class Checkerboard:
# class constructor
def __init__(self):
# utility class objected created here
self.obj1 = UtilClass()
def calling(self):
print("\nPut values from 1 to 64 ")
# It display number from 1 to 64
input1 = input("\nEnter the matrix start value:")
input2 = input("Enter the matrix end value:")
array_created = self.obj1.matrix_creation(input1, input2)
str1 = str(array_created)
# check output correct or not
if re.match(str1, 'None'):
print("Output will not display")
else:
# print("\nNew Matrix:\n", array_created)
print("\n 8 * 8 Dimension matrix")
# whole matrix fill with zeroes
matrix_of_one = self.obj1.null_vector_creation(array_created)
num1 = input("Enter the 1st dimension:")
num2 = input("Enter the 2nd dimension:")
result = self.obj1.reshape_matrix(matrix_of_one, num1, num2)
str2 = str(result)
if re.match(str2, 'None'):
print("Output will not display")
else:
print("Reshape given matrix into 8*8 or given format: \n", result)
""" x[1::2, ::2] = 1 : Slice from 1st index row till 1+2+2… (repeated for 2nd iteration)and
fill all columns with 1 starting from 0th to 0+2+2… and so on.
x[::2, 1::2] = 1 : Slice from 0th row till 0+2+2… and
fill all columns with 1 starting from 1 to 1+2+2+….. """
result[::2, 1::2] = 1
result[1::2, ::2] = 1
print("Checkerboard pattern:\n", result)
class NumpyClass1:
# class constructor
def __init__(self):
# utility class objected created here
self.obj1 = UtilClass()
def calling(self):
print("\nPut values for null vector from 0 to 10")
input1 = input("\nEnter the matrix start value:")
input2 = input("Enter the matrix end value:")
array_created = self.obj1.matrix_creation(input1, input2)
str1 = str(array_created)
if re.match(str1, 'None'):
print("Output will not display")
else:
# print("\nNew Matrix:\n", array_created)
# create null vector
result = self.obj1.null_vector_creation(array_created)
print("\nOriginal null vector array :", result)
# update null vector sixth value to 11
print("Update array: ", self.obj1.update_matrix(result))
class ThreeDArray:
# class constructor
def __init__(self):
# utility class objected created here
self.obj1 = UtilClass()
# call this class functions from utility # 19 to 21
def calling(self):
while True:
try:
print()
print(
"1. Create an array as per requirement"
"\n"
"2. Concatenate 2-dimensional arrays"
"\n"
"3. Make an array immutable (read-only)"
"\n"
"4. Create an array of (3, 4) shape, multiply every element value by 3"
"\n"
"5. Convert a NumPy array into Python list structure "
"\n"
"6. Add an extra column to an numpy array"
"\n"
"7. Remove specific elements in a numpy array"
"\n"
"8. Exit")
ch = input("Enter choice:")
choice = int(ch)
if ch.isdigit():
if choice == 1:
"""19. Write a Python program to create an array which looks like below array. """
array = np.tri(4, 3, -1)
print("Final array: \n", array)
print(
"_______________________________________________________________________________"
)
elif choice == 2:
# 20
data1 = np.array([[0, 1, 3], [5, 7, 9]])
data2 = np.array([[0, 2, 4], [6, 8, 10]])
print("original arrays:\n", data1, "\n", data2)
print("Concreate array:",
self.obj1.concreate_data(data1, data2))
print(
"_______________________________________________________________________________"
)
elif choice == 3:
# 21
print("\nPut values from 0 to 10")
input1 = input("\nEnter the start value of array:")
input2 = input("Enter the end value:")
array_created = self.obj1.matrix_creation(
input1, input2)
str1 = str(array_created)
if re.match(str1, 'None'):
print("Output will not display")
else:
# print("\nNew Matrix:\n", array_created)
# create null vector
result = self.obj1.null_vector_creation(
array_created)
print("\nOriginal null vector array :", result)
# print("try to change value for null")
a = np.zeros((3, 3))
# here we set writable = false , so we can only read our data
result.flags.writeable = False
result[0] = 1
print(result)
print(
"_______________________________________________________________________________"
)
elif choice == 4:
# 22
print("\nPut values from 1 to 12 ")
input1 = input("\nEnter the matrix start value:")
input2 = input("Enter the matrix end value:")
array_created = self.obj1.matrix_creation(
input1, input2)
str1 = str(array_created)
# check output correct or not
if re.match(str1, 'None'):
print("Output will not display")
else:
# print("\nNew Matrix:\n", array_created)
print("\n 3 *4 Dimension matrix")
num1 = input("Enter the 1st dimension:")
num2 = input("Enter the 2nd dimension:")
result = self.obj1.reshape_matrix(
array_created, num1, num2)
str2 = str(result)
if re.match(str2, 'None'):
print("Output will not display")
else:
print(
"Reshape given matrix into given dimension format: \n",
result)
# multiply each element in array by 3
num = 3
print(
"Array multiply every element value by 3: \n",
self.obj1.matrix_scalar_multi(result, num))
print(
"_______________________________________________________________________________"
)
elif choice == 5:
# 23
original_array = np.array([[0, 1], [2, 3], [4, 5]])
print("\nOriginal array: \n", original_array)
print("Array to list conversion:",
original_array.tolist())
# 24
original_array1 = np.array([
0.26153123, 0.52760141, 0.5718299, 0.5927067,
0.7831874, 0.69746349, 0.35399976, 0.99469633,
0.0694458, 0.54711478
])
print("\nOriginal array: \n", original_array1)
np.set_printoptions(precision=3)
print("\nArray to list conversion with precision 3:",
original_array1)
# 25
original_array2 = np.array([1.6e-10, 1.6, 1200, .235])
print("\nOriginal array: ", original_array2)
# np.set_printoptions(suppress=True)
np.set_printoptions(suppress=True)
print("Final array:", original_array2)
elif choice == 6:
# 26
inputarr = np.array([[10, 20, 30], [40, 50, 60]])
addarray = np.array([[100], [200]])
# np.append() add new coloumn to original array with axis = 1 for 2D array
print(np.append(inputarr, addarray, axis=1))
elif choice == 7:
# 27
array_input = np.array(
[10, 20, 30, 40, 50, 60, 70, 80, 90, 100])
index = (0, 3, 4)
print(np.delete(array_input, index))
elif choice == 8:
exit()
print(
"_______________________________________________________________________________"
)
else:
print("Plz enter valid choice: ")
acc = str(input("IF you want to continue: type yes "))
if re.match(acc, 'y'):
continue
elif re.match(acc, 'yes'):
continue
elif re.match(acc, 'n'):
break
elif re.match(acc, 'no'):
break
else:
print("Give proper input")
continue
else:
raise ValueError
except ValueError as e:
print("\nInvalid Input", e)