ca.rectangle(pos, fill="red") item = Vector(item)
"""Exercise 2 Write a program that creates a Canvas and a Button. When the user presses the Button, it should draw a circle on the canvas.""" from swampy.Gui import * g = Gui() g.title = "Gui" def make_circle(): canvas.circle([0, 0], 55, fill="orange", outline="white", width=3) canvas = g.ca(500, 500, bg="black") g.bu(text="make me a circle", command=make_circle) g.mainloop()
presuf=sample(list2, 4)[:] r=randint(1,2) if r==1: ques_pos() elif r==2: ques_neg() def close(event=NONE): if tkMessageBox.askyesno("Quit","Do You Want To Quit???"): p.destroy() p=Gui() p.title('Sentiment Analysis') p.geometry(newGeometry='700x500') fr=p.fr() canint=p.ca(bg='green') imag=Image.open('pic1.jpg') imag2=ImageTk.PhotoImage(imag) canint.image([300,-200],image=imag2) canint.image=imag2 var=IntVar(0) var2=IntVar(0) but1=p.bu('YES',command=start,font=('bold',15), bg='red', fg='white', activebackground='white',activeforeground='red',bd=8).place(x=175,y=370, height=50, width=80) p.bind('y',start) but2=p.bu('NO',command=close,font=('bold',15), bg='red', fg='white', activebackground='white',activeforeground='red',bd=8).place(x=450,y=370, height=50, width=80) item1=canint.create_text(350,140,text="\nWelcome!!!\n Hope You Had A Great Day Till Now.\nIf Not, We Are Gonna Make It Great With This Program!!!\n\n\nSo Shall We Begin???",font=('BOOKMAN OLD STYLE',17,'bold'),justify=CENTER,fill='white') p.bind('n',close) p.mainloop()
la2.configure(text=text) # bu is for button bu = g.bu(text="Press me", command=press_me) # end of the first frame g.endcol() # FRAME 2 g.col() # ca is for canvas ca = g.ca(width=200, height=200) item1 = ca.circle([0, 0], 70, "red") item2 = ca.rectangle([[0, 0], [60, 60]], "blue") item3 = ca.text([0, 0], "This is a canvas.", "white") # mb is for menubutton mb = g.mb(text="Choose a color") def set_color(color): ca.itemconfig(item2, fill=color) # mi is for menuitem for color in ["red", "green", "blue"]:
# save the current drag coordinates self.dragx = event.x self.dragy = event.y # move the item self.move(dx, dy) def drop(self, event): """Drops this item.""" self.config(fill=self.fill) # create the Gui and the Canvas g = Gui() ca = g.ca(width=500, height=500, bg='white') def make_circle(event): """Makes a circle item at the location of a button press.""" pos = ca.canvas_coords([event.x, event.y]) item = ca.circle(pos, 5, fill='red') item = Draggable(item) ca.bind('<ButtonPress-3>', make_circle) def make_text(event=None): """Pressing Return in the Entry makes a text item.""" text = en.get() item = ca.text([0,0], text) item = Draggable(item)
"""This module contains code from Think Python by Allen B. Downey http://thinkpython.com Copyright 2012 Allen B. Downey License: GNU GPLv3 http://www.gnu.org/licenses/gpl.html """ from swampy.Gui import * from tkinter import PhotoImage g = Gui() photo = PhotoImage(file='danger.gif') g.bu(image=photo) canvas = g.ca(width=300) canvas.image([0, 0], image=photo) from PIL import Image as PIL from PIL import ImageTk image = PIL.open('allen.png') photo2 = ImageTk.PhotoImage(image) g.la(image=photo2) g.mainloop()
models = [] models.append([0, 60, 66, 129, 129, 129, 129, 129, 129, 129, 129, 129, 129, 66, 60, 0]) #0 models.append([0, 4, 12, 20, 36, 4, 4, 4, 4, 4, 4, 4, 4, 4, 4, 0]) #1 models.append([0, 60, 66, 129, 129, 1, 1, 2, 4, 8, 16, 32, 64, 128, 255, 0]) #2 models.append([0, 60, 66, 129, 1, 1, 2, 12, 2, 1, 1, 1, 129, 66, 60, 0]) #3 models.append([0, 6, 10, 10, 18, 18, 34, 34, 66, 66, 130, 255, 2, 2, 2, 0]) #4 models.append([0, 254, 128, 128, 128, 128, 188, 194, 1, 1, 1, 129, 129, 66, 60, 0]) #5 models.append([0, 60, 66, 129, 128, 128, 188, 194, 129, 129, 129, 129, 129, 66, 60, 0]) #6 models.append([0, 255, 1, 2, 2, 4, 4, 8, 8, 16, 16, 32, 32, 64, 64, 0]) #7 models.append([0, 60, 66, 129, 129, 129, 66, 60, 66, 129, 129, 129, 129, 66, 60, 0]) #8 models.append([0, 60, 66, 129, 129, 129, 129, 129, 67, 61, 1, 1, 129, 66, 60, 0]) #9 g = Gui() g.title('Font testing') canvas = g.ca(1020, 360, bg='orange') def drawLineOfModels(y_offset, x_delta, e_size): for digit in range(0, 10): for line in range(0, 16): for pos in range(0, 8): x = -380 + digit * x_delta - pos * e_size y = y_offset - line * e_size item = canvas.rectangle([[x, y], [x+e_size, y+e_size]], fill='orange', outline='black', width=0) if testBit(models[digit][line], pos) > 0: item.config(fill='black') drawLineOfModels(80, 90, 10) drawLineOfModels(-100, 30, 3) g.mainloop()
def launch(): """ launches the 'real' gui system, the one we interact with """ #names new databases that we will use now that the application is launched share_hist = db.share_hist display = db.display point_total = db.point_total shared_source = db.shared_source shared_viewer = db.shared_viewer #clears the databases upon running script #IMPORTANT: leave the shared_viewer.remove() shared_viewer.remove() def initialize(): """ upon running the script, gets data from the database and updates the gui displays """ global count global share_count global username try: for thing in point_total.distinct(username): amount = thing points.config(text = str(amount)) except: point_total.insert({username:10}) for thing in point_total.distinct(username): amount = thing points.config(text = str(amount)) for thing in display.distinct(username): share_history.canvas.text([0,count], text = thing['friend'] + ' ' + thing['share'] + ' ' + str(thing['date'])) count -= 12 for thing in shared_viewer.distinct(username): link = new_shared_list.canvas.text([0,share_count], text = str(thing[username]['link']), activefill = 'blue') link.bind('<Double-1>', onObjectClick) share_count -= 12 def update(): """ when the update button is pushed, this looks at the database, and will print things not already in the display, as well as log displayed data (meaning that if the gui closes before update is pressed, the data is still saved, and will be displayed the next time update will be pressed) """ global count global username for log in share_hist.find(): if log not in display.find(): display.insert(log) share_history.canvas.text([0,count], text = log[username]['friend'] + ' ' + log[username]['share'] + ' ' + str(log[username]['date'])) count -= 12 get_new_shares() def print_entry(): """ Allows shares to be made, will check to make sure nothing is a repeat, will log the data. Interactive with the user. """ global count global username res = [] text = en.get() connection = friend.get() for user in users.find(): res.append(user['user']) if connection not in res: label.config(text = 'Sorry, user not in our records') return follower = ' was shared with ' message = text + follower + connection + '!' for thing in point_total.distinct(username): existing = thing point_total.update({username: existing}, {'$inc': {username:(-1)}}) points.config(text = str(existing-1)) if count == 1: t = datetime.datetime.now() if t.minute < 10: minute = '0'+str(t.minute) else: minute = str(t.minute) timestamp = str(t.month) + '/' + str(t.day) +'/' + str(t.year) + ',' +str(t.hour) + ':' + minute share_hist.insert({username:{'friend':connection,'share':text, 'date': timestamp}}) shared_source.insert({connection:{'link': text, 'friend':username}}) label.config(text = message) count -= 12 else: instance_count = 0 for instance in share_hist.distinct(username): if text == instance['share'] and connection == instance['friend']: label.config(text = 'That is a repeat!') return instance_count += 1 if instance_count == len(share_hist.distinct(username)): t = datetime.datetime.now() if t.minute < 10: minute = '0'+str(t.minute) else: minute = str(t.minute) timestamp = str(t.month) + '/' + str(t.day) +'/' + str(t.year) + ',' +str(t.hour) + ':' + minute share_hist.insert({username:{'friend':connection,'share':text, 'date': timestamp}}) shared_source.insert({connection:{'link': text, 'friend':username}}) label.config(text = message) def url_display(url): """ downloads a youtube video into a file, then plays that file within the gui space url - raw string url from gui input """ myfile="playingvid.mp4" try: os.remove(myfile) except OSError: k=2 os.system('youtube-dl -o playingvid.mp4 %s'%url) gobject.threads_init() window_id = canvas.winfo_id() player = gst.element_factory_make('playbin2', 'player') player.set_property('video-sink', None) x=os.path.dirname(os.path.realpath(__file__)) player.set_property('uri', 'file://%s/playingvid.mp4'%(x)) player.set_state(gst.STATE_PLAYING) bus = player.get_bus() bus.add_signal_watch() bus.enable_sync_message_emission() bus.connect('sync-message::element', on_sync_message, window_id) def on_sync_message(bus, message, window_id): if not message.structure is None: if message.structure.get_name() == 'prepare-xwindow-id': image_sink = message.src image_sink.set_property('force-aspect-ratio', True) image_sink.set_xwindow_id(window_id) def add_link(new_link): """ adds a link to the shared_viewer display """ return shared_viewer.insert(new_link) def get_new_shares(): """ will update the recieved, or shared_viewer display """ global share_count global username for i in shared_source.distinct(username): if i['link'] not in shared_viewer.distinct('link'): add_link(i) link = new_shared_list.canvas.text([0,share_count], text = str(i['link']), activefill = 'blue') link.bind('<Double-1>', onObjectClick) share_count -= 12 def onObjectClick(event): """ allows us to double click on a link and show it, as well as remove it from the list of need to view links """ global username for thing in point_total.find(): for key in thing: if key == username: existing = thing[username] point_total.update({username: existing}, {'$inc': {username:1}}) points.config(text = str(existing + 1)) index = event.widget.find_closest(event.x, event.y) i = shared_viewer.find() access = i[index[0] - 1] link = access['link'] url_display(link) shared_source.remove({username: {'link':access['link'], 'friend':access['friend']}}) #General set-up pretty = 'light cyan' gui = Gui() gui.title('MusicswAPPer') gui.row() gui.la(text = 'Welcome to the swAPP', bg = 'black', fg='cyan', justify = 'left', font = ('Times', 20, 'bold italic'), height = 2, relief = 'groove') gui.endrow() gui.row(bg=pretty) gui.col(bg=pretty) gui.bu(text = 'Refresh', fg = 'forest green', font = ('Times', 15, 'bold'), bg=pretty, activeforeground='forest green', activebackground='powder blue', command = update) gui.row([0,1], pady = 10, bg=pretty) gui.endrow() gui.la(text = 'Share a link', bg = pretty, font = ('Times', 13, 'italic'), anchor = 'left', justify='left') friend = gui.en(text = 'Who do you want to share with?', disabledforeground = 'light gray', fg = 'black', font = ('Times', 12)) en = gui.en(text = 'Insert URL here', font = ('Times', 12)) gui.bu(text = 'Share', font = ('Times', 15, 'bold'), bg = pretty, fg = 'forest green', activebackground = 'powder blue', activeforeground = 'forest green', command = print_entry) label = gui.la(bg=pretty, font=('Times', 11)) gui.row([0,1], pady = 10, bg=pretty) gui.endrow() gui.la(text = 'Share history', bg=pretty, font=('Times',13, 'italic')) share_history = gui.sc(width = 500, height = 300) share_history.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty, bd=0) gui.endcol() gui.col(bg=pretty) gui.ca(height = 10, width = 5, bg=pretty, bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.ca(height = 10, width = 5, bg='black',bd=0) gui.ca(height = 10, width = 5, bg=pretty,bd=0) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty) gui.endcol() gui.col(bg=pretty) gui.la(text = 'New Shares from Friends', bg = pretty, font=('Times', 13, 'italic')) new_shared_list = gui.sc(width = 500, height = 100) new_shared_list.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) gui.row([0,1], pady = 30, bg=pretty) gui.endrow() gui.la(text = 'Viewer', bg=pretty, font = ('Times', 13, 'italic')) canvas = gui.ca(width = 500, height = 300, bg='black') canvas.configure(confine = False, scrollregion = (0,0,2000, 2000)) points = gui.la(bg=pretty) gui.endcol() gui.col(bg=pretty) gui.ca(height = 100, width = 5, bg=pretty) gui.endcol() gui.endrow() initialize() gui.mainloop()
friend = g.en(text = 'Who do you want to share with?') en = g.en(text = 'Insert URL here') g.bu(text = 'Share', command = MediaShare.print_entry()) label = g.la() g.row([0,1], pady = 10) g.endrow() g.la(text = 'Share History') share_history = g.sc(width = 500, height = 300) share_history.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) g.endcol() g.col() g.ca(height = 100, width = 50) g.endcol() g.col() g.la(text = 'New Shares from Friends') new_shared_list = g.sc(width = 500, height = 100) new_shared_list.canvas.configure(confine = False, scrollregion = (0,0,1000,1000)) g.row([0,1], pady = 30) g.endrow() g.la(text = 'Link Preview') canvas = g.sc(width = 500, height = 300) canvas.canvas.configure(confine = False, scrollregion = (0,0,2000, 2000))
def change_color(): if circle == None: return 'Create a circle before press button.' color = entry.get() try: circle.config(fill=color) except: message = 'probaly an unknown color name' print message g = Gui() g.title('Gui') button = g.bu(text='Press it', command=callback1) canvas = g.ca(width=500, height=500) circle = None #canvas.config(bg='black') #item = canvas.rectangle([[0, 0], [200, 200]], #fill='white', outline='orange',width=10) #item = canvas.oval([[0, 0], [200, 100]], #fill='white', outline='orange',width=10) #item = canvas.line([[0, 100], [100, 200], [200, 100]], width=10, fill='white') #item = canvas.polygon([[0, 100], [100, 200], [200, 100]], width=10, fill='white', outline='orange') #entry = g.en(text='Default text.') #print entry.get() #text = g.te(width=100, height=5) #text.insert(2.3, 'nother') #text.delete(0.2, END) #print text.get(0.0, END)
from swampy.Gui import * from Tkinter import PhotoImage import PIL.Image import PIL.ImageTk g = Gui() canvas = g.ca(width=300) photo = PhotoImage(file='danger.gif') canvas.image([0,0], image=photo) g.la(image=photo) g.bu(image=photo) image = PIL.Image.open('allen.png') photo2 = PIL.ImageTk.PhotoImage(image) g.la(image=photo2) g.mainloop()
from swampy.Gui import * def testBit(int_type, offset): mask = 1 << offset return(int_type & mask) def toggleBit(int_type, offset): mask = 1 << offset return(int_type ^ mask) model = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0] g = Gui() g.title('Font creator') canvas = g.ca(200, 300, bg='orange') def redrawCanvas(): canvas.clear() for line in range(0, 16): canvas.text([70, 140-18*line], '['+str(line)+']='+str(model[line])) for pos in range(0, 8): x = 40 - pos * 10 y = 80 - line * 10 item = canvas.rectangle([[x, y], [x+10, y+10]], fill='white', outline='black', width=1) if testBit(model[line], pos) > 0: item.config(fill='black') def mouseClicked(event): cc = canvas.canvas_coords([event.x, event.y]) line = (-cc.y + 90) / 10
from swampy.Gui import * import Tkinter import Image as PIL import ImageTk g = Gui() g.title('Image Viewer') canvas = g.ca(width=400, height=400) photo = Tkinter.PhotoImage(file='danger.gif') ''' PhotoImage reads a file and returns a PhotoImage object that Tkinter can display ''' canvas.image([0, 0], image=photo) g.la(image=photo) g.bu(image=photo) g.mainloop()
from swampy.Gui import * g = Gui() g.title('19-3.py') canvas = g.ca(width = 500, height = 600, bg = 'white') circle = None def make_circle(): circle = canvas.circle([0,0], 100) def make_change(): if circle == None: return color = entry.get() try: circle.config(fill = color) except TclError, message: print message b1 = g.bu(text = 'Create Circle', command = make_circle) entry = g.en() b2 = g.bu(text = 'Press to Config', command= make_change) g.mainloop()
self.dragy = event.y self.move(dx, dy) def drop(self, event): self.config(fill=self.fill) def make_circle(event): pos = ca.canvas_coords([event.x, event.y]) item = ca.circle(pos, 5, fill='white') Draggable(item) def make_text(event=None): text = en.get() item = ca.text([0,0], text) Draggable(item) g = Gui() g.title('Draggable Demo') ca = g.ca(width=500, height=500, bg='black') ca.bind('<ButtonPress-3>', make_circle) g.row([1,0]) en = g.en() bu = g.bu('Make text item:', make_text) en.bind('<Return>', make_text) g.mainloop()
from swampy.Gui import * import Tkinter import Image as PIL import ImageTk g = Gui() g.title('Image Viewer') canvas = g.ca(width = 400, height = 400) photo = Tkinter.PhotoImage(file = 'danger.gif') ''' PhotoImage reads a file and returns a PhotoImage object that Tkinter can display ''' canvas.image([0,0], image = photo) g.la(image = photo) g.bu(image = photo) g.mainloop()
from swampy.Gui import * g = Gui() g.title('Event') def make_circle(event): pos = canvas.canvas_coords([event.x, event.y]) item = canvas.circle(pos, 5, fill = 'red') canvas = g.ca(width = 400, height = 400, bg = 'white') canvas.bind('<ButtonPress-1>', make_circle) g.mainloop()