def map_along_line(x, y, q, ax=None, cmap=None, norm=None, time=None, max_step=1., missing=np.nan, new_timebase=None, **kwargs): """Map some quantity q along x,y as a coloured line. With time set, perform linear interpolation of x,y,q onto new_timebase filling with missing, and with max_step.""" if ax is None: ax = plt.gca() if x.shape != y.shape: raise ValueError('Shape mismatch') if x.shape != q.shape: raise ValueError('Shape mismatch') if time is not None: if new_timebase is None: new_timebase = np.arange(time[0], time[-1], np.min(np.diff(time))) # Bit redundant x = interp_safe(new_timebase, time, x, max_step=max_step, missing=missing) y = interp_safe(new_timebase, time, y, max_step=max_step, missing=missing) q = interp_safe(new_timebase, time, q, max_step=max_step, missing=missing) points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=cmap, norm=norm, **kwargs) lc.set_array(q) plt.gca().add_collection(lc) return lc
def hello(): rtimes, rt, rp = np.loadtxt("data/data.txt").T rtimes = map(datetime.datetime.fromtimestamp, rtimes) rtimes = matplotlib.dates.date2num(rtimes) fig = Figure() axis = fig.add_subplot(1, 1, 1) axis.xaxis_date() fig.autofmt_xdate() forecast_list = [] for fname in glob.glob("data/forecast.*.txt"): stamp = fname.split(".")[1] times, tempa = np.loadtxt(fname).T times = map(datetime.datetime.fromtimestamp, times) times = matplotlib.dates.date2num(times) points = np.array([times, tempa]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=plt.get_cmap("jet"), norm=plt.Normalize(0, 1)) lc.set_array(np.linspace(0,1,len(times))) lc.set_linewidth(1) axis.add_collection(lc) axis.plot_date(times, tempa, "-", linewidth=0) axis.plot_date(rtimes, rt, "-",linewidth=1, color="black") canvas = FigureCanvas(fig) output = StringIO.StringIO() canvas.print_png(output) response = make_response(output.getvalue()) response.mimetype = 'image/png' return response
def plot_Kiel_diagram(starl): """ Plot Kiel diagram. """ x = starl['temperature'] y = starl['g'] age = starl['age']/1e6 points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) cmap = pl.cm.spectral norm = pl.Normalize(age.min(), age.max()) lc = LineCollection(segments, cmap=cmap,norm=norm) lc.set_array(age) lc.set_linewidth(3) pl.gca().add_collection(lc) pl.xlim(x.max(), x.min()) pl.ylim(y.max(), y.min()) pl.xlabel('Effective temperature [K]') pl.ylabel('log(surface gravity [cm s$^{-2}$]) [dex]') ax0 = pl.gca() ax1 = pl.mpl.colorbar.make_axes(ax0)[0] norm = pl.mpl.colors.Normalize(age.min(), age.max()) cb1 = pl.mpl.colorbar.ColorbarBase(ax1, cmap=cmap, norm=norm,orientation='vertical') cb1.set_label('Age [Myr]') pl.axes(ax0)
def d3(): rtimes, rt, rp = np.loadtxt("data/data.txt").T mask = np.logical_and(rtimes>1391000000, rtimes<1393000000) rtimes = rtimes[mask] rt = rt[mask] rtimes = map(datetime.datetime.fromtimestamp, rtimes) rtimes = matplotlib.dates.date2num(rtimes) fig, axis = plt.subplots() axis.xaxis_date() fig.autofmt_xdate() axis.plot_date(rtimes, rt, "-",linewidth=3, color="black") forecast_list = [] for fname in glob.glob("data/forecast.1391*.txt"): stamp = fname.split(".")[1] times, tempa = np.loadtxt(fname).T times = map(datetime.datetime.fromtimestamp, times) times = matplotlib.dates.date2num(times) points = np.array([times, tempa]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=plt.get_cmap("jet"), norm=plt.Normalize(0, 1)) lc.set_array(np.linspace(0,1,len(times))) lc.set_linewidth(1) axis.add_collection(lc) axis.plot_date(times, tempa, "-", linewidth=2) return fig_to_html(fig)
def colorbar_legend(ax, values, cmap, vis=True): """ Add a vertical colorbar legend to a plot """ x_range = ax.get_xlim()[1]-ax.get_xlim()[0] y_range = ax.get_ylim()[1]-ax.get_ylim()[0] x = [ax.get_xlim()[0]+x_range*0.05] y = [ax.get_ylim()[1]-(y_range * 0.25), ax.get_ylim()[1]-(y_range*0.05)] segs = [] vals=[] p = (x[0], y[0]+((y[1]-y[0])/256.0)) for i in range(2, 257): n = (x[0], y[0]+((y[1]-y[0])/256.0)*i) segs.append((p, n)) p = segs[-1][-1] vals.append(min(values)+((max(values)-min(values))/256.0)*(i-1)) lcbar = LineCollection(segs, cmap=cmap, lw=15) lcbar.set_visible(vis) lcbar.set_array(np.array(vals)) ax.add_collection(lcbar) lcbar.set_zorder(1) minlab = str(min(values))[:6] maxlab = str(max(values))[:6] ax.text(x[0]+x_range*.02, y[0], minlab, verticalalignment="bottom", visible=vis) ax.text(x[0]+x_range*.02, y[1], maxlab, verticalalignment="top", visible=vis)
def plot_grid(x, y, colormap=None, plaincolor=None, varname=None, var=None, minvar=None, maxvar=None): # colormap and plaincolor are optional - set defaults if colormap == None: colormap = 'jet' if plaincolor == None: plaincolor = 'black' # Last four parameters optional: if not supplied, plain grid is plotted if varname == None: print 'Plotting plain grid ...\n' colorplot = False else: print 'Plotting grid colored by ' + varname + ' ...\n' colorplot = True # Determine grid dimensions imax = x.shape[0] jmax = x.shape[1] # Initialize plot fig = plt.figure() ax = fig.add_subplot(111) # See http://wiki.scipy.org/Cookbook/Matplotlib/MulticoloredLine # LineCollection type allows color to vary along the line according # to a parameter. for j in range(0, jmax): segments = line_to_segments(x[:,j], y[:,j]) if colorplot: lc = LineCollection(segments, cmap=plt.get_cmap(colormap), norm=plt.Normalize(minvar, maxvar)) lc.set_array(var[:,j]) else: lc = LineCollection(segments, colors=plaincolor) ax.add_collection(lc) for i in range(0, imax): segments = line_to_segments(x[i,:], y[i,:]) if colorplot: lc = LineCollection(segments, cmap=plt.get_cmap(colormap), norm=plt.Normalize(minvar, maxvar)) lc.set_array(var[i,:]) else: lc = LineCollection(segments, colors=plaincolor) ax.add_collection(lc) # Create colorbar and title if colorplot: faux_colorbar(minvar, maxvar, varname, colormap) title = 'Grid geometry colored by ' + varname else: title = 'Grid geometry' # Show plot plt.title(title) plt.xlabel('x') plt.ylabel('y') plt.axis('equal') plt.show(block=False)
def plot_multi_line(x, y, z, bins, colors, ax): """ Plot a multi-color line. See: http://matplotlib.sourceforge.net/examples/ pylab_examples/multicolored_line.html """ from matplotlib.collections import LineCollection from matplotlib.colors import ListedColormap, BoundaryNorm # Allow specifying bin centers, not edges if len(bins) == len(colors): bins = np.array(bins, dtype=np.float) bins = np.concatenate([[z.min() - 1], (bins[1:] + bins[:-1]) / 2.0, [z.max() + 1]]) cmap = ListedColormap(colors) norm = BoundaryNorm(bins, cmap.N) points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=cmap, norm=norm) lc.set_array(z) lc.set_linewidth(3) ax.add_collection(lc)
def get_figures(self): from matplotlib.collections import LineCollection figs = [] ys = [(1.0/self.PROCS_PER_WINDOW.value)*(i+1) for i in range(self.PROCS_PER_WINDOW.value)] all_xs = [] for rad1, procs in self.rad1_to_procs.iteritems(): windows = get_procedure_windows(procs, self.PROCS_PER_WINDOW.value, self.STEP_SIZE.value) all_xs = [] for window in windows: all_xs.append([p.fluoro for p in window]) #the matplotlib part fig = plt.figure() ax = plt.gca() ax.set_xlim(0,10) ax.set_ylim(0,1) line_segments= LineCollection([zip(xs,ys) for xs in all_xs]) line_segments.set_array(np.array(range(len(all_xs)))) ax.add_collection(line_segments) plt.title(rad1) plt.xlabel("Fluoro Time") plt.ylabel("Fraction of Procedures Below Fluoro Time") colorbar = fig.colorbar(line_segments, ticks = range(len(windows)))#ticks = ? colorbar.set_ticklabels([str(window[0].dos_start) for window in windows]) colorbar.set_label("Window Start Date") figs.append(fig) return figs
def _draw_segments(ax, x, y, state, cmap, norm, lc_kwargs): """ helper function to turn boundary edges into the input LineCollection expects. Parameters ---------- ax : Axes The axes to draw to x, y, state : array The x edges, the y values and the state of each region cmap : matplotlib.colors.Colormap The color map to use norm : matplotlib.ticker.Norm The norm to use with the color map lc_kwargs : dict kwargs to pass through to LineCollection """ points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=cmap, norm=norm, **lc_kwargs) lc.set_array(state) ax.add_collection(lc) return lc
def draw_edges(tree, steiner_pos, diams=None, fig=None, ax=None, lim=None, colorbar=True): '''Draw edges with given positions.''' if fig is None: fig, ax = new_fig() if lim is None: lim = diam_min, diam_max pos = merge_pos(tree, steiner_pos) nodes = tree.get_nodes() arcs = tree.get_arcs() x = np.array([pos[n][0] for n in nodes]) y = np.array([pos[n][1] for n in nodes]) segments = [(pos[u], pos[v]) for (u,v) in arcs] if diams is None: lines = LineCollection(segments, colors='k', zorder=1) else: diams = np.array([diams[a] for a in arcs]) lw = 7*diams + 1 lines = LineCollection(segments, linewidths=lw, zorder=1) # set colors lines.set_array(diams) lines.set_cmap(_diam_cmap) lines.set_clim(*lim) if colorbar: plt.colorbar(lines, orientation='horizontal') ax.add_collection(lines)
class Visualize: def __init__(self, v, t, e, fig, win, axesLimit=[-3,3.5,-2,2]): self.e = e.copy() self.p = [Polygon(v[ti]) for ti in t] self.p = PatchCollection(self.p, edgecolors='none') self.l = LineCollection(v[e[:,:2]]) win = win or fig.canvas.manager.window if fig is None: fig = gcf() fig.clf() ax = fig.add_axes([0.02,0.02,.98,.98]) ax.axis('scaled') ax.axis(axesLimit) ax.set_autoscale_on(False) self.axis, self.fig, self.win = ax, fig, win ax.add_collection(self.p) ax.add_collection(self.l) # ax.add_collection(self.l1) # ax.add_collection(self.l2) def update(self, title, phi): norm = Normalize(phi.min(), phi.max()) self.p.set_norm(norm) self.l.set_norm(norm) self.p.set_array(phi) self.l.set_array(phi[self.e[:,2:]].mean(1)) if not self.__dict__.has_key('colorbar'): self.colorbar = self.fig.colorbar(self.p) self.win.set_title(title) #self.fig.canvas.set_window_title(title) self.fig.canvas.draw()
def __plot_all(self): total = len(self.data) count = 0.0 for timeStamp in self.data: if len(self.data[timeStamp]) < 2: self.parent.threadPlot = None return None, None if self.fade: alpha = (total - count) / total else: alpha = 1 data = self.data[timeStamp].items() peakF, peakL = self.extent.get_peak_fl() segments, levels = self.__create_segments(data) lc = LineCollection(segments) lc.set_array(numpy.array(levels)) lc.set_norm(self.__get_norm(self.autoL, self.extent)) lc.set_cmap(self.colourMap) lc.set_linewidth(self.lineWidth) lc.set_gid('plot') lc.set_alpha(alpha) self.axes.add_collection(lc) count += 1 return peakF, peakL
def __plot_all(self, spectrum): total = len(spectrum) count = 0.0 for timeStamp in spectrum: if self.settings.fadeScans: alpha = (total - count) / total else: alpha = 1 data = spectrum[timeStamp].items() peakF, peakL = self.extent.get_peak_fl() segments, levels = self.__create_segments(data) if segments is not None: lc = LineCollection(segments) lc.set_array(numpy.array(levels)) lc.set_norm(self.__get_norm(self.settings.autoL, self.extent)) lc.set_cmap(self.colourMap) lc.set_linewidth(self.lineWidth) lc.set_gid('plot') lc.set_alpha(alpha) self.axes.add_collection(lc) count += 1 return peakF, peakL
def colorline(ax, x,y,z,linewidth=1, colormap='jet', norm=None, zorder=1, alpha=1, linestyle='solid'): cmap = plt.get_cmap(colormap) if type(linewidth) is list or type(linewidth) is np.array or type(linewidth) is np.ndarray: linewidths = linewidth else: linewidths = np.ones_like(z)*linewidth if norm is None: norm = plt.Normalize(np.min(z), np.max(z)) else: norm = plt.Normalize(norm[0], norm[1]) ''' if self.hide_colorbar is False: if self.cb is None: self.cb = matplotlib.colorbar.ColorbarBase(self.ax1, cmap=cmap, norm=norm, orientation='vertical', boundaries=None) ''' # Create a set of line segments so that we can color them individually # This creates the points as a N x 1 x 2 array so that we can stack points # together easily to get the segments. The segments array for line collection # needs to be numlines x points per line x 2 (x and y) points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) # Create the line collection object, setting the colormapping parameters. # Have to set the actual values used for colormapping separately. lc = LineCollection(segments, linewidths=linewidths, cmap=cmap, norm=norm, zorder=zorder, alpha=alpha, linestyles=linestyle ) lc.set_array(z) lc.set_linewidth(linewidth) ax.add_collection(lc)
def update_line(num, print_loss, data, axes, epochsInds, test_error, test_data, epochs_bins, loss_train_data, loss_test_data, colors, font_size = 18, axis_font=16, x_lim = [0,12.2], y_lim=[0, 1.08], x_ticks = [], y_ticks = []): """Update the figure of the infomration plane for the movie""" #Print the line between the points cmap = ListedColormap(LAYERS_COLORS) segs = [] for i in range(0, data.shape[1]): x = data[0, i, num, :] y = data[1, i, num, :] points = np.array([x, y]).T.reshape(-1, 1, 2) segs.append(np.concatenate([points[:-1], points[1:]], axis=1)) segs = np.array(segs).reshape(-1, 2, 2) axes[0].clear() if len(axes)>1: axes[1].clear() lc = LineCollection(segs, cmap=cmap, linestyles='solid',linewidths = 0.3, alpha = 0.6) lc.set_array(np.arange(0,5)) #Print the points for layer_num in range(data.shape[3]): axes[0].scatter(data[0, :, num, layer_num], data[1, :, num, layer_num], color = colors[layer_num], s = 35,edgecolors = 'black',alpha = 0.85) axes[1].plot(epochsInds[:num], 1 - np.mean(test_error[:, :num], axis=0), color ='r') title_str = 'Information Plane - Epoch number - ' + str(epochsInds[num]) utils.adjustAxes(axes[0], axis_font, title_str, x_ticks, y_ticks, x_lim, y_lim, set_xlabel=True, set_ylabel=True, x_label='$I(X;T)$', y_label='$I(T;Y)$') title_str = 'Precision as function of the epochs' utils.adjustAxes(axes[1], axis_font, title_str, x_ticks, y_ticks, x_lim, y_lim, set_xlabel=True, set_ylabel=True, x_label='# Epochs', y_label='Precision')
def plot_file_color(base, thin=True, start=0, size=14, save=False): conf, track, pegs = load(base) fig = pl.figure(figsize=(size,size*conf['top']/conf['wall'])) track = track[start:] x = track[:,0]; y = track[:,1] t = np.linspace(0,1,x.shape[0]) points = np.array([x,y]).transpose().reshape(-1,1,2) segs = np.concatenate([points[:-1],points[1:]],axis=1) lc = LineCollection(segs, linewidths=0.25, cmap=pl.cm.coolwarm) lc.set_array(t) pl.gca().add_collection(lc) #pl.scatter(x, y, c=np.arange(len(x)),linestyle='-',cmap=pl.cm.coolwarm) #pl.plot(track[-1000000:,0], track[-1000000:,1], '-', linewidth=0.0125, alpha=0.8) for peg in pegs: pl.gca().add_artist(pl.Circle(peg, conf['radius'], color='k', alpha=0.3)) pl.xlim(0, conf['wall']) pl.ylim(0, conf['top']) pl.xticks([]) pl.yticks([]) pl.tight_layout() pl.show() if save: pl.savefig(base+".png", dpi=200)
def main(self): x_field = self.fields_by_key('x')[0] y_field = self.fields_by_key('y')[0] x = np.array(self.slice_data(x_field,int)) y = np.array(self.slice_data(y_field,int)) n = len(x) render = StringIO.StringIO() ############################################################################### # Fit IsotonicRegression and LinearRegression models ir = IsotonicRegression() y_ = ir.fit_transform(x, y) lr = LinearRegression() lr.fit(x[:, np.newaxis], y) # x needs to be 2d for LinearRegression ############################################################################### # plot result segments = [[[i, y[i]], [i, y_[i]]] for i in range(n)] lc = LineCollection(segments, zorder=0) lc.set_array(np.ones(len(y))) lc.set_linewidths(0.5 * np.ones(n)) fig = plt.figure() plt.plot(x, y, 'r.', markersize=12) plt.plot(x, y_, 'g.-', markersize=12) plt.plot(x, lr.predict(x[:, np.newaxis]), 'b-') plt.gca().add_collection(lc) plt.legend(('Data', 'Isotonic Fit', 'Linear Fit'), loc='lower right') plt.title('Isotonic regression') plt.savefig(render,format='png') return render
def gradient(figure_object, axis_object, xs, ys, start_year, TWP_length, cmap, key_count): """Based on http://matplotlib.org/examples/pylab_examples/multicolored_line.html and http://stackoverflow.com/questions/19132402/set-a-colormap-under-a-graph """ from matplotlib.collections import LineCollection # plot a color_map line fading to white points = np.array([xs, ys]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=plt.get_cmap('gray'), norm=plt.Normalize(start_year, start_year+TWP_length), linewidth=0.2, zorder=1) # norm sets the color min:max range lc.set_array(np.array(xs)) axis_object.add_collection(lc) # add fading color_map fill as well xs.append(max(xs)) xs.append(min(xs)) ys.append(0) ys.append(0) poly, = axis_object.fill(xs, ys, facecolor='none', edgecolor='none') img_data = np.arange(0, 100, 1) img_data = img_data.reshape(1, img_data.size) im = axis_object.imshow(img_data, aspect='auto', origin='lower', cmap=plt.get_cmap(cmap), extent=[start_year+TWP_length, start_year, 1000, -1000], vmin=0., vmax=100., zorder=-(start_year+1)*key_count) im.set_clip_path(poly)
def plot_colored_line(x,y, color, cmap = 'spectral_r', line_width = 2): """Plot a line with color code""" segments = np.array([x, y]).T.reshape(-1, 1, 2); segments = np.concatenate([segments[:-1], segments[1:]], axis=1); lc = LineCollection(segments, cmap=cmap); lc.set_array(np.array(color)); #lc.set_linewidth(line_width); plt.gca().add_collection(lc)
def fading_line(x, y, color='black', alpha_initial=1., alpha_final=0., glow=False, **kwargs): """ Returns a matplotlib LineCollection connecting the points in the x and y lists, with a single color and alpha varying from alpha_initial to alpha_final along the line. Can pass any kwargs you can pass to LineCollection, like linewidgth. Parameters ---------- x : list or array of floats for the positions on the (plot's) x axis y : list or array of floats for the positions on the (plot's) y axis color : matplotlib color for the line. Can also pass a 3-tuple of RGB values (default: 'black') alpha_initial: Limiting value of alpha to use at the beginning of the arrays. alpha_final: Limiting value of alpha to use at the end of the arrays. """ try: from matplotlib.collections import LineCollection from matplotlib.colors import LinearSegmentedColormap import numpy as np except: raise ImportError("Error importing matplotlib and/or numpy. Plotting functions not available. If running from within a jupyter notebook, try calling '%matplotlib inline' beforehand.") if glow: glow = False kwargs["lw"] = 1 fl1 = fading_line(x, y, color, alpha_initial, alpha_final, glow=False, **kwargs) kwargs["lw"] = 2 alpha_initial *= 0.5 alpha_final *= 0.5 fl2 = fading_line(x, y, color, alpha_initial, alpha_final, glow=False, **kwargs) kwargs["lw"] = 6 alpha_initial *= 0.5 alpha_final *= 0.5 fl3 = fading_line(x, y, color, alpha_initial, alpha_final, glow=False, **kwargs) return [fl3,fl2,fl1] color = get_color(color) cdict = {'red': ((0.,color[0],color[0]),(1.,color[0],color[0])), 'green': ((0.,color[1],color[1]),(1.,color[1],color[1])), 'blue': ((0.,color[2],color[2]),(1.,color[2],color[2])), 'alpha': ((0.,alpha_initial, alpha_initial), (1., alpha_final, alpha_final))} Npts = len(x) if len(y) != Npts: raise AttributeError("x and y must have same dimension.") segments = np.zeros((Npts-1,2,2)) segments[0][0] = [x[0], y[0]] for i in range(1,Npts-1): pt = [x[i], y[i]] segments[i-1][1] = pt segments[i][0] = pt segments[-1][1] = [x[-1], y[-1]] individual_cm = LinearSegmentedColormap('indv1', cdict) lc = LineCollection(segments, cmap=individual_cm, **kwargs) lc.set_array(np.linspace(0.,1.,len(segments))) return lc
def _plotpartial(ax, partial, downsample=1, cmap='inferno', exp=1, linewidth=1, avg=True): # columns: time, freq, amp, phase, bw segments, Z = _segmentsZ(partial, downsample=downsample, exp=exp, avg=avg) lc = LineCollection(segments, cmap=cmap) # Set the values used for colormapping lc.set_array(Z) lc.set_linewidth(linewidth) lc.set_alpha(None) ax.add_collection(lc, autolim=True)
def faux_colorbar(minvar, maxvar, varname, colormap): colorx = np.linspace(0.0, 1.0, 10) colory = np.linspace(minvar, maxvar, 10) segments = line_to_segments(colorx, colory) colors = LineCollection(segments, cmap=plt.get_cmap(colormap), norm=plt.Normalize(minvar, maxvar)) colors.set_array(colory) cbar=plt.colorbar(colors) cbar.set_label(varname, rotation=270)
def show_q(): # show all the valid/used transitions coords = np.array([[2, 2], [4, 2], [5, 3], [4, 4], [2, 4], [5, 2]]) # invert y axis for display coords[:, 1] = max(coords[:, 1]) - coords[:, 1] plt.figure(1, facecolor='w', figsize=(10, 8)) plt.clf() ax = plt.axes([0., 0., 1., 1.]) plt.axis('off') plt.scatter(coords[:, 0], coords[:, 1], c='r') start_idx, end_idx = np.where(q > 0) segments = [[coords[start], coords[stop]] for start, stop in zip(start_idx, end_idx)] values = np.array(q[q > 0]) # bump up values for viz values = values lc = LineCollection(segments, zorder=0, cmap=plt.cm.hot_r) lc.set_array(values) ax.add_collection(lc) verticalalignment = 'top' horizontalalignment = 'left' for i in range(len(coords)): x = coords[i][0] y = coords[i][1] name = str(i) if i == 1: y = y - .05 x = x + .05 elif i == 3: y = y - .05 x = x + .05 elif i == 4: y = y - .05 x = x + .05 else: y = y + .05 x = x + .05 plt.text(x, y, name, size=10, horizontalalignment=horizontalalignment, verticalalignment=verticalalignment, bbox=dict(facecolor='w', edgecolor=plt.cm.spectral(float(len(coords))), alpha=.6)) plt.show()
def plotElevationMap(trk, smoothed=True): from cmap_parula import cmap_parula import datetime from matplotlib.collections import LineCollection from matplotlib.colors import ListedColormap import matplotlib.image as mpimg x = np.array([t['lon'] for t in trk]) y = np.array([t['lat'] for t in trk]) z = np.array([t['ele'] for t in trk]) f = butter_lowpass_filtfilt(z, 5000, 50000) pts = np.array([x, y]).T.reshape(-1,1,2) segments = np.hstack([pts[:-1], pts[1:]]) cmap = cmap_parula().parula coll = LineCollection(segments, cmap=cmap, linewidth=2) coll.set_array(f) # Get extents based on the track. xmin = min(x); xmax = max(x) ymin = min(y); ymax = max(y) xdel = xmax - xmin ydel = ymax - ymin xmin = xmin - 0.05 * xdel; xmax = xmax + 0.05 * xdel ymin = ymin - 0.05 * ydel; ymax = ymax + 0.05 * ydel # Get new extents based on OSM's tiling, to ensure alignment. xmin, xmax, ymin, ymax, mapname, ar = getOSM(xmin, xmax, ymin, ymax) fig, ax = plt.subplots() ax = plt.gca() ax.set_aspect(ar) img = mpimg.imread(mapname) implt = plt.imshow(img, zorder=0, extent=[xmin, xmax, ymin, ymax], aspect=ar, alpha=0.4) cs = ax.add_collection(coll) add_colorbar(cs, ax=ax, label='Elevation [feet]') # Final reset of the extents to focus on the track despite OSM's tiling. xmin = min(x); xmax = max(x) ymin = min(y); ymax = max(y) xdel = xmax - xmin ydel = ymax - ymin xmin = xmin - 0.05 * xdel; xmax = xmax + 0.05 * xdel ymin = ymin - 0.05 * ydel; ymax = ymax + 0.05 * ydel plt.xlim([xmin, xmax]) plt.ylim([ymin, ymax]) ax.set_xticks([]) ax.set_yticks([]) return(plt)
def plot_MDS(): """Plots the difference matrix with Multi-Dimensional Scaling""" diff_matrix = fast_generate_diff_matrix() X_true = diff_matrix similarities = euclidean_distances(diff_matrix) seed = 1 mds = manifold.MDS(n_components=1, max_iter=3000, eps=1e-9, random_state=seed, dissimilarity="precomputed", n_jobs=1) pos = mds.fit(similarities).embedding_ # nmds = manifold.MDS(n_components=2, metric=False, max_iter=3000, eps=1e-12, # dissimilarity="precomputed", random_state=2, n_jobs=1, # n_init=1) # npos = nmds.fit_transform(similarities, init=pos) # Rescale the data pos *= np.sqrt((X_true ** 2).sum()) / np.sqrt((pos ** 2).sum()) # npos *= np.sqrt((X_true ** 2).sum()) / np.sqrt((npos ** 2).sum()) # Rotate the data clf = PCA(n_components=2) X_true = clf.fit_transform(X_true) pos = clf.fit_transform(pos) # # npos = clf.fit_transform(npos) fig = plt.figure(1) ax = plt.axes([0., 0., 1., 1.]) plt.scatter(X_true[:, 0], X_true[:, 1], c='r', s=20) # plt.scatter(pos[:, 0], pos[:, 1], s=20, c='g') # plt.scatter(npos[:, 0], npos[:, 1], s=20, c='b') plt.legend(('True position'), loc='best') similarities = similarities.max() / similarities * 100 similarities[np.isinf(similarities)] = 0 # Plot the edges start_idx, end_idx = np.where(pos) #a sequence of (*line0*, *line1*, *line2*), where:: # linen = (x0, y0), (x1, y1), ... (xm, ym) segments = [[X_true[i, :], X_true[j, :]] for i in range(len(pos)) for j in range(len(pos))] values = np.abs(similarities) lc = LineCollection(segments, zorder=0, cmap=plt.cm.hot_r, norm=plt.Normalize(0, values.max())) lc.set_array(similarities.flatten()) lc.set_linewidths(0.5 * np.ones(len(segments))) ax.add_collection(lc) plt.show()
def nts_line_data(nts_data, keys=None, path=None, save=True, show=False, ext='.png'): """ Plot the non timeseries data in ``data`` with ``points`` as the x axis. To plot only a subset of this data list which ADCIRC Output types to plot in keys. .. note:: This only applies to 1D nts data (``irtype`` = 1) :type nts_data: :class:`dict` :param nts_data: ``nts_data`` from :class:`~polyadcirc.run_framework.random_manningsn.runSet` :param list() keys: list of types of ADCIRC output data to plot :type path: string or None :param path: directory to store plots :type save: boolean :param save: flag for whether or not to save plots :type show: boolean :param show: flag for whether or not to show plots :param string ext: file extension """ if path == None: path = os.getcwd() if keys == None: keys = nts_data.keys() s_keys = list() for k in keys: if not(f15.filetype[k][0]) and f15.filetype[k][1] == 1: s_keys.append(k) keys = s_keys fm.mkdir(path+'/figs/nts') for k in keys: fig = plt.figure() x = np.arange(nts_data[k].shape[0]) ax = fig.add_subplot(111) ax.set_xlim((np.min(x),np.max(x))) ax.set_ylim((np.min(nts_data[k]),np.max(nts_data[k]))) segs = list() for j in xrange(nts_data[k].shape[1]): segs.append(zip(x, nts_data[k][...,j])) line_segs = LineCollection(segs, linestyles = 'solid') line_segs.set_array(np.arange(nts_data[k].shape[1])) ax.add_collection(line_segs) colorbar(line_segs, fig) fig.title(k) fig.xlabel('node number') save_show(path+'/figs/nts/'+k, save, show, ext)
def visualize(reader, visualization_method, value_column, segment_column): labels, data = organize_data(reader, visualization_method, value_column, segment_column) if visualization_method == 'hc': link = linkage(data) dendrogram(link, leaf_label_func=lambda i: labels[i]) plt.gcf() plt.show() if visualization_method == 'mds': n = len(labels) data -= data.mean() clf = PCA(n_components=2) data = clf.fit_transform(data) similarities = euclidean_distances(data) # Add noise to the similarities noise = np.random.rand(n, n) noise = noise + noise.T noise[np.arange(noise.shape[0]), np.arange(noise.shape[0])] = 0 similarities += noise fig = plt.figure(1) ax = plt.axes([0., 0., 1., 1.]) similarities = similarities.max() / similarities * 100 similarities[np.isinf(similarities)] = 0 plt.scatter(data[:, 0], data[:, 1], c='r', s=20) plt.legend('Position', loc='best') start_idx, end_idx = np.where(data) segments = [[data[i, :], data[j, :]] for i in range(len(data)) for j in range(len(data))] values = np.abs(similarities) lc = LineCollection(segments, zorder=0, cmap=plt.cm.hot_r, norm=plt.Normalize(0, values.max())) lc.set_array(similarities.flatten()) lc.set_linewidths(0.5 * np.ones(len(segments))) ax.add_collection(lc) for label, x, y in zip(labels, data[:, 0], data[:, 1]): plt.annotate( label, xy = (x, y), xytext = (-20, 20), textcoords = 'offset points', ha = 'right', va = 'bottom', bbox = dict(boxstyle = 'round,pad=0.5', fc = 'yellow', alpha = 0.5), arrowprops = dict(arrowstyle = '->', connectionstyle = 'arc3,rad=0')) plt.show()
def plot_trajectory(trajectories, name='trajectory', pos='left'): print "Plotting trajectory: %s" % name plt.figure(1, figsize=(4, 4)) ax = plt.subplot(111) trajx = np.concatenate([t[0] for t in trajectories]) trajy = np.concatenate([t[1] for t in trajectories]) annote = set() for t in trajectories: for a in t[2]: annote.add(a) cmap = plt.get_cmap('Greys') t = np.arange(trajx.shape[0]) * 0.001 points = np.array([trajy, trajx]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=cmap, norm=plt.Normalize(-t[-1] * 0.5, t[-1] * 0.75)) lc.set_array(t) lc.set_linewidth(3) lc.set_rasterized(True) ax.add_collection(lc) for (a_t, l) in annote: ix = int(a_t / 0.001) - 1 xy = (trajy[ix], trajx[ix]) xytext = (-30 if xy[0] > 0 else 30, -30 if xy[1] > 0 else 30) if l == 'Start of next trial' and xy[1] > 0: l = 'Start of\nnext trial' xytext = (-50, 5) if l == 'Release\n(premature)': xytext = (-10, -35) plt.annotate(l, xy, xycoords='data', xytext=xytext, ha='center', va='center', textcoords='offset points', arrowprops={'arrowstyle': '->', 'connectionstyle': 'arc3, rad=0.2'}) plt.axhline(0.0, color='k', ls=":") plt.axvline(0.0, color='k', ls=":") if 'left' in pos: plt.ylabel("Task state (arbitrary units)") ax.get_yaxis().tick_left() else: plt.yticks(()) ax.get_xaxis().tick_bottom() plt.xlabel("Relative time in task state (arbitrary units)") plt.axis((-1.5, 1.5, -2.0, 1.5)) plt.subplots_adjust(bottom=0.12, top=0.97, left=0.17, right=0.97) save_or_show('plots/' + name + '_traj')
def plot_colored_line(ax, x, y, c=None, s=2, **kwargs): """ Draws a linegraph with the line color coded. """ points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, **kwargs) if c is not None: lc.set_array(c) lc.set_linewidth(s) ax.add_collection(lc) ax.set_xlim([x.min(), x.max()]) ax.set_ylim([y.min(), y.max()])
def plot_linestring_collection(ax, geoms, values=None, color=None, cmap=None, vmin=None, vmax=None, **kwargs): """ Plots a collection of LineString and MultiLineString geometries to `ax` Parameters ---------- ax : matplotlib.axes.Axes where shapes will be plotted geoms : a sequence of `N` LineStrings and/or MultiLineStrings (can be mixed) values : a sequence of `N` values, optional Values will be mapped to colors using vmin/vmax/cmap. They should have 1:1 correspondence with the geometries (not their components). color : single color or sequence of `N` colors Cannot be used together with `values`. Returns ------- collection : matplotlib.collections.Collection that was plotted """ from matplotlib.collections import LineCollection geoms, values = _flatten_multi_geoms(geoms, values) if None in values: values = None # LineCollection does not accept some kwargs. if 'markersize' in kwargs: del kwargs['markersize'] # color=None gives black instead of default color cycle if color is not None: kwargs['color'] = color segments = [np.array(linestring)[:, :2] for linestring in geoms] collection = LineCollection(segments, **kwargs) if values is not None: collection.set_array(np.asarray(values)) collection.set_cmap(cmap) collection.set_clim(vmin, vmax) ax.add_collection(collection, autolim=True) ax.autoscale_view() return collection
non_zero) # 只有条件non_zero,所以返回non_zero.nonzero(),即返回有两个元素的元组, # 第一个元素为非零的数在O轴即竖轴的下标,第二个元素为非零的数在1轴即横轴的下标 # a sequence of (*line0*, *line1*, *line2*), where::linen = (x0, y0), (x1, y1), ... (xm, ym) segments = [[embedding[:, start], embedding[:, stop]] for start, stop in zip(start_idx, end_idx)] #embedding为二维数组 values = np.abs(partial_correlations[non_zero]) # 用non_zero遮罩后的15个元素的数组 lc = LineCollection(segments, zorder=0, cmap=plt.cm.hot_r, norm=plt.Normalize( 0, .7 * values.max())) # zorder:调整层次,cmap:colormap lc.set_array(values) lc.set_linewidths(6 * values) ax.add_collection(lc) # Add a label to each node. The challenge here is that we want to # position the labels to avoid overlap with other labels for index, (name, label, (x, y)) in enumerate(zip(names, labels, embedding.T)): dx = x - embedding[0] dx[index] = 1 dy = y - embedding[1] dy[index] = 1 this_dx = dx[np.argmin(np.abs(dy))] this_dy = dy[np.argmin(np.abs(dx))] if this_dx > 0: horizontalalignment = 'left' x = x + .002
def show_rag(labels, rag, image, border_color='black', edge_width=1.5, edge_cmap='magma', img_cmap='bone', in_place=True, ax=None): """Show a Region Adjacency Graph on an image. Given a labelled image and its corresponding RAG, show the nodes and edges of the RAG on the image with the specified colors. Edges are displayed between the centroid of the 2 adjacent regions in the image. Parameters ---------- labels : ndarray, shape (M, N) The labelled image. rag : RAG The Region Adjacency Graph. image : ndarray, shape (M, N[, 3]) Input image. If `colormap` is `None`, the image should be in RGB format. border_color : color spec, optional Color with which the borders between regions are drawn. edge_width : float, optional The thickness with which the RAG edges are drawn. edge_cmap : :py:class:`matplotlib.colors.Colormap`, optional Any matplotlib colormap with which the edges are drawn. img_cmap : :py:class:`matplotlib.colors.Colormap`, optional Any matplotlib colormap with which the image is draw. If set to `None` the image is drawn as it is. in_place : bool, optional If set, the RAG is modified in place. For each node `n` the function will set a new attribute ``rag.node[n]['centroid']``. ax : :py:class:`matplotlib.axes.Axes`, optional The axes to draw on. If not specified, new axes are created and drawn on. Returns ------- lc : :py:class:`matplotlib.collections.LineCollection` A colection of lines that represent the edges of the graph. It can be passed to the :meth:`matplotlib.figure.Figure.colorbar` function. Examples -------- >>> from skimage import data, segmentation >>> from skimage.future import graph >>> import matplotlib.pyplot as plt >>> >>> img = data.coffee() >>> labels = segmentation.slic(img) >>> g = graph.rag_mean_color(img, labels) >>> lc = graph.show_rag(labels, g, img) >>> cbar = plt.colorbar(lc) """ from matplotlib import colors, cm from matplotlib import pyplot as plt from matplotlib.collections import LineCollection if not in_place: rag = rag.copy() if ax is None: fig, ax = plt.subplots() out = util.img_as_float(image, force_copy=True) if img_cmap is None: if image.ndim < 3 or image.shape[2] not in [3, 4]: msg = 'If colormap is `None`, an RGB or RGBA image should be given' raise ValueError(msg) # Ignore the alpha channel out = image[:, :, :3] else: img_cmap = cm.get_cmap(img_cmap) out = color.rgb2gray(image) # Ignore the alpha channel out = img_cmap(out)[:, :, :3] edge_cmap = cm.get_cmap(edge_cmap) # Handling the case where one node has multiple labels # offset is 1 so that regionprops does not ignore 0 offset = 1 map_array = np.arange(labels.max() + 1) for n, d in rag.nodes(data=True): for label in d['labels']: map_array[label] = offset offset += 1 rag_labels = map_array[labels] regions = measure.regionprops(rag_labels) for (n, data), region in zip(rag.nodes(data=True), regions): data['centroid'] = tuple(map(int, region['centroid'])) cc = colors.ColorConverter() if border_color is not None: border_color = cc.to_rgb(border_color) out = segmentation.mark_boundaries(out, rag_labels, color=border_color) ax.imshow(out) # Defining the end points of the edges # The tuple[::-1] syntax reverses a tuple as matplotlib uses (x,y) # convention while skimage uses (row, column) lines = [[rag.node[n1]['centroid'][::-1], rag.node[n2]['centroid'][::-1]] for (n1, n2) in rag.edges()] lc = LineCollection(lines, linewidths=edge_width, cmap=edge_cmap) edge_weights = [d['weight'] for x, y, d in rag.edges(data=True)] lc.set_array(np.array(edge_weights)) ax.add_collection(lc) return lc
ax = plt.axes([0., 0., 1., 1.]) similarities[np.isinf(similarities)] = 0 # similarities[similarities<1]=0 print np.max(similarities) # Plot the edges start_idx, end_idx = np.where(pos) # a sequence of (*line0*, *line1*, *line2*), where:: # linen = (x0, y0), (x1, y1), ... (xm, ym) segments = [[pca_data[i, :], pca_data[j, :]] for i in range(len(pos)) for j in range(len(pos))] values = np.abs(similarities) lc = LineCollection(segments, zorder=2, cmap=plt.cm.Greys, norm=plt.Normalize(0, values.max())) lc.set_array(similarities.flatten()) lc.set_linewidths(0.5 * np.ones(len(segments))) ax.add_collection(lc) s = 100 plt.scatter(pca_data[:, 0], pca_data[:, 1], color='red', s=s, lw=0, label='True Position') # plt.scatter(pos[:, 0], pos[:, 1], color='turquoise', s=s, lw=0, label='MDS') # plt.scatter(npos[:, 0], npos[:, 1], color='darkorange', s=s, lw=0, label='NMDS') plt.legend(scatterpoints=1, loc='best', shadow=False) plt.show()
def _h_path_curvature(skeletons, body_length=None, partition_str='body', path_step=DFLT_ARGS['path_step'], path_grad_window=DFLT_ARGS['path_grad_window'], _is_debug=False): if body_length is None: #caculate the length if it is not given body_length = np.nanmedian(get_length(skeletons)) #clip_val = clip_val_body_lengths/body_length p_obj = DataPartition(n_segments=skeletons.shape[1]) body_coords = p_obj.apply(skeletons, partition_str, func=np.mean) xx = body_coords[:, 0] yy = body_coords[:, 1] tt = np.arange(body_coords.shape[0]) #empty array return if body_coords.size == 0 or np.all(np.isnan(body_coords)): return np.full_like(tt, np.nan), body_coords #interpolate nan values good = ~np.isnan(xx) x_i = xx[good] y_i = yy[good] t_i = tt[good] t_i = np.hstack([-1, t_i, body_coords.shape[0]]) x_i = np.hstack([x_i[0], x_i, x_i[-1]]) y_i = np.hstack([y_i[0], y_i, y_i[-1]]) fx = interp1d(t_i, x_i) fy = interp1d(t_i, y_i) xx_i = fx(tt) yy_i = fy(tt) # calculate the cumulative length for each segment in the curve dx = np.diff(xx_i) dy = np.diff(yy_i) dr = np.sqrt(dx * dx + dy * dy) lengths = np.cumsum(dr) lengths = np.hstack((0, lengths)) fx = interp1d(lengths, xx_i) fy = interp1d(lengths, yy_i) ft = interp1d(lengths, tt) sub_lengths = np.arange(lengths[0], lengths[-1], path_step) #there is not enough data to calculate the curvature if len(sub_lengths) <= 4 * path_grad_window: return np.full(skeletons.shape[0], np.nan), body_coords xs = fx(sub_lengths) ys = fy(sub_lengths) ts = ft(sub_lengths) curve = np.vstack((xs, ys)).T curvature_r = curvature_grad(curve, points_window=path_grad_window, axis=0, is_nan_border=False) #clip values to remove regions with extremely large curvatures (typically short reversars) #curvature_r = np.clip(curvature_r, -clip_val,clip_val) ts_i = np.hstack((-1, ts, tt[-1] + 1)) c_i = np.hstack((curvature_r[0], curvature_r, curvature_r[-1])) curvature_t = interp1d(ts_i, c_i)(tt) if _is_debug: import matplotlib.pylab as plt from matplotlib.collections import LineCollection #path_curvature[np.isnan(worm_features['speed'])] = np.nan #path_curvature = np.clip(curvature_t, -0.02, 0.02) path_curvature = curvature_t curv_range = (np.nanmin(path_curvature), np.nanmax(path_curvature)) points = body_coords.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=plt.get_cmap('plasma'), norm=plt.Normalize(*curv_range)) lc.set_array(path_curvature) lc.set_linewidth(2) plt.figure(figsize=(20, 5)) plt.subplot(1, 2, 1) plt.gca().add_collection(lc) plt.xlim(3000, 11000) plt.ylim(3000, 11000) plt.axis('equal') plt.subplot(1, 2, 2) plt.plot(path_curvature) return curvature_t, body_coords
def colorplotMD(self, xvals, yvals, cvals, title="", xlabel="", ylabel="", label="", cmap="hsv", config=None, color="black", marker=None, zoom="box", nopaint=False, test_kda=False, integerticks=False, **kwargs): self._axes = [0.11, 0.1, 0.64, 0.8] self.clear_plot("nopaint") self.xlabel = xlabel self.ylabel = ylabel self.zoomtype = zoom if "nticks" in kwargs: nticks = kwargs["nticks"] del kwargs['nticks'] else: nticks = None if test_kda: self.kda_test(xvals) pubflag = 0 if config is not None: if config.publicationmode is not 0: pubflag = 1 self.subplot1 = self.figure.add_axes(self._axes) points = np.array([xvals, yvals]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) # print segments t = cvals # np.linspace(0, 1, len(xvals), endpoint=True) lc = LineCollection(segments, cmap=cmap) lc.set_array(t) lc.set_clim(0, 1) self.subplot1.add_collection(lc) if pubflag == 0: self.subplot1.set_ylabel(self.ylabel) self.subplot1.set_title(title) else: self.subplot1.spines['top'].set_visible(False) self.subplot1.spines['right'].set_visible(False) self.subplot1.get_xaxis().tick_bottom() self.subplot1.get_yaxis().tick_left() self.subplot1.get_yaxis().set_tick_params(direction='out') self.subplot1.get_xaxis().set_tick_params(direction='out') if config.peaknorm is not 2: self.subplot1.get_yaxis().set_ticks( [0, np.amax(yvals) / 2, np.amax(yvals)]) self.subplot1.get_yaxis().set_ticklabels(["0", '%', "100"]) else: self.subplot1.set_ylabel("Relative Intensity") if nticks is not None: self.subplot1.xaxis.set_major_locator(MaxNLocator(nbins=nticks)) if integerticks: self.subplot1.xaxis.set_major_locator(MaxNLocator(integer=True)) self.subplot1.set_xlabel(self.xlabel) cax = self.figure.add_axes([0.77, 0.1, 0.04, 0.8]) self.cbar = colorbar.ColorbarBase(cax, cmap=cmap, orientation="vertical", ticks=np.linspace(0., 1., 11, endpoint=True)) self.cbar.set_label("Normalized Mass Defect") self.setup_zoom([self.subplot1], self.zoomtype, data_lims=[ np.amin(xvals), np.amin(yvals), np.max(xvals), np.amax(yvals) ]) if not nopaint: self.repaint() self.flag = True self.mlist = [] self.x1, self.x2 = None, None self.colors = []
def add_phylorate(treeplot, rates, nodeidx, vis=True): """ Add phylorate plot generated from data analyzed with BAMM (http://bamm-project.org/introduction.html) Args: rates (array): Array of rates along branches created by r_funcs.phylorate nodeidx (array): Array of node indices matching rates (also created by r_funcs.phylorate) WARNING: Ladderizing the tree can cause incorrect assignment of Ape node index numbers. To prevent this, call this function or root.ape_node_idx() before ladderizing the tree to assign correct Ape node index numbers. """ if not treeplot.root.apeidx: treeplot.root.ape_node_idx() segments = [] values = [] if treeplot.plottype == "radial": radpatches = [] # For use in drawing arcs for radial plots for n in treeplot.root.descendants(): n.rates = rates[nodeidx==n.apeidx] c = treeplot.n2c[n] pc = treeplot._path_to_parent(n)[0][1] xd = c.x - pc[0] yd = c.y - pc[1] xseg = xd/len(n.rates) yseg = yd/len(n.rates) for i, rate in enumerate(n.rates): x0 = pc[0] + i*xseg y0 = pc[1] + i*yseg x1 = x0 + xseg y1 = y0 + yseg segments.append(((x0, y0), (x1, y1))) values.append(rate) curverts = treeplot._path_to_parent(n)[0][2:] curcodes = treeplot._path_to_parent(n)[1][2:] curcol = RdYlBu(n.rates[0]) radpatches.append(PathPatch( Path(curverts, curcodes), lw=2, edgecolor = curcol, fill=False)) else: for n in treeplot.root.descendants(): n.rates = rates[nodeidx==n.apeidx] c = treeplot.n2c[n] pc = treeplot.n2c[n.parent] seglen = (c.x-pc.x)/len(n.rates) for i, rate in enumerate(n.rates): x0 = pc.x + i*seglen x1 = x0 + seglen segments.append(((x0, c.y), (x1, c.y))) values.append(rate) segments.append(((pc.x, pc.y), (pc.x, c.y))) values.append(n.rates[0]) lc = LineCollection(segments, cmap=RdYlBu, lw=2) lc.set_array(np.array(values)) treeplot.add_collection(lc) lc.set_zorder(1) if treeplot.plottype == "radial": arccol = matplotlib.collections.PatchCollection(radpatches, match_original=True) treeplot.add_collection(arccol) arccol.set_visible(vis) arccol.set_zorder(1) lc.set_visible(vis) colorbar_legend(treeplot, values, RdYlBu, vis=vis) treeplot.figure.canvas.draw_idle()
def plot_tracks_2D_colorcode(trackDF, output_fig_path=None, colorcode='z', color_map='jet', color_bar=True, norm_min=None, norm_max=None, track_list=None, tracks_highlight=None, plot_xy_outlines=False, polyline_df_xy=None, z_range=15, x_ticks=None, y_ticks=None, draw_spot_start=False, draw_spot_end=False): assert colorcode in ['z', 'speed', 'time'] fig = plt.figure(figsize=(2, 2), dpi=300) ax = fig.add_axes([0.1, 0.1, 0.8, 0.8]) x_min, y_min = trackDF.x.min(), trackDF.y.min() # df = trackDF # alias if track_list is None: track_list = trackDF.track_id.unique() for i, track in enumerate(track_list): df_temp = trackDF[trackDF.track_id == track] df_temp.sort_values('t', ascending=True, inplace=True) df_temp.reset_index(inplace=True, drop=True) # Extract the x, y coordinates of the points x, y = df_temp.x.values - x_min, df_temp.y.values - y_min # Create a set of line segments so that we can color them individually # This creates the points as a N x 1 x 2 array so that we can stack points # together easily to get the segments. The segments array for line collection # needs to be (numlines) x (points per line) x 2 (for x and y) points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) if colorcode == 'z': color_code_values = df_temp.z.values[:-1] if norm_min is None: norm_min = 0 if norm_max is None: norm_max = 100 elif colorcode == 'speed': # Calculate the mean track speed (drop last point to match segment number) color_code_values = get_mean_speed_track(df_temp, n_rolling=12)[:-1] if norm_min is None: norm_min = 10 if norm_max is None: norm_max = 40 elif colorcode == 'time': # Calculte time from anaphase onset # Convert frames to minutes (5 min per frame) if 't_normed' in df_temp.columns: color_code_values = df_temp.t_normed.values[1:] else: n_pre = df_temp.pre_anaphase_onset_n_frames.values[0] frames = df_temp.t.values[1:] start_frame = df_temp.t.min() color_code_values = [ 5 * (i - n_pre - start_frame) for i in frames ] if norm_min is None: norm_min = 0 if norm_max is None: norm_max = 240 # make color code values into a numpy array color_code_values = np.array(color_code_values) # Create a continuous norm to map from data points to colors norm = plt.Normalize( norm_min, norm_max) # empirically determined speed normalization lc = LineCollection(segments, cmap=color_map, norm=norm) # Set the values used for colormapping lc.set_array(color_code_values) lc.set_linewidth(.6) line = ax.add_collection(lc) if draw_spot_start == True: ax.plot(x[0], y[0], 'ob', alpha=.4, markersize=2, markeredgewidth=0) if draw_spot_end == True: ax.plot(x[-1], y[-1], 'or', alpha=.4, markersize=2, markeredgewidth=0) if plot_xy_outlines: plot_2D_outlines_xy(polyline_df_xy, t=1, z_range=z_range, shift_x=x_min, shift_y=y_min, ax=ax, line_color='#1A6A82', line_alpha=.02, line_width=.6) plot_2D_outlines_xy(polyline_df_xy, t=192, z_range=z_range, shift_x=x_min, shift_y=y_min, ax=ax, line_color='#A05B22', line_alpha=.02, line_width=.6) # *** add color bar *** if color_bar: fig.colorbar(line, ax=ax) # *** add axis labels *** ax.set_xlabel('x') ax.set_ylabel('y') # *** set axis ticks if provided *** if x_ticks is not None: ax.set_xticks(x_ticks) if y_ticks is not None: ax.set_yticks(y_ticks) # *** Make the x and y axes equal in dimension to mimic image display *** ax.axis('equal') # *** Flip the y-axis to match the image coordinates *** plt.gca().invert_yaxis() for o in fig.findobj(): o.set_clip_on(False) for o in ax.findobj(): o.set_clip_on(False) if output_fig_path is not None: plt.savefig(output_fig_path) return ax
ax.plot([0, 1], [0, 1], color='lightgray') ax.axvline(0, lw=0.5, color='lightgray') ax.axhline(1, lw=0.5, color='lightgray') fpr, tpr, t = roc_curve(df['label'], df['probabilities'], drop_intermediate=False) nth = 5000 fpr, tpr, t = fpr[::nth], tpr[::nth], t[::nth] points = np.array([fpr, tpr]).T.reshape((-1, 1, 2)) segments = np.concatenate([points[:-1], points[1:]], axis=1) col = LineCollection(segments, zorder=3) col.set_array(t) col.set_clim(0, 1) col.set_cmap('inferno') ax.add_collection(col) rocs = np.array([ roc_auc_score(fold['label'], fold['probabilities']) for _, fold in df.groupby('cv_fold') ]) ax.set_title(f'ROC-AUC: {rocs.mean():.4f} ± {rocs.std():.4f}') ax.set_ylim(0, 1.025) ax.set_xlim(-0.025, 1) ax.set_aspect(1) ax.set_xlabel('False Positive Rate')
def station_data(ts_data, time_obs, keys=None, stations=None, path=None, save=True, show=False, ext='.png'): """ Plot the station data in ``ts_data`` with ``time_obs`` as the x axis. To plot only a subset of this data list which ADCIRC Output types to plot in keys. :type ts_data: :class:`dict` :param ts_data: ``ts_data`` from :class:`~polyadcirc.run_framework.random_manningsn.runSet` :type time_obs: :class:`dict` :param time_obs: ``time_obs`` from :class:`~polyadcirc.run_framework.random_manningsn.runSet` :param list() keys: list of types of ADCIRC output data to plot :param dict stations: dictonary of lists of stations to plot :type path: string or None :param path: directory to store plots :type save: boolean :param save: flag for whether or not to save plots :type show: boolean :param show: flag for whether or not to show plots :param string ext: file extension """ if path == None: path = os.getcwd() if keys == None: keys = ts_data.keys() s_keys = list() for k in keys: if f15.filetype[k][0]: s_keys.append(k) keys = s_keys for k in keys: fm.mkdir(path + '/figs/' + k) if stations[k] == None: stations = xrange(ts_data[k].shape[0]) for i in stations: fig = plt.figure() x = time_obs[k] num_plts = f15.filetype[k][1] if num_plts == 1: ax = fig.add_subplot(111) ax.set_xlim((np.min(x), np.max(x))) ax.set_ylim((np.min(ts_data[k]), np.max(ts_data[k]))) segs = list() for j in xrange(ts_data[k].shape[2]): segs.append(zip(x, ts_data[k][i, ..., j])) line_segs = LineCollection(segs, linestyles='solid') line_segs.set_array(np.arange(ts_data[k].shape[2])) ax.add_collection(line_segs) ax.set_xlabel('time') colorbar(line_segs, fig) elif num_plts == 2: ax1 = fig.add_subplot(121) ax2 = fig.add_subplot(122) ax1.set_xlim((np.min(x), np.max(x))) ax1.set_ylim( (np.min(ts_data[k][:, :, 0, :]), np.max(ts_data[k][:, :, 0, :]))) ax2.set_xlim((np.min(x), np.max(x))) ax2.set_ylim( (np.min(ts_data[k][:, :, 1, :]), np.max(ts_data[k][:, :, 1, :]))) segs1 = list() segs2 = list() for j in xrange(ts_data[k].shape[-1]): segs1.append(zip(x, ts_data[k][i, :, 0, j])) segs2.append(zip(x, ts_data[k][i, :, 1, j])) line_segs1 = LineCollection(segs1, linestyles='solid') line_segs1.set_array(np.arange(ts_data[k].shape[-1])) ax1.add_collection(line_segs1) ax1.set_ylabel('u (m/s)') ax1.set_xlabel('time') line_segs2 = LineCollection(segs2, linestyles='solid') line_segs2.set_array(np.arange(ts_data[k].shape[-1])) ax2.add_collection(line_segs2) ax2.set_xlabel('time') ax2.set_ylabel('v (m/s)') colorbar(line_segs2, fig) save_show(path + '/figs/' + k + '/station' + str(i), save, show, ext)
def plot_curvature(): """ This function computes analytically the curvature at various points on the attractor and compares against the numerical values obtained from the algorithm in dclv_clv, for the directional derivative of the 1st CLV along itself. """ s = [1., Inf] u = rand(3, 1) n = 10000 u0 = step(u, s, n)[0, :, -1] u0 = u0.reshape(3, 1) u_trj = step(u0, s, n)[0] d, n = u_trj.shape x, y, z = u_trj t_trj = arctan2(y, x)[1:] t_trj = t_trj % (2 * pi) du_trj = dstep(u_trj, s) clv_trj = clvs(u_trj, du_trj, 1) V1 = clv_trj[:, :, 0] ddu_trj = d2step(u_trj, s) W1 = dclv_clv(clv_trj, du_trj, ddu_trj) W1 = W1[:, :, 0] W1_ana = analytical_W1(u_trj).T[:-1] W1 = W1[1:] eps = array([-1E-2, 1E-2]).reshape([1, 2, 1]) segments = u_trj[:2].T.reshape([-1,1,2]) + \ eps * V1[:,:2].reshape([-1,1,2]) curvature_num = norm(W1, axis=1) curvature = norm(W1_ana, axis=1) assert (allclose(curvature, curvature_num, rtol=0.05)) lc = LineCollection(segments, cmap=plt.get_cmap('RdBu'), \ norm=plt.Normalize(min(curvature), max(curvature))) lc.set_array(curvature) lc.set_linewidth(1) lc1 = LineCollection(segments, cmap=plt.get_cmap('RdBu'), \ norm=plt.Normalize(min(curvature_num), max(curvature_num))) lc1.set_array(curvature_num) lc1.set_linewidth(1) fig, ax = subplots(1, 2) ax[0].add_collection(lc) ax[1].add_collection(lc1) ''' rad1 = 1.5 xx = linspace(-rad1,rad1,10000) yy = sqrt(rad1*rad1 - xx*xx) ax[0].plot(xx, yy,'-',color='gray',alpha=0.2) ax[0].plot(xx, -yy,'-',color='gray',alpha=0.2) ax[1].plot(xx, yy,'-',color='gray',alpha=0.2) ax[1].plot(xx, -yy,'-',color='gray',alpha=0.2) rad2 = 0.5 xx = linspace(-rad2,rad2,10000) yy = sqrt(rad2*rad2 - xx*xx) ax[0].plot(xx, yy,'-',color='gray',alpha=0.2) ax[0].plot(xx, -yy,'-',color='gray',alpha=0.2) ax[1].plot(xx, yy,'-',color='gray',alpha=0.2) ax[1].plot(xx, -yy,'-',color='gray',alpha=0.2) ''' ax[0].axis('scaled') ax[1].axis('scaled') ax[0].set_title('Analytical curvature', fontsize=30) ax[1].set_title('Numerical curvature', fontsize=30) ax[0].xaxis.set_tick_params(labelsize=30) ax[0].yaxis.set_tick_params(labelsize=30) ax[0].set_xlabel('$x_1$', fontsize=30) ax[0].set_ylabel('$x_2$', fontsize=30) ax[1].set_xlabel('$x_1$', fontsize=30) ax[1].set_ylabel('$x_2$', fontsize=30) ax[1].xaxis.set_tick_params(labelsize=30) ax[1].yaxis.set_tick_params(labelsize=30) ax[0].grid(True) ax[1].grid(True) cbar = fig.colorbar(lc, cmap=get_cmap('RdBu'), norm=Normalize(min(curvature), max(curvature)), ax=ax[0]) cbar.ax.tick_params(labelsize=30) cbar1 = fig.colorbar(lc1, cmap=get_cmap('RdBu'), norm=Normalize(min(curvature), max(curvature)), ax=ax[1]) cbar1.ax.tick_params(labelsize=30)
N=256) fig, axs = plt.subplots(1, 1, figsize=(7, 7)) axs.margins(y=0, x=0) x = np.linspace(0.1, 0.9, num=9) y = np.mean(environmentLacunarities, axis=0) yq75, yq25 = np.percentile(environmentLacunarities, [75, 25], axis=0) colors = cmap(y / np.max(y)) axs.scatter(x, y, c=colors, edgecolor='none') points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=cmap) lc.set_array(y) lc.set_linewidth(1.5) axs.add_collection(lc) axs.errorbar(x[:3], y[:3], yerr=[(y[:3] - yq25[:3]).tolist(), (yq75[:3] - y[:3]).tolist()], fmt='none', ecolor='#1C76BC') axs.errorbar(x[3:7], y[3:7], yerr=[(y[3:7] - yq25[3:7]).tolist(), (yq75[3:7] - y[3:7]).tolist()], fmt='none', ecolor='#6A8055')
def create_line_collection(net, lines=None, line_geodata=None, use_bus_geodata=False, infofunc=None, cmap=None, norm=None, picker=False, z=None, cbar_title="Line Loading [%]", clim=None, **kwargs): """ Creates a matplotlib line collection of pandapower lines. Input: **net** (pandapowerNet) - The pandapower network OPTIONAL: **lines** (list, None) - The lines for which the collections are created. If None, all lines in the network are considered. **line_geodata** (DataFrame, None) - coordinates to use for plotting If None, net["line_geodata"] is used **infofunc** (function, None) - infofunction for the patch element **kwargs - key word arguments are passed to the patch function """ lines = net.line.index.tolist() if lines is None else list(lines) if len(lines) == 0: return None if line_geodata is None: line_geodata = net["line_geodata"] if len(lines) == 0: return None if use_bus_geodata: data = [ ([(net.bus_geodata.at[a, "x"], net.bus_geodata.at[a, "y"]), (net.bus_geodata.at[b, "x"], net.bus_geodata.at[b, "y"])], infofunc(line) if infofunc else []) for line, (a, b) in net.line.loc[lines, ["from_bus", "to_bus"]].iterrows() if a in net.bus_geodata.index.values and b in net.bus_geodata.index.values ] else: data = [(line_geodata.loc[line, "coords"], infofunc(line) if infofunc else []) for line in lines if line in line_geodata.index.values] if len(data) == 0: return None data, info = list(zip(*data)) # This would be done anyways by matplotlib - doing it explicitly makes it a) clear and # b) prevents unexpected behavior when observing colors being "none" lc = LineCollection(data, picker=picker, **kwargs) lc.line_indices = np.array(lines) if cmap: if z is None: z = net.res_line.loading_percent.loc[lines] lc.set_cmap(cmap) lc.set_norm(norm) if clim is not None: lc.set_clim(clim) lc.set_array(np.array(z)) lc.has_colormap = True lc.cbar_title = cbar_title lc.info = info return lc
def draw_networkx_edges(G, pos, edgelist=None, width=1.0, edge_color='k', style='solid', alpha=None, edge_cmap=None, edge_vmin=None, edge_vmax=None, ax=None, arrows=True, **kwds): """Draw the edges of the graph G. This draws only the edges of the graph G. Parameters ---------- G : graph A networkx graph pos : dictionary A dictionary with nodes as keys and positions as values. If not specified a spring layout positioning will be computed. See networkx.layout for functions that compute node positions. ax : Matplotlib Axes object, optional Draw the graph in the specified Matplotlib axes. alpha: float The edge transparency (default=1.0) width`: float Line width of edges (default =1.0) edge_color: color string, or array of floats Edge color. Can be a single color format string (default='r'), or a sequence of colors with the same length as edgelist. If numeric values are specified they will be mapped to colors using the edge_cmap and edge_vmin,edge_vmax parameters. edge_ cmap: Matplotlib colormap Colormap for mapping intensities of edges (default=None) edge_vmin,edge_vmax: floats Minimum and maximum for edge colormap scaling (default=None) style: string Edge line style (default='solid') (solid|dashed|dotted,dashdot) Notes ----- For directed graphs, "arrows" (actually just thicker stubs) are drawn at the head end. Arrows can be turned off with keyword arrows=False. Yes, it is ugly but drawing proper arrows with Matplotlib this way is tricky. Examples -------- >>> G=nx.dodecahedral_graph() >>> edges=nx.draw_networkx_edges(G,pos=nx.spring_layout(G)) Also see the NetworkX drawing examples at http://networkx.lanl.gov/gallery.html See Also -------- draw() draw_networkx() draw_networkx_nodes() draw_networkx_labels() draw_networkx_edge_labels() """ try: import matplotlib import matplotlib.pylab as pylab import matplotlib.cbook as cb from matplotlib.colors import colorConverter, Colormap from matplotlib.collections import LineCollection import numpy except ImportError: raise ImportError("Matplotlib required for draw()") except RuntimeError: print("Matplotlib unable to open display") raise if ax is None: ax = pylab.gca() if edgelist is None: edgelist = G.edges() if not edgelist or len(edgelist) == 0: # no edges! return None # set edge positions edge_pos = numpy.asarray([(pos[e[0]], pos[e[1]]) for e in edgelist]) if not cb.iterable(width): lw = (width, ) else: lw = width if not cb.is_string_like(edge_color) \ and cb.iterable(edge_color) \ and len(edge_color)==len(edge_pos): if numpy.alltrue([cb.is_string_like(c) for c in edge_color]): # (should check ALL elements) # list of color letters such as ['k','r','k',...] edge_colors = tuple( [colorConverter.to_rgba(c, alpha) for c in edge_color]) elif numpy.alltrue([not cb.is_string_like(c) for c in edge_color]): # If color specs are given as (rgb) or (rgba) tuples, we're OK if numpy.alltrue( [cb.iterable(c) and len(c) in (3, 4) for c in edge_color]): edge_colors = tuple(edge_color) else: # numbers (which are going to be mapped with a colormap) edge_colors = None else: raise ValueError( 'edge_color must consist of either color names or numbers') else: if cb.is_string_like(edge_color) or len(edge_color) == 1: edge_colors = (colorConverter.to_rgba(edge_color, alpha), ) else: raise ValueError( 'edge_color must be a single color or list of exactly m colors where m is the number or edges' ) edge_collection = LineCollection( edge_pos, colors=edge_colors, linewidths=lw, antialiaseds=(1, ), linestyle=style, transOffset=ax.transData, ) edge_collection.set_zorder(1) # edges go behind nodes ax.add_collection(edge_collection) # Note: there was a bug in mpl regarding the handling of alpha values for # each line in a LineCollection. It was fixed in matplotlib in r7184 and # r7189 (June 6 2009). We should then not set the alpha value globally, # since the user can instead provide per-edge alphas now. Only set it # globally if provided as a scalar. if cb.is_numlike(alpha): edge_collection.set_alpha(alpha) # need 0.87.7 or greater for edge colormaps mpl_version = matplotlib.__version__ if mpl_version.endswith('.svn'): mpl_version = matplotlib.__version__[0:-4] elif mpl_version.endswith('svn'): mpl_version = matplotlib.__version__[0:-3] elif mpl_version.endswith('pre'): mpl_version = matplotlib.__version__[0:-3] if list(map(int, mpl_version.split('.'))) >= [0, 87, 7]: if edge_colors is None: if edge_cmap is not None: assert (isinstance(edge_cmap, Colormap)) edge_collection.set_array(numpy.asarray(edge_color)) edge_collection.set_cmap(edge_cmap) if edge_vmin is not None or edge_vmax is not None: edge_collection.set_clim(edge_vmin, edge_vmax) else: edge_collection.autoscale() # pylab.axes(ax) pylab.sci(edge_collection) # else: # sys.stderr.write(\ # """matplotlib version >= 0.87.7 required for colormapped edges. # (version %s detected)."""%matplotlib.__version__) # raise UserWarning(\ # """matplotlib version >= 0.87.7 required for colormapped edges. # (version %s detected)."""%matplotlib.__version__) arrow_collection = None if G.is_directed() and arrows: # a directed graph hack # draw thick line segments at head end of edge # waiting for someone else to implement arrows that will work arrow_colors = edge_colors a_pos = [] p = 1.0 - 0.25 # make head segment 25 percent of edge length for src, dst in edge_pos: x1, y1 = src x2, y2 = dst dx = x2 - x1 # x offset dy = y2 - y1 # y offset d = numpy.sqrt(float(dx**2 + dy**2)) # length of edge if d == 0: # source and target at same position continue if dx == 0: # vertical edge xa = x2 ya = dy * p + y1 if dy == 0: # horizontal edge ya = y2 xa = dx * p + x1 else: theta = numpy.arctan2(dy, dx) xa = p * d * numpy.cos(theta) + x1 ya = p * d * numpy.sin(theta) + y1 a_pos.append(((xa, ya), (x2, y2))) arrow_collection = LineCollection( a_pos, colors=arrow_colors, linewidths=[4 * ww for ww in lw], antialiaseds=(1, ), transOffset=ax.transData, ) arrow_collection.set_zorder(1) # edges go behind nodes ax.add_collection(arrow_collection) # update view minx = numpy.amin(numpy.ravel(edge_pos[:, :, 0])) maxx = numpy.amax(numpy.ravel(edge_pos[:, :, 0])) miny = numpy.amin(numpy.ravel(edge_pos[:, :, 1])) maxy = numpy.amax(numpy.ravel(edge_pos[:, :, 1])) w = maxx - minx h = maxy - miny padx, pady = 0.05 * w, 0.05 * h corners = (minx - padx, miny - pady), (maxx + padx, maxy + pady) ax.update_datalim(corners) ax.autoscale_view() # if arrow_collection: return edge_collection
def plot_cluster(X, labels, model): # We use a dense eigen_solver to achieve reproducibility (arpack is # initiated with random vectors that we don't control). In addition, we # use a large number of neighbors to capture the large-scale structure. node_position_model = manifold.LocallyLinearEmbedding(n_components=2, eigen_solver='dense', n_neighbors=6) embedding = node_position_model.fit_transform(X.T).T plt.figure(1, facecolor='w', figsize=(10, 8)) plt.clf() ax = plt.axes([0., 0., 1., 1.]) plt.axis('off') # Display a graph of the partial correlations partial_correlations = model.precision_.copy() d = 1 / np.sqrt(np.diag(partial_correlations)) partial_correlations *= d partial_correlations *= d[:, np.newaxis] non_zero = (np.abs(np.triu(partial_correlations, k=1)) > 0.02) # Plot the nodes using the coordinates of our embedding plt.scatter(embedding[0], embedding[1], s=100 * d**2, c=labels, cmap=plt.cm.spectral) # Plot the edges start_idx, end_idx = np.where(non_zero) # a sequence of (*line0*, *line1*, *line2*), where:: # linen = (x0, y0), (x1, y1), ... (xm, ym) segments = [[embedding[:, start], embedding[:, stop]] for start, stop in zip(start_idx, end_idx)] values = np.abs(partial_correlations[non_zero]) lc = LineCollection(segments, zorder=0, cmap=plt.cm.hot_r, norm=plt.Normalize(0, .7 * values.max())) lc.set_array(values) lc.set_linewidths(15 * values) ax.add_collection(lc) # Add a label to each node. The challenge here is that we want to # position the labels to avoid overlap with other labels for index, (name, label, (x, y)) in enumerate(zip(names, labels, embedding.T)): dx = x - embedding[0] dx[index] = 1 dy = y - embedding[1] dy[index] = 1 this_dx = dx[np.argmin(np.abs(dy))] this_dy = dy[np.argmin(np.abs(dx))] if this_dx > 0: horizontalalignment = 'left' x = x + .002 else: horizontalalignment = 'right' x = x - .002 if this_dy > 0: verticalalignment = 'bottom' y = y + .002 else: verticalalignment = 'top' y = y - .002 plt.text(x, y, name, size=10, horizontalalignment=horizontalalignment, verticalalignment=verticalalignment, bbox=dict(facecolor='w', edgecolor=plt.cm.spectral(label / float(n_labels)), alpha=.6)) plt.xlim( embedding[0].min() - .15 * embedding[0].ptp(), embedding[0].max() + .10 * embedding[0].ptp(), ) plt.ylim(embedding[1].min() - .03 * embedding[1].ptp(), embedding[1].max() + .03 * embedding[1].ptp()) plt.show()
def make_plot(self, z1, z2, stack, collection, plot): cmap = plt.cm.plasma_r x1, y1, id1 = self.specs(z1, stack) x2, y2, id2 = self.specs(z2, stack) dbconnection = make_dbconnection(collection) #use mongo to get the point matches self.pm = get_matches(z1, z2, collection, dbconnection) print('%d tile pairs for z1,z2=%d,%d in collection %s__%s' % (len(self.pm), z1, z2, collection['owner'], collection['name'])) if not plot: return lclist = [ ] #will hold coordinates of line segments (between tile pairs) clist = [] #will hold number of point match pairs, used as color #tiny line to make sure zero is in there for consistent color range tmp = [] tmp.append((0, 0)) tmp.append((0, 0.1)) lclist.append(tmp) clist.append(0) #tiny line to make sure max is in there for consistent color range tmp = [] tmp.append((0.1, 0.1)) tmp.append((0, 0.1)) lclist.append(tmp) clist.append(self.args['threshold']) #if z1!=z2: # clist.append(500) #limit was set at 500 for cross-section matches #else: # clist.append(200) #limit was set at 200 for within section matches ntp = 0 if len(self.pm) != 0: #only plot if there are matches xmin = 1e9 xmax = -1e9 ymin = 1e9 ymax = -1e9 for k in np.arange(len(self.pm)): #find the tilespecs k1 = np.argwhere(id1 == self.pm[k]['pId']).flatten() k2 = np.argwhere(id2 == self.pm[k]['qId']).flatten() if (k1.size != 0) & (k2.size != 0): ntp += 1 k1 = k1[0] k2 = k2[0] tmp = [] tmp.append((x1[k1], y1[k1])) tmp.append((x2[k2], y2[k2])) lclist.append(tmp) clist.append(len(self.pm[k]['matches']['q'][0])) for ix in [x1[k1], x2[k2]]: if ix.min() < xmin: xmin = ix.min() if ix.max() > xmax: xmax = ix.max() for iy in [y1[k1], y2[k2]]: if iy.min() < ymin: ymin = iy.min() if iy.max() > ymax: ymax = iy.max() print('%d tile pairs match stack %s__%s__%s' % (ntp, stack['owner'], stack['project'], stack['name'])) #plot the line segments all at once for speed: # https://matplotlib.org/examples/pylab_examples/line_collection2.html fig = plt.figure(1, figsize=(11.69, 8.27)) fig.clf() ax = fig.add_subplot(111) border = 4000 ax.set_xlim(xmin - border, xmax + border) ax.set_ylim(ymin - border, ymax + border) LC = LineCollection(lclist, cmap=cmap) LC.set_array(np.array(clist)) ax.add_collection(LC) fig = plt.gcf() ax.set_aspect('equal') ax.patch.set_color([0.5, 0.5, 0.5]) #gray background, easier to see yellow ax.set_title('%s %s\n%d tile pairs %d point pairs' % (z1, z2, len(self.pm), sum(clist[2:]))) ax.invert_yaxis() fig.colorbar(LC) plt.draw() fname = '%s/%s_%d_%d.pdf' % (self.args['plot_dir'], collection['name'], z1, z2) pdf = PdfPages(fname) pdf.savefig(fig) #save the figure as a pdf page pdf.close() plt.ion() plt.show() print('wrote %s' % fname) self.outputname = fname
PD_DOWN = probdens[int(probdens.shape[0] / 2):] for k in range(N): if V[k, k] != 0: wt[i, j] += PD_UP[k] + PD_DOWN[k] fig = plt.figure() norm = plt.Normalize(0, 1) ax = fig.add_subplot(1, 1, 1) for i in range(0, bands.shape[1]): ax.plot(qx, bands[:, i], linewidth=1.25, c='w', zorder=-10) for i in range(0, bands.shape[1]): print(bands.shape[1] - i) points = np.array([qx, bands[:, i]]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap='seismic', norm=norm) lc.set_array(wt[:, i]) lc.set_linewidth(1.0) line = ax.add_collection(lc) ax.patch.set_facecolor('black') axcb = fig.colorbar(lc) ax.set_xlim(qx[0], qx[-1]) ax.set_xlabel('kx (1/A)') ax.set_ylabel('Energy (meV)') plt.savefig('weighted_bands.png') plt.show() sys.exit() ##################################### VV = sparse.bmat([[None, V], [-V, None]], format='csc', dtype='complex')
def draw_networkx_edges(G, pos, edgelist=None, width=1.0, edge_color='k', style='solid', alpha=None, edge_cmap=None, edge_vmin=None, edge_vmax=None, ax=None, arrows=True, **kwds): """Draw the edges of the graph G This draws only the edges of the graph G. pos is a dictionary keyed by vertex with a two-tuple of x-y positions as the value. See networkx.layout for functions that compute node positions. edgelist is an optional list of the edges in G to be drawn. If provided, only the edges in edgelist will be drawn. edgecolor can be a list of matplotlib color letters such as 'k' or 'b' that lists the color of each edge; the list must be ordered in the same way as the edge list. Alternatively, this list can contain numbers and those number are mapped to a color scale using the color map edge_cmap. Finally, it can also be a list of (r,g,b) or (r,g,b,a) tuples, in which case these will be used directly to color the edges. If the latter mode is used, you should not provide a value for alpha, as it would be applied globally to all lines. For directed graphs, 'arrows' (actually just thicker stubs) are drawn at the head end. Arrows can be turned off with keyword arrows=False. See draw_networkx for the list of other optional parameters. """ try: import matplotlib.pylab as pylab import matplotlib.cbook as cb from matplotlib.colors import colorConverter, Colormap from matplotlib.collections import LineCollection except ImportError: raise ImportError("Matplotlib required for draw()") except RuntimeError: pass # unable to open display if ax is None: ax = pylab.gca() if edgelist is None: edgelist = G.edges() if not edgelist or len(edgelist) == 0: # no edges! return None # set edge positions edge_pos = np.asarray([(pos[e[0]], pos[e[1]]) for e in edgelist]) if not cb.iterable(width): lw = (width, ) else: lw = width if not cb.is_string_like(edge_color) \ and cb.iterable(edge_color) \ and len(edge_color) == len(edge_pos): if np.alltrue([cb.is_string_like(c) for c in edge_color]): # (should check ALL elements) # list of color letters such as ['k','r','k',...] edge_colors = tuple( [colorConverter.to_rgba(c, alpha) for c in edge_color]) elif np.alltrue([not cb.is_string_like(c) for c in edge_color]): # If color specs are given as (rgb) or (rgba) tuples, we're OK if np.alltrue( [cb.iterable(c) and len(c) in (3, 4) for c in edge_color]): edge_colors = tuple(edge_color) alpha = None else: # numbers (which are going to be mapped with a colormap) edge_colors = None else: e_s = 'edge_color must consist of either color names or numbers' raise ValueError(e_s) else: if len(edge_color) == 1: edge_colors = (colorConverter.to_rgba(edge_color, alpha), ) else: e_s = 'edge_color must be a single color or list of exactly' e_s += 'm colors where m is the number or edges' raise ValueError(e_s) edge_collection = LineCollection( edge_pos, colors=edge_colors, linewidths=lw, antialiaseds=(1, ), linestyle=style, transOffset=ax.transData, ) # Note: there was a bug in mpl regarding the handling of alpha values for # each line in a LineCollection. It was fixed in matplotlib in r7184 and # r7189 (June 6 2009). We should then not set the alpha value globally, # since the user can instead provide per-edge alphas now. Only set it # globally if provided as a scalar. if cb.is_numlike(alpha): edge_collection.set_alpha(alpha) # need 0.87.7 or greater for edge colormaps if edge_colors is None: if edge_cmap is not None: assert (isinstance(edge_cmap, Colormap)) edge_collection.set_array(np.asarray(edge_color)) edge_collection.set_cmap(edge_cmap) if edge_vmin is not None or edge_vmax is not None: edge_collection.set_clim(edge_vmin, edge_vmax) else: edge_collection.autoscale() pylab.sci(edge_collection) # else: # sys.stderr.write(\ # """matplotlib version >= 0.87.7 required for colormapped edges. # (version %s detected)."""%matplotlib.__version__) # raise UserWarning(\ # """matplotlib version >= 0.87.7 required for colormapped edges. # (version %s detected)."""%matplotlib.__version__) arrow_collection = None if G.is_directed() and arrows: # a directed graph hack # draw thick line segments at head end of edge # waiting for someone else to implement arrows that will work arrow_colors = (colorConverter.to_rgba('k', alpha), ) a_pos = [] p = 1.0 - 0.25 # make head segment 25 percent of edge length for src, dst in edge_pos: x1, y1 = src x2, y2 = dst dx = x2 - x1 # x offset dy = y2 - y1 # y offset d = np.sqrt(float(dx**2 + dy**2)) # length of edge if d == 0: # source and target at same position continue if dx == 0: # vertical edge xa = x2 ya = dy * p + y1 if dy == 0: # horizontal edge ya = y2 xa = dx * p + x1 else: theta = np.arctan2(dy, dx) xa = p * d * np.cos(theta) + x1 ya = p * d * np.sin(theta) + y1 a_pos.append(((xa, ya), (x2, y2))) arrow_collection = LineCollection( a_pos, colors=arrow_colors, linewidths=[4 * ww for ww in lw], antialiaseds=(1, ), transOffset=ax.transData, ) # update view minx = np.amin(np.ravel(edge_pos[:, :, 0])) maxx = np.amax(np.ravel(edge_pos[:, :, 0])) miny = np.amin(np.ravel(edge_pos[:, :, 1])) maxy = np.amax(np.ravel(edge_pos[:, :, 1])) w = maxx - minx h = maxy - miny padx, pady = 0.05 * w, 0.05 * h corners = (minx - padx, miny - pady), (maxx + padx, maxy + pady) ax.update_datalim(corners) ax.autoscale_view() edge_collection.set_zorder(1) # edges go behind nodes ax.add_collection(edge_collection) if arrow_collection: arrow_collection.set_zorder(1) # edges go behind nodes ax.add_collection(arrow_collection) return ax
def plot(network, margin=0.05, ax=None, geomap=True, projection=None, bus_colors='b', line_colors={ 'Line': 'g', 'Link': 'cyan' }, bus_sizes=10, line_widths={ 'Line': 2, 'Link': 2 }, flow=None, layouter=None, title="", line_cmap=None, bus_cmap=None, boundaries=None, geometry=False, branch_components=['Line', 'Link'], jitter=None, basemap=None, basemap_parameters=None, color_geomap=None): """ Plot the network buses and lines using matplotlib and cartopy/basemap. Parameters ---------- margin : float Margin at the sides as proportion of distance between max/min x,y ax : matplotlib ax, defaults to plt.gca() Axis to which to plot the network geomap: bool/str, default True Switch to use Basemap or Cartopy (depends on what is installed). If string is passed, it will be used as a resolution argument. For Basemap users 'c' (crude), 'l' (low), 'i' (intermediate), 'h' (high), 'f' (full) are valid resolutions options. For Cartopy users '10m', '50m', '110m' are valid resolutions options. projection: cartopy.crs.Projection, defaults to None Define the projection of your geomap, only valid if cartopy is installed. If None (default) is passed the projection for cartopy is set to cartopy.crs.PlateCarree bus_colors : dict/pandas.Series Colors for the buses, defaults to "b" bus_sizes : dict/pandas.Series Sizes of bus points, defaults to 10 line_colors : dict/pandas.Series Colors for the lines, defaults to "g" for Lines and "cyan" for Links. Colors for branches other than Lines can be specified using a pandas Series with a MultiIndex. line_widths : dict/pandas.Series Widths of lines, defaults to 2. Widths for branches other than Lines can be specified using a pandas Series with a MultiIndex. flow : snapshot/pandas.Series/function/string Flow to be displayed in the plot, defaults to None. If an element of network.snapshots is given, the flow at this timestamp will be displayed. If an aggregation function is given, is will be applied to the total network flow via pandas.DataFrame.agg (accepts also function names). Otherwise flows can be specified by passing a pandas Series with MultiIndex including all necessary branch components. Use the line_widths argument to additionally adjust the size of the flow arrows. layouter : networkx.drawing.layout function, default None Layouting function from `networkx <https://networkx.github.io/>`_ which overrules coordinates given in ``network.buses[['x','y']]``. See `list <https://networkx.github.io/documentation/stable/reference/drawing.html#module-networkx.drawing.layout>`_ of available options. title : string Graph title line_cmap : plt.cm.ColorMap/str|dict If line_colors are floats, this color map will assign the colors. Use a dict to specify colormaps for more than one branch type. bus_cmap : plt.cm.ColorMap/str If bus_colors are floats, this color map will assign the colors boundaries : list of four floats Boundaries of the plot in format [x1,x2,y1,y2] branch_components : list of str Branch components to be plotted, defaults to Line and Link. jitter : None|float Amount of random noise to add to bus positions to distinguish overlapping buses basemap_parameters : dict Specify a dict with additional constructor parameters for the Basemap. Will disable Cartopy. Use this feature to set a custom projection. (e.g. `{'projection': 'tmerc', 'lon_0':10.0, 'lat_0':50.0}`) color_geomap : dict or bool Specify colors to paint land and sea areas in. If True, it defaults to `{'ocean': 'lightblue', 'land': 'whitesmoke'}`. If no dictionary is provided, colors are white. Returns ------- bus_collection, branch_collection1, ... : tuple of Collections Collections for buses and branches. """ defaults_for_branches = pd.Series({ 'Link': dict(color="cyan", width=2), 'Line': dict(color="b", width=2), 'Transformer': dict(color='green', width=2) }).rename_axis('component') if not plt_present: logger.error("Matplotlib is not present, so plotting won't work.") return if basemap is not None: logger.warning("argument `basemap` is deprecated, " "use `geomap` instead.") geomap = basemap if geomap: if not (cartopy_present or basemap_present): # Not suggesting Basemap since it is being deprecated logger.warning( "Cartopy needs to be installed to use `geomap=True`.") geomap = False # Use cartopy by default, fall back on basemap use_basemap = False use_cartopy = cartopy_present if not use_cartopy: use_basemap = basemap_present # If the user specifies basemap parameters, they prefer # basemap over cartopy. # (This means that you can force the use of basemap by # setting `basemap_parameters={}`) if basemap_present: if basemap_parameters is not None: logger.warning("Basemap is being deprecated, consider " "switching to Cartopy.") use_basemap = True use_cartopy = False if use_cartopy: if projection is None: projection = get_projection_from_crs(network.srid) if ax is None: ax = plt.gca(projection=projection) else: assert isinstance(ax, cartopy.mpl.geoaxes.GeoAxesSubplot), ( 'The passed axis is not a GeoAxesSubplot. You can ' 'create one with: \nimport cartopy.crs as ccrs \n' 'fig, ax = plt.subplots(' 'subplot_kw={"projection":ccrs.PlateCarree()})') elif ax is None: ax = plt.gca() x, y = _get_coordinates(network, layouter=layouter) axis_transform = ax.transData if geomap: if use_cartopy: axis_transform = draw_map_cartopy(network, x, y, ax, boundaries, margin, geomap, color_geomap) new_coords = pd.DataFrame(ax.projection.transform_points( axis_transform, x.values, y.values), index=network.buses.index, columns=['x', 'y', 'z']) x, y = new_coords['x'], new_coords['y'] elif use_basemap: basemap_transform = draw_map_basemap(network, x, y, ax, boundaries, margin, geomap, basemap_parameters, color_geomap) # A non-standard projection might be used; the easiest way to # support this is to tranform the bus coordinates. x, y = basemap_transform(x.values, y.values) x = pd.Series(x, network.buses.index) y = pd.Series(y, network.buses.index) if jitter is not None: x = x + np.random.uniform(low=-jitter, high=jitter, size=len(x)) y = y + np.random.uniform(low=-jitter, high=jitter, size=len(y)) if isinstance(bus_sizes, pd.Series) and isinstance(bus_sizes.index, pd.MultiIndex): # We are drawing pies to show all the different shares assert len(bus_sizes.index.levels[0].difference(network.buses.index)) == 0, \ "The first MultiIndex level of bus_sizes must contain buses" assert (isinstance(bus_colors, dict) and set(bus_colors).issuperset(bus_sizes.index.levels[1])), \ "bus_colors must be a dictionary defining a color for each element " \ "in the second MultiIndex level of bus_sizes" bus_sizes = bus_sizes.sort_index(level=0, sort_remaining=False) if geomap: bus_sizes *= projected_area_factor(ax, network.srid)**2 patches = [] for b_i in bus_sizes.index.levels[0]: s = bus_sizes.loc[b_i] radius = s.sum()**0.5 if radius == 0.0: ratios = s else: ratios = s / s.sum() start = 0.25 for i, ratio in ratios.iteritems(): patches.append( Wedge((x.at[b_i], y.at[b_i]), radius, 360 * start, 360 * (start + ratio), facecolor=bus_colors[i])) start += ratio bus_collection = PatchCollection(patches, match_original=True) ax.add_collection(bus_collection) else: c = pd.Series(bus_colors, index=network.buses.index) s = pd.Series(bus_sizes, index=network.buses.index, dtype="float").fillna(10) bus_collection = ax.scatter(x, y, c=c, s=s, cmap=bus_cmap, edgecolor='face') def as_branch_series(ser): # ensure that this function always return a multiindexed series if isinstance(ser, dict) and set(ser).issubset(branch_components): return pd.concat( { c.name: pd.Series(s, index=c.df.index) for c, s in zip(network.iterate_components(ser.keys()), ser.values()) }, names=['component', 'name']) elif isinstance(ser, pd.Series) and isinstance(ser.index, pd.MultiIndex): return ser.rename_axis(index=['component', 'name']) else: ser = pd.Series(ser, network.lines.index) return pd.concat([ser], axis=0, keys=['Line'], names=['component', 'name']).fillna(0) line_colors = as_branch_series(line_colors) line_widths = as_branch_series(line_widths) if not isinstance(line_cmap, dict): line_cmap = {'Line': line_cmap} branch_collections = [] if flow is not None: flow = (_flow_ds_from_arg( flow, network, branch_components).pipe(as_branch_series).div( sum( len(t.df) for t in network.iterate_components(branch_components)) + 100)) flow = flow.mul(line_widths[flow.index], fill_value=1) # update the line width, allows to set line widths separately from flows line_widths.update((5 * flow.abs()).pipe(np.sqrt)) arrows = directed_flow(network, flow, x=x, y=y, ax=ax, geomap=geomap, branch_colors=line_colors, branch_comps=branch_components, cmap=line_cmap['Line']) branch_collections.append(arrows) for c in network.iterate_components(branch_components): l_defaults = defaults_for_branches[c.name] l_widths = line_widths.get(c.name, l_defaults['width']) l_nums = None l_colors = line_colors.get(c.name, l_defaults['color']) if isinstance(l_colors, pd.Series): if issubclass(l_colors.dtype.type, np.number): l_nums = l_colors l_colors = None else: l_colors.fillna(l_defaults['color'], inplace=True) if not geometry: segments = (np.asarray( ((c.df.bus0.map(x), c.df.bus0.map(y)), (c.df.bus1.map(x), c.df.bus1.map(y)))).transpose(2, 0, 1)) else: from shapely.wkt import loads from shapely.geometry import LineString linestrings = c.df.geometry[lambda ds: ds != ''].map(loads) assert all(isinstance(ls, LineString) for ls in linestrings), ( "The WKT-encoded geometry in the 'geometry' column must be " "composed of LineStrings") segments = np.asarray(list(linestrings.map(np.asarray))) l_collection = LineCollection(segments, linewidths=l_widths, antialiaseds=(1, ), colors=l_colors, transOffset=ax.transData) if l_nums is not None: l_collection.set_array(np.asarray(l_nums)) l_collection.set_cmap(line_cmap.get(c.name, None)) l_collection.autoscale() ax.add_collection(l_collection) l_collection.set_zorder(3) branch_collections.append(l_collection) bus_collection.set_zorder(4) ax.update_datalim(compute_bbox_with_margins(margin, x, y)) ax.autoscale_view() if geomap: if use_cartopy: ax.outline_patch.set_visible(False) ax.axis('off') ax.set_title(title) return (bus_collection, ) + tuple(branch_collections)
def area_series_plot(northern=True): all_area = pd.read_pickle('/Users/mskirk/data/PCH_Project/all_area.pkl') if northern: north = pd.concat([ all_area.Area[all_area.Center_lat > 0], all_area.Area_max[all_area.Center_lat > 0], all_area.Area_min[all_area.Center_lat > 0] ]).sort_index() else: north = pd.concat([ all_area.Area[all_area.Center_lat < 0], all_area.Area_max[all_area.Center_lat < 0], all_area.Area_min[all_area.Center_lat < 0] ]).sort_index() north_ci = PCH_series.series_bootstrap(north, interval='360D', delta=True, confidence=0.997).fillna(0) n_div = (north_ci.upper - north_ci.lower) / 2 wso = PCH_series.read_wso_data( '/Users/mskirk/data/PCH_Project/WSO_PolarField.txt') sns.set(style="darkgrid") fig = plt.figure(figsize=(8, 4)) outer_grid = gridspec.GridSpec(2, 1, wspace=0.0, hspace=0.0, height_ratios=[20, 1]) ax = fig.add_subplot(outer_grid[0]) plt.plot(north.resample('11D').median()) plt.tight_layout() plt.fill_between(north_ci.resample('11D').median().index, (north - n_div).resample('11D').median(), (north + n_div).resample('11D').median(), alpha=0.5) if northern: ax.set_title('Northern Polar Coronal Hole') else: ax.set_title('Southern Polar Coronal Hole') ax.set_ylabel('Fractional Area') ax.set_ylim(0, 0.08) ax.set_xlim(all_area.index[0] - timedelta(days=180), all_area.index[-1] + timedelta(days=180)) ax.set_xlabel('') ax.set_xticklabels([]) ax1 = fig.add_subplot(outer_grid[1]) inxval = mdates.date2num(wso.index.to_pydatetime()) y = np.zeros_like(inxval) points = np.array([inxval, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) cmap = ListedColormap(['r', 'y']) if northern: norm = BoundaryNorm([wso.NorthFilter.min(), 0, wso.NorthFilter.max()], cmap.N) lc = LineCollection(segments, cmap=cmap, norm=norm) lc.set_array(wso.NorthFilter) else: norm = BoundaryNorm([wso.SouthFilter.min(), 0, wso.SouthFilter.max()], cmap.N) lc = LineCollection(segments, cmap=cmap, norm=norm) lc.set_array(wso.SouthFilter) lc.set_linewidth(4) line = ax1.add_collection(lc) ax1.xaxis.set_major_locator(mdates.AutoDateLocator()) monthFmt = mdates.DateFormatter("%Y") ax1.xaxis.set_major_formatter(monthFmt) ax1.autoscale_view() ax1.set_ylim(-0.1, 0.1) ax1.axes.get_yaxis().set_visible(False) ax1.set_aspect(1000) t_min = np.floor(Time(all_area.index[0]).jd - 1721424.5 - 180) t_max = np.floor(Time(all_area.index[-1]).jd - 1721424.5 + 180) ax1.set_xlim(t_min, t_max)
def graph_smile_formula_bond_pairs(s, xs, ys, position): cm = plt.get_cmap("RdYlGn") mkdir('graphs') label = ''.join(['Smile Formula Graph: ', s]) zeros = [0.0 for x in xs] complete_set = [xs[0]] complete_set.extend(ys) complete_position = [0] complete_position.extend(position) complete_zeros = [0.0] complete_zeros.extend(zeros) for graph_type in ['scatter', 'line']: #line if graph_type == 'line': # convert to ndarray xs = array(xs) ys = array(ys) position = array(position) points = np.array([xs, ys]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) #print('segments', segments.shape) fig, axs = plt.subplots(2, 1, sharex=True, sharey=True) norm = plt.Normalize(0, position.max()) lc = LineCollection(segments, cmap='viridis', norm=norm) lc.set_array(position) lc.set_linewidth(2) line = axs[0].add_collection(lc) fig.colorbar(line, ax=axs[0]) axs[0].set_xlim(0, xs.max()) axs[0].set_ylim(0, ys.max()) fig.delaxes(axs[1]) #plt.show() image_path = ''.join(['graphs/', s, '_', graph_type, '.png']) plt.savefig(image_path) plt.close() elif graph_type == 'scatter': colors = [cm(float(i) / len(zeros)) for i in range(len(zeros))] complete_colors = [ cm(float(i) / len(complete_zeros)) for i in range(len(complete_zeros)) ] image_path = ''.join(['graphs/', s, '_', graph_type, '.png']) scatters = { 'default': { 'xs': xs, 'ys': ys, 'zs': zeros, 'colors': colors, 'xlabel': '1st electron count', 'ylabel': '2nd electron count', 'zlabel': 'N/A', 'title': 'Bond Pair Electron Counts', 'path': ''.join(['graphs/', s, '_default_', graph_type, '.png']) }, 'position': { 'xs': complete_position, 'ys': complete_set, 'zs': complete_zeros, 'colors': complete_colors, 'xlabel': 'Position of element', 'ylabel': 'Electron count', 'zlabel': 'N/A', 'title': 'Electron counts by position in smile formula', 'path': ''.join(['graphs/', s, '_position_', graph_type, '.png']) }, 'all': { 'xs': xs, 'ys': ys, 'zs': position, 'colors': colors, 'xlabel': '', 'ylabel': '', 'zlabel': '', 'title': '', 'path': ''.join(['graphs/', s, '_all_', graph_type, '.png']) } } for scatter, value in scatters.items(): make_plot(value, cm) plt.close() ''' # comment in one of the following sections if you want to use plotly which has a nice browser UI default = go.Scatter3d(x=xs, y=ys, z=zeros) if graph_type == 'scatter' else px.line_3d(x=xs, y=ys, z=zeros) change = go.Scatter3d(x=complete_position, y=complete_set, z=zeros) if graph_type == 'scatter' else px.line_3d(x=complete_position, y=complete_set, z=zeros) all_changes = go.Scatter3d(x=xs, y=ys, z=position) if graph_type == 'scatter' else px.line_3d(x=xs, y=ys, z=position) fig = go.Figure() fig.add_trace(default) fig.add_trace(change) fig.add_trace(all_changes) fig.update_layout(title = label) fig.show() # comment in the following section if youre using plotly & working offline to view graph in the browser plotly.offline.plot( { "data": traces, "layout": go.Layout(title=label) }, image='jpeg', image_filename=image_path ) traces = [default, change, all_changes] py.image.save_as({'data':traces}, image_path, format='png') ''' return True
def create_ngram_plot(term_or_topic_list: list, use_log_scale: bool = False, subplot_ax: Subplot = None, plot_title: str = None, plot_filename: str = None, show_plot: bool = False, show_male_female_bar: bool = None, scale_factor: int = 1, master_viz_data: dict = None): print(f'Drawing ngram plot for {term_or_topic_list}') if subplot_ax and plot_filename: raise ValueError( "Cannot save a plot that will be stored in a subplot.") if show_male_female_bar not in [None, 'horizontal', 'vertical']: raise ValueError( "show_male_female_bar has to be None, horizontal, or vertical.") if term_or_topic_list[0].startswith( 'topic.') or term_or_topic_list[0].startswith('gen_approach_'): mode = 'topics' else: mode = 'terms' if not master_viz_data: master_viz_data = load_master_viz_data(mode) data = {term: master_viz_data[term] for term in term_or_topic_list} start_year = next(iter(data.values()))['year'][0] end_year = next(iter(data.values()))['year'][0] # 2: Set up the plot # if an ax is passed, we're creating a subplot for that axes. otherwise, we're creating a # complete plot here. if subplot_ax is None: fig = plt.figure(figsize=(12, 12)) gs = gridspec.GridSpec(nrows=1, ncols=1, figure=fig, width_ratios=[1], height_ratios=[1], wspace=0.2, hspace=0.05) ax = fig.add_subplot(gs[0, 0]) else: ax = subplot_ax ax.set_ylim(0, 1) ax.set_xlim(start_year + 2, end_year - 2) ax.set_axisbelow(True) ax.grid(which='major', axis='both') # add all passed terms to chart for t in term_or_topic_list: x = data[t]['year'] y = data[t]['freq'] freq_scores = data[t]['freq_score'] x_lin = np.linspace(min(data[t]['year']), max(data[t]['year']), 1000) spl = make_interp_spline(x, y, k=2) y_lin = spl(x_lin) spl_freq_score = make_interp_spline(x, freq_scores, k=1) freq_score_lin = spl_freq_score(x_lin) points = np.array([x_lin, y_lin]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) norm = plt.Normalize(0.0, 1.0) lc = LineCollection(segments, cmap='coolwarm', norm=norm) # Set the values used for colormapping lc.set_array(freq_score_lin) lc.set_linewidth(4 * scale_factor) line = ax.add_collection(lc) # Line below can be used to add a label to the right of the frequency line # ax.text(x=max(x)+1, y=y[-1], s=t, fontsize=14) # Set x axis (years) ax.set_xlim(x_lin.min(), x_lin.max()) ax.tick_params(axis='x', labelsize=14 * scale_factor) # Set y axis (frequencies or topic weights) y_max = max([max(data[t]['freq']) for t in term_or_topic_list]) * 1.2 ax.set_ylim(0, y_max) ax.yaxis.set_major_formatter(mtick.PercentFormatter(xmax=1.0)) if use_log_scale: y_min = min([min(data[t]['freq']) for t in term_or_topic_list]) * 1.2 ax.set_yscale('log') ax.tick_params(axis='y', labelsize=14 * scale_factor) # Set title if plot_title: ax.set_title(label=plot_title, weight='bold', fontsize=24 * scale_factor, pad=20 * scale_factor) # Set color bar with male female indicator if show_male_female_bar: fig.colorbar(line, ax=ax, orientation=show_male_female_bar, fraction=0.1) if plot_filename: plt.savefig( Path(BASE_PATH, 'visualizations', 'ngram_plots', plot_filename)) if show_plot: plt.show() if subplot_ax: return ax
def _create_xvy_trajectory_fig(self, filter_index, week_index, x_index, y_index, feature_name): ### Generate features subject_generator = self.subject.get_full_generator() features, labels = next(subject_generator) ### Create figure fig, axs = plt.subplots(1) fig.set_figwidth(self.save_config.Callback.figwidth) fig.set_figheight(self.save_config.Callback.figheight) fig.tight_layout() fig.suptitle("Week " + str(week_index + 1) + " Trajectory Response: X vs Y") ### Get individual points x_points = features[0, week_index, :, x_index] y_points = features[0, week_index, :, y_index] ### Create combined points and segments points = np.array([x_points, y_points]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) ### Get convolutional output from logs conv_output = self.recent_epoch_logs["convolutional_output"] ### Define colormap function norm = plt.Normalize(conv_output[0, week_index, :, filter_index].min(), conv_output[0, week_index, :, filter_index].max()) lc = LineCollection(segments, cmap='viridis', norm=norm) # Set the values used for colormapping lc.set_array(conv_output[0, week_index, :, filter_index]) lc.set_linewidth(2) line = axs.add_collection(lc) fig.colorbar(line, ax=axs) ### Set margins margin = .3 half_x_points = x_points.max() - (x_points.min() + x_points.max()) / 2 axs.set_xlim(x_points.min() - half_x_points * margin, x_points.max() + half_x_points * margin) half_y_points = y_points.max() - (y_points.min() + y_points.max()) / 2 axs.set_ylim(y_points.min() - half_y_points * margin, y_points.max() + half_y_points * margin) ### Set labels axs.set_xlabel("Y Position") axs.set_ylabel("X Position") ### Save filter response fig as png and eps filter_response_folder_path = "results/" + self.save_config.Output.batch_name + "/" + self.child_name + "/trajectory-responses/" if not os.path.exists(filter_response_folder_path): os.mkdir(filter_response_folder_path) filter_response_folder_path += "{}/".format(feature_name) if not os.path.exists(filter_response_folder_path): os.mkdir(filter_response_folder_path) filter_response_folder_path += "x-vs-y/".format(filter_index) if not os.path.exists(filter_response_folder_path): os.mkdir(filter_response_folder_path) filter_response_folder_path += "filter-{}/".format(filter_index) if not os.path.exists(filter_response_folder_path): os.mkdir(filter_response_folder_path) filter_response_folder_path += "week-{}/".format(week_index + 1) if not os.path.exists(filter_response_folder_path): os.mkdir(filter_response_folder_path) single_response_png_path = filter_response_folder_path + "week-{}.png".format( week_index + 1) fig.savefig(single_response_png_path, dpi=200, format="png", bbox_inches="tight") single_response_eps_path = filter_response_folder_path + "week-{}.eps".format( week_index + 1) fig.savefig(single_response_eps_path, dpi=200, format="eps", bbox_inches="tight") plt.close(fig)
def plotter(flight_id): flight_datestr = SCI_FLIGHTS[flight_id] flight_date = datetime.strptime(flight_datestr, "%Y%m%d") save_sat_dir = EXTRACTDIR # / f'{flight_date:%Y%m%d}' masin_data_path = ( mypaths.masin_dir / f"flight{flight_id}" / MASIN_FILE_MASK.format(flight_date=flight_date, flight_id=flight_id)) ds = xr.open_dataset(masin_data_path, decode_times=False) ref_date = flight_date.replace(hour=0, minute=0, second=0, microsecond=0) # TODO: decode from ds.Time.units ds.coords["data_point"] = np.array([ np.datetime64(ref_date) + np.timedelta64(timedelta(seconds=int(i))) # NOQA for i in ds.Time.values ]) ds = ds.drop("Time") ds = ds.rename({"data_point": "Time"}) masin_x = ds.LON_OXTS[~ds.ALT_OXTS.isnull()][::flt_stride] masin_y = ds.LAT_OXTS[~ds.ALT_OXTS.isnull()][::flt_stride] masin_z = ds.ALT_OXTS[~ds.ALT_OXTS.isnull()][::flt_stride] masin_t = ds.Time[~ds.ALT_OXTS.isnull()] flight_hours = sorted(set(masin_t.dt.hour.values)) seaice_str = "" if add_sea_ice.lower() == "amsr2": (sic_lons, sic_lats, sic_data) = sat_tools.get_amsr2(dt=flight_date, save_dir=SICDIR) seaice_str = "_amsr2" print(flight_date) for sat_opt in sat_opts: print(sat_opt) prev_tstamp = ref_date for hour in flight_hours: dt = ref_date + timedelta(hours=int(hour)) # Get satellite image with given options closest to the flight time arch_file = ARCH_DIR / f"{dt:%Y%m%d}.zip" with ZipFile(arch_file) as z: zfile, tstamp = sat_tools.get_nearest_zfile(z, dt, **sat_opt) if tstamp == prev_tstamp: continue sat_image_name = save_sat_dir / zfile if not sat_image_name.is_file(): # er = sat_tools.download_file(url=url, save_dir=save_sat_dir) # assert err == 0, 'Downloading the image failed' with ZipFile(arch_file) as z: z.extract(zfile, save_sat_dir) # Open the satellite image and get data, image extent, and CRS im, extent, crs = sat_tools.read_raster_stereo(str(sat_image_name)) fig = plt.figure(figsize=(12, 8)) ax = ukmo_igp_map(fig, coast=COAST, **igp_map_kw, **gridline_kw) ax.tick_params(labelsize="x-large", length=0) ax.imshow( im[::sat_stride, ::sat_stride], origin="upper", extent=extent, transform=crs, cmap="gray", interpolation="nearest", ) if SICDIR: # Add contours of sea-ice concentration cntr = ax.contour(sic_lons, sic_lats, sic_data, **sic_kw, **mapkw) clbls = ax.clabel(cntr, **sic_clab_kw) plt.setp(cntr.collections + clbls, path_effects=path_effects) ax.plot(masin_x, masin_y, linewidth=5, color="k", alpha=0.25, **mapkw) points = np.array([masin_x, masin_y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) lc = LineCollection(segments, cmap=cmap, linewidth=3, zorder=10, norm=norm, **mapkw) lc.set_array(masin_z) h = ax.add_collection(lc) cb = fig.colorbar(h, ax=ax, extend="max", pad=0.01, aspect=40) cb.ax.tick_params(labelsize="large") cb.ax.set_ylabel( f"Altitude [{masin_z.units.strip()}]", fontsize="large", rotation=270, labelpad=15, ) txt = f"Flight {flight_id} | {tstamp:%d %b}" txt += (f"\nFlight time: {str(masin_t.min().values)[11:16]}" f"-{str(masin_t.max().values)[11:16]}") txt += f'\n{" | ".join(sat_opt.values())}' txt += f"\nSat image time: {tstamp:%H:%M}" if SICDIR: txt += f"\n{add_sea_ice.upper()} sea ice" # ax.set_title(txt, loc='left', fontsize='large') ax.add_artist(AnchoredText(txt, prop=dict(size="large"), loc=4)) sat_opt_str = "_".join(sat_opt.values()) outdir = PLOTDIR / f"flight{flight_id}" outdir.mkdir(exist_ok=True) fig.savefig( outdir / (f"flight_{flight_id}_{tstamp:%Y%m%d%H%M}" f"_{sat_opt_str}{seaice_str}{zoom_str}.png"), **svfigkw, ) prev_tstamp = tstamp plt.close(fig)
def martin_plot_frame(well_data, time, vrange=(-100, 100), autocad_path=None, strike=120., hydro_path=None, origin=np.array([2579332., 1247600., 514.]), title=None): """ Plot single frame of wells colored by strain. Take map and cross section from Vero and my presentation to MT partners :param well_data: Output from extract_wells :param time: Time plot signals for :return: """ fig = plt.figure(figsize=(15, 8)) spec = GridSpec(ncols=8, nrows=8, figure=fig) ax3d = fig.add_subplot(spec[:6, :4], projection='3d') ax_x = fig.add_subplot(spec[:7, 4:]) ax_hydro = fig.add_subplot(spec[7:, :]) if title: fig.suptitle(title, fontsize=20) # Cross section plane (strike 320) r = np.deg2rad(360 - strike) normal = np.array([-np.sin(r), -np.cos(r), 0.]) normal /= linalg.norm(normal) new_strk = np.array([np.sin(r), -np.cos(r), 0.]) new_strk /= linalg.norm(new_strk) change_b_mat = np.array([new_strk, [0, 0, 1], normal]) for afile in glob('{}/*.csv'.format(autocad_path)): df_cad = pd.read_csv(afile) lines = df_cad.loc[df_cad['Name'] == 'Line'] arcs = df_cad.loc[df_cad['Name'] == 'Arc'] for i, line in lines.iterrows(): xs = np.array([line['Start X'], line['End X']]) ys = np.array([line['Start Y'], line['End Y']]) zs = np.array([line['Start Z'], line['End Z']]) # Proj pts = np.column_stack([xs, ys, zs]) proj_pts = np.dot(pts - origin, normal)[:, None] * normal proj_pts = pts - origin - proj_pts proj_pts = np.matmul(change_b_mat, proj_pts.T) ax3d.plot(xs, ys, zs, color='lightgray', zorder=210, linewidth=0.5) ax_x.plot(proj_pts[0, :], proj_pts[1, :], color='lightgray', zorder=110, alpha=0.5, linewidth=0.5) for i, arc in arcs.iterrows(): # Stolen math from Melchior if not np.isnan(arc['Extrusion Direction X']): rotaxang = [arc['Extrusion Direction X'], arc['Extrusion Direction Y'], arc['Extrusion Direction Z'], arc['Total Angle']] rad = np.linspace(arc['Start Angle'], arc['Start Angle'] + arc['Total Angle']) dx = np.sin(np.deg2rad(rad)) * arc['Radius'] dy = np.cos(np.deg2rad(rad)) * arc['Radius'] dz = np.zeros(dx.shape[0]) phi1 = -np.arctan2( linalg.norm( np.cross(np.array([rotaxang[0], rotaxang[1], rotaxang[2]]), np.array([0, 0, 1]))), np.dot(np.array([rotaxang[0], rotaxang[1], rotaxang[2]]), np.array([0, 0, 1]))) DX = dx * np.cos(phi1) + dz * np.sin(phi1) DY = dy DZ = dz * np.cos(phi1) - dx * np.sin(phi1) # ax.plot(DX, DY, DZ, color='r') phi2 = np.arctan(rotaxang[1] / rotaxang[0]) fdx = (DX * np.cos(phi2)) - (DY * np.sin(phi2)) fdy = (DX * np.sin(phi2)) + (DY * np.cos(phi2)) fdz = DZ x = fdx + arc['Center X'] y = fdy + arc['Center Y'] z = fdz + arc['Center Z'] # projected pts pts = np.column_stack([x, y, z]) proj_pts = np.dot(pts - origin, normal)[:, None] * normal proj_pts = pts - origin - proj_pts proj_pts = np.matmul(change_b_mat, proj_pts.T) ax3d.plot(x, y, z, color='lightgray', zorder=210, linewidth=0.5) ax_x.plot(proj_pts[0, :], proj_pts[1, :], color='lightgray', zorder=110, alpha=0.5, linewidth=0.5) elif not np.isnan(arc['Start X']): v1 = -1. * np.array([arc['Center X'] - arc['Start X'], arc['Center Y'] - arc['Start Y'], arc['Center Z'] - arc['Start Z']]) v2 = -1. * np.array([arc['Center X'] - arc['End X'], arc['Center Y'] - arc['End Y'], arc['Center Z'] - arc['End Z']]) rad = np.linspace(0, np.deg2rad(arc['Total Angle']), 50) # get rotation vector (norm is rotation angle) rotvec = np.cross(v2, v1) rotvec /= linalg.norm(rotvec) rotvec = rotvec[:, np.newaxis] * rad[np.newaxis, :] Rs = R.from_rotvec(rotvec.T) pt = np.matmul(v1, Rs.as_matrix()) # Projected pts x = arc['Center X'] + pt[:, 0] y = arc['Center Y'] + pt[:, 1] z = arc['Center Z'] + pt[:, 2] pts = np.column_stack([x, y, z]) proj_pts = np.dot(pts - origin, normal)[:, None] * normal proj_pts = pts - origin - proj_pts proj_pts = np.matmul(change_b_mat, proj_pts.T) ax3d.plot(x, y, z, color='lightgray', zorder=210, linewidth=0.5) ax_x.plot(proj_pts[0, :], proj_pts[1, :], color='lightgray', zorder=210, alpha=0.5, linewidth=0.5) well_dict = create_FSB_boreholes() # cmap = ListedColormap(sns.color_palette('icefire', 21).as_hex()) cmap = ListedColormap(sns.color_palette('coolwarm', 21).as_hex()) for well, w_dict in well_data.items(): pts = [] if well == 'B4': continue for feature_dep in w_dict['depth']: feature_dep -= w_dict['depth'][0] pts.append(depth_to_xyz(well_dict, well, feature_dep)) strains = w_dict['data'][:, np.argmin(np.abs(time - w_dict['times']))] # Project well points and fault intersection points onto cross section pts = np.array(pts) proj_pts = np.dot(pts - origin, normal)[:, None] * normal proj_pts = pts - origin - proj_pts proj_pts = np.matmul(change_b_mat, proj_pts.T) proj_pts = proj_pts[:2, :] proj_pts = proj_pts.T.reshape([-1, 1, 2]) ax3d.scatter(pts[0, 0], pts[0, 1], pts[0, 2], color='darkgray', linewidth=1.5, s=15., zorder=110) pts = pts.reshape([-1, 1, 3]) try: fault_pts = [depth_to_xyz(well_dict, well, fault_depths[well][i]) for i in (0, 1)] fault_pts = np.array(fault_pts) p_fault_pts = np.dot(fault_pts - origin, normal)[:, None] * normal p_fault_pts = fault_pts - origin - p_fault_pts p_fault_pts = np.matmul(change_b_mat, p_fault_pts.T) p_fault_pts = p_fault_pts[:2, :].T # Plot fault intersection points ax_x.scatter(p_fault_pts[:, 0], p_fault_pts[:, 1], c='purple', marker='x', s=15., zorder=105) except KeyError as e: # Borehole doesn't intersect fault pass # Make segments proj_seggies = np.concatenate([proj_pts[:-1], proj_pts[1:]], axis=1) seggies = np.concatenate([pts[:-1], pts[1:]], axis=1) col_norm = plt.Normalize(vrange[0], vrange[1]) lc = Line3DCollection(seggies, cmap=cmap, norm=col_norm) lc_proj = LineCollection(proj_seggies, cmap=cmap, norm=col_norm) # Set the values used for colormapping lc.set_array(strains) lc.set_linewidth(3.) lc_proj.set_array(strains) lc_proj.set_linewidth(3.) line = ax3d.add_collection3d(lc) line_x = ax_x.add_collection(lc_proj) fig.colorbar(line_x, ax=ax3d, label=r'$\mu\epsilon$') # Formatting ax3d.set_xlim([2579310, 2579355]) ax3d.set_ylim([1247555, 1247600]) ax3d.set_zlim([485, 530]) # ax3d.view_init(elev=30., azim=-112) ax3d.view_init(elev=75, azim=-120.) ax3d.margins(0.) ax3d.set_xticks([]) ax3d.set_xticklabels([]) ax3d.set_yticks([]) ax3d.set_yticklabels([]) ax3d.set_zticks([]) ax3d.set_zticklabels([]) # Cross section ax_x.set_xlim([-30, 5]) ax_x.axis('equal') ax_x.spines['top'].set_visible(False) ax_x.spines['bottom'].set_visible(False) ax_x.spines['left'].set_visible(False) ax_x.yaxis.set_ticks_position('right') ax_x.tick_params(direction='in', bottom=False, labelbottom=False) ax_x.set_yticks([-30, -20, -10, 0]) ax_x.set_yticklabels(['30', '20', '10', '0']) ax_x.set_ylabel(' Meters', labelpad=15) ax_x.yaxis.set_label_position("right") ax_x.spines['right'].set_bounds(0, -30) # Plot the hydro df_hydro = read_fsb_hydro(hydro_path) pq_axes = plot_fsb_hydro(df_hydro, axes=ax_hydro) # Add 1 hour to Swiss local winter time pq_axes[0].axvline(x=time, linestyle=':', color='k', linewidth=2.) pq_axes[0].set_xlabel('Time', fontsize=14) return fig
ax1.plot([u[0] - eps*W1[0], u[0] + eps*W1[0]],\ [u[1] - eps*W1[1], u[1] + eps*W1[1]],\ lw=1.0,color="blue") ax1.axis("equal") ax.xaxis.set_tick_params(labelsize=30) ax.yaxis.set_tick_params(labelsize=30) ax1.xaxis.set_tick_params(labelsize=30) ax1.yaxis.set_tick_params(labelsize=30) ''' eps=array([-1E-2, 1E-2]).reshape([1,2,1]) segments = u.T.reshape([-1,1,2]) + eps * v1.T.reshape([-1,1,2]) cross_prod = W1[0]*v1[1] - W1[1]*v1[0] lc = LineCollection(segments, cmap=plt.get_cmap('RdBu'), \ norm=plt.Normalize(min(cross_prod), max(cross_prod))) #lc.set_array(ones(u.shape[1])) lc.set_array(cross_prod) #lc.set_array(norm(W1,axis=0)) lc.set_linewidth(1) fig2, ax2 = subplots(1,1) ax2.add_collection(lc) cbar = fig2.colorbar(cm.ScalarMappable(norm=plt.Normalize(min(cross_prod),max(cross_prod)), cmap=plt.get_cmap('RdBu')), ax=ax2) cbar.ax.tick_params(labelsize=30) ax2.xaxis.set_tick_params(labelsize=30) ax2.yaxis.set_tick_params(labelsize=30) ax2.axis('scaled') ax2.set_xlabel("$x_1$",fontsize=30) ax2.set_ylabel("$x_2$",fontsize=30) def clv_along_clv():
def plot_multicolored_line(*, ax=None, x, y, other_y, cmap="viridis", vmin=None, vmax=None, linewidth=2, alpha=1): r"""Plots a line colored based on the values of another array. Plots the curve ``y(x)``, colored based on the values in ``other_y``. Parameters ---------- ax : :py:class:`~matplotlib.axes.Axes`, optional Axes instance, for plotting, defaults to ``None``. If ``None``, a new :py:class:`~matplotlib.figure.Figure` will be created. y : 1d array_like The dependent variable. x : 1d array_like The independent variable. other_y: 1d array_like The values whose magnitude will be converted to colors. cmap : str, optional The used colormap (defaults to "viridis"). vmin : float, optional Lower normalization limit vmax : float, optional Upper normalization limit linewidth : float, optional (default 2) Width of the plotted line alpha : float, optional (default 1) Line transparency, between 0 and 1 Returns ------- ax, line : Axes, LineCollection Main Axes and plotted line Raises ------ AssertionError If the length of `y` and `other_y` do not match. References ---------- ``matplotlib`` `example <https://matplotlib.org/gallery/lines_bars_and_markers/multicolored_line.html>`_. Examples -------- We plot a curve and color it based on the value of its first derivative. .. plot:: :include-source: import numpy as np from matplotlib import pyplot from sliceplots import plot_multicolored_line x = np.linspace(0, 3 * np.pi, 500) y = np.sin(x) dydx = np.gradient(y) * 100 # first derivative _, ax = pyplot.subplots() plot_multicolored_line(ax=ax, x=x, y=y, other_y=dydx, label="dydx") ax.set(ylabel="y", xlabel="x") """ if not (len(y) == len(other_y)): raise AssertionError("The two 'y' arrays must have the same size!") ax = ax or _make_ax() # Create a set of line segments so that we can color them individually # This creates the points as a N x 1 x 2 array so that we can stack points # together easily to get the segments. The segments array for line collection # needs to be (numlines) x (points per line) x 2 (for x and y) points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) if vmin is None: vmin = np.min(other_y) if vmax is None: vmax = np.max(other_y) # Create a continuous norm to map from data points to colors norm = Normalize(vmin, vmax) lc = LineCollection(segments, cmap=cmap, norm=norm) # Set the values used for colormapping lc.set_array(other_y) lc.set_linewidth(linewidth) lc.set_alpha(alpha) line = ax.add_collection(lc) return ax, line
from matplotlib.collections import LineCollection from matplotlib.colors import ListedColormap, BoundaryNorm x = np.linspace(0, 3 * np.pi, 500) y = np.sin(x) z = np.cos(0.5 * (x[:-1] + x[1:])) # first derivative # Create a colormap for red, green and blue and a norm to color # f' < -0.5 red, f' > 0.5 blue, and the rest green cmap = ListedColormap(['r', 'g', 'b']) norm = BoundaryNorm([-1, -0.5, 0.5, 1], cmap.N) # Create a set of line segments so that we can color them individually # This creates the points as a N x 1 x 2 array so that we can stack points # together easily to get the segments. The segments array for line collection # needs to be numlines x points per line x 2 (x and y) points = np.array([x, y]).T.reshape(-1, 1, 2) segments = np.concatenate([points[:-1], points[1:]], axis=1) # Create the line collection object, setting the colormapping parameters. # Have to set the actual values used for colormapping separately. lc = LineCollection(segments, cmap=cmap, norm=norm) lc.set_array(z) lc.set_linewidth(3) fig1 = plt.figure() plt.gca().add_collection(lc) plt.xlim(x.min(), x.max()) plt.ylim(-1.1, 1.1) plt.show()
def file_plotter(logname): """Plots a single timing log file. Arguments: logname -- the log file (str) """ summary_stats = np.zeros((NUM_STATS,workers)) offset = 0 for i in range(0,workers): (segments, colors, offset) = worker_parser(logname, offset, summary_stats) if do_plot or save_eps: cmap = ListedColormap(colors) lc = LineCollection(segments, cmap=cmap) # this (probably?) sets which of cmap's colors to use lc.set_array(np.arange(0, len(colors))) lc.set_linewidth(line_width) plt.gca().add_collection(lc) # min()/max() finds single digit (i.e., flattens and then finds) # this makes sure there aren't messed up/"reversed" timestamps if np.array(segments).min() < 0: print 'WARNING: encountered negative value in ' + logname + '!' #plt.axis('auto') # to get auto max-lims # ensure we modify global var (rather than create local one) global max_xlim max_xlim = max(max_xlim, np.array(segments).max()+0.5) ## pretty plot if do_plot or save_eps: # gca() returns actual Axes object plt.gca().set_xlim(left=0) plt.gca().minorticks_on() plt.xlabel('Time (s)', fontsize=FONTSIZE) # or plt.gca().set_xlabel(...) plt.tick_params(axis='x', which='major', labelsize=XLABELSIZE) plt.ylim(0.25, workers+0.75) plt.yticks(range(1, workers+1)) #plt.gca().set_yticklabels([r'W$_{' + str(i) + '}$' for i in range(workers,0,-1)]) plt.gca().set_yticklabels([str(i) for i in range(workers,0,-1)]) plt.gca().tick_params(axis='y',which='both',right='off',left='off') plt.ylabel('Workers', fontsize=FONTSIZE) plt.tick_params(axis='y', which='major', labelsize=YLABELSIZE) plt.title(logname, fontsize=FONTSIZE) ## print statistics for w in range(0,workers): for s in range(1, NUM_STATS): summary_stats[s, w] /= float(summary_stats[T_TOTAL, w]) stats = summary_stats[1:NUM_STATS] avg_stats = tuple([s.mean()*100 for s in stats]) min_stats = tuple([s.min()*100 for s in stats]) max_stats = tuple([s.max()*100 for s in stats]) print '====================================================================================' print ' ' + logname print '====================================================================================' print ' | compute | ss comm | comm | local barrier | ltw barrier | global barrier' print '----+-----------+---------+----------+---------------+-------------+----------------' print 'avg | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%%' % avg_stats print 'min | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%%' % min_stats print 'max | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%% | %6.3f%%' % max_stats print ''
def plot_run(instructions, channel_labels=None, tmin=None, tmax=None): if channel_labels is None: channel_labels = [f'ch{chan}' for chan in range(24)] #Takes the raw instructions in bytes and them back decoded into a dictionary format decoded_instructions = decode_instructions(instructions) # Simulates what the pulse generator actually does. The output of this may be very large if there are many transitions. durations, states, address, goto_counter, goto_counter_original, stop_and_wait, hard_trig_out, notify_computer, powerline_sync = simulate_output_coordinator( decoded_instructions) instruction_spacing_tn = durations.cumsum() instruction_spacing_tn = np.insert(instruction_spacing_tn, 0, 0) instruction_spacing = np.zeros(instruction_spacing_tn.size) + 1.1 instruction_text_center_pos = instruction_spacing_tn[:-1] + 0.5 * durations # Calculates where the tags should be stop_and_wait_tn = instruction_spacing_tn[1:][stop_and_wait] - 0.1 stop_and_wait = np.zeros(stop_and_wait_tn.size) + 1.08 hard_trig_out_tn = instruction_spacing_tn[:-1][hard_trig_out] + 0.1 hard_trig_out = np.zeros(hard_trig_out_tn.size) + 1.06 notify_computer_tn = instruction_spacing_tn[:-1][notify_computer] + 0.1 notify_computer = np.zeros(notify_computer_tn.size) + 1.04 powerline_sync_tn = instruction_spacing_tn[:-1][powerline_sync] + 0.1 powerline_sync = np.zeros(powerline_sync_tn.size) + 1.02 fig, ax = plt.subplots(figsize=(10, 5)) # Adds the main information about the state of the channels norm = colors.Normalize(0, 1) y_tick_pos = [] indicator_positions = [] for chan in range(24): indicator_pos = 1 - chan / 24 indicator_positions.append(indicator_pos) state_segments, seg_colors = construct_state_line_segments( instruction_spacing_tn, states[:, chan], indicator_pos) coll = LineCollection(state_segments, linewidths=8, cmap='nipy_spectral', norm=norm) coll.set_array(seg_colors) ax.add_collection(coll) y_tick_pos.append(indicator_pos) # Add the instruction tag circles ax.plot(stop_and_wait_tn, stop_and_wait, 'oC1', markersize=3, label='stop and wait') ax.plot(hard_trig_out_tn, hard_trig_out, 'oC2', markersize=3, label='hardware trig out') ax.plot(notify_computer_tn, notify_computer, 'oC3', markersize=3, label='notification') ax.plot(powerline_sync_tn, powerline_sync, 'oC4', markersize=3, label='powerline sync') # Add the white lines between the indicator bars indicator_spacing_segments = construct_indicator_spacing_line_segments( instruction_spacing_tn, indicator_positions) coll = LineCollection(indicator_spacing_segments, linewidths=0.5, colors='white', norm=norm) ax.add_collection(coll) # Add the black instruction edge indicators spacing_segments = construct_instruction_spacing_line_segments( instruction_spacing_tn, ymin=-5, ymax=1.1) coll = LineCollection(spacing_segments, linewidths=0.5, colors='k', norm=norm) ax.add_collection(coll) # Add the black bar with stars indicating the instruction spacing ax.plot(instruction_spacing_tn, instruction_spacing, '-Dk', markersize=3) ax.set_xlabel('time (clock cycles)') ax.set_yticks(y_tick_pos) ax.set_yticklabels(channel_labels) # This makes the cursor display meaningful values def y_pos_to_tick_label(y): val = int(np.round(-(y - 1) * 24)) if val < 0: val = 0 elif val > 23: val = 23 return channel_labels[val] def sec_to_prefex_sec(t): if t < 1E-6: t = t * 1E9 return f'{t:.0f}ns' elif t < 1E-3: t = t * 1E6 return f'{t:.3f}μs' elif t < 1: t = t * 1E3 return f'{t:.6f}ms' else: return f'{t:.9f}s' ax.format_coord = lambda x, y: '{} {}'.format( sec_to_prefex_sec(x * 10E-9), y_pos_to_tick_label(y)) # Sets the limits to be plotted if tmin is not None: ax.set_xlim(left=tmin * 1E8) if tmax is not None: ax.set_xlim(right=tmax * 1E8) ax.set_ylim(0.01, 1.4) ax.legend() secax = ax.secondary_xaxis('top', functions=(n2t, t2n)) secax.set_xlabel('time (s)') # Add the text that give information about the instructions td = Text_Drawer(instruction_text_center_pos, address, durations, goto_counter, goto_counter_original) td.on_xlims_change(ax) ax.callbacks.connect('xlim_changed', td.on_xlims_change) ax.callbacks.connect('ylim_changed', on_ylims_change) plt.show()
n = 100 x = np.arange(n) rs = check_random_state(0) y = rs.randint(-50, 50, size=(n, )) + 50. * np.log(1 + np.arange(n)) ir = IsotonicRegression() y_ = ir.fit_transform(x, y) lr = LinearRegression() lr.fit(x[:, np.newaxis], y) # 线性回归的 x 需要为 2d segments = [[[i, y[i]], [i, y_[i]]] for i in range(n)] lc = LineCollection(segments, zorder=0) lc.set_array(np.ones(len(y))) lc.set_linewidths(0.5 * np.ones(n)) fig = plt.figure() plt.plot(x, y, 'r.', markersize=12) plt.plot(x, y_, 'g.-', markersize=12) plt.plot(x, lr.predict(x[:, np.newaxis]), 'b-') plt.gca().add_collection(lc) # loc(设置图例显示的位置) # ncol(设置列的数量,使显示扁平化,当要表示的线段特别多的时候会有用) # 按照加图的顺序把图放在一个图里面 plt.legend(('Data', 'Isotonic Fit', 'Linear Fit'), loc='lower right') plt.title('Isotonic regression') plt.show() # Kernel ridge regression ( 内核岭回归 )