class ThreeDArray: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() # call this class functions from utility def calling(self): print("\nCreate array ") input1 = input("\nEnter the array start value:") input2 = input("Enter the end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\nGive proper dimension for matrix:") num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(array_created, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Original Array: \n", result) # it will take as as header comment to input matrix res = self.obj1.identitymatrix(result) print("3-D array with ones on a diagonal: \n", res)
class NumpyClass1: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() # call this class function from utility def calling(self): print("\nPut values for reshape matrix from 2 to 10") input1 = input("\nEnter the matrix start value:") input2 = input("Enter the matrix end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: print("\nNew Matrix:\n", array_created) print("\n3 * 3 Dimension matrix") num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(array_created, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Reshape given matrix into given dimension: \n", result)
class ArrayOperation: # arr1 = np.array([10,20,30,40][20,40,50,60]) # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() # call this class functions from utility def calling(self): print("\nCreate an array: ") input1 = input("\nEnter the start value for array:") input2 = input("Enter the end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\nGive proper dimension:") num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(array_created, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Reshape array into given format: \n", result) # it will take as as header comment to input matrix res = self.obj1.flattendarr(result) print("Flatted array: ", res)
class StoreArray: # arr1 = np.array([10,20,30,40][20,40,50,60]) # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() # call this class function from utility def calling(self): print("\nCreate array to store it into file: ") input1 = input("\nEnter the start value for array:") input2 = input("Enter the end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\nGive proper dimension for matrix:") num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(array_created, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Reshape array into given format: \n", result) # it will take as as header comment to input matrix header = 'c1 c2 c3 ' # file only create once and then it will update with new inputs # savetxt function is used to store data into file np.savetxt('file12.txt', result, fmt=" %d ", header=header)
class ChangeDT: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() # call this class functions from utility def calling(self): print("\ncreate matrix to store it into file: ") input1 = input("\nEnter the start value for array:") input2 = input("Enter the end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\nGive proper dimension:") num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(array_created, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Original Array: \n", result) # it will take as as header comment to input matrix res = self.obj1.change_dt(result) print("Array with other DataType: \n", res)
class NumpyClass1: # class constructor def __init__(self): self.obj1 = UtilClass() def calling(self): print("\nPut values from 12 to 37 to reverse array ") # It display number from 12 to 37 input1 = input("\nEnter the matrix start value:") input2 = input("Enter the matrix end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: print("\nOriginal Matrix:", array_created) # call reverse method print("Reverse array:", self.obj1.matrix_reverse(array_created))
class Matrix: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() def calling(self): print("\nPut values from 1 to 9 ") # It display number from 1 to 9 input1 = input("\nEnter the matrix start value:") input2 = input("Enter the matrix end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) # check output correct or not if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\n 3 * 3 Dimension matrix") matrix_of_one = self.obj1.matrix_one_creation(array_created) num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(matrix_of_one, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Reshape given matrix into 3*3 or given format: \n", result) print("\n0 on the border and 1 inside in the array") # Give result as zero outside and border with zeroes # syntax->numpy.pad(array, pad_width, mode, **kwargs) result1 = np.pad(result, pad_width=1, mode='constant', constant_values=0) print(result1)
class Checkerboard: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() def calling(self): print("\nPut values from 1 to 64 ") # It display number from 1 to 64 input1 = input("\nEnter the matrix start value:") input2 = input("Enter the matrix end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) # check output correct or not if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\n 8 * 8 Dimension matrix") # whole matrix fill with zeroes matrix_of_one = self.obj1.null_vector_creation(array_created) num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix(matrix_of_one, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print("Reshape given matrix into 8*8 or given format: \n", result) """ x[1::2, ::2] = 1 : Slice from 1st index row till 1+2+2… (repeated for 2nd iteration)and fill all columns with 1 starting from 0th to 0+2+2… and so on. x[::2, 1::2] = 1 : Slice from 0th row till 0+2+2… and fill all columns with 1 starting from 1 to 1+2+2+….. """ result[::2, 1::2] = 1 result[1::2, ::2] = 1 print("Checkerboard pattern:\n", result)
class NumpyClass1: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() def calling(self): print("\nPut values for null vector from 0 to 10") input1 = input("\nEnter the matrix start value:") input2 = input("Enter the matrix end value:") array_created = self.obj1.matrix_creation(input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) # create null vector result = self.obj1.null_vector_creation(array_created) print("\nOriginal null vector array :", result) # update null vector sixth value to 11 print("Update array: ", self.obj1.update_matrix(result))
class ThreeDArray: # class constructor def __init__(self): # utility class objected created here self.obj1 = UtilClass() # call this class functions from utility # 19 to 21 def calling(self): while True: try: print() print( "1. Create an array as per requirement" "\n" "2. Concatenate 2-dimensional arrays" "\n" "3. Make an array immutable (read-only)" "\n" "4. Create an array of (3, 4) shape, multiply every element value by 3" "\n" "5. Convert a NumPy array into Python list structure " "\n" "6. Add an extra column to an numpy array" "\n" "7. Remove specific elements in a numpy array" "\n" "8. Exit") ch = input("Enter choice:") choice = int(ch) if ch.isdigit(): if choice == 1: """19. Write a Python program to create an array which looks like below array. """ array = np.tri(4, 3, -1) print("Final array: \n", array) print( "_______________________________________________________________________________" ) elif choice == 2: # 20 data1 = np.array([[0, 1, 3], [5, 7, 9]]) data2 = np.array([[0, 2, 4], [6, 8, 10]]) print("original arrays:\n", data1, "\n", data2) print("Concreate array:", self.obj1.concreate_data(data1, data2)) print( "_______________________________________________________________________________" ) elif choice == 3: # 21 print("\nPut values from 0 to 10") input1 = input("\nEnter the start value of array:") input2 = input("Enter the end value:") array_created = self.obj1.matrix_creation( input1, input2) str1 = str(array_created) if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) # create null vector result = self.obj1.null_vector_creation( array_created) print("\nOriginal null vector array :", result) # print("try to change value for null") a = np.zeros((3, 3)) # here we set writable = false , so we can only read our data result.flags.writeable = False result[0] = 1 print(result) print( "_______________________________________________________________________________" ) elif choice == 4: # 22 print("\nPut values from 1 to 12 ") input1 = input("\nEnter the matrix start value:") input2 = input("Enter the matrix end value:") array_created = self.obj1.matrix_creation( input1, input2) str1 = str(array_created) # check output correct or not if re.match(str1, 'None'): print("Output will not display") else: # print("\nNew Matrix:\n", array_created) print("\n 3 *4 Dimension matrix") num1 = input("Enter the 1st dimension:") num2 = input("Enter the 2nd dimension:") result = self.obj1.reshape_matrix( array_created, num1, num2) str2 = str(result) if re.match(str2, 'None'): print("Output will not display") else: print( "Reshape given matrix into given dimension format: \n", result) # multiply each element in array by 3 num = 3 print( "Array multiply every element value by 3: \n", self.obj1.matrix_scalar_multi(result, num)) print( "_______________________________________________________________________________" ) elif choice == 5: # 23 original_array = np.array([[0, 1], [2, 3], [4, 5]]) print("\nOriginal array: \n", original_array) print("Array to list conversion:", original_array.tolist()) # 24 original_array1 = np.array([ 0.26153123, 0.52760141, 0.5718299, 0.5927067, 0.7831874, 0.69746349, 0.35399976, 0.99469633, 0.0694458, 0.54711478 ]) print("\nOriginal array: \n", original_array1) np.set_printoptions(precision=3) print("\nArray to list conversion with precision 3:", original_array1) # 25 original_array2 = np.array([1.6e-10, 1.6, 1200, .235]) print("\nOriginal array: ", original_array2) # np.set_printoptions(suppress=True) np.set_printoptions(suppress=True) print("Final array:", original_array2) elif choice == 6: # 26 inputarr = np.array([[10, 20, 30], [40, 50, 60]]) addarray = np.array([[100], [200]]) # np.append() add new coloumn to original array with axis = 1 for 2D array print(np.append(inputarr, addarray, axis=1)) elif choice == 7: # 27 array_input = np.array( [10, 20, 30, 40, 50, 60, 70, 80, 90, 100]) index = (0, 3, 4) print(np.delete(array_input, index)) elif choice == 8: exit() print( "_______________________________________________________________________________" ) else: print("Plz enter valid choice: ") acc = str(input("IF you want to continue: type yes ")) if re.match(acc, 'y'): continue elif re.match(acc, 'yes'): continue elif re.match(acc, 'n'): break elif re.match(acc, 'no'): break else: print("Give proper input") continue else: raise ValueError except ValueError as e: print("\nInvalid Input", e)