def IoU(bbox, gt): # bbox = [ x , y , w , h ] ( x , y left up) shape = [-1, 1] x1 = tf.maximum(tf.cast(bbox[0], tf.float32), tf.reshape(tf.cast(gt[:,0], tf.float32), shape)) y1 = tf.maximum(tf.cast(bbox[1], tf.float32), tf.reshape(tf.cast(gt[:,1], tf.float32), shape)) x2 = tf.minimum(tf.cast(bbox[2] + bbox[0], tf.float32), tf.reshape(tf.cast(gt[:,2] + gt[:,0], tf.float32), shape)) y2 = tf.minimum(tf.cast(bbox[3] + bbox[1], tf.float32), tf.reshape(tf.cast(gt[:,3] + gt[:,1], tf.float32), shape)) inter_w = tf.sub(x2,x1) inter_h = tf.sub(y2,y1) inter = tf.cast(inter_w * inter_h, tf.float32) bounding_box = tf.cast(tf.mul(bbox[2],bbox[3]), tf.float32) ground_truth = tf.reshape(tf.cast(tf.mul(gt[:,2],gt[:,3]), tf.float32), shape) #iou = tf.div(inter,tf.sub(tf.add(bounding_box,tf.reshape(ground_truth,shape)),inter)) iou = inter / (bounding_box + ground_truth - inter) # limit the iou range between 0 and 1 mask_less = tf.cast(tf.logical_not(tf.less(iou, tf.zeros_like(iou))), tf.float32) #mask_great = tf.cast(tf.logical_not(tf.greater(iou, tf.ones_like(iou))), tf.float32) iou = tf.mul(iou, mask_less) #iou = tf.mul(iou, positive_mask) return iou
def __init__(self, num_features, num_output, l2_reg_lambda=0.0, neg_output=False): self.input_x = tf.placeholder(tf.float32, [None, num_features], name="input_x") self.input_y = tf.placeholder(tf.float32, [None, num_output], name="input_y") # Keeping track of l2 regularization loss (optional) l2_loss = tf.constant(0.0) with tf.name_scope("softmax"): filter_shape = [num_features, num_output] W = tf.Variable(tf.truncated_normal(filter_shape, stddev=0.1)) b = tf.Variable(tf.constant(0.1, shape=[num_output])) self.raw_scores = tf.nn.xw_plus_b(self.input_x, W, b, name="scores") if neg_output: self.scores = tf.nn.elu(self.raw_scores, name="tanh") else: self.scores = tf.nn.relu(self.raw_scores, name="relu") l2_loss += tf.nn.l2_loss(W) l2_loss += tf.nn.l2_loss(b) with tf.name_scope("loss"): self.losses = tf.square(tf.sub(self.scores, self.input_y)) self.avgloss = tf.reduce_mean(tf.abs(tf.sub(self.scores, self.input_y))) self.loss = tf.reduce_mean(self.losses) + l2_reg_lambda * l2_loss
def convert_to_one(bbox, width, height, S): x, y, w, h = bbox x = tf.cast(x, tf.float32) y = tf.cast(y, tf.float32) w = tf.cast(w, tf.float32) h = tf.cast(h, tf.float32) global_center_x = tf.mul(tf.add(tf.mul(x, 2), w), 0.5) global_center_y = tf.mul(tf.add(tf.mul(y, 2), h), 0.5) w = tf.div(w, width) h = tf.div(h, height) cell_w = tf.cast(tf.div(tf.cast(width, tf.int32), S), tf.float32) cell_h = tf.cast(tf.div(tf.cast(height, tf.int32), S), tf.float32) cell_coord_x = tf.cast(tf.cast(tf.div(global_center_x, cell_w), tf.int32), tf.float32) cell_coord_y = tf.cast(tf.cast(tf.div(global_center_y, cell_h), tf.int32), tf.float32) offset_x = tf.div(tf.sub(global_center_x, tf.mul(cell_coord_x, cell_w)), cell_w) offset_y = tf.div(tf.sub(global_center_y, tf.mul(cell_coord_y, cell_h)), cell_h) assert offset_x.dtype == tf.float32 and \ offset_y.dtype == tf.float32 and \ w.dtype == tf.float32 and \ h.dtype == tf.float32 bbox = [offset_x, offset_y, w, h] return bbox
def r_loss(communities = 2, group_size = 10, seed=None, p=0.4, q=0.05, r=1.0, projection_dim=2): """testing to see if the loss will decrease backproping through very simple function""" B = np.asarray(balanced_stochastic_blockmodel(communities, group_size, p, q, seed)).astype(np.double) B = tf.cast(B, tf.float64) Diag = tf.diag(tf.reduce_sum(B,0)) Diag = tf.cast(Diag, tf.float64) #r_grid = tf.linspace(r_min, r_max, grid_size) r = tf.cast(r, tf.float64) BH = (tf.square(r)-1)*tf.diag(tf.ones(shape=[communities*group_size], dtype=tf.float64))-tf.mul(r, B)+Diag with tf.Session() as sess: eigenval, eigenvec = tf.self_adjoint_eig(BH) eigenvec_proj = tf.slice(eigenvec, [0,0], [communities*group_size, projection_dim]) true_assignment_a = tf.concat(0, [-1*tf.ones([group_size], dtype=tf.float64), tf.ones([group_size], dtype=tf.float64)]) true_assignment_b = -1*true_assignment_a true_assignment_a = tf.expand_dims(true_assignment_a, 1) true_assignment_b = tf.expand_dims(true_assignment_b, 1) projected_a = tf.matmul(tf.matmul(eigenvec_proj, tf.transpose(eigenvec_proj)), true_assignment_a)#tf.transpose(true_assignment_a)) projected_b = tf.matmul(tf.matmul(eigenvec_proj, tf.transpose(eigenvec_proj)), true_assignment_b)#tf.transpose(true_assignment_b)) loss = tf.minimum(tf.reduce_sum(tf.square(tf.sub(projected_a, true_assignment_a))), tf.reduce_sum(tf.square(tf.sub(projected_b, true_assignment_b)))) d = sess.run(loss) return d
def _build_loss(self): with tf.variable_scope("loss"): # Compute y_j = r_j * discount*best_qvalue self.tf_discount = tf.constant(self.discount) self.qtarget = tf.add(self.pl_rewards, tf.mul(1.0-self.pl_terminals, tf.mul(self.tf_discount, self.pl_qtargets))) # Select Q-values for given actions self.actions_one_hot = tf.one_hot(self.pl_actions, self.num_actions, 1.0, 0.0) self.qvalue_pred = tf.reduce_sum(tf.mul(self.qvalues, self.actions_one_hot), reduction_indices=1) # Difference between target and predicted Q-network output self.delta = tf.sub(self.qtarget, self.qvalue_pred) if self.clip_delta > 0: # Perform clipping of the error term, default clipping is to (-1, +1) range self.quadratic_part = tf.minimum(tf.abs(self.delta), tf.constant(self.clip_delta)) self.linear_part = tf.sub(tf.abs(self.delta), self.quadratic_part) self.delta_square = tf.mul(tf.constant(0.5), tf.square(self.quadratic_part)) + (self.clip_delta*self.linear_part) #self.delta_clipped = tf.clip_by_value(self.delta, -1.0*self.clip_delta, self.clip_delta) #self.delta_square = tf.square(self.delta_clipped) else: # No error clipping self.delta_square = tf.square(self.delta) # Actual loss if self.batch_accumulator == "sum": self.loss = tf.reduce_sum(self.delta_square) else: self.loss = tf.reduce_mean(self.delta_square) # Running average of the loss for TensorBoard self.loss_moving_avg = tf.train.ExponentialMovingAverage(decay=0.999) self.loss_moving_avg_op = self.loss_moving_avg.apply([self.loss])
def lossFunction(logits, labels, scale_factor): print "TrackNet: building loss function..." logit_trans, logit_rot = tf.split(1,2,logits) label_trans, label_rot = tf.split(1,2,labels) trans_loss = tf.nn.l2_loss(tf.sub(logit_trans, label_trans)) rot_loss = tf.mul(scale_factor, tf.nn.l2_loss(tf.sub(logit_trans, label_trans))) return tf.add(trans_loss,rot_loss)
def metric_single(training, test, scale_frac, scales): """Calculates the distance between a training and test instance.""" if scale_frac == 0: distance = tf.sqrt(tf.reduce_sum(tf.square(tf.sub(training, test)), reduction_indices=1, keep_dims=True)) else: distance = tf.sqrt( tf.reduce_sum(tf.square(tf.div(tf.sub(training, test), scales)), reduction_indices=1, keep_dims=True) ) return distance
def __init__(self, inputX, C=None, hidden_dims=[300,150,300], lambda1=0.01, lambda2=0.01, activation='tanh', \ weight_init='uniform', noise=None, learning_rate=0.1, optimizer='Adam'): self.noise = noise n_sample, n_feat = inputX.shape # M must be a even number assert len(hidden_dims) % 2 == 1 # Add the end layer hidden_dims.append(n_feat) # self.depth = len(dims) # This is not the symbolic variable of tensorflow, this is real! self.inputX = inputX if C is None: # Transpose the matrix first, and get the whole matrix of C self.inputC = sparseCoefRecovery(inputX.T) else: self.inputC = C self.C = tf.placeholder(dtype=tf.float32, shape=[None, None], name='C') self.hidden_layers = [] self.X = self._add_noise(tf.placeholder(dtype=tf.float32, shape=[None, n_feat], name='X')) input_hidden = self.X weights, biases = init_layer_weight(hidden_dims, inputX, weight_init) # J3 regularization term J3_list = [] for init_w, init_b in zip(weights, biases): self.hidden_layers.append(DenseLayer(input_hidden, init_w, init_b, activation=activation)) input_hidden = self.hidden_layers[-1].output J3_list.append(tf.reduce_mean(tf.square(self.hidden_layers[-1].w))) J3_list.append(tf.reduce_mean(tf.square(self.hidden_layers[-1].b))) J3 = lambda2 * tf.add_n(J3_list) self.H_M = self.hidden_layers[-1].output # H(M/2) the output of the mid layer self.H_M_2 = self.hidden_layers[(len(hidden_dims)-1)/2].output # calculate loss J1 # J1 = tf.nn.l2_loss(tf.sub(self.X, self.H_M)) J1 = tf.sqrt(tf.reduce_mean(tf.square(tf.sub(self.X, self.H_M)))) # calculate loss J2 J2 = lambda1 * tf.sqrt(tf.reduce_mean(tf.square(tf.sub(tf.transpose(self.H_M_2), \ tf.matmul(tf.transpose(self.H_M_2), self.C))))) self.cost = J1 + J2 + J3 self.optimizer = optimize(self.cost, learning_rate, optimizer)
def comU(a, b, tag = 2): fea = [] fea.append(cosine_distance(a, b)) #fea.append(tf.sqrt(tf.reduce_sum(tf.square(tf.sub(a,b)), axis=1))) fea.append(tf.sqrt(tf.reduce_sum(tf.square(tf.sub(a,b)), axis=1))) if tag == 2: fea.append(tf.reduce_max(tf.abs(tf.sub(a, b)), axis=1)) #print 'fea=', fea return tf.pack(fea, axis=1)
def binary_cross_entropy(prediction, target): """ let o=prediction, t=target -(t*log(o) + (1-t)*log(1-o)) Adds a small (1e-12) value to the logarithms to avoid log(0) """ op1 = tf.mul(target, tf.log(prediction + 1e-12)) op2 = tf.mul(tf.sub(1., target), tf.log(tf.sub(1., prediction) + 1e-12)) return tf.neg(tf.add(op1, op2))
def norm(name, input_layer): """ Batch-normalizes the layer as in http://arxiv.org/abs/1502.03167 This is important since it allows the different scales to talk to each other when they get joined. """ mean, variance = tf.nn.moments(input_layer, [0, 1, 2]) variance_epsilon = 0.01 # TODO: Check what this value should be inv = tf.rsqrt(variance + variance_epsilon) scale = tf.Variable(tf.random_uniform([1]), name="scale") # TODO: How should these initialize? offset = tf.Variable(tf.random_uniform([1]), name="offset") return tf.sub(tf.mul(tf.mul(scale, inv), tf.sub(input_layer, mean)), offset, name=name)
def tf_2d_normal(x1, x2, mu1, mu2, s1, s2, rho): #Inspired from Hardmaru's implementation on Github norm1 = tf.sub(x1, mu1) norm2 = tf.sub(x2, mu2) s1s2 = tf.mul(s1, s2) z = tf.square(tf.div(norm1, s1))+tf.square(tf.div(norm2, s2))-2*tf.div(tf.mul(rho, tf.mul(norm1, norm2)), s1s2) negRho = 1-tf.square(rho) result = tf.exp(tf.div(-z,2*negRho)) denom = 2*np.pi*tf.mul(s1s2, tf.sqrt(negRho)) result = tf.div(result, denom) return result
def tf_2d_normal(x1, x2, mu1, mu2, s1, s2, rho): # eq # 24 and 25 of http://arxiv.org/abs/1308.0850 norm1 = tf.sub(x1, mu1) norm2 = tf.sub(x2, mu2) s1s2 = tf.mul(s1, s2) z = tf.square(tf.div(norm1, s1))+tf.square(tf.div(norm2, s2))-2*tf.div(tf.mul(rho, tf.mul(norm1, norm2)), s1s2) negRho = 1-tf.square(rho) result = tf.exp(tf.div(-z,2*negRho)) denom = 2*np.pi*tf.mul(s1s2, tf.sqrt(negRho)) result = tf.div(result, denom) return result
def mem_body(self, step, story_len, facts, q_double, mem_state_double): print ("!!!!!!!!!!!!!!!!!!!!!") z = tf.concat(1, [tf.mul(tf.gather(facts, step), q_double), tf.mul(tf.gather(facts, step), mem_state_double), tf.abs(tf.sub(tf.gather(facts, step), q_double)), tf.abs(tf.sub(tf.gather(facts, step), mem_state_double))]) # record Z (all episodic memory states) def f1(): return seq2seq.feedforward_nn(z, self.attention_ff_size, self.attention_ff_l1_size, self.attention_ff_l2_size) def f2(): return tf.concat(0, [tf.reshape(tf.to_float(self.episodic_array),[-1]), tf.reshape(seq2seq.feedforward_nn(z, self.attention_ff_size, self.attention_ff_l1_size, self.attention_ff_l2_size),[-1])]) self.episodic_array = tf.cond(tf.less(step,1), f1, f2) print (self.episodic_array) print ('=-=-=-=-=', tf.to_float(self.episodic_array), seq2seq.feedforward_nn(z, self.attention_ff_size, self.attention_ff_l1_size, self.attention_ff_l2_size)) step =tf.add(step, 1) return step, story_len, facts, q_double, mem_state_double
def loss_with_step(self): margin = 5.0 labels_t = self.y_ labels_f = tf.sub(1.0, self.y_, name="1-yi") # labels_ = !labels; eucd2 = tf.pow(tf.sub(self.o1, self.o2), 2) eucd2 = tf.reduce_sum(eucd2, 1) eucd = tf.sqrt(eucd2+1e-6, name="eucd") C = tf.constant(margin, name="C") pos = tf.mul(labels_t, eucd, name="y_x_eucd") neg = tf.mul(labels_f, tf.maximum(0.0, tf.sub(C, eucd)), name="Ny_C-eucd") losses = tf.add(pos, neg, name="losses") loss = tf.reduce_mean(losses, name="loss") return loss
def spatial_batch_norm(input_layer, name='spatial_batch_norm'): """ Batch-normalizes the layer as in http://arxiv.org/abs/1502.03167 This is important since it allows the different scales to talk to each other when they get joined. """ mean, variance = tf.nn.moments(input_layer, [0, 1, 2]) variance_epsilon = 0.01 # TODO: Check what this value should be inv = tf.rsqrt(variance + variance_epsilon) num_channels = input_layer.get_shape().as_list()[3] # TODO: Clean this up scale = tf.Variable(tf.random_uniform([num_channels]), name='scale') # TODO: How should these initialize? offset = tf.Variable(tf.random_uniform([num_channels]), name='offset') return_val = tf.sub(tf.mul(tf.mul(scale, inv), tf.sub(input_layer, mean)), offset, name=name) return return_val
def getNeighborWeights(self, transformedCoordinates, clampedCoordinatesList): flooredCoordinates = tf.slice(clampedCoordinatesList[0], [0, 1], [tf.shape(clampedCoordinatesList[0])[0], 3]) if self.isVerbose: transformedCoordinates = tf.Print(transformedCoordinates, [transformedCoordinates], summarize=1000) flooredCoordinates = tf.Print(flooredCoordinates, [flooredCoordinates], summarize=1000) deltas = tf.sub(transformedCoordinates, flooredCoordinates) if self.isVerbose: deltas = tf.Print(deltas, [deltas], summarize=1000) deltaW = self.sliceIndex(deltas, 2) deltaH = self.sliceIndex(deltas, 1) deltaC = self.sliceIndex(deltas, 0) if self.isVerbose: deltaW = tf.Print(deltaW, [deltaW], summarize=1000) deltaH = tf.Print(deltaH, [deltaH], summarize=1000) deltaC = tf.Print(deltaC, [deltaC], summarize=1000) #just declare for concisely writing the various weights ConstantOne = tf.constant([1], dtype=tf.float32) W_lll = tf.mul(tf.mul(tf.sub(ConstantOne, deltaW) , tf.sub(ConstantOne, deltaH)) , tf.sub(ConstantOne, deltaC)) W_llu = tf.mul(tf.mul(tf.sub(ConstantOne, deltaW) , tf.sub(ConstantOne, deltaH)) , deltaC ) W_lul = tf.mul(tf.mul(tf.sub(ConstantOne, deltaW) , deltaH ) , tf.sub(ConstantOne, deltaC)) W_luu = tf.mul(tf.mul(tf.sub(ConstantOne, deltaW) , deltaH ) , deltaC ) W_ull = tf.mul(tf.mul(deltaW , tf.sub(ConstantOne, deltaH)) , tf.sub(ConstantOne, deltaC)) W_ulu = tf.mul(tf.mul(deltaW , tf.sub(ConstantOne, deltaH)) , deltaC ) W_uul = tf.mul(tf.mul(deltaW , deltaH ) , tf.sub(ConstantOne, deltaC)) W_uuu = tf.mul(tf.mul(deltaW , deltaH ) , deltaC ) if self.isVerbose: W_lll = tf.Print(W_lll, [W_llu], summarize=1000) W_llu = tf.Print(W_llu, [W_lll], summarize=1000) W_lul = tf.Print(W_lul, [W_lul], summarize=1000) W_luu = tf.Print(W_luu, [W_luu], summarize=1000) W_ull = tf.Print(W_ull, [W_ull], summarize=1000) W_ulu = tf.Print(W_ulu, [W_ulu], summarize=1000) W_uul = tf.Print(W_uul, [W_uul], summarize=1000) W_uuu = tf.Print(W_uuu, [W_uuu], summarize=1000) weightList = [] weightList.append(W_lll) weightList.append(W_llu) weightList.append(W_lul) weightList.append(W_luu) weightList.append(W_ull) weightList.append(W_ulu) weightList.append(W_uul) weightList.append(W_uuu) return weightList
def convert_to_reality(bbox, width, height, S): relative_center_x, relative_center_y, global_w, global_h = bbox w = tf.cast(tf.cast(tf.mul(global_w, width), tf.int32), tf.float32) h = tf.cast(tf.cast(tf.mul(global_h, height), tf.int32), tf.float32) index = tf.reshape(tf.range(S * S),[-1,1]) cell_coord_y = tf.cast(tf.div(index, S), tf.float32) cell_coord_x = tf.cast(tf.mod(index, S), tf.float32) S = tf.cast(S, tf.float32) width = tf.cast(width, tf.float32) height = tf.cast(height, tf.float32) cell_w = tf.cast(width / S, tf.float32) cell_h = tf.cast(height / S, tf.float32) #real_x_left_up = tf.reshape((cell_coord_x + relative_center_x) * cell_w - w / 2,[-1]) #real_y_left_up = tf.reshape((cell_coord_y + relative_center_y) * cell_h - h / 2, [-1]) real_x_left_up = tf.sub(tf.add(tf.reshape(tf.mul(cell_coord_x, cell_w), [-1]), relative_center_x * cell_w), tf.cast(w * 0.5, tf.float32)) real_y_left_up = tf.sub(tf.add(tf.reshape(tf.mul(cell_coord_y, cell_h), [-1]), relative_center_y * cell_h), tf.cast(h * 0.5, tf.float32)) real_x_left_up = tf.cast(tf.nn.relu(real_x_left_up), tf.int32) real_y_left_up = tf.cast(tf.nn.relu(real_y_left_up), tf.int32) w = tf.cast(w, tf.int32) h = tf.cast(h, tf.int32) print 'real x ', relative_center_x.get_shape() print 'real w' , w.get_shape() """ assert real_x_left_up.dtype == tf.int32 and \ real_y_left_up.dtype == tf.int32 and \ w.dtype == tf.int32 and \ h.dtype == tf.int32 """ bbox = [real_x_left_up, real_y_left_up, w, h] return bbox
def kMeansCluster(vector_values, num_clusters, max_num_steps, stop_coeficient = 0.0): vectors = tf.constant(vector_values) centroids = tf.Variable(tf.slice(tf.random_shuffle(vectors), [0,0],[num_clusters,-1])) old_centroids = tf.Variable(tf.zeros([num_clusters,2])) centroid_distance = tf.Variable(tf.zeros([num_clusters,2])) expanded_vectors = tf.expand_dims(vectors, 0) expanded_centroids = tf.expand_dims(centroids, 1) print expanded_vectors.get_shape() print expanded_centroids.get_shape() distances = tf.reduce_sum( tf.square(tf.sub(expanded_vectors, expanded_centroids)), 2) assignments = tf.argmin(distances, 0) means = tf.concat(0, [ tf.reduce_mean( tf.gather(vectors, tf.reshape( tf.where( tf.equal(assignments, c) ),[1,-1]) ),reduction_indices=[1]) for c in xrange(num_clusters)]) save_old_centroids = tf.assign(old_centroids, centroids) update_centroids = tf.assign(centroids, means) init_op = tf.initialize_all_variables() performance = tf.assign(centroid_distance, tf.sub(centroids, old_centroids)) check_stop = tf.reduce_sum(tf.abs(performance)) with tf.Session() as sess: sess.run(init_op) for step in xrange(max_num_steps): print "Running step " + str(step) sess.run(save_old_centroids) _, centroid_values, assignment_values = sess.run([update_centroids, centroids, assignments]) sess.run(check_stop) current_stop_coeficient = check_stop.eval() print "coeficient:", current_stop_coeficient if current_stop_coeficient <= stop_coeficient: break return centroid_values, assignment_values
def mol_conv_layer(atoms, cH_params, aux_params, layer): #Sum all neighbors using adjacency matrix atom_sum_neigh = sum_neigh(atoms, aux_params, layer) # Partition the atom matrix by degree of atoms # THIS CREATES PROBLEMS WITH GRADIENTS. NEED TO USE SLICING indices = tf.sub(deg_list_ph, tf.constant(1,dtype=tf.int32)) atom_partitions = tf.dynamic_partition(atom_sum_neigh, indices, max_deg) # Get collection of modified atom features new_rel_atoms_collection = [] for deg in range(1,6): # Obtain relevant atoms for this degree rel_atoms = atom_partitions[deg-1] # Apply hidden affine to relevant atoms and append if bool_separate_conv_depths: out = affine(rel_atoms, cH_params['W'+str(deg)+'_'+str(layer)], cH_params['b'+str(deg)+'_'+str(layer)]) else: out = affine(rel_atoms, cH_params['W'+str(deg)], cH_params['b'+str(deg)]) new_rel_atoms_collection.append(out) # Combine all atoms back into the list # NOTE: FOR NOW USE CONCATENATION. MEANS WE CANNOT USE ARBITARY deg_list ORDER hidden_atoms = tf.concat(0, new_rel_atoms_collection) # Apply relu activated_atoms = tf.nn.relu(hidden_atoms) return activated_atoms
def testCond_2(self): with self.test_session(): x = tf.constant(10) r = tf.cond(tf.less(1, 0), lambda: tf.add(x, 1), lambda: tf.sub(x, 1)) result = r.eval() self.assertTrue(check_op_order(x.graph)) self.assertAllEqual(9, result)
def image_preprocessing(image_buffer, bbox, train, thread_id=0): """Decode and preprocess one image for evaluation or training. Args: image_buffer: JPEG encoded string Tensor bbox: 3-D float Tensor of bounding boxes arranged [1, num_boxes, coords] where each coordinate is [0, 1) and the coordinates are arranged as [ymin, xmin, ymax, xmax]. train: boolean thread_id: integer indicating preprocessing thread Returns: 3-D float Tensor containing an appropriately scaled image Raises: ValueError: if user does not provide bounding box """ if bbox is None: raise ValueError('Please supply a bounding box.') image = decode_jpeg(image_buffer) height = FLAGS.image_size width = FLAGS.image_size if train: image = distort_image(image, height, width, bbox, thread_id) else: image = eval_image(image, height, width) # Finally, rescale to [-1,1] instead of [0, 1) image = tf.sub(image, 0.5) image = tf.mul(image, 2.0) return image
def get_mixture_coef(output): # returns the tf slices containing mdn dist params # ie, eq 18 -> 23 of http://arxiv.org/abs/1308.0850 z = output z_eos = z[:, 0:1] z_pi, z_mu1, z_mu2, z_sigma1, z_sigma2, z_corr = tf.split(1, 6, z[:, 1:]) # process output z's into MDN paramters # end of stroke signal z_eos = tf.sigmoid(z_eos) # should be negated, but doesn't matter. # softmax all the pi's: max_pi = tf.reduce_max(z_pi, 1, keep_dims=True) z_pi = tf.sub(z_pi, max_pi) z_pi = tf.exp(z_pi) normalize_pi = tf.inv(tf.reduce_sum(z_pi, 1, keep_dims=True)) z_pi = tf.mul(normalize_pi, z_pi) # exponentiate the sigmas and also make corr between -1 and 1. z_sigma1 = tf.exp(z_sigma1) z_sigma2 = tf.exp(z_sigma2) z_corr = tf.tanh(z_corr) return [z_pi, z_mu1, z_mu2, z_sigma1, z_sigma2, z_corr, z_eos]
def bond_conv_layer(activated_atoms, bv_params, layer): flow_depth = flow_layer_depths[layer] next_activated_atoms = tf.zeros(tf.pack([N_atoms_ph, flow_depth])) for deg in range(1, 6): indices = tf.sub(deg_list_ph, tf.constant(1,dtype=tf.int32)) flow_param = bv_params['A_flow'+str(layer)+'_'+str(deg)] flow_map = tf.gather(flow_param, type_adj_ph) multiples = tf.pack([N_atoms_ph, 1, 1]) activated_atoms_dim = tf.expand_dims(tf.tile(tf.expand_dims(activated_atoms, 0), multiples), 2) adj_mul = tf.batch_matmul(activated_atoms_dim, flow_map) adj_mul = tf.squeeze(adj_mul, [2]) deg_mask = tf.to_float(tf.equal(deg_list_ph, deg)) multiples = tf.pack([1, N_atoms_ph, flow_depth]) deg_list_dim = tf.tile(tf.expand_dims(tf.expand_dims(deg_mask, 1), 1), multiples) multiples = tf.pack([N_atoms_ph, N_atoms_ph, 1]) biases = tf.tile(bv_params['b_flow'+str(layer)+'_'+str(deg)], multiples) filtered_atoms = tf.add(tf.mul(adj_mul, deg_list_dim), biases) next_activated_atoms = next_activated_atoms + tf.reduce_sum(filtered_atoms, 1) next_activated_atoms = tf.nn.relu(next_activated_atoms) return next_activated_atoms
def preprocess_image(image_buffer): """Preprocess JPEG encoded bytes to 3D float Tensor.""" # Decode the string as an RGB JPEG. # Note that the resulting image contains an unknown height and width # that is set dynamically by decode_jpeg. In other words, the height # and width of image is unknown at compile-time. image = tf.image.decode_jpeg(image_buffer, channels=3) # After this point, all image pixels reside in [0,1) # until the very end, when they're rescaled to (-1, 1). The various # adjust_* ops all require this range for dtype float. image = tf.image.convert_image_dtype(image, dtype=tf.float32) # Crop the central region of the image with an area containing 87.5% of # the original image. image = tf.image.central_crop(image, central_fraction=0.875) # Resize the image to the original height and width. image = tf.expand_dims(image, 0) image = tf.image.resize_bilinear(image, [FLAGS.image_size, FLAGS.image_size], align_corners=False) image = tf.squeeze(image, [0]) # Finally, rescale to [-1,1] instead of [0, 1) image = tf.sub(image, 0.5) image = tf.mul(image, 2.0) return image
def w(input_data, cu, kappas_t_1, config): batch_size = config.batch_size mixture_size = config.mixture_size vocab_length = config.vocab_length # split along dim of mixture size * 3 hat_alphas_t, hat_betas_t, hat_kappas_t = tf.split(1, 3, input_data) alphas_t = tf.exp(hat_alphas_t) betas_t = tf.exp(hat_betas_t) kappas_t = tf.add(kappas_t_1, tf.exp(hat_kappas_t)) speech_length = tf.shape(cu)[1] u = tf.linspace(1.0, tf.cast(speech_length,tf.float32) , speech_length) u = tf.expand_dims(u, 0) u = tf.expand_dims(u, 0) u = tf.tile(u, [batch_size, mixture_size, 1]) alphas_t_expanded = tf.tile(tf.expand_dims(alphas_t, -1), [1, 1, speech_length]) betas_t_expanded = tf.tile(tf.expand_dims(betas_t, -1), [1, 1, speech_length]) kappas_t_expanded = tf.tile(tf.expand_dims(kappas_t, -1), [1, 1, speech_length]) calc = tf.square(tf.sub(kappas_t_expanded, u)) calc = tf.mul(calc, tf.neg(betas_t_expanded)) calc = tf.exp(calc) calc = tf.mul(calc, alphas_t_expanded) phi_t = tf.expand_dims(tf.reduce_sum(calc, 1), 1) output = tf.squeeze(tf.batch_matmul(phi_t, cu), [1]) return output, kappas_t, phi_t
def fztloss( f, pVecs, nVecs ): """ Tensorized cost function from Fast Zero-Shot Learning paper Args: f: The output from the network, a tensor of shape (# images, word embedding size) pVecs: The vector embeddings of the ground truth tags, a tensor of shape (# images, # positive tags, word embedding size) nVecs: The vector embeddings of negatively sampled tags, a tensor of shape (# images, # negative samples, word embedding size) Returns: Scalar tensor representing the batch cost """ posmul = tf.mul(pVecs, f) negmul = tf.mul(nVecs, f) tfpos = tf.reduce_sum(posmul, reduction_indices=2) tfneg = tf.reduce_sum(negmul, reduction_indices=2) tfpos = tf.transpose(tfpos, [1,0]) tfneg = tf.transpose(tfneg, [1,0]) negexpan = tf.tile( tf.expand_dims(tfneg, -1), [1, 1, tf.shape(tfpos)[1]] ) posexpan = tf.tile( tf.transpose(tf.expand_dims(tfpos, -1), [0,2,1]), [1, tf.shape(tfneg)[1], 1]) differences = tf.sub(negexpan, posexpan) return tf.reduce_sum(tf.reduce_sum(tf.log(1 + tf.exp(differences)), reduction_indices=[1,2]))
def distance_model(batch_x1, batch_x2): with tf.variable_scope("siamese") as scope: model1 = build_model(batch_x1) scope.reuse_variables() model2 = build_model(batch_x2) distance = tf.sqrt(tf.reduce_sum(tf.pow(tf.sub(model1, model2), 2), 1, keep_dims=True)) return model1, model2, distance
def square_loss(outputs, targets): ''' Loss function - square loss (rmsd^2) Args: outputs, targets The shape of both outputs and targets is a list of tensors: [sequence_len, tensor(batch_size,feature_size)] Returns: batch_loss: 1D tensor with the size of batch_size. Each element is the loss value of that batch ''' if len(outputs) != len(targets): raise ValueError("Outputs length must be equal to the targets length," " %d != %d." % (len(outputs), len(targets))) with tf.device("/cpu:0"): frame_loss = [] # list of batch losses of single frames for i in xrange(len(outputs)): a = tf.sub(outputs[i],targets[i]) b = tf.square(a) c = tf.reduce_sum(b,1) n = tf.constant(a.get_shape().dims[1].value/3,dtype=tf.float32) # number of atoms frame_loss.append(tf.div(c,n)) frame_loss = tf.pack(frame_loss) # average over the whole sequence to get the batch losses batch_loss = tf.reduce_mean(frame_loss,0) return batch_loss
def _multichannel_image_summary(name, images, perm=[0, 3, 1, 2], max_summary_images=16): _min = tf.reduce_min(images) _max = tf.reduce_max(images) _ = tf.mul(tf.div(tf.add(images, _min), tf.sub(_max, _min)), 255.0) _ = tf.transpose(_, perm=perm) shape = _.get_shape().as_list() tf.image_summary(name, tf.reshape(tf.transpose(_, perm=perm), [reduce(lambda x,y:x*y, shape)/(shape[3]*shape[2]), shape[2], shape[3], 1]), max_images=max_summary_images)
def __init__(self, config): ### Initialize setting print("initializing") np.set_printoptions(precision=4) self.stage = config['stage'] self.device = config['device'] self.output_dim = config['output_dim'] self.n_class = config['label_dim'] self.subspace_num = config['n_subspace'] self.subcenter_num = config['n_subcenter'] self.code_batch_size = config['code_batch_size'] self.cq_lambda = config['cq_lambda'] self.max_iter_update_Cb = config['max_iter_update_Cb'] self.max_iter_update_b = config['max_iter_update_b'] #self.centers_device = config['centers_device'] self.batch_size = config['batch_size'] self.max_iter = config['max_iter'] self.img_model = config['img_model'] self.loss_type = config['loss_type'] self.console_log = (config['console_log'] == 1) self.learning_rate = config['learning_rate'] self.learning_rate_decay_factor = config['learning_rate_decay_factor'] self.decay_step = config['decay_step'] self.finetune_all = config['finetune_all'] self.margin_param = config['margin_param'] self.wordvec_dict = config['wordvec_dict'] self.partlabel = config['partlabel'] ### Format as 'path/to/save/dir/lr_{$0}_output_dim{$1}_iter_{$2}' self.save_dir = config['save_dir'] + self.loss_type + '_lr_' + str( self.learning_rate) + '_cqlambda_' + str( self.cq_lambda) + '_subspace_' + str( self.subspace_num) + '_margin_' + str( self.margin_param) + '_partlabel_' + str( self.partlabel) + '_iter_' + str( self.max_iter) + '_output_' + str( self.output_dim) + '_' ### Setup session print("launching session") configProto = tf.ConfigProto() configProto.gpu_options.allow_growth = True configProto.allow_soft_placement = True self.sess = tf.Session(config=configProto) ### Create variables and placeholders with tf.device(self.device): self.img = tf.placeholder(tf.float32, [self.batch_size, 256, 256, 3]) self.img_label = tf.placeholder(tf.float32, [self.batch_size, self.n_class]) self.img_last_layer, self.img_output, self.C = \ self.load_model(config['model_weights']) ### Centers shared in different modalities (image & text) ### Binary codes for different modalities (image & text) self.img_output_all = tf.placeholder(tf.float32, [None, self.output_dim]) self.img_b_all = tf.placeholder( tf.float32, [None, self.subspace_num * self.subcenter_num]) self.b_img = tf.placeholder( tf.float32, [None, self.subspace_num * self.subcenter_num]) self.ICM_m = tf.placeholder(tf.int32, []) self.ICM_b_m = tf.placeholder(tf.float32, [None, self.subcenter_num]) self.ICM_b_all = tf.placeholder( tf.float32, [None, self.subcenter_num * self.subspace_num]) self.ICM_X = tf.placeholder( tf.float32, [self.code_batch_size, self.output_dim]) self.ICM_C_m = tf.slice(self.C, [self.ICM_m * self.subcenter_num, 0], [self.subcenter_num, self.output_dim]) self.ICM_X_residual = tf.add( tf.sub(self.ICM_X, tf.matmul(self.ICM_b_all, self.C)), tf.matmul(self.ICM_b_m, self.ICM_C_m)) ICM_X_expand = tf.expand_dims(self.ICM_X_residual, 1) ICM_C_m_expand = tf.expand_dims(self.ICM_C_m, 0) # N*sc*D * D*n word_dict = tf.constant(np.loadtxt(self.wordvec_dict), dtype=tf.float32) ICM_word_dict = tf.reshape( tf.matmul( tf.reshape(tf.sub(ICM_X_expand, ICM_C_m_expand), [ self.code_batch_size * self.subcenter_num, self.output_dim ]), tf.transpose(word_dict)), [self.code_batch_size, self.subcenter_num, self.n_class]) ICM_sum_squares = tf.reduce_sum(tf.square(ICM_word_dict), reduction_indices=2) ICM_best_centers = tf.argmin(ICM_sum_squares, 1) self.ICM_best_centers_one_hot = tf.one_hot(ICM_best_centers, self.subcenter_num, dtype=tf.float32) self.global_step = tf.Variable(0, trainable=False) self.train_op = self.apply_loss_function(self.global_step) self.sess.run(tf.initialize_all_variables()) return
def apply_loss_function(self, global_step): ### loss function if self.loss_type == 'cos_margin_multi_label': assert self.output_dim == 300 word_dict = tf.constant(np.loadtxt(self.wordvec_dict), dtype=tf.float32) margin_param = tf.constant(self.margin_param, dtype=tf.float32) # N: batchsize, L: label_dim, D: 300 # img_label: N * L # word_dic: L * D # v_label: N * L * D v_label = tf.mul(tf.expand_dims(self.img_label, 2), tf.expand_dims(word_dict, 0)) # img_last: N * D # ip_1: N * L ip_1 = tf.reduce_sum( tf.mul(tf.expand_dims(self.img_last_layer, 1), v_label), 2) # mod_1: N * L v_label_mod = tf.mul( tf.expand_dims(tf.ones([self.batch_size, self.n_class]), 2), tf.expand_dims(word_dict, 0)) mod_1 = tf.sqrt( tf.mul( tf.expand_dims( tf.reduce_sum(tf.square(self.img_last_layer), 1), 1), tf.reduce_sum(tf.square(v_label_mod), 2))) #mod_1 = tf.select(tf.less(mod_1_1, tf.constant(0.0000001)), tf.ones([self.batch_size, self.n_class]), mod_1_1) # cos_1: N * L cos_1 = tf.div(ip_1, mod_1) ip_2 = tf.matmul(self.img_last_layer, word_dict, transpose_b=True) # multiply ids to inner product #ip_2 = tf.mul(ip_2_1, ids_dict) def reduce_shaper(t): return tf.reshape(tf.reduce_sum(t, 1), [tf.shape(t)[0], 1]) mod_2_2 = tf.sqrt( tf.matmul(reduce_shaper(tf.square(self.img_last_layer)), reduce_shaper(tf.square(word_dict)), transpose_b=True)) mod_2 = tf.select(tf.less(mod_2_2, tf.constant(0.0000001)), tf.ones([self.batch_size, self.n_class]), mod_2_2) # cos_2: N * L cos_2 = tf.div(ip_2, mod_2) # cos - cos: N * L * L cos_cos_1 = tf.sub( margin_param, tf.sub(tf.expand_dims(cos_1, 2), tf.expand_dims(cos_2, 1))) # we need to let the wrong place be 0 cos_cos = tf.mul(cos_cos_1, tf.expand_dims(self.img_label, 2)) cos_loss = tf.reduce_sum( tf.maximum(tf.constant(0, dtype=tf.float32), cos_cos)) self.cos_loss = tf.div( cos_loss, tf.mul(tf.constant(self.n_class, dtype=tf.float32), tf.reduce_sum(self.img_label))) self.test1 = cos_cos self.test2 = cos_1 self.test3 = cos_2 self.test00 = tf.reduce_sum( tf.cast( tf.not_equal( cos_cos, tf.zeros([self.batch_size, self.n_class, self.n_class])), tf.int32)) self.test0 = tf.mul(tf.constant(self.n_class, dtype=tf.float32), tf.reduce_sum(self.img_label)) self.check0 = tf.check_numerics(cos_cos, "cos_cos") self.check1 = tf.check_numerics(cos_1, "cos_1") self.check2 = tf.check_numerics(cos_2, "cos_2") elif self.loss_type == 'cos_softmargin_multi_label': assert self.output_dim == 300 word_dict = tf.constant(np.loadtxt(self.wordvec_dict), dtype=tf.float32) #margin_param = tf.constant(self.margin_param, dtype=tf.float32) # N: batchsize, L: label_dim, D: 300 # img_label: N * L # word_dic: L * D # v_label: N * L * D v_label = tf.mul(tf.expand_dims(self.img_label, 2), tf.expand_dims(word_dict, 0)) # img_last: N * D # ip_1: N * L ip_1 = tf.reduce_sum( tf.mul(tf.expand_dims(self.img_last_layer, 1), v_label), 2) # mod_1: N * L v_label_mod = tf.mul( tf.expand_dims(tf.ones([self.batch_size, self.n_class]), 2), tf.expand_dims(word_dict, 0)) mod_1 = tf.sqrt( tf.mul( tf.expand_dims( tf.reduce_sum(tf.square(self.img_last_layer), 1), 1), tf.reduce_sum(tf.square(v_label_mod), 2))) #mod_1 = tf.select(tf.less(mod_1_1, tf.constant(0.0000001)), tf.ones([self.batch_size, self.n_class]), mod_1_1) # cos_1: N * L cos_1 = tf.div(ip_1, mod_1) ip_2 = tf.matmul(self.img_last_layer, word_dict, transpose_b=True) # multiply ids to inner product #ip_2 = tf.mul(ip_2_1, ids_dict) def reduce_shaper(t): return tf.reshape(tf.reduce_sum(t, 1), [tf.shape(t)[0], 1]) mod_2_2 = tf.sqrt( tf.matmul(reduce_shaper(tf.square(self.img_last_layer)), reduce_shaper(tf.square(word_dict)), transpose_b=True)) mod_2 = tf.select(tf.less(mod_2_2, tf.constant(0.0000001)), tf.ones([self.batch_size, self.n_class]), mod_2_2) # cos_2: N * L cos_2 = tf.div(ip_2, mod_2) # word_dic: L * D # ip_3: L * L # compute soft margin ip_3 = tf.matmul(word_dict, word_dict, transpose_b=True) # use word_dic to avoid 0 in / mod_3 = tf.sqrt( tf.matmul(reduce_shaper(tf.square(word_dict)), reduce_shaper(tf.square(word_dict)), transpose_b=True)) margin_param = tf.sub(tf.constant(1.0, dtype=tf.float32), tf.div(ip_3, mod_3)) # cos - cos: N * L * L cos_cos_1 = tf.sub( tf.expand_dims(margin_param, 0), tf.sub(tf.expand_dims(cos_1, 2), tf.expand_dims(cos_2, 1))) # we need to let the wrong place be 0 cos_cos = tf.mul(cos_cos_1, tf.expand_dims(self.img_label, 2)) cos_loss = tf.reduce_sum( tf.maximum(tf.constant(0, dtype=tf.float32), cos_cos)) self.cos_loss = tf.div( cos_loss, tf.mul(tf.constant(self.n_class, dtype=tf.float32), tf.reduce_sum(self.img_label))) self.test1 = cos_cos self.test2 = cos_1 self.test3 = cos_2 self.precq_loss_img = tf.reduce_mean( tf.reduce_sum( tf.square( tf.sub(self.img_last_layer, tf.matmul(self.b_img, self.C))), 1)) word_dict = tf.constant(np.loadtxt(self.wordvec_dict), dtype=tf.float32) self.cq_loss_img = tf.reduce_mean( tf.reduce_sum( tf.square( tf.matmul( tf.sub(self.img_last_layer, tf.matmul(self.b_img, self.C)), tf.transpose(word_dict))), 1)) self.q_lambda = tf.Variable(self.cq_lambda, name='cq_lambda') self.cq_loss = tf.mul(self.q_lambda, self.cq_loss_img) self.loss = tf.add(self.cos_loss, self.cq_loss) ### Last layer has a 10 times learning rate self.lr = tf.train.exponential_decay(self.learning_rate, global_step, self.decay_step, self.learning_rate_decay_factor, staircase=True) opt = tf.train.MomentumOptimizer(learning_rate=self.lr, momentum=0.9) grads_and_vars = opt.compute_gradients( self.loss, self.train_layers + self.train_last_layer) fcgrad, _ = grads_and_vars[-2] fbgrad, _ = grads_and_vars[-1] if self.finetune_all: return opt.apply_gradients( [(grads_and_vars[0][0], self.train_layers[0]), (grads_and_vars[1][0] * 2, self.train_layers[1]), (grads_and_vars[2][0], self.train_layers[2]), (grads_and_vars[3][0] * 2, self.train_layers[3]), (grads_and_vars[4][0], self.train_layers[4]), (grads_and_vars[5][0] * 2, self.train_layers[5]), (grads_and_vars[6][0], self.train_layers[6]), (grads_and_vars[7][0] * 2, self.train_layers[7]), (grads_and_vars[8][0], self.train_layers[8]), (grads_and_vars[9][0] * 2, self.train_layers[9]), (grads_and_vars[10][0], self.train_layers[10]), (grads_and_vars[11][0] * 2, self.train_layers[11]), (grads_and_vars[12][0], self.train_layers[12]), (grads_and_vars[13][0] * 2, self.train_layers[13]), (fcgrad * 10, self.train_last_layer[0]), (fbgrad * 20, self.train_last_layer[1])], global_step=global_step) else: return opt.apply_gradients( [(fcgrad * 10, self.train_last_layer[0]), (fbgrad * 20, self.train_last_layer[1])], global_step=global_step)
def train_model(self, sess, max_iters): """Network training loop.""" data_layer = get_data_layer(self.roidb, self.imdb.num_classes) # classification loss cls_score = self.net.get_output('cls_score') label = tf.placeholder(tf.int32, shape=[None]) cross_entropy = tf.reduce_mean(tf.nn.sparse_softmax_cross_entropy_with_logits(cls_score, label)) # subcategory classification loss if cfg.TRAIN.SUBCLS: subcls_score = self.net.get_output('subcls_score') sublabel = tf.placeholder(tf.int32, shape=[None]) subcls_cross_entropy = tf.reduce_mean(tf.nn.sparse_softmax_cross_entropy_with_logits(subcls_score, sublabel)) # bounding box regression L1 loss bbox_pred = self.net.get_output('bbox_pred') bbox_targets = tf.placeholder(tf.float32, shape=[None, 4 * self.imdb.num_classes]) bbox_weights = tf.placeholder(tf.float32, shape=[None, 4 * self.imdb.num_classes]) loss_box = tf.reduce_mean(tf.reduce_sum(tf.mul(bbox_weights, tf.abs(tf.sub(bbox_pred, bbox_targets))), reduction_indices=[1])) # multi-task loss if cfg.TRAIN.SUBCLS: loss = cross_entropy + subcls_cross_entropy + loss_box else: loss = cross_entropy + loss_box # optimizer lr = tf.Variable(cfg.TRAIN.LEARNING_RATE, trainable=False) momentum = cfg.TRAIN.MOMENTUM train_op = tf.train.MomentumOptimizer(lr, momentum).minimize(loss) # intialize variables sess.run(tf.initialize_all_variables()) if self.pretrained_model is not None: print ('Loading pretrained model ' 'weights from {:s}').format(self.pretrained_model) self.net.load(self.pretrained_model, sess, True) last_snapshot_iter = -1 timer = Timer() for iter in range(max_iters): # learning rate if iter >= cfg.TRAIN.STEPSIZE: sess.run(tf.assign(lr, cfg.TRAIN.LEARNING_RATE * cfg.TRAIN.GAMMA)) else: sess.run(tf.assign(lr, cfg.TRAIN.LEARNING_RATE)) # get one batch blobs = data_layer.forward() # Make one SGD update if cfg.TRAIN.SUBCLS: feed_dict={self.net.data: blobs['data'], self.net.rois: blobs['rois'], self.net.keep_prob: 0.5, \ label: blobs['labels'], sublabel: blobs['sublabels'], bbox_targets: blobs['bbox_targets'], bbox_weights: blobs['bbox_inside_weights']} else: feed_dict={self.net.data: blobs['data'], self.net.rois: blobs['rois'], self.net.keep_prob: 0.5, \ label: blobs['labels'], bbox_targets: blobs['bbox_targets'], bbox_weights: blobs['bbox_inside_weights']} timer.tic() if cfg.TRAIN.SUBCLS: loss_cls_value, loss_subcls_value, loss_box_value, _ = sess.run([cross_entropy, subcls_cross_entropy, loss_box, train_op], feed_dict=feed_dict) else: loss_cls_value, loss_box_value, _ = sess.run([cross_entropy, loss_box, train_op], feed_dict=feed_dict) timer.toc() if cfg.TRAIN.SUBCLS: print 'iter: %d / %d, loss_cls: %.4f, loss_subcls: %.4f, loss_box: %.4f, lr: %f, time: %f' %\ (iter+1, max_iters, loss_cls_value, loss_subcls_value, loss_box_value, lr.eval(), timer.diff) else: print 'iter: %d / %d, loss_cls: %.4f, loss_box: %.4f, lr: %f' %\ (iter+1, max_iters, loss_cls_value, loss_box_value, lr.eval()) if (iter+1) % (10 * cfg.TRAIN.DISPLAY) == 0: print 'speed: {:.3f}s / iter'.format(timer.average_time) if (iter+1) % cfg.TRAIN.SNAPSHOT_ITERS == 0: last_snapshot_iter = iter self.snapshot(sess, iter) if last_snapshot_iter != iter: self.snapshot(sess, iter)
def main(layers, t_hor, ind, nrolls, bts, ler_r, mom, teps, renew, imp, q): # Quad Params wMax = 3.0 wMin = -1.0 * wMax aMax = 2 * np.pi / 10.0 aMin = -1.0 * aMax max_list = [wMax, aMax] min_list = [wMin, aMin] print 'Starting worker-' + str(ind) Nx = 101 minn = [-5.0, -5.0, 0.0, 6.0] maxx = [5.0, 5.0, 2 * np.pi, 12.0] X = np.linspace(minn[0], maxx[0], Nx) Y = np.linspace(minn[1], maxx[1], Nx) X, Y = np.meshgrid(X, Y) XX = np.reshape(X, [-1, 1]) YY = np.reshape(Y, [-1, 1]) grid_eval = np.concatenate( (XX, YY, 0.0 * np.ones(XX.shape), 6.0 * np.ones(XX.shape)), axis=1) grid_eval_ = np.concatenate( (XX, YY, (2.0 / 3.0) * np.pi * np.ones(XX.shape), 6.0 * np.ones(XX.shape)), axis=1) grid_eval__ = np.concatenate( (XX, YY, (4.0 / 3.0) * np.pi * np.ones(XX.shape), 6.0 * np.ones(XX.shape)), axis=1) grid_evall = np.concatenate( (XX, YY, 0.0 * np.ones(XX.shape), 12.0 * np.ones(XX.shape)), axis=1) grid_evall_ = np.concatenate( (XX, YY, (2.0 / 3.0) * np.pi * np.ones(XX.shape), 12.0 * np.ones(XX.shape)), axis=1) grid_evall__ = np.concatenate( (XX, YY, (4.0 / 3.0) * np.pi * np.ones(XX.shape), 12.0 * np.ones(XX.shape)), axis=1) reach100s = sio.loadmat('flat_1s.mat') reach100s = reach100s["M"] reach100s[:, [1, 2]] = reach100s[:, [2, 1]] reach100s[:, 2] = np.mod(reach100s[:, 2], 2.0 * np.pi) #mean_data = np.mean(reach100s[:,:-1],axis=0); #std_data = np.std(reach100s[:,:-1],axis=0); nofparams = 0 for i in xrange(len(layers) - 1): nofparams += layers[i] * layers[i + 1] + layers[i + 1] print 'Number of Params is: ' + str(nofparams) H_length = t_hor #-1.0; #Has to be negative #VAR iters = 1000000 #VAR #center = np.array([[0.0,0.0]]) center = np.array([[0.0, 0.0, 0.0, 0.0, 0.0, 0.0]]) depth = 2.0 incl = 1.0 ##################### DEFINITIONS ##################### #layers = [2 + 1,10,1]; #VAR #ssize = layers[0] - 1; dt = 0.05 #VAR num_ac = 2 ##################### INSTANTIATIONS ################# states, y, Tt, L, l_r, lb, reg, cross_entropy = TransDef( "Critic", False, layers, depth, incl, center) ola1 = tf.argmax(Tt, dimension=1) ola2 = tf.argmax(y, dimension=1) ola3 = tf.equal(ola1, ola2) accuracy = tf.reduce_mean(tf.cast(ola3, tf.float32)) #a_layers = layers; #a_layers[-1] = 2; #We have two actions #states_,y_,Tt_,l_r_,lb_,reg_ = TransDef("Actor",False,a_layers,depth,incl,center,outp=True); #theta = tf.get_collection(tf.GraphKeys.VARIABLES, scope='Critic'); #A_func_vars = tf.get_collection(tf.GraphKeys.VARIABLES, scope='Actor'); #var_grad = tf.gradients(Tt_,states_)[0] var_grad_ = tf.gradients(Tt, states)[0] grad_x = tf.slice(var_grad_, [0, 0], [-1, layers[0] - 1]) #theta = tf.trainable_variables(); # set_to_zero = [] # for var in sorted(V_func_vars, key=lambda v: v.name): # set_to_zero.append(var.assign(tf.zeros(tf.shape(var)))) # set_to_zero = tf.group(*set_to_zero) # # set_to_not_zero = [] # for var in sorted(V_func_vars, key=lambda v: v.name): # set_to_not_zero.append(var.assign(tf.random_uniform(tf.shape(var),minval=-0.1,maxval=0.1))); # set_to_not_zero = tf.group(*set_to_not_zero) # DEFINE LOSS lmbda = 0.0 #1.0**(-3.5);#0.01; beta = 0.00 L = tf.sqrt( tf.reduce_mean( tf.reduce_sum(tf.square(tf.sub(y, Tt)), 1, keep_dims=True)) ) + beta * tf.reduce_mean( tf.reduce_max(tf.abs(grad_x), reduction_indices=1, keep_dims=True)) #L = tf.reduce_mean(tf.mul(tf.exp(imp*t_vec),tf.abs(tf.sub(y,Tt)))) + lmbda*reg; #L = tf.reduce_mean(tf.abs(tf.sub(y,Tt))) + lmbda*reg; # DEFINE OPTIMIZER #nu = 5.01; #nunu = ler_r;#0.00005; nu = tf.placeholder(tf.float32, shape=[]) #VAR #lr_multiplier = ler_r lr_schedule = PiecewiseSchedule([ (0, 0.1), (10000, 0.01), (20000, 0.001), (30000, 0.0001), ], outside_value=0.0001) #optimizer = tf.train.GradientDescentOptimizer(nu) #optimizer #train_step = tf.train.MomentumOptimizer(learning_rate=nu,momentum=mom).minimize(L) #optimizer #train_step = tf.train.AdamOptimizer(learning_rate=nu).minimize(L); train_step = tf.train.RMSPropOptimizer(learning_rate=nu, momentum=mom).minimize(L) #optimizer = tf.train.RMSPropOptimizer(learning_rate=nu,momentum=mom); #gvs = optimizer.compute_gradients(L,theta); #capped_gvs = [(tf.clip_by_value(grad, -3., 3.), var) for grad, var in gvs]; #train_step = optimizer.apply_gradients(gvs); #train_step = tf.train.AdagradOptimizer(learning_rate=nu,initial_accumulator_value=0.5).minimize(L); hot_input = tf.placeholder(tf.int64, shape=(None)) make_hot = tf.one_hot(hot_input, 4, on_value=1, off_value=0) # INITIALIZE GRAPH theta = tf.trainable_variables() sess = tf.Session() init = tf.initialize_all_variables() sess.run(init) def V_0(x): return np.linalg.norm(x, ord=np.inf, axis=1, keepdims=True) - 1.0 def p_corr(ALL_x): ALL_x = np.mod(ALL_x, 2.0 * np.pi) return ALL_x def F(ALL_x, opt_a, opt_b): sin_phi = np.sin(ALL_x[:, 2, None]) cos_phi = np.cos(ALL_x[:, 2, None]) col1 = np.multiply(ALL_x[:, 3, None], cos_phi) col2 = np.multiply(ALL_x[:, 3, None], sin_phi) col3 = opt_a[:, 0, None] col4 = opt_a[:, 1, None] return np.concatenate((col1, col2, col3, col4), axis=1) ####################### RECURSIVE FUNC #################### def RK4(ALL_x, dtt, opt_a, opt_b): k1 = F(ALL_x, opt_a, opt_b) #### !!! # ~~~~ Compute optimal input (k2) ALL_tmp = ALL_x + np.multiply(dtt / 2.0, k1) ALL_tmp[:, 2] = p_corr(ALL_tmp[:, 2]) k2 = F(ALL_tmp, opt_a, opt_b) #### !!! # ~~~~ Compute optimal input (k3) ALL_tmp = ALL_x + np.multiply(dtt / 2.0, k2) ALL_tmp[:, 2] = p_corr(ALL_tmp[:, 2]) k3 = F(ALL_tmp, opt_a, opt_b) #### !!! # ~~~~ Compute optimal input (k4) ALL_tmp = ALL_x + np.multiply(dtt, k3) ALL_tmp[:, 2] = p_corr(ALL_tmp[:, 2]) k4 = F(ALL_tmp, opt_a, opt_b) #### !!! Snx = ALL_x + np.multiply((dtt / 6.0), (k1 + 2.0 * k2 + 2.0 * k3 + k4)) Snx[:, 2] = p_corr(Snx[:, 2]) return Snx perms = list(itertools.product([-1, 1], repeat=num_ac)) def Hot_to_Cold(opt_a): for k in range(len(max_list)): ind_max = (opt_a[:, [k]] > 0.0) opt_a[ind_max] = max_list[k] opt_a[not (ind_max)] = min_list[k] return opt_a def getPI( ALL_x, F_PI=[] ): #Things to keep in MIND: You want the returned value to be the minimum accross a trajectory. current_params = sess.run(theta) #perms = list(itertools.product([-1,1], repeat=num_ac)) next_states = [] true_ac_list = [] for i in range(len(perms)): #2**num_actions ac_tuple = perms[i] ac_list = [tmp1 * tmp2 for tmp1, tmp2 in zip(ac_tuple, max_list)] #ASSUMING: aMax = -aMin true_ac_list.append(ac_list) opt_a = np.asarray(ac_list) * np.ones([ALL_x.shape[0], 1]) Snx = RK4(ALL_x, dt, opt_a, None) next_states.append(Snx) next_states = np.concatenate(next_states, axis=0) values = V_0(next_states[:, [0, 1]]) for params in F_PI: for ind in range(len(params)): #Reload pi*(x,t+dt) parameters sess.run(theta[ind].assign(params[i])) opt_a = sess.run(Tt, {states: next_states}) next_states = RK4(ALL_x, dt, opt_a, None) values = np.min((values, V_0(next_states[:, [0, 1]])), axis=1, keepdims=True) compare_vals = values.reshape([ALL_x.shape[0], -1]) values = np.min(compare_vals, axis=1, keepdims=True) index_best_a = compare_vals.argmin(axis=1) #.reshape([-1,1]); best_actions = np.asarray([true_ac_list[i] for i in index_best_a]) final_values = np.min((values, V_0(ALL_x[:, [0, 1]])), axis=1) for ind in range(len(current_params)): #Reload pi*(x,t+dt) parameters sess.run(theta[ind].assign(current_params[ind])) #return index_best_a,final_values return best_actions, final_values # ***************************************************************************** # # ============================= MAIN LOOP ==================================== # ( ) # ***************************************************************************** t1 = time.time() t = 0.0 mse = np.inf k = 0 kk = 0 beta = 3.0 batch_size = bts tau = 1000.0 steps = teps ALL_PI = [] nunu = lr_schedule.value(k) for i in xrange(iters): if (np.mod(i, renew) == 0 and i is not 0): ALL_PI.insert(0, sess.run(theta)) k = 0 ALL_x = np.random.uniform(-5.0, 5.0, (nrolls, layers[0])) ALL_x[:, 2] = ALL_x[:, 2] * np.pi / 5.0 + np.pi ALL_x[:, 3] = ALL_x[:, 3] * 3.0 / 5.0 + 9.0 PI, _ = getPI(ALL_x, ALL_PI) ALL_x_ = np.random.uniform(-5.0, 5.0, (nrolls / 100, layers[0])) ALL_x_[:, 2] = ALL_x_[:, 2] * np.pi / 5.0 + np.pi ALL_x_[:, 3] = ALL_x_[:, 3] * 3.0 / 5.0 + 9.0 PI_, _ = getPI(ALL_x_, ALL_PI) #ZR = getPI #ZR = sess.run(Tt,{states:reach100s[:,:-1]}); #error1 = ZR - reach100s[:,-1,None]; # Z000 = np.reshape(sess.run(Tt,{states:grid_eval}),X.shape); # Z001 = np.reshape(sess.run(Tt,{states:grid_eval_}),X.shape); # Z002 = np.reshape(sess.run(Tt,{states:grid_eval__}),X.shape); # #filter_in = (Z000 <= 0.05) #& (Z000 >= 0.05); # filter_out = (Z000 > 0.00) #| (Z000 < -0.05); # filter_out_ = (Z001 > 0.00) #| (Z000 < -0.05); # filter_out__ = (Z002 > 0.00) #| (Z000 < -0.05); # #Z000[filter_in] = 1.0; # Z000[filter_out] = 0.0; # Z001[filter_out_] = 0.0; # Z002[filter_out__] = 0.0; # # Z000l = np.reshape(sess.run(Tt,{states:grid_evall}),X.shape); # Z001l = np.reshape(sess.run(Tt,{states:grid_evall_}),X.shape); # Z002l = np.reshape(sess.run(Tt,{states:grid_evall__}),X.shape); # #filter_in = (Z000 <= 0.05) #& (Z000 >= 0.05); # filter_outl = (Z000l > 0.00) #| (Z000 < -0.05); # filter_out_l = (Z001l > 0.00) #| (Z000 < -0.05); # filter_out__l = (Z002l > 0.00) #| (Z000 < -0.05); # #Z000[filter_in] = 1.0; # Z000l[filter_outl] = 0.0; # Z001l[filter_out_l] = 0.0; # Z002l[filter_out__l] = 0.0; # # plt.clf(); # #plt.plot(ALL_t_, np.abs(allE), 'ro'); # #plt.axis([-1.0, 0.0, 0.0, 10.0]) # plt.subplot(2,3,1) # plt.imshow(Z000,cmap='gray'); # plt.subplot(2,3,2) # plt.imshow(Z001,cmap='gray'); # plt.subplot(2,3,3) # plt.imshow(Z002,cmap='gray'); # plt.subplot(2,3,4) # plt.imshow(Z000l,cmap='gray'); # plt.subplot(2,3,5) # plt.imshow(Z001l,cmap='gray'); # plt.subplot(2,3,6) # plt.imshow(Z002l,cmap='gray'); # plt.pause(0.01); # # # print str(t) + " || " + str(np.max(np.abs(error1))) + " , " + str(np.mean(np.abs(error1))) + " REG = " + str(sess.run(reg)) + ") | MSE = " + str(mse) + "|ITR=" + str(i) #VAR t = t - dt #elif(i is 0): elif (np.mod(i, renew) == 0 and i is 0): k = 0 # sess.run(set_to_zero); ALL_x = np.random.uniform(-5.0, 5.0, (nrolls, layers[0])) ALL_x[:, 2] = ALL_x[:, 2] * np.pi / 5.0 + np.pi ALL_x[:, 3] = ALL_x[:, 3] * 3.0 / 5.0 + 9.0 PI, _ = getPI(ALL_x) ALL_x_ = np.random.uniform(-5.0, 5.0, (nrolls / 100, layers[0])) ALL_x_[:, 2] = ALL_x_[:, 2] * np.pi / 5.0 + np.pi ALL_x_[:, 3] = ALL_x_[:, 3] * 3.0 / 5.0 + 9.0 PI_, _ = getPI(ALL_x_) # sess.run(set_to_not_zero); # |||||||||||| ---- PRINT ----- |||||||||||| if (np.mod(i, 200) == 0): #xel = sess.run(L,{states:ALL_x,y:PI}); #test_e = sess.run(L,{states:ALL_x_,y:PI_}); train_acc = sess.run(accuracy, { states: ALL_x, y: PI }) test_acc = sess.run(accuracy, { states: ALL_x_, y: PI_ }) #o = np.random.randint(len(ALL_x)); print str(i) + ") | TR_ACC = " + str( train_acc) + " | TE_ACC = " + str( test_acc) + " | Lerning Rate = " + str(nunu) #print str(i) + ") | XEL = " + str(xel) + " | Test_E = " + str(test_e) + " | Lerning Rate = " + str(nunu) #print str(PI[[o],:]) + " || " + str(sess.run(l_r[-1],{states:ALL_x[[o],:]})) #+ " || " + str(sess.run(gvs[-1],{states:ALL_x,y:PI})) nunu = 0.001 #/np.log(i+2.0)#lr_schedule.value(i); #nunu = ler_r/(np.mod(i,renew)+1.0); tmp = np.random.randint(len(ALL_x), size=bts) sess.run(train_step, feed_dict={ states: ALL_x[tmp], y: PI[tmp], nu: nunu })
def test_Sub(self): t = tf.sub(*self.random((3, 4), (3, 4))) self.check(t)
print("Fitting...") print("Number of unknowns:{}".format(num_basis)) x = tf.placeholder("float32", [None]) y = tf.placeholder("float32", [None]) #basis_ = tf.placeholder("float32", [None, num_basis] ) coord_ = tf.placeholder("float32", [None, 3]) # this is the only trainable variable coeff = tf.Variable(init_coeff, name="basis_coeff", trainable=True) # normalization field # calculate EQ^2 distance from every coord to every knot # then sum over them dist_sq_element = tf.square( tf.sub(tf.expand_dims(coord_, 1), tf.expand_dims(knots, 0))) dist_sq = tf.reduce_sum(dist_sq_element, 2) kernels = tf.exp((-1.0 / (spatial_bw * spatial_bw)) * dist_sq) normalization = tf.reduce_sum(tf.expand_dims(coeff, 0) * kernels, 1, name='Normalization_Field') with tf.name_scope('correct') as scope: hist_bins = tf.linspace(rmin, rmax, options.bins, name="hist_bins") corr_x = tf.mul(x, normalization, name='Corrected_Image' ) #tf.exp( tf.add( x, normalization ) ) # calculate standard deviations inside each class
# Constructing the hidden and output layers def multilayer_perceptron(x, weights, biases): layer = [x] for i in range(1, n_layer + 2): layer.append(activation[kernel](tf.add( tf.matmul(layer[i - 1], weights[i - 1]), biases[i - 1]))) return layer[-1] # Defining the output pred = multilayer_perceptron(x, weights, biases) # Defining the cost function based on the function select if cost_func == 0: cost = tf.sqrt(tf.reduce_mean(tf.square(tf.sub(y, pred)))) elif cost_func == 1: cost = tf.reduce_mean( -tf.reduce_sum(y * tf.log(pred), reduction_indices=[1])) elif cost_func == 2: c = np.zeros([nbits, 1]).astype('float32') for i in range(nbits): c[i, 0] = 2**i conv = tf.Variable(c) tpred = tf.nn.sigmoid(tf.mul(1000.0, pred)) cost = tf.sqrt( tf.reduce_mean( tf.square(tf.sub(tf.matmul(tpred, conv), tf.matmul(y, conv))))) else: c = np.ones([nbits, 1]).astype('float32') conv = tf.Variable(c)
def QC(data, sigma, replicas=None, steps=10000, step_size=None, batch_size=None, how_often_to_test_stop=10, with_display=False, same_batch_for_all=False): if replicas is None: replicas = data number_of_data_points = data.shape[0] number_of_replicas = replicas.shape[0] dimensions = data.shape[1] if step_size is None: step_size = sigma / 7 if batch_size is None: batch_size = data.shape[0] inds_to_move_ = tf.placeholder(dtype=tf.int32, shape=(None, ), name="inds") data_ = tf.constant(data, name='data', dtype=DATA_TYPE) replicas_ = tf.get_variable(name='replicas', shape=(number_of_replicas, dimensions), dtype=DATA_TYPE, initializer=tf.constant_initializer( replicas, dtype=DATA_TYPE)) replicas_to_move_ = tf.nn.embedding_lookup(replicas_, inds_to_move_, name="replicas_to_move") if batch_size is None: batch_ = data_ squared_distances_ = tf.reduce_sum(tf.square( tf.sub(tf.expand_dims(replicas_to_move_, 1), tf.expand_dims(batch_, 0))), axis=2, name='squared_distances') elif same_batch_for_all is True: inds_for_batch_ = tf.random_uniform(shape=(1, batch_size), minval=0, maxval=number_of_data_points, dtype=tf.int32, name="inds_for_batch") batch_ = tf.nn.embedding_lookup(data_, inds_for_batch_, name="batch") squared_distances_ = tf.reduce_sum(tf.square( tf.sub(tf.expand_dims(replicas_to_move_, 1), batch_)), axis=2, name='squared_distances') else: inds_for_batch_ = tf.random_uniform(shape=(tf.shape(inds_to_move_)[0], batch_size), minval=0, maxval=number_of_data_points, dtype=tf.int32, name="inds_for_batch") batch_ = tf.nn.embedding_lookup(data_, inds_for_batch_, name="batch") squared_distances_ = tf.reduce_sum(tf.square( tf.sub(tf.expand_dims(replicas_to_move_, 1), batch_)), axis=2, name='squared_distances') gaussians_ = tf.exp(-1 * squared_distances_ / (2 * sigma**2), name='gaussian') wave_function_ = tf.reduce_sum(gaussians_, name='wave_function', axis=1) laplacian_ = tf.reduce_sum(tf.mul(gaussians_, squared_distances_), name='laplacian', axis=1) potential_ = tf.div(laplacian_, wave_function_, name='potential') loss_ = tf.reduce_sum(potential_) # optimizer_ = tf.train.MomentumOptimizer(learning_rate=step_size,momentum=0.9,use_nesterov=True) optimizer_ = tf.train.GradientDescentOptimizer(learning_rate=step_size, name='optimizer') # optimization_step_ = optimizer_.minimize(loss_,name='optimization_step') gradients_ = tf.gradients(loss_, replicas_, name='gradients') normalized_gradients_ = tf.nn.l2_normalize(gradients_[0], dim=1) optimization_step_ = optimizer_.apply_gradients([(normalized_gradients_, replicas_)]) # tf.reduce_sum(tf.square(gradients_),axis=1,name="gradient_norms") if with_display: plt.ion() plt.figure() ax1 = plt.axes() sc = plt.scatter(replicas[:, 0], replicas[:, 1]) plt.axis([-2, 2, -2, 2]) # plt.figure() # ax2 = plt.axes() with tf.Session() as sess: sess.run(tf.global_variables_initializer()) step = 0 inds = np.arange(0, replicas.shape[0]) previous_potential = np.zeros((replicas.shape[0])) previous_potential.fill(np.inf) while step < steps: print(step) _, potential_value = sess.run([optimization_step_, potential_], feed_dict={inds_to_move_: inds}) if ((step % how_often_to_test_stop) == 0): prev_inds = inds inds = inds[previous_potential[inds] > potential_value] previous_potential[prev_inds] = potential_value if len(inds) == 0: break if with_display: x = sess.run(replicas_) sc.set_offsets(x[:, :2]) # plt.sca(ax2) # if np.any(prev_inds==0): # plt.scatter(step,np.mean(potential_values_for_moving_average[0,:])) # plt.scatter(step, potential_value[prev_inds==0],c='r') plt.pause(0.0001) step += 1 if with_display: plt.ioff() plt.show() x = sess.run(replicas_) return x
rpn_cls_soft = tf.nn.softmax(rpn_cls_score_reshape) rpn_cls_score_x = tf.reshape(tf.gather(rpn_cls_score_reshape,tf.where(tf.not_equal(rpn_labels_ind,-1))),[-1,2]) rpn_label = tf.reshape(tf.gather(rpn_labels_ind, tf.where(tf.not_equal(rpn_labels_ind,-1))),[-1]) rpn_loss_cls = tf.reduce_mean(tf.nn.sparse_softmax_cross_entropy_with_logits(rpn_cls_score_x, rpn_label)) unique_rpn_cls, o_cls, o_cls_ind = tf.py_func(cls_unique, \ [rpn_cls_soft, rpn_labels_ind], [tf.float32, tf.float32, tf.float32]) unique_rpn_cls = tf.pack(unique_rpn_cls) rpn_correct_prediction = tf.py_func(rpn_accuracy, [rpn_cls_soft, rpn_labels_ind], [tf.float32]) rpn_correct_prediction = tf.reshape(tf.pack(rpn_correct_prediction), [-1]) rpn_cls_accuracy = tf.reduce_mean(tf.cast(rpn_correct_prediction, tf.float32)) sigma1 = s1 * s1 smoothL1_sign = tf.cast(tf.less(tf.abs(tf.sub(rpn_bbox_pred, rpn_bbox_targets)),1/sigma1),tf.float32) rpn_loss_bbox = tf.mul(tf.reduce_mean(tf.reduce_sum(tf.mul(rpn_bbox_outside_weights,tf.add( \ tf.mul(tf.mul(tf.pow(tf.mul(rpn_bbox_inside_weights, \ tf.sub(rpn_bbox_pred, rpn_bbox_targets)),2),0.5*sigma1), smoothL1_sign), \ tf.mul(tf.sub(tf.abs(tf.sub(rpn_bbox_pred, rpn_bbox_targets)),0.5/sigma1),\ tf.abs(smoothL1_sign-1)))), reduction_indices=[1,2])),1) rpn_loss_bbox_label = rpn_loss_bbox zero_count, one_count = tf.py_func(bbox_counter, [rpn_labels_ind], [tf.float32, tf.float32]) #ROI PROPOSAL rpn_cls_prob = rpn_cls_soft rpn_cls_prob_reshape = tf.reshape(rpn_cls_prob, [1, 18, height, width]) rpn_rois = tf.py_func(proposal, [rpn_cls_prob_reshape, rpn_bbox_pred, im_info], [tf.float32]) rpn_rois = tf.reshape(rpn_rois, [-1, 5])
import scipy import parameters as params ch = [4, 8, 16, 16, 8, 4] # Number of channels for each section (except output section) k_size = 5; # Dropout variable with tf.name_scope('dropout'): keep_prob = tf.placeholder(tf.float32) # Make input and output variables x = tf.placeholder(tf.float32, shape=[None, params.res["height"], params.res["width"], 1]) y_ = tf.placeholder(tf.bool, shape=[None, params.res["height"], params.res["width"]]) prev_y = tf.placeholder(tf.float32, shape=[None, params.res["height"], params.res["width"]]) prev_y_in = tf.sub(tf.expand_dims(prev_y, 3), 0.5) x_in = tf.concat(3, [x, prev_y_in]) ch_in = 2 ############################## # Section 1 # Convolution layer_name = "s1_conv1" with tf.name_scope(layer_name): W = utils.weight_variable([k_size, k_size, ch_in, ch[0]]) b = utils.bias_variable([ch[0]]) conv = utils.conv2d(x_in, W, b, 1) tanh = tf.nn.tanh(conv) s1_conv1 = tf.nn.dropout(tanh, keep_prob)
def build_model_single_gpu(self, gpu_idx): if gpu_idx == 0: # create the nodes to load for input pipeline filename_queue = tf.train.string_input_producer([self.e2e_dataset]) self.get_wav, self.get_noisy = read_and_decode( filename_queue, 2**14) # load the data to input pipeline wavbatch, \ noisybatch = tf.train.shuffle_batch([self.get_wav, self.get_noisy], batch_size=self.batch_size, num_threads=2, capacity=1000 + 3 * self.batch_size, min_after_dequeue=1000, name='wav_and_noisy') if gpu_idx == 0: self.Gs = [] self.zs = [] self.gtruth_wavs = [] self.gtruth_noisy = [] self.gtruth_wavs.append(wavbatch) self.gtruth_noisy.append(noisybatch) # add channels dimension to manipulate in D and G wavbatch = tf.expand_dims(wavbatch, -1) noisybatch = tf.expand_dims(noisybatch, -1) if gpu_idx == 0: #self.sample_wavs = tf.placeholder(tf.float32, [self.batch_size, # self.canvas_size], # name='sample_wavs') self.reference_G = self.generator(noisybatch, is_ref=True, spk=None, z_on=False) # make a dummy copy of discriminator to have variables and then # be able to set up the variable reuse for all other devices #dummy_joint = tf.concat(0, [wavbatch, wavbatch, self.reference_G]) #dummy_words_joint = tf.concat(0, [c_vector, fk_c_vector, # c_vector]) # merge along channels and this would be a real batch G = self.generator(noisybatch, is_ref=False, spk=None, z_on=False) print('GAE shape: ', G.get_shape()) self.Gs.append(G) self.rl_audio_summ = audio_summary('real_audio', wavbatch) self.real_w_summ = histogram_summary('real_wav', wavbatch) self.noisy_audio_summ = audio_summary('noisy_audio', noisybatch) self.noisy_w_summ = histogram_summary('noisy_wav', noisybatch) self.gen_audio_summ = audio_summary('G_audio', G) self.gen_summ = histogram_summary('G_wav', G) if gpu_idx == 0: self.g_losses = [] # Add the L1 loss to G g_loss = tf.reduce_mean(tf.abs(tf.sub(G, wavbatch))) self.g_losses.append(g_loss) self.g_loss_sum = scalar_summary("g_loss", g_loss) if gpu_idx == 0: self.get_vars()
def build_model_single_gpu(self, gpu_idx): if gpu_idx == 0: # create the nodes to load for input pipeline filename_queue = tf.train.string_input_producer([self.e2e_dataset]) self.get_wav, self.get_noisy = read_and_decode( filename_queue, 2**14) # load the data to input pipeline wavbatch, \ noisybatch = tf.train.shuffle_batch([self.get_wav, self.get_noisy], batch_size=self.batch_size, num_threads=2, capacity=1000 + 3 * self.batch_size, min_after_dequeue=1000, name='wav_and_noisy') if gpu_idx == 0: self.Gs = [] self.zs = [] self.gtruth_wavs = [] self.gtruth_noisy = [] self.gtruth_wavs.append(wavbatch) self.gtruth_noisy.append(noisybatch) # add channels dimension to manipulate in D and G wavbatch = tf.expand_dims(wavbatch, -1) noisybatch = tf.expand_dims(noisybatch, -1) # by default leaky relu is used do_prelu = False if self.g_nl == 'prelu': do_prelu = True if gpu_idx == 0: #self.sample_wavs = tf.placeholder(tf.float32, [self.batch_size, # self.canvas_size], # name='sample_wavs') ref_Gs = self.generator(noisybatch, is_ref=True, spk=None, do_prelu=do_prelu) print('num of G returned: ', len(ref_Gs)) self.reference_G = ref_Gs[0] self.ref_z = ref_Gs[1] if do_prelu: self.ref_alpha = ref_Gs[2:] self.alpha_summ = [] for m, ref_alpha in enumerate(self.ref_alpha): # add a summary per alpha self.alpha_summ.append( histogram_summary('alpha_{}'.format(m), ref_alpha)) # make a dummy copy of discriminator to have variables and then # be able to set up the variable reuse for all other devices #dummy_joint = tf.concat(0, [wavbatch, wavbatch, self.reference_G]) #dummy_words_joint = tf.concat(0, [c_vector, fk_c_vector, # c_vector]) # merge along channels and this would be a real batch dummy_joint = tf.concat(2, [wavbatch, noisybatch]) dummy = discriminator(self, dummy_joint, None, reuse=False) G, z = self.generator(noisybatch, is_ref=False, spk=None, do_prelu=do_prelu) print('G shape: ', G.get_shape()) self.Gs.append(G) self.zs.append(z) #joint = tf.concat(0, [wavbatch, wavbatch, G]) #joint_words = tf.concat(0, [c_vector, fk_c_vector, c_vector]) # add new dimension to merge with other pairs D_rl_joint = tf.concat(2, [wavbatch, noisybatch]) D_fk_joint = tf.concat(2, [G, noisybatch]) # build rl discriminator d_rl_logits = discriminator(self, D_rl_joint, reuse=True) # build fk G discriminator d_fk_logits = discriminator(self, D_fk_joint, None, reuse=True) # build fk noisy discriminator #d_nfk_logits = discriminator(self, (wavbatch - noisybatch), None, # reuse=True) # make disc variables summaries self.d_rl_sum = histogram_summary("d_real", d_rl_logits) self.d_fk_sum = histogram_summary("d_fake", d_fk_logits) #self.d_nfk_sum = histogram_summary("d_noisyfake", d_nfk_logits) self.rl_audio_summ = audio_summary('real_audio', wavbatch) self.real_w_summ = histogram_summary('real_wav', wavbatch) self.noisy_audio_summ = audio_summary('noisy_audio', noisybatch) self.noisy_w_summ = histogram_summary('noisy_wav', noisybatch) self.gen_audio_summ = audio_summary('G_audio', G) self.gen_summ = histogram_summary('G_wav', G) if gpu_idx == 0: self.g_losses = [] self.g_l1_losses = [] self.g_adv_losses = [] self.d_rl_losses = [] self.d_fk_losses = [] #self.d_nfk_losses = [] self.d_losses = [] d_rl_loss = tf.reduce_mean(tf.squared_difference(d_rl_logits, 1.)) d_fk_loss = tf.reduce_mean(tf.squared_difference(d_fk_logits, 0.)) #d_nfk_loss = tf.reduce_mean(tf.squared_difference(d_nfk_logits, 0.)) g_adv_loss = tf.reduce_mean(tf.squared_difference(d_fk_logits, 1.)) d_loss = d_rl_loss + d_fk_loss # Add the L1 loss to G g_l1_loss = self.l1_lambda * tf.reduce_mean(tf.abs(tf.sub(G, wavbatch))) g_loss = g_adv_loss + g_l1_loss self.g_l1_losses.append(g_l1_loss) self.g_adv_losses.append(g_adv_loss) self.g_losses.append(g_loss) self.d_rl_losses.append(d_rl_loss) self.d_fk_losses.append(d_fk_loss) #self.d_nfk_losses.append(d_nfk_loss) self.d_losses.append(d_loss) self.d_rl_loss_sum = scalar_summary("d_rl_loss", d_rl_loss) self.d_fk_loss_sum = scalar_summary("d_fk_loss", d_fk_loss) #self.d_nfk_loss_sum = scalar_summary("d_nfk_loss", # d_nfk_loss) self.g_loss_sum = scalar_summary("g_loss", g_loss) self.g_loss_l1_sum = scalar_summary("g_l1_loss", g_l1_loss) self.g_loss_adv_sum = scalar_summary("g_adv_loss", g_adv_loss) self.d_loss_sum = scalar_summary("d_loss", d_loss) if gpu_idx == 0: self.get_vars()
def preprocess_for_train(image, height, width, bbox, fast_mode=True, scope=None): """Distort one image for training a network. Distorting images provides a useful technique for augmenting the data set during training in order to make the network invariant to aspects of the image that do not effect the label. Additionally it would create image_summaries to display the different transformations applied to the image. Args: image: 3-D Tensor of image. If dtype is tf.float32 then the range should be [0, 1], otherwise it would converted to tf.float32 assuming that the range is [0, MAX], where MAX is largest positive representable number for int(8/16/32) data type (see `tf.image.convert_image_dtype` for details). height: integer width: integer bbox: 3-D float Tensor of bounding boxes arranged [1, num_boxes, coords] where each coordinate is [0, 1) and the coordinates are arranged as [ymin, xmin, ymax, xmax]. fast_mode: Optional boolean, if True avoids slower transformations (i.e. bi-cubic resizing, random_hue or random_contrast). scope: Optional scope for name_scope. Returns: 3-D float Tensor of distorted image used for training with range [-1, 1]. """ with tf.name_scope(scope, 'distort_image', [image, height, width, bbox]): if bbox is None: bbox = tf.constant([0.0, 0.0, 1.0, 1.0], dtype=tf.float32, shape=[1, 1, 4]) if image.dtype != tf.float32: image = tf.image.convert_image_dtype(image, dtype=tf.float32) # Each bounding box has shape [1, num_boxes, box coords] and # the coordinates are ordered [ymin, xmin, ymax, xmax]. image_with_box = tf.image.draw_bounding_boxes(tf.expand_dims(image, 0), bbox) tf.image_summary('image_with_bounding_boxes', image_with_box) distorted_image, distorted_bbox = distorted_bounding_box_crop( image, bbox) # Restore the shape since the dynamic slice based upon the bbox_size loses # the third dimension. distorted_image.set_shape([None, None, 3]) image_with_distorted_box = tf.image.draw_bounding_boxes( tf.expand_dims(image, 0), distorted_bbox) tf.image_summary('images_with_distorted_bounding_box', image_with_distorted_box) # This resizing operation may distort the images because the aspect # ratio is not respected. We select a resize method in a round robin # fashion based on the thread number. # Note that ResizeMethod contains 4 enumerated resizing methods. # We select only 1 case for fast_mode bilinear. num_resize_cases = 1 if fast_mode else 4 distorted_image = apply_with_random_selector( distorted_image, lambda x, method: tf.image.resize_images(x, [height, width], method ), num_cases=num_resize_cases) tf.image_summary('cropped_resized_image', tf.expand_dims(distorted_image, 0)) # Randomly flip the image horizontally. distorted_image = tf.image.random_flip_left_right(distorted_image) # Randomly distort the colors. There are 4 ways to do it. distorted_image = apply_with_random_selector( distorted_image, lambda x, ordering: distort_color(x, ordering, fast_mode), num_cases=4) tf.image_summary('final_distorted_image', tf.expand_dims(distorted_image, 0)) distorted_image = tf.sub(distorted_image, 0.5) distorted_image = tf.mul(distorted_image, 2.0) return distorted_image
def trajectory2Vec(): def loopf(prev, i): return prev # Parameters learning_rate = 0.0001 training_epochs = 300 display_step = 100 # Network Parameters # the size of the hidden state for the lstm (notice the lstm uses 2x of this amount so actually lstm will have state of size 2) size = 100 # 2 different sequences total batch_size = 1 # the maximum steps for both sequences is 5 max_n_steps = 17 # each element/frame of the sequence has dimension of 3 frame_dim = 18 input_length = tf.placeholder(tf.int32) initializer = tf.random_uniform_initializer(-1, 1) # the sequences, has n steps of maximum size # seq_input = tf.placeholder(tf.float32, [batch_size, max_n_steps, frame_dim]) seq_input = tf.placeholder(tf.float32, [max_n_steps, batch_size, frame_dim]) # what timesteps we want to stop at, notice it's different for each batch hence dimension of [batch] # inputs for rnn needs to be a list, each item/frame being a timestep. # we need to split our input into each timestep, and reshape it because split keeps dims by default useful_input = seq_input[0:input_length[0]] loss_inputs = [tf.reshape(useful_input, [-1])] encoder_inputs = [item for item in tf.unpack(seq_input)] # if encoder input is "X, Y, Z", then decoder input is "0, X, Y, Z". Therefore, the decoder size # and target size equal encoder size plus 1. For simplicity, here I droped the last one. decoder_inputs = ([tf.zeros_like(encoder_inputs[0], name="GO")] + encoder_inputs[:-1]) targets = encoder_inputs # basic LSTM seq2seq model cell = tf.nn.rnn_cell.LSTMCell(size, state_is_tuple=True, use_peepholes=True) _, enc_state = tf.nn.rnn(cell, encoder_inputs, sequence_length=input_length[0], dtype=tf.float32) cell = tf.nn.rnn_cell.OutputProjectionWrapper(cell, frame_dim) dec_outputs, dec_state = tf.nn.seq2seq.rnn_decoder(decoder_inputs, enc_state, cell, loop_function=loopf) # flatten the prediction and target to compute squared error loss y_true = [tf.reshape(encoder_input, [-1]) for encoder_input in encoder_inputs] y_pred = [tf.reshape(dec_output, [-1]) for dec_output in dec_outputs] # Define loss and optimizer, minimize the squared error loss = 0 for i in range(len(loss_inputs)): loss += tf.reduce_sum(tf.square(tf.sub(y_pred[i], y_true[len(loss_inputs) - i - 1]))) optimizer = tf.train.RMSPropOptimizer(learning_rate).minimize(loss) # Initializing the variables init = tf.initialize_all_variables() # Launch the graph with tf.Session() as sess: sess.run(init) # Training cycle input_datas = cPickle.load(open('./simulated_data/sim_normal_behavior_sequences')) trajectoryVecs = [] j = 0 for input_data in input_datas: print 'Sample:' print j input_len = len(input_data) print input_len defalt = [] for i in range(0, frame_dim): defalt.append(0) while len(input_data) < max_n_steps: input_data.append(defalt) x = np.array(input_data) print np.shape(x[0]) x = x.reshape((max_n_steps, batch_size, frame_dim)) embedding = None for epoch in range(training_epochs): feed = {seq_input: x, input_length: np.array([input_len])} # Fit training using batch data _, cost_value, embedding, en_int, de_outs, loss_in = sess.run( [optimizer, loss, enc_state, encoder_inputs, dec_outputs, loss_inputs], feed_dict=feed) # Display logs per epoch step if epoch % display_step == 0: print "logits" a = sess.run(y_pred, feed_dict=feed) print "labels" b = sess.run(y_true, feed_dict=feed) print("Epoch:", '%04d' % (epoch + 1), "cost=", "{:.9f}".format(cost_value)) trajectoryVecs.append(embedding) print("Optimization Finished!") j = j + 1 fout = file('./simulated_data/sim_traj_vec_normal_reverse', 'w') cPickle.dump(trajectoryVecs, fout)
def main(argv): # Import data dataset = utils.read_files_with_skimage(RESOURCE) input, output = utils.split_dataset(dataset) batch_size = len(input) # Make data as Numpy array input = np.asarray(input) output = np.asarray(output) # HEIGHT * WIDTH because y place holder also has HEIGHT * WIDTH output = np.reshape(output, (batch_size, HEIGHT, WIDTH)) # Test value test_x = skimage.io.imread("../../dataset/1.jpg", True) test_x = np.reshape(test_x, (1, 180, 320)) # Tensorflow placeholders x = tf.placeholder(tf.float32, [None, HEIGHT, WIDTH]) y = tf.placeholder(tf.float32, [None, HEIGHT, WIDTH], name="ground_truth") weights = { # 5x5 conv, 1 input, 32 outputs 'wc1': tf.Variable(tf.random_normal([3, 3, 1, 32])), # 5x5 conv, 32 inputs, 64 outputs 'wc2': tf.Variable(tf.random_normal([3, 3, 32, 64])), 'wc3': tf.Variable(tf.random_normal([3, 3, 64, 128])), 'wdc1': tf.Variable(tf.random_normal([2, 2, 64, 128])), 'wdc2': tf.Variable(tf.random_normal([2, 2, 32, 64])), 'wdc3': tf.Variable(tf.random_normal([2, 2, 1, 32])), } biases = { 'bc1': tf.Variable(tf.random_normal([32])), 'bc2': tf.Variable(tf.random_normal([64])), 'bc3': tf.Variable(tf.random_normal([128])), 'bdc1': tf.Variable(tf.random_normal([64])), 'bdc2': tf.Variable(tf.random_normal([32])), 'bdc3': tf.Variable(tf.random_normal([1])), } # Construct model pred = multilayer_perceptron(x, weights, biases) pred = tf.pack(pred) pred = tf.reshape(pred, [-1, HEIGHT, WIDTH]) with tf.name_scope("opt") as scope: cost = tf.reduce_sum(tf.pow((pred - y), 2)) / (2 * batch_size) optimizer = tf.train.AdamOptimizer(learning_rate=0.01).minimize(cost) # Evaluate model with tf.name_scope("acc") as scope: # accuracy is the difference between prediction and ground truth matrices correct_pred = tf.equal(0, tf.cast(tf.sub(cost, y), tf.int32)) accuracy = tf.reduce_mean(tf.cast(correct_pred, tf.float32)) # Initializing the variables init = tf.global_variables_initializer() with tf.Session() as sess: sess.run(init) # Initializing summary writer for TensorBoard train_writer = tf.summary.FileWriter('/tmp/log_dir/', sess.graph) for step in range(10): feed_dict = {x: input, y: output} _, loss, acc = sess.run([optimizer, cost, accuracy], feed_dict=feed_dict) if step % 10 == 0: print("Minibatch loss at step ", step, ": ", cost) print("Minibatch accuracy: ", acc) print("Done") # Make a prediction prediction = sess.run(pred, feed_dict={x: test_x}) prediction = np.reshape(prediction, (HEIGHT, WIDTH)) prediction = prediction.astype(int) print(prediction) prediction[prediction > 255] = 255 prediction[prediction < 0] = 0 print(prediction) skimage.io.imsave("works.jpg", prediction)
def highway(incoming, n_units, activation='linear', transform_dropout=None, weights_init='truncated_normal', bias_init='zeros', regularizer=None, weight_decay=0.001, trainable=True, restore=True, reuse=False, scope=None, name="FullyConnectedHighway"): """ Fully Connected Highway. A fully connected highway network layer, with some inspiration from [https://github.com/fomorians/highway-fcn](https://github.com/fomorians/highway-fcn). Input: (2+)-D Tensor [samples, input dim]. If not 2D, input will be flatten. Output: 2D Tensor [samples, n_units]. Arguments: incoming: `Tensor`. Incoming (2+)D Tensor. n_units: `int`, number of units for this layer. activation: `str` (name) or `function` (returning a `Tensor`). Activation applied to this layer (see tflearn.activations). Default: 'linear'. transform_dropout: `float`: Keep probability on the highway transform gate. weights_init: `str` (name) or `Tensor`. Weights initialization. (see tflearn.initializations) Default: 'truncated_normal'. bias_init: `str` (name) or `Tensor`. Bias initialization. (see tflearn.initializations) Default: 'zeros'. regularizer: `str` (name) or `Tensor`. Add a regularizer to this layer weights (see tflearn.regularizers). Default: None. weight_decay: `float`. Regularizer decay parameter. Default: 0.001. trainable: `bool`. If True, weights will be trainable. restore: `bool`. If True, this layer weights will be restored when loading a model reuse: `bool`. If True and 'scope' is provided, this layer variables will be reused (shared). scope: `str`. Define this layer scope (optional). A scope can be used to share variables between layers. Note that scope will override name. name: A name for this layer (optional). Default: 'FullyConnectedHighway'. Attributes: scope: `Scope`. This layer scope. W: `Tensor`. Variable representing units weights. W_t: `Tensor`. Variable representing units weights for transform gate. b: `Tensor`. Variable representing biases. b_t: `Tensor`. Variable representing biases for transform gate. Links: [https://arxiv.org/abs/1505.00387](https://arxiv.org/abs/1505.00387) """ input_shape = utils.get_incoming_shape(incoming) assert len(input_shape) > 1, "Incoming Tensor shape must be at least 2-D" n_inputs = int(np.prod(input_shape[1:])) # Build variables and inference. # Variable Scope fix for older TF try: vscope = tf.variable_scope(scope, default_name=name, values=[incoming], reuse=reuse) except Exception: vscope = tf.variable_op_scope([incoming], scope, name, reuse=reuse) with vscope as scope: name = scope.name W_init = weights_init if isinstance(weights_init, str): W_init = initializations.get(weights_init)() W_regul = None if regularizer: W_regul = lambda x: losses.get(regularizer)(x, weight_decay) W = va.variable('W', shape=[n_inputs, n_units], regularizer=W_regul, initializer=W_init, trainable=trainable, restore=restore) tf.add_to_collection(tf.GraphKeys.LAYER_VARIABLES + '/' + name, W) if isinstance(bias_init, str): bias_init = initializations.get(bias_init)() b = va.variable('b', shape=[n_units], initializer=bias_init, trainable=trainable, restore=restore) tf.add_to_collection(tf.GraphKeys.LAYER_VARIABLES + '/' + name, b) # Weight and bias for the transform gate W_T = va.variable('W_T', shape=[n_inputs, n_units], regularizer=None, initializer=W_init, trainable=trainable, restore=restore) tf.add_to_collection(tf.GraphKeys.LAYER_VARIABLES + '/' + name, W_T) b_T = va.variable('b_T', shape=[n_units], initializer=tf.constant_initializer(-1), trainable=trainable, restore=restore) tf.add_to_collection(tf.GraphKeys.LAYER_VARIABLES + '/' + name, b_T) # If input is not 2d, flatten it. if len(input_shape) > 2: incoming = tf.reshape(incoming, [-1, n_inputs]) if isinstance(activation, str): activation = activations.get(activation) elif hasattr(activation, '__call__'): activation = activation else: raise ValueError("Invalid Activation.") H = activation(tf.matmul(incoming, W) + b) T = tf.sigmoid(tf.matmul(incoming, W_T) + b_T) if transform_dropout: T = dropout(T, transform_dropout) C = tf.sub(1.0, T) inference = tf.add(tf.mul(H, T), tf.mul(incoming, C)) # Track activations. tf.add_to_collection(tf.GraphKeys.ACTIVATIONS, inference) # Add attributes to Tensor to easy access weights. inference.scope = scope inference.W = W inference.W_t = W_T inference.b = b inference.b_t = b_T # Track output tensor. tf.add_to_collection(tf.GraphKeys.LAYER_TENSOR + '/' + name, inference) return inference
with tf.Graph().as_default(): is_train = tf.placeholder(tf.bool) learning_rate = tf.placeholder(tf.float32, []) images_tf = tf.placeholder(tf.float32, [batch_size, 33, 33, 1], name="images") cs_meas = tf.placeholder(tf.float32, [batch_size, 1, m, 1], name='cs_meas') keep_prob = tf.placeholder(tf.float32, []) labels_D = tf.concat(0, [tf.ones([batch_size]), tf.zeros([batch_size])]) labels_G = tf.ones([batch_size]) bn1, bn2, bn3, bn4, bn5, reconstruction_ori = csgan.build_reconstruction( cs_meas, is_train) loss_recon = tf.div( tf.reduce_sum(tf.square(tf.sub(images_tf, reconstruction_ori))), 2. * batch_size) adversarial_pos, adversarial_pos_sig = csgan.build_adversarial( images_tf, is_train) adversarial_neg, adversarial_neg_sig = csgan.build_adversarial( reconstruction_ori, is_train, reuse=True ) # I changed this from reconstruction to reconstruction_ori. No idea which is right adversarial_all = tf.concat(0, [adversarial_pos, adversarial_neg]) loss_adv_D = tf.reduce_mean( tf.nn.sigmoid_cross_entropy_with_logits(adversarial_all, labels_D)) loss_adv_G = tf.reduce_mean( tf.nn.sigmoid_cross_entropy_with_logits(adversarial_neg, labels_G)) loss_G = loss_recon * lambda_recon + loss_adv_G * lambda_adv
def b1(x, y): nx = tf.sub(x, 1) ny = y + gen_data_flow_ops._stack_pop(h, tf.float32) return [nx, ny]
def ms_error(self, y_pre, y_target): return tf.square(tf.sub(y_pre, y_target))
x = tf.reshape(x, [-1, n_input]) x = tf.split(0, n_steps, x) lstm_cell = rnn_cell.BasicLSTMCell(n_hidden, forget_bias=1.0) outputs, states = rnn.rnn(lstm_cell, x, dtype=tf.float32) all_lstm_outputs = tf.reshape(tf.stack(outputs, axis=1), [-1, n_steps * n_hidden]) output = tf.matmul(outputs[-1], weights['out']) + biases['out'] # output = tf.matmul(all_lstm_outputs, weights['all_out']) + biases['out'] return tf.nn.dropout(output, 0.75) pred = RNN(x, weights, biases) n_samples = tf.cast(tf.shape(x)[0], tf.float32) cost = tf.reduce_sum(tf.pow(pred - y, 2)) / (2 * n_samples) optimizer = tf.train.AdamOptimizer(learning_rate=learning_rate).minimize(cost) accuracy = tf.reduce_mean(tf.abs(tf.sub(pred, y))) init = tf.initialize_all_variables() saver = tf.train.Saver() # Launch the graph with tf.Session() as sess: sess.run(init) step = 1 # saver.restore(sess, "./lstm_models/200/bball_scraping/lstm_models/200/lstm_model_n_steps_175_750_0.773770080762_1.33473893366_0.408350682807.ckpt") avg_pred_diff = [] avg_pred_vals = [] avg_reg_vals = [] max_r_values = [0, 0, 0] accuracy_data = [] single_game_pred = [] for step in range(250):
def build_inception_graph(self): """Builds an inception graph and add the necessary input & output tensors. To use other Inception models modify this file. Also preprocessing must be modified accordingly. See tensorflow/contrib/slim/python/slim/nets/inception_v3.py for details about InceptionV3. Returns: input_jpeg: A placeholder for jpeg string batch that allows feeding the Inception layer with image bytes for prediction. inception_embeddings: The embeddings tensor. """ # These constants are set by Inception v3's expectations. height = 299 width = 299 channels = 3 image_str_tensor = tf.placeholder(tf.string, shape=[None]) # The CloudML Prediction API always "feeds" the Tensorflow graph with # dynamic batch sizes e.g. (?,). decode_jpeg only processes scalar # strings because it cannot guarantee a batch of images would have # the same output size. We use tf.map_fn to give decode_jpeg a scalar # string from dynamic batches. def decode_and_resize(image_str_tensor): """Decodes jpeg string, resizes it and returns a uint8 tensor.""" image = tf.image.decode_jpeg(image_str_tensor, channels=channels) # Note resize expects a batch_size, but tf_map supresses that index, # thus we have to expand then squeeze. Resize returns float32 in the # range [0, uint8_max] image = tf.expand_dims(image, 0) image = tf.image.resize_bilinear(image, [height, width], align_corners=False) image = tf.squeeze(image, squeeze_dims=[0]) image = tf.cast(image, dtype=tf.uint8) return image image = tf.map_fn(decode_and_resize, image_str_tensor, back_prop=False, dtype=tf.uint8) # convert_image_dtype, also scales [0, uint8_max] -> [0 ,1). image = tf.image.convert_image_dtype(image, dtype=tf.float32) # Then shift images to [-1, 1) for Inception. # Try-except to make the code compatible across sdk versions try: image = tf.subtract(image, 0.5) image = tf.multiply(image, 2.0) except AttributeError: image = tf.sub(image, 0.5) image = tf.mul(image, 2.0) # Build Inception layers, which expect A tensor of type float from [-1, 1) # and shape [batch_size, height, width, channels]. with slim.arg_scope(inception.inception_v3_arg_scope()): _, end_points = inception.inception_v3(image, is_training=False) inception_embeddings = end_points['PreLogits'] inception_embeddings = tf.squeeze(inception_embeddings, [1, 2], name='SpatialSqueeze') return image_str_tensor, inception_embeddings
def tf_voltage(timeSteptf, Nrn_trace, g_L, volt_S, E_L, NrON_1, spineFactor, Nr_D, volt_D, Conduct2, E_AMPA, dist_att, E_NMDA, delta_T, Nrn_u_lp, uM_Tconst, uP_Tconst, u_delay, Homeostat_tau, C, x_reset, x_tau, V_T_tconst, V_Trest, Noise_tau, Noise_avg, Noise_std): #------------ # Currents #------------ ### external current ### I_ext = Nrn_trace[:, 4] ## soma # I_ext_D = repmat([prox_Backprop*Nrn_trace(:,5) dist_Backprop*Nrn_trace(:,5)],1,1,Nr_D) ## dendrites ### leak current ### I_L = g_L * tf.sub(volt_S, E_L * tf.ones(NrON_1)) ## soma I_L_D = tf.mul( tf.tile(tf.expand_dims([[spineFactor * g_L, spineFactor * g_L]], 2), [NrON_1, 1, Nr_D]), tf.sub(volt_D, E_L * tf.ones((NrON_1, 2, Nr_D)))) ## dendrites ### Noise ### I_noise = Nrn_trace[:, 5] ## soma # I_noise_D = repmat([prox_Backprop*Nrn_trace(:,6) dist_Backprop*Nrn_trace(:,6)],1,1,Nr_D) ## dendrites ### AMPA current ### I_prox_ampa = tf.scalar_mul( -1, tf.mul( Conduct2[:, 0, None, :], tf.sub(volt_D[:, 0, None, :], E_AMPA * tf.ones( (NrON_1, 1, Nr_D))))) I_dist_ampa = tf.mul( -1 * (1 / dist_att), tf.mul( Conduct2[:, 1, None, :], tf.sub(volt_D[:, 1, None, :], E_AMPA * tf.ones( (NrON_1, 1, Nr_D))))) I_AMPA = tf.concat(1, [I_prox_ampa, I_dist_ampa]) ### NMDA current ### corrf1 = tf.constant(100, dtype=tf.float32) corrf2 = tf.constant(2, dtype=tf.float32) I_prox_nmda = tf.scalar_mul( -1, tf.mul( Conduct2[:, 2, None, :], tf.div( tf.sub(volt_D[:, 0, None, :], E_NMDA * tf.ones((NrON_1, 1, Nr_D))), (tf.add( tf.to_float(1), tf.div(tf.exp(tf.mul(-0.065, volt_D[:, 0, None, :])), 3.57)))))) I_dist_nmda = tf.mul( -1 * (1 / dist_att), tf.mul( Conduct2[:, 3, None, :], tf.div( tf.sub(volt_D[:, 1, None, :], E_NMDA * tf.ones((NrON_1, 1, Nr_D))), (tf.add( tf.to_float(1), tf.div(tf.exp(tf.mul(-0.065, volt_D[:, 1, None, :])), 3.57)))))) I_NMDA = tf.concat(1, [I_prox_nmda, I_dist_nmda]) ### Exponential term (fast Na activation in soma) ### I_exp = tf.scalar_mul( g_L * delta_T, tf.exp(tf.div(tf.sub(volt_S, Nrn_trace[:, 2]), delta_T))) ### Synacptic current ### I_syn_dend = tf.add(I_AMPA, I_NMDA) ### Dendrites to soma current ### I_soma_prox = 2500 * tf.mul( tf.sub( tf.tile(tf.expand_dims(tf.expand_dims(volt_S, 1), 2), [1, 1, Nr_D]), volt_D[:, 0, None, :]), tf.tile( tf.expand_dims( tf.expand_dims(tf.to_float(tf.equal(Nrn_trace[:, 3], 0)), 1), 2), [1, 1, Nr_D])) I_prox_dist = .5 * 1500 * tf.sub(volt_D[:, 0, None, :], volt_D[:, 1, None, :]) backpr_som_prox = 0.02 #0.04 backpr_prox_dist = 0.15 #15 #0.09 V_fact = 25 ### Total dendritic current ### tval21 = tf.add( tf.mul(I_soma_prox, tf.to_float(tf.greater(I_soma_prox, 0))), tf.mul(V_fact * backpr_som_prox, tf.mul(I_soma_prox, tf.to_float(tf.less(I_soma_prox, 0))))) tval22 = tf.add( tf.mul(backpr_prox_dist, tf.mul(I_prox_dist, tf.to_float(tf.less(I_prox_dist, 0)))), tf.mul(I_prox_dist, tf.to_float(tf.greater(I_prox_dist, 0)))) tval2 = tf.sub(tval21, tval22) tval31 = tf.mul(backpr_prox_dist, tf.mul(I_prox_dist, tf.to_float(tf.less(I_prox_dist, 0)))) tval32 = tf.mul(I_prox_dist, tf.to_float(tf.greater(I_prox_dist, 0))) tval3 = tf.add(tval31, tval32) tval1 = tf.concat(1, [tval2, tval3]) I_dend = tf.add(I_syn_dend, tval1) #I_syn_dend # I_dend(1,1,1) = I_dend(1,1,1) + 9000 # I_dend(1,2,1) = I_dend(1,2,1) + 15500 #--------------------- # Currents #------------------------ ### low-pass filtered membrane potentials ### lp1 = tf.add( Nrn_u_lp[:, 0:2, :], tf.mul((timeSteptf / (uM_Tconst)), tf.sub(u_delay[:, :, :, 0], Nrn_u_lp[:, 0:2, :]))) lp2 = tf.add( Nrn_u_lp[:, 2:4, :], tf.mul((timeSteptf / (uP_Tconst)), tf.sub(u_delay[:, :, :, 0], Nrn_u_lp[:, 2:4, :]))) Nrn_u_lp2 = tf.concat(1, [lp1, lp2]) traces_0 = tf.add( Nrn_trace[:, 0], tf.mul((timeSteptf / Homeostat_tau), tf.sub( tf.mul((volt_S - E_L), tf.to_float(tf.greater(volt_S, E_L))), Nrn_trace[:, 0]))) #rectified to avoid the point u = -u_ref ### store membrane potential of previous timeSteptf ### Nrn_u_delay_shift = u_delay[:, :, :, 1:] Nrn_u_delay_end = tf.expand_dims(volt_D, 3) Nrn_u_delay2 = tf.concat(3, [Nrn_u_delay_shift, Nrn_u_delay_end]) ### Somatic Voltage evolution ### volt_S2 = tf.add( volt_S, tf.mul((timeSteptf / C), tf.add( tf.sub( I_exp, tf.add( I_L, tf.squeeze( tf.reduce_sum( tf.mul( backpr_som_prox, tf.mul( I_soma_prox, tf.to_float(tf.less(I_soma_prox, 0)))), 2)))), tf.add(I_ext, I_noise)) )) #- sum((1/V_fact)*I_soma_prox.*(I_soma_prox>0),3) ### Dendritic voltage evolution ### C_matr = tf.mul(spineFactor * C, tf.ones((NrON_1, 2, Nr_D))) # C_matr = tf.tile(,[NrON,2,Nr_D]) volt_D2 = tf.add(volt_D, tf.mul(timeSteptf, tf.div(tf.sub(I_dend, I_L_D), C_matr))) ### x (spike trace) ### traces_1 = tf.sub( tf.add(Nrn_trace[:, 1], tf.mul(tf.to_float(tf.equal(Nrn_trace[:, 3], 1)), x_reset)), tf.mul((timeSteptf / x_tau), Nrn_trace[:, 1])) ### threshold V_T evolution ### traces_2 = tf.add( Nrn_trace[:, 2], tf.mul((timeSteptf / V_T_tconst), tf.sub(V_Trest, Nrn_trace[:, 2]))) ### Noise ### auxn1 = tf.mul(tf.to_float(tf.sqrt(tf.to_float(2 * Noise_tau))), tf.random_normal([NrON_1])) auxn2 = tf.mul(tf.to_float(Noise_avg), tf.ones(NrON_1)) traces_5 = tf.add(Nrn_trace[:, 5], tf.mul( tf.to_float(timeSteptf / Noise_tau), tf.sub( tf.add(tf.mul(auxn1, tf.to_float(Noise_std)), auxn2), Nrn_trace[:, 5]))) #filter the noise # traces_34 = Nrn_trace[:, 3:5] Nrn_trace2 = tf.concat(1, [ tf.pack([traces_0, traces_1, traces_2], axis=1), traces_34, tf.expand_dims(traces_5, 1) ]) return volt_S2, volt_D2, Nrn_trace2, Nrn_u_lp2, Nrn_u_delay2
def __init__(self, l, m, n, dim, n_iterations=100, alpha=None, sigma=None): self._m = m self._n = n self._l = l if alpha is None: alpha = 0.3 else: alpha = float(alpha) if sigma is None: sigma = max(l, m, n) / 2.0 else: sigma = float(sigma) self._n_iterations = abs(int(n_iterations)) self._graph = tf.Graph() with self._graph.as_default(): self._weightage_vects = tf.Variable(tf.random_normal( [l*m*n, dim])) self._location_vects = tf.constant(np.array( list(self._neuron_locations(l, m, n)))) self._vect_input = tf.placeholder("float", [dim]) self._iter_input = tf.placeholder("float") bmu_index = tf.argmin(tf.sqrt(tf.reduce_sum( tf.pow(tf.sub(self._weightage_vects, tf.pack( [self._vect_input for i in range(l*m*n)])), 2), 1)), 0) slice_input = tf.pad(tf.reshape(bmu_index, [1]), np.array([[0, 1]])) bmu_loc = tf.reshape(tf.slice(self._location_vects, slice_input, tf.constant(np.array([1, 3]))), [3]) learning_rate_op = tf.sub(1.0, tf.div(self._iter_input, self._n_iterations)) _alpha_op = tf.mul(alpha, learning_rate_op) _sigma_op = tf.mul(sigma, learning_rate_op) bmu_distance_squares = tf.reduce_sum(tf.pow(tf.sub( self._location_vects, tf.pack( [bmu_loc for i in range(l*m*n)])), 2), 1) neighbourhood_func = tf.exp(tf.neg(tf.div(tf.cast( bmu_distance_squares, "float32"), tf.pow(_sigma_op, 2)))) learning_rate_op = tf.mul(_alpha_op, neighbourhood_func) learning_rate_multiplier = tf.pack([tf.tile(tf.slice( learning_rate_op, np.array([i]), np.array([1])), [dim]) for i in range(l*m*n)]) weightage_delta = tf.mul( learning_rate_multiplier, tf.sub(tf.pack([self._vect_input for i in range(l*m*n)]), self._weightage_vects)) new_weightages_op = tf.add(self._weightage_vects, weightage_delta) self._training_op = tf.assign(self._weightage_vects, new_weightages_op) self._sess = tf.Session() init_op = tf.global_variables_initializer() self._sess.run(init_op)
def l2distance_tf(x, y): return tf.sqrt(tf.reduce_sum(tf.square(tf.sub(x, y)), 1))
def __init__(self, state_size, no_layers=2, hidden_layer_size=128, reg_L2=0.0): self.no_layers = no_layers self.hidden_layer_size = hidden_layer_size self.reg_L2 = reg_L2 self.l2_loss = tf.constant(0.0, name="l2_loss") self.state_placeholder = tf.placeholder(dtype=tf.float32, shape=[None, state_size], name="state_placeholder") self.reward_placeholder = tf.placeholder(dtype=tf.float32, shape=[None], name="reward_placeholder") self.dropout_input = tf.placeholder(dtype=tf.float32, name="dropout_input") self.in_.append(self.state_placeholder) for i in range(self.no_layers): if i == 0: self.W.append( tf.Variable(tf.truncated_normal( shape=[state_size, self.hidden_layer_size], stddev=0.01), dtype=tf.float32, name="weights" + str(i))) self.B.append( tf.Variable(tf.truncated_normal( shape=[self.hidden_layer_size], stddev=0.01), dtype=tf.float32, name="Bias" + str(i))) elif i == self.no_layers - 1: self.W.append( tf.Variable(tf.truncated_normal( shape=[self.hidden_layer_size, 1], stddev=0.01), dtype=tf.float32, name="weights" + str(i))) self.B.append( tf.Variable(tf.truncated_normal(shape=[1], stddev=0.01), dtype=tf.float32, name="Bias" + str(i))) else: self.W.append( tf.Variable(tf.truncated_normal( shape=[self.hidden_layer_size, self.hidden_layer_size], stddev=0.01), dtype=tf.float32, name="weights" + str(i))) self.B.append( tf.Variable(tf.truncated_normal( shape=[self.hidden_layer_size], stddev=0.01), dtype=tf.float32, name="Bias" + str(i))) self.l2_loss += tf.nn.l2_loss(self.W[i]) self.l2_loss += tf.nn.l2_loss(self.B[i]) self.out.append( tf.nn.xw_plus_b(self.in_[i], self.W[i], self.B[i], name="Prediction" + str(i))) if i == 0 or i == self.no_layers - 1: self.dropout_t = tf.constant(1.0) else: self.dropout_t = self.dropout_input self.out_activated.append( tf.nn.relu(tf.nn.dropout(self.out[i], self.dropout_t))) self.in_.append(self.out_activated[i]) self.prediction = self.out_activated[self.no_layers - 1] self.loss = tf.reduce_sum( tf.square(tf.sub(self.reward_placeholder, self.prediction)) + self.reg_L2 * self.l2_loss)
0.0)) # going to iterate over all outputs, because I don't know how to do it easier out = [] mean = tf.Variable(init_means, name="means") sigma = tf.Variable(init_sds, name="covariance") for i in range(num_classes): M = tf.squeeze(tf.split(0, num_classes, mean)[i]) s = tf.squeeze(tf.split(0, num_classes, sigma)[i]) if num_features == 1: # special case with single modality d = tf.sub(x, M) m2 = tf.mul(tf.div(d, s), d) else: # calculate probabilities of class membership (multivariate gaussian) d = tf.sub(x, M) m1 = tf.matmul(d, tf.matrix_inverse(s)) m2 = tf.expand_dims( tf.reduce_sum(tf.mul(m1, d), 1), -1 ) # have to replace matrix multiplication with this out.append(-0.5 * m2) # should be columns # align columns _out = tf.concat(1, out) y = tf.nn.softmax(_out) + _epsilon # to avoid taking log of 0
def __init__(self, is_training, config): self.batch_size = batch_size = np.int32(config.max_group_size) self.num_steps = num_steps = config.num_steps self.num_features = num_features = config.num_features self.dense_units = dense_units = config.dense_units self.hidden_size = size = np.int32(config.hidden_size) if is_training: print 'Initiating input tensors of shape: {}'.format( (num_steps, batch_size, num_features)) self._input_data = inputs = tf.placeholder( tf.float32, [num_steps, batch_size, num_features]) self._targets = tf.placeholder(tf.float32, [num_steps, batch_size]) # Memory cell to use in model rnn_cell = tf.nn.rnn_cell.BasicRNNCell(num_units=size) if is_training: print 'Memory Cell: {}'.format(type(rnn_cell)) # Wrap the memory cell in a dropout layer (for outputs) if is_training and config.keep_prob < 1: rnn_cell = tf.nn.rnn_cell.DropoutWrapper( cell=rnn_cell, output_keep_prob=config.keep_prob) # Create the RNN with 'num_layers' layers stacked_cell = tf.nn.rnn_cell.MultiRNNCell([rnn_cell] * config.num_layers) # Initialize the state -- it will hold the last output, h_t, as well as the memory state, c_t # Shape will be [batch_size, num_units x 2] -- splitting on dimension 1 will separate output and memory self._initial_state = stacked_cell.zero_state( batch_size=tf.constant(batch_size), dtype=tf.float32) # Split the inputs (by timestep) inputs = [ tf.squeeze(input, [0]) for input in tf.split(0, num_steps, inputs) ] # Computes dropout for inputs if is_training and config.keep_prob < 1: inputs = [tf.nn.dropout(x, config.keep_prob) for x in inputs] # Run inputs through the RNN outputs, state = tf.nn.rnn(stacked_cell, inputs, initial_state=self._initial_state) # Re-joins all output tensors (from each timestep) output = tf.reshape(tf.concat(1, outputs), shape=[-1, size]) # Add a fully-connected layer self.dense_w = dense_w = tf.get_variable('dense_w', shape=[size, dense_units]) self.dense_b = dense_b = tf.get_variable('dense_b', shape=[dense_units]) # Feed the output from the RNN to the fully-connected layer self._predictions = predictions = tf.matmul(output, dense_w) + dense_b self._predictions = predictions = tf.reshape( self.predictions, shape=[num_steps, batch_size]) # Compute the R^2 numerator = tf.reduce_sum( tf.square(tf.sub(self.targets, self.predictions))) denominator = tf.reduce_sum( tf.square(tf.sub(self.targets, tf.reduce_mean(self.targets)))) self.r2 = r2 = tf.sub(1.0, tf.div(numerator, denominator)) # MSE cost function self._cost = cost = tf.reduce_mean( tf.square(tf.sub(self.targets, self.predictions))) self._final_state = state # Variable for state (for when saving model) self.save_state = tf.Variable( tf.zeros([batch_size, size * config.num_layers])) self.save_state.assign(state) if is_training: self._lr = tf.Variable(0.0, trainable=False) # Compute the gradients tvars = tf.trainable_variables() grads, _ = tf.clip_by_global_norm(t_list=tf.gradients(cost, tvars), clip_norm=config.max_grad_norm) # Adjust the parameters based on optimizer and gradients optimizer = tf.train.AdamOptimizer(self.lr) self._train_op = optimizer.apply_gradients( grads_and_vars=zip(grads, tvars)) # Summaries for Tensorboard cost_summ = tf.scalar_summary('mean squared error', cost) r2_summ = tf.scalar_summary('r-squared', r2) state_summ = tf.histogram_summary('states', state) pred_summ = tf.histogram_summary('predictions', predictions) self.summary = tf.merge_all_summaries() else: # Ignore this -- put here so errors are prevented when running model not in training mode self.summary = predictions return
def __init__(self, m, n, dim, n_iterations=100, alpha=None, sigma=None): """ Initializes all necessary components of the TensorFlow Graph. m X n are the dimensions of the SOM. 'n_iterations' should should be an integer denoting the number of iterations undergone while training. 'dim' is the dimensionality of the training inputs. 'alpha' is a number denoting the initial time(iteration no)-based learning rate. Default value is 0.3 'sigma' is the the initial neighbourhood value, denoting the radius of influence of the BMU while training. By default, its taken to be half of max(m, n). """ #Assign required variables first self._m = m self._n = n if alpha is None: alpha = 0.3 else: alpha = float(alpha) if sigma is None: sigma = max(m, n) / 2.0 else: sigma = float(sigma) self._n_iterations = abs(int(n_iterations)) ##INITIALIZE GRAPH self._graph = tf.Graph() ##POPULATE GRAPH WITH NECESSARY COMPONENTS with self._graph.as_default(): ##VARIABLES AND CONSTANT OPS FOR DATA STORAGE #Randomly initialized weightage vectors for all neurons, #stored together as a matrix Variable of size [m*n, dim] self._weightage_vects = tf.Variable(tf.random_normal( [m*n, dim])) #Matrix of size [m*n, 2] for SOM grid locations #of neurons self._location_vects = tf.constant(np.array( list(self._neuron_locations(m, n)))) ##PLACEHOLDERS FOR TRAINING INPUTS #We need to assign them as attributes to self, since they #will be fed in during training #The training vector self._vect_input = tf.placeholder("float", [dim]) #Iteration number self._iter_input = tf.placeholder("float") ##CONSTRUCT TRAINING OP PIECE BY PIECE #Only the final, 'root' training op needs to be assigned as #an attribute to self, since all the rest will be executed #automatically during training #To compute the Best Matching Unit given a vector #Basically calculates the Euclidean distance between every #neuron's weightage vector and the input, and returns the #index of the neuron which gives the least value bmu_index = tf.argmin(tf.sqrt(tf.reduce_sum( tf.pow(tf.sub(self._weightage_vects, tf.pack( [self._vect_input for i in range(m*n)])), 2), 1)), 0) #This will extract the location of the BMU based on the BMU's #index slice_input = tf.pad(tf.reshape(bmu_index, [1]), np.array([[0, 1]])) bmu_loc = tf.reshape(tf.slice(self._location_vects, slice_input, tf.constant(np.array([1, 2]))), [2]) #To compute the alpha and sigma values based on iteration #number learning_rate_op = tf.sub(1.0, tf.div(self._iter_input, self._n_iterations)) _alpha_op = tf.mul(alpha, learning_rate_op) _sigma_op = tf.mul(sigma, learning_rate_op) #Construct the op that will generate a vector with learning #rates for all neurons, based on iteration number and location #wrt BMU. bmu_distance_squares = tf.reduce_sum(tf.pow(tf.sub( self._location_vects, tf.pack( [bmu_loc for i in range(m*n)])), 2), 1) neighbourhood_func = tf.exp(tf.neg(tf.div(tf.cast( bmu_distance_squares, "float32"), tf.pow(_sigma_op, 2)))) learning_rate_op = tf.mul(_alpha_op, neighbourhood_func) #Finally, the op that will use learning_rate_op to update #the weightage vectors of all neurons based on a particular #input learning_rate_multiplier = tf.pack([tf.tile(tf.slice( learning_rate_op, np.array([i]), np.array([1])), [dim]) for i in range(m*n)]) weightage_delta = tf.mul( learning_rate_multiplier, tf.sub(tf.pack([self._vect_input for i in range(m*n)]), self._weightage_vects)) new_weightages_op = tf.add(self._weightage_vects, weightage_delta) self._training_op = tf.assign(self._weightage_vects, new_weightages_op) ##INITIALIZE SESSION self._sess = tf.Session() ##INITIALIZE VARIABLES init_op = tf.initialize_all_variables() self._sess.run(init_op)
def build_model(self, learning_rate=None, deep_n_nodes=[100, 50], deep_dropout=False, bias=True): ''' Model - wide and deep - built using tflearn ''' if not learning_rate: learning_rate = [0.001, 0.01] n_cc = len(self.continuous_columns) n_categories = 1 # two categories: is_idv and is_not_idv input_shape = [None, n_cc] if self.verbose: print("=" * 77 + " Model %s (type=%s)" % (self.name, self.model_type)) print(" Input placeholder shape=%s" % str(input_shape)) wide_inputs = tflearn.input_data(shape=input_shape, name="wide_X") if not isinstance(learning_rate, list): learning_rate = [learning_rate, learning_rate] # wide, deep if self.verbose: print(" Learning rates (wide, deep)=%s" % learning_rate) with tf.name_scope( "Y"): # placeholder for target variable (i.e. trainY input) Y_in = tf.placeholder(shape=[None, 1], dtype=tf.float32, name="Y") if bias: with tf.variable_op_scope([wide_inputs], None, "cb_unit", reuse=False) as scope: central_bias = tflearn.variables.variable( 'central_bias', shape=[1], initializer=tf.constant_initializer(np.random.randn()), trainable=True, restore=True) tf.add_to_collection(tf.GraphKeys.LAYER_VARIABLES + '/cb_unit', central_bias) if 'wide' in self.model_type: wide_network = self.wide_model(wide_inputs, n_cc) network = wide_network if bias: wide_network_with_bias = tf.add(wide_network, central_bias, name="wide_with_bias") if 'deep' in self.model_type: deep_network = self.deep_model(wide_inputs, n_cc, n_nodes=deep_n_nodes, use_dropout=deep_dropout) if bias: deep_network_with_bias = tf.add(deep_network, central_bias, name="deep_with_bias") if 'wide' in self.model_type: network = tf.add(wide_network, deep_network) if self.verbose: print("Wide + deep model network %s" % network) else: network = deep_network if bias: network = tf.add(network, central_bias, name="add_central_bias") # add validation monitor summaries giving confusion matrix entries with tf.name_scope('Monitors'): predictions = tf.cast(tf.greater(network, 0), tf.int64) print("predictions=%s" % predictions) Ybool = tf.cast(Y_in, tf.bool) print("Ybool=%s" % Ybool) pos = tf.boolean_mask(predictions, Ybool) neg = tf.boolean_mask(predictions, ~Ybool) psize = tf.cast(tf.shape(pos)[0], tf.int64) nsize = tf.cast(tf.shape(neg)[0], tf.int64) true_positive = tf.reduce_sum(pos, name="true_positive") false_negative = tf.sub(psize, true_positive, name="false_negative") false_positive = tf.reduce_sum(neg, name="false_positive") true_negative = tf.sub(nsize, false_positive, name="true_negative") overall_accuracy = tf.truediv(tf.add(true_positive, true_negative), tf.add(nsize, psize), name="overall_accuracy") vmset = [ true_positive, true_negative, false_positive, false_negative, overall_accuracy ] trainable_vars = tf.trainable_variables() tv_deep = [v for v in trainable_vars if v.name.startswith('deep_')] tv_wide = [v for v in trainable_vars if v.name.startswith('wide_')] if self.verbose: print("DEEP trainable_vars") for v in tv_deep: print(" Variable %s: %s" % (v.name, v)) print("WIDE trainable_vars") for v in tv_wide: print(" Variable %s: %s" % (v.name, v)) if 'wide' in self.model_type: if bias: if not 'deep' in self.model_type: tv_wide.append(central_bias) target_wide_net = wide_network_with_bias else: target_wide_net = wide_network tflearn.regression( target_wide_net, placeholder=Y_in, optimizer='sgd', #loss='roc_auc_score', loss='binary_crossentropy', metric="accuracy", learning_rate=learning_rate[0], # validation_monitors=vmset, trainable_vars=tv_wide, op_name="wide_regression", name="Y") if 'deep' in self.model_type: if bias: if not 'wide' in self.model_type: tv_wide.append(central_bias) target_deep_net = deep_network_with_bias else: target_deep_net = deep_network tflearn.regression( target_deep_net, placeholder=Y_in, optimizer='adam', #loss='roc_auc_score', loss='binary_crossentropy', metric="accuracy", learning_rate=learning_rate[1], # validation_monitors=vmset if not 'wide' in self.model_type else None, trainable_vars=tv_deep, op_name="deep_regression", name="Y") if bias and self.model_type == 'wide+deep': # learn central bias separately for wide+deep tflearn.regression( network, placeholder=Y_in, optimizer='adam', loss='binary_crossentropy', metric="accuracy", learning_rate=learning_rate[0], # use wide learning rate trainable_vars=[central_bias], op_name="central_bias_regression", name="Y") self.model = tflearn.DNN( network, tensorboard_verbose=self.tensorboard_verbose, max_checkpoints=5, checkpoint_path="%s/%s.tfl" % (self.checkpoints_dir, self.name), ) if self.verbose: print("Target variables:") for v in tf.get_collection(tf.GraphKeys.TARGETS): print(" variable %s: %s" % (v.name, v)) print("=" * 77)
# Reshape conv layer to all-connected layer activation_shape = activation.get_shape().as_list() reshape = tf.reshape(activation, [ activation_shape[0], activation_shape[1] * activation_shape[2] * activation_shape[3] ]) all_connected = tf.nn.sigmoid(tf.matmul(reshape, fc1_weights) + fc1_biases) # if train: # all_connected = tf.nn.dropout(all_connected, 0.8, seed = SEED) return tf.matmul(all_connected, fc2_weights) + fc2_biases # Be careful of the data-structure of network output & labels_node train_output = model(train_images_node, True) train_loss = tf.nn.l2_loss(tf.sub( train_output, train_labels_node)) / (2 * N_POINTS * BATCH_SIZE) # Directly import LeNet L2 regularization for the fully connected parameters. regularizers = (tf.nn.l2_loss(fc1_weights) + tf.nn.l2_loss(fc1_biases) + tf.nn.l2_loss(fc2_weights) + tf.nn.l2_loss(fc2_biases)) # Add the regularization term to the loss. regularized_train_loss = train_loss # + LAMDA * regularizers ############################################################### # Optimizers to be appeared here # Using simple gradient descent method with constant learning rate # SGD # batch = tf.Variable(0, dtype=IMAGE_DATA_TYPE) # opt = tf.train.GradientDescentOptimizer(learning_rate=LEARNING_RATE).minimize(regularized_train_loss)